From 30f8aa7d6fabb2f27318fb305e14eafc011e9d0a Mon Sep 17 00:00:00 2001 From: Yida Lin <yida.lin@outlook.com> Date: Thu, 28 Sep 2017 20:12:21 -0400 Subject: [PATCH] Added C++ libxdf --- C++/.gitignore | 8 + C++/CMakeLists.txt | 32 + C++/LICENSE.txt | 674 + C++/README.md | 87 + C++/_config.yml | 3 + C++/_layouts/default.html | 51 + C++/docs/Example.png | Bin 0 -> 205786 bytes C++/docs/html/_r_e_a_d_m_e_8md.html | 100 + C++/docs/html/annotated.html | 105 + C++/docs/html/annotated_dup.js | 4 + C++/docs/html/bc_s.png | Bin 0 -> 676 bytes C++/docs/html/bdwn.png | Bin 0 -> 147 bytes C++/docs/html/class_xdf-members.html | 131 + C++/docs/html/class_xdf.html | 707 + C++/docs/html/class_xdf.js | 33 + C++/docs/html/classes.html | 109 + C++/docs/html/closed.png | Bin 0 -> 132 bytes .../dir_689ecbe789caf2e46799b15492db205c.html | 109 + .../dir_689ecbe789caf2e46799b15492db205c.js | 8 + .../dir_72e8b74943c3b26541b5ac1c7338ef6f.html | 106 + .../dir_72e8b74943c3b26541b5ac1c7338ef6f.js | 4 + .../dir_7e17ac9cf8fba2cb04bc248c85b0ceb7.html | 106 + .../dir_7e17ac9cf8fba2cb04bc248c85b0ceb7.js | 4 + .../dir_f396504afdc959660871b003fa10164d.html | 106 + .../dir_f396504afdc959660871b003fa10164d.js | 4 + C++/docs/html/doc.png | Bin 0 -> 746 bytes C++/docs/html/doxygen.css | 1508 ++ C++/docs/html/doxygen.png | Bin 0 -> 3779 bytes C++/docs/html/dynsections.js | 97 + C++/docs/html/files.html | 109 + C++/docs/html/files.js | 4 + C++/docs/html/folderclosed.png | Bin 0 -> 616 bytes C++/docs/html/folderopen.png | Bin 0 -> 597 bytes C++/docs/html/functions.html | 310 + C++/docs/html/functions_func.html | 124 + C++/docs/html/functions_type.html | 103 + C++/docs/html/functions_vars.html | 261 + C++/docs/html/globals.html | 100 + C++/docs/html/globals_defs.html | 100 + C++/docs/html/index.html | 99 + C++/docs/html/jquery.js | 87 + ...s__git_hub_libxdf_libxdf__r_e_a_d_m_e.html | 142 + C++/docs/html/menu.js | 26 + C++/docs/html/menudata.js | 46 + C++/docs/html/nav_f.png | Bin 0 -> 153 bytes C++/docs/html/nav_g.png | Bin 0 -> 95 bytes C++/docs/html/nav_h.png | Bin 0 -> 98 bytes C++/docs/html/navtree.css | 146 + C++/docs/html/navtree.js | 517 + C++/docs/html/navtreedata.js | 31 + C++/docs/html/navtreeindex0.js | 75 + C++/docs/html/open.png | Bin 0 -> 123 bytes C++/docs/html/pages.html | 104 + C++/docs/html/resize.js | 113 + C++/docs/html/search/all_0.html | 26 + C++/docs/html/search/all_0.js | 4 + C++/docs/html/search/all_1.html | 26 + C++/docs/html/search/all_1.js | 4 + C++/docs/html/search/all_10.html | 26 + C++/docs/html/search/all_10.js | 4 + C++/docs/html/search/all_11.html | 26 + C++/docs/html/search/all_11.js | 6 + C++/docs/html/search/all_12.html | 26 + C++/docs/html/search/all_12.js | 6 + C++/docs/html/search/all_2.html | 26 + C++/docs/html/search/all_2.js | 11 + C++/docs/html/search/all_3.html | 26 + C++/docs/html/search/all_3.js | 5 + C++/docs/html/search/all_4.html | 26 + C++/docs/html/search/all_4.js | 8 + C++/docs/html/search/all_5.html | 26 + C++/docs/html/search/all_5.js | 6 + C++/docs/html/search/all_6.html | 26 + C++/docs/html/search/all_6.js | 4 + C++/docs/html/search/all_7.html | 26 + C++/docs/html/search/all_7.js | 7 + C++/docs/html/search/all_8.html | 26 + C++/docs/html/search/all_8.js | 8 + C++/docs/html/search/all_9.html | 26 + C++/docs/html/search/all_9.js | 5 + C++/docs/html/search/all_a.html | 26 + C++/docs/html/search/all_a.js | 4 + C++/docs/html/search/all_b.html | 26 + C++/docs/html/search/all_b.js | 5 + C++/docs/html/search/all_c.html | 26 + C++/docs/html/search/all_c.js | 11 + C++/docs/html/search/all_d.html | 26 + C++/docs/html/search/all_d.js | 8 + C++/docs/html/search/all_e.html | 26 + C++/docs/html/search/all_e.js | 5 + C++/docs/html/search/all_f.html | 26 + C++/docs/html/search/all_f.js | 4 + C++/docs/html/search/classes_0.html | 26 + C++/docs/html/search/classes_0.js | 4 + C++/docs/html/search/classes_1.html | 26 + C++/docs/html/search/classes_1.js | 4 + C++/docs/html/search/close.png | Bin 0 -> 273 bytes C++/docs/html/search/defines_0.html | 26 + C++/docs/html/search/defines_0.js | 4 + C++/docs/html/search/files_0.html | 26 + C++/docs/html/search/files_0.js | 4 + C++/docs/html/search/files_1.html | 26 + C++/docs/html/search/files_1.js | 5 + C++/docs/html/search/functions_0.html | 26 + C++/docs/html/search/functions_0.js | 4 + C++/docs/html/search/functions_1.html | 26 + C++/docs/html/search/functions_1.js | 5 + C++/docs/html/search/functions_2.html | 26 + C++/docs/html/search/functions_2.js | 4 + C++/docs/html/search/functions_3.html | 26 + C++/docs/html/search/functions_3.js | 4 + C++/docs/html/search/functions_4.html | 26 + C++/docs/html/search/functions_4.js | 4 + C++/docs/html/search/functions_5.html | 26 + C++/docs/html/search/functions_5.js | 4 + C++/docs/html/search/functions_6.html | 26 + C++/docs/html/search/functions_6.js | 4 + C++/docs/html/search/functions_7.html | 26 + C++/docs/html/search/functions_7.js | 4 + C++/docs/html/search/functions_8.html | 26 + C++/docs/html/search/functions_8.js | 4 + C++/docs/html/search/mag_sel.png | Bin 0 -> 563 bytes C++/docs/html/search/nomatches.html | 12 + C++/docs/html/search/pages_0.html | 26 + C++/docs/html/search/pages_0.js | 4 + C++/docs/html/search/search.css | 271 + C++/docs/html/search/search.js | 791 + C++/docs/html/search/search_l.png | Bin 0 -> 604 bytes C++/docs/html/search/search_m.png | Bin 0 -> 158 bytes C++/docs/html/search/search_r.png | Bin 0 -> 612 bytes C++/docs/html/search/searchdata.js | 36 + C++/docs/html/search/typedefs_0.html | 26 + C++/docs/html/search/typedefs_0.js | 5 + C++/docs/html/search/variables_0.html | 26 + C++/docs/html/search/variables_0.js | 9 + C++/docs/html/search/variables_1.html | 26 + C++/docs/html/search/variables_1.js | 4 + C++/docs/html/search/variables_2.html | 26 + C++/docs/html/search/variables_2.js | 6 + C++/docs/html/search/variables_3.html | 26 + C++/docs/html/search/variables_3.js | 5 + C++/docs/html/search/variables_4.html | 26 + C++/docs/html/search/variables_4.js | 4 + C++/docs/html/search/variables_5.html | 26 + C++/docs/html/search/variables_5.js | 5 + C++/docs/html/search/variables_6.html | 26 + C++/docs/html/search/variables_6.js | 8 + C++/docs/html/search/variables_7.html | 26 + C++/docs/html/search/variables_7.js | 5 + C++/docs/html/search/variables_8.html | 26 + C++/docs/html/search/variables_8.js | 4 + C++/docs/html/search/variables_9.html | 26 + C++/docs/html/search/variables_9.js | 10 + C++/docs/html/search/variables_a.html | 26 + C++/docs/html/search/variables_a.js | 8 + C++/docs/html/search/variables_b.html | 26 + C++/docs/html/search/variables_b.js | 5 + C++/docs/html/search/variables_c.html | 26 + C++/docs/html/search/variables_c.js | 4 + C++/docs/html/splitbar.png | Bin 0 -> 314 bytes .../html/struct_xdf_1_1_stream-members.html | 123 + C++/docs/html/struct_xdf_1_1_stream.html | 475 + C++/docs/html/struct_xdf_1_1_stream.js | 24 + C++/docs/html/sync_off.png | Bin 0 -> 853 bytes C++/docs/html/sync_on.png | Bin 0 -> 845 bytes C++/docs/html/tab_a.png | Bin 0 -> 142 bytes C++/docs/html/tab_b.png | Bin 0 -> 169 bytes C++/docs/html/tab_h.png | Bin 0 -> 177 bytes C++/docs/html/tab_s.png | Bin 0 -> 184 bytes C++/docs/html/tabs.css | 1 + C++/docs/html/xdf_8cpp.html | 132 + C++/docs/html/xdf_8cpp.js | 4 + C++/docs/html/xdf_8h.html | 121 + C++/docs/html/xdf_8h_source.html | 151 + C++/pugixml/pugiconfig.hpp | 74 + C++/pugixml/pugixml.cpp | 12622 ++++++++++++++++ C++/pugixml/pugixml.hpp | 1434 ++ C++/smarc/filtering.c | 111 + C++/smarc/filtering.h | 30 + C++/smarc/multi_stage.c | 580 + C++/smarc/multi_stage.h | 46 + C++/smarc/polyfilt.c | 150 + C++/smarc/polyfilt.h | 79 + C++/smarc/remez_lp.c | 601 + C++/smarc/remez_lp.h | 55 + C++/smarc/smarc.c | 391 + C++/smarc/smarc.h | 138 + C++/smarc/stage_impl.c | 170 + C++/smarc/stage_impl.h | 100 + C++/xdf.cpp | 1033 ++ C++/xdf.h | 297 + C++/xdf.pro | 35 + 192 files changed, 28187 insertions(+) create mode 100644 C++/.gitignore create mode 100644 C++/CMakeLists.txt create mode 100644 C++/LICENSE.txt create mode 100644 C++/README.md create mode 100644 C++/_config.yml create mode 100644 C++/_layouts/default.html create mode 100644 C++/docs/Example.png create mode 100644 C++/docs/html/_r_e_a_d_m_e_8md.html create mode 100644 C++/docs/html/annotated.html create mode 100644 C++/docs/html/annotated_dup.js create mode 100644 C++/docs/html/bc_s.png create mode 100644 C++/docs/html/bdwn.png create mode 100644 C++/docs/html/class_xdf-members.html create mode 100644 C++/docs/html/class_xdf.html create mode 100644 C++/docs/html/class_xdf.js create mode 100644 C++/docs/html/classes.html create mode 100644 C++/docs/html/closed.png create mode 100644 C++/docs/html/dir_689ecbe789caf2e46799b15492db205c.html create mode 100644 C++/docs/html/dir_689ecbe789caf2e46799b15492db205c.js create mode 100644 C++/docs/html/dir_72e8b74943c3b26541b5ac1c7338ef6f.html create mode 100644 C++/docs/html/dir_72e8b74943c3b26541b5ac1c7338ef6f.js create mode 100644 C++/docs/html/dir_7e17ac9cf8fba2cb04bc248c85b0ceb7.html create mode 100644 C++/docs/html/dir_7e17ac9cf8fba2cb04bc248c85b0ceb7.js create mode 100644 C++/docs/html/dir_f396504afdc959660871b003fa10164d.html create mode 100644 C++/docs/html/dir_f396504afdc959660871b003fa10164d.js create mode 100644 C++/docs/html/doc.png create mode 100644 C++/docs/html/doxygen.css create mode 100644 C++/docs/html/doxygen.png create mode 100644 C++/docs/html/dynsections.js create mode 100644 C++/docs/html/files.html create mode 100644 C++/docs/html/files.js create mode 100644 C++/docs/html/folderclosed.png create mode 100644 C++/docs/html/folderopen.png create mode 100644 C++/docs/html/functions.html create mode 100644 C++/docs/html/functions_func.html create mode 100644 C++/docs/html/functions_type.html create mode 100644 C++/docs/html/functions_vars.html create mode 100644 C++/docs/html/globals.html create mode 100644 C++/docs/html/globals_defs.html create mode 100644 C++/docs/html/index.html create mode 100644 C++/docs/html/jquery.js create mode 100644 C++/docs/html/md__c_1__users__yida__lin__documents__git_hub_libxdf_libxdf__r_e_a_d_m_e.html create mode 100644 C++/docs/html/menu.js create mode 100644 C++/docs/html/menudata.js create mode 100644 C++/docs/html/nav_f.png create mode 100644 C++/docs/html/nav_g.png create mode 100644 C++/docs/html/nav_h.png create mode 100644 C++/docs/html/navtree.css create mode 100644 C++/docs/html/navtree.js create mode 100644 C++/docs/html/navtreedata.js create mode 100644 C++/docs/html/navtreeindex0.js create mode 100644 C++/docs/html/open.png create mode 100644 C++/docs/html/pages.html create mode 100644 C++/docs/html/resize.js create mode 100644 C++/docs/html/search/all_0.html create mode 100644 C++/docs/html/search/all_0.js create mode 100644 C++/docs/html/search/all_1.html create mode 100644 C++/docs/html/search/all_1.js create mode 100644 C++/docs/html/search/all_10.html create mode 100644 C++/docs/html/search/all_10.js create mode 100644 C++/docs/html/search/all_11.html create mode 100644 C++/docs/html/search/all_11.js create mode 100644 C++/docs/html/search/all_12.html create mode 100644 C++/docs/html/search/all_12.js create mode 100644 C++/docs/html/search/all_2.html create mode 100644 C++/docs/html/search/all_2.js create mode 100644 C++/docs/html/search/all_3.html create mode 100644 C++/docs/html/search/all_3.js create mode 100644 C++/docs/html/search/all_4.html create mode 100644 C++/docs/html/search/all_4.js create mode 100644 C++/docs/html/search/all_5.html create mode 100644 C++/docs/html/search/all_5.js create mode 100644 C++/docs/html/search/all_6.html create mode 100644 C++/docs/html/search/all_6.js create mode 100644 C++/docs/html/search/all_7.html create mode 100644 C++/docs/html/search/all_7.js create mode 100644 C++/docs/html/search/all_8.html create mode 100644 C++/docs/html/search/all_8.js create mode 100644 C++/docs/html/search/all_9.html create mode 100644 C++/docs/html/search/all_9.js create mode 100644 C++/docs/html/search/all_a.html create mode 100644 C++/docs/html/search/all_a.js create mode 100644 C++/docs/html/search/all_b.html create mode 100644 C++/docs/html/search/all_b.js create mode 100644 C++/docs/html/search/all_c.html create mode 100644 C++/docs/html/search/all_c.js create mode 100644 C++/docs/html/search/all_d.html create mode 100644 C++/docs/html/search/all_d.js create mode 100644 C++/docs/html/search/all_e.html create mode 100644 C++/docs/html/search/all_e.js create mode 100644 C++/docs/html/search/all_f.html create mode 100644 C++/docs/html/search/all_f.js create mode 100644 C++/docs/html/search/classes_0.html create mode 100644 C++/docs/html/search/classes_0.js create mode 100644 C++/docs/html/search/classes_1.html create mode 100644 C++/docs/html/search/classes_1.js create mode 100644 C++/docs/html/search/close.png create mode 100644 C++/docs/html/search/defines_0.html create mode 100644 C++/docs/html/search/defines_0.js create mode 100644 C++/docs/html/search/files_0.html create mode 100644 C++/docs/html/search/files_0.js create mode 100644 C++/docs/html/search/files_1.html create mode 100644 C++/docs/html/search/files_1.js create mode 100644 C++/docs/html/search/functions_0.html create mode 100644 C++/docs/html/search/functions_0.js create mode 100644 C++/docs/html/search/functions_1.html create mode 100644 C++/docs/html/search/functions_1.js create mode 100644 C++/docs/html/search/functions_2.html create mode 100644 C++/docs/html/search/functions_2.js create mode 100644 C++/docs/html/search/functions_3.html create mode 100644 C++/docs/html/search/functions_3.js create mode 100644 C++/docs/html/search/functions_4.html create mode 100644 C++/docs/html/search/functions_4.js create mode 100644 C++/docs/html/search/functions_5.html create mode 100644 C++/docs/html/search/functions_5.js create mode 100644 C++/docs/html/search/functions_6.html create mode 100644 C++/docs/html/search/functions_6.js create mode 100644 C++/docs/html/search/functions_7.html create mode 100644 C++/docs/html/search/functions_7.js create mode 100644 C++/docs/html/search/functions_8.html create mode 100644 C++/docs/html/search/functions_8.js create mode 100644 C++/docs/html/search/mag_sel.png create mode 100644 C++/docs/html/search/nomatches.html create mode 100644 C++/docs/html/search/pages_0.html create mode 100644 C++/docs/html/search/pages_0.js create mode 100644 C++/docs/html/search/search.css create mode 100644 C++/docs/html/search/search.js create mode 100644 C++/docs/html/search/search_l.png create mode 100644 C++/docs/html/search/search_m.png create mode 100644 C++/docs/html/search/search_r.png create mode 100644 C++/docs/html/search/searchdata.js create mode 100644 C++/docs/html/search/typedefs_0.html create mode 100644 C++/docs/html/search/typedefs_0.js create mode 100644 C++/docs/html/search/variables_0.html create mode 100644 C++/docs/html/search/variables_0.js create mode 100644 C++/docs/html/search/variables_1.html create mode 100644 C++/docs/html/search/variables_1.js create mode 100644 C++/docs/html/search/variables_2.html create mode 100644 C++/docs/html/search/variables_2.js create mode 100644 C++/docs/html/search/variables_3.html create mode 100644 C++/docs/html/search/variables_3.js create mode 100644 C++/docs/html/search/variables_4.html create mode 100644 C++/docs/html/search/variables_4.js create mode 100644 C++/docs/html/search/variables_5.html create mode 100644 C++/docs/html/search/variables_5.js create mode 100644 C++/docs/html/search/variables_6.html create mode 100644 C++/docs/html/search/variables_6.js create mode 100644 C++/docs/html/search/variables_7.html create mode 100644 C++/docs/html/search/variables_7.js create mode 100644 C++/docs/html/search/variables_8.html create mode 100644 C++/docs/html/search/variables_8.js create mode 100644 C++/docs/html/search/variables_9.html create mode 100644 C++/docs/html/search/variables_9.js create mode 100644 C++/docs/html/search/variables_a.html create mode 100644 C++/docs/html/search/variables_a.js create mode 100644 C++/docs/html/search/variables_b.html create mode 100644 C++/docs/html/search/variables_b.js create mode 100644 C++/docs/html/search/variables_c.html create mode 100644 C++/docs/html/search/variables_c.js create mode 100644 C++/docs/html/splitbar.png create mode 100644 C++/docs/html/struct_xdf_1_1_stream-members.html create mode 100644 C++/docs/html/struct_xdf_1_1_stream.html create mode 100644 C++/docs/html/struct_xdf_1_1_stream.js create mode 100644 C++/docs/html/sync_off.png create mode 100644 C++/docs/html/sync_on.png create mode 100644 C++/docs/html/tab_a.png create mode 100644 C++/docs/html/tab_b.png create mode 100644 C++/docs/html/tab_h.png create mode 100644 C++/docs/html/tab_s.png create mode 100644 C++/docs/html/tabs.css create mode 100644 C++/docs/html/xdf_8cpp.html create mode 100644 C++/docs/html/xdf_8cpp.js create mode 100644 C++/docs/html/xdf_8h.html create mode 100644 C++/docs/html/xdf_8h_source.html create mode 100644 C++/pugixml/pugiconfig.hpp create mode 100644 C++/pugixml/pugixml.cpp create mode 100644 C++/pugixml/pugixml.hpp create mode 100644 C++/smarc/filtering.c create mode 100644 C++/smarc/filtering.h create mode 100644 C++/smarc/multi_stage.c create mode 100644 C++/smarc/multi_stage.h create mode 100644 C++/smarc/polyfilt.c create mode 100644 C++/smarc/polyfilt.h create mode 100644 C++/smarc/remez_lp.c create mode 100644 C++/smarc/remez_lp.h create mode 100644 C++/smarc/smarc.c create mode 100644 C++/smarc/smarc.h create mode 100644 C++/smarc/stage_impl.c create mode 100644 C++/smarc/stage_impl.h create mode 100644 C++/xdf.cpp create mode 100644 C++/xdf.h create mode 100644 C++/xdf.pro diff --git a/C++/.gitignore b/C++/.gitignore new file mode 100644 index 0000000..db4f04e --- /dev/null +++ b/C++/.gitignore @@ -0,0 +1,8 @@ +xdf.pro.user +CMakeCache.txt +CMakeFiles +Makefile +cmake_install.cmake +CMakeLists.txt.user +*.a +*.dylib diff --git a/C++/CMakeLists.txt b/C++/CMakeLists.txt new file mode 100644 index 0000000..4744a1e --- /dev/null +++ b/C++/CMakeLists.txt @@ -0,0 +1,32 @@ +cmake_minimum_required(VERSION 3.7) +set(CMAKE_OSX_DEPLOYMENT_TARGET 10.9) + +project(libxdf) + +set(SOURCES + xdf.h + xdf.cpp + pugixml/pugiconfig.hpp + pugixml/pugixml.hpp + pugixml/pugixml.cpp + smarc/filtering.h + smarc/filtering.c + smarc/multi_stage.h + smarc/multi_stage.c + smarc/polyfilt.h + smarc/polyfilt.c + smarc/remez_lp.h + smarc/remez_lp.c + smarc/smarc.h + smarc/smarc.c + smarc/stage_impl.h + smarc/stage_impl.c +) + +add_library(xdf-static STATIC ${SOURCES}) +add_library(xdf-shared SHARED ${SOURCES}) + +set_property(TARGET xdf-static xdf-shared PROPERTY CXX_STANDARD 11) +set_property(TARGET xdf-static xdf-shared PROPERTY C_STANDARD 99) +set_target_properties(xdf-static PROPERTIES OUTPUT_NAME xdf) +set_target_properties(xdf-shared PROPERTIES OUTPUT_NAME xdf) diff --git a/C++/LICENSE.txt b/C++/LICENSE.txt new file mode 100644 index 0000000..30ace6a --- /dev/null +++ b/C++/LICENSE.txt @@ -0,0 +1,674 @@ + GNU GENERAL PUBLIC LICENSE + Version 3, 29 June 2007 + + Copyright (C) 2007 Free Software Foundation, Inc. <http://fsf.org/> + Everyone is permitted to copy and distribute verbatim copies + of this license document, but changing it is not allowed. + + Preamble + + The GNU General Public License is a free, copyleft license for +software and other kinds of works. + + The licenses for most software and other practical works are designed +to take away your freedom to share and change the works. By contrast, +the GNU General Public License is intended to guarantee your freedom to +share and change all versions of a program--to make sure it remains free +software for all its users. We, the Free Software Foundation, use the +GNU General Public License for most of our software; it applies also to +any other work released this way by its authors. You can apply it to +your programs, too. + + When we speak of free software, we are referring to freedom, not +price. Our General Public Licenses are designed to make sure that you +have the freedom to distribute copies of free software (and charge for +them if you wish), that you receive source code or can get it if you +want it, that you can change the software or use pieces of it in new +free programs, and that you know you can do these things. + + To protect your rights, we need to prevent others from denying you +these rights or asking you to surrender the rights. Therefore, you have +certain responsibilities if you distribute copies of the software, or if +you modify it: responsibilities to respect the freedom of others. + + For example, if you distribute copies of such a program, whether +gratis or for a fee, you must pass on to the recipients the same +freedoms that you received. You must make sure that they, too, receive +or can get the source code. And you must show them these terms so they +know their rights. + + Developers that use the GNU GPL protect your rights with two steps: +(1) assert copyright on the software, and (2) offer you this License +giving you legal permission to copy, distribute and/or modify it. + + For the developers' and authors' protection, the GPL clearly explains +that there is no warranty for this free software. For both users' and +authors' sake, the GPL requires that modified versions be marked as +changed, so that their problems will not be attributed erroneously to +authors of previous versions. + + Some devices are designed to deny users access to install or run +modified versions of the software inside them, although the manufacturer +can do so. This is fundamentally incompatible with the aim of +protecting users' freedom to change the software. The systematic +pattern of such abuse occurs in the area of products for individuals to +use, which is precisely where it is most unacceptable. Therefore, we +have designed this version of the GPL to prohibit the practice for those +products. If such problems arise substantially in other domains, we +stand ready to extend this provision to those domains in future versions +of the GPL, as needed to protect the freedom of users. + + Finally, every program is threatened constantly by software patents. +States should not allow patents to restrict development and use of +software on general-purpose computers, but in those that do, we wish to +avoid the special danger that patents applied to a free program could +make it effectively proprietary. To prevent this, the GPL assures that +patents cannot be used to render the program non-free. + + The precise terms and conditions for copying, distribution and +modification follow. + + TERMS AND CONDITIONS + + 0. Definitions. + + "This License" refers to version 3 of the GNU General Public License. + + "Copyright" also means copyright-like laws that apply to other kinds of +works, such as semiconductor masks. + + "The Program" refers to any copyrightable work licensed under this +License. Each licensee is addressed as "you". "Licensees" and +"recipients" may be individuals or organizations. + + To "modify" a work means to copy from or adapt all or part of the work +in a fashion requiring copyright permission, other than the making of an +exact copy. The resulting work is called a "modified version" of the +earlier work or a work "based on" the earlier work. + + A "covered work" means either the unmodified Program or a work based +on the Program. + + To "propagate" a work means to do anything with it that, without +permission, would make you directly or secondarily liable for +infringement under applicable copyright law, except executing it on a +computer or modifying a private copy. Propagation includes copying, +distribution (with or without modification), making available to the +public, and in some countries other activities as well. + + To "convey" a work means any kind of propagation that enables other +parties to make or receive copies. Mere interaction with a user through +a computer network, with no transfer of a copy, is not conveying. + + An interactive user interface displays "Appropriate Legal Notices" +to the extent that it includes a convenient and prominently visible +feature that (1) displays an appropriate copyright notice, and (2) +tells the user that there is no warranty for the work (except to the +extent that warranties are provided), that licensees may convey the +work under this License, and how to view a copy of this License. If +the interface presents a list of user commands or options, such as a +menu, a prominent item in the list meets this criterion. + + 1. Source Code. + + The "source code" for a work means the preferred form of the work +for making modifications to it. "Object code" means any non-source +form of a work. + + A "Standard Interface" means an interface that either is an official +standard defined by a recognized standards body, or, in the case of +interfaces specified for a particular programming language, one that +is widely used among developers working in that language. + + The "System Libraries" of an executable work include anything, other +than the work as a whole, that (a) is included in the normal form of +packaging a Major Component, but which is not part of that Major +Component, and (b) serves only to enable use of the work with that +Major Component, or to implement a Standard Interface for which an +implementation is available to the public in source code form. A +"Major Component", in this context, means a major essential component +(kernel, window system, and so on) of the specific operating system +(if any) on which the executable work runs, or a compiler used to +produce the work, or an object code interpreter used to run it. + + The "Corresponding Source" for a work in object code form means all +the source code needed to generate, install, and (for an executable +work) run the object code and to modify the work, including scripts to +control those activities. However, it does not include the work's +System Libraries, or general-purpose tools or generally available free +programs which are used unmodified in performing those activities but +which are not part of the work. For example, Corresponding Source +includes interface definition files associated with source files for +the work, and the source code for shared libraries and dynamically +linked subprograms that the work is specifically designed to require, +such as by intimate data communication or control flow between those +subprograms and other parts of the work. + + The Corresponding Source need not include anything that users +can regenerate automatically from other parts of the Corresponding +Source. + + The Corresponding Source for a work in source code form is that +same work. + + 2. Basic Permissions. + + All rights granted under this License are granted for the term of +copyright on the Program, and are irrevocable provided the stated +conditions are met. This License explicitly affirms your unlimited +permission to run the unmodified Program. The output from running a +covered work is covered by this License only if the output, given its +content, constitutes a covered work. This License acknowledges your +rights of fair use or other equivalent, as provided by copyright law. + + You may make, run and propagate covered works that you do not +convey, without conditions so long as your license otherwise remains +in force. You may convey covered works to others for the sole purpose +of having them make modifications exclusively for you, or provide you +with facilities for running those works, provided that you comply with +the terms of this License in conveying all material for which you do +not control copyright. Those thus making or running the covered works +for you must do so exclusively on your behalf, under your direction +and control, on terms that prohibit them from making any copies of +your copyrighted material outside their relationship with you. + + Conveying under any other circumstances is permitted solely under +the conditions stated below. Sublicensing is not allowed; section 10 +makes it unnecessary. + + 3. Protecting Users' Legal Rights From Anti-Circumvention Law. + + No covered work shall be deemed part of an effective technological +measure under any applicable law fulfilling obligations under article +11 of the WIPO copyright treaty adopted on 20 December 1996, or +similar laws prohibiting or restricting circumvention of such +measures. + + When you convey a covered work, you waive any legal power to forbid +circumvention of technological measures to the extent such circumvention +is effected by exercising rights under this License with respect to +the covered work, and you disclaim any intention to limit operation or +modification of the work as a means of enforcing, against the work's +users, your or third parties' legal rights to forbid circumvention of +technological measures. + + 4. Conveying Verbatim Copies. + + You may convey verbatim copies of the Program's source code as you +receive it, in any medium, provided that you conspicuously and +appropriately publish on each copy an appropriate copyright notice; +keep intact all notices stating that this License and any +non-permissive terms added in accord with section 7 apply to the code; +keep intact all notices of the absence of any warranty; and give all +recipients a copy of this License along with the Program. + + You may charge any price or no price for each copy that you convey, +and you may offer support or warranty protection for a fee. + + 5. Conveying Modified Source Versions. + + You may convey a work based on the Program, or the modifications to +produce it from the Program, in the form of source code under the +terms of section 4, provided that you also meet all of these conditions: + + a) The work must carry prominent notices stating that you modified + it, and giving a relevant date. + + b) The work must carry prominent notices stating that it is + released under this License and any conditions added under section + 7. This requirement modifies the requirement in section 4 to + "keep intact all notices". + + c) You must license the entire work, as a whole, under this + License to anyone who comes into possession of a copy. This + License will therefore apply, along with any applicable section 7 + additional terms, to the whole of the work, and all its parts, + regardless of how they are packaged. This License gives no + permission to license the work in any other way, but it does not + invalidate such permission if you have separately received it. + + d) If the work has interactive user interfaces, each must display + Appropriate Legal Notices; however, if the Program has interactive + interfaces that do not display Appropriate Legal Notices, your + work need not make them do so. + + A compilation of a covered work with other separate and independent +works, which are not by their nature extensions of the covered work, +and which are not combined with it such as to form a larger program, +in or on a volume of a storage or distribution medium, is called an +"aggregate" if the compilation and its resulting copyright are not +used to limit the access or legal rights of the compilation's users +beyond what the individual works permit. Inclusion of a covered work +in an aggregate does not cause this License to apply to the other +parts of the aggregate. + + 6. Conveying Non-Source Forms. + + You may convey a covered work in object code form under the terms +of sections 4 and 5, provided that you also convey the +machine-readable Corresponding Source under the terms of this License, +in one of these ways: + + a) Convey the object code in, or embodied in, a physical product + (including a physical distribution medium), accompanied by the + Corresponding Source fixed on a durable physical medium + customarily used for software interchange. + + b) Convey the object code in, or embodied in, a physical product + (including a physical distribution medium), accompanied by a + written offer, valid for at least three years and valid for as + long as you offer spare parts or customer support for that product + model, to give anyone who possesses the object code either (1) a + copy of the Corresponding Source for all the software in the + product that is covered by this License, on a durable physical + medium customarily used for software interchange, for a price no + more than your reasonable cost of physically performing this + conveying of source, or (2) access to copy the + Corresponding Source from a network server at no charge. + + c) Convey individual copies of the object code with a copy of the + written offer to provide the Corresponding Source. This + alternative is allowed only occasionally and noncommercially, and + only if you received the object code with such an offer, in accord + with subsection 6b. + + d) Convey the object code by offering access from a designated + place (gratis or for a charge), and offer equivalent access to the + Corresponding Source in the same way through the same place at no + further charge. You need not require recipients to copy the + Corresponding Source along with the object code. If the place to + copy the object code is a network server, the Corresponding Source + may be on a different server (operated by you or a third party) + that supports equivalent copying facilities, provided you maintain + clear directions next to the object code saying where to find the + Corresponding Source. Regardless of what server hosts the + Corresponding Source, you remain obligated to ensure that it is + available for as long as needed to satisfy these requirements. + + e) Convey the object code using peer-to-peer transmission, provided + you inform other peers where the object code and Corresponding + Source of the work are being offered to the general public at no + charge under subsection 6d. + + A separable portion of the object code, whose source code is excluded +from the Corresponding Source as a System Library, need not be +included in conveying the object code work. + + A "User Product" is either (1) a "consumer product", which means any +tangible personal property which is normally used for personal, family, +or household purposes, or (2) anything designed or sold for incorporation +into a dwelling. In determining whether a product is a consumer product, +doubtful cases shall be resolved in favor of coverage. For a particular +product received by a particular user, "normally used" refers to a +typical or common use of that class of product, regardless of the status +of the particular user or of the way in which the particular user +actually uses, or expects or is expected to use, the product. A product +is a consumer product regardless of whether the product has substantial +commercial, industrial or non-consumer uses, unless such uses represent +the only significant mode of use of the product. + + "Installation Information" for a User Product means any methods, +procedures, authorization keys, or other information required to install +and execute modified versions of a covered work in that User Product from +a modified version of its Corresponding Source. The information must +suffice to ensure that the continued functioning of the modified object +code is in no case prevented or interfered with solely because +modification has been made. + + If you convey an object code work under this section in, or with, or +specifically for use in, a User Product, and the conveying occurs as +part of a transaction in which the right of possession and use of the +User Product is transferred to the recipient in perpetuity or for a +fixed term (regardless of how the transaction is characterized), the +Corresponding Source conveyed under this section must be accompanied +by the Installation Information. But this requirement does not apply +if neither you nor any third party retains the ability to install +modified object code on the User Product (for example, the work has +been installed in ROM). + + The requirement to provide Installation Information does not include a +requirement to continue to provide support service, warranty, or updates +for a work that has been modified or installed by the recipient, or for +the User Product in which it has been modified or installed. Access to a +network may be denied when the modification itself materially and +adversely affects the operation of the network or violates the rules and +protocols for communication across the network. + + Corresponding Source conveyed, and Installation Information provided, +in accord with this section must be in a format that is publicly +documented (and with an implementation available to the public in +source code form), and must require no special password or key for +unpacking, reading or copying. + + 7. Additional Terms. + + "Additional permissions" are terms that supplement the terms of this +License by making exceptions from one or more of its conditions. +Additional permissions that are applicable to the entire Program shall +be treated as though they were included in this License, to the extent +that they are valid under applicable law. If additional permissions +apply only to part of the Program, that part may be used separately +under those permissions, but the entire Program remains governed by +this License without regard to the additional permissions. + + When you convey a copy of a covered work, you may at your option +remove any additional permissions from that copy, or from any part of +it. (Additional permissions may be written to require their own +removal in certain cases when you modify the work.) You may place +additional permissions on material, added by you to a covered work, +for which you have or can give appropriate copyright permission. + + Notwithstanding any other provision of this License, for material you +add to a covered work, you may (if authorized by the copyright holders of +that material) supplement the terms of this License with terms: + + a) Disclaiming warranty or limiting liability differently from the + terms of sections 15 and 16 of this License; or + + b) Requiring preservation of specified reasonable legal notices or + author attributions in that material or in the Appropriate Legal + Notices displayed by works containing it; or + + c) Prohibiting misrepresentation of the origin of that material, or + requiring that modified versions of such material be marked in + reasonable ways as different from the original version; or + + d) Limiting the use for publicity purposes of names of licensors or + authors of the material; or + + e) Declining to grant rights under trademark law for use of some + trade names, trademarks, or service marks; or + + f) Requiring indemnification of licensors and authors of that + material by anyone who conveys the material (or modified versions of + it) with contractual assumptions of liability to the recipient, for + any liability that these contractual assumptions directly impose on + those licensors and authors. + + All other non-permissive additional terms are considered "further +restrictions" within the meaning of section 10. If the Program as you +received it, or any part of it, contains a notice stating that it is +governed by this License along with a term that is a further +restriction, you may remove that term. If a license document contains +a further restriction but permits relicensing or conveying under this +License, you may add to a covered work material governed by the terms +of that license document, provided that the further restriction does +not survive such relicensing or conveying. + + If you add terms to a covered work in accord with this section, you +must place, in the relevant source files, a statement of the +additional terms that apply to those files, or a notice indicating +where to find the applicable terms. + + Additional terms, permissive or non-permissive, may be stated in the +form of a separately written license, or stated as exceptions; +the above requirements apply either way. + + 8. Termination. + + You may not propagate or modify a covered work except as expressly +provided under this License. Any attempt otherwise to propagate or +modify it is void, and will automatically terminate your rights under +this License (including any patent licenses granted under the third +paragraph of section 11). + + However, if you cease all violation of this License, then your +license from a particular copyright holder is reinstated (a) +provisionally, unless and until the copyright holder explicitly and +finally terminates your license, and (b) permanently, if the copyright +holder fails to notify you of the violation by some reasonable means +prior to 60 days after the cessation. + + Moreover, your license from a particular copyright holder is +reinstated permanently if the copyright holder notifies you of the +violation by some reasonable means, this is the first time you have +received notice of violation of this License (for any work) from that +copyright holder, and you cure the violation prior to 30 days after +your receipt of the notice. + + Termination of your rights under this section does not terminate the +licenses of parties who have received copies or rights from you under +this License. If your rights have been terminated and not permanently +reinstated, you do not qualify to receive new licenses for the same +material under section 10. + + 9. Acceptance Not Required for Having Copies. + + You are not required to accept this License in order to receive or +run a copy of the Program. Ancillary propagation of a covered work +occurring solely as a consequence of using peer-to-peer transmission +to receive a copy likewise does not require acceptance. However, +nothing other than this License grants you permission to propagate or +modify any covered work. These actions infringe copyright if you do +not accept this License. Therefore, by modifying or propagating a +covered work, you indicate your acceptance of this License to do so. + + 10. Automatic Licensing of Downstream Recipients. + + Each time you convey a covered work, the recipient automatically +receives a license from the original licensors, to run, modify and +propagate that work, subject to this License. You are not responsible +for enforcing compliance by third parties with this License. + + An "entity transaction" is a transaction transferring control of an +organization, or substantially all assets of one, or subdividing an +organization, or merging organizations. If propagation of a covered +work results from an entity transaction, each party to that +transaction who receives a copy of the work also receives whatever +licenses to the work the party's predecessor in interest had or could +give under the previous paragraph, plus a right to possession of the +Corresponding Source of the work from the predecessor in interest, if +the predecessor has it or can get it with reasonable efforts. + + You may not impose any further restrictions on the exercise of the +rights granted or affirmed under this License. For example, you may +not impose a license fee, royalty, or other charge for exercise of +rights granted under this License, and you may not initiate litigation +(including a cross-claim or counterclaim in a lawsuit) alleging that +any patent claim is infringed by making, using, selling, offering for +sale, or importing the Program or any portion of it. + + 11. Patents. + + A "contributor" is a copyright holder who authorizes use under this +License of the Program or a work on which the Program is based. The +work thus licensed is called the contributor's "contributor version". + + A contributor's "essential patent claims" are all patent claims +owned or controlled by the contributor, whether already acquired or +hereafter acquired, that would be infringed by some manner, permitted +by this License, of making, using, or selling its contributor version, +but do not include claims that would be infringed only as a +consequence of further modification of the contributor version. For +purposes of this definition, "control" includes the right to grant +patent sublicenses in a manner consistent with the requirements of +this License. + + Each contributor grants you a non-exclusive, worldwide, royalty-free +patent license under the contributor's essential patent claims, to +make, use, sell, offer for sale, import and otherwise run, modify and +propagate the contents of its contributor version. + + In the following three paragraphs, a "patent license" is any express +agreement or commitment, however denominated, not to enforce a patent +(such as an express permission to practice a patent or covenant not to +sue for patent infringement). To "grant" such a patent license to a +party means to make such an agreement or commitment not to enforce a +patent against the party. + + If you convey a covered work, knowingly relying on a patent license, +and the Corresponding Source of the work is not available for anyone +to copy, free of charge and under the terms of this License, through a +publicly available network server or other readily accessible means, +then you must either (1) cause the Corresponding Source to be so +available, or (2) arrange to deprive yourself of the benefit of the +patent license for this particular work, or (3) arrange, in a manner +consistent with the requirements of this License, to extend the patent +license to downstream recipients. "Knowingly relying" means you have +actual knowledge that, but for the patent license, your conveying the +covered work in a country, or your recipient's use of the covered work +in a country, would infringe one or more identifiable patents in that +country that you have reason to believe are valid. + + If, pursuant to or in connection with a single transaction or +arrangement, you convey, or propagate by procuring conveyance of, a +covered work, and grant a patent license to some of the parties +receiving the covered work authorizing them to use, propagate, modify +or convey a specific copy of the covered work, then the patent license +you grant is automatically extended to all recipients of the covered +work and works based on it. + + A patent license is "discriminatory" if it does not include within +the scope of its coverage, prohibits the exercise of, or is +conditioned on the non-exercise of one or more of the rights that are +specifically granted under this License. You may not convey a covered +work if you are a party to an arrangement with a third party that is +in the business of distributing software, under which you make payment +to the third party based on the extent of your activity of conveying +the work, and under which the third party grants, to any of the +parties who would receive the covered work from you, a discriminatory +patent license (a) in connection with copies of the covered work +conveyed by you (or copies made from those copies), or (b) primarily +for and in connection with specific products or compilations that +contain the covered work, unless you entered into that arrangement, +or that patent license was granted, prior to 28 March 2007. + + Nothing in this License shall be construed as excluding or limiting +any implied license or other defenses to infringement that may +otherwise be available to you under applicable patent law. + + 12. No Surrender of Others' Freedom. + + If conditions are imposed on you (whether by court order, agreement or +otherwise) that contradict the conditions of this License, they do not +excuse you from the conditions of this License. If you cannot convey a +covered work so as to satisfy simultaneously your obligations under this +License and any other pertinent obligations, then as a consequence you may +not convey it at all. For example, if you agree to terms that obligate you +to collect a royalty for further conveying from those to whom you convey +the Program, the only way you could satisfy both those terms and this +License would be to refrain entirely from conveying the Program. + + 13. Use with the GNU Affero General Public License. + + Notwithstanding any other provision of this License, you have +permission to link or combine any covered work with a work licensed +under version 3 of the GNU Affero General Public License into a single +combined work, and to convey the resulting work. The terms of this +License will continue to apply to the part which is the covered work, +but the special requirements of the GNU Affero General Public License, +section 13, concerning interaction through a network will apply to the +combination as such. + + 14. Revised Versions of this License. + + The Free Software Foundation may publish revised and/or new versions of +the GNU General Public License from time to time. Such new versions will +be similar in spirit to the present version, but may differ in detail to +address new problems or concerns. + + Each version is given a distinguishing version number. If the +Program specifies that a certain numbered version of the GNU General +Public License "or any later version" applies to it, you have the +option of following the terms and conditions either of that numbered +version or of any later version published by the Free Software +Foundation. If the Program does not specify a version number of the +GNU General Public License, you may choose any version ever published +by the Free Software Foundation. + + If the Program specifies that a proxy can decide which future +versions of the GNU General Public License can be used, that proxy's +public statement of acceptance of a version permanently authorizes you +to choose that version for the Program. + + Later license versions may give you additional or different +permissions. However, no additional obligations are imposed on any +author or copyright holder as a result of your choosing to follow a +later version. + + 15. Disclaimer of Warranty. + + THERE IS NO WARRANTY FOR THE PROGRAM, TO THE EXTENT PERMITTED BY +APPLICABLE LAW. EXCEPT WHEN OTHERWISE STATED IN WRITING THE COPYRIGHT +HOLDERS AND/OR OTHER PARTIES PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY +OF ANY KIND, EITHER EXPRESSED OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, +THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR +PURPOSE. THE ENTIRE RISK AS TO THE QUALITY AND PERFORMANCE OF THE PROGRAM +IS WITH YOU. SHOULD THE PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF +ALL NECESSARY SERVICING, REPAIR OR CORRECTION. + + 16. Limitation of Liability. + + IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING +WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MODIFIES AND/OR CONVEYS +THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES, INCLUDING ANY +GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING OUT OF THE +USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED TO LOSS OF +DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY YOU OR THIRD +PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER PROGRAMS), +EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE POSSIBILITY OF +SUCH DAMAGES. + + 17. Interpretation of Sections 15 and 16. + + If the disclaimer of warranty and limitation of liability provided +above cannot be given local legal effect according to their terms, +reviewing courts shall apply local law that most closely approximates +an absolute waiver of all civil liability in connection with the +Program, unless a warranty or assumption of liability accompanies a +copy of the Program in return for a fee. + + END OF TERMS AND CONDITIONS + + How to Apply These Terms to Your New Programs + + If you develop a new program, and you want it to be of the greatest +possible use to the public, the best way to achieve this is to make it +free software which everyone can redistribute and change under these terms. + + To do so, attach the following notices to the program. It is safest +to attach them to the start of each source file to most effectively +state the exclusion of warranty; and each file should have at least +the "copyright" line and a pointer to where the full notice is found. + + {one line to give the program's name and a brief idea of what it does.} + Copyright (C) {year} {name of author} + + This program is free software: you can redistribute it and/or modify + it under the terms of the GNU General Public License as published by + the Free Software Foundation, either version 3 of the License, or + (at your option) any later version. + + This program is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + GNU General Public License for more details. + + You should have received a copy of the GNU General Public License + along with this program. If not, see <http://www.gnu.org/licenses/>. + +Also add information on how to contact you by electronic and paper mail. + + If the program does terminal interaction, make it output a short +notice like this when it starts in an interactive mode: + + {project} Copyright (C) {year} {fullname} + This program comes with ABSOLUTELY NO WARRANTY; for details type `show w'. + This is free software, and you are welcome to redistribute it + under certain conditions; type `show c' for details. + +The hypothetical commands `show w' and `show c' should show the appropriate +parts of the General Public License. Of course, your program's commands +might be different; for a GUI interface, you would use an "about box". + + You should also get your employer (if you work as a programmer) or school, +if any, to sign a "copyright disclaimer" for the program, if necessary. +For more information on this, and how to apply and follow the GNU GPL, see +<http://www.gnu.org/licenses/>. + + The GNU General Public License does not permit incorporating your program +into proprietary programs. If your program is a subroutine library, you +may consider it more useful to permit linking proprietary applications with +the library. If this is what you want to do, use the GNU Lesser General +Public License instead of this License. But first, please read +<http://www.gnu.org/philosophy/why-not-lgpl.html>. \ No newline at end of file diff --git a/C++/README.md b/C++/README.md new file mode 100644 index 0000000..a23819d --- /dev/null +++ b/C++/README.md @@ -0,0 +1,87 @@ +# Libxdf - a C++ library for loading [XDF](https://github.com/sccn/xdf/wiki/Specifications "Extensible Data Format") files + + +* [Introduction](#intro) +* [Download](#download) +* [Quick-Start Guide](#quick) +* [Documentation](#doc) +* [Support](#support) + + +## <a name="intro"></a>Introduction + +Libxdf is a cross-platform C++ library for loading multimodal, multi-rate signals stored in [XDF](https://github.com/sccn/xdf/wiki/Specifications "Extensible Data Format") files. +Libxdf is used in the biosignal viewing application [SigViewer](https://github.com/cbrnr/sigviewer). It can also be integrated into other +C++ applications. + +Libxdf is open-source, free, and actively maintained. + + +## <a name="download"></a>Download + +* [Source code (zip)](https://github.com/Yida-Lin/libxdf/archive/0.94.zip) +* [Source code (tar.gz)](https://github.com/Yida-Lin/libxdf/archive/0.94.tar.gz) +* [Pre-built binaries](https://github.com/Yida-Lin/libxdf/releases) + +## <a name="quick"></a>Quick-Start Guide + +### Building libxdf +Libxdf can be conveniently built either using `qmake` or `cmake`. Configuration files for both build tools are included with the source. + +### Use in conjunction with [SigViewer](https://github.com/cbrnr/sigviewer) + +Libxdf is a built-in component of [SigViewer](https://github.com/cbrnr/sigviewer). If you wish to build SigViewer from source, follow these steps: + +1. Download `xdf.h` and `libxdf.a` from the [release](https://github.com/Yida-Lin/libxdf/releases) page. +2. Copy `xdf.h` into `sigviewer/external/include` +3. Copy `libxdf.a` into `sigviewer/external/lib` +4. Build and run Sigviewer + + + + +Example: SigViewer using _libxdf_ to display signals in an XDF file. + +### Use in other C++ applications + +1. Build libxdf from source or use a pre-built binary release +2. Instantiate an object of the `Xdf` class and call the `load_xdf` method. + +Example: + +```C++ +#include "xdf.h" + +Xdf XDFdata; +XDFdata.load_xdf("C:/example.xdf"); +``` + +To resample the signals to e.g. 100Hz: + +```C++ +XDFdata.resample(100); +``` + +The functions in libxdf must be called following a certain order. For instance, if you call the `subtractMean` function before you load any data, it will cause undefined behavior. + +The recommended order is shown here. Only `load_xdf` is mandatory. + +```C++ +XDFdata.load_xdf(std::string filepath); +XDFdata.subtractMean(); +XDFdata.createLabels(); +XDFdata.resample(int sampleRate); +XDFdata.freeUpTimeStamps(); +``` + +Libxdf depends on third party libraries [Pugixml v1.8](http://pugixml.org/) for XML parsing and [Smarc](http://audio-smarc.sourceforge.net/) for resampling. + +## <a name="doc"></a> Documentation +Detailed documentation was generated via [Doxygen](http://www.stack.nl/~dimitri/doxygen/index.html) and is available [here](docs/html/class_xdf.html). + +## <a name="SigViewer"></a> SigViewer Online Repo +SigViewer Online Repository is [here](repository/Updates.xml). + +## <a name="support"></a>Support + +[Email author](mailto:yida.lin@outlook.com) or report a new [issue](https://github.com/Yida-Lin/libxdf/issues). diff --git a/C++/_config.yml b/C++/_config.yml new file mode 100644 index 0000000..e318203 --- /dev/null +++ b/C++/_config.yml @@ -0,0 +1,3 @@ +theme: jekyll-theme-cayman +description: [libxdf is a static C++ library for loading XDF files] +show_downloads: ["true"] \ No newline at end of file diff --git a/C++/_layouts/default.html b/C++/_layouts/default.html new file mode 100644 index 0000000..559a292 --- /dev/null +++ b/C++/_layouts/default.html @@ -0,0 +1,51 @@ +<!DOCTYPE html> +<html lang="en-us"> + <head> + <meta charset="UTF-8"> + <title>{{ page.title | default: site.title }}</title> + <meta name="viewport" content="width=device-width, initial-scale=1"> + <meta name="theme-color" content="#157878"> + <link href='https://fonts.googleapis.com/css?family=Open+Sans:400,700' rel='stylesheet' type='text/css'> + <link rel="stylesheet" href="{{ '/assets/css/style.css?v=' | append: site.github.build_revision | relative_url }}"> + </head> + <body> + <section class="page-header"> + <h1 class="project-name">{{ site.title | default: site.github.repository_name }}</h1> + <h2 class="project-tagline">{{ site.description | default: site.github.project_tagline }}</h2> + {% if site.github.is_project_page %} + <a href="{{ site.github.repository_url }}" class="btn">View on GitHub</a> + {% endif %} + {% if site.show_downloads %} + <a href="https://github.com/Yida-Lin/libxdf/releases" class="btn">Download</a> + <a href="docs/html/class_xdf.html" class="btn">Documentation</a> + <!-- + <a href="{{ site.github.zip_url }}" class="btn">Download .zip</a> + <a href="{{ site.github.tar_url }}" class="btn">Download .tar.gz</a> + --> + {% endif %} + </section> + + <section class="main-content"> + {{ content }} + + <footer class="site-footer"> + {% if site.github.is_project_page %} + <span class="site-footer-owner"><a href="{{ site.github.repository_url }}">{{ site.github.repository_name }}</a> is maintained by <a href="{{ site.github.owner_url }}">{{ site.github.owner_name }}</a>.</span> + {% endif %} + <span class="site-footer-credits">This page was generated by <a href="https://pages.github.com">GitHub Pages</a>.</span> + </footer> + </section> + + {% if site.google_analytics %} + <script type="text/javascript"> + (function(i,s,o,g,r,a,m){i['GoogleAnalyticsObject']=r;i[r]=i[r]||function(){ + (i[r].q=i[r].q||[]).push(arguments)},i[r].l=1*new Date();a=s.createElement(o), + m=s.getElementsByTagName(o)[0];a.async=1;a.src=g;m.parentNode.insertBefore(a,m) + })(window,document,'script','//www.google-analytics.com/analytics.js','ga'); + + ga('create', '{{ site.google_analytics }}', 'auto'); + ga('send', 'pageview'); + </script> + {% endif %} + </body> +</html> diff --git a/C++/docs/Example.png b/C++/docs/Example.png new file mode 100644 index 0000000000000000000000000000000000000000..073677718b3def46924c8997393f954577c32175 GIT binary patch literal 205786 zcmd43d0bQH);1i9LLGpr6_hD$J!&l~Qe~1MT2zh$qD2J(iAWVBKtyEBgrcA_MC$-$ zib@?B0!79^!k|P&2nd8BgfJ#RMhIlu8QvY*bB?w>&-eV^f4(<A9QJ1Kdsz3n*SglV z)}0$i4!avHHC+mUKn(W(bI*?uh<+jjvPkc9J@5{_;AuYik51H&?ms|E+RdlHi$%e^ zJ$6GNW%y;vz{TM8k_-Pl83lo?yrli3Gjt9b2Z3lF@87fgSX=;4wd|!W^JMQ0a`9L8 zD;DuwKYZqP{u+Dr`CTppZa~`oNW&FZ7KvPT;lIAP;?{+uyS`d<*F^E{w?9<BtFZAm zZ94e*t!4YKXYJa`w*2SNpb#p*C@24eV6kKAKzF|<U&R7WM)edOKOWWo!V#gt2063D zIfZQWixb5a(kgnwkT0-L9~|IEA5x;;wvR3$kcPt#be4Z|r*u^aME8?BysNExBB-(v zddV6)lS=Zg8(qz`g3I4EmWI2{%w|&RQ2ng|^!mBS*8F^F9Vc2dK~ZL=zWAgKNU3qA z!EkTAAeu=UnlBM()D(@7eA#I|RwKnx@GPL7#chs2ahzEFF47uW{WI-)eDpy?_Cv@h zX#}eQ^R5d%sIrF7R12cW;(n%yvSAr1Mg58?Kwu^Jn9Wdet-#Mx+9Dt*-<j1CDdKEF zA$IyK(?s(I8H?krpmEg_80ws~mqvG1?L|&wrLnjwU>>fS|GOcd1{7?K0<J+wud=Ec zs@Fu!Vd-<$%m)F%MbO6NDBplx$X{1Q8=(fBYTaFhuuCxD3X4xx*hr&Uv(;761Qju$ zS0(de(J`HrguPM|^7KjOoqX{V!DW5R$$Ulk(|}`IE&9(Vv7$N*!eEIi^h9?EGqZxD z6#0F@NurWci(<)9Oe@wbp_W5Y!(xzVsxTTE2b|2EFwwM=NG$YgQmy@<hCsr_+6fJ$ z^&}t#rkE9YW5;ZnT)0LdIPZxX*n9jxU4j3rju@<t4Eph9nuSJ8&?r-nn&*_WG4+F8 zRsl0N)k2M{d@XTO-K~)zm{i<+RBej7udtRfL!tbN>VV<mrK@4`WWjc_(3WYWQZQ;g z<?Y@va9}%flB}e{nW_mQ4l6B#&lCyVV4Szi0!^D$tv5x{!$hjt$be%m?DpbveK9>R zwR5E)rV2SUnS5Zbg1L(Ql`&8JEWa?4%s-KN(UW~aDrqYKI#_h5pCWR+j;K<;kxLkK z*OZUvQff#??tFdM(YByP;Ik_3UGAWNevdbK_8vx8wuzQ-TpB=_TgGg&#)e7_VDf1J zPTgX1iJ)Ryb6uq<cqfK4Hq?y~t`hQHxugKPeToLon!6$Zpg2!ymHKT|tyBreJtT<{ z)<UkcYRZ%HEaCmpC{cT{prwt$WTuXsA2m2l^I0`}y&%Ye<zB6B=Q~n=$t=(lF&WG@ zGkX%_t^ToL@_^htj5jnDk>}F*)OGX6<L@w5T}xi|LzG`|Q6p)uxVPH5FlM5}HW8=l zCr+t*tm|u0qftX2>Sw}*f`GXJO(8JPN<c}otLjLow`SNXR8Nj3NSc=E(%~`^FO4Rm zyKs~FB3{*{Shz+=^3#m}!lc3Ek5%6LVPk7))z1<Rtuh!6YwJNTw@=*e@8UO3-e+3h z+46~j;9cJ2!E~`rOn<mfc%ltHHd{ny+k&GRHc~%84T#|^RVPK>%1lACi7`fUIwuCF z5NpDv9J0*5))S~SiNVPc>Qho0R8=b|AdlOVXljW`3_-nx#&=cXP#2{-M(TS47j-Xu z5-Ye7OUkSpU(YPhpD#*%L6x<H34>#m-}_TV)7<ne=%nw%AaMUi(;de8W(^qK*;2O1 zCYStU51qNZ_KAK)#E?L+935UBiDfBgEaBIjPH;toxv%>!=l}X1!>`ic+ssIwZn2b( zB~Ymrc5gjlDeZ{9Af1m_V9E#1{xW;}*$69Hvhe=z)0I>Z`DP8YxK0-)6+1)Wt2spM zJ}Hwjrx19N=dUp{mBX#I*7Aqmm+;CeqyRhDE8vrdfq(%Q-bQ$ji%cRW5j5#2k~J{I zns()t<0^ofjpSc}VwR#<z*2#G_2_(7!M>q})eV@jc2>-ViOE3SYNAPzeTHOJz*GXK zQvAjy*JWE^(vMf$S_{UGl=nlM*K?%1xy^vn^AjajiL`Go!i_AqkBK6;H`Ny4N%9*Q zUl)U?&M6T?brac5A5U;%5-{EV==c+J68j|@mU3jQ_e>$17#V*8F0JjIm!G7lo(NXp z<HI$pX~;SuEZVak*d=YHq1>e{fF?>hZlVDM`BfT@AksR{T`DuFt0$po!Wh`>D^%@9 zn1(DUC(k=FX)aUinakj^CV?X@{xBSIogBZ$ZYidqq`dHZRZn&@(lS7Pblr!@mxQw9 zsZJaJ4x%IORug+NP<(MROFyGADБ6}ywc8RFpSiPr*8fNlKxRz3^swc(|#g+7j zXX10<xJUGBDbiIR&+bFkhwh%-O;LW2YV|}~gQs3P99%DpRS@IUSBde5rE6L84+4#f z1}=__1n<EJj3{KF2#P)>O~;d~ptw#v`3aEgUROj27Ha?ve-pDHf9_{NJPj2f9pt!5 zA5Gi1r#JQ8%hQeQs3V>CE^aY<Ks9(Pj`of=FVidSu&KGG-`4ui?Uj_J^C7|BbJR86 zdHz=43zs6U1au37!b;YSVdlAq!zqKpUAfj`1Ah`SW_d{`7utNX;^T>YWkSb0USl8n zg|ReL?JFTK&J3Q<M+v6XT%3x?#0X_ffjt}zm(G!-v9!2;6|+15YfN;&2a}aNNhY}h zHIORgV^!Crmpl^$ToM%~wq;to@K-afohKrsMI2R(lot$ha?_0~Iyq(5FmgQK+nnz{ zXK)CiSBtqy-L{7!5H0O)W>36)^6V)K8?!kxI_-JIVY|dtZ=&JWH137w=mV!{6Rtej zR!i%`NNiWz+KNw6!`;&dyu72Hybr(p5Zp-~!>#3t_E>T`sw-!xTSe8#prqJ(?kT3O zk#h$Vr%^HeSPHse2qom3y^`2=60!4zzvGO9aK#6~Yin$z<{mAkhiHo>$lnJ`ZqKdm z*e#yPDr7U`b)(}1omj)_kZ*wGk>`3BVzGOR4_NN7UPpCKSROi@jCe}_phyi2xXA2H zwYnr+4&~mh)$hwKr%oO2<JCt4r4LcR85^AbNc@Q_4~0Xle1nTRNyk^ohKtC`32R}# za(rVfMNvo@pcX(?lY$vMPI)#-dXkoKLOS;pRu81JWa$Eynt@}eUU@3_NT0d8ydV_B zz4OZdpc)dYhW5S=$}qjA>y3~^8Agy8O!8wrexO)Tx5RnSf4MZucDZTdh>eeKC(&iy zAZ@pJ_R-MHz4wAOhS@)J#1&*BpDv-go@kxqTCjxucdLmRV(Rx~{)-Z}0=QI3Y^5?C zkcXf<RD2n7$a$y9SVg<Ax#8=NjoYrz=q6h4xMka8(7UXP6Y&OEpJDk3I78JgR34VH z?I|^s@B2#hB!S+#jN?r)(WSN-npT|L+N6*=WfrBMSCyLl$W}7Q&rEMl{oL#p`6}Cz z$wp3^J#m{)6RqhEnTs4eoklNpDD1NTF?xB4&LA`g`5=HNeD>C~@a%XfB(s{BpUM`A zo|FpY;oj60{n!hFtr=%e>(BUd5Xl)!K3W3E{V~+`pfY_P_Rx9WizRi&NvPjiggAw# z<~g8ZX;cEH5F5*aR5IqGJ0z<+Vjj@VD;+g*7-*T+TgShB9r}fvL3{nhJb~56jqWO5 zZkJeG1~4cp29v>3OI!scAz82m8Gn%Vc_n3WSle(_JwH5?!AI)A=AV1k`xv;4^d1oY z!o39lSd@_OHY606fsT2^1p9CSIts2?qXRXzG-5(ep<)}ZGc}+a3A`mJ-wHBu@=TyG zk+^-N*FaeFb;6&AbTAFu|I#*^&&}7gQRMc_1?A#k1)N%fs-M6Yk6B8q1vNBGgcRIA z;xl$1&j$htdz*j@U-Rj`n?LA&dgt`U4v03G`Ol|s$&SQNCIpH3?2|13fh6Yb`hTjK zZO?Vk9D2H-CB3;inu;X#oLUadv@v3>_f6EG0Cr~?vpTZe%;_pNUC^+01oLg9+_fcx zdpNc=gK5$GV-w*0vl_csGEr3=nZdb;J#_mGS{(*QDE-r1BvJUl;-HTOl!!hQ0r3o9 zRLtDr`+?_N1A<g7#yi!H3go;tO)ZNGqFxf8%WvUl8w{)c4eVlQW&;R|ec!3ZyhNva z6*ZrRR2S+W>NxLtsCR)iY!P;Uh#$eK>&t(*q$X6?fj*gTm&|=-N%)x)R!mrC+VGzx zf<St6#`P{#hlfP4?tbv*=F1Y;HHXf}4A`6!XxMzg;nEhUxY0lLkVm5!GdN{d@4nvJ zw0$IUZ3-ts7I&BlD;N*z5W@Q4aSXYNAgOaGi5>hYf3}(yIO%$Q6Tb1eqq~%XyoJD$ zsX@HD_wmcqE|6RF5#MXvKG}!=EQr&sMjFdE9A#U%QB4DqEod`pT0|5gL%`bWMrZz< zCW*Y{+V0TD&fwN{vS~f?drc!{gj(EVXwp~$hdKqlFEYnldc~>r1$TPH^IlW5v0aT| z|J~H7Sv9Mk$((DWJ5|}AhY%71u8M)EOA-fvW(*qkv3j2N+hCsv=nbAtv%gW&5;Jiw zE_y67YTGq2+wTH8)1&yI3O-2iiE0Op(%R|)_X~$G+eJ#WrJXPt&!pko9P4ls(4;cp zALm@GujoB528}+iaupu2G=+0$k7WCZ&F8enMitZnR<lMKf5C<mEEd@~L7{mC!)2d+ zv>=J$n^22OO9sua`?pcctSp1lD=)Nls;mYeu9t9|^{K1<)8nrp20dzUR?d3+c&<0% zY0FsGUjhheCsX(X-ZSn!hZ;X>ll47ypIQwcq!a=<_=i!}Y!|%|8z`RUSV#D%Gf3$c zs~w3c*+KF(h`84hXo+JjuCnB`u8arSYFb7Aye>4~!agF?7W%a3?fVHwr@EWR-eUs% zhxDDiP4L%x94J%lk+FL^g_t?#198g@*?r%lGuEoa4cR4fOM<9|{|m6@D%Cj-dIk7o zxfwrJ>I~Xfzq3neF%2kFF>DmJ?o#1zzx;x4#`y2pkF*eQhRLtmPvL;QV-fFEej_#x zoJT9-s1}4EiMWZKo0sE6?nmHTiy27<>|;%wJ)S%VfI)>OB{>G0yHK|};<heF=FmXJ z=2csa*cjy(EJ^?A<7xZge=``~u6WY9J83c^7C1p>PlxEr(y$uxFAV!4L$j0aQsOQz zL>x4w>YDVdXmD{`({m|tJm{--X;d|G#gL|p`jf%goU!b?^p|z<;s<5fsp`0Is4i1B zS=%@l(ULW%_|s@XLy3t^jSjkHIFdv?9Y==I#nd;nk2MZl>mi6;x5JO)VQc0MtiAnK z*!69#$_rl;`qI+!j^C>DPueEppmb-au%8TVg-t*#T5y=9-EtS+?iI&R-rW)(Fvl<| zc}1=!{$jbxlS2F_vkTui<)|;EP!utBLq8^4qHLr#pK}O!p}7m|V+lO4++YhD=Va42 zAKyJ<veB$TJ>9Ua^4w$=y1S{PEbr!tH9IBSLeEb6U|zO#V6MMj`6&eJ_C%f93h7() zsa2VG`@b>kP3c;=X0iK=MSuP2#9mmu&EHB3kl<@}VdJnL39^AcD3fZ`tk^}7r+zS~ zeHgyzwy87a^DAF{`qQ^F1hT64yO0k4Ix?qUShAH@9fw`<=f29KJ0KfMj(0p@xcfBE zpC`(hp;z>_{bfKEiwsVW`Ytx8#eo0$b5CDgA9<j2$iMKx?y6JDKD^3Dss*D$HIJYw zXLb?PbB&H(NqXBx#<c8AP>9)|TlcT}_v`3keeCJjv6ggKOXaY>wCd!#KBX9@5tDlB z*tYJ7GrM)Oj?~Q;Bl%=yE2Yjz{Lt~w6N=2cq9-~qQ`=i#f@)fo-{CU40zXNX=TK^l zqDXC(2E|{`>KoMZe`tfJQY5`<UtG>9gCa)J67!N9ukY%Kyx^)5K?+p-QXr;Gn~^jV zy9q<8#}vta=0?mwv7nVaLx_Q??wZUqQs`Tjm^Lu3stPXayG-t8;>0YaJtm7LPg(Tm zF_lq6YIT&;-XPng7858AL$VfoLweg<PxR<25>1vyn{<^W!K#r*WE--sG0!o=+VAAg z{n}`{hn&^*05!4<-e*4<b+yNIfI2Yqb7tMIC_xm#sd`JW@*PomKpF{^MuMaJurV5h zU=${cO^}8{0KyWc-TEgxK%(QG(IpKb1uYn+F;Ns65JO1difiFm0aw4b-N3YgOO47G z=L*<uIqrBqK_kYIS#~d<9IG3%5Kd|cXDH2t*}G3KS%Z9}9;bM%dDqKlGg+T%+E+go z^y`TVEa#sImXU{-)zW}EkPvKV$(>S15flj`_0$&0P4Bu#s5fqwAL=<MGUsU0H^z3o z^uB?I*?STWg?G3pM~s9+-1;FzX}p7dQF4#s2~zQ-5mUUHe!Y^?2)GKxu1vi04Ssq1 z+ts*PPxaeY0LP^ltL<=yyLlG1;Rg<#hxj>9tw(Z+igcF@=*(?skIVFVYYTs;jUf=C z83k0ALDdb|%*L%ysweQ$lj|15I2V;nXQ$cMjTkVSEhVLbb*`i96oeVrT#EV#6pSu} zOpWe!El0~6QcJ3gO17;2+u2`y4O-JYAv##9r5~93m=66@*izRowa9wvIPt<uD_pVM zsk=MR46f>dGkeVjXdg;9+(IU*I$;WT5>1{<o5He#u}?@K7pr;r+cmkTX3kT}2+LsO zCR4B>QmqV=DsH^Y`tYEf^PBCWxw!GAh|P7Ad#z0egQrT_L|jHc%uY4}RgW~*I5x3_ zW#@z);V?-MjBfve&wa>8E-HM2e{OI(bt9{u2$&HRCp$NY2&ybRh=4|`3`_D%51KW^ z5K=PEf6GSil>{`a33JvU<6NgqvAs_baLFZ<n_W$VNT5WhD8aTJDejI_jzL+P5()n3 z8c8l-g_|JGc@G)&ys`Lu3AKO{%EV4()=J~>(lyEpJJMj{VD<Y@kJCWyzEg69cYJ?b zXrHoliP9D>w(ZYuphFZ5M#=_tu5tvXOd(NJRhk&qq(wHj+4U!N5lvBqO)sv{TjMdT zw0XQcxb1^a`L^{%PkJl|g5Oqa)Bp*uk>O!GEfKfw)voLl21n@nz+lEkSW%KSLa`<k zWP;}^h!{g;RouH)R;MamU&C*t_Cx?AxV*G6+AAnsPqYy`y3rVM&J|?!Ch?E=`0yWM z+S9A*CblrO6OnkIACSv}a6J6H=K2U|*Q#@aBC7iBa)P2j%d7zwV(%p1=Ya-$R7p#L zyzulUoSLSImu69&p8#@#My`JML95VpXrAkIf$IyDycO>1)0)wS)%f+%raN*sl}Ur% zt+usX^{KVoBUlp-(Tw4gcx%|Ayp=KQOEGaf*Q;MsWG27o4^;U}5#ul75w1Hn8e@x% zNGl!Yxexe-InfiuQ@cZ<-_g$Z^$iMT8N%v1MR&=OQSJkAOSfJrE`XC(Vb-t^YlV4R zGHAhZ&XVX38fr+KL4TagO0m`PLM{t>rlV}e$NOsRaeM@!Iouet%HiUAQHnAaI^Z(0 zS87<2vl6i*5ez0-6b<z|H;U($<Y~|J0fLx*3*C`qc}d=f=}W=%O|lMEh1*ft1EzjC zg-gQV7Da{bEGdRn1!$xCM&eSkbO>bk)T7qqFdy8zr|1K?dlwyq!8l1Uz&AdaGtoPe zb#YHRb<d~1^XNDG%o-%INBGUOm4VQA8Y4}!ru5ko|3^Aufw)z&bR>FgxOP(@j?yd0 zId%M}HaPBV_NbNvGW*7uJrd&=<Z-$%u%hUkL-2uL{VRGd=GL+t%^IL09cYKWX!H9N z_SM@3Ywc{o=#e_F`D!EuJDH-GSr#C=qCSAZIZNgRUL{8eW>{!YI`eteHJfgTT1iy2 zsHHbmZE#?KbAj|ah@fc^cq(CPAPM8sS1VLcQH@G|(aOy8^%2$cqrmD02|kECYDIp8 z%jF#i(d4G94p%sWwh}$zjXhgg__Vk`g2TYN`{{Nf%Yjhuw$QM)y}(Ue4zg_z@XMTd z%f%gj)QnAOrWxno#=l!pL;JJ-6qlXU?Q3$)s<OJAB5^T(Y}#NP#offaxn0HI5025N zywTnysBM=Y@C!lyi^{yvG3K$~W*(QM<%kR;7ziJ)MuD`$Zg0C@scqHE7IetrHDy%i z*govs@pmzMYt%zT+so0QRvJvNBFJ79RDkv<IPd9QMiaR0G}cCnIc&Nrpv(%xzX_*c zcuP;G;zV0Cv!~U$A@w?gKh*KVkz92@3<zfC49z`BVo<S92mJkl5Gww`=914;*YUFJ zSh%F8aipg}5|`{9#OT%M2G2ynq)|qdCx5l`^R(zX5{5Z+u-z;4u7l^F9C1a<xSps( za`y;R<TkwNXppXKyX)9?1rX#>QD*fWHG8!yZ~9wR-VX>pqqeon0ElK8MYOB{I^^dz z4rY0LrAaVZ64M^tY(EE&J&*J5r}y3KV9lRm^=OJ;JuJL?@G75LQu>=}K+SjH#qp|n zGM)oJE-2lcM5t^5g%<NVIt0RSof|ybw;CDx8KZYMgSBXDkFr7p(Blu(Y)N~lCxR;w zgiAFg$j@LhB;4*YRjpS#dXOw&WP~0DeKq5CH|x1$lUnnDI9Y{^|GbJZ<~XN$x!}-x zeRRJcygv};5`D<njkT|A!e)!3=kueZ&VRyu-KGTw!$@Tdk_VH$Tr-fr@<q-7q;j4m z31`_khLMr7<iLs)iK8(Q#pKo+fk_F05RW-K-eJC%$32iTS`Gusfo$mP*U%5bppe6x zdAev4jQ-`k_h$@Nqw*SDc1_Ja)(n8|PbgH?3*52e?&pNKP@hwXLj%}k2{hS4s-<I+ z_LXK+Dpj@iiN!ZctmsXp>=d$L!n+>irV(kO`0ho&HEsr{f$3n%3GdHf61g-jKwb#u z4`dGuvb_rC^-5LC`^)ZLUvKcr(S{Qn8roN7GbwCxW!vDVkYY|dd8xV?rfjyR`Uc}j z{dDDR*sS|jq}PIec&+iR`tP!7vrmko{tW82Ww*aVy9F8@4~{;?PCr#-p8&jZ^WOTL zS3ek>UWO<c&}YU>JU!)s@TMyO=k=C~j+7YCQB&;Vu66%hy7L5W+K`Xj%#-o4N;*=t zKxnES#G~`f8t@oi5I~u7dI`U#@)-86pFW<%jY?)cZTET?9=O~#k-{_6Of~v01NzG- za?}esU@4r*XX0UkU)*h<?&BH^Kc~spADwli#5hlE@~jE_My;f2(6}6oUy=&<{s#|_ z^on-%$j#z-p%g1@WqkR(jqXMLGMOG8|KIk7p26@}_je>hXRf>Z4-v|UxXP@kifoKS zaV<;i!rJbz(U`0gHnSH#x7XdfANw{Fy<e(j3|0DLF@r=5AF;qIW4z|IPO}y#Gt!JS zf<sc$Xdi|v*~Ff*1TvW~glo7srjV7<oI%ZK%@6`)A)pwW7i$3uR?awJo5;Uui|~=j zezOLCYqizd<5l!cJ<H3jaGtg}{=3tFukhh~O|wuM1VS5p`&2iB=WN&m1<lHwS3q~Y z6sQw6DxS{-2vx4kSl8K1Jh){_AQ|9lj^_G^mkwvv^Uh+{b+k)6G$funxr!kqQPjPf z1PVLIl^taGzc3$vh=~G56Y^Pgt|IglYxsL;c7YahSaSwkli9Dn34;JK5>6_N(NHxr zxJ#hRG1Kq;E=)t;rUY;rA-trb5E(t+{UNTqz%u&6>fd^*q5=W4Y+~t{Y6hyA>9oo^ zXq#9ZXtN`BbC`z@r#p!J58kw>uh-Rzhx{y4nL`O&ZqfYn^*kwPEEa+lFC=E@bl#>J zs;ele)?N92RmSw;8+5aVE!14lR*a6h3dR%|%(y%Dr&wXV)H2L0Gz?4=tJ!DAW?Dg5 z{JYuQ(gI??O4ldrIh)+aUH@V?wG%IK)0JtIFb%EIwyc!W1$eOLJTlY0Nf%?!do|Ff z-oXolr3eAbq_QwYrJ9Lknl{jt73_#=D3op<P%cN<TrxlSP0UaV=x`{?!QNOcMz{4r z9H`UiqfblgVbWh42ZDC%#*wnbPPXn!Fc~^L;eC@)^+lShy$bhob_qeWMCFh8hbvgh z;F5i(pg+MPW0QM#+@U`i`SoY2K+91(1_jEXTv%P@HY3W`xNkx2=AakP<(}KyPE3@{ zXzdhpJLuCIqsvN(Cn~51Y{}r>twgo@4SnxmZ;Zr>b4Wz>G?82sNF%c3d91a$X3J2U z`Lg5d(tb1;Hl=(vK$gh6?@^$0yP?O%5d@)@^<LnZH@ZyiXF9Ru?FD={>TmzxIVV?a zIRk=kcNhL+rWSQO$zyRrGi0IEJ=p%T9}>c#-NOmkX^#zFJuhQ>@AC8M5)qa6C?5z> zK+bOju_K|Y9?X`&vV!0iVcz%`mqTc;iSlfsV^)FeF<kLjjU4rL<~Y*U=0<&2(rhzv z-4uW0Q!e1qo-~l79|?vg`YsRmT+*|p6H>_*YBRzG(J_qY8$`bwyfDQSK|R&zxRmAZ z+_PNyoS=A)&F`tSa!FyoI#UE<C{9R3P>VYGkvgOFR6WAu%ES0F*=xA+b!*{u{&b-z zN$M3yHB(!RZ38!RN>jF<ZxDz=)4cHV?l@i$6g7)f55yo=8WnpkK`8ykUgc*BXDo%C z7{ybZ;^>`_$+-JhVN}-^P(eJ=GkzoraL<VAI!*yPS_vMnQFT<51Sjrg87H4w;>_Vb z@G@(lhm^Cfxy>wwix#_6?Z0%Jf7;T`QU3g9K9{(O2j!r<-A|o5AEEhTtjm?(rPw#( zjehMthqFHc%8>>`*bUf2a}^r50~Zc;J!%R1=F_0|jRgs;80jIqaW`Y<+;NvKq@UTZ z+edB!19e#v00gC%Jp=_6;@GoB&ZDV$*r62ko0LmLoQey2h|yyp#>y^@%4wkAr7MUU z1ra8XMXk0Ia>)Yj*4}|$2cx#sYZgx}h;-`c&K-%x&p|Vf@JL_jt@c%F!970vg;1jw zvM@c~n4XE=cp!XJ*-M?GxTaJv5e__svQ$Y(c_uRx&8&)Mi7a5<D%n_mKZdgoSEI?H zxB<udV*H$r*{5}bq#)L}PMdGnhS%IlS<@O{CtDt;HRIu)_bQ9+_H^=RK7pFV2`|?P zFNNMn$5>!s`X0n)U)|0Y+&Er&TL4frfIfHP^NjPpf8A`3L0|<^S#nainQwv52S_Ez zWysRh>ONLbg;iQI+egM8_1P}c<{Cj)1SXs7Xv+6A^W5#mUf?Rn?B(YYlPdLE!7y0! z?Dy186%MEZh^^+?CdqB(ay)u`9WWndY8!)oTB1D8tJewhzTy`Z`>e7lKWV*&O;m*+ zA|2Q|NVL7C87C<3sCw_EFzzRVTJ*#&k=j%us<6VOND50gi0)clK4_Q7hkByH#hmLb zyJquJvhx*)rq+*I2;<x}M&G+iqhM8l7GRS1hom>-<yrVCEz6{w6}AlY6bR+{!hUFh ztr!PVRKw3slniG*+549W<hE4^L?2wKFx;}^(3LoPFor(N+FOzJp{TSX^jklVLYE!* zEa(;x^~e!z%!jp05r&yz>hFp!Bc+aYD;;8AnHD&Ll95zl`AD@P-!IT()C;$&`X}8i z2fQ|o#)PS!YUU<E5?*x}qs{vg<GFsUgbRRipf`T{Km@`LtBs?E>ui&PvW@=|J-+f0 zfl1!Y;UHHs{<YDRunVeg##I9uU_97Z803jL^}M*O;zV=kmKsIob@z5Xkv_UXe=gl= z8A!ARUNv~}eCCQt-SGGyR*#1uq>LIM<J_d)nrXO&^L_uLwV;(~V|sai=65HqXvtuL zZl5|ZEx)xUhzA`%WB|C^z~%Sg{hFjCZGbMMe7&1-hT_G~S>rmh3RVUecci%PP~b1p zmy;5@O|MI`{M^ctiC?n+PSPt<JM~2Nm@fNyXpFB<fnD&k5`It!D=6}Xj#3L$77AVp zq9w<hD#Jt4zj>^q)KXADhmoqI)#!ThZKtPGr=!9_7Qyrc_Z|^FG3<Zl<aijw`o?2} zVJ|8e8v;AK9#*VxR@=?P6$f$WMOhcG+J2ED$tee?2p6NLk>DI1z!16EJ`sU#2THBt z_{hrXn_}4fQ+4;G{kpzNBcRlX%NfYl(u2qS7l&z=D7J3Gl>B4X-!9G(&`LwaS=37l zW)atS@|z-wwd#YlfdI9+Xg?57kj5t&_+PV4;D^FViuX;*W8&UWkmB2d<@aKX0j=GT zN@*pd6~rV<Ag5s|=}{Y5auPHt=}$qRm=twm!lpvUf3z^Y_}mS>(o<{e_KLk{vU}^E z0I9ecYeP%F(4ro23kwKX<=YLV;Z^Y?z94>b&#+3|Qgj(O3zwW_LKSYfNo5(xd=vp% zz9|XmyRC{5meW>N19~F3uZP%s1@`d*7uXn&(4+3y66(C+Q@;56HZVw!**jf@<yOUL z*|kAj-!I#X*i{%t)fR<s`$8p~3A)i_xm~2!s5Sxv&e1zuIae3r%4;en9W=Kz0SL*l zFOYgHu+RaM#R#wDYYPIlau~kZl(T0JBx#e!BNO^c$FX{_4w7V2Ke;yva9#}-l(<y! zkh(_2C$|U8zwnOMbZO>b29`kwd~_p2aO<^J>6-94Xq7gIq^iL?M)ZmyNW^-c#snYt zYTZ`NQ0)X!H2@mZnT*)E8N9j^wzE%i3XB0$)zI>NKI=M7uY)j!&;j2M+Y!wFHu4Z1 zt?37o&UaP-)YH8ae<n^Zg2Y%gyR<N(C=fM$V0crYZ4q6In~emB{e27J;fd{M4)pm0 zITSQMswQjTK{;_lRdRTS)#YN4B-O&WMvTXehu~_;{oKUfftqd2*$s}we02^^j5HJ! zYW<L!PE@tA9*!MV_E2UXB-!pr>`kY-O3IixfTga=#8b85P0Rv0My=#~V<)`zdg)(E zG-U&(*K6=^)erAjW|qlBMjBD$yfH|;eCj8^y11_#jE6|Rz2x5<-N&nEW54AgkNSG` zmc&_xruBy}M2fiMbA7Cr|CoK1tCx4G7?Iv<UN-j*{@O)47<Ej%*gCFpcyLRzdZd|( z<xwqNXqo$X$g7!Q5I>()4l(OR3#_#UpeXv2<RDQgnSUekVJou7xnI&Sf+&EKt*H-H zb2LhV5G1lW%S*nd<IUUXgGa|~{uKI-r#%62@oR2?v{oJ3rnTr(#6=aL0$1M*sn23O zSjSGWy}W?i&BLC(Ujn48pg&tX;69~SdJSW7NoIe!SPpoSrMKOqGVKy?ye!342YKJ{ z8|!VV>xQwvzJE<sqYLO8K0VX+1oKzVu>Fs8Oz|pf%+x^=MP#CG+AY3xxQ}J0UI;V? zj6oV`i`Kj2`WI!`;<ki9kS0hJgHcNaiGJP!DJ1>-gvYkX;wyU0gh05Tsx-x=2#CT7 zXdVi`KE=*Czp99NZ<ayNv4y=&CZH~Y<XtlnBLSf{BX0PzzGBV5zE5ei-Cy*AegBa= zqK82|!92&GK=z{D-79w_-axG0F)3L=zfip8e@-r~JD^9i{?rVBT2yIh+VHAksp+LX zZ-?c3|2&3Q^vGsY<G=K)eQXa9IR@J7v+g{n<ei$odxU4L(A&l{`I~Wnu_zKV3euQ5 zAgwo^9Cf|qvkmWFbr`MwlxAIMGi<fK!LZM&6$7UyXA1V8-0D#E*RJ-2H+t_9nrGjg zxDs{n&r<-UWbCg~x32oLIOg!+%D=u{vDh2(KfmmM3*{<pWVWhj-D9maIBa)FpLtHs zQg1M)k?Z#tiGKd5a(L<R4?b?vbe8BfGe<oIn-pMP_0G?*g(^i-2Op_aP`c^`2VJ)x zT;(ucyJORWztJeb*nEFrR7&W3kYxJnF!zLa%2qeT*815;#8e3bmRmKIOk-M&um`2J zIMD+^G+a6i{-vpE9~&`wSQhS-6Gf}S?5AwF#!XmUYI|uRf#iu(bdiExxF-t&#g-Zw zHTe8zU62ibvL)bUXzFrrh~Fy7zSw4Ju~UTKTRpyyYHY05x#-TX&?-!YIESL)0vm)} z%2XGr3MNS*p~zw|KZxT7&j&70@Zu*z#S5%QM2Xv-58yZ@<pie7$P&-VeA%mwF`n4j zJNnI){kczF=bx*xANof9UAlA8QNMo#=%A}enC)RjU|lh@4pVv7;IM5XvyxOr%CV2Q zWWO;wdOKLHBpczhv8bvL97D*`JQ3sz<tR*+S!El$ZVE-&P@|J8T{`R@W3<F{(io~L z4K{l3VZi8hk2OL`Ix4$ByKNiKU&_iP&plT4G*HxB%1}zpLIQAm{><{fTZ&g(*YTGQ zlb<IProw%k2CvqKejCboUB{@}T6M}cG&~1BX4W2*K5#iawuqcze?nUK91~4ygE}P# zZZ&IQ%}z00Gyo@>qNx-o3x$-iV$2*iCMUey5vd>(i+M|jUq0d0{Syg+Y0nFUsnv~8 z<!)(7Y<(ee&KLBuAZh8n`)`*`vgTw7guJ4DwAVh6#<8@E0qetyGHPE0rB5V<llQ&p zs1&P~+aWjhx{Uoa#;{F9;`ZUL3C$=oQ6v^c*k<BK8sgi58M%u)62)*G=kB`})vA6l z{8O~J)w%~nP(ts*#&2iGmI(rlY6fGlwln3V6wF+Y((Hx!O<_F7dHl9XbVjp%BA=Vr zBT|6`6m0Hca%p&h&Y{0<N}l8QN`qn1&66yL==AQSLZkufCj+w*x3Pzqt72z2MmyI$ zV7GHcM3`V(CP*cK3P+($3*-`-6PP&)UszjsMbu)^I_Sk1%_%oYzY#E*IupNLI*WLe zV%qE*`?8H+$YM(|m6#vEkWtWYT4x;kS)sg;5pMW5+4IlO5O2pV7TLriSv*6^Ir*cb zp$5ZAR@X3hY{ROP87(E|60UYsh&=m5PPavlQyLN?#fhclRAM5QkpoPscy^5Yg*tUD zEQo+O$tSiS7fb4<7%Xf@w?U<a?Oj#eGaVk$($WYl?vrUtDhu>VnNRo<>6P=4Re#;> zs5Ec~rtC3&evk;suV~+1+SZ%x6?;i5j9~_$vtBg=8)8XNNO_*X01g)PHV>AD*N{I; zxc*YF6xpZvJev$^x}ZM>C97yNu_5U=A3+qY<$;wJNU-cSf&qG#zv(mMrBxyyIg*S! z(wqG_(_4}3aa=mzit)1jaAAH-E#%jR7jT^$E6Ew8o6?_7#TFGrrPPE$aIH^ciGYIA z!_<gjeVR5_uZt4-hZ*Q<XF*(zF#Pg~RwCN9`g@18Ukpw|3!;t88mw{hRv?+kRF7|j z{azN(Z%+O!`%}_HYh3#fpcyb%tKg}(t<C~1Q?Kj%ss<}dZ=)PsHNI1uxXv7p!Pe;D z6_OWY(W*)@u-z{9dZuauFA%6oh*JR?55kZ;YtpugB1eoMol@;J4b6aU&88j*oi(MJ z#7m;CP;}77G;E*SHy%T!I=qru%($CjsJZ`H=P$HbN?Ap+Fcq#GJy->Tl<^&jOa5Z< zuh;LBP;{L0%Glw+pt#0J5TJQX=&2tGBy=&w*5qd-4yk>VqzQ<nts{>+zvow$hf~CS zBYpr73wsQ|(`1U%?Xy1zmES67WSEvW*0%D442Dy!ZUVM3kCD|#iol`h7X(}w)^^Gk zy9J~}jMa9_{)?!-l$kX|3I;EF>oa;9GU2Q1J&PV9yypkJo$%M%_J^xmstrBfQJvW~ z%vJfKtK=F0Eb&!+U$iM~1X-@-hZw}QFKoeV{oklZ#p@T|5LV3uae5BE+Q9J*YVifX zK!a1H7qJJ%L)5-t3CrI(lH){3^8Ca9>bT2BSdipFe~wjR)#vS7{_6ja`dwHoYX9%= z+r%y2R>SB0_XiqRH#ntiI9u~yT))9^UJ%~;ul?@+0sw*0$AwA|h|~Yo8M8l?DS^#g z{=Ye@_WyS?yIv21F1Wg%Nk-W$(#j=qQD_3D4WZ&1;9=V9UHd~I-c3w~J;}^I!oQ{M zt?){dy+_@REBqw{nmu@iWz_R+8D}#s7<{&RYae**K`}Lsc(!u6d2_Lo38Uq6czK?w zTclt}5TS>kkh`7i3W}We2?Itj!}4mwRu~~m7r$_PZ=s_Gc}}5UFcSAlZpJ*1{4K6) zQFNpd?TWfT<f|~BkQ;!V^j;h5by0C&>^C5q4}!(1$L<`-wdneF!=*T0T{7dYQ<dTg zQxpVtvpr_BGqma(zW9cts9HM}$la@YB6cq2mz@g#r?{>X`%@;!v<L#_Hbr4l%|YIb zX2_Mp9^H);rDfbI^fB?3R3n3}K@~>%56&w%jJ_OMDu-#|Vy&NFuIh7<D(&(!!8S|% zntJyH_aO>fpX8woE*a}vCuNjK(kPWT$>?c>xq2NrC^__+aKCE}$yQ-G(G(<fYY{9X zF5Y-S9rr3HI*6kY%~VwHeEpQ3?)+povmo0o<()WkT{~^6^HhxzeP-CkDXu8la@E+G zQ*)T%k=n+JPL9dKY?gyj2I3JiOn+$kl*JJZyA^rIjLO~0ayUgk&(%+{RYlHOcGo3H z7k@#`4=T`nrx}fp-A084HyafV{xNoh67eVsG%Lhj7k%N^`vPFs7>|T5X{jwI=PCw$ zibZ|Y7WQrF*Fn;2y;r&%c6xr@D2K)2*IbxeL$$10i=XPO?JJu_4_-|Igf+Fo5#i%P z<aZA9Sy%B-od{pMAu4D|G`EGZeg$SZegMnNh-=diJ~Aj5+dFcEkxlmdo>rbp!w<dp z^zWtg&uT^`w;lp+FQGxp+oX|ie+4TihSrWmS)<!$>;9oNLXQM%f<nl6D_%4$y}Vbr z)i6MIm0=yQ&VbCu*H`XDcDxGkJP&lbDm;QJ23=7tE$bMEhcYn~V{`3m2Qw_6-YTQE zl+JWSoepEZsXR%``63@5btdhh+;!^>GNBy6M&gXxQ=Nq6Q0~Jh*j$_uP0Ybgy8a&O z9x_O*|3SC<i#xc;J*)?Sz2k^k{taXVeyFZ3&TEkJoRlD*VEH$y9p=$_O0;2ql!{^q z#fT#o(fa#RHmh!N)`Ozx-dovwG>LfUYIv&ujkvjN7&<(9e&D<S@hpk5c&D$Gv!rb1 zO=TJI!AJ`DZexg_;c!zl<eTTz4YSTpHCulRr;E>-=i?)1U2%sot}Aw6qBG9H=xRIh zbDE2$Mq3oV%e0F{)OiVpS3exmypB}w<4m?4)Ufv>>zeGHv27idsWZC`f<|j^73?gv zpT(a3!WFNKLQKZ9Bb*csmwz9m2RO*`0BLnid1c$#&;>nM$7m58{O2sDFcnQJ5VQM^ zuiNs|lpK1}z7iY~`^$sejCA)(+d1@m05#doStY6DD-nb(aMxaNcwV&VYP*YRT1{A% zrQW&ZflCO)<V?GDMiTDrV3a!foD5DG=%9d{zfxASJFg&mB<ES`On+UH(Q+ka`r4_V zg}S;Z#o!uw=In^L{qrgkCrXn$5wEQTp8r`G-QB_cby*YcCk}jFdOg-OL~p1bV@1Z7 z7M!Wr3P+~*EX@eKz{B^lXcrjs=q*{|d6_(3%wah=RjK5rj+%{x;M>s!jKeNS<xYJX z_2f8OovTKVrloS;wdJS>+b~7U@Th#0$_|It&Y<;|`JHADY_u~FSZ9dsPkO`eToSRT zM-6&=B+d4Ry%BtmBO>-Q+&bHrThY2~>KKrux-Hh#U59psV~(tH6{ZbWstr`HYyGO? z0>FapT|MI{3){J!Q#X@(z4eK=+pm+c-(TrH(z&50Ud+B201dpeK7cE7+3z5cZmA<Q z%CgDE?^Ov(5oS0(*ZzAd4X2E^tBj~)%lj-^CsDeM;z+|90!*KlRPLZekLHfyWQbRm zcSO!+DOKq(sefBK%@&*oFSVaou48&d@50x!>d`d`<%@3N2cZimG5k%YQ5F?XrG~v6 z%ojwe--98}7?}V=TWZV8Cx)Z#cxz1?uDt<LlkA<3+{fTfgSR0^GE4*9nKct7X)mpe z@g?sNDK5-RM^QrEVc&RH0U&SYe64-TFd(=&|Dlfm^*V|}T(j=keyRS#QHF_UBhkk+ z$BQ!I_-WG<2ERQ8zSj@H_wKi%Q86%_%vtN4-ZgT=`nK;#T-Io97;@uZ{Tc?i?>3CH z+`ZHprya-rM(#iU{m>HEh0~!vdc=aS^quivEzVzXYOTZ3D;MT4Y@+{i(eIPqoYZ^t zmTtcLt<Pvsu$jcOqMb`5%fVeFO4aqfVzhAR9BljBH#)R+|GdmG0-tI4J}z$&DjAfZ z?6uC8#@{Cbw*BRJB4@>~4PxzK_S0+Y4qtI`1MP-#H1YnhuGZIS+g^IHLHzlT!*cC) z>GFV$jas36j*Z-PP;^;akPNnMvDk4qe$gh8QhN<f;m&DV2W0Caio=8TvIg*$w(X27 z<|5}SU&g7m*WeWPmj;8Hc?E9Xu@Ze+dk<{;|26R(3$Rp+QiL1W|KAe0msykE_2Z<+ z><93S3Zm(6B>F~mxlvmhu|az%eV5fZ)*_nu{JD;D(jAs?v;&e{G4iR1uh&o<lCw`o zogpq~_B!fxf$#5rSHp<}*CFx#8`aL~S}#9cALRX~`?eUI*5rrm-{mJleGaz$pM^X) z^uYQo4cXyn&AkQa>RQ@^zpdW-d(Xu>$_8Dd_cyam8xD@l$D#iGZryI0F6XSpMcnC9 zA(ekPmfO-MkT6rVTf-l5k&;m>=%z!kRHvcHFYO}+*VHjV3MEX3vT$zvKbmbe=NuLr z5E?pr4|X5ivv=bMe?N>KF<6H=moivmizaad{2WzEbf(Qt951&^d!8!M3T%I88yWtT z4t4>6G3*!W`JbxWv^_K`e(yq}^M{u0nX;dx$WkeN^#D^Ss6W;m7N*)Jhe5uJ3NVjF z#@aJe9E__3eaRSHsqxQ%Zqi+&^p@Uy*hXaSolg6hjkY*sUfx?P!Ju!#VMIa%IJ*YA zRzPoUF?l=t9O|RE)6R#m$e)u<8>C>G;jE1M!$_6i%K=Ef$~9Di+Pkhxyk1dWcDH+M zKpp&BpHM5G#JuJ|cJ|R(0|i*YYBVS2d(<9%6i5$37J<hIQBn2Goc@cPiL_LspABJ~ z9Z=#SLJptx3Vu}W14?`wCvur%O{J!RGm4JGM_z1yEw3*y`nl++d47}`VD!sjp7wNZ zi9rqAecpep_qls|m)hT4?MAjeqAMc<0`Ay!^l)TI#@<we;eKI3+Fs%6?auIhIJ^5l zcG0@Ozo}fXkJWnrG8}gkl1l73_g}xQh%!58;#1IPN_}TiWvMwRRC`qSEFW@!*Ev$s z7Hc+>2ICzg(x4Y3;Sq3VN?}c98<SXGT??KBeO<XWB^n=k&YAdi4QyMMqT0abd~se< zPF1a6Fn;7MiAA#jc1@1fLEq1CoY5tV@LH3zphyD~+-|kYo2$Ly!RB^{X|&gOqic@p z%G$u{i=vQXow`ZY#M)-z>hxj9NJnxUG+wT(4w;5K+qWad++>IO^1$4<5=$5AI%@Qb z!*fu4izEs>b5!9FO?Y}+BmF|Vp!11;SetJq3~E*UXJ01|<(l0Y8l;`in(s3kNwqJK zY?y!G$Y#Y6C^oLdsUexAZ8oiPi){Q!U%cZ^@+~nCEq{1i6L@0$T@v|(X!m8h$B;2P zEAr)5VZ6axa9{t*`RVF&1VFSg5}<I=D9!GhuV2S!cS8&b%SIffcvXkiAy=1Z6-$|5 z{VE`}x_9@My2Jb`4;1ubheQ3d_%7SYC*5x@gIWfj)h&8frjx5tP4uDmN^>V?#vX<X zY%EY)&D?2ax4dXQWgH68>EYoyS3G~?GgRr;bl&fKqGZXxEcijz14eHIW_Ba)Vl2%? zIv2D86%~<-O~SU1C;t+NBwKUxDMwv=5@z;EDvK$D!$S=cMi=bCrkDW3q3cE~$ZMgd z+&X!bePzT?jLsQZlx2IXrqNqqwET(d#+0m=mB{HK9_@9H{<kYYudIpMrpQ_=s4Osg zl*|ULQ$zH6Dfbyyy>tFS<N(DmiW)svTVx&zW>rC3vv&wSFm^${D@C|E*qNpW4<_`Q zq6rDp!9mke6~W`x=Xz}Rg~}rvrK|gKMp}2`zv^GE>ppomPD)}iUFIGdxy0RZm9PgL z<a*3f`y4N`bHV<$Z~gu23x$q2FV|VUN?a1E!qvz1#u?6IoEJ=T4mF;R5|-g=FrlY@ z^1D!CNIO}&wfR4bcL$*gik*#g4!Y3ZH+H6)k>Lt4&DMI(-g|?@f)aq+J*Ia-wsSL$ z%kp}rQ)J)jRZyvS;f6GGOt{)T|DYQ!^D;8~rYrd=){gD$?P<|FzO&_@TVSrW6t{}| zw^hIEq3z{A^zh7-*`;R6evJgFk#yQ~TAtfa>Lc%ZVjuj}XLeMxJ9WiiOy`%R=nKbZ z-k9|j7$Kh=71ZV8s=q)cr$}F?;{~Y%r{5yN7?biPy^hBDy|+Ninu|W1u}vDu)qLI5 zsK1Fi2mLV}>){uNZRQJ-o~d))Ewz)Wj#;q%@TZnL4&#SNX*}!gp=?)CgKqhwO1;wC zQp{cO$lTa8av5|T%&^kH6;3r(Zp7N1bMfYwXKpMCO6#5-YXr>bzWdZHH?TcOukIgs z;QC$r$>gD52?<dVX_VdYj&0@kPuzvIG;S`7#~gZTs6<Sbo9ZLq^P6*4dDMRWE-!Pt z!hU!}e|fO<A*@~0R&AC7-7_D(!}6qkZTMtlZFJq%uHRSZZ4~SWG+*v`)5YG?_OcOW zUpvhRYO=1HKU(vFTI{DQ29;#E_Gcja7;Pxvsf4<Eh!ALK_A~`>RqH*v2<CXSr{nRh zy;pP}IvU&BC8mc73wVyJ<6W@W@>rL1>UcImpEK6V@z9`MW@H)autVq)i7YbCKWchS zVDSyWQ6@jMPAcZKG{YSi&OG~`?F4KS_dNiSVK+GG`u(^Mck(aU+`Lm27^6Jrook-~ zmcj2RikELt%G&rn`s-SU`tCbgXQUbxlw^1z-%y9D;knC-9Ya3PC^jR;yT(wz?|ZPE zZC(UF3~sOudBEqJ5L(5jZvc1ELCM_C=t$i@QMAhD-d=;@DvFAq85zwgX+l;#tI!D> zPr$9k5#wg+s^f4WkzxryiSwaHEPm995;+rOGSK9wZK53?yMVsre}}t9T{)wYMcolY z@3XP$<+kxuElhrJ+?WE_4S{HZ@{AtlJ5)qgWB~nZ5bZi^-Qk5(3s_@&Riy7y+e9Hn zqfV+08_L^T-S&vBCps4ALN<158$Ub#af5Lby#=rtmz1yH-nw&K-O$jEIRG{WdHI8& z_h@h40BGl!v8<y$;@HU;@O19BmOMX!RS7?IxYa5ZL^{f~p|cqaIH^#CHCO<*o8y!6 zSE9~NlG~SL?E?j+ZLMTkUB<hE;ReGfVSVh0?rzB8CEqsZ`FVTa;wVvcFtl*<7%I~~ z7_xeZ_#fN~jz@cQxVC}&tPVsm0V~0D_(;NSK)$_u++rE{tHcu{f5Z-2+`Z?M?mP^J z?`kpL&;P5(Q*94RS4L^k@uw2XGx#?gzYRh&ZJ*rF{=oj%25E$c8-zY}ytCHp7C6mk z8`upWM-=}KfBpr%|7d)4i<IfUkn1?Q7d)C?t&N$qi2uKKu^b~iu<(4@|L%Di(SL#9 zxYD=te>bAvH7xE=(@p$3U!&yEz^|f8H2zl<a_fJTXY!igHDcGYe?=spYROKse}_Qd zXahC3Kh*od;y8<YnJF;k2nl4@zyRbT440f;xA5&W9pBZpC;vO*`42wl-O)-PT#}c& z7PR$aWdFCTo&}@^JzHY85%S{#NRI-)SOWWp2Jc$-JKX*k(C_YmNQA317ropo;LwiT ziCy@fBHwFL#6mc9=B?S>W09W4k07Yfp#`rw^X#pYF*uMdw}9yG=%=8O9@^}g{x8V> zsYd;K&lzf$J4xkA5MHW^801B;>en=F{$tJ^pMjY1RBR{$0@Ip(Eu!B2cLTX%KiRPo z1ajZbqRA){DSm8U>~<b`sHTVM(0R8W{91tiTr=-Taf}JUl|KGhC%5U3srY`Sb^V9I zEg1`*9dr*QZcK>)4|Xp1`*d|xrVBysw<<lA32w%O6iWe^^_d}Ad0PY#Ea#qY#T{!9 zzko{qCD8C3Cm7m^s=OiQOm#*LMh+?G5k>Dma6$*f%Cq2k#EJ~<S}pI<rfsg<o-qWc zSFu+ug;dxkf?q>X1-+_qzcyl*$_0yEsj6w`xyV+^z)&_<Iy9G{SwO))hW`pA-r7&X zM7ppJTGfWq+awUHw~gi4lX7-M6BlbGA-~)OnilA``8H-5?$-{@y6a^e(d!hq*mh0X zD>?0e?DA2WPVX#X39w5JZo}B{AnoG0*)H&bm%95QB^4w0DV=tG4t!RZ|Df;=QFST9 zP@^;K-wh#aYsbfC*Z9l$#sCsRpb(tViaZyi4VvZ=+c%oJqP%GA0vh5O{mbG0i0l9l zjcoqS?)}!%c=|t1kgMlqFNRwSZzS3GtKCdfU#RywTm>!NgF*enEpq(_RS|?xL4F{u zxswCL7dJbqYs}S2H(nau34s{dCj{9XOVWz)fIG%uINL1ZJTX1lAvD)gl|)~|A#yL} zE2O)YaQ<m947BI3GS(M{U+FMUWrE)wumN~Z9aENd$ZHY=0nT7pQ19)G&cjrkyTI&( z4VY)+X7cA}C8<F!GOCW+(dif?B7&<5lm8AMfU6$?b4+yK7jA9vb%^F7>d+4OdoFR2 z1ez;L?%T^0$G+hpb1OEWy-vx^*j%ljyonjU)F|)W2@QB#!e}2GmD@iDb99HU(#~ph zdOMU;efsZu9kojT$HeH@9km;A&yUS*4udiMZ+7;4VHWmb?QR!}9eoF>ulH`%qLlQm zhwRv^rAN_o`9E2PLMZY!Wd7>jiKW9bM3@HKnXHzhW(GTT2Vm!JQ$s?SeOyI>d?aeX z1#g)Df7pBTsHU$iepKtNRI5^FWvsQ<QmT|<WQJO*+=_~dia>xWEvR9RVIHg~I03Z| zATl@<QGp;*hA@f@aUet#2r>!?L1u`|)7$5KlaL_v-uruRt+(D<&p%ut-|zRFy+8Z2 z_dee<>?qDj4vy5cp?;-3FZK2y|1Iz_|1B`_Jsg>i=dJhcUGEB;oeXtXBsM2pOg>~? zA>Hs?HEoW3IysY(ZP%7iyVWx5X=ke8=#9DeKZhvRq~o}xK0sq}JEL8v2zDu{yJbt3 zIi;SK|8iH2(t_`aWOZT%O3<N~{i_O0Co0FUmL+mFt(Q7nskXbTRr|E3-KO$Q*L%j_ z+;H;P!@E-xFixuecVIUShV?~y{KVOwGuxJ|m9SCnlHb6e66}?YUY$dYE3&UHiVRo@ zn=a}#l%2-kP=+g%Ba|D5Oh0WR2IlQc1yqc7cu_aj>FO%!-J&NM_Q(nwvHe2qSJ%$J zsp)d(sd+7x&3>9~TKDogx9#6xyk|ade%;}v1G~+*oJF9JtoI3$Q_go!M1#no6`QN) zT7DX#9J^+7Px79e4P&&4EscNc?sENBpV{%rfP6;R(miwBeg@&ap5%Jwz45+rc#yGt zbHLh(v^Pg0l&!L5U*+oFSVh@x`B`;vDVKJ%d`KJ3%{|Z+yin||y)p7tH`;7GP<5DK zUerpTyGyEFdUDwt22xM!w*`Cep0gk3PW*c1)pmO8RK4nIclYT2J=jun-}>rKo$hy0 z&tLU_$`mFWn79ag{MO&Bot9Rk!&uW?sNZ*zk(>DK(J)!n6M18Sr3?F`dee6<{3XjI zQi_u}+pAkk&7(+5j~!n@En_d_L@3*gxA2bKaCy?=ecx{b-|1%ykcI&#?7rwA5H6~% zmh-;Vp!=D|xN)VvLpb}`U_w}@bYV$CoSzg*L_?C{U+F|Csg0)dlG40%7M0DjZ`18& z9CU3fj~jcuhCetu@;kiY+;JML)T|6o9}KvzUlmk-FzcXRQDAWEX{xLhlk|8?<NKCx zYA=qRt{7ih>v#9s2%b3t_wP`iSEnQw-o_g^KR))R1~#C`CB5n4u`hNfcBUTH>Q0La zPv9mw>11ntl~Z@K(x%GHQ#XS}xJQ3Ie`*s(oi$;P3_V_6+PKZBmsAu~7k57UcNgBx z8a;N3{H8M_s_g#eN{+6tpZDucnheW|Fd{R|3$qqYkBfg^n98#=PN-uSb~?;5q@0n> zDbD$plaNsX9^Q7Hmc3>r_koj#Tiv3G1v}m9WK{ZBf&)P5p9pVqR;v0UR$|4(@<%JV zV{c?m1&+TNd(%WErD?lGxpfC`mK?ADZ7^JGy-uA2Z(;L!hD5Uev0!<dz-1EzrHllW zYIXNp<cQ?!_VQmNnsa3@y>wJLY1evgm;ITK8_)aB@~}{}eR<DfH<cLOJDpzmrXuq< zcwgy<G5+`T&Z_-HE{OR|C-w7{ANZVi=9YlAAHkQ})vqmiU?|#^xoh+0T?TM6Xbfho zKFc1Gwoke-TMO2;_D-GSgZaUjfBi5Y=3gn_34+NR+CB>y9@M$kdFvm79ivqnjvbp7 z^V8}hvqDZ1QG4o~^dl)D{n1zpjqULqM)d3joKOFG8r%IIOz?bpWL93~KhGUMGZ2ir zr<+-woU8susa&nbpy>Die^MK!VgBEk^FKA#@cEgmXrYqW-jnZsL3vZu=l=McdMlCd zXSFZ?V1L8^CpRWQN}2rE4%;NIr8%`}6;^lagdB_@_h}!{PtKH982Nh7tEI8mlCqB# zXf3z2IT!N_ZQt{Zi&Xhr$64e)&Yc44ue5!N&G!a1l-Z|s?YlPY84l&B>1SJ?9WIm_ z`TFN~Rw={L>^<*>*HGHmszwLDZVmB~+0KzPv65#T?Fr@FdCz-t>^^-Ud@wA!HI_b5 z*~47TTQ<r#<Ni%{@iN2Q*1K0-*K&1!dKaeN7JHy*VHfpm+0*@XR;W{jQ#9w&O@~R; za^v_=>00iR*h{h5%+|XHii~<_+c`!1eeF!O^g)lq_HI!Ial7cla<R8fYXiw6-IwV| zB@?+`LBChKnbi$FdYX6lTvvp>i`Tky9vzN6m!MK$^g!c&llJ;-Yx-~^Ap<miIPz29 z>RJj@-lnMj++Oa#lfRX8-{r;H+qa+NX>eJmnN)l+!Q__Cj@$2H;e$R$&gRJPq{x`c z0Ho%+R_W+2y`$w?O10Dm%GLV`=|n?Ddp11Ro9wdY2}5#Ex^?mJ{pGxUUJ(kBC(HJ1 z=-Nj2c5^PfAZv5h%HsM<uC|SL*+Z?j>OCZ@$dlseZ+kbgJ8VVp>dJgo2kNOUbJUiO zuRMr=5s_Wc<x(Dbu(7{($p$%I<z*fHaYiFj7+dhjYR&c0?8RJJnArKXV<I)aXM#cM zzj*y6)3z^JvI}}PC^I(i+E5?N$nP29HJ}IY4c~9eS{B{u_r%0f6q$~}#tZJTm(wJp z*%!<9nd65`Rkzm#yu7Sq?Q5|;Vy$J;Ph)?O`e(oRCfoh`TCl_F5~c3|m8F(R`@GBg zYL`R@y9ZL=Qm)>0xSTB+4Fnq4Hdw9D6MC60`RYyeoLP@*zaE>|Y>{Uh9N`+_$?u`O zLjULO@=0YJolI^%=iB|3w5-%qy3I?NUF`EB7BSUoPVV8}%^&Jz%Mwo_mTuTP>~wI% zY3>O%zDOTGu)OLy*c6w3)u7|{m(juMT1xBsjnjReNR6EEeoRH{1GA1rzaP2(vTxvr zcf7-W2D*!)+obPP7^OPf_YQ}Sxhv3uyjV;6^gu3q=v4a_GuQbnGoSNTSz^}L!49>} zpZLvnoV|T4n3L2$acW3@Oxe>b98ImkKhs|wy4XVt-mC(%$OpXao4x%Jb@{9t-d?=T z`m12!cF(YH=4f!%A~zZ0elXi17W>d(5t6I?F~J4A1}(Tg>z6t3@CvBv5vA)kvKtyf zU2QwqXgN-$<@R^0SxUNvx1FHk%}cY)9(yjiyRa@(c0OhN8~>DmL#UGAk!2QlZT)n+ zC|Yy1imM(JHX?Ak5=y;~M7-qI>^6T+X_pK#Y0QkJH<9`|--qAUIM|rUt3XTh=ewn> zJ-6%5Jy6%>$CNqtNYx>)n^kvj=Pyum>DS)^Ew7ILSnHoW5%Z)`D=0#~xMXu&PtuL_ z`bP3$-{`iGTkjJKiw)>wrm|({kOMC1GuShnX4OaSc#gsV@~^v==Uy_UG?f_r6cjTM zVM~<?Uby!}URpvLIH9Wq(P^-vH#Ck}$&FyTc)EorNN5$)9;sK(^{q7k!F*X`xyvcx zu4TzuZ)ce`Tu;?`e8)j8==7F3tN!fC`P^XQ;oFtHE^$3-vG#*%Ar+SQ!0+OV_naM$ z{@Ob(k@qJh2Sp%6;h)BqoZ^1Labh03S{VZI6#JO^YK@h(;FfpX=Kte;>$<sL@TK4S z&MGh>Bz$B)3K+QE0|4$_deh4hMVh>6%zO8NgWhrhb``x&&B{4Ha!*qKmQCbE@|1TA zAJ}_Yr}N+#dE}wS{pHjX8+uq~TjO3!XVe71mZ!P#<6nI3U7hW7&-)&3(>!NcbTG-q z!nuPpiRwqb8~<yi1mV}}+jvUb-<wgkFw*)MVzIJnCVSn1^~Pg+TS6g(3PL^(;D;?# z#>x2vNb5df7ld)wakArr1h@gZ)rrH5{@*68DuPRN|C;R_C6O=qKrI=hF6QAN4BT;I zwsI>&%J#&EqOh<h=U?MwH^TzXwFZTQz$Zq%>@PdLcn6g6MA5YszKbspf4m~r<d`Ky zWZVSzOP7t#vaWH~0F;1i7#5T_C|j7nx<8pT>~t7-%`<gy4^qlah-jeB;~cYfKWd({ zx!He!k>C3EzQd8MCiU!p<+z+<uOnZ-O^<(7DNJ%V`>q-?>b*B6YABF6`9VfZDQeyb z`7q77OzCvc)80Q~8rpXBEJI)k(z$^Z^G+jAm|plAgnX{Gk`ft0@PLoYG+#Z6IzIzM zNCZY}@WsZo4U^_8UnX%-x-N771(F*a#j(ks=;n-{|D`45>VP1T#fO4~`I(zX$AYoZ zEl-x4=`>-*|0*Rf)!ZdZAyU1<p1LP{IORv}Q0BTbxa9BJUKz`imYN0JCG@h2-s*Hc ziWPxu@vx~bC*%!hSC7JlvXY97dhNm&l?n(yx?yfJg+<1X#e8=_->S=hV3i&vW^l=9 zrGm~%v)DeW_dFlFBFaxpn@MXl-^En@z!=;wnNDVMy_1^o2Od5O$9G%}5RQ>>q_ML2 zRFC`Ea~fI;%))%)R4wup<=j7!VbO!l{2Zjxtvjk5^}M1onr0VKUWj{D+S0Zm${EvO zd#R*}=_G1o+xT*J-@3tM<%GquQG8Mv9*PSptX<fp>|f3w^C{?jd_94Lu;?HME2kVl zIITGhIPDu9T^4l`HqtXNoSt{+WopgJhj}wx@poN(UAG{nfg3Zp%r?8c2=}bSs`h^E z6@RVGpqs+=xR97E<*Ay<gyY-=V6);rg$n+)m_hR6WGOR?bjfKw;Wyikm+2|H1V*P1 z`wNNl_P%Z*acz?2gjei6M*lsCEk>M|-hc)UJ~rnJw^F`k_W(Rp?ZOJvz%1!ns|E29 z4M@;otN`sqG8C4Tfm9dy`$T>45SB2~%=L&Je>`ep*~T5lY&xB&!B<S0?~&zD{uN-` z+#G!^LrDzZ#!%)NR#byg56{SJ{$@)`Girj-c`f}wW2m%VC%35Y-rx}5C^g+Wrz<MM z={?I-{j1s6+9n@Luh-sY>!ZMNqf5s$@93HO2!powpmUL_3e*}lIs;lo-lLF$7|L&b zipf#uqM-K&LvRt>V3ieI8d?=oUg(7=FlliJKykMdUGqj14$}@35vid3*cjnagd<Mk zx!%}YuWbXyQ~5)qGrcYtQLLtTCCBPQJTR*8j}djM_cuO1=Lm;Y&75<&kQlJI%}taa zXXGp^EI-x`Q2b=uv22R;G<IpS6jN)P?f8@{g_)bE1HbW-t?AOWF`t>4J)1^-@PflU z14g0QkdW%j<n!1jd8FEB%x<dl(5f&S^?=}dZd|>TLzC5@I>T!LD=9n=uHA7v+T8iP znX>bo;IgP`yyqt-8&#{&;tQ3h+6^09&dL@p$v2i(h8h;I4SR%cK)48jmd<iraHn68 z3J@Iv-H8raWYtW=H7PFV2zUGtJh+&0nUZ-&*znIzCrI5w9{;Y?B*m;=<*aK%7v6EL z&3`~4zx=9mpq2dsMwAL?(urw#o);=c88l~QS4-gPUatkZHVZj!ir5TRM<SbKbo`@| z{3)4Nq-(Vk)fJ$ej7f35zpJ6`F5sr3YWe$BoAr6ljQX0T*NvV5u7M<Ne^yB*86Hz9 zFi@dcib5>JP`n?4teDBHcT$E<R!_#l86xmt3u_i=8*z@wP^Z6`x@*2ckO{~SJVSyB zX>_Rp>`F;1G{YjoUr47#59Urr+-`OA#(4A`=I5lrr}E)WrvdL<u47)t`pq$5fGg4z zj|JCnyECfq79hRjtF2NgX7f~=i<F(yp}WK@p6xDniuHxz>f3f9s8XDRYv^{2YPBXK zZiw|WpAHwh=S|x-(0dNp$GyX1*}DzoH(z!ROm#+`tS?}`(0Z;eW)XyxP$O|xUu)n; zBCydvSxg{C_oCe&)n&34!$jQbe4jT)07CV_SGddS?#{C;g(mQc!Z5kK<|7sxRh`|B z-f4dh9|a1M(h~0=1*@I~?xi~|1Qp~m%&StIZ(pX6{iG@BOnXjBeD&8&Qk*x1VV#Lp z$##mWhb_VsMw0Qz?TkV}3jono0t98KF4=^2=L0;99TYP!nmk3mYY$WYWi$}&ewCUw zNj`xQQjP~w9IbW^RCH7xcszT1{q<D!$1v$QXF@OX)y&2MT|)VmnMtjiiA`bEPu^jz z?2p(ozETBaBTb~G%;--Sc15qQN+`UV>M|n?@u#Gz&8raQsw<vpyJVzXakMg+q{q7I zRlN$-@?S7L1msDZt6F{>k;ja&=NXBf8%V0bT$A|vH1Ss1y<ik3Dmc^MS9QQXKXa4S z2#l-B?SWkg7}ZTF<V(``=uUR_aUD{e=56;W<m=LujKXBb#a8&cuo7KzQ`%{pGah=3 zx;BO|s;KsSn~E56DrRdTH$JrdfE7}r`298KGJbhYOq$yr(ODiST@&~mAF4@wnuZp7 z86D-X+uaA{d&3Em`4?WLIE#tXZ4p-CGp1Z7&>^jml!0~Froc&CuDaK}u@ccRwSmwP zcyyo|o^i~P;<SsZ{fYqgMTPTD`?myr2$aB9Qs5a212=Hq`VYLk&|z%#oW!^&djDVP z09+zO$vXmd65tfAn}c~Wt*bWsbxoRkhGy67I#dz9#N0lc`rPii|HK+YS|EjLWyeX| zOh|dKibQ7th0b<x<c;j?aid^w`+~rI=pG>2hIB$RF!fgA8K7cn3rLk8blds^U8mZU z5Hkgty4GN6Rf6uF%Ibe3A%Lyb=LkAr)lcjlY_<#f&c)?p#}g!Xw$Jw?kq*9n2^n9c z$+I)&S4{j7!&jJ`L_7twGIPrFJbIY9hyM+<V|ILP8HxTHNspxst2x*pmD-6w$2Xlv z1Z!72=7Mfx1%ido6G{WN_9cYUK(F{T5p!mSeB~k|Ft7lIuo|R=qd@AKSvqMSso4(t zFRY&j%$XKEk#^b(mvGz+?Z0&jq_|j}rDU#Gy^1)Lm`|#`ByB)$#A0_n<$Rvfb)XtF zz_h8pg%oEYdH=IfuzUhE)`4d&+C3kI-a;Svc_Tm7!Drm0sF$&dJ{?^jGo>FH`|4Mm z9>MHD$Ph?i<F2SdWOw?z0VGbdMq+w8gT#O)h^fs0i2?0(^qxpUOsrS-+(hrxX&)%Z zsQoWpRLa~~hVtfx2&mk}@VuSzE+b=g!mLHUZ$kb9Vg$rHXuuKz;ydYJR{~<lJQ!Co zi2rAsh(AESE^x%Wx!phTIG;#oAJTLCC{cb8;AbIQ54?pZ_#pO@&U9ofR~46OMNMd{ zRM*o$F!OnPkQ^SsM25ROKYU=4Ct!dXdk`U(Kx<C(tY|!XYmb{Pb95Yjb;Z7JLG}_; zUwOALKwRiukuNUvz8u?pviA+?%4LY9(AbKaRn)+NRzk)?a$^>{1l&>PxFzs8AQa!( z>OS&!Od51o0YMtj7c<4paPk47NBqDo)Qyk=-lP*FIXutNRL=yd$J~Vtyeh8w7zG9r z5E{h9!YC5XgF0v_45efmBdp=BW~r_+1aO=EDV<FYh6rXe*R}6&x{Dwza@z-Xn3PL< zNU9>cSq8!;YU4O42!1T+gwy^?EoW8Fef{O53NOd2j)n}}3+nMsIG>ijq}R48Q}=Yb z)N6L$$KFwn?cwYSmq#xcMXo;HXy#Qj<D;~12{W9xzrZN;q#@{TNn6o-EW8&U9s%g4 z6`y8RgzS=N2M-87O`0t}WAX5dOl`)bh4@m#t+9kLXGD#7w$f`!`R+{HN0r@oMmAUS ztm8M=F=$r(s%3IZym)r(*E);(Lt?gE3wiI*F8lW3wYDx^y?U2?aFWD(FSV2nzqXK@ zHFE?b;4@>7AQSO%$B3p&-;`ukT}s$uTSuV(G_WEiE1eK}aaD@3>W}hasq0k_SM|4U zYtiHNzujhA73qcWK!i)9;p@h#K*REyPrQ%RMpjR2`bk!F;$~Wb8`Ze;Sk}rC)pbf? z=f=wJ(Q_*t432z0T&aJ`_=~E{^Zre;r0vQ5nTzi;j2AZLRRyO;l%;$3u`<U}d(s_R zWyh)UHm3$W-}~&?$~xF|{<@Mw&MLWfimlnd4|3AdJ2Kt9+~{<AzD}TE>{Ki_@cdgu z7EkB3DR!8J1ELze2x#t@L?FvObbt`I`A}^JM(TQidoXsH79koI$Q}8ZA_~~o1fpij zCgE9c=~s~rOcl_BhItPX#Ba7dY2M`d`V&^otOJ)+J^I>rt85DQwSfIt%&;5!EF;d_ z_SDmj3bf)D<~we^7l#>GIljH^{8(S0DJN96%H@euO?_4IK}TQy;(?80zf4+@9^c3E zQ$PwN3o9>EpO69f%=@m3kP*Ij#RgQB<ke#H)oK-azDF@~tN8bk)o1LgVhOTL!*$|r z5t=j~qL*<UX<P47{$;W0XC==IYXcwWDQ;(movpu;?PFhYL*~dqe^!N`_5DK>|JJDc z+7FZ#Z+@)byh~lud+9*$35jE`$L(u0GR88Cw*<S|R?R+O%&cFlb%*C(5*xJ^4_S`P zV*k=2QHvc+%u=@rHX{y;eNR}>PcbUpE*K-^AlIxtES2A1b4y^`F2VO%|8=wUvXzTB zYmW3BoTD7b^S{@>a<krAR*7GudN6O>k&2@CZH8rX6(OHoFaDGsn)QY435kI<aW!>y z=X)wr*7|p{d+Y*OE$;*h{h<5yYCtveBV-67K7zGMko&9<8psv6>p;&u?)lsvOw76x zV(;)8xh<pjWk>uFp%BEQ{{PL)VBn+x#sSOxgVa}2K_v+e7Uvwc?>h3Vf2W}@iQagm zD!g*e$dY>Xcg%}cp*tVc<&HR($jDW><i8kG&+K?Gq$4SK#|+oD4{?7YV4jd+ayX2Z z2qfK*0r5rE*dje^t0a%+*c4r5_WnCd3G@YtPgYSiU;h(VAw0D|i?OddkGM&Nrc%3q zu4d3){Lp^=By2Xyey84lC2#2isYA0V$1FOPY>zA=Df_|ptwPv1RLngUSebq3zSF_B z(u$>CtoOOfF-zK2wb<G3G*ddx+#G4N|CC*}L*QZGy`R%n16W;GRH~_cDCp0Ohn!}e zK#}83MyVZ7kzq=%7}lh$$66Ze(5fQI?(h1`ar}HLyz(0gug%X4Qd8R@y4Ipwt_r&d z<Fk1RR-hnx)AEGubAyBPU-7C!R6k8vH9XvyH@CU0?nQEy)lL&%vQ2$hqJ*zs>Vz4? zRK8q;w5Vs~0?9n&y9agIiLu@+l>WvT>G2b-+~*oAm2cnc5WG8&{b44D0^}5uu@DWf zl7~v|Je`rbu324R?T0j`P-W(X{&q$GiF}GOSlXGf9O+II2VjME5hr&V+Wv`r(-1NH zJl(4`MH>;?Ozj5+0rsDb)PIODma5Vm;fnq{fDxYYQ#JSHDahrh^BVNu<fj=eMaMUa z-(4p*)i5VPhT4>sj@&N|{g;71v7_e=)SN>!Nk{+jKN&hTt>6oLPBFCwS-lhe*Ps*f zRkf=kQoarS_a8oWQjb1{(f;J)f=>?h{81*J>;Bz1h|y~?1r0F_V$z%y=~@L>23nsP zkr~U4BO9K1(wY?L)#nsJR8VS}F~F5qwS8%465p0^%Lc40q35K=lb>ePJzkc0v4EWc zumsZmOxd_LRs<b{(+D}tv5u4h9m6G%0W5k>vFqs-ZaQDmx6i2NNYb`vfHZkhJZnPu z+xgW}&C*63g|4zIpxybYkb<&i$3?jb`heX8-HA$gcI-_6J<}MqD{{vHvU+Cxrg|NU z3*eNw9t)C&1gYW6$hiW(z(5ePX-&XNx*}Mr-VXR+k|g?-5!pQfVGm9N4gGUBf~)*) zddvB5mN2PzE#IeG&$#vyYFZ2|nc4$kj!^*Rf07OGq!DU3yO{y8%G(jd{I5ix2A&Ae z2c9?+N(Q7}`KsE6Mc4XJZ-<Vflf_dmd{47@@{(qxV4g$jjTEE{Bt4TnO=thlOaGyK z)7wR$yP2m{;HDE@P?x1Pt)#}$sV&GZ^xy>iyfrB|(=RNw_?w7kI6@pU($xsR-si}1 z&8SlKtC9$+VY1#{YP>l+Q}eLypcTD3oo^VRK_@}oMGlHP)7W8{8T_vVY^J}yLS+DH z0ZiZ*nO=PhJq@?odLAw8xAap4O1ELCoe=sTwk>E#=(X0W<z(Y3Q>&jBHo@CB)!Ys} zo!Y-i>d34CmKn*bz@#Sosm9Im-{zFFH62PV%K!G3AyFmO9meH0pX;ig-)}dP?#{FI zO|*LEsI%><Ssi~x=c`2dQRV4KPw>Hx9u8iExHpqZ>LDlq0@&8@i!T;oiDR5M&lqIJ z*8f9?;<P`5u!RAM*Iron-6q{kjlTQuJe0fo-BrpPx}TNhCF{2xUikEUbNeAGhgy3# z&~lw-Q=08WuG9OGh0L|avjcc*4_>P1Pw?8&?)6hAb1QG8+b6JwdvNSG!3gckem~tZ zh#!DGIZ2W0jDk5`5xTajGEhmGkRlUGDbUH+(Nzc)A&Q*lXY0tIWO388WQOxRJ|19( zlq{I6O~@q-4rsyEjmGvRD2lM?;m?KL2uu!yNbG=lXWxbVtILe(EaB5;Zc=L(=K0;Z z%gS&{VV_^|F4y=QiJg_VX=@ig_38ZgoWWlkX)S4gJNRC4aFmf?x)t6V+mZI;pqKAT zQe5qu(Tbr@I++FT>N1Az-yZG@5lp0CN@8XOM+<2<oz13Ij{KP5FW?a32>c~*5TL|3 zg+ihLr4{Dt1y?9k5w=g)4W`B}r>07baRX4r{ZqrWwyP{QtyEfDeo!llGw^wyb?d=K z+D83kJ^!FKFE8#@%AfwcMN$QYP<I68FcPh|o8ce11A7`A)mcQMs{wEo`kYG{#Q zRqgD=Awv{I33-<AZCptfdY_0cB5EJy+rf@bt|SxzwS(=HSQX<G$EL|<Ky9E3D6-jj zWBoHy2AEsKfXR&Bihh`N&Y3HE)gX-^Lu&V?$AyR6+fL;b-l916v-Xj8Bz$3@_t0Th zaJ*z2#mmR5q;bCV^O*jnn@)^0J6m=gW0l!$4AOX%$XlEtzcSCyDQ$yQo;K{yLYoQQ zkoT^$|JEe+j<i8}L3OBx>rU0Han~D!QZZ9PtZgSqY0lFs7ve(L0k|D)4(ecTPm13` za2b>nh!5tS76+l{i@?cuk=_-N{*+Zg<mH~#2melVn8l>O+-djkNLAH@u$OD}n54gR z-t<4Hhswo`xpNZ}j>^%4Yc|&pZe!{}kw4DQ6Zs`MpR95}8R(c|+bsc3iwTD4I4Qc2 zj(;O3CF~+1dWQ2tI^r?4=_Q@)hj=W?gvn+m5fBAy(gB1_fM#%5s3bG^JpzUENDK15 zvZ<>G+$1X*md)H*nUU(SFyT{1OR%i@*KO|xmKUqXR#{$@E)VWd%B-;@dHQ!W<{N7b z7!S%7Ig#wfN+Le#FHz|mEG*1T@ne2*z;`vCxuulOik$dT`tigA?(zTDRsw|`o8rmt zikO9Iy<vRarC=PEkc%1pp&p3QV#q=Ge~yq71S}E900T&o!4(|pkIHObAUQtX5pTBT z)t;5#o1WTP_{+#|QEflzIfJ9BrTx*XRm?fnXEh?7UIRahcwR+vLZ{p0{eX(k6=z-D z@=ZE#O2@jbe5+SjwY|hHOpb!X@=D(f_l(A#7?bqeHM3u)IyaHb8HA^$^&X&SUP1N+ z9TkmhpCQ&RL|-{Hq0l`S27r|BQYJ7c!mD=_Az#7O|3-5h1pE{e-aP|{nrB@5xIX=2 z>QhaBG%?i}Mmk}hr)v9&AtaZmR^kqN?iJ2)0w(Ci$ZKI?e-0MM3}=wsD_DN_ogi%B zx;AG<;;-f~&08MLR|Ptvq=Qyk1)Lv777R$&rrbfgh&&vREC5YY()lEJ6vbnirC;J0 zegGOlE-=XmGc~g6ky)v^xvo^{M#<{j=%$q=b#g<w?03^OFCsYz6voH&pFbM*kY4EI zjrpg>qbAWqeBlulA-+z^LK3qaW+&hRX4+|N@d`mC_{ecivwtzm-tSq$tbWuSrXZLa z?gE(MuKNkAD--xMa3R=_44pxI1xQ4j6U=}{U-Gpu@@Bp8A$kFK7N7;K1NtC0aB7;5 z`z%%dwj??LhaqkQ>ft^&@RxbT8G%J4@w*pD#O{Ij*!>`)h&*83qlmol72#jl;5dX4 zPz1p%=KrcBHFHz_hf0DOpvh#xDpA|3S)KgyI`<kWmh-%M{jcMBXU5(@=n<eLBAq%~ zltpZrlns0gQV6yuL|Pa*VNV1vfWa{KM4`esp%Si%nuMhFys7X{8l(E)!;K-}0xa4G z<`X_E0v7loBwz3{XZ~U$eb1bV2VHIDb?+l!0d(<5t`hQn!ssG>3h}^0J;H$mv2LcY zXpn_41ft=g3p|5WNAVF+nFvDSOi(nAY=qavSkM!0hr~1&85V9QqhOrS#DB*pC(U)# zfJD9*2U~t)1diY}r7-_u46Z;7F~r6uA~{ejd0Di=nzX8m8DwBQumtEK%;D51CIOIL z03cv0VoyRTh^+h}f%DG}OEbQEIp$vaP4`NQMFDI4b7o2eb)cV>*YRm~N9tz5+|CjV zIMx)LQY2SLqg8*a)GH|Y5`#!FiKkcYzj{baIp{RR<LKd$z?uU%;{(uQLxpu&JCE7T zVg?-@bz@)838?G#<Q}jaaL^H~t-w@4h%+*e*i#TS?uC4nQdePz69w@G@Sg`%|BpQc z-l5n5-l42|r`Y@zWQt}tPqglM-1u4T;M>mf*A<pKt7;fDr;j_fHum+u9y~mro9Q#M zKi<sB*Q&3xqqDgs9L@)3+mEnn*L+~ADVeW#FWN<tShYRPS<EBg^@YVB7~{z#NUm@l zO{qXCoXWWWBbtgo^d5dl@NU2Hi}ZvY*;K{B*57D$@ycF|&diHmuRrUQP7E-vm)m`R zw%6;pTKWIUeDLyd0H@7n^rm@^c(Ea7ckt*Hy?RgTbQ}$MucP;Mf%YG=L+B<)X9NO6 zM)kaYYT<s}AjYA_^IvuD$s5RAqvf%@`)h78jnq@WzhEs4c?}o&&F$U+Qx4JS^#$gX z1l=p5435dY(42S!fp_lZ#5)F>+$kUi>1g`qcoXgpPql$7Q{BKLralC3sW5ZdKn#5V zk}z{(Fbi*UNhpzF-_t|Qi`)rwa~K?Zhf5C<Dc+^$W8EdC?$>K^-gYF+4cheEN++)! z#usd%B8!V|aqzkWv9jW96W|RofUg@0Z&eO0NDSQghIB$K&~2+RwiL2V3t=gkLcuSY zSRq-eh?c~ADxR#v?{-3SZYCN5z?Ax4=J!jd6L0Pq8j**%&QVoXH*R{A{5#8gsE<7s zn5!i{GPnDQu@2k%&>XjJcs(mSCc$4Cxpqo-5XL@$dC3(t+lppp@=S00OWijLTgNpZ zR0COVA=bdOte8baW_|GWMabK%2uGT1l8-aYBNPy`kz%qo$)ISehjJ}UXbR;(4<Y<U zs^#bxJ)aKQ1?;T3ana+&`-S6kyH`VH_;ae}24f4~s0_#YNM_IV@bXa<Oo-(BJQ<T5 z4VxnCc_fy4=BC84AU<0Jb81AlGtZQAy8&#?vdNj$NlM~IrxRO|c!=+n0$YOz@F&Qk z%-+I0-Ac<VUS-`K()T1}O-ZMhA2K3U==7($t%uQf{CPEp?}F_#xvg+ur6O_DN&bTI zj>qz&F!Gw5xD!mS71u+abiMz<#Gc?f0ltXE@U#>LKL*<$8)xcun7sYZl%4WW)WGi} zBiSMCjoT{^2==)DJm{Bm2gxRwdlrC?EwYP7OxucFhlyxIJQ01In23fY8~$WEEa~9L z5rLNnh^aaLq&s-R6j{*hGaoDU0F?Ib%`j1E1T*M%E8iQp`1`&JncIC;K&CH8f46*v zOh2_@0df$XN?=l-Skiz=QCJu#gJqnA*OOmzSFLMKQL9^J7870t5u$4eT6-e2aYpMJ zx6qmbEG^-{_YYl(Tt^EA{2BTrZzUPuu_Ty4F%Sl*@kcP=$8-6xZUfWccrnEw6^D(C zd~xvrA@PMOSWP3=i!yreRXM}Hx)F1<ssqzR;w`>K%QJvKo^}^eW0`Sr2jb#cSVgf& z;;-3EE<}ZQOfCogJU9nvL9FV$>=3N5DAi=6NJ`+uU*XZAnc+pKHna=}BtjxjD`<>8 zg}*vxSW}LdxzK+ia{Sl5IBNbdPk`w6{dty^LW}YtgZ>#=5KuNc!QyH%UNh@FL@XYq z2f#WCS~!zyCRX7*Lpi+=Ml$mAU{wXLKmOm*D8T(3e~%fOH?z_mg%FNc`R-Mj;x$iK zkf^C&tV2m2UUkb#gGFw%rtPhS*6Q)1XH8z_RpcD&CZ&bNH@prgfYUo@aq)iGRRk-m zGq+u?U1TI<dOISA(#~JFy#!}0AY6g9w2NR74_0FbzDsDr>>v;tu|WGc{Lq5iL%io< z+K-AjxY30-WUoXE)NineA0nQNqWs35@314*;T3qinD2u2n%qo1?chVN`6NENC%s8M zG(Zqn3w;LRbqEVM`P@3xQZcbRX0i!SN3@t;g0~aoqBV1UyfsAvEvL(&JrNf3P$Hz_ z?GbXs;yKzuG4-PWlYxe9wr2Pd1))h^^IOL|DPYIU>DrAnRo&-X<{Y$=dbD)aNIgU) z!8O8&_=zhxS8=9_CbpYKxQPRAxtZY!yzAjNzFxrBsUM9WBM&8ic!Lmwma5M-Z<GiN zOLd?@QQVfs=BA%m8C5me?%5q$_7Qfg-=MMl>wYso>A)x1ofkSr4p#)%D8JWagi^U) zIU!7%lMI)-e{G!WHeCnXz?-y-)Hgv{!GjS>K?0Mt2UH)X2tfyU(LR9V$jG90`wx4I zFdF}S|D<6>Oek(+Vb7j|?oMYf)MM?dTSW^rs9UBT#-%Ly4yrPBQl4cig(ZZXW*0&c zs<DAvwL7U!K2=Sn*;_m<c*Pqm^ITkchh;3O*&Cb}!H+?6-`Zxx<_M4ICCWRW57QFa zhx366MK@5%;cc1ihiY%5J%f?pfoR9qMjV{a3BD3%1KOA++#Z8BV2SD}wgm`x4O(t# zbdI~Xx@JYO+2e}r3s1&_q~Z_130)MH>d#^v>6Ek8bofTT&OVKlB`I^s>0y1=M!^dX zC^L40(;&K$4Q+FbMj>^V6WW`W1bf@?&PUidgm;s&VSg0fxe0r3^wAc-muT=9lZG~P zPQM*TTs={;i)xCIVtPqG-uCX_Mk?tW!c$Krdau4XCQCX}@JRV}wV&ci^V^&Zk^{-% z_|CVXKl$3KZnS!C{Qxo1%4Xp&p0g6<;_|wNbsBHo_RY3yndchTEs;G}k|$;Yr=ut= z7*(Uqve+uHrxkWKR+XoteV5aHTEbTkHrk?ne*X&=7#?lU(18}%maF#O?i1+{tDUTh z6vx^nh5f(%)Xy1cvfgw;vbi!mwlFTc|8;LuowS_!QuRA)f?DIwW5p~%u`d`ayeEE5 zYabn<PpsCT_~sX>em(m=m!=4l_BTo&3V5q>D+IH)DWBdFn=3&}*m&9u`|#0L;Zrj| zgLb=4wRs3iXPRiwYmWu&MWWP*eR684a;&Io9kD36V;xt2)Td!S=aS`FtrVrTDP6oq z`Elt-K3RuSYtE>;j#y>BuE|{8shaYY)}1`L`X;HoV@fTnoB2mU6i>_<o#Wk;pXQ}C z(lctG4LgrYTRv3D0KJDsG=LtkegDGHi!i~KZM+2)@8=|T>k>Mbq3zJHTNg)pBeWwG zc6SSJrNPEa8r}pt%_kh2z#m{&u`y&lQ&;q9J+Z$P+6l;B?VZpzT4m=@n=QMElxN-2 zox&^Zd6L?=f-*~bb9pN7{%V<G#+wGUVy>J+4z;bl|G^$<b81>}9`!SsS1%Id&R}D6 z&`)fg$n$s5jhr}9Dar78L7}2h3Y&28Hg7AmQyTU+iz)uWerLgsaQ>!xq%z((J=0To zm+nkxh-f~kuLy28`D36G+c|^xjpW}I1x%Q($=s*aG8#ZG%RV>We^GvX1Aq4~wv#|y zGEQF0h;6sXO#J=m(;i|F9?rl|ITTIqS4W-&))%xYViXY}#grg6g$qE!lnD@=$JmuH zODE^}NXtkD+vmptmyaJ1JG6oB#13YBjsp8ksQ8f!unU|7!G}g*r!P1bKAjPd4<e!S zC4{3*d5GWWhbjm}+=z!<=TKyt_H>8Zalw(7idk|;#-$Ds>qVo#*Hun;3IW4Vh|Y!x z4&lHF0RAZuIF$k0+Tp0v)Uzt{lma_!I(y*61ng$U$9dp<!=$!iM`VPZVyXqA11Tcc zMLK=KKay8rGDq#@Xa@s^B&)sF9Ulz1wf;L;lD|rvtr71NyR9-h0KtcqI7bBMxrpOG zlP9UdYS6Jmbhs=0IhqYBLIzom59%R<q_z-GiYX7o5gg9IsH-+3tI^PrDgqHFbm$Bn zTT0B4{ah8VrA~7M!g7pqO1Ik#pIE|n=eGcuhoE7hG?l=RM21so_~_Nt^IycVr*aoK zl?AsJqj9>b;AorRcwRd?+QvT-gc=b&!vk9I?ToLWbBO#CS%QOp?G6%8@ZNVT8{=6a z>qmcAdM9jeTIe>b3dDg^TFK}<-At0Jg`j*AN}LH3^e1|-a8mOBzNfK{S&Yd!j5$$N z)5$=_>jA{^u|#~r4Z<FAxbY1fzlD>L_(&*ma?lJN*@Q!8)1%8j{3vo*PS_MO1aQh~ z<eI0J*q0(Yj#SNdZWO$FbxY`^esHW3T4tb^8V~;2(P(tI5}z`xc!>@nqN9#-4Gxxh z=#RZ{G*<WrT-k`mFSYm{ds}o46>0aMEc74Hsi<4@2Nd?eXMtfdvRl1+QV?M$*tV8k z7);5Y)P#D}H#%xP^B-{59!?SC+tdoc6BAs4j+s{i2CF!Za9&T`7@+G0bkdSITzeHA z_k=TqRCmbnef$HN2FQ-Yd0UKGG~W}^woyEi<@SE&J0it@l+rEu15PIz5rD&SLNoU> zIo@{Y#4Y?$8@Ofw)dBD+mO@96;l?afqTy|?@@P029eu9-4`1RVvbESs!eiIysIpdm zUA8~6tJojN$f8%45ylj=G5TY&shKqdSyP4T3IrF5ljw@h$)i*Fm!4Zy$guF)+{A%Z ziBNe$<U8W9{xT@pafW5sgO2j2I9u%uK1AK5RDi1|7-^x?{BSZnZ_MozU7Kg4<oy0N z6kk12;e)5RXafHhu`lt7dpNvW`%G`N1O6bTP5on655z;<6j6F%x>gv1FGWJY*|9&` zB(y^WWf_2i6&X<XV%J7s+tVgxI6`jMgue8=z~E6A1Lv$34m7SA4JVY0YC}iplkP~H zq2dqj_n;_9elr`_Df!u{u~eq35WsIXv1k>RDrinetrrExquLOer6Q#h5W=DShFZh+ zjb=X{vu{EN`J?UKf}vIl2N!oBcm}=146Xtx5w;HE-23mogcGYN;C?f!TQQ1?Tl|cR zO_;n2Bu%AGOd2jJa*p{xJuFpFy+8qr8r6Vsi+@KbADRBu@|*<696m%MWh78F3T4%l zUIkp%MFgVy8kJ3T8OjCPR8C>*j$BklL|B1Ag~JSe=yHzvWdC~q__ATq!Vba8zjZ7d zC^DChRr%QL`a_>ZK9==9sUJ2kW&zAgqJ)dBpg_SnY{wWkRFDB5lJA#WyIHpY75Q){ zzDx8U>G{m3`0^0rOa~_e{&HHt>fv#5nU!&(D9SR`U928^+Ye0$C0MH215n~Xn20P+ z_`KMlG+D?+!9F~!v8Lh~DxY8=TI&Ry<SdkefXXLq^Q2`6Rmw0?w`a1Vi}wWuN{rhD zGVO4MX?zr}q%*wl@4{XgfDkH#?7nq}DJaXriMd6>C8D4JNpjiysrUb==6lZY=1)6= z<9C|qN}%49qaI(@pi(>prGlUki>Z}+kPvv@2c{ImTFCal(wvS3xmqd8>+!x-;uj6U zb%jJVH{$%&FtEJSRgtJMBUZsfTaT9|4K-6-?TUmoPa@ikN~E4sz2;jH`p>!wW!O-m zhVT<(kJ<u!#44CT^`Wks(1u6`#fo<47fQ0&RjVB)P#=U(zB_SIes#uab)klbwns2X z+9?N!GCsh(_(ZQ~xXws?y!DxKv&crM1{6b7XtQ@SToY|=Yqy>CS$wJ%6PKLArM9%z zE0D%e$tm%#q14mqicvBN>P_wCuy5v%DeO`CiC-ay>b(&<#dVYvbWSgsB7zokMu&h> z7gKQ(aX)`o_6x7B!Vf$qCe5a^@?eC*R60Das8o<!YaF30D6hrg9;PJgKqWG$22*}u z=`V};^FZ?|Br|<laIGT@5|(gtvr*_?8+#xVI4x1y2P!I|QdG+hQz)_T5|b6$xZgMF z6lq5;A?XRaz=buT4B20$?}f<z)vg4^;JkxTNjA<I-IUOnH(kE`8cY0|pQMK14b2LJ zBl3cRX9K8Kn|t7()p_^Wx9PaF<eqq3_Y2o5RRkrL?LAgley4Oni3e~9N*gUhWkpdf zQK*O%A3w!uxPwq-XjjiFMr;0qWTK>4ao@coflcZ<ryZfV(2r-s*4%63?rs>re0TM& zzN=hRMvQ^Wh(SRqRCFgLOc^S#?d*YyQv51+?6V2i_Uayp$yc8934i$X(|bKZ={J70 zIaDhsxooPC)IayWg7R<%|2B{EBQtlm%FGifn>Q6HVYRtTX-5B^lP{U?*jsVoG`DZ= z{|4nJosEXo#ssBRw<doZQV9hp)r&Wrjkrzb;);o4^;KuU8tN=w9!}J_$Bg4^k86{n z3aqHUlG#+Z5c1y*?4yfHe~Q~j{ptQ!oU`t@`k|mm9;(v{#manbmHDqAP!RL0QKczW zUMczVW<^Hb1G<8ed0mN6&X6b7!(72@+x1RZnbt^adD%nqF?oi9cR0VKV3Co+e%B4# zWs_P>aShmYt)AO!pbn{qby**`z!R5}6x8P=eLYs47<ONpD8qX0n90WE;OfgdyHEi{ zL4{a;ugjpI9Z{E$(dtRmDr6iR)=(A@PNaA(1~>lCHXSIqI<-VCR()O2tGWqPcJG2a zVZH4ypE><F!e8vPc|7sad11jssFBOj+5VYkF_~%0FUKoX`e>6{>aT&+ztW-39IiM? zRN@UXp+U($tZ4nFdaH~8rhB0G-~JJoUIy#E8=j@mqJGr<2`->1|F964(;B*;)BA^r zIAUZX>h%7j3}3ngIY%l9%heJ%{&`uW_$E;`_ADw9Jm<!K{xY6Qz3)6G61WIesa0>I zZ@p(Fr$N-ry^BS9)u7z9&~w3dU1I}Iz)@7Ev|MWd>W}6!B-CQwPk3(U1iY$n=P(9{ z8kta6_Tu%uOejst#{pN!B@rcHmDyWS-Od%k?snUw)=pIS2%jmDs<$$0khwyaob`(T zc3FJJ=V#N6W6zV0qhhrsQZBo;qY|%k-rjo8yA*|f{%6*~?e92$W*(@K)9mu}4Chqn zQ!3OI#?&s;k>tNbwRhOe_BY{G^VH_p;`v+P_nPe!kKg(}rafxJzYzol|Ftu9bL6_! z&`*=e@w>*q<SDG&S}}`=Ccg;3IdYOjFKTMFL?SHZhnkb^^&cxJxf$k3qu<hke<wQX z$A<cDytn$L&mGm3MP)9D>ah<4R{oXwMw=xkXT!g>{B_<4wRR%PpUGI{Mz@y?o;~Z4 z5C6PF@r4O_hkFzApsef5iQ7u%z6(ut^|gwLCy&PUL<S7(k2yM)6<_8srV}?in0M6F zHynyXJBE?upeFLH6ST>Oq7I*(*kZb~tk2@y%RU36R+*u&=;Dj5SJNdUU-of+ksP>5 zbHljYI8g3pm|Uo1dZ!6Ey`fIR@TvD@4SlFO+-MA?;Vz>BtPfVytDiiyJ?b{8HPr`x zYt%HCIJTgsGVW`-Zd{^yf(b7a$vJ<X8d$UPzDauap8MIY9#AfHINGF9CiiH$+X6RS za5t!)^ztYWA~pwgSgPJjR6E{wZ|v;eJ_9+|cf;GD*s(M(9CE>4XZh&j=aB~+W#aeb z^o=}_P}7Is8ROfaXwdS>Iv;hjon?XGw7ckG%Fc4B-B5~Fm0vX)J0j<=QuRvdXm*KI zpIHtv)^2&q=tLCfJ3vv!WK3JDc-_Dr1Puffc~_#C^Z9V*22}WVp`{As#l|4id=d2` zFHQTt$^G%l%bAjZV}i-B@+Vz-??zsIL(y6k{W`C4)(Z`OPQTWZ^DR`5MmZN1<<wfK z9&CoIR1<}qYn~+MEFoDDNZlV7(XU)hUuzN2^eakc_CY9={Hj-dZ_VC;TnJbjQBmi< zK*-<0nnZ2zt;O)m98gl)KLM5Zc49)w%Jt2RC+^jcq4KJ)9o)aS&zlt*bITOD=elG5 zm#g*f@fu8S`?L+r{zXy{^$I7xKTo6z2)#?8r9_w<X}^8kd+h-gsD*t_sQqcEzYW^s z0Reo>-ZQM@ww+_?R}SC?tIUd%&}F~)$aB!QN=lcquKy+?TY?E<fvR(d(g77T2q`k> zfNXW$Bvf0wlMhb46SpD&HMm$<6n#AuA}3MHmS<ZZ)E&s)zF3ZWcI1Y}p)qoPkUA$D z=?YQo-tf9sV0Iv8WI6D8b}PTOA&_$AmLgPU92fdVn30+l@{f5yDOyO2;|Hw>RUd~j zTIZu8!X!BG*q|d~BB-_97Gf>QJt8@9NHWeT$W122CNPR5$9?4(v@5BQn*6W(6!<yK z{PFEI5{qjCWcZIl>SW5Iq!!BkLaS3|1k;gUO&v4gW8XMs!!-w9K>^cU=w>N=bIfPu zMOl)-w&cd(q<rsHvDa>kfq{%FSN5%W-Pe2S&eQ}fK{biXztGa3wNBveJK95jqg#G9 z9<sB@=xkY$iSH5lTB9>%?*%4B^-KZOK`WTgsnCBnO!-WX+Bx!u;@?NDrxa>^45ilt z!$&@291GfWSpNP|#(VFBh$e>?x`i7i1uz+#pop_s0QGp-UhWfI?wdf6{8r1p9+eIs z6!o8zy5*rUpT)k@=JyHyiR!#dcI0`^PYgqqnGb{c;hrU6@bMQqnds&$m&42s?b8Q$ zcA>)e;Ea?RoDsWq;9gqbUhc<___KZC*D92f$T^>nDqRnSdbBF~-fL4NyQZ=DXkwuj z>LYonrhOMwwJicb0WM3ZCXL81q7SYq?-z4?>}7ksOh>&=`)oOG2ZXZtEl)>a%m}fx zHP&8K#0Nff?}B5^aS5i%lQjD=?hdNZOEB<WK3vxQd#YgD<DewH-bi;Oy1DYKZ0f+W z!=$W9x**POeB4-^C<#>kz$*j3HkW@SpuvfW`Y58*vip21617zIFuz%$41AsWrl72M zsh*A}eCI>4h4A3*9SNJ(4J?klO@<#82(qLZ)JPZti*_TYK}p4QV=|Q1_faU<(vMc4 z$wPb>jh#lHP?~E4AWR9xm;s8%2U#+GffWQJW}wf^GL!l-gp-}1Ur>N3*?$*e#Vk2~ z-dHdwKmLNWYwY9tw(#C%g~yujI^_4)d(VqG<^lDLrPB))`m_(R)<7{|>!9InwuB#9 zXeKsJ)4JiBxNEU=e$o*S&Cn^4%4SH5+d91mc@0_nw^vIbv*tmFpFf@^3`|m<Q^Ev_ zBJ%Ka2jbii6B1q&Hy;l)YV~{^rWYxMQmKBQfbU`v5NOvq>|ZyvMG>~C#7PS4RPs?9 z`gn1<dXtbus6aL<UyHky&MsD%L@mVe{)}v%e~48Lu`zF$A)W~)(<Bi{VGQt2!Ks=^ za)MNn@DpoQz4w#fQ8tnqv|7}q7c|m{Vi5AKnVnB4Gmb$p#o$kO+U{+5kov@kh__V% z1M9-?ze9DaTcl!O6cJ%G2_h<~-b@4y0>pU(7yTYI{~;E_L<oxp4E4cPp7Ylo`{)8b zxeM!UgZ8c?&4HbT3k&e?XYYh!CpE0+cB$!_D^+6}d<XS76?Hlx4~i8mA72iG-`*%M zQEP_Ro3lgkIt+}B?-C;{lnGZ(h^TOykthVU#X-s99*&z5r#4Owo5UFmg9{@2W=Kwn z5myef!utaH>!*ZkA&!WnP*-=MdE;e>Ak=4o@M<1oFkKn_WJnQ#{V{J#?qw+S{ax~% z0pTU=+n71v#E$anpHLRf6v!qc$mP59zQgDCtYF6mrMou$SX*tDcTxuYCZTKX936*6 zmbmPrLEc1n0Nu&9c-do(7_WIo$2_784(d0CV$;H0lpaSdIU9rx`7RnHIz`(QG=$iV zJwN-D5!NW;pMxtubH%!@W$GO6n-aojApPkF*7Wqp;Qbx>LBJQW{5V4<6L)Pw^vyQ& z4@DTk%f4RR9Vjck3@Uyzy%0r+n0AwWD6Uum;13eJi1{O86v823#^UQeDqnt(K_?T{ z*|1qwc>IXURQ}*w&{c3HJ1ax+<XFm2qmsTYQUN*vi5hw!&Ews&UE7LcK11cr1ynw0 zj(%|lSbeATJ<vU<ke~&&J$Fg$QXb6m+@yr>ty@|yGZ~<#aP1!lIe|kHQCTWQ4;z~k z{~BmKT{Qo1`2?otJKx%1{jU}NQVd-=?<*C{o_EjHxU7YLeE$9Z)|Y9L8GkLmf6cf^ zvbso-tMYv48x7{r{9$@)?sB#xugsO1l{!4%{?0J}>tf@())vaTj_lo*xvYJ<evzzQ zS>NlvP}i5c%XVZIea^n=qI3Rw<LCm9&6>3S)%Vr)YnzS)dEBU76BX?ucUQi?Sq(oF z;q8B{_@b+N*loGHu1{?4MM$*jr>PgC?mTYzoZ`2T-1hDk)!OUou^^twaXN2#XQX_K z3|FxwL&LIwmFYa*vbt5VTA5dW^G79zgu#F1^nKi2XE{DNU}*2fJMEDDnZ*w|Lw%Bd z&us2C%eaT!R&V{?Bf#rwrMsYqau!QRk7V-}zAlmB5*LTQwGZOSmbg;8;)R;@JsbUj zD>F2|tVpq0q7ynzyVe@}fh7O&%dK2B%Pn<fLkQ2#w1EQ%LQCP7qK(_UNP2zGnA;Y< zI;w!RN3vA&ZBl9RoW8ZyGF*HqiM^Yp-n&tsS~{n1(a^Uvre<0aTt^?9RQ6GWGM|^o z^!<>fr(;mlv#2wU_k*`YZ^j<iOh3&w5!2`xkeEZ?YH-|d==fc~mwm4IDLd_?7WM7# z!wX!CiqdTECV)u;0_JCBW;HAwy}I&|yl)?MT=hg_g4g)4`7m$2&&2qEfz#|!UftsH zA*UAAobf}uhZdBDukCtMtN~J|naH9~U~w9i5E%=D<m&KRp~@TzYRO;>9FQyxcBF<! zZDCu-SVSaHgS<{3YhKQqGq9j<dG(Gym6q2*37=6zo5a7~e>{k{{JnWZ!fsaPVV^gV zH?vP-9h|aHX2<gOBQ^)~ztrr^Dl>LeDP!NTNis?(GVU$9DAB4?t*p`*dDF-L_O;fT zF@;BJs@pN7fSuOvu0Pm&5sXzm8!Nl4e~Y>qMty4@)O=T>RkqipHOSS`Ml<`<VVzF% z2>2L*RVoIGai7>YAzPVLley@2Lf2~vZ?EZt5xDI|7d-uk=erhpx!ry7yh>3g*I{hw zqa5<Ej_zz*CmV1M*=h)2M2qQ+*O<=|uI27GYI9l6gj>}u_EsIJEk;DZdd9LFn$^Gt z7m#p@V9cocBX@>Zzqe(w9}PWOYk4!wy<qf_wx0LLszzfAJW?7J^JT2n#lH4l9?|Ia zv9~c-ai2;;sJx&JL|xsy5^S0FQbpdJ2$ja9ebjLFEh^uQu>dyHfP*vvoCt>$DA4LA z;hNHD{&yYg8HS3_W%~n&)v|RTd&>{dv0nc`a3D#0>1zNvNF-W>4t4Lo8Io%3b+T^c zqk~HBAI1bx5fGYdqRQOE+~W;&G#h2BO&}sjsKyeXh8Lx|c7UMeLja*mD?teZn;;(e zTr$r@;F!o~Kfrdg=5zss@bP9v_vR<UpbFmZl#S>LnoK%`^;CCOX)#e%9l?&~yh&es zT2_k6|2oLE#HTpv&NWW@+a#6R+z1*(UB@I1_|!4Dv1KI9m4-gLt?Y13dN^HZ5izL1 z(qgf}V&x-W-=Tr?)h#}w`(OBu_jRRe*7=T)wXt=5I+=zN6BXC>bL#sfKYEx{zAh?) zh)G#~*UNg&-A<D2x@GgU*fgZY6#|!@4ayd|tX8*x*VkGz-qa>w`~fU``+vwMSsIpH z8Hi(fvMMSNpl#H`?)l8sz8>L0%Pv;$<tI3mQnuqJMD`C2lEhCw!zlXm$t0FE()omd z{E^;^^O_in03BD0G7WY98Tzz=wkhP#kP*at96C`DP0}E2EtU!vK{k_=bmh~#?W4iQ z7>~ZX4wi1c^h9Su)pfm`dM6fu>g7^6=})qB-*Uyj_1S+$BySvQzkmXYFtkA2>KsFi zK-_?gtT>(fiUhQb<IQ*3e{y$gBF;{SwHSqQOn)}26;LUXU;kk|pgDz)MBYGzS=4FE z%s8UUHF;G;G4Fl7dNS1{sA)i0_PDBLnuh|%<OTTT;<d7Rgf@NPCPJ%b?beZ+IKr>R zv*++8`H3AzhhzTj%V4HAINU4qOz4V=(w#R%>k9Lo-{-t>Lc@#OP0>jl`1E!{6V1|+ z$d}*~N<U#MR4(omfE`qAsNJ@RquaK;@-`;Dn0*w3rWaJymrc+J;6q;!j#coeYpt%H z&7J8&6HW*yEuaAfvQXEV?CYKmT-3vdS&$!syKaryA0V7hob;#rTTFV7EJXOCp@o)X z=L=p^r{h?X#Z7H-JA`Y#AB{7XLE&bS^HIFGqs`MWab`;_)7`kD?__sn&b@wJp3dM% zoszC~r^jrsK2E)6UV^*VLLZ&BMu$b?!_vd?asA(mm_uvjqxB^YZe-q(g|2DiCX%K4 zX-V#Z8jke0a;+xln}io~+6Hp*^~?2b5c$9hG@W((;xx$<amL3z=#R53aXJDl!fke{ zB+#DP*kGM^cfGMj#NrPQjByH^^x~<bw$+ej4sBxMT=QRzh<~bMWu@|j<0kVD$5$?y z=liLVBv$4$p;e%jY&8TT<nF~+s`a$ne%F|yvE1EYM;o3L?G5><c4?B_UB9-dzH__S z`;oB<N?r#UA2D=^xT)TYyl*m|U^km2hj66d2|?{ZmgGvmcPG0WPkzt&RCmlYa>C{5 zaAV9#-QnyUb{+ZhxX0q{UF=VrEIAVy1GI9>o~5aE{o@xbE0~6Fwre-ECge$Y#Xs$O zu3MfHlA{${`TQ*-m!0eo!p!lB_Zk1PU)jUmvtYg3#uJ9UeZF&jPEf#hi#RzA*KUtz zZj)6rc9!gmlW2W2Y?Jk)=lgHn|Mo|g1PDOM8=X(aN(r8pykpEC@R7x#V}8d|y2>Wr zl$goacBYZ_^r;x7ArIp1g8L++sCb`X+z2eGn>|2B!3miy!$f>6#~%t|c|le_5mBn1 z>Q!O{UT#cg#~B|9j$9XUDQ#_3#$#E!Zo(dH>#T-zZP$dRys=1-0rV+2@rXv2e@IpP zyKd^%csS;UD*YHU<nxr`>#^C=bX&wo4r|cK#LWEUIJbA-Ms?kO=bCH0E5ROPZQqTC z`8IVaS=P0U@N_mFYdV}#IdWy9ST@1CDL+9Uzpb%9?*2J@oSi4>$hu9ct{*lgJ88fE z*<3PQkrCigu$-ep#7KP2MtisMwlU$=@;NjVWcbDtdaq0Qhr=6@F^y;riGw6B977Q= zD-aQ<e_Ih`9oO7{jsXoVwoIH|`PlwG{E6#kz8OArIh&gLVS&Rb($gX#Bwg7Pe24md z!f(#(<&o;GY)a|x)O7>96Ve(ytg~*tqAu?ovo?3q77MPJ2E}u@i?ku7pvbj#M4cVh z{N#fKc;9s}ZTG0t+0c!j==x|JP}<7+xWU+G?Ci_d@0BP1O6YGM^5c$iZyiuF@>5d@ z^WEgx{cYM{+ioA0pIdE+k|igHHPjT8S~+q$^tort`kYs(IwP;xb8)64LhGQTj%jds zzU)x-a?qyzFS>+HIAO-$)4y*mIlikQ$g6X{G1<^%FJ}&Sd*@9Hr-HsBkF7D>Zy+;+ z{e_MyPJ9ce<LKpJhFme@3k5NnkEVO!d4_2RI%vE*-Jne@I6~k==|K=u&MDGufPKG} z-hLNeM7dT?J#7;-9P8bBqpeg?P6qV3LBHU!DdLj*hD)Aw$AZ3J*C!cCn8#T3yt#{> zD~PZAJ^R&UBkq4+9neo3N3lqlj3i5Q``8{+Q>!4&#QN;WzA!d4ly)$4biL)o^VCm` zA}=cGv6}9B)=iMDTZeAH_Or>2whSodkga`3J#si@wZ5yyJjOHn+kQJPFEm)av_(?m zuNKeWMk*q|ds-rOJi?>E?>6u-h%C6GrPlg%SF49(;XPycI71jg=>ew}{E~{JY)R6u zHXpo1{X=*Wee)3YQd_3b=Mr8-wrl87-=ah&(Ym(!wU|ZtZs+cMs!g{IWq_-c-6#W0 zA}uhNB7ME)wFr$CjXrz1qBMcKA;$jdf~=U~euJLYr}@Iwly5Q-Q)`laEp9LRAU@$y z<qzJc1Op%#J?xKKZ~j^Hr%bQK9`lBaytb&P<&UPl-_+F|m30l-C*CsPeRX|8{YaBz z@__udoJdQKPnK7do**#(%hI<FQkn~&V-ot>5#I5Bbfd23+>88gc_zDp%Ebi6{>0}E zF~+&F$5-HOk$peNqM-~*5}H#6&NvyNEcx1`?N4?wddr3J33>;^w*7}!$I0OVG#gyr z4R3RzTo%nsGk64oS8G)~ig|KHk?XLx)Uy26%16XbD*yUvd+8R=Jy+h1M%UY2e_xkS zp$qIuxZe-vFl@n5RAj&-@LSiGArnaOu{ws?n|AnSIg@{=^vy}#LJn`PdS+?e{3)ws zU304I%bbUUQ90ROZBJJw%dfms>R!Glo;*q$JpH~p*iz4<oKyEA_+jOU<Za8~xTb`% zF9pMo^)DQp!C~G$0pBrJGf}7QR_`m8lVMmhpJrZts-1BBp)<j&7d;sz)3FLM@?M)r zsOOJYrU`@7zBJ7EQiq1yZqvk9aM5#9smzbj&B;4D8IPB9E=3gWl7)bvIvEVu&fja& zUeH=2v{wz?O?7sDd#=qr`O@oqn3Y?YUEAu8s!CduU#VZ?e9z$GKu<idTr$YR8s%^8 zu;Qngn;-W@(E{28$&Kv+Lz227t<IN!<lGsoHatK6>wAv;ga(hBb5pwQ_Q1UN5!pU( zzwZz6^&4ocd)DL?N!w@h{#vZ1#Bbfz!RO5*N$9Q1lFd#I&KVwJhId7sHLw!|xuq?t z>h#x6&Nk~6V-|fAQ~TO)EvH>gz4y&s?($s+_zG(Hs1EN!UOy#n)3ous!6bzVddmtj zE@ZGsP$a5ven&~t+Y%}K!YcHfw7h9zxX8;!%X{)^&m4$klLOSN11kF`OxQAgTvF?s z3q}cUj-@JXxfduJ>v^VM4Up^4wLRTs9kVEXS5}h5TKT>MyMiDlyPv*v1tl2J?P9Qp z;(C2ZLYa@BKD+1l>|R~L94@#^;&lmq`j~yk5#OJ{w!l)6NGGCmK%1`V9NM~pme)!2 zG&!ztZh`xe+ec$xaU6UeHoh%JsO{S|wo&eaSE-pgBMEhW#i*-YVE-WUNKIwQ_!-EH zh}P<+zz#wYOx@ebnNjzK+39&m$487mJ@2AX(1(ei7`@|HFBGo;dH#FHlq5-zo0Sd& zBq71T=Zs;*^iV)e957`V4IT#ou6OMeL~9$#Z91*-;nlANKoQ`%x*%V5ZguT>G*r{# z+1{S}L_h1wrL{m{i~3)ih!FHkA?g1j?OouaF0=n}wJo=c@~yruiwab(vEOK+Vp;A? zR?3#;Wy@F;m`Y<z3Iv4VI+M9dc_U+$P+%;!QbA@nB)N}fiYUxT3bP_G+y@z8fMFPh zx&6-bJfF{JJ~M#Z{{OyS+j1FZKF>Mt^FHUfoi~-<M;kT@%ho%eqUzNiV^^2Q#Q5a? z^`qhQ)}K`LPB*SkVm>3J#9M#c)@+gk3#AY?TUkNojx#Rt@`;6m*G`4d@kDSzY!<X( zA-#f7=v|G<&ik~Fj(kYxCaOB7rr>BzA#j6hm$aWUIjXZ^hUXq*T0D`DjFPK;F~Ui^ zoyOV4jq8(UhPoZjXj2`DenapBf#b*!GEv_xb@y&fRg>=D6e7thRks4tHdIW$z0RIt zE+74CK-y$i*K3UBI&1ayhqD6$FqL{2MCTblw0D;k*AU%^i0G$-#32`)PddkWiVB#) zR6L_)7ub*SdlNz-K4}PId*B5Nszzm*+QwE%8pijLcPThbzSCRSajpIcWN7hD8a?D^ z`T0ZTQJ+VoeQ#r;I`2J0t=SRL<E246fq7iYTY7nE&y8=4?IY1;MJJ6}I_kSGZp_kT zW>%36f`s{jyAAzr0qbb9Czr&b_YB%rSD&9>oacWkFSU1bwrJSK86i;U;3Ne^-X7>1 z-*}i+scQUPm>Q7GMX;%o`%j_Cq+K;{_2Vrq!&bX1yIa&RqC~*dkfHwIM^@UPxLDxG z`1Ek}1Gmd~Z}os3I#aJA&)<$~e4=V{oBTL<K2LF|cHykCLpTt?ET-Tp8=uuW*y3Ji zSk@taS>wG9po=2#KKx0uQUWp<N?`tm&4^_iZAyP@Ex8~3U&^W{frY8cA8MJyFoc^i zq$JqEIh8uX(9CQ=Dajo21!8rUKk|LF?9`Qd+2jT7=gw{rMm@(@B@H_@`vQ-YYpa@+ zUC6zJqG+2{@0pnz%+Csw%O7TPVmZa+N#R~sOM(iQ;&%q@G2e6U+;<+385oW*N^-rO z)0U^~yrp>vB~?g9D7)N_BePbUVWV7&Yk|@{x|qPZHh>NHx7G#4pM^2nT7tO7-VzW{ z_Le!TSR`8(q&S<gkKrIzfUzFFa-Aux_KLzH(D%rMmT6_$2X`mmmlmkvbw++qt2i^V zBXaD)f`>aFZ1dsZiXouHX`8%Y;~@-3s34f{A)>ZOmKFG<)^0Hz)V|YOs=1mU<U9Bc z6c{W}Ljs0sok}1ni^63*KYG@IOT#1XC8P$y+0<9EEF+69tmw}gn(5wyJ5WBch6sFL zeW|`WScQY0f%V9s_+#av0(DF9rTgSB;~a#8%&m$|HpJng;ppo6`$suKlR@b!G#WC~ zYmLs!8uhT9lNxo)M<=itwMtL*Xq^aNp=uJMJ)LvG$$XQs!gzV3$8@TYS<U&?$O#ec zp>aXd`H+sTZIPlxTsJW2;%h@MXx7O1(W0*1swXjh&F(RKbE0}?&KhU;OpcvB;%9p# z_0AW>GJii+Zww9s!|isLl+5guj4Ryv7+k~sEc4F7=9=5JYji)34qfiP-|-9Aob%yR zKgugybBYh?IUer_hYf~@bN*SQGbHH^eX7TW<GP$(e=5)_MO=|GDsoi&`--Gm27PN3 zqcLZDdKa%Nh#NfFDz^8ouCyv>e6gEm`k-V1M&O-BTQtl}mG+el9cVa1Oh*LHOhSyS zfC$*=K@{!0u3sDG#>;POtPgW@7f<dSf5xpeG;M|5kLU*!B*E`B)5Y1P>qfwcDD@Gy z(2+@^3Xsm9UYh#uZ_OIFH-$C3OdUG;`Ro6lGEQd~NeWCdKmL<?Q~ad-dPLuy^|z)) zUkq1=1}bXmE*dV@rMc)XuZ#;689f)Oj|iO=o)V!cF*mY(S<v*aSW~p*_{;UqdEs#{ zq?P%^+dWjZsD1bdAGnHVTryhSq-k&6gokMbr|m=I$%IP<JC<fGi?c9;-owBIc$jXg z);S-XY%U7QtG<Tfxwkkwz_+4%TVJ!wy2!q5lRIL2XZ*<1;NF>1sN}hc<8AOeE2*m| zy!StRDQoR|LAUp`d1|^r?NcT(9=&$=i%E`h|HJi#4|iTVAa6<=8;VtHKe~==yQ;w? z<LdH0Q)Y;ksDp;Y9WM)<6%r3gOTOYjzxcb)7|>2VEf0^2U+5N^*AO{;2#oyw_znm7 zuI(a#q$+Z_s~6eRNqB!?>_qzcq@xg8Ei+&n?!cm58|oud>Z@f>bMDxJnbe*!rkLc8 z0e#G{SId6|*NgQ_2y{d9imO{M!FT+f0FrCO2Sd$~lbEPvEc;ja-A){Q=bU(C@@ha{ zgQ|3$m0D47<kzmLea<MTnCj{A_>DxH(YDGQ@8`73Bl3iimlQP-sTj<H?TNL2F}PSF zELw%$R4cETceub+c2m6j=Zvf~F2fNM+I0hc!%IY+74r&SlyuP#HPqa36~0CRXOH95 zI&bwpo+=?fI}~Q#yqPI-mg2$1I+Z)5T<XTMt8IzV1@NjWYtN%eofITw=u-cR6A;#K z6Zb~hJsD-lnXr&oFDp1JOSCbnpNhsgWQ+KgdiX$GI71cCaW}g6z-pcRLFIwf6`jVZ z2jB8|T`2IV_}o}NuSBZU-%@nQB#wVnct*_2GMhR@(c^mAqJO3p7!uPxg{L(gdmTp} zWGbHlpTLT4;MNk~+?v*9epGms_*U%6c3%f0SVR4$qQ8Cg!;F%IIceg*Ffv1?Ox^<! zp%n>sz+?A@5&X^J>i=la65p^Cpf)fcqB$Iazzc}&>@3=KTzLeT;6S+PgFAyiKfj}9 zUJ~b<s?;a-!|@vBH@g6*h04Yfw|$OHsecL-E^6DX3_6o~P8UAUa%^-_$$vB;JVj=7 z$0Ava(jO=QB5Ro+&a6^@^qW~hYG2pce;;A8q2<}L&m7@=PjiNAVv>IdmfIo03h6cL zY*1d3;!^QkLr$KnV^#mpV>xRTmdKyY8hOrGMMIsJW_{n&!3Ew^_3c@rtBsm=O_bbn zy>9)Kd0hVD_1npH7UNSBZV6u*TsGxT3iLHQH8OH^1D01lY4S1dCwz~Iet-7S&@^Cw zd#IMA_yledsc83Nf+eJ2hg6bfQJqknZ8LK~^9uG%f>q{l0#XPuQ#fRJ&;_D`9U<6_ z?(0T6d-rGGE~+^Kv4btPe<4rW-gPlIVGyUQRp;d}OV~2pb)0{xR9hjnrLP(I%uA$x z)TlA0zB_eYA~f`^t=wg-HILQj9Q?pixBBkIz1x%ve5X2e8vTe{WV^;(Wfn=k*AFPB zOxMJg;OBV8_5UZFs9M{@^_@=K?(Cu7P_Tt8s9Ux;UXU0aN(|4Z$Oe`PF4udNcvI$` zV>GiqG+jGb3m&MdQ#ff1tn(7%eXJ7&Tv0GoVJ(QqX5<x|>hI}#;seC+0r2I2{m_^_ zz*SI&A-5rTr5ue8HhRVluZ-P`6S+Cl<KvrIAJ=8=@G*-Y`8$SW1V0U4%@iUO4p0S1 zaweU5Xav|}7?*`8FsVwBsRZSx_cYa3-dVw_yxIIf%CJ&I7Ko^UKkiN1lsyXK&e939 zq$&u;Y<2VP#Pi=-qem5!H8V4jf`xuodHNK$yJDWeVO(+AyisQQ-%$)4^1hg1@tb^a zeJfN%{3nCh1T~7cnjYG~*!`sL1cI|M8Y%V#Npt1^`q42kL-U5fvY~l_J)0pkvA>BQ zdEwFU4%D-+w^E<H-DM`%*adyA+{K&&XDt+a(z{N0{_R9>?9>vss^Hd#&zMSx*X3nT zi{n}5fQPtA<@z}RYcuw_SkLZBkgsj>3sbpKR9^+v*%CJytgBJb#pBy14@p~9rbxtP z>QH41l%z=+=N#WMM3A&w68%PhSyfl=bhr}!j%_g5hEh3$g^5+MXDB;2M8hKaNqoN4 zlK*h$l)FeG$TS;2Q%v`pm7GDNM)R+N+AjFZ>Fu63P+>!CzZr0STiX=5VVF-Gjh;AE zI8m{J`4r;2d(|m(Pyjt<7MbV=vx51(@Cz!bILVJw;GY905w64cSJIg;305i>ySdx_ z=mmp2XSxlA_Z;s*u*MYFEK4cfJ{D$+=1IwP8>5u(8>Zjxd1|tXLaY4va(#QbGKw(= z%k=go@Gp%C6rHacW5zZ4Ouovt2?$_>?^T60CtKB|u!Z?*Ut!IQa+t#K6L1LyGv?n` z^cQDWAwp^v_>5E>1wy3^WMxVcPT0yQEvME2Cuv$QU2-Ocy>Mtj@~~pw;&C72CbXM! z5bYhp>RTS!j5rdFOAcoY;H&B@K|TRcr&17R0u|^iq{KJnO4-w)^qltplOd8|;_D7; z4OZTaegmePbgcN0Y5ld3wB03C;XrKxmDE7oB)~KxpSFX&z3dqn7{q1dMZCXl32?k% zF>BOZp?OU07?a*3{+n4N78fM|t3b2?t2`rzHFc^CgdHZdl88$e^+Z*i>}(zs3o0B% z*bKNhVUNUq9?C=$Opn-;Q}7EENbc*<-%hpnDg$N%9E@_jDe@$mkyDjBn*Q59-_dBi zdY_b6eG@zed!uL$Q=ERzae%BUN&S(-kYP{nsZP2=79zwou3Ap!wBJtwCY|VAlcr~7 zQBAB-BNs_VMCGbGi}19?=nye);WWor!!a$J%R2U-4qgHD!MY&vTd7N)A3qa{v(tpu z7J4b$Xu@aXh{-vCB%8z;(#_8nsZrHQrM$VKgqc;Az@}LMtm4Bor!;HwlWS#Q5?IxQ z*&M&8U<;Z5AWFHNC_#&E81YB5CKp5?yrI;mX*K*yb^kxpzMIaFM3~K~5}humU67%% zhETq7k??5tZ6Ni&R=g33>e?3!KqKL4?qo@uf+j9_X&2&JW|mY1`I1F4B!!Uw;za=f z^J9_|#&nz;*tW&XT4=uooV`tMVnF+g9}Mj`4iC>xIn|Sq>4p<=Li4#Hi$Ql?zFByD zQmHs*Fm-FiVy({1oerK9N~g!p4<DYIa{FshLAK)sy(ramh}j`})x1w~t$qj`7C(%) zJJHf{F3Nkfi^kVUmg(BA(Hm~h#Wy0pqabvxz69L21Du5FF9H_wUslYK$Rl+I#oTX$ zOK&Hhtq))a0nKm>8erpU60#uL6ofC~w8U?EwQ$H_P9I`ZF{3~!<7x>?--w;7Ck4jT zucpTyKQ|uww8ga2)O@|I^~&YZtOSL}7sBvg3&Vf<jqv(N1RMgkd?4o&9)bgiztb-> z!wM!Fr2S=2h=s>&p+)fyW+AlW9UUu2s}zWoY;apu;tf?DN}$aG`JCy##M^J2#bc2E z;Lu3LWD;6co#7z+7@F<zG@Cz{%cdb^zD@Foox@pgABIBfi04~nNiMILOpoa}j<pJp zzg-tC@X-J1gy?Cr_PhNDYLpAgO=vIVRh*-uU^EQHG(@k8v^+c0U?MFZ5X(SlJCnE^ zXAiOfjEIFY5Uw!L!pkfbM&vNV6R`CLM;Xe_kDt6_2y<y`GK87_BWkuqK0H1R`z>so zzaYLp#Z;^~lor!B2h_;f20F2AE3*iC544wun9Mh;CE=&~gDZMXQy;vO@PBFhEwwk- z@2}Z4f4Ssvthzg@#(`O9K3%Ja<iko}cpWSFx@`!i{NbvKXNqY{a0gDD&7ZK>hY5>p zJJ_HMt-IT$B)br{22_4N`%z$h`;+S0J=rPF4ovz&KQb?Nd21b62E^;9$i*BL<p69p z*uP^92|o^w0pjA~Nk!Jhy@R>~w<H3iR_1!(v?r`7d6=&$KUfzz&%v^&b4QDTRLQW` z@r7}b#mNQJkErY7)v~&?et4rZAenh?v`diCf)nZYa6)mWFR75g=UvdYD5^=|0e6wP zHbz?Ct&3N^@j}sI*jkt)GLRocu()ndLj2K_@jC+LzIrE@gW+jy$Kgos{jftF>hR2W zR}v1PEp^zq!rOzT0-xrD5LHYgOw7TOVe9^5u)J+hXNLEhJMXlLb1LsXrG-_biP(9< zJ~(+cwN_qbUeqa0H{Mcv3K#8aw|FpX!M_t;67EC1)7Q&OzM@6D!_Uag5kaT&mdd;_ zeg0CbvFR5b*RW<!e0qUS6ZbS)0AOhhrxe(4LJRke@QtDwjvS4J!!|zq0SEkD&&G{= z1^%{TvfNvF96pcJ!+$e~e{Q5D4~`zd4m5ZmvJQnfsS#$2hawZdS0phT&7mtT)uX2J zKb!jY9b5Zuu>LRJ!=aYn#HtqjH7diBUiD7NWbK$nt}(q?bNz%3<eqVm`oe?6_g>s6 z+s_M!EnfV{^{`3XQvrMIqwn;#_O#@olL*RU#T(kTrphe|v&JUkT8>>n+vQZiC%Z;W z`R*RH1Neqj^%5!~C}h1=Vya5r;D^q>psn`OZYTMASV%q<Zs3o19@I3!lKmyG5)rJD zL(s^ebmbiaoVITCgg+GZ&5y3wM|pxAsF)q+rzD(lwZYt}n|igCznVUH`aAsz%O;n+ zxZqp8utm+g%zTWx_o9>X<u_bxpN9uis?s$jK{1UL=%`B)?4<TsG4;!AWs`lG5^*-> zfgl@dEiHl*XSPl|8f{s}dS>Sm#o0rXt0L-^NyuDZJ)H%IoWjN$Hd-2j!9rdFpM2g2 z>yyT}yWTpQ9uw+NDGkAgj1ZD>s4Ic-R8~TQ%H)(J$d&We3CkM_<$@`%CVWK~PT;(1 z?so-)z%e~yoBmV67V_y?SC!IK_>JJb<CXK~Stee6Wz}2MtME~@p6Pm6JcI{72xu#A zGEl)Gp$CU1KfjbyW-FwCnb7>y8O{#c;MF!@OAwaOk-=g(<Rgs2_HaX?vSa+JR|wp& z=#qXBVhHI?2uRs^MZY0C1g<5(fk*zaz}AI{D@7;9s_q6yPsGH0bk1S$wcztb3nP?; zaH<9lW5`|3_rv*JIIyCB)(s98krad28W4X=k#8|;Wfv3X8*^C{r^yOTxTP3-5$-so z3c!wVSFtVZ`_i|M7-aZ_pKnk4srnUgI!ji$LPt@cljOu;SfMU1TIvlPBBVJQ%|1|s zL#={7oUV4~0M)F_4LOj-Qz~^Q9Bo5qtk_%z?!qHJ45yIX;S4_*LikEBzXczom-<q- z$I9V&sQFQSTbKhx3QWi1s0(L1dG&>+72_2!hLO@W>i(8BhLa_5HVqDb-W;0|=juV~ z0jNV>07_0^_#t{17K$~?Rp$~(51heDok+(g0*8u2;j_0dy5*d51syEq2W|)rcYvFd zf${j@D*xC}@uprge7>~wTu5op@!geQ$c9m%v%E-nM{Auy%uXjWYIk&4$&axiW>)7w zIvp_ZXU8q$?bQBLXdEkaZ=$23a2FzAZBolK@fLKT8;;Cc?@*4wiS?qZD5BeWhdLS| z>LKpXwToSWzCCb_4FP+NJOug00b;EL&bMW?*yMG%LmR3QT6Dsk45)asdt=Q<0{qdf z*u!m{<9%=&d0ibmR{XgK1`h}Jz-2&T9bDqj4(Q1pgfKDqP`Y{bh{!e)7zCg|0x&F* zmBaB_l>OKNK4)==um*V<o%4dNTFQ{wBJcQNE6y=#QQ0BFRa;fogt(2y&YLo@Av=C9 zA?NdZ1y<;x$L7FQR0z2CBZkxDAnuR(a5-Q}h46~{TSIYERbvUj1K$QzC&MKWUQog< zxMnm0x9M!mSrBJ}!yWg*nc+~c%Bw+!6u6Z47@U7yc#%RRc#<?tc(MI?|1=w8hKziN zZVM(cu?{JvQns|_&Jcb+ba{<%I0`ZHLF_=Mi!qWi(Oi;dAAG#c-jY=L5j_!%G8SY{ zI;|m6u7=TPAp}X$p>!&ejN}GrIl9sElnxzTS0}UX4+23JdV^t|ko^MiozcV@u?HNl z3oGQGhybiwUuVY-O8~71w&~}t;Nzs!V8N>D9}UK;D}@KzN=1-;emC|;iSU08!i6dN z<M3Ut?*7kbJ_!5<b2#}86(%1gp@C@O@N(TAuXRD_x(vo~VFoHNv?o=}6Hw*v+|?Z^ zKdlyrHvsqf%YJrggzSb=LN=Tmb?{E<r9WgY)P+QYQN5%P?i5a00oJtiR4ANE2Y!Xa z_s$g}bQK?60y^Au+h$<H6w}RQi4;Q1=+>Y!E4`s?c6*^#_p&F4oAGGn^~)-rU{U{X zBYF!==uTU`@QDWFyKqsHL=JB5(Q&!)N!GLCE1ak|1$wf=Qu3Q93c>K)0pka$=UyU* zqdNGoJ4RW^Kq|@;N1|oLl!f-I!p07&(Dot0@-Hv{c8R=Gea`<0r{n+?OseorGaxB) zubHAKR;&YX;I=QX2A%|-IPxnVqFLJR=-LV3cnvSB1scc{`1CLoLEXvs$y|PRck14P ze2VknEjpf*ors$m8Tn=V+fYGdA4<JV!KWlXX<R`^9h3lYSpIX%i(i`Vdk0_iQ#8io zs}zntnYXkTQtr?2FX}-zDM^PA=6CQ6l`CXlj)mSxX&Gog+yW%V%bO)St<L~y?eXm{ z6+hn<C58-Dp`85d2pK66AN)Rh1ze$}W(IJXXqL+Hl)JudmOyqd36af}rBLr3CI<)f zrg*_!Mz~ppZXZ(@fKR*(PmZk&mpAjFNr%t%6x<A@Z8^$0&g0c9g!kt|ZbR5c@4y5> zs$GG^IFNCAp{eGoW6qwnjgnfUq0Uv9o^Cca{aL|*(o1>1CRXIh<v#%H%@U!Y-SR@) zBMqhIk^)nW@l>C4u*-OjQXMNZjYTRHJzG4z#;e8Y6PtJoq`BhV)rPt{OLr`9*O9bI zP53;~?`riu*%{ExCk1s6$-}pnAV?B}Hi%a9tQ{Bp$c<+*;Fn}l)Cb^qtVo(WJCSm5 ziM+HMXC5f9Y*>X~E}*b~r+$x@H1l}iI8^$$^1)TtEIzYd?6;Oj3~3;z!G(&%x`7WT zH-Zbk<|-Q?LA6+iCwRao;qTBaYCw+KUZIv&s6oOpxT6ofbvmOCk3W(!as>J+xcO~{ zjx{MA2jL<XX(xdDG_e?YmSnJv_mS(GoYSe#KjWB_`hU}+;QZ%LCeF`;zBH4t1njy; z(!w=QPg?{c9nUv?i=k;cZk6Gqeg${en!pj6x{RawNS3}RxFb~ZG*|b&xyXqov(IA9 zQ`=Ch4%A%XS?KqGu49@}mniU^95u(1R&AG@=);#8Jz^I7Z4Ovl!0&|yEZHdBGXrC< zkU&Pc9N#CAqPol`@ZjDMTtl{{dYEv-HT?amCaN(6J)__S!ID4&x?0Mx;>^l}L3<^p z09+)XxLA@piJD2Uj0!zuOoe_PVDBbqAQiZQ^CNqtqOZK(M8m|rM^NJ?KXv>c>-0`- z4I2xdlm(4D$EgFaK^#t~@~D0yGt!LsM(G^h`uXzviKjo%#Vef7@b2$Vu~cl|dojQi zpR()~neKW!cd|C(84Ew?b1&E6<nKC1e>9XG^oW-UP__A!4@Wrf6!d9=4o#)y6;kLL z5hvIueI2)nf{rw#T^UJtq*WTc)?abIt^gJFKnDOnAadNfgt(NI6lZ-}Ci9ajmf;Fk zTAn%kqAN0+d^W>C>d%#ptT^#I4o%?lbMd&SPB4`fgV6iR7qupVHajJB)1;UZ(sXB6 z)EPXyM|IM|z?Tcspbgoh(2R$1R|;f={{Y1dhw;@P#MwCGBsgQW+LQC>vyL@`aVcxL zDOai=Pp`h?$_W;wI0ahERpWH#kGDCGw4sPNM)#@lg0?`srV3|k>m6r;9Dgs=qA8z5 zIgS)GG%F8OmHW{XFB@iI(gB*1F~6Z&!i+o%jFA{p5J%<A*+Q*hsvYI~^HBL9i^Dx8 zcH*YW6UfH_<1d;%1t?+jiN5iIwnsC(0T7eQZseYZ-Z3g@#|Dk0L@SvFe$=b^|IkRS zPK0h_q|uB&;|jQ62Cd#`IN(YWfTCViTVCwp-5xm-@Uph}LZCWFvUIak^_%*e)z1&! z;To3fdlbt&WMA@^j*0xl@7pI6>QSVEV>|k<$~yafMXQxbzvvNX<WTFpjXl+{ozeZr z-~0g6(XG2CNr8D#@`)7Y>q#U*JHgdrm9-A!>^b3g&8xQ}glfps(zppXNU{m*>1R_G zQ%%F5@g4L{3xHQcCq!01C1{TKtpE9*fbNc)_zUbSXhs(f<N!?ocY1|5o#KBgfYxic zg$J4}qbXJZnx3J&6Ldqg-6VK$ho^V@Uf$Hj_2n++qgR_t7wF)CHwSw7Y198FS~zvR zT`kO?5DEL0m0tS%Ub(JJU6=c!@XXZXOcnfDtiU{P0|@|LeZr|y(KpBa#!*u~*<(CE z#TYyei5P!F*qPiFF#ewO-{jvJbG}<$%7i&;?#3?NaQTR?%#%KPxHy0c;Gon6mvz3@ zc_}G6PmcUHKWIj5Saa2V+J}MydaTJxeU&szB%cd?X*6CGy<lfN5TxoyWMjicHgP}q z@Ct^fo{c-EaaKI4E1<an^}nLuk@i2kGJr;nc|gq@CDJ&jQ?ZxozUe;?x1D7Y^J_WB z^)KwI)(v<2Mtv!YuNhw8`{}fjTV@=7!B>~AG^C}gOlq@&TU(+$usN+CZYWH9|5^RV z)EvhbSj=Udf6|JdB5`LF>bOWf<_yPCjAr-vP<N6Nz_R`Dbp&73wv*ys+^WV}sm?kd zfLeTp(-^*1U**4|fHER~CD0OrFLnzF5McPQT`_gm6hQ$!Ab4$FUpo3ZYMVH|d~k?& zI_fYqul%8>^rtW>-%17)Nu1<Se*&L%*8VkAQ_|T#3`({aHVBiGm*6S3Vq(FRA?u5( zWd^QUJWpzh=oo7h3xA(yx^$s&BXsL*8+*j(O<>B)jTQ01N><?VIBUHVdU;ep*RB`| z%4bD3ByJ2n77wrsu8@RqQfopJJHR?=h`|)otXZ0sY1C-SUseiLK<$cr{@d{GiIho? zk<>aDwFKQ63+sM%mPfx)>MU9*jj!zi9}MnBB$YT>`j%G+pqu)W+7;6=_OAgVgKWr< z^sy@CLTG(tWxdQy**lou(<0~9-7hw#PuFE7Sf)0PaxDcDS+2R9F<lB*yKs**4myxl z^f=*Wv)^G41~}XTrfUvu@*8n#^}^<5o-yESb&LHts9tmwcOoQ_nil%GDR~18Z_zel z84>Eh_hJ4zohXH#ps=EVIwjJRuyaDxToL_|orRh4F@~|m9|Z&EIT>4)p+35(w;)BF zn314?o?XB~AJ6ml)JmG>S^t!3H_57;IDzR85cp~q_-e);mneik>n`=VeUcdaiE-hj zFld&#X_wSlMyx3fy}?hU`lVuvvmOgt->L}1!N8&QEaLop%#}2=lLS<nXHTFctjXkk z*cJaRlt}1R*1Cu(H$vLd{AW$-_X=>q1JV!|z0=5-rw8%^3c4tsbMkfdgKFp5X5$hv zMAUaR$@oZKR^T`u4ZI+wm+^x=rme0c@IevEV3rd%f4Swi6C#c!QOWg$uEIOB!JH2@ zH0AOe97dA&Q7va5Dt#)1ZO>Fh$O(PvQa~{OQjKzx+Vx(!lF6ZzqglC%OxNt|X1cd8 zN-WIe=5V=gSMUKT5PuBx&<tK%@NzyFrQry&M*1<|>-xjs3pCZ}^}B^y7^6P10ktnR zyn8Hl=Vh-mdUs;fGiWm67up#5-r~|*;_ec?znfu+?1mq7vI}d=E9!TDJ`?yCku2^Q zOUn6~RAFyc6e^5aCs8lqno|9FfpDZg)p%6Kl^hV7e^M(fg8%dQSSU5?^?$X%`f;=H zw*%0~SB1TOM*MX`9(Ql;`RQj0k@>&pjy(bmYUw7mRfX!?_JlBZFy50QStLz((6(5! z=XMBU`w!xkZ~gY`1Pl-;>$>~Hy}6(HHT*@gzp7uAHxvp+>wqrWf+f=(gQ0Oc<BPmV z{UiMY4FUZNrQ(+qTY}1aQbM~rG>3Ir@K+8c$!ok}9SGVL2ifv5nJwC6M+XPd#et`E zL&{;#kGBkbqu$4v|42%Ivu00Kzn6P_FKSyI`jz^uU`a~<CQZAw=l3&(y0;b188R04 zP>g}Y$sRzrWq)a04m0TG%F=;07O-$rNzui|I9nu=cF*+7VcN8%j`vw<o_aQ{lE_^$ z@}(06NbtKq#_9B?wjj=pTz(_3Wcuhp1B@ut^vrlek#eE<OIf(q9ikHbYGfcSDShvk zm!8!Yl}Fc-oPrrnv|Do|r1mB6g!cvP;DE**Ubx;h#)i*Rt&FW5ZFKzcjc$ieiY(7v z^%57jR=*dV&@6t1*WoRy7z{naiwxqFZ>_C851e{fQ*;9xZoRVTIj}FJO=u`x#O5bl zE?UX-mln_rDcBd*HUte7NjY!3jEQqJY$Y^B_qySCTMY21j<5aNOMM)yQ&gTNI7z;w z4YjE^H&o^j`8*mG^(y{L3jJZ7Tzmj*?afuTnGWu#g)&~cNplpx^IKk_{Yt-El>4EZ zw5v<-o~G3!w`J;-`9@uiP;&LqNFDcnlagx@RB22~1svSyQ3{N^Mzd;y#};067XG%) zw6LLF_~l*sYSU}G`Xe;CMF@>EAX*zRT>#M_@qiGKr{^csc|kXDv|OdUre`DPEHLlg zUs4&)T}*~dwEL6f0^A9`?v;mm(9IouNe^7xxu5rzM*I>50otUqpyO*VMIs9=>c7=$ zoYi8kBW?d=>=WtTsfQ4cLg(j_23f)>)SsNBEe4APz>%EhB1=rH`9Z}LU)Ua*HMOVH z+49^Cer=CQtNL27(qB`eZ`dT+9}pF_%j_)snY)J$iwyomP(F9BAi{>hp^(DWTL*MX zz7E~Mse$4|@c*ygMycTRLU-A3aYuVV4OD@c$!3dB2wi?YD_#S>Qm5A$R8}~c*9`<H z#>~@+8zuV#HG}$#?kLh<+x0DUe6MNV<6f|_k-JK{P15b;51mv|s%<uAX1bFY2D^E7 zgPF<=`CEf!8zhhAr^t<=fj#RY$IM_X^lf_o8Oh_*Qhv3BHc*}ZnTGw#vG@W0f`H#z z>hBPsrs*h%sVTrs)CZjAuzdZ@fX8(l>RbPfU<tob4$+wU048|KX^-XWOAzuYCkovr z^3};gQ{^e{XVU6ubGxkkM5y4<Et++#ID+6+`?DgJ#I-neA1<KpPF=dhdybkMx_YcM ze_U;FXb5ePY#nj0FqpK_yX5k<1jW|3ESd$!){xt@Yh7LFrzj6egD(;PS`7npAlNN0 zJs5?uvo+rpH#877j49Vu_n5ZgQes5E8-~UT4j>(CuvkWTZH?{fV(tn|<WOE6H#{>U zuzV@hsV}u__8=FcZ|lRgRpl!AJew@=TBJ9p90Vb15Ka3Flcye8<5<Dtz!Bd|eQl=9 zUU&2V2y~nQ?pWGM8RS-+E?87IlLv9;s25!J!j&^+0Pg#L)Ew4dq|0b$&V9-iA+&oT zu+a=A4kvXeM(!G)nSdZ&!k0NvBsZ(8w+eR3+Z3Nw30)({48{$Qb9GgcNts&nym)G9 zjR8ikcJ;Et1mH`<=BA$Q>5junhpwP<gRX0d#Z?WP$8LOyuwfhI$+qX;Y|`^<I5RR> zbTFz~=_h7!ES=SGwX&S#HM(w?D>N~Uo7c6Oq<U3+oo1xK@=sS7g)&YjH|uMH`t@Gw zFRLVLp3k<X8a9x>w2baNhSLb_2#${abEV8um)78Jez~vRvUOlYmz8S`T?mkLIpRGk zl)0DNL4zQr&)Ae!go6hm>?v7ws$g_KybJ=?SMpFstk&vpJDWVuDL2S>`iPU2p#qrh z>pHu-y58NVlvQjUF)zKGo^i!lmUbC9LvcAm@<2Ha;O8w}UC+|H^6(d3Z=}HE-fNIJ z3(pd2xS&WzpFlsp;=v4MKnE96pEXEP(r%DdcRM+de<E4CMQC<6FYAZnCD~O9PSgvC zBm12-t}fCaR}XJOT?7Ql@Na6k+`#Fa;Jn1tFt+cCYNlCAfmv7q{au9G5|D9d<OyNK zNODIzd>HvR(y5RA5*zGwGLEh0OP9jvu3nr#^e?Y-#PUx1W#Q*9_>7nE+UilX=Tz0M zp(yc-fT(BuEhRcubqC|AlCr+fzrhz=Hb{Ep14{zAIhpi7uj*+@mzq3|^lN-24~|M8 zr*ysha-_-iEA^CX4PTPbAm_D>RRbFuocIa40G0gDbOnN;3n6zG)!^dfEBVz119@ot z<kdbh%ewJ@y3<F!=}|wzw|L$sp5g{}n1o-YTvpGg6Hb*V&WA72xYw@X%Ph{xwH}n$ z(EnA98r5zN0rUlM@|^If*~uOUgGE!73X@@Uzd~8nj~>c9Rp3CGnEpR0eYTbP%P!&Z z(8x!EbN<Hq6!PVM`hXa1s@eX3J#!)A(mnpU&G^{t6!Ydz%c25>a>lzJwEx^sLXC!h zf?;27RF4{rI~&{u4m1DG$rdkxf&Xh<?6^mAY45En;URc=P%><McIrjVtk0A6>J_iL zBr&~H$q23lT2`etR7L*qoX<Fj$-+EVd_-EUivFpsO0ei!yM}v_yyMo$G4E6qB-B4{ z<e22mAWJ~~r5O5XB95VC-+J|^>p#?H*J^&oA&Sr)`7+4?U^V}nAeq!L$cLF+Rk<Ph zA71L|rR}EZ4I>3YADMi+1NsaB4H*{~>F9n-MwdReIkTO<sso%iI{Iy(<*RYMaj|99 zbcrS5r!<Au`{!I(s{w_alGJ_ib+50qEG>Bv%^YvgKTdxj-23Jc;i6Ee?7ws!cpb!% z(ux*_2EAOdwckCtc1;@a@9!<aG?K$Fx|<E%ODy>lBh?1^@B39=f=oqrrjF_11jaiS z2ui$fm>rG=OgRf2My9-BqE)-5;ZU{8X{XNEImjEpg&MBK^3jxB{5dbu+Yu4Zeff7m zFD6!rwUHpFHr}6~QU{Y;e~>-8qldCDpkJ|D@P|BZy|Wj$v0bt+v_YujUQ%CxFp;T= z<J?m&3%S5@>V^pJ3V6RIQL7K52^xLq);O9JD11T~%(u8ycUyWgbQZtV+BJ1;$X2K% zNZr}2X=^~s6q>;be@NH6rMo~9h|JZNz+@5DOTbj+xuH_tF+72zeyA}P5wj+toLK8M zUA7YyXOQnB687-Tl^1~g`$qKQ&UOhrtj4k!p4jpL%G5IXfF|X#MWWdc6->UYTm=Zo z7oSuQv!6TgqGsX6=lK9*&gZ&L{#1rQZt?4`5$1@SoMjj^_)pMshVhw_^w=A@DdtVG zcrS6D>{((^BzwhHjKY#!DNn<?B9@Md=|8H;?Ze9<you;8=8g8|LIsj1{;~LKRl$6a z7+R^1-Uahz%ZOy3Vz;78r|<d_{kPqs9MCV-miNd{f<#!_PMs$5d5ct6n<nVQK81A! zYs()&Cg;~9X7B3v%vF}99ZO7=VE*@FdfO!q5E1v8Dtlp2k^-P}y?p2Wb2x!u=cIa& zS;4W9)nat9*y3YNAQ84k@*62kWTfKmYq|$!;A<hjaZ!g}wSaG0`u8fO<P*MSX^=z~ z1l+N;!=%&empUiN<$nf5?hQM#0+$B+-4)ArMHL8}ODP33D68lck_>;pr?Z6900GZk z(chuPG3_|r!8b0&(`FR%0Xv~&#Whp;c+DzncoH1FRPZXApdxuKN}7rmuIj`!a~=R? zZWAb+Oq+etV{)IARZlx%Q=UlaOONuSpMA@_{ZRg(A`MdN1&FIx%}d*1!Xz<>yJ7^H z;wJTIbos*_0m4HgQ`+k8=v~URkPcHKdKPN^;;K3W%G_^BEP$dGtR+8<^W0RU$Hx}E zPRy}P>9ROeM!lMANmo2%)~gg8;ZTNNr&eE&=+HWRQe}DWCRuukXbZ9|2D)Q-EB%4C z=PfbaK`EgOE5PDczdrOU5+XLv2L%#m?vwq`feIZ$bBJsMtur;70vK8kC&FN836RD- z5v*csv7!18JDJ5$p}?knC3>;3(ib5iRO*bly8=ZnaQE{*mZiA3QNJkhkm4zrWi~Q- zeFs)3qov5KhO6=TxaSkyby;+~&^)bCaLh)PB9?za;gKo)&|+FWnOfcB`YZ9&rPs+! z?BXU_)z)uU*s{Boh8XDB3iVMYqJ;Q{nFR%+&j)i=v@LmO%xh=xxK&|_F(|zjrrEC- zUob7bg+hw8Ex^L+Y@AtS3w4~J#`o*_wK@bwNJ0S!pA32>`;8r;fn?G19*o9Bo?^)D z<Hub&V+NC31}9wb)L(VS+r}2|mOdh(V!)2m`#+IZZ-vz@hC=TF2U<Ch(ukrAbe|Ts z6>{TbXuF5l4eyb`;_Z!mI3OXV_STr)2`o{^-EHtbCGL)j^b<}Hu{s(GR9^fG+T6kG z)=ZS|g#``Ri-IcCO4t<P!<sf(;=t6XJ_wm|?)SmEY%G{N+;Vk^Bn&N3J=`gg7{}D2 zwyFMy73ojrP3h%-zOLNI`8D`*rmf(S&QzTAf&^I52V)V1VSZ(ZmPQ3e(-PPf$YV73 zVCe;EJ(4|H+4Qr`%ax$-wnK@w-mqqvSSt7P>iEX1E(HlM;`3J!wnMjyG_c`@-^QGO zu;b1g(u#BCfY7U6r?H|R16n+b4XyPVXb7~N;Z<0Zdw!F6FT-rM&hXJ((-(rsA$SOH zk-*Yv@nKG2^-^;6p6DHF>b^M}K6-_#H)^YN%JoLGNuATZAo*_s4eVL&Hh=ZCOZXUC z?6Nu&5fEA~EZ18#BAHmARrgGfgkU|w0KDo5YgjMyzs1^=wkA5rzuORpwKFM8|0w`8 zF+YbBi8)fr)Z~;DHfqUtFBeeijp_G~)WEuo*Dl@}8OZXn#|YH~Dt=sv^dF<~$LLwk zEHV0<VcQO40z-kWj;yo<>#_{+yQ9#)9<EgIDFn1T*W=(IUW2cgNwn+dS>o>o=pVnZ zV&a754CmJvPxe7VgWDz{Y|=olUKUg+kl}5AW3lWpC2U66qOYo8af;Mx!<l+xly%V! z1S0IWLw@r~S?-uezTY6<%kXT5JPeMzpaU(Sn@M>L??iy2<}ox|mFsQ9QRn1PBvffX zNRqKwD8#`I)j;3|IIxwF2rFxpX5&yX9QBblOkcWGM9N@w#{A-(YW<Hs++X|Lh&30P zpSZz!E6>i$ltAfhjL&}|H5REl;<bFTWrNf=lY*Sb;RNK*xjofLqLUn>gs?x6?@!bQ zXDH<~uCrHi#hOLzzxg@0P~cN4`<b7w1+z-+rA#B%JF@g6?S}Bnff@t5Sr{I4<zSN* zooO$!hSaLvbu}RhO7vzj(bHAVGaIf;xV>w1J>pNGBZ*MbuBY0RB!FhlR9&Qlsb4ba zu)y^4Wxdm3D{H`p3oVd|_r#gQH$+XdYNr}ZseTT$Zhess6zmBzdZ(1dZB!hQl31s7 za5mXd8<8=%c0g&q(vn;w#Zn|_3zAcyA}GASR2Hvp9fLh$wn{9fWfB;$g@?B35@`)o zQhTAj0cWoz`Kt8$ecrUv!>q1=A2veoVvHqp+Jz<>X{w|273ma}53nvOTMQL46}h-3 z5I@|RB^o>=G~}$Ob~!qppKcU3yZ#F8j=+WuQo*G5@);FJ`p0BX67PTew59Q@DLGDj z%9^AfqCrYTu8?vgzBz(Uc(}9iOk`^3(&L(;BqaIdHm?H2Kp8<{q7BKC&kH+ak8`|K z%mZyw>Fr!65VrMNj@6Uxi#8@!S%SB?$gom5E#sO*Q<bfI;RG~;0vj`*XkvI`21qMj z;4tSt=?aHJ>?uX#Q0YVjujbyyB|53(^o+f2X>ql6Z0$NYFq+zev<a$TO8fpzqMC;Q z&Am8O+E$fReSPS4O4&Fs_cWX-X{J<fsl3O66bT_Zz_F|_+M2;Cw{U!=d~4JdNOeeU znE5e@OAlUwcdGg@ih}<nPfcBY8J1CW$5aV$PY6^-BsNlu)B!0hDh)SSYzrThqrG|} z{1a}eqb9?qOG>T!*f<LjVL*G?DlFx)cXHcz>|a>#LAGY+vqVYR>KW^ktYW)*_b)S! zrO8=hP583LYD4LpvugE1<VAfa#eBj$4TpH_s0&Fo6K!r=3EYVFnSn|;e+l(;%D&sY zyH!%UE+kGvilbrqC+q~k|0@eq+Ss!tD#GfB3Z~l|g4Ze%TPT{GUCYwmR`6mke5jsQ zN+epHVBa1juV(WrN++yf=+;p%BvykoE@=q9UK368@yyS(kx0ZUOZPxFu{{W_&agd` zsI95hh6d1eh})-UQwc}Ep~O7RqoX_M^;Xa;G0u{jGXr^7=+C!T4~L*kG(Qw2>gy;Y zXOOX2GO`kgY22ptV=?t26+7yV6sS5l9bW+l-<QC>9VHe$!V*A~E^SCO9B3EAWpqV~ zRkwqdbV9B`H^EwHAR`?x5NXD5pE|3CG$oBbw>j8p0)jFRDc{bhU?4l2D9572O4L(n z2}d3kB6Gpa<&>yj?P)QO)rruhcir?tp~diixnSRy+B&)Ns`9$xdwz3*M?W;UFlp)n zg!<`k9iN{*ZW%BBtcLsBj6aAC(}Q$N=nEMdnRyi@K~9w1sp$X_9(q#r4PD9>pP(WP zr0?j2Wv@;Ibb^kI6Ymi#vIQdTTmkn}DS5lBmT|$igB;a<)!pP7Zt63=-Yjf^?g3Kn zDqTvUZVOxt<h#&%oY&B;<a2HTluSL5O(g=Vb4#kjL}o6^Kw`x^d5KnO=xLhda`R6k zRv*DS(&)f3OI)0hOT<V;{?6ClG?xF>2->o0&;09GJS;|oTm*6mJ+-<$5{qeE$>s8E z4XYjhF8`t<z~dufwPpdWH;X!xRLb@yl;t?h@KzBY1aVQIKtZhPkHV75q#9v_#nG(K zO5QdBWfM2wjetKOR!R=S#b0brB06%)z0jqR7FOy`^+){$+To%<$Zds0r*PiXinN`l zzU#T@M2QgYagqmazHZ1pV<~no`L0L&1SbvYLP6UKn~+1ShLymP9^ZwEmu0e4N(|1n zcA`}?At)H3YPcc;=VociQ{-0>J%M0_(p&+9%*Eh^$YXu4dgKk|V!5zIcJcDbswb)k zx<`9{yczLVLDe=>((UD<0fV_sQt^9}_Nl*jh#ap;N-TV}s#wzP79$xpIY~}ti7p&X z{i!bPx>#aN+|?ERnt*Hmm$}B+7uFp4v}}=}B%><Otc})c-2RnC?=u8mlq+<up8@nh zxfn2pKsbwZJuQwqGtJttlYLx)LKWqyFXLu<kNFw2X7@r8D_$i?DH7>}fq-Tmca>lg zNo+xmBWa3=yb}G|5G<I9d6GDkQu9R@f!?11z*#Cb%A<DWFwMEx5>jVq&|z1+Aqgsk z6cF{YDk{-PlNEB>{VV_YNZa(Y3eS|`^|F5DD|4#H_Ng`s8zrV&+Vjec@LSg|e^{n- zFI1E^wT7-UrZNd@6si9Hj#6p<Z|WoSLzU29KmihX66$fW1{RTV+uR|0%fy2_aOj>m zmWb?cB0mF-m%FG50w1YB5e5`~lU+%|jd2+2RN`-bXuLFp2y5cEp#!xf69lghBdJ^X zpPlE}#W5q6J%@NLl9^>wC|z~1T)?9>!l=px-3FvTkzC0HZ86REKd5<U%%#EC>-KhM zt$ih7)pogXT($o1Z`bJEGRk~7ywNsG_^rYBcl-};jV3F~q2PX3&dOrhL`}Z<QkOii zK-YI&u8mC)RP>yk6g=5K?lN7ko;WKrPn52r8w!Ca4A<IU!nW4OGO$(=J->WZM&Y}q z{&3n=`GIT`+|Z|TM+_*IS&0r>>!21XNDuQM2tT8oV|fj=dI13|BtB)}wXA`BRoz-& zeHiODVb)uQn-^W&XpJC{ZK51)^X~Tb2az6~Q2;Wv;keTozYxM(l-T5*F^EQ%Ptj!j zCadTnqP}1b#B3|T2XNI@Y9H$kx1z`2ACk$$jt4IH4Lqgrc)cRLQTBXJ;bey9{cj66 z$Agl86F&X;g@s&AprJ=@s41B=UmB2W6lGk`LIb^hUGQ=2_@7Pt_(bXaCv(Gc<&xIy zj6b@kLEDWhvtb65>4_pU^y5*(q56XFf<mD|hCN}?<b>1(&sMqGn0tkM*Sgw5q`^mY zd!l6xtyR9KRpJ*#%7Wq4Bn?(BeXfVjQP5OnS0E8wL~@a!*==JPf)rZ96ecye8N=+= zI8uqVx=QlNh-QuYeD`9xn)UufEs)NS4I3pITQCXt%6dFj9k|}~{;ni}v=h{P3Z`$C z|0tY{LP4PK_U8WD^GHE}(K}tToHDu!I=ZP77^8Qp)OWIevVZRUuX5$k$Yu%hHcJGV zh_;eo1i`Vxl2437kAjFM5*}j_3|5)5)#e+IK;l|fNk+W~(ulNbC#5?=$46)o20fxE zd0VT^>AHYYHKQ{OGzto^5#i2`;BEJZk{x5z=BaIpdAgE7r5}D3NS|424J?p`#qAD< zYqoy`qJ0(Dlui*#ABf5LqTILf{L#46a3yrA(eZepQeb#+v&sE{MX$PkzF^#Ko2IyM z^Q*$f2~TzPYpEl3;wOVts@Q>$uwheXlQ^VhT)yKmM&zSBb_y~kXyu`6=PZuHOai45 zQ6rs|uk%sUpsJLey{(+m$(eQpY1*T2f@UMuovS@y#WvF2R9vpFPV&*`LMu2%T)4lf z^(wS2*n_0=kTfbyx5&fjXGCooDeW;i2I7rEDN=NwF#!9-f+UQ|r)YK%p=qpfx(kHu zWE#cVOIebqrX2LoMx-A$Pxo*=pA(vwRsL(l<Nd7>QC9;@<FTUx<Ccm%S?S@ygTb1% z^^J#}0(Cv_<?!AZGW`fVk}%AXh{tlLYMSYWXY&=kM@SOHl97aYg)K|u_G~OfJ+NpT z<92FR#X)s9!XlE{Bw|$jIFOqJ)!eFNmJXr~q@gu?y$l*;g9>mT=u6_hk&Q#@{$Gq~ zR5cOgVpV4rF4;9OdSt7!5Jnk=TTpU?UX_hQl54ImBQIH#+cL9F5+cL4zQ-TbdsO;o z-4abp1~gC;s6=<?9(rNI?T~1I->tQ*ct#y&*|>u^E))7RYxoI_%}`e;FGCfhFNYw3 zOBV62zsP5#6kA5Ya;!L+hJG#zdP<iLjc<vfFBYB!R1@K4N}o?QX{)ffkAnh+VHC;F zuSSrvX*u*IEUr0_U1@%3BBct&#Hl<G8^f|+_LRjMqK)ETKr$r<88!?(@{G=Tv}76U zT_{4i>4!yqo7eRxLW?n~Y{S8Kf|dOtg+&hkqeQYGBT_KA-Q-1S9D^7vG%)-qO6Y?^ z$Qt5;A2@++L>vP(!<~wfV`{-_x?a&Ku1M4GH1zZXRY*`B#py0(IA+`n`cTgSXVlFL zwZ$c^sYY0;avklY1M}P?wT%axVFGMJ15ig!q+X7lffZ|qw?$T+Fg8FJSgdqRY2HFY zxc4ae3L_G_WQGLoVi{pWCYwNWd^!}7LM|oNs#SN+91{`qtga#r<XfR%pFY5s`XQxO zISZLGu!FXoQIi<$SVYt}{tabs6|_bid76^|?Zw#+vws`T9d@k#t}r&;)Gxjl44cjE zZ^;xFi72peArV)_s&$$X(##mkC?c&ds<|=#9?2?F-|w)*oKYexpmwa9#khYPYEMh2 zXyZWmWK*lu<=`Y;7*WZCVK!t=AV{n0td6Gx#j+S4#`qyy)ie8G?U?q2<er>rfPRK( zP`Gm~pU*(iAjzhh`yXG`Ap<Q6s_{Pbn8l(sxH&hpIG<F1n`(xSW}|nOkhDJUy=xKc zv%=@$R(LoFK#$T0TkLRRMkf~5<{XRR_77Ef@MS`u5>qNuU2U5<Bvu%$u?o*<4@fGM zSZ|G+LO!A9fmQ?UKHL(Y`UV6It-rB#<Os|AN@qf2RF_wFY}lZYVd|Zvg<r}-+$tCT zjO78IVQFmqe4~tOG3)DGE#@ahp2E5{3FyXuK~t^ocbZi7l#DC9mMexEsM9+6R=h6t zLB{CFv_3(9pfG$wYd%b$w0(7rVrsgPixMf#oLG(C`t2{ViH#X-zF};F^#RyYQr59y zZA4ogRI6|&wEwh?e~J`vi^CK?#GBv;aZ}B6focCrzPPuyuI~?ywWEn6bt|K{nzJ7M z>)iw1PE&FJGKj9XarIU;&55Be4OmUH<L)Qokoq!>me$~YVfqSH3sdTX`032fq;oqR z?GVE$5)h%KU=Nyh))*k)w1fCTJQBkwZW}&Q1#)2^TJSa%PUMFOTDG1AP*EKSX@y>* zW5_CUW(4G_^SaW&@<Jb7^cy2X7u{tMUC{%3-<=Y3@~1V2C(;yLg~!$&jcR>~Idzhw zY}?zbyMCMN$v+y)*{Bk}_JbyJ%(zE4Rld!vjn_E_ca-{C^2>jBSeb3PT$8C!OqUqV zTKOi^aR)(uHan8mqk02zvi%6?F#=$FO+ztRl=dvr>w|9^k=PPyzJHDArD823B#r|5 zUk+|a+KEr>R%EI=T_D+m)B>%RMeJf$_x^YJg5U){66AVDhCq@-)D``|j{9JC7QTOt z!j&u1oAyuSNdDp%@v~VO9`|I*uKDT7WB#e01*YMe+K-ymaZ`_9cwX1(_BTn8+Thh) zlW7_W`dQp#koU<eHEA0y{yb*+@746eI$keozKM~ESP+vs#RXI_z%v{LttlQ-uE3h8 zKp{vZ^)Pg{AL)nRVu>_bxQo_N+lfS6u`&$wa;HLqvg&Qp;JpWHzSzVVijO&-f;<|i ziX#ugi&#%(e1yA#`&)q|+&C8Jct9~73>P;l@*bIX6lc<^loH9+l^<wb6rNjz9c6<O zjluLf2(6_G0@q6(*q`QLQBCb@DXckA+rdaFW)JwJB{kYoDXrp7vFRN40qG=Pq&hc? z@D(;0qbi5BzlgTe_dVj1DD!|sSjC+c{3I-|0va&!=R=S^P~bxTK-##}@aOVWg#0)_ zILrpMAVnGm?X=}r9S@9%AD22Fh`*>Gd;C=Rmu6#l{FC}Pzb*MP&1p%ENa*>gz~sH` z=le(N`o`<3MKW{6(;`dTyee_#47EvPY{WdFMdC3v$@!mV%gQ}<89hpyWNQDwq^93# z7fb<20+ta5o6|lZ*n+jMKsyJiaU$8P+hd^{f-I#Fe;`_ynT@3AkZ>H4>|_O@8xlFW zcfOy+>PSRcjkL^oQ%mFDor*hB#DA;#o2|D}=MRni@V4jgBoQ&w54Sd@9V+nIY?+Mq ztu`(KIZ1ynA}47ga+0xso_>CGLb&?I%G#zLFDxB~_+?>xhiv?v9~=)$E5Mx&BLk*l z0V_mosD+W71<~9gP|BT4s1V7jA?p#HLVNQNJzy#ti3gz4LNWqO7}>-WjzSxUv0jdq z^&sej!1Uu@>5JwNjC_4sm6Mqs=&no8H^k)}Q&uStO&`yZDD+bgD!3!+ZBf-dLcybV z&FVe5x`f15L!a))Mh+1vH}gF{*7)2C88&;a44iI^^dmum%Q?zd34jO?Ai@P352;&H z7`m5AD-sb#d~Mb4rG?KJbzBmMv%FzDQe=W?WN?8reP%uu30%64B(Gql30^*y4`zI+ zcdET2cHAd18qRZT|FJg2{Pdlv-nCcGS$e*n=zQt>g!#+U)dqdKv{yfp@`1_lO}u$| z#IG&W>idMIbfdp%PBF->ju+ywh+TQC5z0oK$$%5k(?KSK5JAjMX4%l_pVBbHTB@1o zSDjeR*al9R)){cwerFSj7;1<D*@Al@h(hQP=T7uIY>uL^Ma}v#L(mGvwt&Yn(MWdL z_=s?d+ta$X;~{d6RSnXu<At|ZnU?9UTi(B@lhsw~ugGvNMpC{=+m2SXV^i}z9-I-8 z#KXAPcS*)2Z^@tuJ3$xYS~?G|K{~*MN@&Q~00PxpEbgK!wlE^x%=QVTMapCi&Lvl~ z919k{Ay`lj^3L}hsx~xZB3Cp#hi4guBTzv~elB5M^f<^#<W*hT<E0!K?QHM^H8M(2 zvdVlWD_B!%)o+AAM52Ez<<NV$-j3VoH=E_pX{%w~<PvCTZXT6ffs3;)z38-e+fNxi zFf~T9?6a7NMT34l{DcW(C{}*O37HZ6q=k8&LF$NzW&t721Sa?g&=T@+fn^7!oruLY zow0OzM;r_pX~(h!HfQ%c8ZLfg=s#bml(g0p!eKu$P29u-f_=<_3?e~^rRN66yjwNp z{*_R_@T)Wk=WF%V9dV$#XCGp0sb}bd9U>E!QL2@cq#i9_1*&OKT2grgN!l?=p-|o7 z-w>OvuoF?l=3$fPEVN+{Q845cb^m}~oP;gR&@3fUi8MSRl#|OJCSi<};Kq7djVEf6 z7#s|?%7(2G%&go^n-u>PYvmEKKpf~$a{^h<F-Sy#-M!E>SKxspyeL(47<yzMsDKeW z(PD=PB@FE`G{%S*OQ+hG2U(hD`6GB69`q@QAhQr8iRi35B+OyIoh^&fNX0)zic!zt z%7uD5$aO#zkg-wWTZI!Ml;cz-jfV<<pDkL8rXMx~ve&|FyJ(H+@pY~h-5_Vo2dP|& zpnu88`nQ3+91l(vdoVlI-L+%tcy?HT=P%b2fkfxLys;|3R5NJV&*cy#T*~#M^8koa zo@^B(wMbOQB1cO7Q(Dwdb8?UkaDLhkHuy!pV~FjbqOnQC9j0X7kZ>E4NG1BIXs!!( za}uuaj=f^iC?rvqpj%s-BxiL>r7SC_7$kRKg~D7Z>=vc96V*aE6q!9cKv_^E<G#vh zT0-JQGbvQLU>#*75ZElRlM!<!(tbqn=?v)YfzFA(f(lbwu9A66WP~C@T}ZtUNk#&I za8*r<-r8W4F&icL38H>)8KjEr2+xn(1De%_;c=Z@*sWE2R+*;znTg_OhAR?OClK*B zwy3C8qtXU{)VouV#S<7J7D;B{Xp#rqNXc2@5z}g5)M#fwfPqdgRA)1|o5<Zl%-KgZ zi5qI73UPx~So0;Wc#&y5`+K2LB9x?`)qeMZ#bmgy6P+{(#-`=+=`@RHhO2?Y%V=8m z?*@+0WZ>OS7+)~8b;Q7(JWStc4xGy_z;8ra5t7Jw0;;({PgM#PBSHXHfh6->nAbr; zxGJd~qa6$5)wJ#zs>HE?%mP_;VI{201*&jx+e?74shhAGQZWScSX~5<LWF`LDFBQh zav>p65^IDaPh^+6fPUurg&{Rq4R(cay`W};Y3jkvdiQLL`3v*l`!OH&yf;->5$jmb z@%S6Z<2|A2|Ju0ass&SZ?`zehW=H!6{=#2}-zAeXt86JrF?osO#fWfG$;=QJJvuZg zvR7?{d9ICW5<(26VpgDqt+JJn08gqgvPdk6CsE}{M;6WBXdMg46k-nL30UC*2-D<` zp2cd6amdxwB#7Vyq!%GD(!V-Wrg>seol|b97&Rq58E*dHo%QE$8~->a=4=Wd3Ua(K zynYn=`_l|)4>&yD8SbNf3-X{u6O1)HJmFVdw(5n!qCc%@N1}r^1b!t^<{a?Hk%gCN zKok}0K+hlxhJPS;8pEj!3GPRe0ipzq+<@N*towO{E??rNf6r%Rqr~z@wWs5miuE2T z9Kq6mhhHn`mZ&GP-}8)^S10bdQ&k?O-oq@>w)vRdDSiVl6vI1WA!MXqXQeaS=(knG zM0+1Zdkq5v_M;hbMq@-ERzC$P$X?|a_7bF2uuyO!v5u5dF)pawfo8lUe}<yG1VADz zjMOd}QfAyjn?6#huJ3$FYgj$V<(Q|HS(k4)mPO8U6!vNU=;rxxrsaX1-l_~XEeQ9L z4F{mL4a1>$QHuooeC>8gJc$KRe!nk*TJb`^WGfKrt8B!%dbLQgk5;auEfR)=O{<SZ zTLodI>tF)>MAZoMi7eKg6&sZ9F|nr|HQ6Y>!cGV5Ji;ddCgP76_QXa@A_u=caEt4a zaZ@ticoZ%HcY8*tr+q$_jE}tuS2MkDBwDKIb{ff#nWCT|rD1=o&_+iVFCW9I$PvU4 zw5BCmC5eYA|2@!vbR2~XDa}Fz+;Kj^4a8ed!5tQc;LHMBDig>Bc^xq;U1iYuCqJJ- zfi3ZVud-%pSczeza9M_Nw-~ibo#Yw4a<95>^`NKEx$uWH^*LugkW8OX-r{)S1(iX0 z=l+B;-64^rKrI@K==c?Vr~?%fp=5m;Lhr>OQvcYnBIs#CF0m0lrGbDJBxz&Ny3JPM z%jh=%#zZDfaS>?6Cm>}n((7YM64E%gYEr}c4iF$Ca?COpdMHYo_GmVFD8x8S5<^>i zthY9MAaOFO(6v{gGhI}VWuH?s4O?EtT!AH3;qz`Jk_|iL6MC4~lPBcyi)K&&p9rmu zPX{D}jv%ml_CnZOC%bGg%G03u&5xthHK~^{!^R?x$Y?a5pf|He8enE-GDgfmMK2pr zH1HV00{K4k*{P`q+l{f)!HyTKeI?jKW=lH@9f@WsF#Jfxtoo&PZbSow<2-}8w=-!~ zxU#4D;}^7_!@dIuF3uRUok18;VmO<^Ry4HNm<CFr<#EGM+OXwnb+@e+A_5pZnYVDE z*&ydEgyv+{MiXBc55WmWT>02!Fe=x9S#3dybTTD-kQCzP>;R-eSn2@Ul}KStD@7;u zhh7G;v21b@1<p6X(UL(*e=GuIa3Z_-kIQmXTtU`tM|gC+8{V44>Uhq9R!!0RIT9^e zFlHj#-3?0*_m_pkCvHLW6lXW&FRYb{c*pv-^39sAuEor}=nKgh_bwDE>`x&9fkUS) zApix(ZH!dB4};kZ`LXj9FUl1QpyJaWpwjw%c77QWAq5E-I4=zcqj_@B9Ty@oL#;DG zO(kf<wAI65iQEj39i{dB@Rk8>Oj^g?2Kkg1VUh*f?x1doQ~+)MigrOlk}C>0IHxe= z;J~N5J0*WHc)}6`o~4I|x!6*w`%_C|@713_GOT#{$^!k0wAO;jkisXN{_@=3S5^wX zU%cU`NLBT}KYQ(W`-i@Y>bM-DeRKJ(@U*jDyyQQ1R6M%SoA-wNc*Pg@i8Gzz-gpNo zZ~jkWi+e!%;0F=+dCSd5mrwYrn%m-=6_pR{C^5PF4aBvaU0jm7#`Z@}1&8=CKdrhI zCLZcM^If0c>5575;K}~tyPLiEaZx|zCN286)){?nv^4y7?xVcm%c~m8&i6MQ&3B6H z#}5=O9nyYSov>o@4(aijX#a%wd28}MkbfMZxVY+;{@up#`iq;^s}tUfNP9aG9<aqB z^Vx~<q$>;a9`0PTgJZlcJ?MM0WPVlco;}B-V;ghb1H8IluX<o;dhy~NB{eO%UV+Qh zZJ+KrUixh`d8_LQe@PhT*00Jcjci<1UsmVu^}XHrzE*u>Zt>ngy(%X0vdSsWK`cpJ zbSvBt8h@jwc#HEZsV|I4wb(+-{~n%J3>{vxk4Ib1EdE+L{h;*2ly&&?XN;#Y?B+*r z@JfanKJ^lHBP0Frtyfx*^#R+Oa{nOvEO9uj+0LL(3>KetP1-6FivJbaA)Wd-VSd}6 zhch{Mz@V+(@5uQ(Hzc&|I-6VN>(zbyLgnO8C-DH~>5aUa<9oh{&PwcWW(FUVxU<=- z`!^Au+Vds5;n81PoSK(d<Q^&eR6aWS!rJJc67E-3^7rj2D)@Ad3$J}}zuc?aySk>~ z>e3CNAJVTrQt(K1LeRn>X{z`6aP9d(H^9v%=U4Kz*8nJ+DU*O(OS}^ttzM<A@XkMS zCh|->7J8pgI~OG#r7-|6UJ31|{vdm`u}rvWAw2x|@D#_C|LAX(d;!n$QHJNlxMt+Q zjZGerTz$}X=-S0gzfdtR<{y)nM8gfAMlVpcmI4}($J;LFJ}UoJOBrt=yib1D?PO&t zj8nTKreZMGit@KZs|y|#cMZRPtmV_n%=~|$PiY@KR%CwL`okvGi}}f>M?r^3UTE0T z4q-8f%<=Qmjk<q&r8)x$HakPWynX(a)Tlz<Y6Ok9VH7K3nzVlrs+OLDu;@KmXCEc} zxSh>64S6_3^1LIW`#o52Mgz!0&%9>2ok_n2gD(s%F?DRd>$fp<s20U)w94@PWFOB( zx!_A}#k|EE3|*qG3#xb5gg=g8n@9j6PTCMZJk}D3ZL$d*=YOe`1~Q53TTAX>E6*JN z$==qRgD<vUnk<b;gm7q%PEO1H#{27$cX<<)nR3^-lOyjM!a|mx${C&fA@xvEP2_?^ zhlzoXNZsi4ip95<h(mPeD?|Rl`%UWGKSA)tBwpVnEJ9dY5&dGszX-oz_DNX>bW`O2 zslV!|bGY_gpc`?YGLyyy1juc|4OZ*ySo~T^Pz$soMxa><1FLL?jyM?0toLu>?x`t% zHhhP9%B&Fy%_)X-L;KZQi@-cJX&y3ZO!Djn7Soh|SguiD&b;8KQncQ7?c4GP^=Q)7 z5Sc`+Gz-L8x@2|VBLQm1*o?BEj}3WhP&2y&YGyZKF~`Yur^m<3E;{%HhcWnn4JaY? zeH0zmFx$uL$yYIaTD|XlPT1xZgDy!|9s$HWiXT3x+7^5+k;0#LS7r_aF5$}}d3md9 z<p$l0StG;X3r;t7%i-i-#m3I@E8h*C?;5<CN}r-VktrttzPfo4?eNYsyq_)}ji%5# z2%Hm|0C4%2v^v$^B~+XzqLD0%16nSsSS?>`gGUt;Rcl&y{M+mV7I|uMVCaVq(JJv* zyK>Js7RJY&&iPuXy?b!MR}a6F_IB@3)^)jJkFZ%GG=e%=gW&-;b+lxQ!ehIFXEsFe zI?H2S%Opxut|llsjcY0}rg}iT20HkE#p#`D*o7bWU@=W-GXj0#k%HF=V^uaU5%Ydx zVc36z8@6$`cEJ4UecH!5I^Gt?mC4th9NF#Cen-VPz&Y+@<d1ij0o*sXM%VoP#rFGx zD$mQoU!UHW=x|5o-~DKH4bX(kH#IG5AG{UK1VGS-9Mz{G+lO6O$@cqh(EZa?yrun; zDptF+BQolPL#NXI?Noy>d=~TYmXhf$HGm7Ju=@u0)7k0|p(a9#2;V>eE9EXKXk1S7 zB8%Q4FWtF*uy}srWkNdVEBnsa#49~kz|%)2?=KHrZ~f+5L&KzYL%_qnN>gIfYY(X> z?vDTFq_QVoce7NtwofA8J(QyPF<|%ght+9pqziBGD&Wo8xiMUOu-x`X5uZ(L>!c8m zn3p}~kuEK8M%upxEsth(4u7Ow8k*L;Tj^3M{K?LwSznvJ@f*CL`L%yhv;D8)y+fRn zT~_hRSVR=~QncmQz%}fs!I|xq_Dj+M5;YNHsk?+lY00Lu#A40=oU_g;vLB|k1i(Dc zyn)y9aP2G0Pq{~Cjl|B)lUsy~Cci!xfBJ54X-3d3=>lnrFyh7+KL&iIyBYhd>#N27 z9<jGW+k2`XPf0s36bK_zoQiYKdj)rf&+~at*vYdu@EDY3msFC?D+=8IDz726TFhq? z4QmkALaSZc6@)hI4S?7j(*~F+<TO`#>OR?uf#SCbWfR1XPOb^uKbh0d`jyLSLrqvg z$lSkSqa3(@ZE_m?H|VvrvpJ8QN;?^%o3#4rJbcMcrElW`3mmfs@gfWVq+pr51gUI> z_`rUA_UxmH4grPo-Tq@J^Ppj%5pAit(j4izJ9QB|ngRa*#_-qC@Xweo`s(P90h@#; z91A-vt-M~fP_Z*HOS5jJ`FMh7YDz%QebW1Pu9$kVj`uCQR3b^oo>YEcF?r4(djJw- z<d2iQuc0;|a9=pMvbyGMWX}$9&g>*&MZ7x@eBn8t?v3XZC;C!=<$o&NF7c_;yuB+1 zIqn1eePRpklC*@t*ws)qoJ#vUc3xU(VAhRR&L;&+#(v+bZX6H%<UG7rNq_PTexi7f zDTSI;IO{{<!sd|ficb>T11>>bPBJ+Z$YY4cwk<m4{sWbL|8S(>_COd@FWE62E9%*1 z2wE_mxb6VNBO=frL}gm}NeRePJ~$Y;Bh|5B^nhY#jnVx`G;h9oNT>6(1bm#xxzNfn z_x(TSzB{0)EPL3FI~LY)l*Ix&!&+ugQ8TE30XwTWqfU`QnvP0FgM%7+AhF{piep2N zqB7VhQ6nNXDk3V7sFYA70Tn_E0RssTl6>dBmxLr>+28to-|wGC-s6>f&prK|dk%C9 zm?jsVCvqz{^H*kPy9cwR1LR4sjKDpH(Tv{(yH-N4oL#{HZFo%rG%##>E>C(NN5Y|| zQf)A>p@ra5ssn~ZmmreD*~{d%;XK}9`{y*T<AS96mxohd6}AD<IFp2Wi{;z~bks4N z=N8?B{fF9G=g&LBKIU)Eo5VqDnlB!nBsT-V!Q%5~aLj;mfZ7}=#d`%~yw@XEg@eZD zA^b~)(dh<(-d>E}e`y$6e}sTEk-$-27R=i#iiypkZXiWs)~mHzvloOBM1*X;N}h|b z<MXTbi&*S!U<2tY8qZ>0xcT6auuPT&0;OfrqQ^y?dQ=%-Cv*R?N0?_wxwg$>X+DQ% zaePir*G%s15gYe(bD%dF&DfJ_+vy)B<*{OwGC4Or>#C15$o92ZdN1?G2G`%0sl>X; zJw>Zjd$_&I<U2LZzJk`w<bLJEw&_U(V%P=dhO8BjRxg(&F(nI^Y&j0)fN^5U9Orf1 zdaYM3dy_EWbb?ik^a9n4_nBlj{UN?)>zgN)mcmb$07F<R=jUl-ymHUSjV^{|@JSY| z+aRO1@ruOLE4-pp1V{rw>lby{{#hDE;ex&j+6}q&m0XP=OGh$I$K22$*LyU+-+jXV z&6&}jh^ro|cVJ43$v~agtF@9bt5lfuaBufGm<RP)mTybV3D}|nMr8<O9QJ&Z=C@hd zpd5FvlV7`o-sy}n5jPb_)eKktKG1Sv26Kqs%EP_r_t5ONB<uodIS>G1Jk`Qu{$B{C zIG!(9%X)DBb-)+GRCa}Ux+7(wXt8uf=D6ls1)`aC28~H&R*6J_?CSu-^!cxnHd;vS zdsk*hR(M6hN&S_<sHtnazo-G8;hs-0sokzw);obiychyto7QBEmXH*ZTlZBK-et95 zxbz`qupg$rl)4J3F^FW5s&2Iw@Yd(70P$Sj{`u2hjRD3D$OI=XDHOFwV`0;ve;8%H zl{I*=*m9ZUeLE!)e$KV)lm=9qD#nNHw#@6RjpCdqEi!KOLdLpCoF~15k-(R6k<p9M zF^E%T8dObeTYn>5X2v@*-+uDd)L#WR?(iITcsv307~?gRnr8PZ$sZ6W(A;-4xhbpI z<7~f=WPg+5cX@CJq7>D8RqSwZhk2$|46w(hM4}2GEMT!??4LO$X-NX~FVKvq3sc-y zUFZ*iRl+jskgnBppj0tNO#{7%Ns9)MAbKb6OXZ49yczQyvw+6?A$a0k@y@%jArHI= zIkdrLt&)i>Q&xkl?(M|;-HBsmIea85LH*H3bHtkg*Q{F??qh?RWl@7;x<`P?#T5Dw z;G;O+#kn95_eus8mM2MnIPdh<#M|qk^L@9LFeCwdF7S>-=Trn*q(n^Vk1*c-NcZ(( zUc~5P=bMyYsIZ86Fkh|rA~NT>bYS#$A4tpGdVW6&1$`SnmF;>KC8l981bsE{4Kn*@ z$e=`QzgH{4kUIgC!$3gpj=Jmb!Z4GFfCVn#;RFHw+~{6s_+q+D?B%Bjsv%n(u(@H^ zGgC|MJ=`1kH<i)@0#ZlR+NVV#ej-&vJ)d#`xP1cUKV%{ZX&cS_2}E7En=Th@iK;1V z|1iFP4kgC+w}2oo%a@PwnljfEBO?i7UIJo0?{MnAte2*3>v1~pI;)lu8k2?$g0|NV zLM&55B1lC<JPcGn6{@R92^fOd1m2i>3B0Gp45UkZB*-^bj;Ky$@yfgW<cff)kpC7- zmmg4c9plsKGzKJlM#u%5Z{ll^g})ycp}pE83<pOfoHGEMWp^xGMW$QusMmFPz=wGY zahb<;#B<i0-an6cxSH>Wghm`;KUt7-{u*F*TU|jE2Ox_HU4-Wej8G}NaZ%Pdn~;<a zx9tQ6E%0k@>W3IqM5c#E?_p7(a5;jK00O<#iE0v`!ZH#O5t;;2N>nUdz3LzSY~Yr< znw_|`wO0;nz2d+RQ4E{inmH~S^b<$KVsSts1zlG&0p?he7Q;9sjrq`=6T+&s5!QCe zqtzEEbJ?vPXk9X`n013&?9WcR3hc*jAG<ARNU$Tv{<#&#=lPTiyj9yScTcy@>rN!x zs-ZU8R7xF@Qj}!7Z+?+3SNRaPA|ipM{|HW-_<vNGi}5R5aZ0Gkx&qYV=9L_X6ylE& zKTEe<Mq;Vy&xnwmahP=$gB3QFJm9(w_qzl*tS9!6x<Cd=z&@j|NMI_SW4wgz{Z2lt z;s-y0qT)~SC^UE(Hp6PID1IJ&Nc865N6<=2yw3Z$fC=puVh=`Jk+bJh>VnvBgT9D< z-8DVx;Eb*rx9XZEar_puEE+eyX+l`6yI3D1fH@z)x?ZrVWVs~BGE<6%{E@oVV5u1+ z=s-ompIy3e^%>YBlE(6DS4f3W+*I;fAd42!?dU-=0f*A#+bSZxF0&h++%Kzqw>FXR z1C@m9-MuJAt){&>BRv64hpb9TQ5Pu-0qo0yh7{Dy=x{2FVAfFyq(TD(PQX*K6LhQK zJYYu=O}7*ZW^8!^xE#ZQ{)fTied`jtcm+;k(GXFAbUnPo-*#U%`60q8(O%h~jyx6a zyho*Z=eXa!2-y>!`>n_A2=hN98g+QTKIwK2KbPYa6Lw<G*!oEv!;o@FW(_s;FCE%i z>DAH5O64jJStzntJm#F%9FE<9ulnO~&VYT)H~oF3`>DSu5!VS2mZ@>padrr^_<ks1 zuE!v+x`M8#T0JPfoD)kaAzdOc>nO?HGnxy^#rG$RtsH}=S`)~&g6k?!b2w9*sBa3R ztYVo9Rm6Z^ywLQ^%~PLQ8I$@*QXKu>t--uo>0zuAMmOm5dBc}snQu+LB9vgFKtn`h zRAacjoa9kpH|a2D*N|KXu>LL|JoQz-P#Vr#t;c8pgPcfPUS%<X4^DeM(hKp!X|K#S zjwW40v$y1*w<6nCYopp!YYMk3D#3Pabc7`iJ!nps)<}3B;e>;ZlGjyU9qlJK*){&w zo4ER@!(n@@qT)w;M6E+i_@?dak<nw@dUZBKKpaG^p9)+mJX?F-YA*l$W==hj0xnV` z8E97fjY(SyZg1hJ0Y(|P@Ne>*{{&v8r073K@qgq8)X9Lq*+28^z<AyaXthV$L}JGn zww%*~2lS~UKxZlo4S@Q);1{fHX4D)<U_An2YCJT@Vcr13mwHr)1A)eSg_&E|@RSHM zv9Mna?gMzYA=qb?$dm7msS(|3TreF-S&%OtGuLB-cU=Ktfjx;G#i%bxL}M9YLy-iX zAS!qMQ{@V5{a3r;`NL{i!V)aX8j52K!W_ie&J!rMQYygv>%yN96UrXZ9lTD(jS>WL zK=~wSrV6-|))d74Ira~BK_tM+=1)0WB0IT@hY{bjThLNd^e4OEoZ&6jAy3~R(oxzd zV|PwJl&NNdW6&fVCKoJ-(@3Xj7zIf0$se1GzMT7`?woO!h#P>f3U88{_hd7Jm47mF z--$3foMN?i-Epy@0dzgVJZ@_S+4b}czDJq;Hsrv3Qe9AsH0X3j-QXqy`<Yct*d<`; z2bm|PsD)%{kIj7>5`7d<%Lu2p5jd!`$Cg7+N9n(Tk`4T#{#+@s*{qmMI+4h1Szva` zMq#{#9(GIM+_GTvJezEB)fS~-I6;d|EhDv9>oPJYaaM#R(+%V^FcU9!V%KMNJI`95 z+qGhcVmRnKq0pvJ=Rg0jiu?A*U?jR{)k~LSKQI}-+WWG=Oe1u3fB-!wMV*Qel&Oft z0;gT1?+F0({lg#l6-fVPkVaV%1Oer2@45p*l?Hi%sPfzA$5u?xB^1rFD~GgnW^akz zr6^Cn-z5kt8z|?jdqlrH`&2KlhL4k=8>M@(4)b1I8pK|5R)-oRML6HqlB!#vyJU=L zpVq^xy*=PbgpMzviu`rXGLlE3z@;O)tS#D*s#)a+vYgczWYm<7-fd~R6XS9!#8y+x z=v#c*ar!V7o3xXKdSbJCew;7OsoA-p`KZG0e7EYesCiwelq))_zMwx2qz4H014V)s zpdPA9<5DA&Ujd9)gG=3PV-bUIgf4`3{ZmF>FezrADwSg4pD#>3oai?iv?zRMo)#?< zo<O(oo@S=+6dCnE1U`W|pl$?zE}(iZm^3=%%Aa!9oLhqZHtfg$l10ynC0*6P>zN-L zT5@J<F5m;VLBdr%ZUFHv#pGrM@xf}G{&6C|#dl&^IPuM*Bj)gT=NX6OBxCBq0;79> zt2ceD;hmu7G<Q{Fd{QNT{C>^z%Rb*M`cuyN{!u`=*f0dachYFiGG*#@^;bU#;TgBG zhn<uw{BFFKstIdz_Q?**g?pRnqXjbBf<#D3#!^wD_9(*7s^1&C61=MdQkI=A&cr@S zR+d`<sL)V?MzzxuJbFZ>XyAmoPiUk9fw6i*#G{Ffy`aizt({Fa<ya`g9>+jz0ngg7 z5!}zHLy=>jDPQ$roo<q#od7ohMZu(?yW!KF*Q1m(gT9kUhl@KxL&X@eLF?EkXcQZ~ z4zXS}e-$|1YN8(p8sH+xh1h98U#5Ij)xkO-0v^=t_oxRS2M%BOz*+%YsTB8NQLkHr z*!1Htf=zUF?$VG}_w;gQE>&?fcof@Cpm_s)E_=K{=`Qzq*+mbrQbyschpGtSz<$_e z`UeI@6)?5_Ts)-4=m<x*p6teEu_ZshE7EWZn?9@Mbx@&ncXpj@fx9>>iqU18{fe78 zR$yl&-IZNOwQ?5+!$mhXH^|hzjm-N)9D7uK=T84o>ZsSW?vN!9Nk3Q*jtIUp-%jST z_Fcbx9~I14#UHU{Tkup~Pcvn4!^ka?@=x>2n82JKY;hvKBf?+I<P41`oG2$zKglmr zLBXZ=tVL%_Nv{eywnnGfi#%e5@A<{sB~csmkdO6;6kub2ZxV6^f+NGY4e6rb9kXxs zSb=O8aME{-$&A3nGK5%y4>(b7Jx39h;2~Zf|H*^@;qCw1za!uISd+wYPgY~vHvQ%P zW*_9lvw5}du0eUzB5>gPJ&fCFc#DhNBcj9hH6~ja5JfYi+SgkhrJl&bqA>OgKa>8G zI{7Mi9*_Hf(Xv=#y%u~XlRy4-Jl>eF2gJv228|HEF*7-czc{pc@<qXnPxd;0YJcOL zear7a4D-E{?RRvBAtTlNWLTzY=NQI)+c%z!i$r6${lSmR-Ih}4W)72`U}hbXZ1Eo@ z`I1B(C2U)GzTT;MDO)n3;#7@gSxA)7^7gbG@(n|)O7d@O4skb{?!Lo)7BliAUiGAP z0{)`c0rQ?SKh3K&W6BeIULxK6$WZ|f;r@Hb0$fCYOmMkx9lI4JKE#Z4yul_Jqok*4 zIpY$=PKQv?_sPzoO+jaC7D1LlrefqJ(UbSxG56zN*6*!(O`Lyr$EZHn?;ZV*>_52m ze=rH!f-Si39TG||*u61M-WbifRduPU{M|odNMo&x0B*wZt{h(k!2kY-bm95OX}<`V zo~iYLcg#P@k90x#GIlO3f5vhy(-q;tdwz7PL!ZFE_b5(~7HmA0nSVcF(v20o+UlQ2 z|6(TE-TI9|;-7w2zjb(S7u@P|+5gPoQs|VE`E(%pjq7N)+C7$UXBjYd-<uE+zTeSG z>uncGnAf87`&`!j$ot;5o^#oE)_XtV(XBTdt0tStnJ=994b^AZ-QOE9yi5J8(L6-= z)Mx(j%<Q83=FuI|qum-3Mc%EeNWoY3J6h{Lm=yD!aPluYuldk}Xu4U0bzg&hA0A{& za=wHO>CtTi1%vJmlz$o9km$H`X9&~n{{6}9z@Y|y3!27FTDEW^br$@6S<}xy`@Q%{ zpRm#6C?xBC#xjQUC?;P$;C{!XfALd3(fz&Mq+4o3bK*18w-FlP^?r8oL*`AvEgi`A z{!<Iwy%#^}6WK-T*fwPA4{Hwzx{Q+U&*~iZ3d+kUPK>&L=6~Gbp4hWF4Kh<t)PCHd zI$)l}r8L3n@oxQtpB}-4p^W1KZ`cEI4p7o}b`fN2!`Ir0>+#<kVf5wqSEGD%fb~`b z0?Kpu(0vHL)@`Ewf)6~@x^QA}Sf8)LL$oudqn&VnaM{pSmK{qe=5QbrFk9Z!#?Lcr z<%h-cX?8M2LdGchm!@drM(?1pZvtHFsfo=W_<rw0pKPY`Z`6p{nmA&kODj!DNs{ry zyzG=+C}uFZ6^|JRM0rYDIB5=GMX{6U)kfXJBG?sy;NF<%x9cMg7h;Y{0qp<qDa}~$ z5r?&$M^u1%sCAR;B%Om}mzsx$$cNn+7!LlFx%`$OK27FGGwV$HT{d&0{7ccUQX6a7 z4WoTfy%DnhC!=iuA39tmz0S&e3aP#w$3Ny!%xvRr-ioq*?R5`BHK48^QN4yW(9<GF zc<@FI$K7nEY1jYGfxd*u^9VPwqph<0Yq@wLt5Z5uW^`{#dq`%Ulc*jt4Ydy{G=M!f ze%>E(P@#d|+Pw4hor^ZEN3BpUwb-*OO~&DP1!h!sPP{h-wCt-)UKMQ55w$>qyq_QB zzGuiL`;$bkG^aMOb)gFFf@wjy|9)r(OU8c9Q-0OaSx0+M-}@AQub*UA-<L3|Lza%m zY;qI-fi8D@hGM}^gH~EKncck-_EBjcXa>CUj0IP%nx<KO_|S#T1U3)FzWIm)K9xu& z?Ii5B={>j=s=5Bc=0Rm?J;AS8v3A)Jtj{BrwCaEI41)@t?4B&vJ&5kvP>o<qn*3iM zabOJ=HM>qKj_Nq|5r>}9nM}W3u>EDtZk<DdhSX7fNKU0et$49uNvC{YXK<D<mA+Rx z*uBp~Yu?(lvU#wDt?vx_yY@+DwOymDZ(<FMa(ENM54<K?IXW@CJLb(j^-o_Z8rbu_ z9Y63-P5Q;6gZShFKZPx5_2LFM#b-~my5ZJHJ^6v3l~rgq_6DU6!E1JJ%qo`tOY<{z zpITOdb8^%&T4$2Z*sx)G`LPB^mAw7l+~x)?h2*DsR_ir=e&U2xubHIQeEa|T9w;PL z7iP+nQus7QSL)eD{trjPY@2e~Jsn+Q(Gq!w=Og34^+;a}Qu(5niuscCo(`fi_X=}D zOfYzaqNH-DUXO3?nJ&MVFj!Rn<79tMOyfPO<R=3ja~ei9^{TTg)~zwblD*RAYojws zYkaDSkPoAJ;0+FPy~q1La1zn|as9{Fi>K1uXFMJHWhu>_eW^zxj`gymN%*D;sW=bz z2t0l4-XjysL=g#Y1I|ky#S5QFYxcj8_6Vu1g2Yr&7lVF5v{e`p|G#KH3o`$adH0_| zvK=LR`Ly7S)^-WY{gy(JRGpd~ChZD0ijTEeQZ5rL=@NJIIkdv=y^I=p`TU@ZUhb!g zr|@{r*%l=Xv(H%Eg0NbClWFZ0=622u-&vhZ2`!+fi`pTWf0Lnh5Krvv;K=>XPSRR7 z4DL^Gq~<aEu7YOS&^rGM@tn!ptKR<ur!aQot-b2-_?^hSXZ+u1x=v7RD)ky5BQ$qi z-Jz6)^21Y79G<aet*JdJ7DgnQQD|-JW&A7TM!uNNQU)@@#Jp_5?m5m>NyH1g{1+7# z*4ZX%!)dR((zr7^rn2X=-^J#43mMh(V(SrlC1_n??dv^RB>sbDuppr}dcEIy_xn3& zLsPrPy{vQGsdX||j##CS)|KlfHNqur(kYiHi-+6JTAd|(#9^)5kg@tUt05sv((^#p z<FhUy{MrEODlx;ui2W5^UdQB5?6P&Cadz>fB33D15Y!#RjR_t^=`!iQDQf2l6cVO7 zZt!wZgF*II;YxPq2I@%yqcrACK|;!vP9%cRuW44|?Rx*zyYvc8_>}rdy?^Sy;s_$C z?{&U}?%y$m^~mj!qAMu-m*$Lrg|^Z*J<b1_YTW2@Jkn1t&Xy2;lqJm%oVGN24R8<Q z2%A$G(zs-z?C1-wSXv>-uV0|{j1P`C?L4bL<o|wr{muVtB++g90_RNTWYLS+g16Gi z#G)8?|JYQAHS!%UH4M^B<_OXlYTI^;10k~o<5`Eo@@p!Xtm(nTSgx&mcB;k?)Y=qV zDf)@zmPC9K;YePyyRM|-R8&BU<O_uR(dgH|`u<b*(vKMWYo65oC-$=5OKnJE>3#|Q zGwF@6%ppfQ;?cHn*4+gusb}sMLpAr#6r;#^hXN`8LWy6uC{GG$a9)qkX5ZP6bdKfG zU1SsXD?3;=p}>iy*qePOg+yQ19k`{C#+aa?e_-6HiT_t8X7Fdqw4}kZsIFxyNoU;$ ze_@Fz+d6&kcS_xVeo6n*rMoH2&V8ez%dh^|s*KaQ=>;e9%ho7I^HS-Kv!s<yjw#DI z&9bEOxd$nB!TgCx7<KeGQDq6SbWT_2w=Ub8P`(h7xve3SuCbegv*QTVSW$fePhexs zly?1&V+#B_-uIunmohLJ_D21r?mw}Y^<JvO$xi!A=%0$u)W!(f1^dj@A9nv|z;674 zDzw$V1vWNQ{I~^=VzQ1B%-AohVC#BI3v7h<^Xun6*esrwLH5|p;lT#(58a2o&XRc( zbnw3KTcy#SFi&S|-#c28BaRWNXn%TI#)n7tNoH_HV_#qn>*{{y=t`JKm7v|=6u%FT z?32vET%!<U-q3sfz#_wAo}}3|O0%5r9oZ+Df#X{pXW?Gb9czlc-a)k_&e3UcgbyE7 zSe3+vVhbNWsL*OXsinR^`;c9swsBA$icHg<t5EKu4zOA4aM?BgQB2w`f_+rl(T_O@ zH_VejT@0&N1+GyaaoEPabraQ+0Qz{PbI7j9>y!$lxU0y%;d3Fgz2)dhB7J@x%}yOI z`rkL?vNwY|S*CU@Ir4M85zE~d4reQ+G6u0i%IBE!z1^B8D`jopNqV}2WNqY=Z|692 zM~ISRy>j@IYF!4{jTRZ$HTDIZ21o`(nOp4zQmi$_2!0krsSFCRr+yDb$y+ybpjZiT zsoak__|BY2t$WIzv<s>?=o}J)Lr2Zp!=L39P~$)=49?gxsz4b$&^-8;Q+vIPGU%># zv^x1)nBrJvtH_TsuZ|{@G%XZGPYtrWUJ%Vt@ArKrueOiwi$R|XTlA1eb-Fs^>@gyg zVmZD5DtBlf#3i<e-2U;vPU+hiYx5#3+f)>OvolChSi+$yD+I3prn#_b*)M<Q(c?;$ zGs_=SYkD42gR)=BA6AN=Dhzk73>8PvUuT7geS%zQQ1WxTyEvCyj^}9t+c_-V&wq_* zARh|3P|gw@ed}fbj;lw*-VJb$s_lD2ffK4O!;AuIBU!<)D^fh0b>5(VgWj9eOWyki z^$m`l|2Q)uXHEE}dYOP5Ve0r-tYXzx%1RkG`{}_qB|}?lbIA=^{t_8A%kDZWkHr_} z-W*7=pe^l`XND14dAT$Zv4Gpw7To1xuW%}6vDa%Tuyy}&&PY;nU4h=ALJXlMMz#KB zy}No(KiU1+5AtrHP8dg7cD&qIRDR{;H&^mk{+;EY^@dS?_60SId$(8~ys|MfFP45q z6icF)ZXxa-7#hPDG)Nb<Wka>>w&SJoq*K}aVQMR7jC_-+Pu+HQ!A_k+A`zlliqG^f z>)q9Rs=9x4pk(=^WmJ*(Gp5C>f|96+n)e-?s1Ud68Q0HUu%?n<pUavK2y-vF?97%A z`^I9mGU&3)zq4Hja3z&piF`hXZjn>TU7PmXJfnMF;rU)-MU<TMoh^NGU9epy<8@rm zPnD#x7B4lKF=jkNS{T8R;&Dj#APkt7B6i%Ve_8LY-qTNZzkAK*#|LZN!!M*b*rTor zt}(~m{+;dqdpDg(X~<e7aLvpsSx#w7V;`s#?M)pYz}ny%=sRnV=?L1hw*KJyZfN$u z4xjFRSgqZgezUOR&+?6S$XgShO?Q8xkiMn{#MTN|3sQGKsdTy{;J!@dKTZ*6i4`<@ zv{V9yP0u)v7pq2g&EDhHWM%hP?ei%sTjkeN0wfKw2j{a4F${Hw605K6szt2NTjZ>h zSL5uO3DIf$2u$4rnZvA!kho+>z9D(oP=<cYp)`h+LlCC<3V&u7_|^fUfA|16euz{- z5mqEbMF<N3ZM6>>L7^O@L$L~ZDxY=U!JfCdX0wHHp_p$JZ)9}x&k-A28%%^?uja9( zY(f*g@Mu+GutGXm*_|02t?>F<8GLh65NrFWaKEc96Y+9MM(G3QDJ=%<{E^<Ke0t%4 zbUz4By>E_-f;Ak)xh<$jakL^-Mwl=7hy(1Zo*1)@lR{?f_P9d;#Q*SNXNTsIXG}(k z{&)PkY7*v1Pp0CzZ44+;FHt^Sq*$C)B4iD1mRE;ai+^Tk7DX_2*G02~&JaZ2bqP_% zZ8p_t$$YQi=K)s;?zIIr(Out=cnt-PR^snT*-s<<^d2>%87wS{A#+>2wO;k1M?D^j z_F(H4-Dec=sOW8u<7<}zqP<zIDMk+#gQB?Z|IwG<HQ&(A$*rrY$*vhiedZ6KbES1| z2aT54*=|7^)<NGHtN6Vwj8mB|MhMauZXVFwx77sz{vjx70o1s|#%^Kw`&R;6M6GwO zkh2XrTl-luY{=?dmY!j)U$F)z_O}ksPzKJ$Yi6Y`nrMBYAGDYWrR|ba&kFmQx7KuY z-!Y!^$cF2j@7oVZ2%2Dc(9IDW)71D70a7i+T92(Txu`5x>D;Kk+(?f(sZPtAP;E1^ zG27*SMES=Yu$p^WDWFDF7kKI(R;%s!R-ajW=qmRzO>oRYv8o<i&PjJ_<kcMSzLbqB z*#V4m^eOnAj3WyNa7|y%qr?1q`H~wB-JSh#)ONL<=w3hQAJu$WKK+W9%u6{)WI(^H z&(N9CpAuYp&{LgC0-?wvZv#m7K0NTU=x;5#6-uA0Y4xsEv7FS@@I)e2z%u3A+KD>1 za!RnIj@H~+d-B?7tt9KdT=!GLtzW_9!9W$tlD00;LrZkp9g_&^MAnb;V7>+2PPtFO z;ycQ^D>RNa7&EgUoeNt!YeG&$f>rOKzT9Zn--TI4i#gec_x~n}?yC@DBOyokr;)tl zTE8E{K1sPF%9F7sba1@#6(WJuJw-837)y6;%*$;GbMLTMUdc`s&^_b|ZqnIKQ69&u zB!&&K>NKcGe^!%c^PkMFcb<KJVN2-q(Q4r#tW2a!Q@=(*dG@qei=X(k{p%G^-_Tj- zS%DF$ckcc}ktLFU)g?XHTDjb_)}0v%+c#ymx&zdi?8p4=I-UA4rm#YcP$U$YQEDTo zk3ptuPN6DrWPO`W_ZGc(p{krP8$GK{^|?sdCX1g^B$F;E?mm<^J&?+m-0gP0_cM<q zPW{79xqeq|In+0#ql%9Y71bmyGg19MD^%1lrJuQhx1|417N9bw$v&8|`L0{^fbd>8 zky}Et%5sT~d0t{#`r4G>-A`na%6sg1Pa`_3$n+ad!O+>+$EAL49zsnp<golc2e)>0 z2k_qmcYjQ93{Y3Xr1oYpm`|V>{7-;TD4*_fmFDu7qEpVbW6g}T1*^iP%RKgcL*{^4 z3Y$G-rev|Y7$2+)zd^?*g}D_lkdbwLBzi6rz0;Av@S#|29~W2uP7Ap2y`LzQpE&xG zpUDW$F19qf7CS4rkTtl|2r53dxTkx_ZT8UHB+jf@#f17m<tz=EREN0Gt3l1s_3gna zR$SFm$2p?sE73niOX*DM`zCFtq0WEb_ldi8$01@}ndg3{NAN%@{Hmj9)J%(mT{pw8 z*98dqxf9a|oOLpdm5!*ZU_w<5qG@bJhNpVR(@Q`$R#9K~XOs}Mh|;L?#)8SwA9pB6 z<$nwNzUiIL)%Sj4b%tc*8@@<(p42l{sM+pxtjx62rl0YA+HdzeWt~reqLx%$%?>ti z9x5QylzSox!U{8g*(g_;s2%!LFw{k>fGynv^w)M5W8P!71WMeJ*`7Xi$3ODmiKBm? zH|aT}dr#l{iOa6kL3CvY2Z{)?KG%3?WP_F8^!4MDsGz>A>wEoO(Hg5tV7bSvb)!A+ zdmMvoaX*0%2o_y-wV5<mBXV!rwSqC(Czf;vl^*r!d;MME5+<s%e6^pThF*wDJ!lM3 zSM-Li)Yq}dRYgk9mxFadD6!=~kI3Tqd3%V&Ks~Y`tTw8T`pllx=LX$N#)y)Nb>5(R z1NKtQC5$z!>+hw<7usn-@0z?7a1jE6l06$N#4AUyh!K_LGzZ%v5qS&+347yunz&&< zmk=YK-}q7CLG&7|>h@KgV5I7$_A#cuzv|VoR({`i9{>NK$2Z98$&`KNedZ|Fk!Dz- z!9#!~>#0s)9EGb35m8e=Dmaef-}4Zi2zRMN>%GzNcf`yw4v^R9t5_gg(iM{!+!c|R zHozlz)}Fz|v`!H1`gs!`h>(eW5+C|YEI^4E=aB@EEa(%ten)b}4n&2OulsxzrE*xx zdT7nLTWfw0=SgFgJz`F!pi;C#B1h>;Qj#cE#ESU>)3aGIbPL-dY$s(YTQQx#Js>1? zscoPl*iI^?2506`El6bnEdQni;lP)IAj3CRd|QQ4EOac#%b*XZJ#KS)qLt6$7l0<L zPKr^dz$|#y^V#TcS^EZ~Oc~Kzv}StQFFL6(u80`Jdb4Nd!FxhG$<tjgH|Ab-acPXN zcMrCXTU0-&EM}aQ?Dg9YX|;QY)Rd)QnToUTKao|4N>fKvNF$UquJMAFN_(LwfL<45 z$m2P(rm<r3doncU5~>z$o`y!H8tN>>^YgSOq@S(Bt3^wMrTnO8r+1QpYTldZCiob) zaW~GIMGlW_Ayjgg3TISDNx93-zs@YWlJC4HCM>^d4OD47qjWR4B`6#r8ZyfwQ?y*I z&OvSEp2hCDT4U-T$lAmBpH1U1YZ!IihO}bu*z#<X?WBQ%OxCR5R@Ov6lQqoWS9{5E za(HTULd!1RADLN|b}Tza=EzcYW*&$Mb1S{nyL?ns-o8)LSHIbLa}m(SKssOliCsDw ze~26UJ?t;XFA*lN%PFI{Jw`o&HFV3{Klop1^b-GCEOVEILNd$5WSGLWhwhXXZ4h@R zzUnX25gXU~kII+S%FD#0Ny2+mI`K42hNQVg^Vtu53+ksURy5^Jxk|m(;OhUtf|k?q zma!~3dT1t-&u8_B29(MNkd>X`8K(5;_Eay4i&t3iw61PihnzRKJ@ttD9yQe-mhYvf z^fx+e#hfR9Oa`k~itAR?(IQDNCAR+*QLU>Vp6w^BWQvqRRz-hFx&L<tuZ0U*KR<vL zwoRJEa^HbLyRbr_i}<JzXtldggC+j~2(><~_45Oxct=7qBD&O){ve29LTrcH1IS4q z@MtKbht^%mpePkTw{qxf;AeqfPcSdVRN>f9E<FC~{xZ1VaShYHlJqj|-*;+_^sODJ z3xi%7I-H7Mm<X*VdBkA>f5`Fnd`2%9S9&R*dJSQrAcrSFzoySVf!^Bt8Sme4pnejA zI_lJ-wR7QpPhxW%qqloO{W47(mWADeI*YspRE}_`emM!@_=CP*K;WJKvHK(73#y(i znk^IRkG^Z7n9*<6cb^0{(Ij<ldYNQUr*Jn{<|p5$-hlGA-VG>p4`o+ok|V8Cv>R>d z&;bm#c*hpJcUy<f7(eBN$-Ok$J@MY%mvVt%epZ$I5^Lb<YW-a?B&7SG1`_)Fg!Hxz z^`4$ZR@APK*jl5$<-MQSz||Bns~)<u=B-hg8ZG#>dK<jpl=Iee=l4xAoefxe`?2&+ zosgGK(DzM!wvVZAflr`z4{_{3qrL~N(UuLpLFtk`LOat4^eNve<@ZK`(;-85a~L+5 zPdkMEh82j`q{-?X+t|`+3kvXh2~0>WQV>~mWd>F0GMwf9cNQa6DY3X=*Xq~L!%XCH z<=h9F%Kf-Q3{o=#N3V$PnDvo|89?S-$~$)J`N(&kJBEpW*jcyJR$^dVq_+_iPEFci zxk~z8@3U!CeaokO;Ew5NrnXv6f5x1=#j2@flFk9P@Y*=`b6xMY-qTO{fUIWrM2**> z=Y-gRSgD3YFNi)ROmw&Es=xJ~FZ2h*-p$3D9mnf2DE9M@cklRiM$ttd{e9x^eZ}vn zuULuZquTFY+;^aaNiT(o?zPpwljPqR_}Mf$THUR5N)4QsLJ|3vGIsAwg+00ZGom{Z z`n!+y^nMk)`{&UuzNKip{L7EHulJQc38Wuwq&nZ#ystfH(>(Pi186!SFbq7@-yl$V zfEM)#df)t>!KR~%1k{h66!uDh=XL?FFOXoc(Hgb{VHwO`jIG@`jub7_IZSTzY<5am z(Bx_GafidC&72LnP9&ROKI&i(MFUE|VOv+;*E=NisF@Gs7=p*3Yrk#&%=8%HXQf>; zD&PI%Re3S{MTaLUAyN)~ygtQ`F|bZ&lSvu-d~EZ5kA9LLNB!reFujSDsJzJ?=lB0m zi)Yv~aI88c%C4UI5^8?@UPIV&89g~O=um+-8r4D0i3l{~)K=rSPXSNjKXB9BA_T?p zwo5(Iq3lN01JdKwsHBH;=g5c#R4!yh?3V;oT?D@L<_sXa!v}79_i*}t$y^0etugn# z2^&ry29G)q`OBFv2NRpm*FuYirr27O`c3>9(0#;BIYYY0Q09S^?kA-g1eOW9CNE>Z zh#9GOd44{07~<OH6QAW|JE3Ce3Mc3oB`Mr}0ZQ9*b{n?e@Hz{fp&0bD)C(cO%nyEX zA#49*C#cQy?ty%YFUAV|{%++!o%?Z9SAVe&`Xv1arI(!E{`^cDQTzUyPW_fSf*u?F zRZZ$!-RXblCtwGPx?rN;J=4G~N1^`ZhTt#QOYU?|x4u$hUo)ehOK%F&m~GjL!(k7c z9*>7gjkmj@_@rmsI`8ij{;Nw76w>Qp`507wb0$=#+}5#f!HDu#P?C22e|3o<U_X*| zo7sLw`qCMSO%^rAK@G@UsHB_J&n4OdO*y-T!<Dla@wyCFyh#kD3>17NT4=L-{iC!! zlt2AqCR>@mcDa}K*oJdF>ddZLk0Wi)kIS}KpH{oPi6+^zpDr-kIqNN(X-3)_HDZBL zfS~+O=3MsBsH2(U=EqLPf<f%%ya3;Kz5Rrx-#qi6uoHbg_FugHpX3(L^_?bPzGo_$ zw@cNHC(;JkY8CRs$~CHs{As!vnc~$GCyjPLL08BHIlCXn&{cH}@jtCY)XC+Va)L+q z=9f=%84&AGr@4d*8fM_m2A2W7?+k_8_-&TDquA2tzN2ji@{7clE~lUbuJ*^f)d6$$ zu=8%paw{eqg=M(^Zd(iGHr0cN|F@>7^=x%%%CJ{1Bi%N$?2QFgbL_+;ZS3|pcde;D zE_&W2(Ef^}nvT@Nw!JBfH>!(eTpUSi?1>;Xs7j8mdbHY*XeLXX(b8$M^^$U=*0*>1 z4^^pCt!gOG_j5VaOuI<oN`I3WTNhy^+!6Y|F)Q|9pEGP;UCONE|B+1}?^nQ=>&%3w zKWYBLnz;{YqnMohNH5Z@7%O)YUV3$ScXAA>!3~7GC3=^U1nM8#$*8}w4voAeP|pRG zhxF20z+(%-zqE}?aNmzAaXX2Ht4j%jrh=1Uub_e}%li;2SlqELGp#Y<lw4t*7c*yK zbnJ3TkJeH*<2Dy%U=Y3nH^%t6{In(NB39m8fE83uB{*UA!A+Nw&hGxA;CaLpC|`KZ z_Q-t4;H{Z{sBU^0!Q&#qrzMe)3B}i)Z`GY_?ozKZET*Oir)n|hy*jQmW5vvATBxos z&MSxzJCLs80C>+wHmaaC!z0`851nt6=psze*SC~mWf^RN3tsO%?1HGVYr0>7Md8o* z*x55`r=N=>I6&6|DB<gsjMYNNrZfaA&J1<>7mSGT8FoWc92F)s+el?wb>cV|UIP=6 z92a-UUUf~^o<r{W1pLL(Poju?_MLZsWlXy(F?RW*)ed+mQq96VQ>Xpl%d*M1rPFS< zsFVJ%G{V?@Kf68X3k17(0;(Q)9adXCtt}NPW12HhVvvMUWY6W<B=r6px()QaFm7Z% zKDRAxGfe^|W7R1B?5N7~j(_jVf-buO+$WI?LPw|*sT@|k@7g0k4R>Tl01*_aN8xTP ziY~EltGlimfE9(-FcPcDFW4U{U9W@7!*$8*?|wa|YeeT5qyk$Da(48Sz`CGlr?>08 zJ-)WTKM8(8Y0Snre@Y4VshyVRt(NSV2d#)UlIHqAf#KRNRLs720adG^Dn_4~dQzJk ztx$(-afCc@_qEbL66&&dkk^{#o=0O2wW%wze;xs~?S-CA(DkJRZ;)e>48VqOm+zl1 zdJ2W*&!t1f{S@)H!ipnhQs_1SJ#?^P)))M6e4mvy^NpH*IFXF{o*CNH7vP*~lhHjT z6l@Z5m0?wOv37iA?Q68f%}uE|m5;AZa(Rc+|GG%1i($)2b4i?3W)gxkv>Mqxp8KtE z!xtISr+WiO#0QjG#+4b*M7@HFQK8J1l7L9x9m`jVo>-Q~l?6n$k7;f`83x3(`wQxd zC-!M%+Z&{UC8Wle5u_8L5o)C1QWSnX)Jom=k-@^ZgF2-LMbiqHP<Nn5P#NZ)fZeum zf3tG&kuJZe#U9b|Fh(`IK_IigL5N5P4dQJOU`n82dN}j$<!#(cWm(X;M>?0t4gHmL z+y4u%(LbW9of(dTZ51iwzRsG){RIlQH!u9Id$_Of6P<TJm3`n~gKd~^px*MfwAZ0( z>?N_4!)#ve#V{Dl|F2|08IS5?BIjV*2#i)aU&`nwex*SJjw11x_AH`?fniAOJC%96 z^k}prhGWoOg#9Y=vg^@brFZ<lsLF45AsmT*j+(am9<y8<wo%%+u<#_~Q1F_|$xvd{ zm%%RjOS(4lb(cOVsQ3&NrYG=aDjD^?uaZAoKo6PRvIq;Enpy0TvlLFVpe7S8Y@TdU zhUG%hYO>Nmlqk-`D}iIcRMS+=_B(|pK;iK1cq`3_zRMV&+p?o=dU|+6n#UJ5ak-!o zGfFo+qp^#e8drCJbDCF}d~;aim}a-=D=VS*M8@t5yd~RWe3CnUIRBjvFtCmp1wme6 zYWA9KvZj+i+b?KT2+opF6Sz9aMW!io9Nc=&aAIk%rTkdFxzWAAKMFXApTrc7RTwmQ zw$tAPVwL%^1~OV~3M$=CFJvZ{?~nGYRfF{c^IQy}VN7%A_^?aVh#2yUn}iL}PLb<e zWPPN{kuo)SXtT|Ag3y|HL_)FSCTia**(f-JP^`O`{6Naj5obAU;TWikTi>SS(Ul?v zYfek&gwX~V8xPAKKx4g;ch0O9PrQe)`D*KF<>FO<$b2Kz@FoTm8d?}l)EycQ(9lTj zvEak5%1^Xvn(pgf7|}lNhUhB$Hrx7$q|&%FqJ6mUilg?=vsQB~sW-%{01#SW!C*CB zl0}N$Bp{&%0!Sb)wejnbf~=HfCU*IHNMEM9uP&xem!+1m@5TkP42s-6dLU8xn6q;E zWA3R|8a<dpZ}T;MELxMpTyvV|!;@hZ06Kp)y7$)bf!lCQm2e=m+tuycQoxPqwk)vD zXJc(raKge+t!74a;cfCve@gPgBQ0A4lZ|uPzqJkbwI~W~a5`NvvT1eT5Wujwdbi7h z$aQGNHcID`VT!%$l*BxKN$z{dXDV?Ykj^@9iy{g_T5~UGfYi&Qt(m6@&myL%#9!+H z1}=<j(q6M{0uHGZnu6psmc{tOtYT5V(`i6Du`rLLkU{x}t;StPp&6BuNT}K8^SP3i zCw&w|U-5M?rz57-NJOX177ZhFX2gqXGer!HGe8xmaGF0&nKRdJcqe`6?DqXW0AYiz zrOJD6?`~Ec2eDer*i`D|>j5odBH||vrFg?Hv_KD>tk3u1TthO#w`H}@ShYiUn$vv` zB}Gip1xYgR=9|R0Vvk=)FU){1<Ls~bK0D(rbQHRr9CiuXqF@@8Mk_fQ8gbU9PNcxK z?TrC1=ynO5ugKZ#hV%JH?;joU;JN!xi7lzD9igg1I4_TO*k#d^%WWA-c{4ZBwDVY{ zl*Dg62zwWki+`S#ZTH>Iv(eic*YKGY1cwG!WnvcJo~Ce<cYW7P#yNcR{5@@jrCvAW z2JxIM`e8&6ziq9<U_+}j_EjV@LC?jN%S!|YtIz7{LCr)O>p`YBG?>9#TK1Bz77Yyd zJ!D;!Tx3?3RS?NM{=@lA+$8%O)Cfz`<lL47t5ey797VtEE?w80twTyc)~*52xCw~| zbKjV$!9#2^pfieEvc~xnNE`!6XgNmY_a~E({jkZ<S0S3mE@3PV9`7X1t826{J3DKX zau0uBR`$P=+IBr@QrwCoDqkOO{t;Ez5v|J@B5!)z&Yj`5JDbStC?UGYWn-@>h;-$S z*HXWLjH_pkmRB%2r+Fm-%2Y;{u;~R#CTYDfq8f>w%zYB&m&NSKVgl!em=qmPQHd4J zD(;JZqLIH-@V<t<@}$|#qtMCzrffU=FOYJ@5x&tNsJE_IxN6&>(t?v80iZk8g&A+B z^8kU=atK6vIM~)sPuI=12Td9JY3z@nATH=vz_ERe_=#+zlKSOqmf768CMwnTXkwQc zg+J>Hy8BmWEru(5?p&p>?ChGqiX8rjWPWf87Zr(N&D!2EcihG`+Z3qI4SiSDSgd+a zoAVPsOSyp_D{eTRDrp{jE?@dAEcl8vyYy(VwvwE4TVZ(7#9L9oT#yfD5Bu(Bq!40C z5+Gz@;OQ5hP``W0w&SjwM->BxSg%o`67UpEMJS7OdJDXVS(g}B7HkOw<WhJcJZ50W z=kdYoxQUyjXSQ3PGO5|V;)xUZ&@vcxtGhpQ$=dv+7qT0)nHbM4<I#kx09+pxLYb8T zrRT=1d%LbB(y-Z>`Mk^N<s4`|f!4R+HCyTSxLY(FHR{TSPAo6yu)LD9LgnJG-DYIV zeV#b7rc^$X9sHV9k-t{3yExdL8gWgA>Kt_+{WoWv5uYNfyzAvIvUjCQjN<*|RH1mQ z_aqf`7X0Z%FGDyxy_{~6A~(Ef>kTA^RFjMID35}wqc37c!-0hIc_1p1kt|FuPd}(( zzwe?ZfW@#ZN#X&?Y-d;Ip(@Ag4Xdr!T3nPzT9QT;kE@JB_{O+bVskdi=L-ZbjF-d9 zKqMiZ5vr<_kp_k-Hn+*dGOH;DjWe}@bc=(U>^QcZi=E^61oJPL-;~8(>*kMWM6GJD z);^dt7T3AC?DXyV`98Nk0+oU)o^??fSUNXjXQ}(LzzuT<N8NMsYIh3D-B0s6#84|q zI!|re{_BxqEg-A=v1U7qTZ+}M3Yxp_^`o{qGIwB10y^TkGJQs*Xap=UmoZ^KL~bIh zQ3EG4?(_~SIldx&IrUspveSN<cbK5yq;n<>=n#s2OX?B-vHXficqV<GXhpt|TxNnK z8i=rq?AuKsx-ld??Xe8?3)N^-+qi)@D9M@7WYB2?)QdC6RbcP$9~mRd8})iS*Tplz z)R0Z%Vp>VpX`=`%6X+SEvG}+0Ua~CAI(D}SA3T#wrNizGy_J>pFuqO{Az8xo{-aAV z@piZ4c%}5UjJl>{{uW_kLi)15u8bpyh2#^Wy>8v5G4kaNu3LAs&UIJi<9+{Yv*E#i zpl?DB7U#iax?6$mQq(1<U+wqf!8q7wxpcM}dq&!;4u5i~17}7>j;BxI=f1H?e<Twe zlKqLiNT1S0t~ZJ4jJkr8=DfgRfoHXWJEnQ0&t=yuh_}J|oZnRo`Y2+8&uKPGi;_Dw z3S0ur9mSsSQ|MSnq36@z_;ER#jC_@ZHJrx_^4YOIhtzEfRnj^m?CsV!v8>B?MXAe` zYf%v;PLEjhEH~Y+=7>+km*FpB6_Yc)l*ukFsm$a?PNw|lC+vvLU$BES%4(fPacrSD zlp;~y(NSI0YT2MFp|r9d@<b3Xjk;+gptc9bv~sGC+gW(TUL**6oJdu3wB0R47Z8j{ zRUe-j;E2(bXVnswrhsD;urC#gjxKiijfH`!ALxE}R5-I_88>2zW2T8$A>})VYp?;@ zJJ*@Bi1R`lNgtGq3~Vr7Yq3c>*UTjT+ofcWCn^r1Qp8rF9`KmTMl1{Hb>Lu>ikjq= zNn?T!MaM!bH$UZs(IKvPWr6@nfG=%W;G+U2QiR$(*ir7*OQ9JBXxdTnOv8}X8hUMq zS~o4{=!%UA;sbQ{nrc`e8wKTC*~sVyU9%PG3a7v>^{XY;PtsB!lfq+`Un{)PD+({( zwrE^;ca5}>=1MyI@>K`HEP3149VynQlFQtDzS|gWn&j}CA+yAC=AG1^#=<R=TsoG; zIFm-LN-l3)o&G9`bb++3G|F<Vqh}b>G2G&cMM-D2H$l&M<F@JX#v2F@NZOVH6RhI2 zN38_O3AQK_&P)Rv#v4_OF10xisz#w>`$#HpBsBcG#kt!=eq48)Fq$J^#~uu2Vl9^b zoKtj(q*A7}JwY&GNzI8rRL+&C1B#jxxfqCVS@GlkA)x*wNLEg2Q~6kM--AXxvOQin z-xMcLx@!N-O2eM<K?CQO1RSVe=sXq^ga!o@US6Sk$Ev8X;%BcvesE79G#nBB%pFqN z^}OO&#PYV?%!-e!w`P_^5ZMz>yTD&<M5;IONEqw$E43t|l+4-gB1}m07?r{JsR)b~ zN5U#l?^{TL*!rjhYWY6o1A%t++U}*&ptXP^SjVA7oX0V-Fjpq$v4>PjA0)A}H&(93 z8tSOMBK>(4KO;3X=X^O<B_;jmb{p(dT%6rxI2?7r`pm<lU<%f65Rmj9(%3U!Q&0bm zr#vni)6}1z3f|_aXUcEtC5>ODC9w26E%&=o*DukA(3>N|O?T3#PEYgb4~QG~pCsP_ zjdozh@6nd3ds1We#>5-@lwNofnZ*9f{EnmR*wZm*UcTP$UT8@!3yzNj(A|w(*H_I& z79;8btYy7wtGIx7q0K6t#M75fZ~aR->6*HCl+%_%DY)7Q4#PJL7@%xlxoq)Im<w6U zHw4}7c8({77FbXEO6`gsdz1dp(|Erx+>Hvop^QoO1+J`NTcx6P<Ac23Oy<Xx3j)A} z(`yIe&Yb8gdUlY$dPY9oot5&#j;c$<g7w_nWxOB0^Nx1fUEKlN$XFcZ)^12m{#&9r z&hqOdD%rcb<F`Rg6>*kV(<CdRw{iElrm`pe!W9tNe+~8`jwL2|E6y;7P2qa_Or3nX zG>JT@spmIWY^j`bTFgtlrxG8Ogq~y`$5&EA#F)nh^&Qr@B75DJn0j@T=r!K@M*-W~ zZ1d$1`GmRt54b0u6e)}gdIHt$S(ii8wPf6X?me|A`51T^CS6U1&biRG9$XL`NRvk= zy#u6)UDgB{EZaY^epn~4Q}W|Q{PJvNA|sc*1vN57jpMdau#T`}npdlJcqVRatNl1R zdX~WG;y)z6aEAmXb5{NS9O#w2!IOcb+->r`WMF@ZO%$KCyM=9~UtuurI0It2%;d7` zU|(1AT8i)(#y^`9_xc34ShWV8bBy^ezboEEXrAWrWG@$lxfW+tVJ-BwuV6S)H0BvD z!7&#GrZ486&nX5yXMG{{TH#+|y_O-glH6>2gW$x8Vt|(&YtTsGXDq|q+!19`PUnVO z+4fP_#H5&b%EH)#*{R*r<Dp|)xXN`5{!IsRR#|`}a$<t^HNAo(cll9k-_o>K^1T<Z z_d=YM9YsdIYUmvpVJzN@yyKc{ObDU0M-#!Xt8vNSCYxa*kiDf5S^y!3p30?xB<5lJ zuM3}PY>vI@zf!%ykAuYT`Fpk&CF3g*l#U8Za0co-s>}xiXL8FXS;RWhsO`yF>qsy5 zT0b`_yvj`8M2%zr<-CgMU3xFwR_bz-SYQr$O{@dL=jd@2m$|_XE1hyXq`Wb5ysN;r z>a`W~4Tz~eAP1!>MjS9A1@wuF^FppQp@yexFs<oy&=8wb*P7z$XK*lg#U;F%v$}~Q zL9hYuJohl0{)h`w3L;N<&<X2Ss1p_0a<()OL=IACw{aWR-Hw%|UCy4TRP-n~sj+qn z*>u-S!Do5F>uw1c>VUz*F(Shu5Mu&gC4bj2Xk`h$<VC&8W(jFGH|PRsOVpXY!2%SQ z!Xp(AN<7aaMMQM}JZ2*=Ce0zLyd!<AV6a=N0P0g+Z)P<{-m|vbaOy>R>Uh`$h+*~a z!u6yI%U2!0VaRV-$qBVax;yVGp~1vamK^0Xs&b;w)T*2oCKXY~h3`G>#7`mD+F}#+ z_OQ~9Gy%@*(JK7)CZ2Z{Xv*u_)O65tbDKz7Dul^>_F7Vf54ftee5}IAB<k0Nn=4XG znxnuaJ04N8mOBUQO|JHV`pg!O^mr7M8*_7Fx5CNYL1Q79)n^21B1FjFI40Sn5_1nB z>mKyw=d>0<WOs$<?twk1tAnDegLsA`rMFf8s<;x&r~5cdvKFbgxv1zu73on0C<~k@ zf3R<ZkD?Z9?1;MiZWohkqA%*ihj{zhn*xzr)^Ya*+QIpGdJayo$f4<#%$p$qi_&qG z99Q<A1EVLs7+0Cl%hbofdTivT-1*HEsThVCoR*u(oD!m^9pP1^CFpd^qE<@pRye+W z!JJUR30-iiWs|g=2rH2uA|$y5%$rHtZs;lnArNDJ2T?`uiX#lT!*~;^R)&uzQ({}% zR3bcZJRlCPp?DU~2v8Y?h;0;Mb}Yt85UV;X&~d2aU7r*1i_fhjp;b3Tc1>iwM=`{* zwAEgfLbxdF;ERP#k$}HQw{J??HhH;};E+9UqRRlK%ym}K6Gj@J*3-kVR-(H0PizYU zDs$d)?c!38)=&mw^;pNYDHg5m6H}8O?`lUTBZd%5cGQJ--LqMW$5>VD3%ZwKx?n#p zfu$fm8^)}XUDBAg=5ArB9?_r!dxNGN;jJ%tXA39XXxiZHX$o6dar$UC##oQ>u0o_v ze#QQaS{B^6x+$Jyc{^6`o`Bl&+fmnu-c@m&bB-WlJc=<J`ucv1H1!wC;hM#()q%%; zV5P3V9@mG-#{I^MzUcH8TF=L%?zZH382Y;5epfZKIHJa86jgc-y_a7uFO@Y#g+jO) zd=6@LNwumQuzuG`E`>}?Lxn&{mSqz7j$#<c+%7zzXQc)yT+(Una(`B6uAuUYa}i#b z@CL2tP>UenwO0PQRP3~>HjC$xU+$G6pILoW>iiG2I{FpQba>xS^5(><i5%y^FmO#I zRJzl$NQ?{g5xh)u<QeYQ+QCSp-WF^b7w9@>$+2Ag#L^iywQKNyg`=k-QaY1;Mpfmg z$)-EhX*c3|cQIu>94PAs)UE{EeEV-eZmZKnsz}m$g2xk}KHz%WtbU}{r`yNQaR5z1 zNLqoA!_%ucVv2zq{%WMoJ{iZza~8XRx`w~t3j4NO;CN(^MOrr7I`>*m!c+nTV%Dvq zn(>~NEX3HkZYW9H5JGtke}2~xP0D7m)ogJKJI0ITta^rvHTcFtEGjW~pS=kgXe~D> ziHz@R2elU+Y{(mG;kBJlGY^*)OcA=vzA;L4G`c7GTxzjO)UoSMR_jc*wb8wvJ<y-} z&t|(x&43!ea;B@Jl70nOK>q0FMVP-vUA)1Zjc8xroT(Fh>c@k9TC&`==u#69M>FNT znhUK(5(q$vsjw>z8kbSOCA$T#Un+yW>o17SwoPDcBJE&|%3TRG=7tD?@r(wW(-D76 z2Q`oTj8=DsRJ8lD<e5*H?dG#Db0mZ~cKRWtvmv$bH;ku(Dm=sLZsX0rHB*`rF$7uZ z=*h4K?<nXlGm~|dV(_#_f55WUB_2dtTYd}_M2JLv5(@A*yA8N!*Cp5aYejHD9%8zR zEr<KaZ4b@mszTA~lqM4LO5ASKx)Z_;EPhc&?)W;3Yo8Q;-|IAQYpdK%UCwji-UPe9 z7lZrT!RiPx?u`y#)^UTXGc+LFUOOXs8?uXa{JMP{#3cY+q#mn8IdWKm19Vj~W{bqJ zCltFN)r{&QG!JNS8U>_)QBESca7G$Pp%pH;>$Kn`WPkEDT+3dfTE31zxEEwpVBNTG zw<+96ocOGpCfu11Zil>*Y;(-ZIuYDlgMF*4$rx_n(y^J6v^V_{=6Zae>B1c9#XFPw zs&JjQ#`@kQl2dBOqwiF8DBY<y&;;I~d9R=1zMx@^Ccd!(a-7kHo${u$LPFN`GY-5k zx;;Z)kTD=xm@1C9Wet4U4sF-`|1L5d2wm^N?_hte@Ul9c1k+N6*f3AWl@V5HRF<b@ zejbew;ODYI(ynXfy^D$_#M8WzesaGk*E0>NQI<E7IYeM@gvLaqaif*dmpn}!NLc_j zC#)G+#Q^OrgeywgHmaEDjj0vQ*=`JYu{mc2Cvyp({19myjfv!930U|TOT^vZXkpCU z!c=BD2rIC7V#6Ch#~hgxeBG~ICNwO{Iv^n<#-nkM_l7zlbiSz(@(`f+JIEdg9;|i+ zDIU-Z3Y{brYt_<Nt@XO!$Jl_EdOVCf?eQB@RxlcZ{NfgI(2h5QZg)>)#vfguH9$gh z@N3^^*(n;JXm>MB0sf|#*H$mf8m*Q`AGu6f237e^E=7MaRtu|~pcB1tp<cp(zM%;! z*);;0J>jZ(I%b$uI$sADud|kg-nb~bj0RGldjlCfz~+1|ci;*gCW^RZe`<syhw;pW z{Y>77(@|vUI&85V{R!aIa$gr&1BB#p;DyZ{L{*69Bs&kaNcCk{hR01J?s5Tt-`-%i z>$vBSyc6ku7y)Xc?Y-f3t^60TAg`=6z0aPdS_aMXp==_@M^qA)AcyguyOBG<|EEgr zfy`xyM{yvAa3A8|Ai*)u;hkO#v0Mw7wb1?i(}N9_xwFWWb=?gwq#}n3B`wH8#LSF- z!XNM3**WSphsc7;&23FvY~0E6gsb$uR$kQ8+FC{LDpK3(baNScQEW+Rkk%sN5gMkp zLk`09H!LA~hWXUF&rAS)!3pmc){EiaZFB{j2lJ*>{m^)kiOe6QbgS5%gC5xxnrEVb z5S9XPkl@Wif{3_^3O0}PGcc5;YtK8rU7uWcjTA?^b3s(r2xiMK+{BB-sEabN<+M?v zSH~CJYeJs2UYi#g1pbJeg<x#;OLHKzH-X({7#{$3hu31kvdl9H0R>~WGl5cvs?t8r zwDFv<G(Iq&eDKs3Rl)(#tFDo+rn|C8^;dB(F;JeZ`yQwpTUoiasZt>G3pkV=){z>P z^{pj`?ta_N<;IFxd+yuwW5sECY>SeY;;vM>QmzQ#@xyb-cor-fQe(Oe&q&RiclgtX z`vU?YCpWPeUsF{I)JoCCZ}Y^M&qr-3s->FaU+pniN>4x8Fqln)vk6zQxejCTmU$X- zh(Ml*q?r|YU?*d?u9hy3u{8(SYyi=(?$6M2;~7oOSOUj_rBZNmCLveLU}<>WnbHl& z0RSLwEU%B4Sr5c{Ai=oQlKh(?sh;Konq;P$iysCH+c&mqvukX^V4q)Q5lJc&FyPvJ z@MQqYaOj0FP>OD#Tb)({5m}EWw^ibEQ^Iyz=7|BH=Gb2?oE2csn}pFNQqW-8!T#ap zl&t1Br$v%55(VNt2O;z2vb0!oZ(>csVRGpW*(yu$If7P<1xV^m>Y!7iG3Ki4Tw-+Z zPj^GFJlWEJVreO2lkMVF=*1l--WH@?-{G+dh%w*6&0rH)D~cwAZd`Llx%ABh@&yxJ zcLi>B!dF52n{wM7v@uN5kHJ)V&q1=xpPW6B35Kl^8Fx(p;J|d6BE2Ek9y5dQTr}Y- zwH`D>RXDa~>jqNQ(rs>q;A;2RULh25eCyd>Fur}VGk8HqHbt((mQs76F;?1a($wuz z1?nWYV1E(VlYiJCEd|@oTopM%!4<^mLE@tDdYN(K>WuG^m7>bf14BCXvd<Tw?0*X} zlgf#0uteo}@=B%^WbvP6d*~+a;i+hvyM|*cJRao$Y0`m^BcM6^hws#(oxiP04yX-T zIt<GQ&1Mh1A(yfFjcxov62;#SYm)GG)h?2M=5<_vXXs4@|Cb2T9fw5cU{M><Q!w>} zXmPN7$0_auMODq%Df_Aw;^7+a4R$uY1cF+iCFm~}IGA_bB(4_DOmYULzSq=(JOhn! zT#;j(?v5`uA7!>+EQNZt(A;V*>j8VydlxK_)5hacz`ufqP5A6RG(`pZ3My<_LU4sM zwq(f1OU88Aoh4%fk~P6CEP$vEtU^{z{I_N((@zyy&FK|jkQ->|3)<zcg4sThI{T|8 z<<hgtVVj9|4iA=F0xReBUDNdR*ajW=A@=~zQc%QqL!lFdL)@S>2%djw;X81KQMP2s z-LWFWy@&B!w|)`}^wmUFMBRJ5c>A&JL6WL-V8UKfXH2Ov(u{U66-A_`r1~SO*@wa~ zr$(=8@-DqlSCIfe;w>Gn<vAx<HBCqlQ8_G<K_p`Ci^2)2WefYEg3R@-+J||I00=0{ zXljvllgTRacHXKjkgEF9J<@Rl8L}i%ewN1*W&<&g>dry=zL1!Rsh@uh_6d98rqX6{ zJ_v{qj*K=l+zOjQda?LP3K|SD0>%K-#SO=WIL;#%fGSPlqDE-jKbNoOXeS9ex7KNL zps*C#vq6^4)VV_ItdNS#7aQK4hNqRZ0JMg9F^bTSP7eHvlZ4_anT<qM2{2T`x6RR( z-hGVU%}VSpV$JA&{o@klqTf2yK?q1Dh4c{c0<GIlNW>E}b<+aD->PPaH|%6N%ya6@ zE{M8%A+Hp`A9=S`5<z2&K>@+5%wd*X%vI|fYmM>?Rf=F0w+Uag>7Y!MV79rrXs^sc zyo!uTDijo8r-!`Aj097uEz=-6Cow4nU&_(Ux`<d4Z?A`Fy-J;=8%dCM2V%qCf|vjn z!eO#oP2q2CDq{iyoXBT#x5BR$H>dFsRK=wx%%DTjP?*g977~`1mDI2r3BxI>#5J{E zs7kp-5-A;58c`BcS*-jyvmWu%OY)Z-%igR>M3-L|9!8F2Fr1On4*_Zw4MX}w)`6-@ z&5~&}?$a(m#+r`y!&`Cn4BPq2YXHiI-KU*Th7|DWy;(55F&b5*8`(46<DO@)+uoaR zhYUg(qe0^lBp-@?r8-zX2O&SMGN*YL7POe;PeiNKcmz2jFtY$q7g^U2QCu?%r5k}4 zDeQu*VMAXn0)-KxeL!=w1Ofg!z|a~`lF4{$;ywCD(sjmRX>ttWMoG+;i}N_ipiz>@ zmuSnkttiB#pBwU_U|y5PlPYh%<=Sa?Sh<)aZA!$|9Xu>x%bjpF{07xoWx2m^p;Rux zdfH_H4v$r$I^@HZ3AJ)tG20Au#J|)5Fnpo#*o^oEA?ydQVs-Wb3I>m1*poMcCIpLw zXZ9a;9l)1~26$+N4D_umJp{sybUc>H`l@37D&b@YRaz}l>DUv>EIBigrK(8^0k<79 z&uK8o_sLhsqR0n0BA^;-U#|sVt#>IXqU9YZ4Og3zz~`?mui#V_0t!ipXf%J7l^{qe zvs&Gh2;z;|gx-)IUa=7Ua1Bt?D&&~KCvj`=8B$Fl?;u5!VIa9qMjBA~GZe4Hl`}0h zDMXcG1qt>@9aW{H;XYga1;VmL)i6^VW0-3V8TUk#KkD#%Tesz2AKL9%7gccy;Cw#8 zCLkS|WhO}w_e_Spg?Ks!+9@DL4tlv*Y~vNw=D36oeS=cMUYHIqRb^vhN@}lBrODRp z^*!nT(|wF^V!Y(InnfUj(V9Mlx_|6rNTZw-pHj>1vPAF`A|-tTWHMH%T)Me?yT|#C zR!gTN^Yg?&I@oRnKP-hN`Wo*D`-nei%g9?(@M41n2zcq=Bd%pn;8Ceq@Kl>mwpbLJ zBSx9x58Ma%7M|fTMcUe(W!aQSh8z&^NIF~#!GiEHgBc+!{|{$x0@mcUwGBH|aRTe{ zP>P7Oa#}1{u|z}+kYiPNJBb`ciek`OK*bUyg(L(L6~zgqR4rvnRK6;eQPBbt2#5kQ zBvMd7Faa5YObG-C5R&|BKTpD7d*1K=|Lf{?j-~SC*=w)iUiZ59j^1y<J@IJriH|6; zc8$zLd?se}+_MF?IYRSol19*fS4PpVcJXFtS6SQdQ?CA*&+y+nX}n3P>lDcbzJoM) zNWZCVS#<&*95ZjJegOO$Mg$;dSJ~IW<>;BSr9(Z;ADqM@^1YGXB<Q-86JaeG6hlmw z6n10rf$N&$H<~_gm{0ah$Fy&2769|=+T7_aH2%Vq8@hih6H_SvJLz!rG}dTZPYsFa z1s045Yy)@e`~z3pFMZ>Gz5fQ}GD<Os-n8+wraBchIn%f8I<z#mLajDeQm>0n+10{U zLr+qTVYaC)or+LUjYu2=*+<An(hZ53Sd|uP#U?mCcCFiLYH$O?Pa&lB88d#JdJ5qd zjP3cu1(U=a@JrEF7ueB1m%JrtS6w(PUh{yqR(HlhtM5J;x-dU>3LN5;_x-NTiZ>iA zCE!w|he(-<@ksS6yz+1Y+;#tQS)Nm^M0nu&;ses8ZmE(rrW|8Q#nRO9@IJhAgA)u? znfl*Z3rD@UZ{${ADvu(m1fcl0B_P<Fe||)K?Qf*!m^Z!z?JG7EgS%+|Kk*}w<?3Z4 zHt2AJG7e6w{1+s$HhmZ&k)<(l-HumrIRmJ08tgYW{dFf_#&xH6rJch;j4n9$<84G} zhUZr1|I*T7DPOytUp)N^(Qt-Zpa)qH3s0@y7Z<*6{_==--3-DJm)v`7Q#$`XLoy8! zT7WbNQ=5q%xUBv!n;C!gMZtq}1Z<F~6^CNXE%}!TW1glum(AKY!Y1)GcZPG0XeNHh zGc(F0v7Vc$xZ@&@CT>_sY5H_vB=bP}@Q>tKP3-4A5xRqU#2H(C6BLalFLXPdal;Wi zTBAEw07Dr^5Y4{@&dBC3?dFEt&D2#kyfec1{o{|UhjFb@y;cRcG~e}AC04;OPy=Eu zjFJWDf~y08^~H~B1iyeCeU9W>(1fn^J(6w&EhzI`)o!yJA*Bm`L*f%!<j7D<bzNR} z!S_PpBPInS(TTeX43i88(1cS_r238V+XEOj!D$#&d!ce2;|sF1jP~0h8w@mtZjX<= z+IMji2q3khswX`IFVZk%R)acsE#F4CPQHnc>QI0ECj@0*{UkqXbu&D<4m*r8t=T6B zU7Qk&V-b<lnWxphUB4fIkp?|hn8Xt7m-oW<$EDiAV872(Zi!^^^BnQ@YkZqAv9vRj z+?oFAx=6N^$^Rd9_=giA%l3`!3xSKM^fb>itaN9^X)UUg2k?+z^-_3jcnu8Hkov=` zdX0ULCYv_Dlkw`|Jx5jUPy0?Pk30Tup=w|8bJ?m(v;Xn0@*ln^9WT@z{GT}&_X+au zT~S?)YFU+J;<LMb8JT@wlAcYcHYPrycC9crY;5T*R(ZJ?_bh8prY1*SI2Jg+Yd{ci zf|+~S=EZ!!NWYyP1j~D^eg2(C50{>;&yIQ+@8;4-yeJFJHa4{XT(UvF;(6t=m(lT0 zy|Rmn<%w<uiCg^KY!4MgY~GN(I`d|sCwaSLO8i|>vHa4YWsF4yQMT5rq4r_KIPX{> z`3W`1>1iJ^KzXU_@-EtT^{(a-@ndHH8tG5RgUBBZIy0`7FYhp2FCF6*xYyZLrl#n* z6JE@hEa`rR-gKmeRh<%FkiD!KK0c*<+2*pi)RR=FHtNzomulZMeL>Vn&_<r>u=N$U zVBxcHiay=!dF9u2%lo#+r9M*r+7`Dad9_Q|O20a{5y5Jn=ve3G&m}xtn>(@Q_sxQ@ z-WA+L25~TN^6(joBA0HyD7a*Er=PJ+mFQ;6^joC3p5dEezP^m$P^L^F``+Xnrd++d zkyjOLn+*RU(l?CmSc(7KmGHuxKHv6=Ta5XS0e0+FLuV{AlaDowmwnYNCXW^tzPn2O zPuWi%cC7f(K3Bt~g7JBQ<A;V8x9H!bEZD2>D0xsE*J@n%yz2Q@$&Y<LyT6af)>BYT zebQV4qv4e-gH8*MJ3sGD@{x7ki%WIcAW4sLD@fa>N=c3yUeI5Y=jJ?Y6A>=$ou7NQ zXU(A>s%+|?!!G8nh#zPjUYoqyL{#XDEZ`hSI{Gm(NTM$}Ih65^BH7ober=%4!4E!B zzJ$|pM_Epc3KNMeyAwK08zL%p2#DJ<)@1&Jag#S!=uGZ!{4i)wLCYW9yzsIg_{9Pf zT9({=ocqD}icKEx+q;fl>M{_dZsV+x7OkqQ!5-pX7jehfKY}_x_^|VK!Ru;gCU4^= z7ny_ZHPZB7)oS<B<#48ep{!YTZ`ttmZq5xQ4-EahvNX+tnqlmJMhQ;ZvgCd&!DFki z;DH{#Gd~LUnJ0(Zf39?MK_7A&nd)9~Tuos@%c_jzs0YR1y<o4K1#ZZApEO5+O)Ovb zq|cTnhsK=`g`bzclp$NiSAT1g9A$eC4z-~0Xihc;=U7!tNQtWoJ}v0$6h;&_JW!;N zSn-PL#qNE{u{>*%{)DQ&l=(^i6RB|MVsRXA)*qQ|!=9__%T9WWIHT{Y=FlU$Oit~Y zdff{nq5js%p`Pc*;dOhKIYi9xX!(MEm;KdVhJC{?$grEshqp1~;T0S=+f{&zWl57> z%~Av+m$#-4BNO>Tl=wL_Aw=V9$byvQ-lR({th%qAw_ko{U(ItK9z1vWz2K0-IV&B6 z#)b^T;p#zy-Yuqm=@71>la49f?Yu?#Hz7Vh3<}z~Df8y4G+XWmgWT7Dh;#A1-N&Na z!@p`4I(wI#&y@TjKG)yE`?CG~)MK<!zr{4(Eyg2m?5Ddkb`~5AZ44o<XF=7#*Wh&~ ziL-SJNdLa>Sn1wYr@H4+7pe|h`(;FOnEp%qx4`-xZ`xBXMRj*9=yL)0NAWFdUIV*T zTu2L<+gt+M0-w_5wJ~`$;bkT4QUT!%6I{b%JE&V)!gpH}UPg5L9IA_Wa3fBbd~BOz zN@LW6&nmt(?|E5?r4M8GY}&?C_<JQaRde+uXS$<}euo2<JzVdNzX@MV%%RIN!^pn! zd09&FtW|kV1`~rLkITA@iWXNDet6h+LtBaVRcCJ1#!ZC(H#>^`HAt{A#=T6xoEGH} zSyUhOpw%aXyz%BLu*%Dps>2jm9n7nIcUOxV!7Hl2&p=5f`kb$upTsI<Ykf+2Y6|5S z+JU9rhbh{Pb+?e1)}`lt-rnwY#xee`6T^t;%80X=u#@KY*)=dKms(4%WXU5n8z*`m zjs4SH^LzeH;wC(<nLAyW=y@J)OYium(RQBo-QDi)>-2q^hno;`hc;Qv+)J0LPG4jH zl1eWtW7`C6MnoGDmwH1YdKoceM_dk*x*;b8`rbb)aW;Nlxn!gu+e90maW$(rmA<>b zcV^mCZHJooF$0%&AB8g1xeCwZ&ULVxr9G`q)nTiAoS8ebA<PLS;pGoUrg9?Y_MMx} zgVNfCa|_B<PkTg7u@47V4_ANXJw}<umWV0dZLt|SYLg-{W9)aaon}SXagEDll%8y~ zdnX;`^1fonlvG$j9FvE;lAG)O+t>#}9?<3mv_QyUu+`dBQV`Yc^Ktk2k(*WS1LJ!L zmRK5oFU<SL%n{kkXH^n6-}`#VM4JdN6RO|#z^L-OKNGsvBD23g_9I&l57Ob05I6B! zR39_eKTJL)ad-pwx??-&(8_0Ei5Cmb(@Ay{Ij!DCg4?ji0k2x^lkp_&>C-+mXxY8x zdDO50hjP{9yu-t@!<OA~J{g47WnW%?23ewW^Bk(f6;x2O^E@FE!~3dzcUzkzubNCR zSk1snoYpKi3q&hqPIqFjrJ%xz)>8ttv)gCBQq-s)xU?PxH1?R8o9X=AajOD_CdB$3 z=7qP7(tI`zaw1lur@Y;>?(WZ|<r<c9unoSmrRR*a@?xDG<?z6N-Zu;X-BOaQd5_XP zZ+#vsjO@KWT0kBf9-bJD;&en5SyNoYqFA$eMO`LyUX-q(TKknWMUU8EdrJR-9+w(x z+=r43<k0HxVZGU_(x);H3g;6Fw}Ps}$OrGx!&3n|Jqvfr|EANae@mxvb(o+LDv+7& z75&{2ga~`i`N1xS)!oq}_w}$!dhcZXM?KCPHwkxQaU=^%)}_lC8`}0xj%q%UGS=D= z_Ky(JU`gfJKd1jdCXQt9-^6WSsHrBdCP^$~a$cL+7w|5G?nHn~V$$KhI=cU0!G%!Y zIRE#8)7mj$<OM;RgF@o*v4CIhuDVgssI|4s#sg(UEfmm}%}C$=0eq#~9Bar|^DN2Y zqt4r>l^DbRt^2`O0b1dR@WKe-pxv(sKXU7}B?s#2kIn=xb>pVF7!GrZ>f8YN9$AAI z{2nFXYM!rK*_Z0(XKb;;g4<?sgk(9HMWYHoJn%!5jY5mt0HlC~B{DWIwDDXh%H)t$ z2*wY7&RY@MpKge4mtkKAmLVaOf-MfgKK2}ShT_2efNG}rKpy4mBw2Ywg_mlEKkTc^ zHdPHLhf|DxW_xk7FI2zlM@vKXgmx8Lbh4X5F+#y+Y#~{cOxzLJM9Gr>Vn!BN9F%;j z(YHRJNzZR!lu*JVGh07K8S`JRqZH9+gWQK!50kO|__DpmF^$$T_BBA*Z4A9CW?>Ea zy`=q5&2zy&@-DZm+C=9N0A=1(AD)DU!LBu{$R_b)4i!<zpjdFFW6m~}@DSV)#HGF- zPKT^G6<Rn-xp0iG#6g{{Y$UnhYb>@Hj;H)~5-^~?$>n(^dVvHCH{6C?yUY#s0)Wjn zP^)iV_T0FMy_d}T+(VO4sG2kC`bZZqClva#0b?m1#AdhlxiHHi?E)gQYCek<s=nt@ zsG4RQBjf+KjicGTh=h$mZ-~&1MR{|XW4S|eoX{Tf|Iv@BrZ=df71}o{^9QgwOgDB{ z-0SLH3)o|K^|#WNF>Nc*knFAq*(qEr4J<J}uDsmDib%?tkOes{BvM8%?IUkx?+<7W zZpuV^vtgu)9)N8ciI?blyos`nw!41?gv-|UZ5=98y3-X%er}@Ka*nWR-}dnAV}YC- ztLoNJtLNwmsm{Ye+v?2v7(K?i-r_bPek?J&*cb{HDnif;VV(~g)!&L7Fx5ENmTHT^ z|J8&B1=d0V3<KZI@I~1DS=7?ZlR0L6ADXx=J-YGGUpHo&XSi(3hL&mLCcm9!YozN3 z8Do@I1zVL}V|_yNuW6xTe;{2}IN}TaS+TJ;$!bwkCP2aJu)-^DP!kVb&BJ#t4ql?l z5g})2QMy;13#I>XxRWZlP`|wINa^@O8^!VH&Xh@9mLz{so<hESZamqM47&h%`0tvz zESJ>&zU!;3O%iFwW3JP7BtR6TtUsgTwq_Q)OswdQ8)!~+eI(H0MsaTNSxFQYVeYH3 zBIJf(XR@xzv#roIlPi}EyD;I1ENVtjqw_`=&=_)Su56s<>v-(Hdit#ixfA)O{wqm# zf~>%6w$#5AtF{P4J+E@#Vy!rynIr8p2F!UF<q8+s5?#yjcIRX5_skPH;PuOHqJ!=7 zpxTK~Mmze>N5fVay&q033O$YN52;m9De^pBk5_TzDh?HRoR}n66(s6YNG~f9ti?lh zveYHwjV9|<Rd{o<{T;Hl{OY<;$Pdx=sVQXuPN!k8soGI<hnc@kaHqZv)q?<~K2|aE zj;J?sM)~t5%SUM+suhdO{hmu1lT`=D`Z!2Oeg?R1dS;Beu<{0Vvo1ivTR%s=M5D|` z5jC>p6>3OpM8_b*Y-b`LlCJ@u1{fD^QW%^1NO-!cK%2*=+7PG-o05-CYciVyR^cgl zG1h}Lwm3xi<)J)`dO<RTWAg^~A{K-B8a2Z6Zc+@qTn=3Jvw>9h-A0Lz^w{IW0asB! zy~A&V+}<yO0KjDmA7d@8&f3^gO8mf=;qSQNj_wK<O<+jp6tks;AxJ5oFIhm@__7U< z(1494;G={NtU2v5br7QtcaupXAmA7AuJ4Yy4xZMWC+?(-Uov5}ohQb3ng=R1?*(YY zu}+#dN>mu|YEgP#iD-@gt>>MQW1vj0%+z<<IvjL*BpD26e%~$u7U)aOhF0}0b3@hM zT=6Yw%Ujsv?~x>y{X?kpleS;d_4DnBOd%c+$r%{9Pv~?l)@A#D4^^MkHD!n!nFL<D z+ZQC&BAkQ3em1nI7-Yqg2hN^g&1F(60UQYf^{RK`l)1Nmc0sfP)wI|VV-nikot^ee zZ3giVMqNd}x%Az<n}CK|!+vg}HIJC|@;c7O%Jl=r8X5Ajgj-`?&7+*h0ux=Pe^Sow z&iL<U<+ya(LOyJaP})xV8>%n)f77FA+w6z84=>GxbcrK4z^_<5MpU7MPt|UQGopeZ zCNSy;tK)7lE_79@eT3kqGk`5r(Q&_-VymkC+S(>)m&SDY;#{G9py^3~hKON;*cR>+ zPB!I9HB}On4N!ST2<^hk&l2SK@Md%d&xY^&I@YZ(QT$*u#w61=Rm+e$p?&{o5Vh~` z+S_xX9q2zG(Fa;)pV~xp&O&-L{+99aHl-QVO+0TPr0M*lp2XA_c%3Z0;QKij#&zK6 zY>cbIL*@&Wz$DR}z6ybuXL+yw23Pq`%cTNTT!0zWd1}o{cjOswm3v9LAI>{Lt@~1N zJv+s%Gk&{iwhkTRc}ndis}$b$K3y1Vl*t~fKcGJ|F#x`G{=0%57Ku>>s6_^v4rnkG zT9^NKs|warKY)HzaNPhv?pvKS4hSvjf-9`ZNqaV_Zykx}U#b<)t=6+ZeKdlKsOfU1 zCFWWWQc+<OiPlYJ6lbSb;)9)AOE)hTB8F|*=9~m=j7&p8x0T;Uw;0!by^(Icx^31b z3BgG*mA#^Udyn900{uEh_c^SN-wrI6mgNy#zkChRu*o>W#YohKh|Mn%%$Z;?#MUG! z6tKJfMn%i9%!(Os`^HVoK>iF~VTWJAqy@Ef8iwMBmuQKH9fVA`0^|okH7@_Y|Fz%V z>iH65)LjC-7O^=u6en;SBD(wf5V!PUTf5i6AIlc%iq+V^dU>ss_*+K=gEegL7D;E= zqF~O5N!VEt?Nqstp*M0pl$k$8Kj3}vapw-z+UCs5Ziuf9p+?4SCDbo#p8NNx&Dejd zVyJm5A^~ySN$#}82;S*P9BZ?sYa{IJ0C=Pv`Uo%jCW!=D*vDFa^U)c{jB+BKvxe_F z^yD}Bf8<T|8nuEi^)6EgW4V{QlnOq@n=B-gy!qTs6UsimwOGi1c-A=(PPFB-*LuGg zT4EhL(KRL+7IB5cZT4hl>rOF^Jnl@G-+9V=Zs<s?>%<f9vpRNgwkonn{Lel7Eh$?8 zUd#^;L>#4-%s`7qX=!rvF_5IAPO)T%dQRZ)U4JV0iu+lDj=a(Hu-36U1qJ(23HUxS z(JHEcQ!(OeF>KZznSCVw79+ArTtZP5&c%o!%%RUsB+^<M%PSpIqY}x;r>9f;P)RP0 z_-@O#vM;H+0i0g{$q0$PuH~EQEDk`g&De^W^+AibOcMQ4{C>guM3fVze-<`A*t`7| znZ>1B?;3m3rI3_e{EGF-_&zh@%KuoO7|y7AMIslf;l3ueYDA?`wJN_e=Jl(Ng)_D& zyC)=8#NLP2q!$BKJ)Sau*&uJie^8Y;;aZ|AfG1d6TPTZC#UIq&fW#ZI8DI<WZYzuB zI=WZeR0l3azy<H3%6is1pb3aeSM!&M=UfY5NVRH!L%XUq{S;=~g7^D4BVJ=_fiZ9; z6o)a}4d2vmsQzJ8k!``E<f9V!iL<(5e|Pa-`8xC4v9xoEDLnpMp&vd(!7L69(wC60 z4tH+W!WbN`Qye2O3NxzwhW~DB1avUeLmMEt2jM7SGFsqY5fOyODLhE`fWo%U+}UZ? zF27h=^HsI%Yh}p$uYBH7s77uYZW0c4cBCJ4B$4|I?U~`fPbdqw5Ud*+A0HZjr1YEw z%FieZu2B}D4@ul&n&=j6X1`c?6Hk3V>kF1STtueB?TOE$;$eW4bVlMvu&*rttkRSI z9xBSwbRn?<p8yf*g>HCntxFJAQHd54rCpboV*sMnFCbhW%=wM{UlYp4ba4|-k->Dy zq{j4GzVi<2|1x00lGh|mvPP_`EmVWcEexQ=pe`W?KdDW1ciNY1zPQ3C!&8SKjU6gs zIz>bgiy=suk=!xXAxQ0v<oET1=8!?QziIi+mwqdp7}alcO37kwS)Ay1Ph>}0_O*4W zeN*MWA$`A7esipaBdSbIw2&KSTs6%-Q^Iy(JnWM0mMECXfO+tOd@b>eABru=ji`7T z*A*MX`*@;y?Qw2pHm{=UY}7FGF;nFB_DBxz;y9iefhE5;7q$V--@0;OC>&XkI#;dg z9gzxiSklw=-EW8p;5I)jp*l0pMqQCx#%NiS6AYmQ8z0PUDey#^d6VObTMy9EQ9$7L zXm1GpGtHNp5>2p_O5e4Qfq4O9IEzr@?=jFEPy5y0URsnL6U(&R#%ilGr9Cr>O^%JP zi5ux#|FCjFKU1C=>6_@cLcJmLce3Vza1UFph&)RuCNL&C8Si08A?zM}uP|j~?2;-W zXN1K1KgwXX%KHDXs5(oo6{YpR37yB;UfpiEx@@iAc?U>2f=4RMWuGKm8lhv}$T%A# z)XpHK%cKmKzfec$B}2|7_IB_p%h?w&G;5cLtXNw|A5=(8*rf=AL6=-E%zISsIp8AF zj?dnr*`dyv1#*hBy|6hd!k0kifwzG>S$tb?kxQ`!!`7_<T7-TH3tUtwFOTe*VK=L7 zI|S|ljN%_Oj-wWP*}Ql3y^lIuJACTOdK5gKxoy=epKUY^oucU3ZmP07!4PE?Xr5Tp zyg37vZ12LZf|@9&<>BFCB}?%B#I7goS-2r9jEdBne|J==U9v`vcJb|Z7jBX9#xZs} z=sgZ}7`W@NjX{H2T`06gRVY1IN5|qji&Hv$7oNm)W|O505$LgQ2x?go(r3yY*9El* zU%@|3?8v-Um{znIgg7JP4Kx3{@qjExAi=cmvkI74X5$lSJR$1~2z3!FI!qnRGAA8P zJB~#0x<g>tVA8QD<_gttByng?h)Cw$(eYcS!jHwM8T*EOw7YVrrg!+sUHemJmw6*| z8nT9a<oq!5x*CodZ)}S|EYysRhkJ|r&JZY4y3+pxVY_2xgsie@xmlZ(F?*s-<5wi) zpRn$Ez@77gVsMS}t^@Zeq8&4Bw7uBdwYs8edR%Ff;5JT5|8<ckN`ZM5pIYNn9Ck@% z^N1am^=Q;KApwvTZmv6;$NO<?@4njg>eOUNI|VT3_Din=Hq#MdR;Z_eD0O`8C|&ax z{!NP_d0R`L<~_nD_a-|cxe3%-o*tI(2R`whr3pRcY8^3rCbRI}9oNMxEyW*b$u_c2 zryTRrw;l@<B?>mI!e0r?QKAonLWA`<52^$gjKGuUPjRu4;@plOkW1WRT&QJpJ~K<4 zq?W#GCk1;z6N4?Z#WOeSb}*Wo%$Rq)P5D8Z`Fm&71tqO~lfB3Lua2M6v5f)oidlS~ z<G^Q5y^CACNq2rQ(`@fgU>iMD=Rfjh@rbP1Rn{?VR#(E@dec#pueA`e(~+Aqt*4qK zoZm{F_!euCSxSq&>v){DEyjQ{tUJtUoGTyALjzdx`>)*cfURWcaW3(ivn$HqpvnA< zsx$Lr|9)5L@2%@Sz8xeQ+fY`gp3&hFG*`OCSc?1a71cXggX2;eYwVMj64LCdU_JHx zE12^_uAV;8pH}jwe|RWUY8Wo^%vc}9k(uDUdY9>KH%&URNS}>z<c4nu5_7e^FcIf- z(GcW93_mC~H0uTAQ*32;8=))xc*gs`<`XEne}P-aU21#ri4ebc-ueRBbE8KKdrcnw zPI<StqWy2f1Rs`7<0*;Tc4QX14CVRdJ<`7&G>waXs_%y{M_!maEcqXpl%K{)>L;I) zm^X>Je%E4ZE75Q3Vt6WhPhZR18;K+q2tIh^w(brP1D_2eTmBId0V9M*y{u34{njtk zbY*_p=RNyUEH6_N-oh;#$vmwd>{AA;QkCu*`}lFj8X&UHC1R_XY)WSu6>qqZ&-3kW zN-hVTG1<{EVyc@$HDmi!yMY~Vp-!vN^0~io9cxUr-naU;2W_Wxt*+0QK0Owji{zJ) zLO?rvoLSf(o0@ArLF>wdELP2oz&asruf+*(_G?8wJI90lC{|d{8n53pcInc7w~Tku zM3Z^HTV&83hw8}xpH)a_tL1Mlky4#n5!}X9NEQ3dE$$UF424e{TVSx3bs5LolY|Hq zT3v4RIM?izn$lEh=qy;yGJn|ihXyE=(p|LcA{ik^^^IKA5}RY;RBFMT9Ts~<+|W=W z+C{@M8NBU-&i#Nw(RPdMHf27_(2k09a27K^RLIU_fufGcU9H5SLM^hj<K!k|_3+ja zk$H}0?Xex05(8t@9p31fvpd!eAArJ&GW}En1fvg+h^)qW*<J_R9a`;RzK`7KCUM6r z!!h9Hfyx}IpB11?=%k$1wV)^W!8<d%FPA^fTQudiS$ghCi5>?%v`G!$fB~JwCOF37 z`W8DSNBG6Gu5i@c1Z+yc>-Vj(q<w4-Zs(bd(_h~e1PhA!B>#^mbwh>$o37ysF(g#r z=JjD_P=7qxVq{T{+7;ftt7tdn$Rm*&h2yS8`5A#d2D;5edE~s;M{Sa~-V<I}n}KRK z2#>c3<>QLQx20OX441m-GHu=>uij2julZv5muVi_zsBR-MCn3=>S8qi?ByNT!zneH z-8b^Pt;hqM`LoC^opx+GrTKWJkYhsICRn4LU+rU!H0PQJ1!V*^Y5wIJrVrdFztso! zL1(j-&7;cYfI_sa=ocKBn0E*(axPCuK_Hv)7)VUi7XTd1OUAbrXs4Dx#0MmwqNx|` zEWjtHjk=-H#pdx&$mysN%ITLSc1xxK)&6r(M~^pY-of5OS8U>MjrBIGm3J)Al<nzq zbpoPj(eGNQ4z!cP>p#7jd6If2Mt&L$G*uz7c^q)J4Or<&_MT-O)RUkc!$E_Qth|KP zw9v9o8s2nFX;0oW8>mmwdUt$hb_qK(q)pm1Dz%$Rp*m&R5zU+YfMwzOiB`>lmN`>G z7BJjxEbfri+s)PUsVGsFn)Xhd10RPx7AZQuVp#leZZkei7r!=Fudu~1I;6I+kWuOL zfQfJujq2m+Tpk8Ho%+yv1K9f7M1_cc&4?-duKA=N=BZ4UVCKbHY;3=vpL#~zk*wZF zJ7J=3l4UNI><fGBovhvBBk@85O~K1_J|&{Q`w|fzKhcbhE46Q}wxGZEr&my#b0a{~ z0pb9dbBf@1m+1Bsu06OkP)ga*3o?({@avOc2;jjqH)!h0tb|D%hMO=GM@Oi`yFLlf z6nsjuoBqns;jvBB!L3MvFk)gh;C}$~NA)|C9~iZdKbtgWBJImODgR=swbm{<U=z2K z5QeqiSQ)G?YcbcT?8V2&owQFyx&}o2@%1$i1GTPlBwn!;!&Kw*WZsYZNDj^Fhzs^w z9fX(%Hl#n&wAVk=)*mo>b)uU2M%>DdEJhDQgbBRM)T=}M)ozfQ>6qfq1+EiY=8;qF z`g2vb&7lFEgi(sPX6k9*Q0Gh#qV{PVrVW(2EhCxB<ZkRs$Y?8c%dcKGy3_(5)>Ufi zIx)NFJTc%;zO&AO&;$AMWg14LBY~5Ey^&@^4nI;T^RI*dmZqbbnpd_yB~`^~N=;RI zX_KA+f9RyVe#5?1kDgO4)kTk;+0W{^hj36a{eR^(Sb`}%8#a4FSg%nj_?kvZC0ndk z-5q<x*Mutv`I<tt{Lt8Zd!?j@tx+N<F#Q3#KUd3fj5k;Fj*O%U-w&;dG)GeysHq(9 zp?#(MThkY*`;A@j{Sc}*E%icSZ1MOb5AOwwdy8&sL)dAtN=)~k^0-@L+K;(XFpE{m z7Z*+_<lf7F&{Rn5NCQMJ;(^gW!gB?QswLJZlpj&2eX^M;-hp;QEAL2REus%toY1Dp z&g?;B@+{H-Mxp6mvN;kfWbDSp2fFKx9%+9p-!Zzx+EwX)c-mXV;hQ2Hp3^|?R!>B$ zU;e2!d`5q&92e`U8OJnVc3F!Hr5o`lR4Z?Ka|C%R+px%KAq>Tsg!#wlPcWk&8|MQz zOd6jEi&2g*=ko<a7GYyN_IM7qJb2q0?=;7O*8|D?W}eE{Vc7pi<>hHUAhN?BRYaPt zgIj!g-NpQbX7!3X_V~Kd`<%y#y^fd?lh!OF757P4uj@OK)i1H`53?C}uFmoC2Y2o| zXiW_$d<K;hvV?`wRrF*>CVC7BCh?#l8@e1Fseafzx*|aHuxomhO%kKpSK+muH(F<x zr}`X3pSe)$lD*C(ksW6f3%o!p>Qua(=1{y`$X3?3zo1UN%{Mp=1Cw0s+gP~rmN3T8 z2;L~`*o(q_(_CNuw!_-v;BAl8U(Y6y0o&PooaZHy7P&fTu=aMUA|8p4*4O5VK-@dz zSA;T~)BH#i@9530W6#eIe?fw`Ig^xfTh;x-YfDlJ&-=`NH<r|4Y$CMmNPwdqwMje~ z_hH9$sT=ntr*~a>DWfUYTU$CHxqVW{s1S<QcmR%R`H$TTcZZzLMcp7CvFyDt$aLl! zUsI%Joh`UMu|!EZ{(pNY7%OqFYq8L@!_sxs(OQCW47qief(?b~d8anJG58n8b64~I zoQ0Qz4MUDN=_@boqcv}Xb!oeLwAzX4$&`S(<I47A&DPO<*8gaUI%+7-s;zYA$Wl!V z^G-c1@S3+ycxms!cIS-iJ9djQZ#rd^OXF&?5AEL`?iG_t7c{Zju5xRLJEmDfo->)A zFauG4YSR2Pv5+J_-t9!cx%Y`f?@-V+i-~UM?HShttUZ3sbF+$SE;p<@U!iobD>EE( zB!q^f0g-1FG%uK$w}@B}IwyoPWC>VU7sqU(E{kG6ns9GcpKSp7RI}D4>uOoS{@C`P zy!a{w9^Kcmh+ud0OpM82Of-BPe+#YC^g0IX?bPT`a};f71lnBuvuv@?Qf(cqrDYK+ z+#Ak^zRV1$o_u@Ylr9C&3l7bzD8Gbz&GztkF;OJ{ZfTEYciRQ8Ew9KKk9K74`D`h% zAnXEkMZXg#lZeQC=DOgs^r~_uFf@oFWSTF+Q&Z_qy$APi0Y{(1-OR{5C8_nA=M)me zlG2429l?OE)N8O{upegf!A}7EHqjiWrMF(4I13BP>iip;+1X2(w%h~lE*W!TAKuM) zooDOue%{@Tn@-j4tF1GwQou7>c3DW>WnuBDMP)k#Qd248?%80&;UgI~LFOJOzj}pn ztr+pvR!T+vi*C;hXGF*sRHYfmsg)1j+)WBL(tharphNqgQ2n8|KZLF89}EV*KC}EC zO1ET`8#>2Vo#!M_4M!WEVkSP=>72ek$Q%=ucg*|mpEvNB<WSIY)`K6pOX1k+m-E81 zdnD*goXG>&FF?Gd4^M3_@cL+Q5dA;z;&{UozZ3FBy%&Pcls}E@Vg4&LK;YhT$U<Ui zZm0V#m@#reW>C<lD>%0plo?@l<@I?sJydBn?wnV#oE4nB+GA%<tW{NWilNqq<=;w+ z*43?{?k}d&neL#j0Xi{%bjdX#fo@RbBz1_eGxN!i#&qS`dz_3;N}SqnWb1<#-ADKj zV_Zwr`=%mW&cG|VBowRUXtKyYbeo&02_sFQ$s&uyw1<)Xk$Bgl<(dO>b9Kos7IYry zStModv==;7e}sf2!v~Cxg3dC|-kF)2RVhDG{mAM25Sg(h*H5<cM7W4Ce-quQ!b@yk zL#1ZSF(aaM%Y#H=?O~i3W0kTTCAP2RpFsAV3@B2`a`rFBR^UZ=kUNVN{zlo+#3xbt zGDOBXS-DO`R9i?l1;@gEU|AO>8Y|Qv`v%l4lHKhAbwdTQsF(v1I~(fZQonga)Zvvc zW6y+hN{DT8<7R0!LqZlWn0m9$hZiIp?vP9K=Nk7c>W17iJq>v5v?IEXUV}IU5e{Bf za=N%5#nQ)aJh9dk@NWLc+3%|fx!7Z@xUAmn!sA8&YR6m0c;5AFzDm&{$rL_nG~xL< zDkku1+iZQpTm3m(rH(DaQ%1F<bA<HIwW^bL3n2lngUm3QrLouoYf)d#b_z)x41J!} z+m|^@PssH2f3L^PenVUKobl(s(Zh|?%(%;Xxx+TFwm0^f*<Fd7>1Nl2;^iX3VD@)h zg-wc8P+F)Xk9dC%%vV#VCsQniqtbfbo<fhqL<X?P=<*S639IniAIa}t7W^U;F;#ML zJ)jfrMEP0rP7Zv9=g2U3)b@jBZx5yI=&=8gGzaF;1ERnmZ_)X`NLb;R7-itR_bj=q zM!i=vp_#pf?S@KU=R&7(()}j&T<JTTlJQhOFZkvl3uTDcV_9cWYK-eK;Iu`0sFLMN z0;@Xju)fb&6q+nQ7iYA4BF;Y1FVwg{x^py9ncd~p{%exvi_ykhOZrHc!{-GtheDiA z`Q@zufnS4Rho$WID+<e~=5IaR%sko`K{y+Rgbx3!lh>+C0}}<!YC`F9^)ONPUEt84 zvZBh8SR+o&;;+Ije8Wlo6MEKPiVGL0RIeJFRAOOaexYjIHM@`(ovhj2lc}IC(_`tg z=EQFHQFYcIgOv-%{iVYl15Mtk-lX%6_>7&am?ul%s#Qt#{P)L=dW`t0GvjIupDi*Q zUdoeoo6%igm9g-2uk+`r%ncNPUC)?De+w)9K!{Vx_<(V-+S9s3m2E#H7{A)<^@pox z+`c#Snn?*;rD?7Moep{<_Z6-s!esX?lpj~!5S4#Mgu!fjB&}3pMK`GSqMeA|pP0Ih zO#bgSNeYW3m86M_N!L=X^<Dgk6M#_V7A(Vpk{2&E-J@goLWce^loNYfyr2GbEa+Cx zsOc*!3zmM=KxR*ms|nw!vNC^*LmSQ6k21iqrK@8z!~1$(;|x{!?1^y_PnKD`IF5sS zf%5u1X}##Q=HH>1-y_NcP26=zqT1cTsQ+1k>H0FKYOid%fwM4|G*{v8{>&uF<$FmW z=Z#M;d*fM=C->*1%8^g3s8$6hlz!B%q~T8*k(+Q&b6rwTiNG-=tIK*p5b(eztTQQk zr!{c{7Es4CQ2Eeh5BG*Q&#(L{k2FHO174NV<d3Bq?C{DSDV=d+RQ{y4$>?-4p`*|B z>SglBYWl+7k#18#62Bm&Blh>wp8We_6(NUOPpM+s@C|AqHcr-Ldh@0HP!Z2)Wl}*g zk8YsuA{2~Nv&Y9i#nZu6ln(TksWtRjne1h+`M*LvtQJ4s#Xi7W$kxBz|DW5jsYSm9 zq@~gULpTSdp%Uvwldb#(4%IDkxL9Ez4VyQ5(|-7JsN<wDN*K3dTh)y#L;b?P3|ZH7 zJFO~xXih)3`UdUA?e8VIelL{&vJ##FyWONh#DKnQud$O{;F1z+8lTrc%PfBr0>!CC zw|9tA5&i<?<65+1gu^SD0zRIS^J2}|<yyt7!E6ud`^naa*x`k0!e-@XtP}M{w<dNy zoH%7ew_o9OrLd}fEUqc9$Iix)@G(DQyf)X`TN*vw)oaJ|Q-w?WD!UwTOPmH~*{FGp z^uBWO7YP(i^mT}mu_jMtN%Ja@UJup>YJH@;^dUm99<s3VZ#{P22Ho@eAi7@|=fj?& zLfXdF#Iy3RrvhZ9qAJw5%Exz4=<HAewVBZ4vpzP?^Ub`j>Z%)lZ&~AYHN&9yh;&JR zeT6KJ=Ja_%Hypg!cV_>A`#Eq*4TDY?h|#qVPG>f|DleG`)A8~OGQ9KRgyVX^aSWC` z>34Lt-sH-g7&?$CYHc1H{F6ZU7-?#}fLkK<T&-#ai??-Uk}6V>Mp0NwP4SHRh71#* z{WSKtV%WMlGe^T@FGEE~xKMMWe?9=c=V7N}%zzu@m^_#h*4<vPh_e){S)jNioP{7a zt~*FK$c3Y-SOmmfvmdI0H1Yq%3O^^caXhWFZBSgj9&^-d7J0r`b#JR8ZE$Q6XDg1Y zE=WpNy>PF)-DAnwN4?g>>ilIYYUCSSCq(Coo4BukF<TcRZ7taFPIC6Y1|y=a8@{UM zO3TUOi>jjo{b8zwd)4qoO3J<-f1%9c`{%a%nBRx)SthBh|2KdB#GkYuM@&T7e{$4& zKgB_)>*#U>u&cQ(b!J(s5kI+Ab-VwRkyE-mpm)na1}gq2;nU&Nn7+WXVcFPCDE67p zWr9(MxxT*CMyHQ3-+-lYP|CoU89@wzWZEA$Z1ZbnRoc*;A>U32kjeuA8%rFsMHZfn zby%WB7DU#Bq}#;u{n3b<F1kSuIo$bhZdmVYuP5?@O945wM`2A?#SbKE<zis@@oMVk zG%o#NLP>bbFVw?j6z>D-aZ1-q){nRQu0*iP2kR#k!b-N4k-R%TT|78gl31K%o5=Jg z_rA_JlWj-$7G@TR3s))EhJ7==4KP;Et@(7CK{6)$nR%lP9esUs^pw1);P;X)uFQt> zotSg4x@%MBm`$Ef%{C4ZqJ@D0P=*K;rp0>36`STm_INvT<~4KUJcmie74;{k*$=r% zP!pxgloKK3$(MC^!1okMtYl$VXM#~i1toDP6icn8%W0_VGmD6xV4CnIYy&d}PkX=m zhPr$@ldwc{vg^H^i3z<tpt04vXvK@QB^)90IbpqnBOxav!qH)AJBfYP?E(Ux{LD)F z|J#e3SP@=CxV|?c#P@d{A-hMi`BCT|X-i?Rsh4=JmGFDV(X^j1w}{BAs`}FU-xS}= zOy7biJ4v-Xj)u}?ac@|pomq!vOl-Yj-J1@C^{?HYKuqt5`1L|f9|jPq4l3oNOUeNI z)=O9y8xWr`9rgQ+F5PCg6V5(1Fxw1<nGY8A%O<98Sn#7vgVf}x;9q)I3J3*D6vEDD z#GXS9jtR(L(Tio61#d)~SEP!IbLZc+IpjEc;;@0zE16v6xYy;tx~59olI|#2=RNXI z!%j~t2%bxwtgy6Sc>q@Z=i+Axarm<um*o4wC*TDY&;IXf8!FU5z@9Y&e;o)s0%;s^ zHFCRwcIo0oXx?_QMx3#8p7Yj)*j0Zst#eb)8C|;8j{cI}y$=4$Uyv;HDf_$YQCu3z zoX~5bD*g-{3roqz!TpN8e0}SqH)G3fQCC&n5r3O>*NJn!Ggr^H+lQBDoD*97r8Obn zU*h@et2~o5)~DC7zjcDxBOI9?zWtLp>7T>dAl)>D2322xwW!Vk00*`F3Us}OBjVhi zH<>p8kz~tj__qgPk*Qg=sqR%J(5dXSu#|#Q=nGmcUAK?k|A+tKhHtKPj3_QPvHyoL zbFmvd2ErOjP@4#&>(PcAWJhkX4zK+ss8Bg-9Hu6@y%7rDw^Bd?f|WW@>UvtMt>QQf z;9sm*hc>cdYLhSgxzA5iVVYXtshRZ6C7m{eDb&;Lah6tiQIZ8GfB+#t1CA;<YL$VP z%J_%9>lo-SZ_pAu|KP()9S0sOculk{P5b`dA)M6Faul>bUu{^WOE9rrlm);i2P&0M z(xqPnI<+ch{N3AmSS^5PfRjnGM9BeoLoFD6D$s4`Z${Vc2zb7Ui`!4CU)#tU$!spB zE<-E4gsqUG9PKSqmlrz{i^6M#&kxlXRP@)|B-Bz<-7?FLN`D}AA49P?bG;lf6%I&l zqqUZR6yU6H2C+zD9|Kg;e*^r|^A?4Y0aLsF|7d<E&g5lgu9^PY<a2h(k$4ZM63wR$ z1FF|UrkKh_`rNYf;O$tvaYgh=c_nHXZR!mhmKUq95hoFtE>>r3R6Z-i)0Zk5t1xwt zRu2@?oFe>^$1aF}t!{F1B4&xHvO*eX_T|Is(`L`9+mv=Kex3(6N|G|0@7Ct`aI5c< zYAaQqIC`11aH~VDNwLAwT-VWL%-Npgec9dtY|9j9<@%k#gdEtkl#|=`v6*Ttq0@Yz zhCj^+cbJBCk`6o?x`}TJD}k0*iDNZ|D&-;LpZj)&NbWU{@V#{rZawhW?zBZ=YgiQJ zDEk++?YKN_h(CX10!9yT55q2~$lvj`<mz;e=A>!2OK1GN%Z)3QDC1x`ZP&eNc&wS2 za7fW@>OlOio?p_Nk>q!fF2W6BK;b9~<V&&{&Bq@}?df8oaF)vk5|Mi{uiWi;<~`<8 z&S&vutS4L_$vRG4b^1sU`#l`*O@0cfM=c$QbNcUar{P;3a8`JswCo+~{-WxssFs$Z zneY1Q_!U&P$u&}=+Zu|i%C3dD12}9z!4`M=-FI@)=09(00v^phOgONG4Bs&V8f=YH z?f)gPC=JDrHNO2lihu*uUM1Z+Mt3FyH`|1n%0IVyIp3LkQZ26e)k01C5mT8hBDw`< zo*L)rXeQpp%?&=r-2D#L2kh?E+s%Nq?}y+8EUl{LvMKw$A!&0=+(4)w)j0Dk&FBz{ zB9^dNiHH{-L!=N8sydICE#ymD!le##SJq7QhRyF>?eYYo%aLAsc$LzS)LnI#T6URK z>mSH|FPEZ>aY-Ap`8A<Bi}|85P;<<nAlqrXs`uHHcL5F#9wh6C*MCs&X@*Sg5-a+M zobeR_^2est5;z+zJ~f7baEko@n5`>}pkA|3r9AZ55>C!oPc=tZw%jR{jLyO)7=u5L z44<(c?N<%<@!4n9FgqGK(^)0Ak()9<`}z@^A3hd5vPCy&EquIO{4Phv9?ERpsPey> z%)V6WFw8e^#%U7_6;EU9qU46Y28lhQMVyFYb(-~eJ^@%F0`zAVA*#X<T}9Mq3Ht_Y z;w1O7mt)zds`Cdku4#kT(azclktsQfm2lAV9^K%3kwk6?GTiFW!Z~l7@e<L7RV1;Z z4VV(r^ti@W<RXF=S0-p-73$F4_?vlhclvu~MOylBlBWdn)<PBe(3bmo(rwjz(5J93 zT1>#ex!P}Rg_F&AeM@P*{4{ptqa&J^h>0#+1`$<=NXHlt!V8cr_l|SUcwgVER@*+4 z)D!<S3m22UOX1606LK;re(Z#cqBQmB!dE%gw7B}%T#EF&`NHAXxAMJTOzbLpT=`XJ zOK*~n@C{q2>I{qr?mjzA-)?M)cggawNWOtx-ta_kJBT@qU~qD>lA65deW3AB!bN=; zuz<iweI7EEsAm<#p$6prAzw)@>8s$6<C_L-vKdWfetIKJ1LU1W%c_L}zXR)nu-vB& zb%LItAbV~1`yHl#Z|XZ*Z_XaO!0lP!;POYTf8;gep2mU*KXZiL)2dLTOJ@mNhkdeG zNj|7ALgdFJKWi9rlQWVEol7~4U1Tt;&!InJgRm+L{OY`f{V19k5blVNdOxWPuMlQ{ z^db=&;tm)@AX3|XHJp3(Xw6&0_nvQkSj=0m8aQP{IqFUR^}8M9Kh+yO=(E$TkF!gd z8D_Me#p08x>^ZsKv%F`E-$@gVb_O;HL5~IlGN;P=z=Y^g|HlFtz|0qh^?(wMxf7!@ z-SMr}GU;fuy|U9b0q?=gqGI50J~b}x8u^6C0vNG=;eV3OcZTq)j)_JF8c(V?5h!5> z%6Ptx-m|G#6Z?ev0kuPJNZ$kZ7K!$4Hw8)4N{38Op+`~T=9{X7UQvW!yVk4qq)dr% z%ehY1(Y(u9tHSQ}4*B}+QR??R@pFC>?Jx)OLB~SA0PB>Y9|Ty{a>xj0y<<$Ueh`T? zyla#@fOmFim1edI2kX2e5&&qt*pJziikaU9+O=*uMwJ7c-;7<f;?bDIH0xUY(#(1{ zn-$opDB#ha8>N%T3;2asp66|6QLRK&)wi0FT?NJ2yynlwKWSGi)Xnm@j3#_}6@fO3 z&m{Utsp`~SUnEEnQkutC6n#n}QrP-XQ7<1gY;GN!#unoZW3{2f?Heqo%A&%!xdk<O zdPKizrKxNGfVm$a(Wr43Dw*;g2X6j`BD6lC%+z9{S2i*hHg6N1oCFy`7z&-|w5v;K z=u|bZwW+&=9<r5gh1HOAojLVs5~~9{Ohr!IOekdRM?%|E%02xr-|Ub3?4GJuSOsYq zQoI)PZx!lDJ=(mGStB3H$1J-c7oROJQySJiHOB0X=u`C<4a`4<z|lNxizIx`kF14G z%eDFV@^H0@cV(Zq`3RSH5#x9p+1&=n`?K-c&!ehKdx2X1-CO9fGq%|2dnaL$+{}pe z$<a7XaAjzzwd<RY;NFWDQa)?YUNMKhA(OSYr}9v}k1Cn{WJq~NE8!abVB(vPVA7={ z&<3;RNC8udB<TLL(0B@@5GS~CR)C{twsGw+Q3>jNIET4JSPYZXQ#gJ1Sudx08g`^T ziB3GJ%qEl`yNo$DUCxsx`L!^FC&Q&{=XN%L_!@2m>#hU;ej)!*cO#h1)F1ybc7L@L z<gaC88}k({#*9^QR@}@Mdr-4(x;eI-m9Z?WFsQzw`9kbd!42V2-$-S4QPQv<bCNN# zOE{>2c=tRLUQYI&KMYqt7{o*?-s&U{N`EJ=MyXhS6?9>nE{#)~gO&cd`Xo(yX2&g~ z=apy@_$MW0AMXEuvjIjsb2!45vFODG>rK^<(-b$adCzho{gz5i{g=k1h{EY9+v`2r zy|^`26g@Urud9hp3)s8PBWC--1x5p-qUQ#5%fHL78i9UIe8BIjm5fS7dMeOCZR483 zyakO-Va|ySI-vMq?IxUs)M2x60yGpTZ)+)$-f>6+oMZfYFalka(1zg%kpoH+fY1(z ziIpepL*R%#rz92K+65CU{6u4w_K#k0sZ8#a^}FQGa1WFa-?H9zUWDX3xK+xh$g9+? z;81Br_WR9TAD_}t+0#cl2BO-x!Li3DR}8%Xx*woO=|wwW=ON0RIYhFmFhs`3I~n=a z`nL1=0SxXbuI5F3P#Y#KB)YjOpQppL6aK$(dfP%QDl-`FX3Q71&Zhmi>Ml`H_&#ra zIOFcc2fV}K@;?=d*!yq`Ot<h8YuXO=a3zWLX!HjmO<Kv$_E7OU*@nZkD!H65_YXHy zbY$wzH;28e?tHgH_dfT<=O%9V=c4iBd{8o+<bq;{BV*D6S;8(t^335!-XchctsZB` z8Qgl$dsG0gHeJH$%oNUCY*i-bxo19->yo_#(O%kO-*85o-XkP3%RvKkGaKFE2!i&H z^`_2%dts*%DcQ_uC(7;^kAam~IS|5m+^UtE6at$pX6L5kWefWE<@w*XBSc6VhP9*# zkYZR@U9*x))mV1BjfNRX4G`NlGZx;OVmC4e4R%{|+ka7fGCD>H|I`jC08_J;58wBG z6+hWa84Axj0=rG9fLl21f65!2z9DqwoME^?iA?^ZFszXETQ)GvBq59WyOo4OzJJs@ zhB5otM3*v{<O|;`{n=KMO4;_?J(km-iw|Oy(!_r26XJ<z%kgC+;iCy#ucj6~3CKXC zA(BR1+ecmxSE}?Z<kR3%qvPWSqm$x@nG-45-K_<ooGqqHls^>|;`FNVkRL`YXH${a z-g@or6H+h8Uhkkqk9xxFD{=!)#QseZxNrha`N27!H!BR`bPsU0unllLx4m|F9g@sq zcP+t5Bx|v+VpX^(Wp(CjEIrXVNr@m|4(w0zIY4V~;h6f$Lj!EPha28hSGCwrGM6*p z`qCu%%7&(axx$0SW@NA>@Da^Ce6}{#7-F+wTMX7@xkyJ3cge+|$!T5&xNcgbgVKd7 z)lf*oPFG9U2OY599NmIX7ApF^Y7<Z3+NYYuEj7_+xhMJd+c0?plA54fz<?d1rr*Rz z2vdq1Omd;qh#;B3IyjV36$HoOpo^DCfE+Tb9<W#VJrzKETX~&?b5==h>b1lIhvn7G z0;{S{*KtQ2sI)Lbf<(pCti=*u&V|h|*x3@E4SH>KQBg@bI+eiyeKiDqLBXP!rb;+) z{=71$vA`l!gzg7~BN^IsMR%Gn5qbU+gF~lnat^6`xO}MFw9z>1UKV>A<SLq^a)6y% z);mi!V2o<X27CZNbFhY^Ob`fwusPt>z&~?1q`@Fub)v)0*a$qu6=2jovcL)^=m)vN zdob7hxA%|zI@ah_-Yxst7|v01jEcskM7Aea^~nL0V05CD8OGiT@}@3RT;22+TW1`m zz&spmZD?ZvLm%@=$^s3Iwy=GDp-0NGu{-o+af7s4jx!Rh5U05_aip%!B6E}B=>MY~ z*kwkHJm9|1^|!(huQ$E97=9?-m{04H3v_CH`~axr5OQc^T{F*qL^>rU7hLos{I8aN z=ywg_C~QPU+(Dn6zX8`6VWWSTjA0WptO(=<m;Epr=jQ4}g0T%qLO`n`!9*ZhE{_XT z5%dG2y(jX@QLp^Y3>Gb)3K~s3arjuDc!N$CIn82ITPgr@;he8_V67!tkp5*#2LtLS zV<{u%E)qFNZyJPn!UaB7vb8d}CJZV}v178+864!mj1n)gg0!I(UFlVfEXtF`^cM*d ztis~pd?k^mJ2hKTe!FMCvr~Hhw*EUtS<BrOceeHKV#!XMT_e<6b~|;<<LvAC#*!wZ zVz!2i0z_*foIFEUB0_w8AV+vpPw4+bZn)map6=}r{4&?Ce<vkmzOGrtM@8V)i-bY$ zEtdu6b*V62G|FwfL54AysT(ffK*9|qQJLgWA=|^ihoh>Kr|J}0XgqaF(iv=s<XK_8 z?QkIX33XQWXxa%@@F%?^0`tis90v26E55ExJcXwc;o_E9&4LY@$I?;Ko^;LK!^$dI z;TAeGzo-~AMw7ajDIhu7bwKw4ufkj8OJU8jk(y%yAy|3JSInWX`9jNHli^Dz4s9%h z@i{gD0uBJ?Vt&6@Mag(X+BU);(L#e>#YzM%Pee$b|BhNl>q#&<_$Jf{9h$J%srbZN z)@;`=>$iXM1An%)nEH=ku`D^1CE^eN{%BP&XD}H6?ZwT{E19V{27()XW*gwJAMbNN zB(j?*-!63`?BSj8^QCshY3J3(+7T_@xwd+S&Enp`hHknhi?fu8b=oro91O!M(Znn= z71V;=wYo{vP!Pr|02zq<A1*z8*ZzcW*q(oDj$M9bMMGnN9+xD9v5f-RA-9g~z}tTH z!j`$D*=gdhM@`--JSY>b>y3uz)IDVyIske=(mPBog2YfWCa@ljah_+SEq>^{P4DME zTw38ArLVz|vt*fZrbqU-Bq#F*QjgD`&S!+4L(dW*ksH5Eh?`ARyZg%jV)axwasH;! z038-wKf~xd6>!)?WP*+b$OauP+!QWyP^4xSQ~lHD<ValL$lq4otv>Uz@$m6#*U?@J zN%hN!w7#LeN!62MUoB7I&{`HHX(8-(@&=I=)aAMxlaw|#;F%0|@<Bge!@>ye71YLX zJ1up)fkx(7KDr6FVAu&SH;%ys`ObB_&C$OyX6JkK7omZMF!=QFVX(f^w*ZbhPi7aP z#_q%z+|N1}Rj*Khr4TJH+cR1qXfaKlgV{(HCYL(tn#A)chL#4&-N-)pn}E!z%Ymp5 z3V@O7m0gzv=Dy^j{%gebSib^uJj6m{jcc+o+{#U`p#|=L(kUDGH3`I7<vbzs@XXa< zX6Ttp%FpiIu8P+e<kJISpc-DWxGwx9B}-9?PGs@IgkRLDY9?F*mHwFTPw;ZKBIsfc zCk?-Bp9}cLu;Hlzg)8(pVIEIvm2Cb_vaUZ#M_Jn?v`$Wx2Tz+3_UcQcP$nmrh8hmj z5o7(JnDMqE689+?#|T{hFV?P0l~`3FPR{u{H&ya$l1m_e&%A;f#^b8R4Fy4Zkj{Z? zC)|g+9iA<^l{Zy9H7cbz2iRJvm1y)O{~zO(InsRF(P<mNFan6CCDD&y`j8p&NeCv~ z_~xN64wEhl_W9HUqpF>tRq;+}gA2{rk{bK$YzW=azQ@=v2y=nfziQ@LoJad*J9bm; z`LMk)&>2B)KG?q1@ytWYsGB`^+bgqb3U)3YJI7HAzK&dc%d6W!3_jR%(9DS^@@a>Y zt>?pLfy2xZ23;C72;3&Om`EX%2~3IVuQQ8Po-G`VZ$xvn-;A^ruFuA^;Tdj}$5l6! zVSk(o<t>5Rdh%qga5X2I=%WZn1vJG~Zb>Ah%1lM_P$o_+&Tw*M_LQ$qGM{JSx+0y# zL`V3c0SA!!IiY1rzX|SE6`_F;u6gi_FgErqs9y#_BSsM}<@G3Qu{m0sb?EG4GEHDN zN#!qt+fU~U7;rZCo-06R*ZT5FIq9UV6yrH#<p!HGcQ|@uv3O`C4JO(>WqNdI=;4l| zbdZTrmxc%?C%mu^`8J2D#%Tp7BwD-(#MW3$-ip72<oj29KTl0j-WQ*UmD-<w2-=RB zSJ%Rw;gMWrY5n#7TGrNAdsDNPnvp%up^K``xfwL=g`3*ITK8L!OX<=Ospp$AYLzdh zDA3Jb5vPMg+dxefPGQs)D^tP>Pd!{RI*LUGuAK!FNGxS{;r0XVrZ__tEL$gVM_B<t zmsS{vF()O*4Eo(k;|u{ckc&pum_AH5D>x7kJin?lu<*5Anwi;BkP4C3Nr&eJ4t?Dw z2@fArj;KT=Z*fz7jsXrb;SvK$E8GZv32u`N{uW$}6TLrd56lonTTopz1X0$eK2#Y% zVGF^_ix8yN5{38v-1njK7|}c8plUSgfF@0+K!O?b3^Fb5Ghb>xxk%Tz(&c~$2(mOh z1x^F-1qI7flvk0i1W)%z_yec8QpBsk=_BpMrP_N+KZgLB&!jZp2-pv^SN!5|-L-0Z zHXcsi2RlI;^vi6jv7RCWCj5m}rk>VwX)m~aNC$*NkYkarvdNLk2bPdW{a_eZB_L$Y zEh_VaZIL`f+8+iB@Hs{^_+=RH38l3XM~&eU45$}~4sunXJ{mIG*_gS^nz02O)7gs4 zq{*QtqH3{;gK<^5;5s-cZC-A&z0hQs^)(s3nSsyRJEBo5$HS{h-za;;zbM<D^yEl; z%v6+dvVfh(Qa6P-lGV%8k~!7T0B}Q9+jNs?qgKkQWXgM9V-9d5jwCfpNQE2E=;}4n z>xd9Dtt(zvIlB8G8+u;gt@Bf$g)O{bCuD{S!U=mqt-j}03kEzt#AGoMFh!p>uH55S zbj(14hR-=Y^K>08%tHcTj)W7P2aN9I<XnUUif~l*HFd>^C>IV-X%B)8PHolbC85l= z`Sj#{vd-$|G)6!=aq6}uC`MjmVQ1pzDn*|2t1hi<&fXfrQQFXa3aToihFh+jnIX{8 z*4CXA(0)d@cxLFNjlk~5jt_^;6W&0rXO(Tqm(q1%dZe~Bhv1%CxQg;jOo@$D4i#q> zT-Ug^w*_gubb)dels#$9ce^nGfg~5E3b}-W6X;|2&+b1QP_Mj8SAIU+VR874cie=~ zW6Z<4Ej_*9eYL$}eD#<F7&)W65$wwTbfcoP>e>wHGM$oT^+a`v^5YwR&D`y#k&<tR z=OoDcXC-GZ;c)k7BZfW<lTHU_Fs-h0{jXv`!ogZ%+}nn(dvT`zaa+Q(gRceH&i!nT zuyEW9({$-b2d$bdXLH16G{OpWk!Q<|f4ztU*pdXl92)1OpCe*@vKGU@a=Wfi3)@kG zqbPj9@oB&q#VH4l<mC4J;f)48NANo|;r78!Q&*@;=#mutxH!(sj4g8L!3l{R-5iGD zBy2vjDkIxIDK6%?O)qyEd8@5IPvlI4e$;Jxr`|B;f}j(ZqMCL;mm4~q?F1r*P`|{g zAYW!W5d~L#VYed&MV7ao6m<c1XI$P-5=Qyv`PJRl)iWOhM=M&|=%s7qxdqqqj02_P z$@cw?vjY&$<}MAtQPH!;<PY`0KNLAeg_+i;&ywajv_HSZ{g|cP^&}#jH9JuacjM<S zU{ik$zw&RG%Xtn^tG`o?(o<-4J;f?fB1evW4Fjm^^aNv3LV|4VQEabx1Se2)#FP-d zXFE|YEAm1MRy7t{jz=w{k35%D%pfc<__ZquX3})y+~hHUg;m?}q1SY>dT#zsbVrt? zV;8DC2c&Q^Q+L58<15X>Fc#dgc}81@S~{3JitwBB;ijsoEAQbhoT4T)nM6|?H^0kC z`5~d{)2rZ&CchQrz^E4>)w`kVh)-5&+iFmV*i);s{>)!2E*5TjDakghYlCm{SQ1kL zGm&Y~3fG%hVOoqF)q&eI#buN^T8zOSy1A1ktn1=_X7qU5ZHAb)^SM*#Q{`Z7k(iyt zi@mpRLj5)W{luq>4=6X2xgQ0EuhfYPE~bS=d<$|QQUb_%UqlNRj0i#Nt>~mLEdafK z(k?wI70wq3(N}NCmpEW|BKaBsmh=Po=M%CD3J==9)bEvdx(LoKjUHSpB2u0B`pl>G zj$>8G)<&?P&>|>MXb>1Zk&ML)n(X3NDPa^T3YOG&^HRy%wM7NH00CW1_KiGe;IZb@ zsf+i}b^y6GgGWLwAG(G}gbO)rnJ#sbyS4tfVhbPI&0vspS_lVzZ2If$MZ{brQ3iM( zpO^94UjP4L?M<MXJkzjYmntqGwU#O((8^e?IHej9Su<87)7DBEtCXstj*!@51&Oi+ zh>GHdFxCY@APO^TMTv@5!GwTVP=Q1$5>X&Qgdkf2Aqfzc|9+nLO$gY2|9AfLpX2F4 zDdBye=U%RRyKZ%NO~UE=E$xZzluRcVZc%KQ(qpk6>7a)A>+Gf(hHi(AxYKo~E@cN* zd#!d~{q_<K)7_3tDa6Ttm@SG_s2cd+40g>|zZ7!@Rb>}@YEu2jnGc;7m+dGR7Y0=Z zyOGTicOO1>I!rpQoN?Nt9799E??4$@y`-AE3$@8kptv0>*L@F5Sy=Su$8rj&IO@43 znid{vHZ(A;_A&iqa&QxB%4y5m8*Sq9UBgp)m#s4|DAhN;K#D1j=}r`W5lI;4kb+=R ztyy=zb3GkFt~h~{;va%HPCI*#FYMf&npD^^yy@;B$G^GM8qYD;7Qn#zF39whM9mf- zF?<HDBOh*N$|*$NBR-v;ZQSr_+!sxTghaDk1gqYS8!5M|vZ^SyPN!XV3N078-;A;7 zjbvz{z$`CfomkDj8NsS_BZd=3?qa0VIIn|wGyGaqQF*W~H^UN`Nex+gUG$S<wOoFu zAm&$lhkr@=J*S5!E5nBdHIA`wqS}Px2hx+d{V^)uJ{v9P{m}}7L5pHq2(NdfmxjT5 zE=fIDm+OZ*RBPsGm@#CE+VFbNXg8^*U{*lJba&MJjdCA;DK~7Q8CN6R$Hw7~ZD8e% zNXG1JVHwVrs-*JUNAtZSp^L2Rfwk-mH{FQ~on%Q#vBH&u?r3TpD1bARz+(r^Z-`zC z=bl#KVl&x!VxkDDxNfWtM{OhD!ENd&hA4lGTGkDKv6NEprn%)bk<3Q%oyGgyJFHK1 zWEYAl_spRX4RScIwlSSX6#PfGIHoto=Ge(Znovh*xmp|FUVCNs^V*gfX>6t+Vrz<+ z5!R5V^|1T@&hNiDpvme1223;DbII0X!(0Y#-NdD|wWtAq%&-EaT4x97*8K;1i?6!P zj)L+5bu~MDu(I~3WZMed2}kzuh>Jc=Q`M7Kkr16PgfLzGNmWwxduXx@<{72q@!ZtL zyIt-_4Cf!({QcHu8VW2?LIi4a5F#3|fmoJOGw>yd)ipb!P31Z?klqVd?s#Wxzi%L! zM*x3;$8T^y>W43V4|0EgCnH9kN3?H2R_Cqu)bO2?YjFp0&baVu;k0|CUPD8N+acc* z!!|8Kh3=%d>*Ot43j<Q>ZT?T+<Qph(PB9LUa03$2w@m=llW5fAt>*SszbW1sh@RPk z+O?tAg!7K>CdE|j$#SJLMjvRyhSwX2Dlt?CboU}Mt~`yay9~qnZ=5oeD(gFuuh4|F z>A;`@C^j0LdJ>;rhW@4uU5RxDmuM}=RsGLcvRc=&!kuKR6+>kK38sj|9S(qEDAl=a z6R{U+r6yu<qvprc(6vjB?jRBQtJ6$Rfno<>8YasPCKe)gK9~xrBew5e*VLEl31Ms_ zDQ<t$&wJIhaJO3c=A|)f`<k9}zw3>+@dU(3vXQJ^kuXx9G9u0%B?ggz=4E#~DtE;D zIp}UN_SwNN-(SP;Xw03ct7+&^!8icae6y8T<sfHJ(^9|RTF@YgYD_$bDU_Y~sL6ZZ zQ|WLoyY-rar|+i`tKW|@(RtT4<(;@uzi$g7W1nwZ=&ZO_xQ;wcT$8tXaWb#0ExqDe z|7}j-&gwGUtxoj3kbx8)>M(Bd+rPu#BK9{DiQ%XYr$Ek!hkrV;)^(`7_DhFimfgBu zK#C2ilMt?-{=5T2Ss!TBkU<-Hn-Hd2)MB9Y7&@tsu!8SP=iN;#boym2Y-BKMLLKRC zY6i#qe|MVwjseUBKVEtk^Y=1nec~!vu*oMES{P7q@btq=P$A4vqry4N)8c(92KuGc zi_T@V;TTjoM*Kl9!y|S=ugMRyVfoJKhbAE+w*B>|dS8kgNTH$1<^rYt$di<r?Pa1} z(yNk(QI>aehj!@O+DEt2;$j3G;OTZ&jq{jx@l7e`#%pspEAISJrmQ_YD;99xZN|Q0 z+zUX!ieL*cGoJ!!;nykyDN6l6gouVZZ>_^~=$|oY0@-~BcQGd5WKh~O)XVHqt^kd* zp_Ji6P5Or{$w~i-(ndqA=y6i{GbAmU1aGo8>>+|;_V<vt!MOs=&_ZwlG4Bq#4^%5$ zflmf9^}BR4)LGp_GfvEcaGhccxu!`OfhLMw;u#bZO}GNONuUzcXA14e&urD7WV33W z+5*F(D3plAEq`+B#7NDm-*{hY@}Q1lVQ6JVt(Yq%d6sTY6Fcz_BBfogxD1B96nABk ztwKLJ!kuMb-gXM*^8fVIzUx>sEFuJ03+lh~fBNd&NGml0XBO1Z$(?2OMSHx!1ZInu z>%M2mDf-^o#O)YY-6qpr@aDuywbqXGf7D&#WB#5F2sntrOrV6d65gqU@izrx;r+oJ z$M?H|`H?_l852?8%x6T?N8X7z_Fcw4^5vjS00s*p7)FIsl<<gR#5@L{elr{(c>uRe zl#7D~Zyg0j^-RSTd)X4|xyE`6St4$EFH+Ud!_8+um@~=kPsrG!QDI}|_<gag@3yMX zJ^IO^Kb*+)+FfO;XLLf7ME`N<11wrN9V%>S)N3On1Ug$M-pgg##{z5C7wt95uEL>C zi6Qx<<hww|fKWMTTiG1`jdY3cH?}bEYX*aTBxkM|I>^urR`VBdK%0bjZV=4da76Z= zJ9AtwlOhOOi~AP(rhz~Sa!pYv&U2hTuQDx)Ca_7ND-xHWCTGsYWL+*Uz{p*;X=ecZ z>d%eYa8n#8uYqx#Y|3Wnzny>@nR}MGIc@vjY~|YJcNzm_HhnY#z@q+V6ZT5jl7SnX zaQHY2hM&ifz&kw&o{@dE{HmtYP4c*W)(~#sS$Z>;ftzb?zBmR1OCc54U)+l-Ju3aK zYm@lO@E6MHO3J@E+8`*Yw|H<#4Z}68!cU1^HKCK#=^=~T1-qbC0v7MZk|WX09}lpX z8EA~=^daMZyAyFelKjm?_o17~z3XCQLshSWlgXvKN?gMR+K+tq#*xgtKuj4}@=%k@ zX-eEMjOf03tfrdJ?zj~10l+0o*)CFf32f^5zq~mj^CP;$4b6^3Ki>0VWKUC2o5k~k zSlH=*N$qadbFO$Xj3o>|PE*(R#DM@k((ocu((}^m&p}K7#;8?+AAhAuOlK|y0J@dk z%lBo7S3>)_a~M%A8ugnH`FPIxf?4Yh3IJ2+S;>H5O30}n8tlUi*Ae%V9{0UNG$SDL zQfMpAiPm=y&M_Fe`$?_nYi?0)Zr^Eoyqr-eXmnz*R{D2Y;qi$Zt(^VOm@m-WNDBKF zQ({}u5s^Z=XG3oUG%8PH<e^44d?ZBY33(*IWKpVXiV+U*X~J<O`TpY;RtCSH9Z+!N z+kq0)N$OXm63w#@|Be@ah=#_DU*=^kJGn-2xcO&Jbz?(Cd9&}p+UiZ}O=?t#sh?g? z`3cpQOO1-Ar~?lR=(H2(1Zm+u+NqcB6S*e?TkR{Y{2XGd{X2EB{3M7mG-!+vy5fLb z-*t_18-^slI|q-*yvT*gh>qUl5Y0fpfuOSXO77#<EiI6Nl0LSkP<0#mrqJ|0mFoMu zQD>~aBc}|tYj&kQ1pW`Az8Q|IUL5n7U2phR0~)n(cu=8}^bD$+n0Ea`gNm2Ql3a;c zqF6Ws!Ujc|R>kYQFtb)IZt1iwOLlZGE?Yp28j2KX<*dPoL<xOml{P)OpfX`!o(x9j z2AgJax+Dhng{zz!^#g033JZDMbYVts^L3rs1eTqNw*9kncVeP9exrDJK>)=R@7{35 zXB!z|110T!P)KS7m+o^b{B%w2C&CS=|FK;lbI-zkzU|6Uy<RZOV~Ezk_W|2IrpZxx zM0RVV2UR6gfx{}euuPlg3G>$P=H+#s_t>I0Dse7EYot-i3WJpmJA|PoVo`Ir0%m*Q zfODPE`oQl5_PPY<pfrifawW$zIFFOA8Uti8z;0-G3V{BuS(Z>l2E+&z<aLqzpvVFf zqHCLGXGw)0@LOIbXA0Ffia%0M_)hV-cCfLo*1JoqmIO<OrM3kQXNubD#ns8-u{;r{ z;AU}-u6vucn4d98IN3p5Cj3|`el)zC7$ts9MT6#7CByzEyuJti)M#K}jyvmoUC1sS z)gztTw}lfX62TEKqgV)+5+@&wtH#AUhW;x>u8!@XRQ-s&wf%M0DSg(>vTyg6-&N_# zWvxToV^=Hg7X3XK)0iAD;$%2aLfmOD!#!g~7W17X)>W5+jJ%n`Fug)dX<)E>v;!vm zYib4(r7~Byp4y+P+LoRxE(q7qA9^%)O7`Zp=$qxa-FEiSp{E~3K;aawB908Rgxt{m zt<|GLc!+;@o}kK9d@J}+<rc3HX|Tih`&4U#>GgA~RgHrBbCf8lQ)=WR5ykT9?0PX# z{}&HVSlMs;;N$*^3*Bb_CXc};JWXlbtdEAg!qrgEoJuvGS^}Ukk#z!6_%-Z(T%xNG zsv)ptr#T-=#WAm^Whf3LqoTc46b&C$1+B4!d$LFT&r5@lHXy44_bzV|@b3_CV|3z% znEQct=?ymqVSvi@oU{wpH^97G=xi~Yg)LAGvvzRqXS3^!$6tsze<K0#`A7K>K%*hu z<I(#c2B#HFEWoLyA$H5LKZ-_i&hP(Vr8qzk96SH4w9V(Y<U1`^qIbma&@(z<2TyGD z(Ce}vaO4{O3RuE8Cpd$yrT&uB!n63~?vHA=-<M9dXc`6K%)Q09&!>3D*wckk2vX*b z1H-jj8>$dPq8HQ?9Lu|T-kFdHgEdTMgt%3lOdC>}4qLvd<|glyc0n_c>I>OMs^Xea z^YebcQ7z|W3CGn<=FyM@rIv}cPJ@>-@V#x-BpA{J=n07u0tp_=JSqTZlN%YJ-^m+> zehKq&X;Ay;OzHg{fj86xQOSom9l6iAilO+?T<One7dmh*a0<%z3}t>j^lyQvlyjqR zO_w+cYb#L{BCr{h9}XH)%V?y5@bZ5-;8X=wZcV*R-UzJqB#}Rv)~zYayKf-xciI_A zl5s5_V7j6WZpU4p_svB84(9si+3V9`LCu%1p91^292wYzdC!lDfPE)yD_6VG(7{HG zqhWLW8N0;DY?7INa_mCTuF`}lVHX^RMdTqO`o&ha4x!1gXLiBMKY(z4x_8-0+oNei z_9tlJmX&qX*p;eFy}EumXX078*~={3_9|^Ob!g8YquA32$Gr*fy>xVV9AN?fOC7(2 z^U;=N?!iS)??h*T`5SYfG8Dk;VH5Tp#H-=9ie-k0oDAPf8PMJcZD?#y?(7ZP6DTZT zK(AfrNi@t&@L?8{JZHVNL#(s?-qIpbQi~I0$M0_3%58pZjk365me2(bO|7V(?JSH_ z!6E8vzVd%G$9VWdzTC)!6tTU~jFtFioR*I#uJ*K|x)ag{oH7717t~TnW{2_SM8wuD z5S4vZp%8XDIJgKOef4#WWh-~E|H5OL$wHoB+=?B8{R0l%<gaeYO{f`-x3yXoryy1; znSHyV{H1IC(A<ZVNOAXv#Q9-bj`{1PRl=d)V;mgzI_iBR?7Rdt6+zF<;6dX%f`D$g z#Ee={b<mUHYLps54P*oxJc<->R}GHc;p9jFw7f$1s+wzu7^q>^N@I;^b;B}&8rjpM zjy4)SkDA@lr&A%&&`zLoaq*mN2QiLmfIO-akLrE?+T%z*HPt^4xTv&~ahczvVY*EA zd(PnSxbqbfr@=1a{1>Z*MH>pH{)+cXAncV5yHUcS84jg`&u%-Ej2j8@91-sS#7BW# z`vy1o9>FJWF<*;Yg}|g67@dT1R-8osAoCf1MHmP19BFt)I~P&6H{5PE5!XYz9NEqb z12rhqrI-|3;IoE)km(MMWz*)hH$ZA1nQ_!>X5Fy?(KGe=JmXBm1?W+4SU3F#ZK=@z ziLIQ@?t>nal{v1@mw52KVDVevNc)mOw~c`~T02axJ;1*UQ^gYoIH{RP3zk?zf(!l0 zE$g6W-z1_!1nv!CHsVLeecwbVGLm=R2zBdJI59j8L4b1n|KTrT78kMLT;fBBj@uf> zP*p1z?o|{?Wmjb9{^sh;s{5$>jR$o4<4!Dim1%EJA>m!h7=-`^yQY|l$kDMY!Ea&( zgIW4FS>IH`-B5$q{37aJ)Ohg&H`z=C&HBX5>n?P3M57&=`M|C177=H%8CRut{d}J_ z`lK`L*27<-LO|X|ALyAR+V{>O(rTv)sVNpgpkSRaV3sqDbJ7!fMWO$Hi{icwM4HKv zn$;U_qtYCFiP2Oc^wIkP%`~MlSH)u0uNmCzeIY!0xp72_!gWE2PW-a@04Cfvi|ETZ zd07{ax@D~+KG>=5u3t=+`|tuXLz06X(8JI7{~bjxU%h@hxH!W*$O5KfVJefjjQV|1 zVC^^r89G|Wt#rD(c;M^zQY8AWocnZguPZDA7}JJJIC2j>OMFK=^9hqWSPNrPNL7wo ziQt*>pICV{S8lKfs07b_XQx{A_5&LUCYrS-h>Uax*6&MJpbl)5-?3F%JLSR3p9<+T z!-?N1*!Rk+`3oWDaG6hqu6x+f1a5Nd4ToJo6zyU(x76AZ^G;8VH&u)CX!=+JL|-+} zX~<2?5f`GZZbbD5cBIy}$_0A3kCfr5Bk4}@HWOk(0FS75&O)5;wsk<oZslEDxtudg zPdfnT`sU=>q`FIBEn@B`!T7O$E%oBdFIAzixN&3Gc;E+jAcnF*KsRVTruDa9;`*nf z@!1R7bQxYTg%4FcaoD~1xR8S)ay?Aa3@q&Y7trnD91dP&4t`Av)a8gpkcE3nbIubF zh)L;tN6}1&sDNhLsS~Mt9@<|AJut2HpHvO{!1F#6pvlJ555?-N^Zvze<i41uyjE#- z2c^XEpXg6}72fOabHuDNjw%uQ_tF5_UD9Wi#ATD^hEqp`r!YhT-(8r8saVHQZBMTq zXf}to0VuqMdaQcQprRkW!oKv4me!LM3W0$GP#+FY1;S=P8BROh!pTQiUNPg&aQ*9Q z=`dN*{)Q@9-(v0EkFq!35yv0KJT}i{-z^C5sX>om)SL)><-lTYYo)K<OxhW%I)pn# z^%4NSCKIse)cM*^sCPR!`xh2W25xZ!PwT+f(GP^dl!b^mJT~VNTE_<NZz8=w{x>Kg z(3;BCf-G?-jORco1MwB6(}rWC=*yt9^SUaAHNl_hMGn!HLr!W|?6)GaFZii{F>SyR z6B#0%>T6d@v+H_wD~5Dmixx)Shckcc_ld+Yub{hiAwK~eCF)}$=v=(?bpVG@ozom* z%Q+GuHB8sxW(|n+qIVC^as#H`x5&1S3xgYl($~?y7&UNYc3Q<&Sq&|e$qTw1jWASj zZ8uQ=2I$B7Voj9631nTnaVoXdOyB&h$6Oq%!99o`*!Y)ToG}#p&9Fz$`%oIJhsFg0 zpgRp*b{g<56vs3MVFe)k36Q)_)gP#I{2k6oKB*jrH!~A7E^ig?F}d3ythnZ%thZ08 z7rXANwHL^G4s@$%SniXknA#h4t2Uq}u=U}!uYW@<Bi{OT=mVm=YAa=j^g!PXfdaOV z1MA*7)XNQ2xmBFD#3T{3*O)WBh&HHW#dccx7wd`G?fSX0BfN%B5P`lbR!?{z%dG7; z>(d1Hv<uZH7Dg*DFw=<_S7-2TNbFztUFL9NRota#&DR+=Hiy3CSjBd3g5QKcdPx7# zI}-~zEA!MQACaHxgupHo1V_j;(MP839kwjF#>pV}+QI(IfjbTUv(cyHZ6hk9&r?3I z{Z@7xDrB3)X21`uvV{45V}fYs@k3)j3tFxvhx;xQ#NUQ>l+9BH4xL;$^x^Kt#H9XO z?(v}!QHL|n>hc+moJ`fiT~G!nT;iKM^%sE|!I#W+>g>HNt|P1w`Cmo)ko@1sJT;D{ z=S8n+^haf)m(iUhALfW;AYGfN*BFDo8~yOpf$@5wJ9p9V;_$h@8-F%8ZsCx#_i*li z(I*}mxrjeFXLSS5{Tp9$(sdk~@lWugdpI*x52#<|e?6Rg1%3>2(cPK{rQn(?mS*%8 zZyw$nB$~xB>*pDBd{@MH6jKjHzCvsq;^9hycs<7OVB6ff4&{lJhpvfb!!7=C(Cjes zD^(}@OgV~yO5tSo&`Y327!oTb<7<1r_bBH1z$xX9kjp>lpnAG>nVe1<a_r&xBtjSD z$T?Kd<VS?zL#D$C4IeklU3b=MdnC%4k*|0~9sXHKLlWS=Yo_RLfnP`){<?SSFp5rn zgp(oKiLUau3yZBnj79ph_n2ins1S2|b;ApV@teY-NHH9*{lcT4SNZesdRS8q|7!`c z>tt|3#J;4Vb4pm;(C?U*uZUm24=)7Jq5VHFy4|d@x>FFpu&+ftLSJ1K`AWeJ4%I2d z!O#^gj6WHEW8vdVEBk7_yHjG11AIYL6(Gue>-CrK5TbHAyGgk32Ia9uFYJss=zb~9 zlxojxd=LY>5nOI~G&wzggcg+mmsClb6W_bL5;c>Muk&ly1L;d(|BWnNFZ8<Gh$xCe zEi|5e@At##&D~W!<xUyWG$#e{5d!a70W2yp+ALgHA^l<J;N+5Z1&vi(fXx+tE^h)g z=oDVvhko-LCU7cVhv$DHFMvvh$1BQ+q{^QN?+A*JZ34RV1Hg2F`NF-Se>U)0nZi0& zv<P@Ft|WW!!VBzv#hg(F8^<p^E*&SUk`|&LyXxIv1LI;RRR5LUiz7By97cEnP68&W zk~cUA!+V{%5zR^6ZGY$mLuHdUsQtE?^D5D*FdLwQZs!QkIQ&$hcy5z+1{Do;^VXd5 zE()*PueiHQvK~wq-qw<2VgPxUgwCqq@6(RMEcmRpld)k@(5dbAM%yVv^FT1yz*Pc4 zus3{Au2-L+SZvv}KKj2#CSLonLwM;AVeq|OQZp(w{FL{uGF#$jNb2-hg{L^WwXens zz2PZt1A?%ycVb~d{KX&V>P-#5@J+C2z>NBM!+gc8*w==$fPu&_UjwRxqlhY<3PW}H zrM$aN#BR|Gz>i^f2eoeAy}%*^YdcPHxsH#4a-2<vl&WFO`zg8*2FaY-^cx}>$ICC! z=HZJ!dU)s!!Su8tv%SIw8fsR@udip<CeOl|7=tDGzR<N~!Q^W8LV?YlL2socdL{f= zH4R6o)2004S|B@uC8m8rGJKclR`4Y8!!kVdO0sYd)Hg6Sdb0FxSY<Mf*lmQiK~$6) zw%?48UR@nrbq~Z5wfm#bAxHV&jQLRdwSU`$MG==ZZ6K(q?*ncTkd~0o772!s8cgky zN0L$x+$Mi0>Wc6aEg+{(F_YO=-&0c8fpX&G5bw0O3{7no>-VyrL^%SXp)qIDIu45g z@?Tqk*2iFq_xmItis#tdNN-8;cBis~AxL^`*>!-}S%OTbir&}4sow~scU2^9{({hq z9+-d6AsP4)!wFO@2r?>=hTPEv{pj1^Q1Pmn(Bennf%O56N6mB@;tXoiIf;e^gVBQ~ zrP3i?H*2_!^IR0#e~!Y=+&uR6F?SAm*f4f<`)GYblXhKC`K1i50Q02j%nE?Beyb5F zH6wZ9(2{7?3^h0ZtMu=<J-NVh4s;g;8yGyC{_bE{td%}V9oaW^F|0w&A_6EZvL}*R z#2|2H^t9NWqDyFZ5f~9SSP;f{!k!0jw2N-g8Sl`riEg|R_3GTaMsJ~K!^d0`#E0&8 zxjo<a2XDC7N(wg$QS&`s4^@ekW@ueNF!~kPz^M8nUWxBJb?!wpUH@8GO^^uv$!p}I zaV(UDg6Qwgul2u+6VTEth+EOzzW&w;wTFFCmsPi<ce`rK0Y344i8s;m$Hn%&kva^= z6kAD?)i1oqH(H5*4gS3SNcRl4>9aLJ2qBAvHH_?UviM)U1{N4JBE7jCk_NCE4v_|8 zIxHg%BD5Y9yg0V8+S;j7@A>-N+`5=wgfxCSnA>{9^|>W5F68Z^!Q{D~3ZJlcNW*;~ zaq$!uD)FPwJ>KG0Mzq8m%OASXS!lJveEBETEP^Jl-rkT7Y~&15i2ZHK<MJw}k2IdJ z4DaA{_GbMWQP`9DS$8B-IQ~R2UgMk%GY<M$*|&uH(ty`%Y9xT`fSvASOr~N+z7j{a z3wO<i?K)UWpR@Gj6$C*Tyv~Z1u#;1RW{*4lMEB7ibNx%ztA4^?BeMqMLGMM5Hf-qj zyhHWGq&55Sye+qVl5!Jtoi+)F8y4^e?YYu{2MVBov*wR$PJT$GQVW)*^?&>z1E%G3 zL$)T_>le<V0fnli5T}}E(6lg&L_8CO<#_l$YjfahFU)O$wShE39t|{)M`jCIZFxl6 zJ$0$~u(P5h=FUKfpBl@6-ax~=b~Sn{SS^nj-h*LHdTx7TE8aGii(Bz?-tEH|sefm~ z|4Bz&hsdhvS$c`TBq5GYFv8mn=}+}^nIxGH3toCB4!rXjtb{GhMdQPGJ8>E$=<$Ad zd*{{5v)SLlhVJXr9Ut#ineHjSS>%l5_OISB=YGZ_?yJ`<nm$a3_RQ#|%mK%X{Qg*9 zv9%e!Cj%{b?Jj^#=AxV4u!j4C;1wr{*JSvVE|FdgP1f>>5)j&Y3&#QHym?Qs2@Fr_ zmp2e9#K!%K)z>*cXOTdWpYgLT}7~(_Z(a&aHxp;w$(HH$6hje90Z;hZ%dk(TMs_ zr+iLO&{FaSSozA@@=-Tfv5kuE4Aw2o+-78{H$0!!v_37m^RS*S-U^(LT^CoiQjaM{ zxt+5_GYI+Y=qjJ$4bApwJu_Z9Ti*S1Sm!IbC!!^oPmG(Ob#=hdM~5AZA$Zp9+q&%Y zqzSq%2YR6aQz)~ZW0(+ixSZLAnty5KoF2&;4R3GBSM`!%52bjU&i8XppC-mhd?eV- zEgSZzgv%n;kT0F)a_<-Y2_MSw5u|;T`pkU`@3T-yT;iqnu;G|kYTviQHN1<J2__ZR zK#W)u;4cA>ExQ@@M>dM#A)Ljewh);{^ou`RsMvo@I2pWx{0m{Y3HIth6^RaIM~DcP zST4de6=@5)@vTFPMAn!CX_;%G|HZ^oURZQ{S__F-po$>m1MP1m_y|Yb4_*T$UG9o8 zcq8o5RJM5!4D~BCt=_%eeJ{L+=T<spoDO~upM;sn5^~NPw0OBUwj;22I^Ro;R(Hb= zc%Wxko;9EOP3f0}k%4dKMxRT+*Xs-igJ?BIT`>VALszV;8(+nVBZGk-QyJ;!gj8ym z4sCWpiw#CeE1~ROdLiiamEwiS`AKNK^#ALDm{#Id%AKWd8uB@je4$;Fggeoj5>Q9~ zqS$x4DmX`bAVa_r6h{p{5j*ZYulT)y6Fc~~*V^3M!|%7|ZjLCB##RVb-NEmaj9u9f z;ILP*KX~%SzZR3-$6K3VZ?end@0gW&KBNq-8Y@F67dqzYjQ6}u9i|Nvoo2babXxhP z*x^!Zf&kvYMT=?Ze&6|R-KLMa%ZWwEk|nL*J+jR7t9y$0;OC-=9b#X%<!(@Mw4NKb zv%h}XUi-WF2)5d2Sv!+Z`VeaKjZ1j@{6_M_tgGaKaVldt3rMZ|-azz?hYnMkq~C5T zQK3~3++od2t!_du?12c%5_+tu^=A=#AT-i>ZZ7Nj{$(s-fdPL<NdJZ$1gwY0Lsg4I zC&QZQCBy&^dOC-<z6obZdYC&kdB?c3z*fPeEn*rOWrj!umR%d-1!L1V8oT&o2J9-T z57TLxYU$l$u-iH8$OzjIFcpEiKz3EOKQ6m7u(Ag4GRK;}5edF^;MLrg+C@n4O_<-- z(ZE<;P66%;r9mGVp&y8gMjm;(ILm9y0YWm})5d@Z5y#-LYsAva4pYp9u-v-AQgFSB zyW+P3Td~TVeySj5=Fxh8u{La2o2$qP*37!YWBRvGkLjDb`Frz9f9|x9U)NU$$5wbT zk7}<9HFSR);o$9l^~vWfeYRq@vfvBkA1?!E^atry`2Im4(B*H=y}Vj-nf{mG+;%27 zmo=NZ@Fy5;^C|rj8)$#yeFy};MJw-**6%`WkSM2j@yD}bCHv(y-uQI{9A*(N7E=o0 zUF8N>hGo;p)r^*b5U*!3Xxn(|BR@A2p3e#LVLoPd&Epex2wjKLZIokbj82BuIk<5k z;l_v>;@T$8bm8k~$?^UF`mKLi?;(ZUdth;t@Y?O+XI-kmj+O;2!4BTSd&)`tv^OqM zDbsrT!Yl_<Inv0!9~&ji$Vi{Bge_UQcOt}d-G<8~1)4owXpc5pCMk<KDML%W(Xx9N zC#+02exbDBSwJ7`H%5Q62<+(z{C(s~;p`t8#5WgtR@nE>#|In^T>yq9PuQ*8w-GeH z-|qHC4M|2~^{R96ETJO0O8QdvjMwlWrab{N8MSzcC$R0PSpalWU~%j>ky7-CHKWuR zX;{nLXJsG-drsXDWwHo!n&z{|7A@UIGJGNE^+K8J@p3_bLi?PiB^j$F&<AJ9fQohc z8u_1#G@&*lOSgVWo_&<+KR?kwq+qD(GG|D$@JpJ*EcO4EX<G+HssT;r8UKrOS2Xr9 zcgl05XSD&b))$4%n)Q$Tg|SkOnjcx}>cWnT?3y=F$&BhaH{7GzWRPiD@U+olJCiPC zkot(t>x|&z2}j-Tw<T$olMftuK*B@EPm36=q@RLqA@r>IQil4|PC2$DaBrTu`G;;} zkd=gW-w$qJWD(d_fQS?J+|*WCmzyoj@?VX@)`C7$p~Lmzsx1SxB&ZZ0$0UFH5;nP5 zmx;C@8KEa+KMvi2I<x3A#3`be9fNp$%(A|~s-N38HB)B?+lo%+B|dRRFO;^m8JbM| zcJDO)Fa*UaLeHceg0Rfuu1t1??RvQsho7vLvgiJ`!@s|3E4$zOzeX3H!`i+}yZa^u zDnq}`P)k&;Wot9IdFl6J?VeJ$bqD28kL$YCL*FHdVvE_;Qf+-fg2<3#9LHI&9AyD% zEt^kad2vdvpzK~Jp?j@?rxbyiQBUc_P7ePy6?RR~Ik#pLBII2d&QNCfpr(x~tSMI* ziY3#v+icjIk@Gwb`+EsKm9RBq@q_oSZX6frYKJne2_4e%9Uw(eY%wYe0>OY`oAhHH z1Rt$)NPCBj%t^TPEp~ABXQ9o6w1s-PkyQjzBr{#)*G_Oh%%^^?^P!})O-WZ(|CP`a zK8gStv&Dz>XATUGwiI^Jk8-B}IH6#@B0NLh^gpJO_tQ|vj^8_K)mAAP8y>ugHKWE> z(3rvo_qLY;Sd3)gYNYQKeiX8$@8hK-QZdtIb|45gOrl@Tjy&LWDaauUw(XABZubJ? zM+-?39bdLM^nhqr^G~ugaW61r`uMUwDDT>Fin~`)4!xh9$3+;lKk@sv0ycI0-{2t} zo<#44YDWe8RkhYF;u;_`$S~}KB%5)r;(qzHJqI5;mHEvFsA<O>1qhK-Y?%w5ueiLy z_&L{L6%3)a{?zR9xt#CVJ<C%|ixAY5?>Qif3<~%*ATHNL%QAAaB)%je69K~u2hWz; z_&PuYyAl=;BR;yiRrI+pywm=8`TOJP#j_u1_Y0~9`lP+jW~bJFRW9M4Z{h@Y38e)E z8dJ{a8@J@%rd?!O>?(*h>j^4!h`~2u-|>d`Y`zgBc|XDdKRczReF=Hw_>6mM<KT>Q z_g#r#<!icI(vC!By4RJykd<#Y7azZwK?|5SP9A+xZd03-pGs3YH(z&pte1K(SieHT z8GIQTYtZG5fE`!Jrx+hF9D4M$m`+SQPKFRF=ZIJA`Zq)><4EYF*lL1%n9RDsu6849 zcB#$63yr~861w&in3a9b8Ap~azFAZgr^`!RR&95eCcl}Iohf)hb&=mLN@=jHdRD%n zk{)apF+8<5Ry30yyn?Vrme0y&VwOLvG&|D%#8J?-gU?<odgUB}5bkKq-Nm4wz%`03 zuS|~rZ75bN_HJlWOs^LX^<Gm+IIATZLGsynH;H)mL$~2URk!r<?|kj;<JG~DeZC7! z!mC3%5zFSi4@C8{7<Zv2Ru|Qtt8_Ft-*;oy%YseQ++iqS(Kh$}%x@_0jBBg1o;_g& zcNDo_&PMN5KUe8-B{}8t!WT~yi1%CTrCv5mz1^{=b`v|q9OUqd(xW-zV{}Q0Pvox% zbUtHCRuuAta71IREn>98faVCvvW<dWM56k;*`-ij;w6+0&gc^!6e|ZOgr`9|kd9U> z^b26q`AB+<8ONHeIgex8tFKKfcibxdQzw9L>q_$J%eLUASFEJGC}!0p94+7Oz^wAo zh~Dp9wWVUSMTfe2uNJgjes$z^yu`PooWY9GEQ8`$2at`xSMHeA>H%M@X8KT^kI7|@ zSCWy_12MU4t9nib-Ncm{jU3TG?7t`rT+m7btuzyviqA8ap%bM6Q-dv?Ji_g~JCpfI zt$`o69s!5@a|k11@*Zf3v#Kv(<iuyNgUk(&N{^jTz&hYDTdcRY;1<h)809VGZ|^xK zq1X;Aws)^a^}TP*Chr7gsNweqC6NhzxT38jBO*`H$ymh<q8bo#18*W_>LW=AE=I>< zGenmmsw_HJ#>lbztd!z|CB&1RI{L_SfE6JE3znrt%7}_g)1J>^<V;g+OJw$J&Q1n@ zjqi$v!h|U2`K=Q7EkTJ-Vn>vO2m>2p_l(LV-2QQ7vGsIM>HGY0Pxs0U#$TQIPurVq zKuK-&5>L0vDi^p~?r~%x!M1-9m!F!q_(j__!N5DwmuA*wi+^W<jeQ3R`d`7gC9P*i zIa65rN0b!cz+v4tu<8(HJX8|}riNiR$QPs+D9-q&e@7tvBe09T-kPMI|F;wL^kgg? z$y0qfCd`l}K=-XBKW|5~%LJBNF>93g+&Uz`iBDOy*{q^hIX9xFt%C7wfEW9=xQrh@ zEA|5saqRJo&MuICAHj}@6n3Uy5o<$)Ez50I;I|Gm&%yjlK^0)LQXg%mwWOgW4hhC< zd3vKrq<B_Ta0#ALRQYT<w;!8}W6OMhZ`%aMGeHyD{L^+|X*{Yy7Y)C$;dVn{4t+(Y z&9`-w-Tv%v&=W>2$im-@j<~iR8x^b(!|y~>nFrb5_yV>#+n9plMkDND3W2#H_&Edl z7B}xxkiyX?(DhqaAWH<ycHwE=R_y_bN3MkkeHNQ}#0iD*RPjkpx-%Cx0t~c1NF@pg z<hE8oQbg7~V^h!vM&UF@U9F2qP+TKxFB(h*7*``J$4<HR0xRF3$(iLFy81U#7B9;Z zq~*;`?P_pT-jtlHxSY>y@!**`sOrD&^;>C0*F@!lS2wMbqjNc(kXrE_5=Jmo^DeMl zve-TwGeP>1yN4`DU|jAY!mLKv5ZQ+tWTMUZ7G^5o7A!lEc{6ihZGl^ezr#zx1_z6_ z&mQrU7`lD!p?r9D__AXa%*htFolXF$C!SN2C0N^hWy~e`9@H*H>b(X`DPYn|Bgk9- z5Gc$Qy<5?01AGPsK101Cpb}|^Q*R<Fm*Q3L!iGTN8qBG~k9d<l9ddjHJ6$unvu6d7 zbx2S54qxpe5~%E(4kLs(&chkhip;TIMsT&fpC+$Qxj)Kz9ryEYPNVo1mu(j8@N_pi ziiyG07i9rR2)UB@<VeNG1547(9N2L3SJ?5Lsu#*-k}tg~7*~(`G}rI&TC<UFa}C>K z-oh8hmJwjrM=<Zg;ONW%A(1dpX{gd3)_z@7mOw~9Y|~=^M0oZDb_ngeW83kO70NSO zK9^HGn0HOU=C|4$j*9qsd$THiL=dnoDhnzerMgEoQGjKmQV@Oui7}uG2!jDqz;4#e z#M3zK3MSC7%Ndp?eZNMb1cGwa0qHjjs}~NA6#g%vazC{1RY^ilLY>)4NulLU7|!=Z z#jeH@>l3JQimPuGP^4JZ6ay|eJ&?;l`7o@9C=y;4+EUPL<Q&F81-;cp@0oEy2M%Jn zD)JO5sK^SO@$m&vWSK7xilfZxfCZBWa~nEn?39rkd6tlW^2Q3_n|j+lf|Y`pP#t<e zll3RK<L6W=!BYrbvGePlCON>#x2`LB@uXbtYUz0HhRp?miyVFz7_9S&H^VO?Fn~j{ z^vZHM$OX&$meXUsX6}g4rTXMr8m@%6-M_jL1JE0NE0(*@=r`+DL8dM05Hw3dsZ(E* zf`|dC<aC6K?uVzret~v(C}%YtDr>#wy7N7E)vt0V^UXf6+)b(?NRPk48*~im{V_o^ z2{H`^WHQr>9r5WopA(iHO(2h~U~G83p1H5q3LIrIRnOqeKWuHdeIZ5cY?Zc8qqooQ zWuQXIdCXhLh|vO~u6T;U5FvA3wWH+4*}$BXksBgSI)NtJrj&QBJ@uBxU_VAE4Ryuv zfL6`%AJS<QNrC_T&ATSOEcE5Dp&5<-KzH#vVX;8sQ~T0DID)(?0x;@GNjSPAWO8ls zo>KzKL2czB0jMlQ(D?R<B*0>Rl5@r*h>^V5&RGmfwL#~x9mqkqSE##8XJlq<_oh@& zX2v5(Y~dW|vJzk)irt}nqE7}Fzrb0c(r0CU3>y*NjEojj<IW4R2_j>WuZ#&R>a2hg z33tkLe*yag#G`slvfUcA1Pn$WVLeit`IF1reLSJn03#DL%FQdR_@x2Oz&jgKBL4?C zNjMFpIbi6J5`FTbIA}G6%R<-*E@n<(Cm?{=hiht=Y;&Lgbp3*;9BjxZc2*`pT0Kc- zS+y1nJ3q!@+t09o;U_QTJ3u90#3A?VyM`^eovgn*Nb-D6=CJV5e1HS7?$V|>{<tCS zOSnMopyZr~|L~2tBf}N75=EU%I$RL5Ra(kEQtlA!9i0$6p8v4r+~+H@=G)WFmsQ6z zJmf%=19_#q#KL*v0Ep@y>=2dJ*Bq`y$zo7!k<#)C!iJE`8GDV>wC>}nU#$T7)SL1= zY!wlj;TOP5*)*tW?0NvmL@^8}?jWB(a)p+eHH&<4742=vj3dOnhJfdfMh7Fp@Jyx$ zZ0k8b>e4@B1!21jl_wCHGbdow1IMRi7WPoi2_FFhrtqT1uYqVPii6gmlP0X+K^^{b z^c_YW&@kZhAX(uB1*GE-d%mq?{sFgg!ftmW1t19#!&&%sMg4~`tj8~dM<G627RYlt zhY{^~1;A=Dw4r3VyAf$uoI1mB&gTU6Q(M_2CDq@b{zpN9a*|ZwUofauJQ?o)MJrE> zq%#V(ImCa_3v8o8k;fE$#D6TI;FAFSbZ-*iHj!IQAprA9;sGI31sph844iKHu^D0~ zGBrnB_{~>pPj*(q?fW_(@fW>*fL?2q8p2KR!Q3O9KC5F*O7<&tpmD+m_C*pe@TXN5 zMvaUpHKStpsOlma-w+i<=xlyXHczS8hqyK5V#1MdQ$CGyry8sN?hiKPhMx(14IEl& ztE`O@z9?lha<_CT_zuRcWQy-<iU)t=Envm>s*1y~;`@e}j8zo@-@cxb{?xJ}T7>Q* z*RpM97K)q=DZiAA#r<pZHN>mpRF%^7r;iC$*xt+%O=g~lgcbqm2pofuHG$=?dZM%6 z&=7;|EhNeb|ARnN)_l(9-bq)Q6#lbfVg+`CmD&z<;MJG{eq>vJnC4DiOGRrE_eqQ{ zG&wTnh)(k<L%G>uXTC15f;wq!f~fuz!)+^_#zn6#q=Nz@<wQ?JMhZV9GBXoen+{*5 zzED+D?t;Ri>)+`_+fF6(Ct!iW45cL_Go6)jQke^4gAg(SO0DS4t%2LBPdZBy5F940 zdR7W7R`PhNnpwYj#s9H<feG_Rrx)}^EQ6^vbQT%)X^{l~S@V6rxdQ_^mLqwfmL&$X zPr3rg02Ggnb$yzzz^X(-Xi1GjSON*{k0t;ATsa)@Xn2m$6y5l|?(1H-;vx!YGdM8$ zlnh$M>!b?Vq>gjRnN+&+)z=+m-c5!bS_7dTXT!N|rFH%P3YYcE+gcW=bcVjUnM0HJ z2Ad94e1z|B9kbUIC$NZM5W_6bD%*~(7qWRpDx~QLL><jjI%vol?-p&c!=ZbUhObUo z>wUT<4+<V&mb@^mmYLq-EYRaWemMvTGKt@trKwVqEl{2VSE~%srlBrG1e-8N?*K_l zBi$sIz&stD`Xj@*?lJldt4Y4Cd%4Oz7Z<^SP~7Fu>XO=<L<n(ThojD@n!{1wgkv`) zeRR1d;r7zUwGhTVoXjkAPesM6nQn2Zk1ju)>2fIr>VYWNjBKA4wkD;4&zy<ePn6fi zOGiCUA_qYJ!(_cNG#E_K=l%4~MtZRHC50bjh!a`Y0>FcV5Op9AJ|(>|;Yy9`F_aP+ zdj8fnui&9)WiEFf2JieGwxb2bS`OS-h`YOav9YQ>u?8YYnEsi8+&#ia4HO9W3FSmJ z6O^a);oK^Pyw^Kou+|Xg+&M>DYFtDy==L)A4Vh5;LCQSu%Dxznr!4cH1~&{SpJCkv zb$~n%WFQpfWkkBc4(c3#QZFUYA0mfAk)AJ^7=&#QBcOO}?<Q*Zs-ERP5kNBPU_wPd zL0Vw*5#yS@QE?7eviP?dIG2FH41sV_D1jmnaFi$lSelB;yW{~|p<Bc;_`OK%w<I%b zCz^;^5MUt5k8HCfY&1k1-G_&R6{f#5KD?dY(NsId;WbzDKy@#{Ch8OS&eJ`wD_mav z+}Kel{O-NKO>sHo7VvT4h7Ss+Y~H)}J->fl36Ne4WU?Dlvx3|s-1)yWJhaUBrj(ea zKW&?tZ$qz`<Ft~J|66Lq!!K`nQTWMAcY3A_{xjZ}QZh~4_Tr~_JNwGH6(JRsw@tU0 z^Iq%X&DU&d<{o$!6#dUH5Ahv_y?CwsiL(0Gj!Rt+yvK3emJIbP0VMw9Ry|(XF@1vn z^-|k{*!53>-}hrEF6cJ0;&Tr9E@PY1<7U*0EfZ@&x7!?x9k*>hs4ccn5gh8=RDmC| zhOL~tTNx_~c?~v(&a=#M&ack8*}SMfb$5bkQYd_iHgxwjTCl%E@rl#h&6brMUz96m ztX!5A<eclYe6?Gm%u!iWUcXwqW?R6@(1Sj-Q%iF)by1dyn^(CqLM`g2i<jw4{iKV; zneHJO!66xIbk9#Dov-up*dOK<`@Vp7D(OFaLOs5$F6*1(w@{uH!hB8p(Y@BPi8n*Y zP*Xf6cRuQ#d25zPMXU7CEb@J**+_gQ+oI#_Ba7V*aE$oZ<*<(CRH`f0^|z<cCvq#= zkLDaN*(-0zwaj6CxT&}?o>7ny=p`x4wrsQ!#0X4jq9-wFqb@4gQ7cm`zho$if}RxV zoQt#4PFxc=N7TyFeEeAN*G}Ylmp)W3@_iyeH)O-Np+5?FZCZCJrBu0y*%B4uxUF`z zWFuvs^J?v`crBcg4})8w{Hf$_Wf>n`c|uN;siLXnd#_u+rPe6ST|Vm=daz^nlgB27 zHGL_a=l<6lJWj~o;;_wK`E26Wi{UE=)-)8qq*O(mpZLSjQuV?Yv%9oh@7y*>hA#fo z%UfJozaz19Lj;xoOAWiF;90HR%jvdTY{{27VZYskdAGUc`=rOISuH_-EM4aI*s`X7 z$ES0XS~}VSSBA!SK6Ov+bCG+Uiu`)H<Z!bizT1tv&7xQ2(po&MX`}?zuq_)G=kt;q z9$MVm_OWk+K)EE>w=yxs?U<%8vY;sPgN|)9`bVwk&emJ^O{qQEWEYU0mh_7{)Z_E& zM}3QGr&90v-*e;ydhx7d573>6yEPNRO=@q@@;?9V&M(<Ydc+y@`K#e*;k=dflDkJc zf!Xg=%8uhvt9i6We8V9DUXs>)EQ^Mx2O!nf@GN0hQhfnE-VS0~k<n$@RQA`5ITc8> zL<ksn8420tIsPB9kEb^H<eVST-x^wgHN|<ggwU5`B|gMwq6acj>=QH4r5|3V+YxU^ z$v;D38y>A)OOqG&gk3*&W8SR-*Pg+Mf5I$?ZI?$=)1lA&#SQa!YX5Nb7Ti&}bjWwf z6BM7Yq#eBd9uY&@8bYB(<CW#y8H?VFS${b|W0OBtGEXoq)gO_19OGHN^dvg~o_Xoc z5YZEL?FFoOD?!o6NG>y=EjMqw+kSW(%fz$`y4^{P0ug#SCOkRi!M1lRn5@&~IV~@? zn?~5!1TNTQt_V!XZb1j>`y??1%*OrPa{3z3>C;zDL@M&i?8KQdS<wf4oCc-{cD^2c z*DXi$8)z+i><pJ38mBUSF;(6-Sw1a4S+~3xq_T8v&V6=+ANn0Ltc$ZYuhQNJ3A5pQ zY1JU2Yk%_+T(Eq#>m44P_Fa+V?u=5x`WS8;nMy_iyGNs5MyOs;VvZW?F)!1alDEI} zATvcU%_V}$Tp4<LJ5Tf`BECj#-_rIJX#fb_X4dX&COl*)kv%aoh(k+?Pf&K-G9w(e z)y8QH?MXZ0b*d(-_F;A53Ck^IDI?FO(KQZ^Z+$5|qWiBcwdMOw+GU(sw)rbw_qT1m zV)JC$>4~zEviv)`ZAlv1w)P7ufq6`+XeibsI)WWP*F0?8RsVO>9jYc&IvoW2b3w;| zgF1ZK?lJfaIF^c#*M3nkE*bma0!(ROKfUsbA`fT^ktvr19b&8uozx*Sl_cys4R02} z^I<JNgiY6Ovruz7IFiZYKu>Evjp8p)yU^B<i=Vn{5nTJd%%H5LvPh&?U$3}i*$7D_ ziSn)c-VILR;0~T>Ypo1!C)Cyz9&Sqgrbi$EcTF;yvU>7QjI!W%3FNI$&ek5K^B5Y7 zTfwKY1F-Q2<;wG>%*)#!R{nZg{_G4eJd-*Omplx4JuNG75lC!#%iMb33Z&YhjNt9@ z5%Y?IWXOb@rOS6^B}e}3h%SZOSy?V|Mn-o*uJ%bx<s3_!ri2|aD`p?3Dbc@yJ@VNZ zVspVg1bJNY1kpnvC69`E=oXKpHm$);Ds%gs?Uf=ps(&1f4S%vVpGz?qM<hvD>Fcsm zc+8Ya#}K+zMbOBjrPQ4j?>7$?f77^Y#$M^*6n56|LW}yL{}!G*1sRbAzHfl)amkB` zl7y~lFN$oM{BD`#s2<w)^k?Sz!2>ZXZNT;r4+!74gzs%&NO<Q7SM!#_n)}Dmkivow z^KwuDU=TCH)=0dz6{?hrC^e}&)&bNICFC?9_m=Zn>pv26HjwritJX&^T~p6}^n#kY zI_Ezf*IqB?&(3JtaI;{M?MH2|`4bcsQO@WqgD%%ytv%+y(5<Z9e!CR;T?Wf7=e~|m zRWJvjsP=hZR$V|&AJV(vDwm`CQ`+<z%pv6gX{pnLTHKPX(k!=Z0$Db#D|J?3mkGBg zb8L|frZxD89##W=D_Ahupz=%l1<7oDR3MV_X?)w1QqX|^pY9Jql_#cMEB8wZK>?O> zC)w6#T!`mP=sg)bVNT-a1ur%|%H3|hnNk7{lYNT$DC#DEf`%4TS-a$g(_^FWAc0P& zW$a^zeW55uXK;FZ@QPA+UekJW9{d&g(`YlBCc-{hWJqp5GX+#)R>6-)CXANys5*d! zY&K)JnF2ZBgFYqzvj}^2G^}NgO%o_cec2q}hCyZJJkY@41qN>m(wzZUMJnVy(Y5pL z_@7#zmKW^TsJnMo>{Yk>F|Y;v{5Pj_jk_%BBxRsvFP5IPZ=sK<P2k6yPFDO_a(C(D z_FQoAdbdBhGI|B<Ard6)GOwRVyiH?T<S91RF8!T7G!xC_(<yLN7<BlysMmn^-xpL8 zagfdx@y^F&xlPn`ye~aONoshQ3o^vpI|#dpETUqtl?Puk>919dwKHULzKzGZ8mrWg zY~mKtg0e?6t!T#HH-*0D2WHEHC-i<?B>iw@@d;*SfltO7wk&lifRDB&znd9L(694f z?sQCZT(5yX{tn__)B%0=?+G^Az|SBr3Qn>}*KnG|gD$pB7}>SEUr*A0yKG+G%s~3d z3N^;Ow7e77_5oJctC%G3aD7zzv68(k&szi@8iQAmZ9DsDLxcn9&;|sS9!1H(<X|Iu zPgL<AHS{Qw=$Ok$2&b@ZW7A1AMY=&f(2ApMmY+aHAqN87Z3ke!?Buma%{R;I4=-b% zvZ|Tey8{~~)6Bl@Iq=X~7{<rxef>t(L7zhmy>*+H_vI~L`ELG~JcrbC;7;_{cA1xq z1b)Ec5k2V47|}Nq+1)b92-GY#($~s}caZ1AewPs}bMbG~hdEIx0EMGh6z>t8O*cRq z9)~kHux_|_x6b~8|8PTVqs(doXT6MYX=9#Yw9>hyZbFZF=IX*S{}U~@yXPdjm0dOm zAj-F;KWca1E&ZvpsIB32dHqCPg!ck)5nehk%WVhcd%$1p$+@5cJ@ZV7Sy4<l?R{<0 ze}6m;5JmIi=cQ}_`eRPp7}jq7=w&twyIy<Nh8O);nWr#1-4zp0H@dUNep4UYBmz5v z(&&{98FU}OWDr#N?*4gsA_g=crv`bd9?o%Eu2L_d<WD9=JZUU?!4ce~y6NE7<5-hA zo{*<BsXb}5?>O8aMV?FhZ3h0z{s&Ig?1~D2WeAfa7`S<#)=mWm#ioXiLI4B`u!Y)G zVQCzdB0pQwegJ#3eKYo2bw~$eq8jUWw_oB|M6ZS>(=<YlQ6N__hxe{p-Mz%m`;2el z(B%<1qOr0;)kmq>8}*xr$@SBDqoC{sT_%n}@@?wNDjg5XZ_HplGnM4Ui-Jn-&J5Jl zn9>-#|IXCJGY*%|<fBt!|6r?V04M@yG8&hHBO-Ar*hnzJdZjVCMtVtvQ?9l_GF6OV z-jk&m`RM~k6sN8%-sADuGAl-4z`so;+rM63+VcIDODR0U7#W4{mib8(18~$Gz6!qz zg@to?PuiaLA-FU8Opr<Z6W!7lvRTM3lIICO8(Cp-Q{Zx`ai%`HypxJ-F1o|=7L*`x z%Iu>voEQuBxRGxjy=~ORD7Wvl=&&N}U!lAHZ?{ZrDy|`c_^SG36Yrlr-$#--a+>0x zZ|G@y=_03<Oo+PPf>Q`qZ<fz>;aQ>px&RUy5XKriP(YBoPBmaxkRc!=aq>WINbo(% znN?zJavqR5{AxhvN5guSmE21am<!kaY0O9XMaB0x0MLUSJIlm!@@9~BL5xjgClFjW z2)JhPi=~gT)ylDK1gGO7+z*~$TJ1yy)(!sW)ewkSL~s@mviggldI|a}a#H6$Z8KxU zom`MyQtbu6n{A0=9?Sd;*Qk;BJ9TMi<xB9a0Sms*vP|4j{%NmLW9k?^F8aORkD(*) z8~;^cw%`*-v|{w%z*{F`B@)iB397(ffmd3?+K?$Yy?H^~zNDO_xA85RhB2#%PG{LY z=3|4BiXA0QiTr@x)_`&YegJn(hU?giAoqW!CVTs##J9}V(v#S>!8d6R+xX{Fbjr4W z^Ik9ZF&S&wY$~JF@${q;LNTpUBh8YmaJFL+rE)GEDGXusz=mZa=@_Lhpn!8oaA%QO zK+jmv_Q?2F{&!Nf#4q@a@0>lMLq`L6j%B$4?tb)rY?;6qF}JAS3`~1b3Rhwe51X6x z(1ig23VFDEhq;idfbbSTf#RgbsWEm~t-8tqzWv_dwwR~dm&e+-u$!e^snnm^#bpm} z!S1PdT<_nar0-YxJ}K~_f7F%`J*ne33ReA?XMANg5zFr!MY3~xohUaz;D;aC_iyZL z#8=av+ro{JiVXf+kB<mUYvd!}*q|GOe43bn?b^{C2x|2*y~w^M3Wu5!GUA>g0(^;* z5g5n0#M6*EL0)OYZj^|_=^POR%|!kM@O@;g69r7%@AO9-GH2KnXF<O20vkcNI7(Jf z1o|0hl;%}}^0rkH=og}XUIQ6b?O9jp=(clvb6Xl^HzY1m1_^<T(4-v>0Pv6+F;9VD zl<JL@!T7&*Iv)2shqjDdoHlbhs})5Myh7|Xj4h-$g-GIgS*H?7NPWz`vOA`GgZbWE zNfk#RJ|t8OACU+-(YKR=Z9MqytIcf3aXq0Ys(%_la{F&xoI!6<b}6OF;x28AeB+Z0 zANqwq9)UA-!qQ_TN8@!_1>1LifGi|LVmQ2b0SOa*Zj>g8LJ)UUj7b8kt1Wufn(Ssy zfG-^HK)gyIYaG2nLctB=><il>P9aru*tU5MWHM018xr5<ruSYwE;sw?%4=!<jcarE z$MBuXl=}O}5wHaQ?&K9zWfkQ<*B)Vn1{cYbNE>@MUQjlXyFsB~9+9^o6TCQHfLHQ^ zn=;1Yq~qaF&=zLp*#*=QXLInfQyJ}{i!*1>O-V)ML7#<kiwKAO&n|&M!bTDWtR!5H zM3`eaPVyn3lv`dOCpjOdWyRB+?Kas~)Y%RX_4f_FQ45D|wGZpmjX##7wR{R&2kI(a zsIp)6<G{_Ky8M^wJ2|$|6S4<%Dv7o;_4kRgO^QKVjn~`ix0S{$Nn}IP&?*h$;{+U( z*2>(zs)FpHpM!j|-14Sq31`hsN$Q`%d_7#sd9R}aXKxMg9_I-l9>ZbSyGg5-b1OD1 z`|BLYoIM}XBy$PSo$YDu_SYKtWzKthlygL?dntKI1tlp23_a7}!?@{Klg3Cufp4+y ziX{p4{`5juG69|;uix$-VMb)Dh%8HP!k^<k`w(-tRM&|eiQO}!(wRL@H`yT`pYv1+ zL*fs0b5@ce{hHa$dXsiQH871Y{KbIk1$m3}!x3y5W3gx~?IYd9XD_{<`~lnhwB~); z$-91fIV0X*>u&ouq0JQOjDJgq-|ut{vmPh3+30URMj>Z6O_uv*t`jkDHrn89z8GI+ zQn%mWaceCIoYP8<<4sAr0io273alZS)x9LkBLL2fqR(VwJA`T(`Z5WT3G|pdG2_tK zFgoJY=^gHyS&HwIDhuc+lLjDjUfz9_O7qo2kF*AtBqYf8dDApqbWuo#w4yww$590E z6vBa<Bau~0;Nj9NB4|g_Vq4*u8Cem6a~T#Ha(6N@RDlFzlqMzu?gk|?xCPSkjhIY< zp99bNbDnMA6oH7+Z*@;m*(RJF#xWHP*=hf<NpOVQOX!~F$9!$CtUr@Sd5m4)i0PUv zpZQ`ULb9l81I34cwyZpzr}?*$X-!^M!g;S^S1MyX-t8QEKO|Ycb6|Owj=Q*Xvub>Z zA2OWpa3;!vr=&t+YCiY(&Y_YVwr9F)zg1LHu1vHD{|mk_p-WAhh=BJ73$M>(fx#Rd ze)%u=0%L#^Q)JMEQ=}+OMP^Ik%aTR8zC-|Y?&-WO>myKMfk@sF=GVBefRPH@6Y|yI zP76KiDUa_p=mNB_C6hpRXXbmCLSYAM*XA=dfIN~y?KVw>EU=ZJJjfX!^7eH{s<)#W zjC+K+z6b{xhKLb~tiwErH?5j1u2Wl&VX#L!ed{KR#p&4WIC582OIJ49+|yYJ*l9(b zLt<b@y?#%4qOS2OTit&m=}DX0A3XOtOd{qAG3Pt!Qw<|mqkX8ke?l?K{rS)G%MR2E zUFSbGNGd;4bX?lU^)Roz(EgsS|5K~<pwMx(9*J_vFMI0DF|hX-=P`9?a-sCy<-9-I zJUx!p4IZ!4KChELVW%C}aAT6-?_0EoUBvCfYr~>PW0b$VBQ66l0m}c5M9BybY=vX9 zpqp^9T=U@w5so9%uPy5BIQ^Qkr6IDt(cO=@W5~{r<cYD31fK~`Qn4?F&pZ{rK5rq) z)f-?9xUt0&C=_Ov+mPiqNL_v}I=<Z_wd}7daJ>DvVmVfg{<FucV460eduG_~#Wn7t zeBWx$2ZEv8&S&>ZE!#VXO+ka;wrcYlZE91R?0Q_pEx`d=8UOy}lPUx3CqiQW=R9w@ zBQky|i9A}!`To%V^sCf7PQllY^H(%al!^TN+$vs;4}qGTHowz^v~j`z5PlIt|DWVY z^at>J?kR5E6JF4+wCbShY+gi$apDvgw61Y=gWRITq>tLlyQlGIZ#lajM*v1?vCmpp zmqdKfVHt?)I%EzTM0`C|6B8inDEY1-5~WEY0}gS`g%loy>O`rvCu%uSY8_LeA>2!p zrM_gtMk(08xQ-fA|3`D+E;6o7;>QahEz+}$cMS>%@tuvPl6hO&P!<KJ!m@Gj7CC8m zh&dBXG6Gr#5l5DZR>@9#Ha$%16eisk&S|9dhu3clA7)<HZ38)#iLA9U(GuGWl1ML( z-8~aIDhnYT9c%=>P)No@zeT(|+P&pN?P+<Q_E0`tMCTLVAv4)RSO8*2-Cd^+9!K4! z`&AmwG26`<6cir1!@S%uQD)ZSbR@UH*)yG~nb_fWPgtaVqDu!YogCiTN^_7?8bn(L zTbj^CQRBAQuCDrZ5NUPiM*Ve=0U2a6(rJ)xzLbLNXrr;O*KZ!@o+jM5uOdtKlW`E7 z(d6~pWHMC>S3*=s?ekasxjP~%ma4ljOy-VK&yb)JFH&3#^~N=7$OeCmeooAQ8q9Vx z-cz!yfdhV}OMtaLlyM}HDG}-5w2%=#(?_fb^@2~q<_Zqtu1R=jOK`N;u!wD}9@(}6 zKLRRvg_(;G2m}YE9OZ{SV+4S>K4;6^I7tB5bY=dh2f}1**MG)@e|~KB)_<CBXo^xu zU;W*B+<M8e4D+*WNk*hDf?mb`d-w#LPdDG|R46qKi(da^Xp45-z5dFwz9k?mcUivF zC}-|e;*xTo*A0hG60IFK&aU7K&sE=Awhzq-Q?tyYmJ%=&Y*|wCMihzT7!myGkGL{` za_mGl$ziS?S*8apj*E2q!X~culZDMSIMx4Ftt(y&6@YmumABJs5Y8TnohR1}th>qf za{hkPNWT96{)SL79Kj36ZT!!xB!=*{vUV|2qV|^Z=g5GYb=E#hqKlaK)AfhLnS75L zPky6*iS2?mw_IwzUUd*+Nco?{5+WQFw&1`SvfXYRvlgi~rfDwq3pS5L(h(B}Dt;(+ zn$#iPV}2d(I!*lVa88_SxH>CYl@cP)iR}qR9)(-fnY1+=w6pXCTkVns=@84lY0z+% z3-Q!Q<{Txcao%p^q%*sw=<|oDV<75`<rZV#yCdfpNJT&o0S=S0f@JoPh?Nw*ebT|( zn;k3X1gKmeby_xUheR!g3z1*1NH*$5c)Pk=au;UOaRbZIumn_zBq|PXML8b#6W0Z5 z-A4&sOK|(ZoVzUAh@C=4qIP9ltlzL-2(P{|K^HiPdKGNmDE8pI%}C~MrT_ky-Yu=d zH*FJT(y1dtJ_Uqa7Q7-&e86zT0u6E0iLs2*(n3I2)VMm^ViIfljS5ZaBd89_aU<wI z;uPhkx@Plo8-qd4NA=rUnJGl)db16Mwzkcy<&n^Wz&-`HK$vz27RMy%h&bQwaXw>V zr8^tK5Y!=o5=ZCCaMsz7ml)|5BI>Dzau&{|k;N~t4LFTx5fNNn7L@oOwUg*BjW@gm zI|5S9K1Gh9HqMpWxb1m`NbI9Z2gHKx@yFasp~}XOD$fcK(E8cwJ}9$esM*+vd}WRP z!?nusN(D|s7n>AX$%5Z;E%-#~WJM@TxOAHnx2vD3V(sRMWfUsSRhG1hnn3}#1B!K( zs~VN183EytWJR@=RVE5Kq&1LfKUQLA=+V;ZGap1n4wad$D)}QF2e|fw4jU{p(eU8} zu>e%_^kL+fGY0>#j8|z2iE5)rp{`gWBg+9}dW^`HERg82rK&}Kiq0W0l<4IQR^#6D zy5NGzt{Idu&JKa0({+vi<nSnu?E}(7GW_>xeF4OqGq;6-<9q_tf6@?})-A!k<G@NB zM^<8pQQWr{sl+p-yhVGxt!<dnkhHb5G?&CSa`wDD|EfpOaG=ko7>VrvDTjivJ=8A? z_Y{;!?1+>SB=CO?Sb6h3s9QzpE7;_jJ^{xEuq5ba9<<g#!_*m;T`H7kEK$yVapc0g z-YTLBFCtrSh@#UQn}W$nxW@rvH+|vW{iXmFW*4;TOC}`vA}qv8Cy0&jm39tM`VxlH z5vT^RGI(5k*96YgCeGTQc5N1zOj4Qs+B*S4u8iVcr97rRS+`QmE7aM;NgT>u>MASV zblF<TIK&qOeGP$C@Lu7}_TGzy(j6<gj}q5y6EP%`Vdj0?;>09oIA^tD*NPV$jeFD} zO<|$_^EwTGf7o{11~byL1f?x*=W%F8fHDna28f!Z^EN0j=#d+o<|+&mamp1CBhhV^ zi%!nojeE`6s`ik-FC_nrTUqjoSe63tQd=*23ru)eC1}tuQN*s<V-tChK2kIV_uC+N zVGY5$jfnXRihKeGnK$oo^CU_8T*G@fD|~zBlq;ALw%O=23%OLUFuet5*0RUujW{Y7 z3`TLyS!-p(-w&*&ySG#{qfj(hMk$!tYn8NAT&t5%g@?lV-0=UWxoZt;>dM-OL5)>Q z#t)~ULNfjAh!-rS6ezc(wkm2>Y^$YIOjN3=jTIFUNJ4@iRYv8~ma5#-LY1~6K~VvL z1jK?0<bW5V5J-?qU?NE{gxpSYW}grc5IX%g9}iESTu%07?X}ik`+eUeV<o~`9tt|s z0@w#I7GTq}@)s6D%W9}oK#^cYSDE-1Iy}H(fO0w&sKu~q4gmDkOzB8XYe}Kl5eTF| zJgBh&#&*@y!XE5xT-ZlnY}t3Ftb<1tM3V|(OMxPMuRO2fR<dxO;-NA7__3Tv^@n62 z^NZ@BW7@@G9gj7X50r&kYp7z8Jgz#vM*bHD`r~O4L1I`yZ%8O{4S4qG@Wqp$eo{S= z%tn&x(u^l1HGUm%-vNHH;EH8G&lPc6DgoXz3Y}Yvq!IQTqbq>E<mkK?gwCZ=c*1&! zTe5@Oxb_9dl+S!e9SMjHOrNT40x|{Q3$rTLSqQGcy^SGK&(565dP$4Ia0CsUaGoy3 zb!1u?<r5oSK-I66vc7T7o->xFoK5!>Ojd2(u0*|)!o;M=C3<%dV$VRO`W3oR+uAO< zqX3`Ob<P&xNC@&QzKI6_L_abvLe+WsG(L7^f&dG(#bFKcMRM;I;xdalx;+fVV_E7o z#WycX`%yy9DxR7sdbI-Ff3OoMezKyiKuibf?`<tvGb#3pCjj3C5|%N3eS{3clw=rA z4n&I{R%~I^X)E3boW}fPk~|UTHS3T;dKm(<2=4LV%LXa}<sHp%wx6Opo7+CJvY>bo zO6o);L|o@-7nixuj+42F1bNk_;r7&pZ<}02KZ3Jg5PhT7AyzWG=J7j1@jJ<>i?agP zI9FOVx)W*(?76|x>K7Z+B+6#g0e~>lBGIu1+&In?2&|+gtE4J#1ZCb15)_7y<O!NB zNAqxN*=es3H-{&>Q_rqs!R2*ShtFNWVPHcGm~$yWqaQbyog{?LO2{B{5X105zbC2R zD1X1es1?CVSd^pb>fcx;Aai0lH_b~b9<NtuqLdwOHEn5>nt`QmbTgZ;l*<`0&M>|C zr`RBIi)Q$pA~(HL6J4+zm6p^bl%)SQ>OP4+NzQ`#hD6DM!`6Cur%9aJ9xrOR4}do- zgfbre&MgD#+KrgL1duTnaAKn14D59oF`%rlDz4idlJdq0j91Wwf8o8NeK@i1u&^oK z@1`_aBw!<imgST^B6hH1gJXv|aH^$+CA#l(K<JIh)F_?ELr8nR(By}q5L=F>-NWSt z@m|H9XDu`Ac8;3ygI%14a+WD@;`3i4Cvgy#L2{n2Too@X6J02=ZIuZHoI`=-?b`E) z`7-_I&wWZODdsHyo%v??q=o+9gR5ekMhir=lWuo1RWo-by7#&sL)NY5#9x;a01#FM zj&qubpksJSF*rC_P9*>~>nz+jc2pbBh>cWTAgv@zH5p@?Ymh@o7<h^ShnCPhQw#Lf zR?%DT)m~Rs#-SjPq_Jmw2v!|m_N82A;7eK&jM|vO>5|R0ij-={u*AEM2jzAs<Az*x z1MZW=fJ!Q|TY5F>mvqX5$dyBiN9z^Z&L96agV*2Q`E}mq7@sa?)PUYq)y0Y*79UY% zEOL{b5DYeGoh|6xd4DLGm=;Q>E>N1kIPPAXmiNq%)TEH?I*cYWuWuPSUL`#v(AqDF zQY^ub5t?Jb`<Rl<zkcP9@k~Hdj!LsFx{N90z9T~P+`)g|%P6j*-wN;q<Q@=rTQr3j z7W=ZoX@q1BymJ#Mb1AZgrlgJl;V#Q5aLA*aGz<7qZ*et`R?hyqYYZom_pRP9+v-ty zQT}OP`=#&1${L$hvndY}BK%0AJh5H)mBMnDn9b7R)|{MyGf#_uhmViS9yLJ=#kJ<; zyFjx_j{VIp?+7GwjgST$vpSn0@Msb)<8AHl20MA?l!OgXMo!QyV|)#kmM-@Ky^5~S zFmIgV2vZ3DQs6T;7AUoW=wL~-TluJda-5!WR1>pOMLD{Ai)mSFV<k--7MOqQ1xVBv zOzI-kI)*jS4)X*gwY(RDisXIOdzD)~%12G$7I0=Rut3ez8@&S!c+Nls_@18dQp^nV zi42kh1`8&ANPrSth7D^k;%;Hh+553QN{rs8!~!|RlI$%|%X-cq&;1{*qaq`0H^~Ij z+JzQ1zjZ$;tM*yan%Ov5dheNGNgw^;OIjd+tzkOS(Rl~nWkhMYCywQSVuRUd67Gp2 z7ne&w9F#38XUF!wSn>+Ax~}c@FB!k2J4fHhLR4>*W~XafKtSA4n2sFO9{Vg1o%NP7 z{90MKzEe?O)}d80BnMLXOAWf5mP*C`YYK_3WR@EH42pQbMx}PpKX7Q=Y*_oeq1^j@ zT|V?Q_EplFlZhZicz0;X$se#2GD!3zMIm5<;BO=MVXitsZ!s$0gWm>fM$-SvN5uj_ z35xlN|A#;vOFcUx0-MCMd>eTyhCQ=`dUs`_uMcr=u$!gY0te6bW*)0H01U*@qfSBP zMh%r%!}Jreuq204lgdYt<p~)q;RReyxTr(;@O$o&_G6Iv%PyIS^I%}<&E6B|MS~T? zT^a$$zfr#W>zguDKnKUJ+jA|i$KLWejnc<K&`KDu8oquMeAB1SWhPr@>j^wUDD_}} zaL<DBlpU@$F-){8fEgPvE10z3oSP(CtR!V)pyilo5#V7j<PgDke3wvHGXt$3oq^LU z<3MSF;cRF!1;k^mW073D$dALlEeL#ipux@}PkECKvECdAvPqM7$q+}K4|x__m~xz} z4wL?ehX)e(gOlT5I9;rHNEXqSEUT-6_3o+&_J4es<PPe#AZd8kpXz7apo-lu0<`xP zBuV|J`WZJUuiAH5kpFSPVbY(S-e|YAX`udgQF#mh^z^LVK5=}YvMB;aw^)AcCUgc? zvto-e?xtbw|AR|aGbDVIPNV(ME2;r2tx!;Q#dv9Q`UL_uyY8m9N##(Tt=9605<Y6s zE9;v=<L-HAjQY>7(S-1QWxtWun{F_%Rt?2~TeQLd69Lz)UP7J)cZi*9X#dixudCD* z1P}NjjD9cXrwIIEC7GLZwT!tDeyF5{5f&05xQYL(!QqadOz%)BqITbex3y%H%alZ2 zQZgF$aQiQ0tj)E?c>kfdP?Nr0K$7@<0^Th9uv4qnsEki4%*S`2ImWkt$oW+Qi*CVc z1{ekztv~FyYzXhQ^Yn8t-Y02+wYVw|u{kJ(bESfQ5dPL2MAxQ+Zs||C5TBsoLc>OV zt`2RWq$sfY-PdW`L^T2l`z@96ZP2>!HtvMh>7BBe0EF#T`w&1?^BB=zD)1)!)^?f! znfo)!NW9dEIz|Spz=pZ9i|bfHILmb$GU_v~37&M8bH3v*Fj;IPMXUNG5!CqfiI)1f z0x5x&Lz_(g%B)|(OU3RfiTJpD6?&?YNkZ0qWJ>Qahh5{MGgU?%qrqaI+XJXhhgOB2 zzKb>G8O=@}Ag|YjP)?l19>+!)^L;3S7^7AkEWKk{KV1wZ1#~Op$i(Iy%L2>DkG( z<0GA&z{k=0%-4P?n|ly0GT2vbG?FVwUzBnXVqRgLW%(ERlLOIf(zBn%Tx64}b5Pu` za(B%p6Pr&ZnUB8GEsNnf#bU3_CBt%e^(GUd%)kpA)anYRUBD+~P8i`8u<k!5B=nk_ zY$afd)W7pqGm}XW|FxBv&5SbrLW4@Xv4DiF{qGNnLXW89XjM=A{hSMudeNR?i_anc zyt)Ptjaon_A(R8d#xng8CkE(sv3fm7QYVM==}7pz4j-6vTCZ^^i-L!Gg5K@gWBmOG zwkONH@@)hMDTwGgEn^MVC0&hhK4a;a|6o{rOFhJNXJo<f1A&AeeiM7Du38}D6AaiS z-(ly7@{HI$FBo<}sr9gW&JgB(wQ1g#jN?N&Aw%yVh$wi_<1F>>lFJXS_ky3QS^O!o z$wW+3<{;Sk_aEf6&nLq){d>CPe#=BR8}a`Gn$E?VW;?YOYiv~4o3Qn}J_v%S61%7A z1jgd>Ru6+qylN{tZLykbLRv{In~fb5$7dRFMcNtZfB#bHE2>kzpP*_o8Wz&FAht2& z+}?@*o-Sbu;2A+x;X}m>oLfU$LQeC0UF)w-{Le^r*M0-?v((!Va@uadRqnc$8Zo)4 zy^VL%n743M_Nv7u*R=`9&PATf<@ro*>T2&74FTBpqDx|*%l*Kw-uJ_1QP!kU?G1@| zyEg~K`3z*8vLE}A`%Ag<g1#o<RpG}&p0tTm*c+1aTe^qSxzQmqE<Oo&YW^vEZ}x>g zx^U7=t`b6uX+E24#r7m9Cr;A$-KYHBYo;43<7i_}za#jCd$0ks^DgZZeDvP5?G}_3 zJCB<3XiJ0l?CnRtq=nFy8#0O~+VZNaJmirFVeH!Nn#JF&@V!=CP(0Q8^l%|B(eD<c z2HbD(p0jMaD_ipD!<*_x7a-ulGw;Od?N#ukIBV(X2!?X@@efaLgKdpjokfXdE+EWo z1kLcr(@u-NWz4Fy<<kxG+<(*I4o-HQb9)0$TBdeja!9*7RO6~9hqPnFe3BEi<0Z$( zn$=zs+3uS0lDA`PFX#8z?wabAf-`q;Ra3U+@EtyG)f8{>-HaLq=wjgx?h@jZ1BuLF zK?rl2{<fsz<2XDPbl_z>gtY8`4j7=b({)RN%$3h=ie8FSF#7zvxGF&~3A!=a&+D%e zKINDO2Sg=g^BkUuU{cFrlx5V^QJb$HHygS{CE-EDpdU;4GP8*OD8<xb;!-(g`%wEN zyEs&@CWmVU{V7yVd!e)LF?qv)yoU^4rDO&xyUxmnxMYqgp57dBQPww=apk);ZTPsh z-2|c{J9f6A5bfDIsOfric&XDmLIAW5Z^xnz4K3o5J5tHRulmX%-EgG#NVIXVE7t7) zvvxmxP2Di1odOC9V<Fd_D595>8M;M{rw)>@80&}v^SjXyOCF=W@*ANWDh*J#$q-&X z++UZX)vL2Po0AKT(BsLe$hDsF8JMaBjr^Sjovyh@L!(V0NNUc2O6}%b!Hl}x??vvb zbbj1ow}<TXrhwpoKcnsSFY=X|xOYE`k{fl4x@@JoB6Z~)?t?aY^>vpM39={V_tDhn zG=dWp$c=yQahl{3o#d~jOu0A(YbtG}ZL4=M;!b~XyCj~!!{M@MP`>+h39oTxLfU@i zZ5vfW%{@^~C`II#)>E_I2Wk-winu%<e~7IutAEFwWme0GLstX^91|;fIM~31LrM8h zWYRk}Zw-?oE1i!Dlnl;$rZ@Bk%~YPFDZ1$loy1igk;d2)|4EV|ah|P2v6~M>Ad2l4 zC}Mn|3q}bAE&)1m6CK#8OLTMyivCv^N2^~vK#kc4GgW$hG~{ncW8AZg<C2t&W!W9F zvUu*VQ#o-#!gdD4@+)GIoVE|zsOoCU&)eSaKBTIlN-~|G{7RnOU^v7Lu5@zbvt65i zlBJR=-rT80d?h4exGw|r@|cXwC;;EAY{ZEY;843bKW==+Roh*$1Xvprb*S-s`0_N} zqEKnnt`MJ1$WC0<>cERTO8CN(_{Ob>A>7!8><Em8LJf}Vh{pO(PY%B$*1T?{1AH8H z0n6?y-+oAULpIPc<q8r$?YB7;{nxrhPD_^>$>Q)jn<A&#!#|)u7p>55=*;XOZUyFb zqZ_opv9?G!p(TLBuu+v?zjDh~nh8$QU(K<L%M&>Yzw4H^PL+pRYE}e5wb!F?$tYq_ zr<B#y;>nj=*&lDi$7u+a9k*WZF@DgTd{BF_@L-7(L>`D`CMl^AEJ(ZnnGybgF6yph zFOHxNq<4z~F@qJu$N9o-%{FhDPs>Y0s?KjSDR>f&rFu3^{IaAjxwacC&BvO&NSkhF zh)f*hZ^-Rcm&+RQjJXMCly=J{8z^vjywD}Gya&?tNaycl2@t4s1GOgg9<KCVrwg$I ze>L8=m0m>B>t$X>ry1E-o`OeFM4AdWqoXiZtemRndczw%3B{t1Q0Q^%swtCf3$1TB z_|5vDcFNZ2)8g0Pnz!FdIizdr2HJ&{Q?_&N50mxuo5T4g)MP*hOV{RRRi4s7;BUj) MEo%zj-}Qh024yDFR{#J2 literal 0 HcmV?d00001 diff --git a/C++/docs/html/_r_e_a_d_m_e_8md.html b/C++/docs/html/_r_e_a_d_m_e_8md.html new file mode 100644 index 0000000..262db35 --- /dev/null +++ b/C++/docs/html/_r_e_a_d_m_e_8md.html @@ -0,0 +1,100 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>libxdf: C:/Users/Yida Lin/Documents/GitHub/libxdf/libxdf/README.md File Reference</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="navtree.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="resize.js"></script> +<script type="text/javascript" src="navtreedata.js"></script> +<script type="text/javascript" src="navtree.js"></script> +<script type="text/javascript"> + $(document).ready(initResizable); +</script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">libxdf +  <span id="projectnumber">0.92</span> + </div> + <div id="projectbrief">A static C++ library for loading XDF files</div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.12 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<div id="side-nav" class="ui-resizable side-nav-resizable"> + <div id="nav-tree"> + <div id="nav-tree-contents"> + <div id="nav-sync" class="sync"></div> + </div> + </div> + <div id="splitbar" style="-moz-user-select:none;" + class="ui-resizable-handle"> + </div> +</div> +<script type="text/javascript"> +$(document).ready(function(){initNavTree('_r_e_a_d_m_e_8md.html','');}); +</script> +<div id="doc-content"> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="header"> + <div class="headertitle"> +<div class="title">C:/Users/Yida Lin/Documents/GitHub/libxdf/libxdf/README.md File Reference</div> </div> +</div><!--header--> +<div class="contents"> +</div><!-- contents --> +</div><!-- doc-content --> +<!-- start footer part --> +<div id="nav-path" class="navpath"><!-- id is needed for treeview function! --> + <ul> + <li class="navelem"><a class="el" href="_r_e_a_d_m_e_8md.html">README.md</a></li> + <li class="footer">Generated by + <a href="http://www.doxygen.org/index.html"> + <img class="footer" src="doxygen.png" alt="doxygen"/></a> 1.8.12 </li> + </ul> +</div> +</body> +</html> diff --git a/C++/docs/html/annotated.html b/C++/docs/html/annotated.html new file mode 100644 index 0000000..1796cb7 --- /dev/null +++ b/C++/docs/html/annotated.html @@ -0,0 +1,105 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>libxdf: Class List</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="navtree.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="resize.js"></script> +<script type="text/javascript" src="navtreedata.js"></script> +<script type="text/javascript" src="navtree.js"></script> +<script type="text/javascript"> + $(document).ready(initResizable); +</script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">libxdf +  <span id="projectnumber">0.92</span> + </div> + <div id="projectbrief">A static C++ library for loading XDF files</div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.12 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<div id="side-nav" class="ui-resizable side-nav-resizable"> + <div id="nav-tree"> + <div id="nav-tree-contents"> + <div id="nav-sync" class="sync"></div> + </div> + </div> + <div id="splitbar" style="-moz-user-select:none;" + class="ui-resizable-handle"> + </div> +</div> +<script type="text/javascript"> +$(document).ready(function(){initNavTree('annotated.html','');}); +</script> +<div id="doc-content"> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="header"> + <div class="headertitle"> +<div class="title">Class List</div> </div> +</div><!--header--> +<div class="contents"> +<div class="textblock">Here are the classes, structs, unions and interfaces with brief descriptions:</div><div class="directory"> +<div class="levels">[detail level <span onclick="javascript:toggleLevel(1);">1</span><span onclick="javascript:toggleLevel(2);">2</span>]</div><table class="directory"> +<tr id="row_0_" class="even"><td class="entry"><span style="width:0px;display:inline-block;"> </span><span id="arr_0_" class="arrow" onclick="toggleFolder('0_')">▼</span><span class="icona"><span class="icon">C</span></span><a class="el" href="class_xdf.html" target="_self">Xdf</a></td><td class="desc"></td></tr> +<tr id="row_0_0_"><td class="entry"><span style="width:32px;display:inline-block;"> </span><span class="icona"><span class="icon">C</span></span><a class="el" href="struct_xdf_1_1_stream.html" target="_self">Stream</a></td><td class="desc"></td></tr> +</table> +</div><!-- directory --> +</div><!-- contents --> +</div><!-- doc-content --> +<!-- start footer part --> +<div id="nav-path" class="navpath"><!-- id is needed for treeview function! --> + <ul> + <li class="footer">Generated by + <a href="http://www.doxygen.org/index.html"> + <img class="footer" src="doxygen.png" alt="doxygen"/></a> 1.8.12 </li> + </ul> +</div> +</body> +</html> diff --git a/C++/docs/html/annotated_dup.js b/C++/docs/html/annotated_dup.js new file mode 100644 index 0000000..bd22548 --- /dev/null +++ b/C++/docs/html/annotated_dup.js @@ -0,0 +1,4 @@ +var annotated_dup = +[ + [ "Xdf", "class_xdf.html", "class_xdf" ] +]; \ No newline at end of file diff --git a/C++/docs/html/bc_s.png b/C++/docs/html/bc_s.png new file mode 100644 index 0000000000000000000000000000000000000000..224b29aa9847d5a4b3902efd602b7ddf7d33e6c2 GIT binary patch literal 676 zcmV;V0$crwP)<h;3K|Lk000e1NJLTq000O80015c1^@s65rAI}0007ONkl<ZcmeI5 z%WD%+6voe;xyj6=NhXt~4{e$zF*P<SZp4L@2Hd!iQY<tJD@e5{RU55hl&Talf{KWb zN*6A=C`Gqz5#NvcXzNOCOH(I9n<#?l<k5ws2omoMCgj%s3y1G=&gJ~>y__>=_9%My z{n931IS})GlGUF8K#6VIbs%684A^L3@%PlP2>_sk`UWPq@f;rU*V%rPy_ekbhXT&s z(GN{DxFv}*vZp`F>S!r||M`I*nOwwKX+BC~3P5N3-)Y{65c;ywYiAh-1*hZcToLHK ztpl1xomJ+Yb}K(cfbJr2=GNOnT!UFA7Vy~fBz8?J>XHsbZoDad^8PxfSa0GDgENZS zuLCEqzb*xWX2CG*b&5IiO#NzrW*;`VC9455M`o1NBh+(k8~`XCEEoC1Ybwf;vr4K3 zg|EB<07?SOqHp9DhLpS&bzgo70I+ghB_#)K7H%AMU3v}xuyQq9&Bm~++VYhF09a+U zl7>n7Jjm$K#b*FONz~fj;I->Bf;ule1prFN9FovcDGBkpg>)O*-}eLnC{6oZHZ$o% zXKW$;0_{8hxHQ>l;_*HATI(`7t#^{$(zLe}h*mqwOc*nRY9=?Sx4OOeVIfI|0V(V2 zBrW#G7Ss9wvzr@>H*`r>zE<Gz)cj&*s5lRy$b&*W@2j<GZEpXZ$P|Z!4Q$_|`5gj> z+e8bOBgqIgldUJlG(YUDviMB`9+DH8n-s9SXRLyJHO1!=wY^79WYZMTa(wiZ!zP66 zA~!21vmF3H2{ngD;+`6j#~6j;$*f*G_2ZD1E;9(yaw7d-QnSCpK(cR1zU3qU0000< KMNUMnLSTYoA~SLT literal 0 HcmV?d00001 diff --git a/C++/docs/html/bdwn.png b/C++/docs/html/bdwn.png new file mode 100644 index 0000000000000000000000000000000000000000..940a0b950443a0bb1b216ac03c45b8a16c955452 GIT binary patch literal 147 zcmeAS@N?(olHy`uVBq!ia0vp^>_E)H!3HEvS)PKZC{Gv1kP61Pb5HX&C<wUB513~7 zF-Lk{?g8$ijf`2F^ip|Vw7EpzIJxiU`6~>2wk~_T<sM_r%les%%^JdHy*A#$ew5wb vr&wL1c8#4j*F5jfGT)c(PZrEb5O3m+yDrVre6KeTXbXd<tDnm{r-UW|3$!!q literal 0 HcmV?d00001 diff --git a/C++/docs/html/class_xdf-members.html b/C++/docs/html/class_xdf-members.html new file mode 100644 index 0000000..3634bf4 --- /dev/null +++ b/C++/docs/html/class_xdf-members.html @@ -0,0 +1,131 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>libxdf: Member List</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="navtree.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="resize.js"></script> +<script type="text/javascript" src="navtreedata.js"></script> +<script type="text/javascript" src="navtree.js"></script> +<script type="text/javascript"> + $(document).ready(initResizable); +</script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">libxdf +  <span id="projectnumber">0.92</span> + </div> + <div id="projectbrief">A static C++ library for loading XDF files</div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.12 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<div id="side-nav" class="ui-resizable side-nav-resizable"> + <div id="nav-tree"> + <div id="nav-tree-contents"> + <div id="nav-sync" class="sync"></div> + </div> + </div> + <div id="splitbar" style="-moz-user-select:none;" + class="ui-resizable-handle"> + </div> +</div> +<script type="text/javascript"> +$(document).ready(function(){initNavTree('class_xdf.html','');}); +</script> +<div id="doc-content"> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="header"> + <div class="headertitle"> +<div class="title">Xdf Member List</div> </div> +</div><!--header--> +<div class="contents"> + +<p>This is the complete list of members for <a class="el" href="class_xdf.html">Xdf</a>, including all inherited members.</p> +<table class="directory"> + <tr class="even"><td class="entry"><a class="el" href="class_xdf.html#aa7dc1ef8c04216d703604bf868146428">adjustTotalLength</a>()</td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr><td class="entry"><a class="el" href="class_xdf.html#a75ef15a72071fe0d36ef6311214518fe">calcTotalLength</a>(int sampleRate)</td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr class="even"><td class="entry"><a class="el" href="class_xdf.html#ad98829202c9ae64505c9ecc7796c8ddc">createLabels</a>()</td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr><td class="entry"><a class="el" href="class_xdf.html#a4d2c5859af84542a15a80c906465f4e3">detrend</a>()</td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr class="even"><td class="entry"><a class="el" href="class_xdf.html#a26a2b517f020dc9f188c2277c76add85">dictionary</a></td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr><td class="entry"><a class="el" href="class_xdf.html#a45004fc495cad33768fae80b996a68db">eventMap</a></td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr class="even"><td class="entry"><a class="el" href="class_xdf.html#a4e3322abfe4d533d6b7a96cbbea7271a">eventName</a> typedef</td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr><td class="entry"><a class="el" href="class_xdf.html#a1fbf3d641262cc1daade33eca1789990">eventTimeStamp</a> typedef</td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr class="even"><td class="entry"><a class="el" href="class_xdf.html#a4acb87e86380bf7266976cd6c4cb3826">eventType</a></td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr><td class="entry"><a class="el" href="class_xdf.html#a1e46bbbf31121fb394aa8cf5c10d10b0">fileHeader</a></td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr class="even"><td class="entry"><a class="el" href="class_xdf.html#a12332c25006e2c6d71883c368c3c1f61">freeUpTimeStamps</a>()</td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr><td class="entry"><a class="el" href="class_xdf.html#a250d6f79d0333887393eab248fee3c93">labels</a></td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr class="even"><td class="entry"><a class="el" href="class_xdf.html#a993e94535d6d9e544a64ffbbb2bb4e8c">load_xdf</a>(std::string filename)</td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr><td class="entry"><a class="el" href="class_xdf.html#ac65175994e0e2eeec4dd2f4688cd2040">majSR</a></td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr class="even"><td class="entry"><a class="el" href="class_xdf.html#a3cb480731a20caa480e3e6744acb562c">maxSR</a></td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr><td class="entry"><a class="el" href="class_xdf.html#a6874a847c980f296ebbcf703fa48096a">maxTS</a></td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr class="even"><td class="entry"><a class="el" href="class_xdf.html#a44da046e191b2ae90b9bfe4de8d58ea3">minTS</a></td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr><td class="entry"><a class="el" href="class_xdf.html#a1a2b080f29080a5c521de907769d9419">offsets</a></td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr class="even"><td class="entry"><a class="el" href="class_xdf.html#a67c5890ac84f257e91bdb93dcbe958ae">resample</a>(int userSrate)</td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr><td class="entry"><a class="el" href="class_xdf.html#add8aceaf68ad49b708f4df29f439778d">sampleRateMap</a></td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr class="even"><td class="entry"><a class="el" href="class_xdf.html#aa02e5a435186cdabbaf2487068c53dbc">streamMap</a></td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr><td class="entry"><a class="el" href="class_xdf.html#acc12687ca26e8352afb960d459c5947a">streams</a></td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr class="even"><td class="entry"><a class="el" href="class_xdf.html#a9b4fc485a140ba5020a48ca5fa2e45ea">totalCh</a></td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr><td class="entry"><a class="el" href="class_xdf.html#ac0b5d7d53fb28832594718cc16f65184">totalLen</a></td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr class="even"><td class="entry"><a class="el" href="class_xdf.html#a83d5309d854b1052fa575b539a69c58d">userAddedStream</a></td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr><td class="entry"><a class="el" href="class_xdf.html#a7b1496a8667d67b90836696a1e2da618">userCreatedEvents</a></td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr class="even"><td class="entry"><a class="el" href="class_xdf.html#a1d7401eb1557b2f34ac0ff4b9f79d04f">version</a></td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr><td class="entry"><a class="el" href="class_xdf.html#a072e657d7620d61080a15a215c691210">writeEventsToXDF</a>(std::string file_path)</td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> + <tr class="even"><td class="entry"><a class="el" href="class_xdf.html#a7900b5a4f3792b9d59a5d43db821607e">Xdf</a>()</td><td class="entry"><a class="el" href="class_xdf.html">Xdf</a></td><td class="entry"></td></tr> +</table></div><!-- contents --> +</div><!-- doc-content --> +<!-- start footer part --> +<div id="nav-path" class="navpath"><!-- id is needed for treeview function! --> + <ul> + <li class="footer">Generated by + <a href="http://www.doxygen.org/index.html"> + <img class="footer" src="doxygen.png" alt="doxygen"/></a> 1.8.12 </li> + </ul> +</div> +</body> +</html> diff --git a/C++/docs/html/class_xdf.html b/C++/docs/html/class_xdf.html new file mode 100644 index 0000000..41c7802 --- /dev/null +++ b/C++/docs/html/class_xdf.html @@ -0,0 +1,707 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>libxdf: Xdf Class Reference</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="navtree.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="resize.js"></script> +<script type="text/javascript" src="navtreedata.js"></script> +<script type="text/javascript" src="navtree.js"></script> +<script type="text/javascript"> + $(document).ready(initResizable); +</script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">libxdf +  <span id="projectnumber">0.92</span> + </div> + <div id="projectbrief">A static C++ library for loading XDF files</div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.12 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<div id="side-nav" class="ui-resizable side-nav-resizable"> + <div id="nav-tree"> + <div id="nav-tree-contents"> + <div id="nav-sync" class="sync"></div> + </div> + </div> + <div id="splitbar" style="-moz-user-select:none;" + class="ui-resizable-handle"> + </div> +</div> +<script type="text/javascript"> +$(document).ready(function(){initNavTree('class_xdf.html','');}); +</script> +<div id="doc-content"> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="header"> + <div class="summary"> +<a href="#nested-classes">Classes</a> | +<a href="#pub-types">Public Types</a> | +<a href="#pub-methods">Public Member Functions</a> | +<a href="#pub-attribs">Public Attributes</a> | +<a href="class_xdf-members.html">List of all members</a> </div> + <div class="headertitle"> +<div class="title">Xdf Class Reference</div> </div> +</div><!--header--> +<div class="contents"> + +<p><code>#include <<a class="el" href="xdf_8h_source.html">xdf.h</a>></code></p> +<table class="memberdecls"> +<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="nested-classes"></a> +Classes</h2></td></tr> +<tr class="memitem:"><td class="memItemLeft" align="right" valign="top">class  </td><td class="memItemRight" valign="bottom"><a class="el" href="struct_xdf_1_1_stream.html">Stream</a></td></tr> +<tr class="separator:"><td class="memSeparator" colspan="2"> </td></tr> +</table><table class="memberdecls"> +<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="pub-types"></a> +Public Types</h2></td></tr> +<tr class="memitem:a4e3322abfe4d533d6b7a96cbbea7271a"><td class="memItemLeft" align="right" valign="top">typedef std::string </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#a4e3322abfe4d533d6b7a96cbbea7271a">eventName</a></td></tr> +<tr class="memdesc:a4e3322abfe4d533d6b7a96cbbea7271a"><td class="mdescLeft"> </td><td class="mdescRight">Used as <code>std::vector<std::pair<std::pair<eventName, eventTimeStamp>, int> ></code> in eventMap. <a href="#a4e3322abfe4d533d6b7a96cbbea7271a">More...</a><br /></td></tr> +<tr class="separator:a4e3322abfe4d533d6b7a96cbbea7271a"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a1fbf3d641262cc1daade33eca1789990"><td class="memItemLeft" align="right" valign="top">typedef float </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#a1fbf3d641262cc1daade33eca1789990">eventTimeStamp</a></td></tr> +<tr class="memdesc:a1fbf3d641262cc1daade33eca1789990"><td class="mdescLeft"> </td><td class="mdescRight">Used as <code>std::vector<std::pair<std::pair<eventName, eventTimeStamp>, int> ></code> in eventMap. <a href="#a1fbf3d641262cc1daade33eca1789990">More...</a><br /></td></tr> +<tr class="separator:a1fbf3d641262cc1daade33eca1789990"><td class="memSeparator" colspan="2"> </td></tr> +</table><table class="memberdecls"> +<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="pub-methods"></a> +Public Member Functions</h2></td></tr> +<tr class="memitem:a7900b5a4f3792b9d59a5d43db821607e"><td class="memItemLeft" align="right" valign="top"> </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#a7900b5a4f3792b9d59a5d43db821607e">Xdf</a> ()</td></tr> +<tr class="memdesc:a7900b5a4f3792b9d59a5d43db821607e"><td class="mdescLeft"> </td><td class="mdescRight">Default constructor with no parameter. <a href="#a7900b5a4f3792b9d59a5d43db821607e">More...</a><br /></td></tr> +<tr class="separator:a7900b5a4f3792b9d59a5d43db821607e"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:aa7dc1ef8c04216d703604bf868146428"><td class="memItemLeft" align="right" valign="top">void </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#aa7dc1ef8c04216d703604bf868146428">adjustTotalLength</a> ()</td></tr> +<tr class="memdesc:aa7dc1ef8c04216d703604bf868146428"><td class="mdescLeft"> </td><td class="mdescRight">Adjust <code>totalLen</code> to avoid possible deviation. <a href="#aa7dc1ef8c04216d703604bf868146428">More...</a><br /></td></tr> +<tr class="separator:aa7dc1ef8c04216d703604bf868146428"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a75ef15a72071fe0d36ef6311214518fe"><td class="memItemLeft" align="right" valign="top">void </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#a75ef15a72071fe0d36ef6311214518fe">calcTotalLength</a> (int sampleRate)</td></tr> +<tr class="memdesc:a75ef15a72071fe0d36ef6311214518fe"><td class="mdescLeft"> </td><td class="mdescRight">Calculate the globle length (in samples). <a href="#a75ef15a72071fe0d36ef6311214518fe">More...</a><br /></td></tr> +<tr class="separator:a75ef15a72071fe0d36ef6311214518fe"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:ad98829202c9ae64505c9ecc7796c8ddc"><td class="memItemLeft" align="right" valign="top">void </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#ad98829202c9ae64505c9ecc7796c8ddc">createLabels</a> ()</td></tr> +<tr class="memdesc:ad98829202c9ae64505c9ecc7796c8ddc"><td class="mdescLeft"> </td><td class="mdescRight">Create labels for each channel and store them in <em>labels</em> vector. <a href="#ad98829202c9ae64505c9ecc7796c8ddc">More...</a><br /></td></tr> +<tr class="separator:ad98829202c9ae64505c9ecc7796c8ddc"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a4d2c5859af84542a15a80c906465f4e3"><td class="memItemLeft" align="right" valign="top">void </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#a4d2c5859af84542a15a80c906465f4e3">detrend</a> ()</td></tr> +<tr class="memdesc:a4d2c5859af84542a15a80c906465f4e3"><td class="mdescLeft"> </td><td class="mdescRight">Subtract the entire channel by its mean. <a href="#a4d2c5859af84542a15a80c906465f4e3">More...</a><br /></td></tr> +<tr class="separator:a4d2c5859af84542a15a80c906465f4e3"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a12332c25006e2c6d71883c368c3c1f61"><td class="memItemLeft" align="right" valign="top">void </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#a12332c25006e2c6d71883c368c3c1f61">freeUpTimeStamps</a> ()</td></tr> +<tr class="memdesc:a12332c25006e2c6d71883c368c3c1f61"><td class="mdescLeft"> </td><td class="mdescRight">Delete the time stamps vectors when no longer needed to release some memory. <a href="#a12332c25006e2c6d71883c368c3c1f61">More...</a><br /></td></tr> +<tr class="separator:a12332c25006e2c6d71883c368c3c1f61"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a993e94535d6d9e544a64ffbbb2bb4e8c"><td class="memItemLeft" align="right" valign="top">int </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#a993e94535d6d9e544a64ffbbb2bb4e8c">load_xdf</a> (std::string filename)</td></tr> +<tr class="memdesc:a993e94535d6d9e544a64ffbbb2bb4e8c"><td class="mdescLeft"> </td><td class="mdescRight">The main function of loading an XDF file. <a href="#a993e94535d6d9e544a64ffbbb2bb4e8c">More...</a><br /></td></tr> +<tr class="separator:a993e94535d6d9e544a64ffbbb2bb4e8c"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a67c5890ac84f257e91bdb93dcbe958ae"><td class="memItemLeft" align="right" valign="top">void </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#a67c5890ac84f257e91bdb93dcbe958ae">resample</a> (int userSrate)</td></tr> +<tr class="memdesc:a67c5890ac84f257e91bdb93dcbe958ae"><td class="mdescLeft"> </td><td class="mdescRight">Resample all streams and channel to a chosen sample rate. <a href="#a67c5890ac84f257e91bdb93dcbe958ae">More...</a><br /></td></tr> +<tr class="separator:a67c5890ac84f257e91bdb93dcbe958ae"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a072e657d7620d61080a15a215c691210"><td class="memItemLeft" align="right" valign="top">int </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#a072e657d7620d61080a15a215c691210">writeEventsToXDF</a> (std::string file_path)</td></tr> +<tr class="memdesc:a072e657d7620d61080a15a215c691210"><td class="mdescLeft"> </td><td class="mdescRight">writeEventsToXDF <a href="#a072e657d7620d61080a15a215c691210">More...</a><br /></td></tr> +<tr class="separator:a072e657d7620d61080a15a215c691210"><td class="memSeparator" colspan="2"> </td></tr> +</table><table class="memberdecls"> +<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="pub-attribs"></a> +Public Attributes</h2></td></tr> +<tr class="memitem:acc12687ca26e8352afb960d459c5947a"><td class="memItemLeft" align="right" valign="top">std::vector< <a class="el" href="struct_xdf_1_1_stream.html">Stream</a> > </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#acc12687ca26e8352afb960d459c5947a">streams</a></td></tr> +<tr class="separator:acc12687ca26e8352afb960d459c5947a"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a1d7401eb1557b2f34ac0ff4b9f79d04f"><td class="memItemLeft" align="right" valign="top">float </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#a1d7401eb1557b2f34ac0ff4b9f79d04f">version</a></td></tr> +<tr class="separator:a1d7401eb1557b2f34ac0ff4b9f79d04f"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:ac0b5d7d53fb28832594718cc16f65184"><td class="memItemLeft" align="right" valign="top">uint64_t </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#ac0b5d7d53fb28832594718cc16f65184">totalLen</a> = 0</td></tr> +<tr class="separator:ac0b5d7d53fb28832594718cc16f65184"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a44da046e191b2ae90b9bfe4de8d58ea3"><td class="memItemLeft" align="right" valign="top">float </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#a44da046e191b2ae90b9bfe4de8d58ea3">minTS</a> = 0</td></tr> +<tr class="separator:a44da046e191b2ae90b9bfe4de8d58ea3"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a6874a847c980f296ebbcf703fa48096a"><td class="memItemLeft" align="right" valign="top">float </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#a6874a847c980f296ebbcf703fa48096a">maxTS</a> = 0</td></tr> +<tr class="separator:a6874a847c980f296ebbcf703fa48096a"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a9b4fc485a140ba5020a48ca5fa2e45ea"><td class="memItemLeft" align="right" valign="top">size_t </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#a9b4fc485a140ba5020a48ca5fa2e45ea">totalCh</a> = 0</td></tr> +<tr class="separator:a9b4fc485a140ba5020a48ca5fa2e45ea"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:ac65175994e0e2eeec4dd2f4688cd2040"><td class="memItemLeft" align="right" valign="top">int </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#ac65175994e0e2eeec4dd2f4688cd2040">majSR</a> = 0</td></tr> +<tr class="separator:ac65175994e0e2eeec4dd2f4688cd2040"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a3cb480731a20caa480e3e6744acb562c"><td class="memItemLeft" align="right" valign="top">int </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#a3cb480731a20caa480e3e6744acb562c">maxSR</a> = 0</td></tr> +<tr class="separator:a3cb480731a20caa480e3e6744acb562c"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:aa02e5a435186cdabbaf2487068c53dbc"><td class="memItemLeft" align="right" valign="top">std::vector< int > </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#aa02e5a435186cdabbaf2487068c53dbc">streamMap</a></td></tr> +<tr class="separator:aa02e5a435186cdabbaf2487068c53dbc"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a45004fc495cad33768fae80b996a68db"><td class="memItemLeft" align="right" valign="top">std::vector< std::pair< std::pair< <a class="el" href="class_xdf.html#a4e3322abfe4d533d6b7a96cbbea7271a">eventName</a>, <a class="el" href="class_xdf.html#a1fbf3d641262cc1daade33eca1789990">eventTimeStamp</a> >, int > > </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#a45004fc495cad33768fae80b996a68db">eventMap</a></td></tr> +<tr class="separator:a45004fc495cad33768fae80b996a68db"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a26a2b517f020dc9f188c2277c76add85"><td class="memItemLeft" align="right" valign="top">std::vector< std::string > </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#a26a2b517f020dc9f188c2277c76add85">dictionary</a></td></tr> +<tr class="separator:a26a2b517f020dc9f188c2277c76add85"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a4acb87e86380bf7266976cd6c4cb3826"><td class="memItemLeft" align="right" valign="top">std::vector< uint16_t > </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#a4acb87e86380bf7266976cd6c4cb3826">eventType</a></td></tr> +<tr class="separator:a4acb87e86380bf7266976cd6c4cb3826"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a250d6f79d0333887393eab248fee3c93"><td class="memItemLeft" align="right" valign="top">std::vector< std::string > </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#a250d6f79d0333887393eab248fee3c93">labels</a></td></tr> +<tr class="separator:a250d6f79d0333887393eab248fee3c93"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:add8aceaf68ad49b708f4df29f439778d"><td class="memItemLeft" align="right" valign="top">std::set< double > </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#add8aceaf68ad49b708f4df29f439778d">sampleRateMap</a></td></tr> +<tr class="separator:add8aceaf68ad49b708f4df29f439778d"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a1a2b080f29080a5c521de907769d9419"><td class="memItemLeft" align="right" valign="top">std::vector< float > </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#a1a2b080f29080a5c521de907769d9419">offsets</a></td></tr> +<tr class="separator:a1a2b080f29080a5c521de907769d9419"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a1e46bbbf31121fb394aa8cf5c10d10b0"><td class="memItemLeft" align="right" valign="top">std::string </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#a1e46bbbf31121fb394aa8cf5c10d10b0">fileHeader</a></td></tr> +<tr class="separator:a1e46bbbf31121fb394aa8cf5c10d10b0"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a83d5309d854b1052fa575b539a69c58d"><td class="memItemLeft" align="right" valign="top">int </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#a83d5309d854b1052fa575b539a69c58d">userAddedStream</a> { 0 }</td></tr> +<tr class="separator:a83d5309d854b1052fa575b539a69c58d"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a7b1496a8667d67b90836696a1e2da618"><td class="memItemLeft" align="right" valign="top">std::vector< std::pair< std::string, double > > </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html#a7b1496a8667d67b90836696a1e2da618">userCreatedEvents</a></td></tr> +<tr class="separator:a7b1496a8667d67b90836696a1e2da618"><td class="memSeparator" colspan="2"> </td></tr> +</table> +<a name="details" id="details"></a><h2 class="groupheader">Detailed Description</h2> +<div class="textblock"><p><a class="el" href="class_xdf.html">Xdf</a> class is designed to store the data of an entire XDF file. It comes with methods to read XDF files and containers to store the data, as well as some additional methods e.g. resampling etc. </p> +</div><h2 class="groupheader">Member Typedef Documentation</h2> +<a id="a4e3322abfe4d533d6b7a96cbbea7271a"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a4e3322abfe4d533d6b7a96cbbea7271a">§ </a></span>eventName</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">typedef std::string <a class="el" href="class_xdf.html#a4e3322abfe4d533d6b7a96cbbea7271a">Xdf::eventName</a></td> + </tr> + </table> +</div><div class="memdoc"> + +<p>Used as <code>std::vector<std::pair<std::pair<eventName, eventTimeStamp>, int> ></code> in eventMap. </p> +<dl class="section see"><dt>See also</dt><dd><a class="el" href="class_xdf.html#a45004fc495cad33768fae80b996a68db">eventMap</a> </dd></dl> + +</div> +</div> +<a id="a1fbf3d641262cc1daade33eca1789990"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a1fbf3d641262cc1daade33eca1789990">§ </a></span>eventTimeStamp</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">typedef float <a class="el" href="class_xdf.html#a1fbf3d641262cc1daade33eca1789990">Xdf::eventTimeStamp</a></td> + </tr> + </table> +</div><div class="memdoc"> + +<p>Used as <code>std::vector<std::pair<std::pair<eventName, eventTimeStamp>, int> ></code> in eventMap. </p> +<dl class="section see"><dt>See also</dt><dd><a class="el" href="class_xdf.html#a45004fc495cad33768fae80b996a68db">eventMap</a> </dd></dl> + +</div> +</div> +<h2 class="groupheader">Constructor & Destructor Documentation</h2> +<a id="a7900b5a4f3792b9d59a5d43db821607e"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a7900b5a4f3792b9d59a5d43db821607e">§ </a></span>Xdf()</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">Xdf::Xdf </td> + <td>(</td> + <td class="paramname"></td><td>)</td> + <td></td> + </tr> + </table> +</div><div class="memdoc"> + +<p>Default constructor with no parameter. </p> + +</div> +</div> +<h2 class="groupheader">Member Function Documentation</h2> +<a id="aa7dc1ef8c04216d703604bf868146428"></a> +<h2 class="memtitle"><span class="permalink"><a href="#aa7dc1ef8c04216d703604bf868146428">§ </a></span>adjustTotalLength()</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">void Xdf::adjustTotalLength </td> + <td>(</td> + <td class="paramname"></td><td>)</td> + <td></td> + </tr> + </table> +</div><div class="memdoc"> + +<p>Adjust <code>totalLen</code> to avoid possible deviation. </p> +<p><code>totalLen</code> is calculated by multiplying the difference between max time stamp and minimal time stamp by the <code>majSR</code> (major sample rate). However, this can be inaccurate. In case any channel is longer than <code>totalLen</code>, this function will make <code>totalLen</code> match the length of that channel.</p> +<dl class="section see"><dt>See also</dt><dd><a class="el" href="class_xdf.html#ac0b5d7d53fb28832594718cc16f65184">totalLen</a>, <a class="el" href="class_xdf.html#ac65175994e0e2eeec4dd2f4688cd2040">majSR</a>, <a class="el" href="class_xdf.html#a75ef15a72071fe0d36ef6311214518fe" title="Calculate the globle length (in samples). ">calcTotalLength()</a> </dd></dl> + +</div> +</div> +<a id="a75ef15a72071fe0d36ef6311214518fe"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a75ef15a72071fe0d36ef6311214518fe">§ </a></span>calcTotalLength()</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">void Xdf::calcTotalLength </td> + <td>(</td> + <td class="paramtype">int </td> + <td class="paramname"><em>sampleRate</em></td><td>)</td> + <td></td> + </tr> + </table> +</div><div class="memdoc"> + +<p>Calculate the globle length (in samples). </p> +<p>This is calculated by multiplying the rage from the earliest time stamp to the last time stamp across all channels by the parameter sampleRate.</p> +<dl class="params"><dt>Parameters</dt><dd> + <table class="params"> + <tr><td class="paramname">sampleRate</td><td>is the sample rate you wish to use to calculate the total length. </td></tr> + </table> + </dd> +</dl> + +</div> +</div> +<a id="ad98829202c9ae64505c9ecc7796c8ddc"></a> +<h2 class="memtitle"><span class="permalink"><a href="#ad98829202c9ae64505c9ecc7796c8ddc">§ </a></span>createLabels()</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">void Xdf::createLabels </td> + <td>(</td> + <td class="paramname"></td><td>)</td> + <td></td> + </tr> + </table> +</div><div class="memdoc"> + +<p>Create labels for each channel and store them in <em>labels</em> vector. </p> +<dl class="section see"><dt>See also</dt><dd><a class="el" href="class_xdf.html#a250d6f79d0333887393eab248fee3c93">labels</a>, <a class="el" href="class_xdf.html#a1a2b080f29080a5c521de907769d9419">offsets</a> </dd></dl> + +</div> +</div> +<a id="a4d2c5859af84542a15a80c906465f4e3"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a4d2c5859af84542a15a80c906465f4e3">§ </a></span>detrend()</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">void Xdf::detrend </td> + <td>(</td> + <td class="paramname"></td><td>)</td> + <td></td> + </tr> + </table> +</div><div class="memdoc"> + +<p>Subtract the entire channel by its mean. </p> +<p>Sigviewer displays both the channel signals as well as the zero baseline. Thus when the mean of a channel is too high or too low it would be very hard to see the fluctuation. Subtract the entire channel by its mean will make the signal fluctuate around the zero baseline, and has better visual effect. The mean of each channel times <code>-1</code> will be stored in member vector <code>offsets</code></p> +<dl class="section see"><dt>See also</dt><dd><a class="el" href="class_xdf.html#a1a2b080f29080a5c521de907769d9419">offsets</a> </dd></dl> + +</div> +</div> +<a id="a12332c25006e2c6d71883c368c3c1f61"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a12332c25006e2c6d71883c368c3c1f61">§ </a></span>freeUpTimeStamps()</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">void Xdf::freeUpTimeStamps </td> + <td>(</td> + <td class="paramname"></td><td>)</td> + <td></td> + </tr> + </table> +</div><div class="memdoc"> + +<p>Delete the time stamps vectors when no longer needed to release some memory. </p> +<p>Sigviewer doesn't demand time stamps to display signals except irregular sample rate channels, events, and the first time stamp of each channel (used to decide where does a channel start when putting all streams together). In this case we can delete the time stamps when no longer needed to free up some memory. </p> + +</div> +</div> +<a id="a993e94535d6d9e544a64ffbbb2bb4e8c"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a993e94535d6d9e544a64ffbbb2bb4e8c">§ </a></span>load_xdf()</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">int Xdf::load_xdf </td> + <td>(</td> + <td class="paramtype">std::string </td> + <td class="paramname"><em>filename</em></td><td>)</td> + <td></td> + </tr> + </table> +</div><div class="memdoc"> + +<p>The main function of loading an XDF file. </p> +<dl class="params"><dt>Parameters</dt><dd> + <table class="params"> + <tr><td class="paramname">filename</td><td>is the path to the file being loaded including the file name. </td></tr> + </table> + </dd> +</dl> + +</div> +</div> +<a id="a67c5890ac84f257e91bdb93dcbe958ae"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a67c5890ac84f257e91bdb93dcbe958ae">§ </a></span>resample()</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">void Xdf::resample </td> + <td>(</td> + <td class="paramtype">int </td> + <td class="paramname"><em>userSrate</em></td><td>)</td> + <td></td> + </tr> + </table> +</div><div class="memdoc"> + +<p>Resample all streams and channel to a chosen sample rate. </p> +<dl class="params"><dt>Parameters</dt><dd> + <table class="params"> + <tr><td class="paramname">userSrate</td><td>is recommended to be between integer 1 and the highest sample rate of the current file. </td></tr> + </table> + </dd> +</dl> + +</div> +</div> +<a id="a072e657d7620d61080a15a215c691210"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a072e657d7620d61080a15a215c691210">§ </a></span>writeEventsToXDF()</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">int Xdf::writeEventsToXDF </td> + <td>(</td> + <td class="paramtype">std::string </td> + <td class="paramname"><em>file_path</em></td><td>)</td> + <td></td> + </tr> + </table> +</div><div class="memdoc"> + +<p>writeEventsToXDF </p> +<p>If user added some markups and events in Sigviewer, this function can store those user created events back to the XDF file in a new stream </p> + +</div> +</div> +<h2 class="groupheader">Member Data Documentation</h2> +<a id="a26a2b517f020dc9f188c2277c76add85"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a26a2b517f020dc9f188c2277c76add85">§ </a></span>dictionary</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">std::vector<std::string> Xdf::dictionary</td> + </tr> + </table> +</div><div class="memdoc"> +<p>The vector to store unique event types with no repetitions. </p><dl class="section see"><dt>See also</dt><dd><a class="el" href="class_xdf.html#a45004fc495cad33768fae80b996a68db">eventMap</a> </dd></dl> + +</div> +</div> +<a id="a45004fc495cad33768fae80b996a68db"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a45004fc495cad33768fae80b996a68db">§ </a></span>eventMap</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">std::vector<std::pair<std::pair<<a class="el" href="class_xdf.html#a4e3322abfe4d533d6b7a96cbbea7271a">eventName</a>, <a class="el" href="class_xdf.html#a1fbf3d641262cc1daade33eca1789990">eventTimeStamp</a>>, int> > Xdf::eventMap</td> + </tr> + </table> +</div><div class="memdoc"> +<p>The vector to store all the events across all streams. The format is <<events, timestamps>, streamNum>. </p> + +</div> +</div> +<a id="a4acb87e86380bf7266976cd6c4cb3826"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a4acb87e86380bf7266976cd6c4cb3826">§ </a></span>eventType</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">std::vector<uint16_t> Xdf::eventType</td> + </tr> + </table> +</div><div class="memdoc"> +<p>The vector to store events by their index in the dictionary.</p><dl class="section see"><dt>See also</dt><dd><a class="el" href="class_xdf.html#a26a2b517f020dc9f188c2277c76add85">dictionary</a>, <a class="el" href="class_xdf.html#a45004fc495cad33768fae80b996a68db">eventMap</a> </dd></dl> + +</div> +</div> +<a id="a1e46bbbf31121fb394aa8cf5c10d10b0"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a1e46bbbf31121fb394aa8cf5c10d10b0">§ </a></span>fileHeader</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">std::string Xdf::fileHeader</td> + </tr> + </table> +</div><div class="memdoc"> +<p>Raw XML of the file header. </p> + +</div> +</div> +<a id="a250d6f79d0333887393eab248fee3c93"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a250d6f79d0333887393eab248fee3c93">§ </a></span>labels</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">std::vector<std::string> Xdf::labels</td> + </tr> + </table> +</div><div class="memdoc"> +<p>The vector to store descriptive labels of each channel. </p> + +</div> +</div> +<a id="ac65175994e0e2eeec4dd2f4688cd2040"></a> +<h2 class="memtitle"><span class="permalink"><a href="#ac65175994e0e2eeec4dd2f4688cd2040">§ </a></span>majSR</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">int Xdf::majSR = 0</td> + </tr> + </table> +</div><div class="memdoc"> +<p>The sample rate that has the most channels across all streams. </p> + +</div> +</div> +<a id="a3cb480731a20caa480e3e6744acb562c"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a3cb480731a20caa480e3e6744acb562c">§ </a></span>maxSR</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">int Xdf::maxSR = 0</td> + </tr> + </table> +</div><div class="memdoc"> +<p>Highest sample rate across all streams. </p> + +</div> +</div> +<a id="a6874a847c980f296ebbcf703fa48096a"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a6874a847c980f296ebbcf703fa48096a">§ </a></span>maxTS</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">float Xdf::maxTS = 0</td> + </tr> + </table> +</div><div class="memdoc"> +<p>The largest time stamp across all streams. </p> + +</div> +</div> +<a id="a44da046e191b2ae90b9bfe4de8d58ea3"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a44da046e191b2ae90b9bfe4de8d58ea3">§ </a></span>minTS</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">float Xdf::minTS = 0</td> + </tr> + </table> +</div><div class="memdoc"> +<p>The smallest time stamp across all streams. </p> + +</div> +</div> +<a id="a1a2b080f29080a5c521de907769d9419"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a1a2b080f29080a5c521de907769d9419">§ </a></span>offsets</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">std::vector<float> Xdf::offsets</td> + </tr> + </table> +</div><div class="memdoc"> +<p>Offsets of each channel after using subtractMean() function </p> + +</div> +</div> +<a id="add8aceaf68ad49b708f4df29f439778d"></a> +<h2 class="memtitle"><span class="permalink"><a href="#add8aceaf68ad49b708f4df29f439778d">§ </a></span>sampleRateMap</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">std::set<double> Xdf::sampleRateMap</td> + </tr> + </table> +</div><div class="memdoc"> +<p>The vector to store all sample rates across all the streams. </p> + +</div> +</div> +<a id="aa02e5a435186cdabbaf2487068c53dbc"></a> +<h2 class="memtitle"><span class="permalink"><a href="#aa02e5a435186cdabbaf2487068c53dbc">§ </a></span>streamMap</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">std::vector<int> Xdf::streamMap</td> + </tr> + </table> +</div><div class="memdoc"> +<p>A vector indexes which channels belong to which stream. The index is the same as channel number; the actual content is the stream Number </p> + +</div> +</div> +<a id="acc12687ca26e8352afb960d459c5947a"></a> +<h2 class="memtitle"><span class="permalink"><a href="#acc12687ca26e8352afb960d459c5947a">§ </a></span>streams</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">std::vector<<a class="el" href="struct_xdf_1_1_stream.html">Stream</a>> Xdf::streams</td> + </tr> + </table> +</div><div class="memdoc"> +<p>A vector to store all the streams of the current XDF file. </p> + +</div> +</div> +<a id="a9b4fc485a140ba5020a48ca5fa2e45ea"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a9b4fc485a140ba5020a48ca5fa2e45ea">§ </a></span>totalCh</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">size_t Xdf::totalCh = 0</td> + </tr> + </table> +</div><div class="memdoc"> +<p>The total number of channel count. </p> + +</div> +</div> +<a id="ac0b5d7d53fb28832594718cc16f65184"></a> +<h2 class="memtitle"><span class="permalink"><a href="#ac0b5d7d53fb28832594718cc16f65184">§ </a></span>totalLen</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">uint64_t Xdf::totalLen = 0</td> + </tr> + </table> +</div><div class="memdoc"> +<p>The total length is the product of the range between the smallest time stamp and the largest multiplied by the major sample rate. </p> + +</div> +</div> +<a id="a83d5309d854b1052fa575b539a69c58d"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a83d5309d854b1052fa575b539a69c58d">§ </a></span>userAddedStream</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">int Xdf::userAddedStream { 0 }</td> + </tr> + </table> +</div><div class="memdoc"> +<p>For Sigviewer only: if user manually added events in Sigviewer, the events will be stored in a new stream after all current streams. The index will be userAddedStream. </p> + +</div> +</div> +<a id="a7b1496a8667d67b90836696a1e2da618"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a7b1496a8667d67b90836696a1e2da618">§ </a></span>userCreatedEvents</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">std::vector<std::pair<std::string, double> > Xdf::userCreatedEvents</td> + </tr> + </table> +</div><div class="memdoc"> +<p>User created events in Sigviewer. </p> + +</div> +</div> +<a id="a1d7401eb1557b2f34ac0ff4b9f79d04f"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a1d7401eb1557b2f34ac0ff4b9f79d04f">§ </a></span>version</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">float Xdf::version</td> + </tr> + </table> +</div><div class="memdoc"> +<p>The version of XDF file </p> + +</div> +</div> +<hr/>The documentation for this class was generated from the following files:<ul> +<li>C:/Users/Yida Lin/Documents/GitHub/libxdf/libxdf/<a class="el" href="xdf_8h_source.html">xdf.h</a></li> +<li>C:/Users/Yida Lin/Documents/GitHub/libxdf/libxdf/<a class="el" href="xdf_8cpp.html">xdf.cpp</a></li> +</ul> +</div><!-- contents --> +</div><!-- doc-content --> +<!-- start footer part --> +<div id="nav-path" class="navpath"><!-- id is needed for treeview function! --> + <ul> + <li class="navelem"><a class="el" href="class_xdf.html">Xdf</a></li> + <li class="footer">Generated by + <a href="http://www.doxygen.org/index.html"> + <img class="footer" src="doxygen.png" alt="doxygen"/></a> 1.8.12 </li> + </ul> +</div> +</body> +</html> diff --git a/C++/docs/html/class_xdf.js b/C++/docs/html/class_xdf.js new file mode 100644 index 0000000..cc915ea --- /dev/null +++ b/C++/docs/html/class_xdf.js @@ -0,0 +1,33 @@ +var class_xdf = +[ + [ "Stream", "struct_xdf_1_1_stream.html", "struct_xdf_1_1_stream" ], + [ "eventName", "class_xdf.html#a4e3322abfe4d533d6b7a96cbbea7271a", null ], + [ "eventTimeStamp", "class_xdf.html#a1fbf3d641262cc1daade33eca1789990", null ], + [ "Xdf", "class_xdf.html#a7900b5a4f3792b9d59a5d43db821607e", null ], + [ "adjustTotalLength", "class_xdf.html#aa7dc1ef8c04216d703604bf868146428", null ], + [ "calcTotalLength", "class_xdf.html#a75ef15a72071fe0d36ef6311214518fe", null ], + [ "createLabels", "class_xdf.html#ad98829202c9ae64505c9ecc7796c8ddc", null ], + [ "detrend", "class_xdf.html#a4d2c5859af84542a15a80c906465f4e3", null ], + [ "freeUpTimeStamps", "class_xdf.html#a12332c25006e2c6d71883c368c3c1f61", null ], + [ "load_xdf", "class_xdf.html#a993e94535d6d9e544a64ffbbb2bb4e8c", null ], + [ "resample", "class_xdf.html#a67c5890ac84f257e91bdb93dcbe958ae", null ], + [ "writeEventsToXDF", "class_xdf.html#a072e657d7620d61080a15a215c691210", null ], + [ "dictionary", "class_xdf.html#a26a2b517f020dc9f188c2277c76add85", null ], + [ "eventMap", "class_xdf.html#a45004fc495cad33768fae80b996a68db", null ], + [ "eventType", "class_xdf.html#a4acb87e86380bf7266976cd6c4cb3826", null ], + [ "fileHeader", "class_xdf.html#a1e46bbbf31121fb394aa8cf5c10d10b0", null ], + [ "labels", "class_xdf.html#a250d6f79d0333887393eab248fee3c93", null ], + [ "majSR", "class_xdf.html#ac65175994e0e2eeec4dd2f4688cd2040", null ], + [ "maxSR", "class_xdf.html#a3cb480731a20caa480e3e6744acb562c", null ], + [ "maxTS", "class_xdf.html#a6874a847c980f296ebbcf703fa48096a", null ], + [ "minTS", "class_xdf.html#a44da046e191b2ae90b9bfe4de8d58ea3", null ], + [ "offsets", "class_xdf.html#a1a2b080f29080a5c521de907769d9419", null ], + [ "sampleRateMap", "class_xdf.html#add8aceaf68ad49b708f4df29f439778d", null ], + [ "streamMap", "class_xdf.html#aa02e5a435186cdabbaf2487068c53dbc", null ], + [ "streams", "class_xdf.html#acc12687ca26e8352afb960d459c5947a", null ], + [ "totalCh", "class_xdf.html#a9b4fc485a140ba5020a48ca5fa2e45ea", null ], + [ "totalLen", "class_xdf.html#ac0b5d7d53fb28832594718cc16f65184", null ], + [ "userAddedStream", "class_xdf.html#a83d5309d854b1052fa575b539a69c58d", null ], + [ "userCreatedEvents", "class_xdf.html#a7b1496a8667d67b90836696a1e2da618", null ], + [ "version", "class_xdf.html#a1d7401eb1557b2f34ac0ff4b9f79d04f", null ] +]; \ No newline at end of file diff --git a/C++/docs/html/classes.html b/C++/docs/html/classes.html new file mode 100644 index 0000000..eeb2709 --- /dev/null +++ b/C++/docs/html/classes.html @@ -0,0 +1,109 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>libxdf: Class Index</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="navtree.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="resize.js"></script> +<script type="text/javascript" src="navtreedata.js"></script> +<script type="text/javascript" src="navtree.js"></script> +<script type="text/javascript"> + $(document).ready(initResizable); +</script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">libxdf +  <span id="projectnumber">0.92</span> + </div> + <div id="projectbrief">A static C++ library for loading XDF files</div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.12 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<div id="side-nav" class="ui-resizable side-nav-resizable"> + <div id="nav-tree"> + <div id="nav-tree-contents"> + <div id="nav-sync" class="sync"></div> + </div> + </div> + <div id="splitbar" style="-moz-user-select:none;" + class="ui-resizable-handle"> + </div> +</div> +<script type="text/javascript"> +$(document).ready(function(){initNavTree('classes.html','');}); +</script> +<div id="doc-content"> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="header"> + <div class="headertitle"> +<div class="title">Class Index</div> </div> +</div><!--header--> +<div class="contents"> +<div class="qindex"><a class="qindex" href="#letter_s">s</a> | <a class="qindex" href="#letter_x">x</a></div> +<table class="classindex"> +<tr><td rowspan="2" valign="bottom"><a name="letter_s"></a><table border="0" cellspacing="0" cellpadding="0"><tr><td><div class="ah">  s  </div></td></tr></table> +</td><td rowspan="2" valign="bottom"><a name="letter_x"></a><table border="0" cellspacing="0" cellpadding="0"><tr><td><div class="ah">  x  </div></td></tr></table> +</td><td></td></tr> +<tr><td></td></tr> +<tr><td valign="top"><a class="el" href="struct_xdf_1_1_stream.html">Xdf::Stream</a>   </td><td valign="top"><a class="el" href="class_xdf.html">Xdf</a>   </td><td></td></tr> +<tr><td></td><td></td><td></td></tr> +</table> +<div class="qindex"><a class="qindex" href="#letter_s">s</a> | <a class="qindex" href="#letter_x">x</a></div> +</div><!-- contents --> +</div><!-- doc-content --> +<!-- start footer part --> +<div id="nav-path" class="navpath"><!-- id is needed for treeview function! --> + <ul> + <li class="footer">Generated by + <a href="http://www.doxygen.org/index.html"> + <img class="footer" src="doxygen.png" alt="doxygen"/></a> 1.8.12 </li> + </ul> +</div> +</body> +</html> diff --git a/C++/docs/html/closed.png b/C++/docs/html/closed.png new file mode 100644 index 0000000000000000000000000000000000000000..98cc2c909da37a6df914fbf67780eebd99c597f5 GIT binary patch literal 132 zcmeAS@N?(olHy`uVBq!ia0vp^oFL4>1|%O$WD@{V-kvUwAr*{o@8<G4C~~x2bkCl7 zlF9slZh~6z%aUT|WfKm3{P*dDAfv<6>{^CZMh(5KoB^r_<4^zF@3)Cp&&t3hdujKf f*?bjBoY!V+E))@{xMcbjXe@)LtDnm{r-UW|*e5JT literal 0 HcmV?d00001 diff --git a/C++/docs/html/dir_689ecbe789caf2e46799b15492db205c.html b/C++/docs/html/dir_689ecbe789caf2e46799b15492db205c.html new file mode 100644 index 0000000..5930c3f --- /dev/null +++ b/C++/docs/html/dir_689ecbe789caf2e46799b15492db205c.html @@ -0,0 +1,109 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>libxdf: C:/Users/Yida Lin/Documents/GitHub/libxdf/libxdf Directory Reference</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="navtree.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="resize.js"></script> +<script type="text/javascript" src="navtreedata.js"></script> +<script type="text/javascript" src="navtree.js"></script> +<script type="text/javascript"> + $(document).ready(initResizable); +</script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">libxdf +  <span id="projectnumber">0.92</span> + </div> + <div id="projectbrief">A static C++ library for loading XDF files</div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.12 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<div id="side-nav" class="ui-resizable side-nav-resizable"> + <div id="nav-tree"> + <div id="nav-tree-contents"> + <div id="nav-sync" class="sync"></div> + </div> + </div> + <div id="splitbar" style="-moz-user-select:none;" + class="ui-resizable-handle"> + </div> +</div> +<script type="text/javascript"> +$(document).ready(function(){initNavTree('dir_689ecbe789caf2e46799b15492db205c.html','');}); +</script> +<div id="doc-content"> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="header"> + <div class="headertitle"> +<div class="title">libxdf Directory Reference</div> </div> +</div><!--header--> +<div class="contents"> +<table class="memberdecls"> +<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="files"></a> +Files</h2></td></tr> +<tr class="memitem:xdf_8cpp"><td class="memItemLeft" align="right" valign="top">file  </td><td class="memItemRight" valign="bottom"><a class="el" href="xdf_8cpp.html">xdf.cpp</a></td></tr> +<tr class="separator:"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:xdf_8h"><td class="memItemLeft" align="right" valign="top">file  </td><td class="memItemRight" valign="bottom"><a class="el" href="xdf_8h.html">xdf.h</a> <a href="xdf_8h_source.html">[code]</a></td></tr> +<tr class="memdesc:xdf_8h"><td class="mdescLeft"> </td><td class="mdescRight">The header file of <a class="el" href="class_xdf.html">Xdf</a> class. <br /></td></tr> +<tr class="separator:"><td class="memSeparator" colspan="2"> </td></tr> +</table> +</div><!-- contents --> +</div><!-- doc-content --> +<!-- start footer part --> +<div id="nav-path" class="navpath"><!-- id is needed for treeview function! --> + <ul> + <li class="navelem"><a class="el" href="dir_f396504afdc959660871b003fa10164d.html">Documents</a></li><li class="navelem"><a class="el" href="dir_7e17ac9cf8fba2cb04bc248c85b0ceb7.html">GitHub</a></li><li class="navelem"><a class="el" href="dir_72e8b74943c3b26541b5ac1c7338ef6f.html">libxdf</a></li><li class="navelem"><a class="el" href="dir_689ecbe789caf2e46799b15492db205c.html">libxdf</a></li> + <li class="footer">Generated by + <a href="http://www.doxygen.org/index.html"> + <img class="footer" src="doxygen.png" alt="doxygen"/></a> 1.8.12 </li> + </ul> +</div> +</body> +</html> diff --git a/C++/docs/html/dir_689ecbe789caf2e46799b15492db205c.js b/C++/docs/html/dir_689ecbe789caf2e46799b15492db205c.js new file mode 100644 index 0000000..3568309 --- /dev/null +++ b/C++/docs/html/dir_689ecbe789caf2e46799b15492db205c.js @@ -0,0 +1,8 @@ +var dir_689ecbe789caf2e46799b15492db205c = +[ + [ "xdf.cpp", "xdf_8cpp.html", "xdf_8cpp" ], + [ "xdf.h", "xdf_8h.html", [ + [ "Xdf", "class_xdf.html", "class_xdf" ], + [ "Stream", "struct_xdf_1_1_stream.html", "struct_xdf_1_1_stream" ] + ] ] +]; \ No newline at end of file diff --git a/C++/docs/html/dir_72e8b74943c3b26541b5ac1c7338ef6f.html b/C++/docs/html/dir_72e8b74943c3b26541b5ac1c7338ef6f.html new file mode 100644 index 0000000..4dd6ab2 --- /dev/null +++ b/C++/docs/html/dir_72e8b74943c3b26541b5ac1c7338ef6f.html @@ -0,0 +1,106 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>libxdf: C:/Users/Yida Lin/Documents/GitHub/libxdf Directory Reference</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="navtree.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="resize.js"></script> +<script type="text/javascript" src="navtreedata.js"></script> +<script type="text/javascript" src="navtree.js"></script> +<script type="text/javascript"> + $(document).ready(initResizable); +</script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">libxdf +  <span id="projectnumber">0.92</span> + </div> + <div id="projectbrief">A static C++ library for loading XDF files</div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.12 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<div id="side-nav" class="ui-resizable side-nav-resizable"> + <div id="nav-tree"> + <div id="nav-tree-contents"> + <div id="nav-sync" class="sync"></div> + </div> + </div> + <div id="splitbar" style="-moz-user-select:none;" + class="ui-resizable-handle"> + </div> +</div> +<script type="text/javascript"> +$(document).ready(function(){initNavTree('dir_72e8b74943c3b26541b5ac1c7338ef6f.html','');}); +</script> +<div id="doc-content"> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="header"> + <div class="headertitle"> +<div class="title">libxdf Directory Reference</div> </div> +</div><!--header--> +<div class="contents"> +<table class="memberdecls"> +<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="subdirs"></a> +Directories</h2></td></tr> +<tr class="memitem:dir_689ecbe789caf2e46799b15492db205c"><td class="memItemLeft" align="right" valign="top">directory  </td><td class="memItemRight" valign="bottom"><a class="el" href="dir_689ecbe789caf2e46799b15492db205c.html">libxdf</a></td></tr> +<tr class="separator:"><td class="memSeparator" colspan="2"> </td></tr> +</table> +</div><!-- contents --> +</div><!-- doc-content --> +<!-- start footer part --> +<div id="nav-path" class="navpath"><!-- id is needed for treeview function! --> + <ul> + <li class="navelem"><a class="el" href="dir_f396504afdc959660871b003fa10164d.html">Documents</a></li><li class="navelem"><a class="el" href="dir_7e17ac9cf8fba2cb04bc248c85b0ceb7.html">GitHub</a></li><li class="navelem"><a class="el" href="dir_72e8b74943c3b26541b5ac1c7338ef6f.html">libxdf</a></li> + <li class="footer">Generated by + <a href="http://www.doxygen.org/index.html"> + <img class="footer" src="doxygen.png" alt="doxygen"/></a> 1.8.12 </li> + </ul> +</div> +</body> +</html> diff --git a/C++/docs/html/dir_72e8b74943c3b26541b5ac1c7338ef6f.js b/C++/docs/html/dir_72e8b74943c3b26541b5ac1c7338ef6f.js new file mode 100644 index 0000000..a4113c4 --- /dev/null +++ b/C++/docs/html/dir_72e8b74943c3b26541b5ac1c7338ef6f.js @@ -0,0 +1,4 @@ +var dir_72e8b74943c3b26541b5ac1c7338ef6f = +[ + [ "libxdf", "dir_689ecbe789caf2e46799b15492db205c.html", "dir_689ecbe789caf2e46799b15492db205c" ] +]; \ No newline at end of file diff --git a/C++/docs/html/dir_7e17ac9cf8fba2cb04bc248c85b0ceb7.html b/C++/docs/html/dir_7e17ac9cf8fba2cb04bc248c85b0ceb7.html new file mode 100644 index 0000000..c177221 --- /dev/null +++ b/C++/docs/html/dir_7e17ac9cf8fba2cb04bc248c85b0ceb7.html @@ -0,0 +1,106 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>libxdf: C:/Users/Yida Lin/Documents/GitHub Directory Reference</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="navtree.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="resize.js"></script> +<script type="text/javascript" src="navtreedata.js"></script> +<script type="text/javascript" src="navtree.js"></script> +<script type="text/javascript"> + $(document).ready(initResizable); +</script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">libxdf +  <span id="projectnumber">0.92</span> + </div> + <div id="projectbrief">A static C++ library for loading XDF files</div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.12 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<div id="side-nav" class="ui-resizable side-nav-resizable"> + <div id="nav-tree"> + <div id="nav-tree-contents"> + <div id="nav-sync" class="sync"></div> + </div> + </div> + <div id="splitbar" style="-moz-user-select:none;" + class="ui-resizable-handle"> + </div> +</div> +<script type="text/javascript"> +$(document).ready(function(){initNavTree('dir_7e17ac9cf8fba2cb04bc248c85b0ceb7.html','');}); +</script> +<div id="doc-content"> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="header"> + <div class="headertitle"> +<div class="title">GitHub Directory Reference</div> </div> +</div><!--header--> +<div class="contents"> +<table class="memberdecls"> +<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="subdirs"></a> +Directories</h2></td></tr> +<tr class="memitem:dir_72e8b74943c3b26541b5ac1c7338ef6f"><td class="memItemLeft" align="right" valign="top">directory  </td><td class="memItemRight" valign="bottom"><a class="el" href="dir_72e8b74943c3b26541b5ac1c7338ef6f.html">libxdf</a></td></tr> +<tr class="separator:"><td class="memSeparator" colspan="2"> </td></tr> +</table> +</div><!-- contents --> +</div><!-- doc-content --> +<!-- start footer part --> +<div id="nav-path" class="navpath"><!-- id is needed for treeview function! --> + <ul> + <li class="navelem"><a class="el" href="dir_f396504afdc959660871b003fa10164d.html">Documents</a></li><li class="navelem"><a class="el" href="dir_7e17ac9cf8fba2cb04bc248c85b0ceb7.html">GitHub</a></li> + <li class="footer">Generated by + <a href="http://www.doxygen.org/index.html"> + <img class="footer" src="doxygen.png" alt="doxygen"/></a> 1.8.12 </li> + </ul> +</div> +</body> +</html> diff --git a/C++/docs/html/dir_7e17ac9cf8fba2cb04bc248c85b0ceb7.js b/C++/docs/html/dir_7e17ac9cf8fba2cb04bc248c85b0ceb7.js new file mode 100644 index 0000000..638e409 --- /dev/null +++ b/C++/docs/html/dir_7e17ac9cf8fba2cb04bc248c85b0ceb7.js @@ -0,0 +1,4 @@ +var dir_7e17ac9cf8fba2cb04bc248c85b0ceb7 = +[ + [ "libxdf", "dir_72e8b74943c3b26541b5ac1c7338ef6f.html", "dir_72e8b74943c3b26541b5ac1c7338ef6f" ] +]; \ No newline at end of file diff --git a/C++/docs/html/dir_f396504afdc959660871b003fa10164d.html b/C++/docs/html/dir_f396504afdc959660871b003fa10164d.html new file mode 100644 index 0000000..764c1dd --- /dev/null +++ b/C++/docs/html/dir_f396504afdc959660871b003fa10164d.html @@ -0,0 +1,106 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>libxdf: C:/Users/Yida Lin/Documents Directory Reference</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="navtree.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="resize.js"></script> +<script type="text/javascript" src="navtreedata.js"></script> +<script type="text/javascript" src="navtree.js"></script> +<script type="text/javascript"> + $(document).ready(initResizable); +</script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">libxdf +  <span id="projectnumber">0.92</span> + </div> + <div id="projectbrief">A static C++ library for loading XDF files</div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.12 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<div id="side-nav" class="ui-resizable side-nav-resizable"> + <div id="nav-tree"> + <div id="nav-tree-contents"> + <div id="nav-sync" class="sync"></div> + </div> + </div> + <div id="splitbar" style="-moz-user-select:none;" + class="ui-resizable-handle"> + </div> +</div> +<script type="text/javascript"> +$(document).ready(function(){initNavTree('dir_f396504afdc959660871b003fa10164d.html','');}); +</script> +<div id="doc-content"> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="header"> + <div class="headertitle"> +<div class="title">Documents Directory Reference</div> </div> +</div><!--header--> +<div class="contents"> +<table class="memberdecls"> +<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="subdirs"></a> +Directories</h2></td></tr> +<tr class="memitem:dir_7e17ac9cf8fba2cb04bc248c85b0ceb7"><td class="memItemLeft" align="right" valign="top">directory  </td><td class="memItemRight" valign="bottom"><a class="el" href="dir_7e17ac9cf8fba2cb04bc248c85b0ceb7.html">GitHub</a></td></tr> +<tr class="separator:"><td class="memSeparator" colspan="2"> </td></tr> +</table> +</div><!-- contents --> +</div><!-- doc-content --> +<!-- start footer part --> +<div id="nav-path" class="navpath"><!-- id is needed for treeview function! --> + <ul> + <li class="navelem"><a class="el" href="dir_f396504afdc959660871b003fa10164d.html">Documents</a></li> + <li class="footer">Generated by + <a href="http://www.doxygen.org/index.html"> + <img class="footer" src="doxygen.png" alt="doxygen"/></a> 1.8.12 </li> + </ul> +</div> +</body> +</html> diff --git a/C++/docs/html/dir_f396504afdc959660871b003fa10164d.js b/C++/docs/html/dir_f396504afdc959660871b003fa10164d.js new file mode 100644 index 0000000..47f5072 --- /dev/null +++ b/C++/docs/html/dir_f396504afdc959660871b003fa10164d.js @@ -0,0 +1,4 @@ +var dir_f396504afdc959660871b003fa10164d = +[ + [ "GitHub", "dir_7e17ac9cf8fba2cb04bc248c85b0ceb7.html", "dir_7e17ac9cf8fba2cb04bc248c85b0ceb7" ] +]; \ No newline at end of file diff --git a/C++/docs/html/doc.png b/C++/docs/html/doc.png new file mode 100644 index 0000000000000000000000000000000000000000..17edabff95f7b8da13c9516a04efe05493c29501 GIT binary patch literal 746 zcmV<G0u}v<P)<h;3K|Lk000e1NJLTq000;O000&U1^@s6+I?Jz00089Nkl<ZcmeI5 zO;1x>7=@pnbNXRFEm&G8P!&WHG=d)>K?YZ1bzou)2{$))<VZ%w8AHp|fq%mP;4ffy zZ-fC6h(S;T@^On$pg;?)``rZ-=s7qr4DR5hE4!!NdDmX=TJJeiSGimUI5QXkXNfZ> zumDct!>4SyxL;zgaG>wy`^Hv*+}0kUfCrz~BCOViSb$_*&;{TGGn2^x9K*!Sf0=lV zpP=7O;GA0*Jm*tTYj$IoXvimpnV4S1Z5f$p*f$Db2iq2zrVGQUz~yq`ahn7ck(|CE z7Gz;%OP~J6)tEZWDzjhL9h2hdfoU2)Nd%T<5Kt;Y0XLt&<@6pQx!n<GayH9yHg8K} z>w*5`@bq#?l*?3z{Hlzoc=Pr>oB5(9i6~_&-}A(4{Q$>c>%rV&E|a(r&;?i5cQB=} zYSDU5nXG)NS4HEs0it2AHe2>shCyr7`6@4*6{r@8fXR<pt)Tx_l7FX`b+T&0J~3Ac zDisC2f48s?Pz6U1j(Y#7FGXj244=p1VQ-4TfmZrD8|c58q%jdB67*815?3si0IJ}q zK#I#XHom~r+!`&75xy*K>bTA?=IFVWAQJL&H5H{)DpM#{W(GL+Idzf^)uRV@oB8u$ z8v{MfJbTiiRg4bza<41N<zz(9MkMF~u!W-n>Azrl{=3fl_D+$t+^!xlQ8S}{UtY`e z;;&9UhyZqQRN%2pot{*Ei0*4~hSF_3AH2@fKU!$NSflS>{@tZpDT4`M2WRTTVH+D? z)GFlEGGHe?koB}i|1w45!BF}N_q&^HJ&-tyR{(afC6H7|aml|tBBbv}55C5DNP8p3 z)~jLEO4Z&2hZmP^i-e%(@d!(E|KRafiU8Q5u(wU((j8un3<FfbmLT1ma;4wB2Ka6K c|6iFu0IFBSu=gW%4*&oF07*qoM6N<$f>OR*Hvj+t literal 0 HcmV?d00001 diff --git a/C++/docs/html/doxygen.css b/C++/docs/html/doxygen.css new file mode 100644 index 0000000..a2cf15f --- /dev/null +++ b/C++/docs/html/doxygen.css @@ -0,0 +1,1508 @@ +/* The standard CSS for doxygen 1.8.12 */ + +body, table, div, p, dl { + font: 400 14px/22px Roboto,sans-serif; +} + +/* @group Heading Levels */ + +h1.groupheader { + font-size: 150%; +} + +.title { + font: 400 14px/28px Roboto,sans-serif; + font-size: 150%; + font-weight: bold; + margin: 10px 2px; +} + +h2.groupheader { + border-bottom: 1px solid #879ECB; + color: #354C7B; + font-size: 150%; + font-weight: normal; + margin-top: 1.75em; + padding-top: 8px; + padding-bottom: 4px; + width: 100%; +} + +h3.groupheader { + font-size: 100%; +} + +h1, h2, h3, h4, h5, h6 { + -webkit-transition: text-shadow 0.5s linear; + -moz-transition: text-shadow 0.5s linear; + -ms-transition: text-shadow 0.5s linear; + -o-transition: text-shadow 0.5s linear; + transition: text-shadow 0.5s linear; + margin-right: 15px; +} + +h1.glow, h2.glow, h3.glow, h4.glow, h5.glow, h6.glow { + text-shadow: 0 0 15px cyan; +} + +dt { + font-weight: bold; +} + +div.multicol { + -moz-column-gap: 1em; + -webkit-column-gap: 1em; + -moz-column-count: 3; + -webkit-column-count: 3; +} + +p.startli, p.startdd { + margin-top: 2px; +} + +p.starttd { + margin-top: 0px; +} + +p.endli { + margin-bottom: 0px; +} + +p.enddd { + margin-bottom: 4px; +} + +p.endtd { + margin-bottom: 2px; +} + +/* @end */ + +caption { + font-weight: bold; +} + +span.legend { + font-size: 70%; + text-align: center; +} + +h3.version { + font-size: 90%; + text-align: center; +} + +div.qindex, div.navtab{ + background-color: #EBEFF6; + border: 1px solid #A3B4D7; + text-align: center; +} + +div.qindex, div.navpath { + width: 100%; + line-height: 140%; +} + +div.navtab { + margin-right: 15px; +} + +/* @group Link Styling */ + +a { + color: #3D578C; + font-weight: normal; + text-decoration: none; +} + +.contents a:visited { + color: #4665A2; +} + +a:hover { + text-decoration: underline; +} + +a.qindex { + font-weight: bold; +} + +a.qindexHL { + font-weight: bold; + background-color: #9CAFD4; + color: #ffffff; + border: 1px double #869DCA; +} + +.contents a.qindexHL:visited { + color: #ffffff; +} + +a.el { + font-weight: bold; +} + +a.elRef { +} + +a.code, a.code:visited, a.line, a.line:visited { + color: #4665A2; +} + +a.codeRef, a.codeRef:visited, a.lineRef, a.lineRef:visited { + color: #4665A2; +} + +/* @end */ + +dl.el { + margin-left: -1cm; +} + +pre.fragment { + border: 1px solid #C4CFE5; + background-color: #FBFCFD; + padding: 4px 6px; + margin: 4px 8px 4px 2px; + overflow: auto; + word-wrap: break-word; + font-size: 9pt; + line-height: 125%; + font-family: monospace, fixed; + font-size: 105%; +} + +div.fragment { + padding: 0px; + margin: 4px 8px 4px 2px; + background-color: #FBFCFD; + border: 1px solid #C4CFE5; +} + +div.line { + font-family: monospace, fixed; + font-size: 13px; + min-height: 13px; + line-height: 1.0; + text-wrap: unrestricted; + white-space: -moz-pre-wrap; /* Moz */ + white-space: -pre-wrap; /* Opera 4-6 */ + white-space: -o-pre-wrap; /* Opera 7 */ + white-space: pre-wrap; /* CSS3 */ + word-wrap: break-word; /* IE 5.5+ */ + text-indent: -53px; + padding-left: 53px; + padding-bottom: 0px; + margin: 0px; + -webkit-transition-property: background-color, box-shadow; + -webkit-transition-duration: 0.5s; + -moz-transition-property: background-color, box-shadow; + -moz-transition-duration: 0.5s; + -ms-transition-property: background-color, box-shadow; + -ms-transition-duration: 0.5s; + -o-transition-property: background-color, box-shadow; + -o-transition-duration: 0.5s; + transition-property: background-color, box-shadow; + transition-duration: 0.5s; +} + +div.line:after { + content:"\000A"; + white-space: pre; +} + +div.line.glow { + background-color: cyan; + box-shadow: 0 0 10px cyan; +} + + +span.lineno { + padding-right: 4px; + text-align: right; + border-right: 2px solid #0F0; + background-color: #E8E8E8; + white-space: pre; +} +span.lineno a { + background-color: #D8D8D8; +} + +span.lineno a:hover { + background-color: #C8C8C8; +} + +.lineno { + -webkit-touch-callout: none; + -webkit-user-select: none; + -khtml-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +div.ah, span.ah { + background-color: black; + font-weight: bold; + color: #ffffff; + margin-bottom: 3px; + margin-top: 3px; + padding: 0.2em; + border: solid thin #333; + border-radius: 0.5em; + -webkit-border-radius: .5em; + -moz-border-radius: .5em; + box-shadow: 2px 2px 3px #999; + -webkit-box-shadow: 2px 2px 3px #999; + -moz-box-shadow: rgba(0, 0, 0, 0.15) 2px 2px 2px; + background-image: -webkit-gradient(linear, left top, left bottom, from(#eee), to(#000),color-stop(0.3, #444)); + background-image: -moz-linear-gradient(center top, #eee 0%, #444 40%, #000 110%); +} + +div.classindex ul { + list-style: none; + padding-left: 0; +} + +div.classindex span.ai { + display: inline-block; +} + +div.groupHeader { + margin-left: 16px; + margin-top: 12px; + font-weight: bold; +} + +div.groupText { + margin-left: 16px; + font-style: italic; +} + +body { + background-color: white; + color: black; + margin: 0; +} + +div.contents { + margin-top: 10px; + margin-left: 12px; + margin-right: 8px; +} + +td.indexkey { + background-color: #EBEFF6; + font-weight: bold; + border: 1px solid #C4CFE5; + margin: 2px 0px 2px 0; + padding: 2px 10px; + white-space: nowrap; + vertical-align: top; +} + +td.indexvalue { + background-color: #EBEFF6; + border: 1px solid #C4CFE5; + padding: 2px 10px; + margin: 2px 0px; +} + +tr.memlist { + background-color: #EEF1F7; +} + +p.formulaDsp { + text-align: center; +} + +img.formulaDsp { + +} + +img.formulaInl { + vertical-align: middle; +} + +div.center { + text-align: center; + margin-top: 0px; + margin-bottom: 0px; + padding: 0px; +} + +div.center img { + border: 0px; +} + +address.footer { + text-align: right; + padding-right: 12px; +} + +img.footer { + border: 0px; + vertical-align: middle; +} + +/* @group Code Colorization */ + +span.keyword { + color: #008000 +} + +span.keywordtype { + color: #604020 +} + +span.keywordflow { + color: #e08000 +} + +span.comment { + color: #800000 +} + +span.preprocessor { + color: #806020 +} + +span.stringliteral { + color: #002080 +} + +span.charliteral { + color: #008080 +} + +span.vhdldigit { + color: #ff00ff +} + +span.vhdlchar { + color: #000000 +} + +span.vhdlkeyword { + color: #700070 +} + +span.vhdllogic { + color: #ff0000 +} + +blockquote { + background-color: #F7F8FB; + border-left: 2px solid #9CAFD4; + margin: 0 24px 0 4px; + padding: 0 12px 0 16px; +} + +/* @end */ + +/* +.search { + color: #003399; + font-weight: bold; +} + +form.search { + margin-bottom: 0px; + margin-top: 0px; +} + +input.search { + font-size: 75%; + color: #000080; + font-weight: normal; + background-color: #e8eef2; +} +*/ + +td.tiny { + font-size: 75%; +} + +.dirtab { + padding: 4px; + border-collapse: collapse; + border: 1px solid #A3B4D7; +} + +th.dirtab { + background: #EBEFF6; + font-weight: bold; +} + +hr { + height: 0px; + border: none; + border-top: 1px solid #4A6AAA; +} + +hr.footer { + height: 1px; +} + +/* @group Member Descriptions */ + +table.memberdecls { + border-spacing: 0px; + padding: 0px; +} + +.memberdecls td, .fieldtable tr { + -webkit-transition-property: background-color, box-shadow; + -webkit-transition-duration: 0.5s; + -moz-transition-property: background-color, box-shadow; + -moz-transition-duration: 0.5s; + -ms-transition-property: background-color, box-shadow; + -ms-transition-duration: 0.5s; + -o-transition-property: background-color, box-shadow; + -o-transition-duration: 0.5s; + transition-property: background-color, box-shadow; + transition-duration: 0.5s; +} + +.memberdecls td.glow, .fieldtable tr.glow { + background-color: cyan; + box-shadow: 0 0 15px cyan; +} + +.mdescLeft, .mdescRight, +.memItemLeft, .memItemRight, +.memTemplItemLeft, .memTemplItemRight, .memTemplParams { + background-color: #F9FAFC; + border: none; + margin: 4px; + padding: 1px 0 0 8px; +} + +.mdescLeft, .mdescRight { + padding: 0px 8px 4px 8px; + color: #555; +} + +.memSeparator { + border-bottom: 1px solid #DEE4F0; + line-height: 1px; + margin: 0px; + padding: 0px; +} + +.memItemLeft, .memTemplItemLeft { + white-space: nowrap; +} + +.memItemRight { + width: 100%; +} + +.memTemplParams { + color: #4665A2; + white-space: nowrap; + font-size: 80%; +} + +/* @end */ + +/* @group Member Details */ + +/* Styles for detailed member documentation */ + +.memtitle { + padding: 8px; + border-top: 1px solid #A8B8D9; + border-left: 1px solid #A8B8D9; + border-right: 1px solid #A8B8D9; + border-top-right-radius: 4px; + border-top-left-radius: 4px; + margin-bottom: -1px; + background-image: url('nav_f.png'); + background-repeat: repeat-x; + background-color: #E2E8F2; + line-height: 1.25; + font-weight: 300; + float:left; +} + +.permalink +{ + font-size: 65%; + display: inline-block; + vertical-align: middle; +} + +.memtemplate { + font-size: 80%; + color: #4665A2; + font-weight: normal; + margin-left: 9px; +} + +.memnav { + background-color: #EBEFF6; + border: 1px solid #A3B4D7; + text-align: center; + margin: 2px; + margin-right: 15px; + padding: 2px; +} + +.mempage { + width: 100%; +} + +.memitem { + padding: 0; + margin-bottom: 10px; + margin-right: 5px; + -webkit-transition: box-shadow 0.5s linear; + -moz-transition: box-shadow 0.5s linear; + -ms-transition: box-shadow 0.5s linear; + -o-transition: box-shadow 0.5s linear; + transition: box-shadow 0.5s linear; + display: table !important; + width: 100%; +} + +.memitem.glow { + box-shadow: 0 0 15px cyan; +} + +.memname { + font-weight: 400; + margin-left: 6px; +} + +.memname td { + vertical-align: bottom; +} + +.memproto, dl.reflist dt { + border-top: 1px solid #A8B8D9; + border-left: 1px solid #A8B8D9; + border-right: 1px solid #A8B8D9; + padding: 6px 0px 6px 0px; + color: #253555; + font-weight: bold; + text-shadow: 0px 1px 1px rgba(255, 255, 255, 0.9); + background-color: #DFE5F1; + /* opera specific markup */ + box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15); + border-top-right-radius: 4px; + /* firefox specific markup */ + -moz-box-shadow: rgba(0, 0, 0, 0.15) 5px 5px 5px; + -moz-border-radius-topright: 4px; + /* webkit specific markup */ + -webkit-box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15); + -webkit-border-top-right-radius: 4px; + +} + +.overload { + font-family: "courier new",courier,monospace; + font-size: 65%; +} + +.memdoc, dl.reflist dd { + border-bottom: 1px solid #A8B8D9; + border-left: 1px solid #A8B8D9; + border-right: 1px solid #A8B8D9; + padding: 6px 10px 2px 10px; + background-color: #FBFCFD; + border-top-width: 0; + background-image:url('nav_g.png'); + background-repeat:repeat-x; + background-color: #FFFFFF; + /* opera specific markup */ + border-bottom-left-radius: 4px; + border-bottom-right-radius: 4px; + box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15); + /* firefox specific markup */ + -moz-border-radius-bottomleft: 4px; + -moz-border-radius-bottomright: 4px; + -moz-box-shadow: rgba(0, 0, 0, 0.15) 5px 5px 5px; + /* webkit specific markup */ + -webkit-border-bottom-left-radius: 4px; + -webkit-border-bottom-right-radius: 4px; + -webkit-box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15); +} + +dl.reflist dt { + padding: 5px; +} + +dl.reflist dd { + margin: 0px 0px 10px 0px; + padding: 5px; +} + +.paramkey { + text-align: right; +} + +.paramtype { + white-space: nowrap; +} + +.paramname { + color: #602020; + white-space: nowrap; +} +.paramname em { + font-style: normal; +} +.paramname code { + line-height: 14px; +} + +.params, .retval, .exception, .tparams { + margin-left: 0px; + padding-left: 0px; +} + +.params .paramname, .retval .paramname { + font-weight: bold; + vertical-align: top; +} + +.params .paramtype { + font-style: italic; + vertical-align: top; +} + +.params .paramdir { + font-family: "courier new",courier,monospace; + vertical-align: top; +} + +table.mlabels { + border-spacing: 0px; +} + +td.mlabels-left { + width: 100%; + padding: 0px; +} + +td.mlabels-right { + vertical-align: bottom; + padding: 0px; + white-space: nowrap; +} + +span.mlabels { + margin-left: 8px; +} + +span.mlabel { + background-color: #728DC1; + border-top:1px solid #5373B4; + border-left:1px solid #5373B4; + border-right:1px solid #C4CFE5; + border-bottom:1px solid #C4CFE5; + text-shadow: none; + color: white; + margin-right: 4px; + padding: 2px 3px; + border-radius: 3px; + font-size: 7pt; + white-space: nowrap; + vertical-align: middle; +} + + + +/* @end */ + +/* these are for tree view inside a (index) page */ + +div.directory { + margin: 10px 0px; + border-top: 1px solid #9CAFD4; + border-bottom: 1px solid #9CAFD4; + width: 100%; +} + +.directory table { + border-collapse:collapse; +} + +.directory td { + margin: 0px; + padding: 0px; + vertical-align: top; +} + +.directory td.entry { + white-space: nowrap; + padding-right: 6px; + padding-top: 3px; +} + +.directory td.entry a { + outline:none; +} + +.directory td.entry a img { + border: none; +} + +.directory td.desc { + width: 100%; + padding-left: 6px; + padding-right: 6px; + padding-top: 3px; + border-left: 1px solid rgba(0,0,0,0.05); +} + +.directory tr.even { + padding-left: 6px; + background-color: #F7F8FB; +} + +.directory img { + vertical-align: -30%; +} + +.directory .levels { + white-space: nowrap; + width: 100%; + text-align: right; + font-size: 9pt; +} + +.directory .levels span { + cursor: pointer; + padding-left: 2px; + padding-right: 2px; + color: #3D578C; +} + +.arrow { + color: #9CAFD4; + -webkit-user-select: none; + -khtml-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + cursor: pointer; + font-size: 80%; + display: inline-block; + width: 16px; + height: 22px; +} + +.icon { + font-family: Arial, Helvetica; + font-weight: bold; + font-size: 12px; + height: 14px; + width: 16px; + display: inline-block; + background-color: #728DC1; + color: white; + text-align: center; + border-radius: 4px; + margin-left: 2px; + margin-right: 2px; +} + +.icona { + width: 24px; + height: 22px; + display: inline-block; +} + +.iconfopen { + width: 24px; + height: 18px; + margin-bottom: 4px; + background-image:url('folderopen.png'); + background-position: 0px -4px; + background-repeat: repeat-y; + vertical-align:top; + display: inline-block; +} + +.iconfclosed { + width: 24px; + height: 18px; + margin-bottom: 4px; + background-image:url('folderclosed.png'); + background-position: 0px -4px; + background-repeat: repeat-y; + vertical-align:top; + display: inline-block; +} + +.icondoc { + width: 24px; + height: 18px; + margin-bottom: 4px; + background-image:url('doc.png'); + background-position: 0px -4px; + background-repeat: repeat-y; + vertical-align:top; + display: inline-block; +} + +table.directory { + font: 400 14px Roboto,sans-serif; +} + +/* @end */ + +div.dynheader { + margin-top: 8px; + -webkit-touch-callout: none; + -webkit-user-select: none; + -khtml-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +address { + font-style: normal; + color: #2A3D61; +} + +table.doxtable caption { + caption-side: top; +} + +table.doxtable { + border-collapse:collapse; + margin-top: 4px; + margin-bottom: 4px; +} + +table.doxtable td, table.doxtable th { + border: 1px solid #2D4068; + padding: 3px 7px 2px; +} + +table.doxtable th { + background-color: #374F7F; + color: #FFFFFF; + font-size: 110%; + padding-bottom: 4px; + padding-top: 5px; +} + +table.fieldtable { + /*width: 100%;*/ + margin-bottom: 10px; + border: 1px solid #A8B8D9; + border-spacing: 0px; + -moz-border-radius: 4px; + -webkit-border-radius: 4px; + border-radius: 4px; + -moz-box-shadow: rgba(0, 0, 0, 0.15) 2px 2px 2px; + -webkit-box-shadow: 2px 2px 2px rgba(0, 0, 0, 0.15); + box-shadow: 2px 2px 2px rgba(0, 0, 0, 0.15); +} + +.fieldtable td, .fieldtable th { + padding: 3px 7px 2px; +} + +.fieldtable td.fieldtype, .fieldtable td.fieldname { + white-space: nowrap; + border-right: 1px solid #A8B8D9; + border-bottom: 1px solid #A8B8D9; + vertical-align: top; +} + +.fieldtable td.fieldname { + padding-top: 3px; +} + +.fieldtable td.fielddoc { + border-bottom: 1px solid #A8B8D9; + /*width: 100%;*/ +} + +.fieldtable td.fielddoc p:first-child { + margin-top: 0px; +} + +.fieldtable td.fielddoc p:last-child { + margin-bottom: 2px; +} + +.fieldtable tr:last-child td { + border-bottom: none; +} + +.fieldtable th { + background-image:url('nav_f.png'); + background-repeat:repeat-x; + background-color: #E2E8F2; + font-size: 90%; + color: #253555; + padding-bottom: 4px; + padding-top: 5px; + text-align:left; + font-weight: 400; + -moz-border-radius-topleft: 4px; + -moz-border-radius-topright: 4px; + -webkit-border-top-left-radius: 4px; + -webkit-border-top-right-radius: 4px; + border-top-left-radius: 4px; + border-top-right-radius: 4px; + border-bottom: 1px solid #A8B8D9; +} + + +.tabsearch { + top: 0px; + left: 10px; + height: 36px; + background-image: url('tab_b.png'); + z-index: 101; + overflow: hidden; + font-size: 13px; +} + +.navpath ul +{ + font-size: 11px; + background-image:url('tab_b.png'); + background-repeat:repeat-x; + background-position: 0 -5px; + height:30px; + line-height:30px; + color:#8AA0CC; + border:solid 1px #C2CDE4; + overflow:hidden; + margin:0px; + padding:0px; +} + +.navpath li +{ + list-style-type:none; + float:left; + padding-left:10px; + padding-right:15px; + background-image:url('bc_s.png'); + background-repeat:no-repeat; + background-position:right; + color:#364D7C; +} + +.navpath li.navelem a +{ + height:32px; + display:block; + text-decoration: none; + outline: none; + color: #283A5D; + font-family: 'Lucida Grande',Geneva,Helvetica,Arial,sans-serif; + text-shadow: 0px 1px 1px rgba(255, 255, 255, 0.9); + text-decoration: none; +} + +.navpath li.navelem a:hover +{ + color:#6884BD; +} + +.navpath li.footer +{ + list-style-type:none; + float:right; + padding-left:10px; + padding-right:15px; + background-image:none; + background-repeat:no-repeat; + background-position:right; + color:#364D7C; + font-size: 8pt; +} + + +div.summary +{ + float: right; + font-size: 8pt; + padding-right: 5px; + width: 50%; + text-align: right; +} + +div.summary a +{ + white-space: nowrap; +} + +table.classindex +{ + margin: 10px; + white-space: nowrap; + margin-left: 3%; + margin-right: 3%; + width: 94%; + border: 0; + border-spacing: 0; + padding: 0; +} + +div.ingroups +{ + font-size: 8pt; + width: 50%; + text-align: left; +} + +div.ingroups a +{ + white-space: nowrap; +} + +div.header +{ + background-image:url('nav_h.png'); + background-repeat:repeat-x; + background-color: #F9FAFC; + margin: 0px; + border-bottom: 1px solid #C4CFE5; +} + +div.headertitle +{ + padding: 5px 5px 5px 10px; +} + +dl +{ + padding: 0 0 0 10px; +} + +/* dl.note, dl.warning, dl.attention, dl.pre, dl.post, dl.invariant, dl.deprecated, dl.todo, dl.test, dl.bug */ +dl.section +{ + margin-left: 0px; + padding-left: 0px; +} + +dl.note +{ + margin-left:-7px; + padding-left: 3px; + border-left:4px solid; + border-color: #D0C000; +} + +dl.warning, dl.attention +{ + margin-left:-7px; + padding-left: 3px; + border-left:4px solid; + border-color: #FF0000; +} + +dl.pre, dl.post, dl.invariant +{ + margin-left:-7px; + padding-left: 3px; + border-left:4px solid; + border-color: #00D000; +} + +dl.deprecated +{ + margin-left:-7px; + padding-left: 3px; + border-left:4px solid; + border-color: #505050; +} + +dl.todo +{ + margin-left:-7px; + padding-left: 3px; + border-left:4px solid; + border-color: #00C0E0; +} + +dl.test +{ + margin-left:-7px; + padding-left: 3px; + border-left:4px solid; + border-color: #3030E0; +} + +dl.bug +{ + margin-left:-7px; + padding-left: 3px; + border-left:4px solid; + border-color: #C08050; +} + +dl.section dd { + margin-bottom: 6px; +} + + +#projectlogo +{ + text-align: center; + vertical-align: bottom; + border-collapse: separate; +} + +#projectlogo img +{ + border: 0px none; +} + +#projectalign +{ + vertical-align: middle; +} + +#projectname +{ + font: 300% Tahoma, Arial,sans-serif; + margin: 0px; + padding: 2px 0px; +} + +#projectbrief +{ + font: 120% Tahoma, Arial,sans-serif; + margin: 0px; + padding: 0px; +} + +#projectnumber +{ + font: 50% Tahoma, Arial,sans-serif; + margin: 0px; + padding: 0px; +} + +#titlearea +{ + padding: 0px; + margin: 0px; + width: 100%; + border-bottom: 1px solid #5373B4; +} + +.image +{ + text-align: center; +} + +.dotgraph +{ + text-align: center; +} + +.mscgraph +{ + text-align: center; +} + +.diagraph +{ + text-align: center; +} + +.caption +{ + font-weight: bold; +} + +div.zoom +{ + border: 1px solid #90A5CE; +} + +dl.citelist { + margin-bottom:50px; +} + +dl.citelist dt { + color:#334975; + float:left; + font-weight:bold; + margin-right:10px; + padding:5px; +} + +dl.citelist dd { + margin:2px 0; + padding:5px 0; +} + +div.toc { + padding: 14px 25px; + background-color: #F4F6FA; + border: 1px solid #D8DFEE; + border-radius: 7px 7px 7px 7px; + float: right; + height: auto; + margin: 0 8px 10px 10px; + width: 200px; +} + +div.toc li { + background: url("bdwn.png") no-repeat scroll 0 5px transparent; + font: 10px/1.2 Verdana,DejaVu Sans,Geneva,sans-serif; + margin-top: 5px; + padding-left: 10px; + padding-top: 2px; +} + +div.toc h3 { + font: bold 12px/1.2 Arial,FreeSans,sans-serif; + color: #4665A2; + border-bottom: 0 none; + margin: 0; +} + +div.toc ul { + list-style: none outside none; + border: medium none; + padding: 0px; +} + +div.toc li.level1 { + margin-left: 0px; +} + +div.toc li.level2 { + margin-left: 15px; +} + +div.toc li.level3 { + margin-left: 30px; +} + +div.toc li.level4 { + margin-left: 45px; +} + +.inherit_header { + font-weight: bold; + color: gray; + cursor: pointer; + -webkit-touch-callout: none; + -webkit-user-select: none; + -khtml-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.inherit_header td { + padding: 6px 0px 2px 5px; +} + +.inherit { + display: none; +} + +tr.heading h2 { + margin-top: 12px; + margin-bottom: 4px; +} + +/* tooltip related style info */ + +.ttc { + position: absolute; + display: none; +} + +#powerTip { + cursor: default; + white-space: nowrap; + background-color: white; + border: 1px solid gray; + border-radius: 4px 4px 4px 4px; + box-shadow: 1px 1px 7px gray; + display: none; + font-size: smaller; + max-width: 80%; + opacity: 0.9; + padding: 1ex 1em 1em; + position: absolute; + z-index: 2147483647; +} + +#powerTip div.ttdoc { + color: grey; + font-style: italic; +} + +#powerTip div.ttname a { + font-weight: bold; +} + +#powerTip div.ttname { + font-weight: bold; +} + +#powerTip div.ttdeci { + color: #006318; +} + +#powerTip div { + margin: 0px; + padding: 0px; + font: 12px/16px Roboto,sans-serif; +} + +#powerTip:before, #powerTip:after { + content: ""; + position: absolute; + margin: 0px; +} + +#powerTip.n:after, #powerTip.n:before, +#powerTip.s:after, #powerTip.s:before, +#powerTip.w:after, #powerTip.w:before, +#powerTip.e:after, #powerTip.e:before, +#powerTip.ne:after, #powerTip.ne:before, +#powerTip.se:after, #powerTip.se:before, +#powerTip.nw:after, #powerTip.nw:before, +#powerTip.sw:after, #powerTip.sw:before { + border: solid transparent; + content: " "; + height: 0; + width: 0; + position: absolute; +} + +#powerTip.n:after, #powerTip.s:after, +#powerTip.w:after, #powerTip.e:after, +#powerTip.nw:after, #powerTip.ne:after, +#powerTip.sw:after, #powerTip.se:after { + border-color: rgba(255, 255, 255, 0); +} + +#powerTip.n:before, #powerTip.s:before, +#powerTip.w:before, #powerTip.e:before, +#powerTip.nw:before, #powerTip.ne:before, +#powerTip.sw:before, #powerTip.se:before { + border-color: rgba(128, 128, 128, 0); +} + +#powerTip.n:after, #powerTip.n:before, +#powerTip.ne:after, #powerTip.ne:before, +#powerTip.nw:after, #powerTip.nw:before { + top: 100%; +} + +#powerTip.n:after, #powerTip.ne:after, #powerTip.nw:after { + border-top-color: #ffffff; + border-width: 10px; + margin: 0px -10px; +} +#powerTip.n:before { + border-top-color: #808080; + border-width: 11px; + margin: 0px -11px; +} +#powerTip.n:after, #powerTip.n:before { + left: 50%; +} + +#powerTip.nw:after, #powerTip.nw:before { + right: 14px; +} + +#powerTip.ne:after, #powerTip.ne:before { + left: 14px; +} + +#powerTip.s:after, #powerTip.s:before, +#powerTip.se:after, #powerTip.se:before, +#powerTip.sw:after, #powerTip.sw:before { + bottom: 100%; +} + +#powerTip.s:after, #powerTip.se:after, #powerTip.sw:after { + border-bottom-color: #ffffff; + border-width: 10px; + margin: 0px -10px; +} + +#powerTip.s:before, #powerTip.se:before, #powerTip.sw:before { + border-bottom-color: #808080; + border-width: 11px; + margin: 0px -11px; +} + +#powerTip.s:after, #powerTip.s:before { + left: 50%; +} + +#powerTip.sw:after, #powerTip.sw:before { + right: 14px; +} + +#powerTip.se:after, #powerTip.se:before { + left: 14px; +} + +#powerTip.e:after, #powerTip.e:before { + left: 100%; +} +#powerTip.e:after { + border-left-color: #ffffff; + border-width: 10px; + top: 50%; + margin-top: -10px; +} +#powerTip.e:before { + border-left-color: #808080; + border-width: 11px; + top: 50%; + margin-top: -11px; +} + +#powerTip.w:after, #powerTip.w:before { + right: 100%; +} +#powerTip.w:after { + border-right-color: #ffffff; + border-width: 10px; + top: 50%; + margin-top: -10px; +} +#powerTip.w:before { + border-right-color: #808080; + border-width: 11px; + top: 50%; + margin-top: -11px; +} + +@media print +{ + #top { display: none; } + #side-nav { display: none; } + #nav-path { display: none; } + body { overflow:visible; } + h1, h2, h3, h4, h5, h6 { page-break-after: avoid; } + .summary { display: none; } + .memitem { page-break-inside: avoid; } + #doc-content + { + margin-left:0 !important; + height:auto !important; + width:auto !important; + overflow:inherit; + display:inline; + } +} + diff --git a/C++/docs/html/doxygen.png b/C++/docs/html/doxygen.png new file mode 100644 index 0000000000000000000000000000000000000000..3ff17d807fd8aa003bed8bb2a69e8f0909592fd1 GIT binary patch literal 3779 zcmV;!4m|ORP)<h;3K|Lk000e1NJLTq003wJ0018d1^@s63p<F|000h(Nkl<ZcmeHQ zd0ds%x_&e@B~(leQIt>tMIv#Q0*~7<F|l1ZVT5-RDygU_D&hbl1PO?G!02E&AgGC= zZN)5-^5BGUBqbS?oI>*`IBSO7_x;@a8#Zk6_PeKR_s92J&)(m+);m9Iz3blw)z#Gi zP!9lj4$%+*>Hz@HCmM9L9|8c+0u=!H$O3?R0Kgx|#WP<6fKfC8fM-CQZT|_r@`>VO zX^Hgb|9cJqpdJA5$MCEK`F_2@2Y@s>^+;pF`~jdI0Pvr|vl4`=C)EH@1IFe7pdJ8F zH(qGi004~QnF)Ggga~8v08kGAs2hKTATxr7pwfNk|4#_AaT>w8P6TV+R2kbS$v==} zAjf`s0g#V8lB+b3)5oEI*q+{Yt$MZDruD2^;$+(_%Qn+%v0X-bJO=;@kiJ^ygLBnC z?1OVv_%aex1<B=i>M@jKU|Z~$eI?PoF4Vj>f<jDMm<J9Y`yoa+TL}}nh1XOW>Dzyo zAiLfpXY*a<I(D9QKZkbcV%budKX>^Sj-S5D0S3@#V$sRW)g)_1e#$%8xdM>Jm7?!h zu0P2X=xoN>^!4DoPRgph2(2va07yfpXF+<E#%$BN8?9&2`XF7LYR>WH7EOg1GY%Zn z7~1A<(z7Q$ktEXhW_?GMpHp9l_UL18F3KOsxu81pqoBiNbFSGsof<JcynBP?5;;Hj z5&eaFaU9!r?$Z!yiA0iczsm`lZQ1Q_f!pH!Vb=UbaniMS2h4rH7k+#41ORG)=X>-W z6~eloMoz=4?OOnl2J268x5rOY`dCk0us(u<ZFT0vzGbA7HOqUbO4YBUD4VpaA7aAi z`;yHWY}3Vkp6~i#=>S#Ud4yqOr@?=Q57a}tit|BhY>}~frH1sP`ScHS_d)oqH^lYy zZ%VP`#10MlE~P?cE(%(#(AUSv_T{+;t@$U}El}(1ig`vZo`Rm;+5&(AYzJ^Ae=h2X z@Re%vH<EH?l6o;YyW^)wNA36}ocwXH@B9yX*N9`RUu$0?DW6D6ZqU(wh|t!U;k4w{ zH3|#>wZU<K8~-&UxVP@$khUv1RFND27=jD%j`vdBxN>>|f0NI&%$*4eJ<o-E@WY`` zqsV5Uq0M(^e2$XbFQVQY6A&05BoX(oqU-Sbz&pR-sMeX{(#EY_uNvG}BHk}N3y1ea z&)~4V{6c-_c}Yb90AmPVmxDc9RtA&ZXtL`~<RoleJ4+E0`>weC5OROQrpPMA@*w|o z()A==l}(@bv^&>H1Ob3C=<^|hob?0+xJ?QQ3-ueQC}zy&JQNib!OqSO@-=>XzxlSF zAZ^U*1l6EEmg3r};_HY>&Jo_{dOPEFTWPmt=U&F#+0(O59^UIlHbNX+eF8UzyDR*T z(=5X$VF3!gm@RooS-&iiUYGG^`hMR(07zr_xP`d!^BH?uD>Phl8Rdifx3Af^Zr`Ku ztL+~HkVeL#bJ)7;`=>;{KNRvjmc}1}c58Sr#Treq=4{xo!ATy|c>iRSp4`dzMMVd@ zL8?uwXDY}Wqgh4mH`|$BTXpUIu6A1-cSq%hJw;@^Zr8TP=GMh*p(m(tN7@!^D~sl$ zz^tf4II4|};+irE$Fnm4NTc5%p{PRA`%}Zk`CE5?#h3|xcyQ<Xbb-O<Z4>sS#iONZ z6H(@^i9td!$z~bZiJLTax$o>r(p}3o<nje2|Avo`h6^!)bS{!kN^oebdd#5CQZW;b zA~P)_xQB}-?DMcO;{2ZM^9Wlyhwp^EkrNh$g-#zJZI+W)Fn_KeU+CPzoDA3XHu>@< zyD7%(>ZYvy=6$U3e!F{Z`uSaYy`xQyl?b{}eg|G3&fz*`QH@mDUn)1%#5u`0m$%D} z?;tZ0u(mWeMV0QtzjgN!lT*pNRj;6510Wwx?Yi_=tYw|J#7@(Xe7ifDzXuK;JB;QO z#bg~K$cgm$@{QiL_3yr}y&~wuv=P=#O&Tj=Sr)aCUlYmZMcw?)T?c<qySZ3PfzX|h zNxj~sZx=;8Umdw9ghf!XjC^g!!4jbxk=-nc)2X_;TCvXGx~JD`-7FPr%}ttM#Q243 zdSwWYRlDX2nZa}#Gt<Dmm^PQv_W8@V1ahd2xzT--lXvzyozAEE>%0rUe1cS+o!qs_ zQ6Gp)-{)V!;=q}llyK3|^WeLKyjf%y;xHku;9(vM!j|~<7w1<b9>c*Mk-;P{T&yG) z@C-8E?QPynNQ<8f01D`2qexcVEIOU?y}MG)TAE6&VT5`rK8s(4PE;uQ92LTXUQ<>^ ztyQ@=@kRdh@ebUG^Z6NWWIL;_IGJ2ST>$t!$m$qvtj0Qmw8moN6GUV^!Q<bah>KNK zHBXCtUH<T{Q0VG*iQ!ybGT-d~B6-ML?|B@`9jAJuXM0(zdxXQ88~8P;7XLeUe|t_d z>8)<!#He?t!J^GeqTQ|g&oVhlWWSQ^3wbH*P~P%5jK!(1iLn|0Ky6Ue@po!$EH;54 z;b>RY9++gH_TUV4^=-j$t}dD3qsN7GclJ^Zc&(j6&a_!$jCf}%c5ey`pm~1)@{yI3 zTdWyB+*X{JFw#z;PwRr5evb2!ueWF;v`B0HoUu4-(~aL=z;OXUUEtG`_$)Oxw6FKg zEzY`CyKaSBK3xt#8gA|r_|Kehn_HYVBMpEwbn9-fI*!u*eTA1ef8<m-U!GYcFSJLJ zOPLuMsUG=;l_>Mkl1=!jV4oYwWYM}i`A>_F4nhmlCIC<a0TFv~_Gn5J$t&6%>6WLa zY%;4&@AlnaG11ejl61Jev21|r*m+?Kru3;1tFDl}#!OzUp6c<MxE}d=F238nid!5E zbuV4Li)mAR_zs;;KC)#onQ@0|X4)pAsc9QjTs>>go4{C|^erwpG*&h6bs<zmjhG<* zE{sn|w6-*tdUsTEE)MUBrppa@^|iO0)`UpL`5B|0$bS|TNcm?8(P;6KR3zVdakzT^ zsBpiu>pUPJag}oOkN2912Y3I?(eRc@U9>z#HPBHC?nps7<lndN{fZB#2e8hBJ?W_# zvKYcfdj<vgzAF_~|7`oJ7%A(QC6W9Love!T&>H5!zP``90!Q1n80jo+B3TWXp!8Pe zwuKuLLI6l3Gv@+QH*Y}2wPLPQ1<z4ER5ty_VVXxzYOzIn{d_~;>^EZhT#+Ed8q8Wo z1pTmIBxv14-{l&QVKxAyQF#8Q@NeJwWdKk>?cpiJLkJr+aZ!Me+Cfp!?FWSRf^j2k z73BRR{WSKaMkJ>1Nbx5dan5hg^_}O{Tj6u%iV%#QGz0Q@j{R^Ik)Z*+(<hQHpK6Z5 zi8eq^eB?|3P+;Mzy(m7G=1H>YvY2ziBG)?AmJa|JV%4UT$k`hcOg5r9R?5>?o~JzK zJCrj&{i#hG>N7!B4kNX(%igb%kDj0fOQThC-8mtfap82PNRXr1D>lbgg)dYTQ(kbx z`Ee5kXG~Bh+BHQBf|kJEy6(ga%Wfhvd<CBbJFZu|&ix|RtW*|v*5b8v`i@U0n+f47 zSD?cyrs7)6mOLEQ#wKo0-7FqSilZ<#F2PzZ$MO33Xevog+LBLYy~$@nSkTm3^W^yC zIq3WalbvYN?L<?79-5^ZkD<zq3;?x3uP+ePW4QK{U>QNDuOfQoe377l#h<A9J4gi0 z4<mxkd?gaZPl$u7PvFeS1JK+=3Z4yZ-0&IVW0nAr#-z!@ac#DB%O-yJZu-*838Tl) zfLhfR0BRsTs}x^uTZf1DZceAq-6UVWVnvvOfYmAaIKDqNk!<>t&DrMGeIsI5C<&ai zWG$|hop2@@q5YDa)_-A?B02W;#fH!%k`daQLEItaJJ8Yf1L%8x;kg?)k)00P-lH+w z)5$QNV6r2$YtnV(4o=0^3{kmaXn*Dm0F*fU(@o)yVVjk|ln8ea6BMy%vZAhW9|wvA z8RoDkVoMEz1d>|5(k0Nw>22ZT){V<3$^C-cN+|~hKt2)){+l-?3m@-$c?-dlzQ)q- zZ)j%n^gerV{|+t}9m1_&&Ly!9$rtG4XX|WQ8`xYzGC~U@nYh~g(z<YhXx*Cp6|P&Q z+&qgTQ*iOjK{t})*a1j`bTm4jd}pY1(@eH1C?v+IyX*vouKAMl_ar-Fo7CB0J+`B! zO@tRs%)~YFtGCC#lSsGBNG`mdNCagNLGHRWeLO;*wB~O}5I-EeTKCSz6~O^ejO66c z0Z7B!dkX8bBYo7B91O_`fdat)7RXmXui^e-vnKTv=YIa>9)bdAl#xH)xd5a=@|qql z|FzEil{P5(@gy!4ek05i$>`E^G~{;pnf6ftpLh$h#W?^#4UkPfa;;?bsIe&kz!+40 zI|6`F2n020)-r`pFaZ38F!S-lJM-o&inOw|66=GMeP@xQU5ghQH{~5Uh~TMTd;I9` z>YhVB`e^EVj*S7JF39ZgNf}A-0DwOcTT63ydN$I3b?yBQtUI*_fae~kPvzoD$zjX3 zoqBe#>12im4WzZ=f^4+u=!lA|#r%1`WB0-6*3BL#at`47#ebPpR|D1b)3BjT34nYY z%Ds%d?5$|{LgOIaRO{{oC&RK`O91$fqwM0(C_TALcozu*fWHb%%q&p-q{_8*2Zsi^ zh1ZCnr^UYa;4vQEtHk{~zi>wwMC5o{S=$P0X681y`SXwFH?Ewn{x-MOZynmc)JT5v zuHLwh;tLfxRrr%|k370}GofLl7thg>ACWWY&msqaVu&ry+`7+Ss>NL^%T1|z{IGMA zW-SKl=V-^{(f!Kf^#3(|T2W47d(%JVCI4JgRrT1pNz>+ietmFToNv^`gzC@&O-)+i zPQ~RwK8%C_vf%;%e>NyTp~dM5;!C|N0Q^6|CEb7Bw=Vz~$1#FA;Z*?mKSC)Hl-20s t8QyHj(g6VK0RYbl8UjE)0O0w=e*@m04r>stuEhWV002ovPDHLkV1hl;dM*F} literal 0 HcmV?d00001 diff --git a/C++/docs/html/dynsections.js b/C++/docs/html/dynsections.js new file mode 100644 index 0000000..85e1836 --- /dev/null +++ b/C++/docs/html/dynsections.js @@ -0,0 +1,97 @@ +function toggleVisibility(linkObj) +{ + var base = $(linkObj).attr('id'); + var summary = $('#'+base+'-summary'); + var content = $('#'+base+'-content'); + var trigger = $('#'+base+'-trigger'); + var src=$(trigger).attr('src'); + if (content.is(':visible')===true) { + content.hide(); + summary.show(); + $(linkObj).addClass('closed').removeClass('opened'); + $(trigger).attr('src',src.substring(0,src.length-8)+'closed.png'); + } else { + content.show(); + summary.hide(); + $(linkObj).removeClass('closed').addClass('opened'); + $(trigger).attr('src',src.substring(0,src.length-10)+'open.png'); + } + return false; +} + +function updateStripes() +{ + $('table.directory tr'). + removeClass('even').filter(':visible:even').addClass('even'); +} + +function toggleLevel(level) +{ + $('table.directory tr').each(function() { + var l = this.id.split('_').length-1; + var i = $('#img'+this.id.substring(3)); + var a = $('#arr'+this.id.substring(3)); + if (l<level+1) { + i.removeClass('iconfopen iconfclosed').addClass('iconfopen'); + a.html('▼'); + $(this).show(); + } else if (l==level+1) { + i.removeClass('iconfclosed iconfopen').addClass('iconfclosed'); + a.html('►'); + $(this).show(); + } else { + $(this).hide(); + } + }); + updateStripes(); +} + +function toggleFolder(id) +{ + // the clicked row + var currentRow = $('#row_'+id); + + // all rows after the clicked row + var rows = currentRow.nextAll("tr"); + + var re = new RegExp('^row_'+id+'\\d+_$', "i"); //only one sub + + // only match elements AFTER this one (can't hide elements before) + var childRows = rows.filter(function() { return this.id.match(re); }); + + // first row is visible we are HIDING + if (childRows.filter(':first').is(':visible')===true) { + // replace down arrow by right arrow for current row + var currentRowSpans = currentRow.find("span"); + currentRowSpans.filter(".iconfopen").removeClass("iconfopen").addClass("iconfclosed"); + currentRowSpans.filter(".arrow").html('►'); + rows.filter("[id^=row_"+id+"]").hide(); // hide all children + } else { // we are SHOWING + // replace right arrow by down arrow for current row + var currentRowSpans = currentRow.find("span"); + currentRowSpans.filter(".iconfclosed").removeClass("iconfclosed").addClass("iconfopen"); + currentRowSpans.filter(".arrow").html('▼'); + // replace down arrows by right arrows for child rows + var childRowsSpans = childRows.find("span"); + childRowsSpans.filter(".iconfopen").removeClass("iconfopen").addClass("iconfclosed"); + childRowsSpans.filter(".arrow").html('►'); + childRows.show(); //show all children + } + updateStripes(); +} + + +function toggleInherit(id) +{ + var rows = $('tr.inherit.'+id); + var img = $('tr.inherit_header.'+id+' img'); + var src = $(img).attr('src'); + if (rows.filter(':first').is(':visible')===true) { + rows.css('display','none'); + $(img).attr('src',src.substring(0,src.length-8)+'closed.png'); + } else { + rows.css('display','table-row'); // using show() causes jump in firefox + $(img).attr('src',src.substring(0,src.length-10)+'open.png'); + } +} + diff --git a/C++/docs/html/files.html b/C++/docs/html/files.html new file mode 100644 index 0000000..0e25f7d --- /dev/null +++ b/C++/docs/html/files.html @@ -0,0 +1,109 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>libxdf: File List</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="navtree.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="resize.js"></script> +<script type="text/javascript" src="navtreedata.js"></script> +<script type="text/javascript" src="navtree.js"></script> +<script type="text/javascript"> + $(document).ready(initResizable); +</script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">libxdf +  <span id="projectnumber">0.92</span> + </div> + <div id="projectbrief">A static C++ library for loading XDF files</div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.12 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<div id="side-nav" class="ui-resizable side-nav-resizable"> + <div id="nav-tree"> + <div id="nav-tree-contents"> + <div id="nav-sync" class="sync"></div> + </div> + </div> + <div id="splitbar" style="-moz-user-select:none;" + class="ui-resizable-handle"> + </div> +</div> +<script type="text/javascript"> +$(document).ready(function(){initNavTree('files.html','');}); +</script> +<div id="doc-content"> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="header"> + <div class="headertitle"> +<div class="title">File List</div> </div> +</div><!--header--> +<div class="contents"> +<div class="textblock">Here is a list of all files with brief descriptions:</div><div class="directory"> +<div class="levels">[detail level <span onclick="javascript:toggleLevel(1);">1</span><span onclick="javascript:toggleLevel(2);">2</span><span onclick="javascript:toggleLevel(3);">3</span><span onclick="javascript:toggleLevel(4);">4</span><span onclick="javascript:toggleLevel(5);">5</span>]</div><table class="directory"> +<tr id="row_0_" class="even"><td class="entry"><span style="width:0px;display:inline-block;"> </span><span id="arr_0_" class="arrow" onclick="toggleFolder('0_')">▼</span><span id="img_0_" class="iconfopen" onclick="toggleFolder('0_')"> </span><a class="el" href="dir_f396504afdc959660871b003fa10164d.html" target="_self">Documents</a></td><td class="desc"></td></tr> +<tr id="row_0_0_"><td class="entry"><span style="width:16px;display:inline-block;"> </span><span id="arr_0_0_" class="arrow" onclick="toggleFolder('0_0_')">▼</span><span id="img_0_0_" class="iconfopen" onclick="toggleFolder('0_0_')"> </span><a class="el" href="dir_7e17ac9cf8fba2cb04bc248c85b0ceb7.html" target="_self">GitHub</a></td><td class="desc"></td></tr> +<tr id="row_0_0_0_" class="even"><td class="entry"><span style="width:32px;display:inline-block;"> </span><span id="arr_0_0_0_" class="arrow" onclick="toggleFolder('0_0_0_')">▼</span><span id="img_0_0_0_" class="iconfopen" onclick="toggleFolder('0_0_0_')"> </span><a class="el" href="dir_72e8b74943c3b26541b5ac1c7338ef6f.html" target="_self">libxdf</a></td><td class="desc"></td></tr> +<tr id="row_0_0_0_0_"><td class="entry"><span style="width:48px;display:inline-block;"> </span><span id="arr_0_0_0_0_" class="arrow" onclick="toggleFolder('0_0_0_0_')">▼</span><span id="img_0_0_0_0_" class="iconfopen" onclick="toggleFolder('0_0_0_0_')"> </span><a class="el" href="dir_689ecbe789caf2e46799b15492db205c.html" target="_self">libxdf</a></td><td class="desc"></td></tr> +<tr id="row_0_0_0_0_0_" class="even"><td class="entry"><span style="width:80px;display:inline-block;"> </span><span class="icondoc"></span><a class="el" href="xdf_8cpp.html" target="_self">xdf.cpp</a></td><td class="desc"></td></tr> +<tr id="row_0_0_0_0_1_"><td class="entry"><span style="width:80px;display:inline-block;"> </span><a href="xdf_8h_source.html"><span class="icondoc"></span></a><a class="el" href="xdf_8h.html" target="_self">xdf.h</a></td><td class="desc">The header file of <a class="el" href="class_xdf.html">Xdf</a> class </td></tr> +</table> +</div><!-- directory --> +</div><!-- contents --> +</div><!-- doc-content --> +<!-- start footer part --> +<div id="nav-path" class="navpath"><!-- id is needed for treeview function! --> + <ul> + <li class="footer">Generated by + <a href="http://www.doxygen.org/index.html"> + <img class="footer" src="doxygen.png" alt="doxygen"/></a> 1.8.12 </li> + </ul> +</div> +</body> +</html> diff --git a/C++/docs/html/files.js b/C++/docs/html/files.js new file mode 100644 index 0000000..0e25e12 --- /dev/null +++ b/C++/docs/html/files.js @@ -0,0 +1,4 @@ +var files = +[ + [ "Documents", "dir_f396504afdc959660871b003fa10164d.html", "dir_f396504afdc959660871b003fa10164d" ] +]; \ No newline at end of file diff --git a/C++/docs/html/folderclosed.png b/C++/docs/html/folderclosed.png new file mode 100644 index 0000000000000000000000000000000000000000..bb8ab35edce8e97554e360005ee9fc5bffb36e66 GIT binary patch literal 616 zcmV-u0+;=XP)<h;3K|Lk000e1NJLTq000;O000&U1^@s6+I?Jz0006nNkl<ZcmeHQ zO;6N77=GINb=Z(>a9#ETzayK)T~Jw&MMH>OIr#&;dC}is*2Mqdf&akCc=O@`qC+4i z5Iu3w#1M@KqXCz8TIZd1wli&kkl2HVcAiZ8PUn5z_kG@-y;?yK06=cA0U%H0PH+kU zl6dp}OR(|r8-RG+YLu`zbI}5TlOU6ToR41{9=uz^?dGTNL;wIMf|V3`d1Wj3y!#6` zBLZ?xpKR~^2x}?~zA(_NUu3IaDB$tKma*XUdOZN~c=dLt_h_k!dbxm_*ibDM<n!c> zlFX`g{k$X}yIe%$N)cn1LNu=q<K5OS7CNKPk1f&9-+dXiicCfAy8a*|m;2$mAHWmO zXHGi+kV1-pHt+rM<gA>9_CS)*<?(PP8<}W6a5(^^keLBRMb50K&dQM@pmn94ZU=xQ zQX)TlxfVQ_9);_LB~VUu;v|U_-?p*(;VWJ|=^7%ZGN6sBL~)dHv|OyK(wPKdmH>>A zsX_mM4<gjHpqc8Q=uo450T?4i;CdW;`z|<XAntIp>L@`(cSNQKMFc$RtYbx{79<Tw zWXi-A43v#7I@t_Ijx7TKV2n(H{k|uniNrjlLmWw}y*t^*R9a-QX?;6B==9%$de=Kk z*QYpi761&SjtX%clomR5cK>#j-J7hk*>*+ZZhM4Hw?<fJyv$}=71o`ou(^pUn-ky6 z->I?rsXCi#mRWJ=-0LGV5a-WR0Qgt<|Nqf)C-@80`5gIz45^_20000<MNUMnLSTaR CZX#j; literal 0 HcmV?d00001 diff --git a/C++/docs/html/folderopen.png b/C++/docs/html/folderopen.png new file mode 100644 index 0000000000000000000000000000000000000000..d6c7f676a3b3ef8c2c307d319dff3c6a604eb227 GIT binary patch literal 597 zcmV-b0;>IqP)<h;3K|Lk000e1NJLTq000;O000&U1^@s6+I?Jz0006UNkl<ZcmeHQ zKX21e5dS%8nlx#!9XpK>X=#(TiCT&PiIIVc55T}TU}EUh*{q$|`3@{d>{Tc9Bo>e= zfmF3!f>fbI9#GoEHh0f`i5)wkLpva0ztf%HpZneK?w-7AK@b4Itw{y|Zd3k!fH?q2 zlhckHd_V2M_X7+)U&_Xcfvtw60l;--DgZmLSw-Y?S>)zIqMyJ1#FwLU*%bl38ok+! zh78H87n`ZTS;uhzAR$M`zZ`bVhq=+%u9^$5jDplgxd44}9;IRqUH1YHH|@6oFe%z( zo4)_>E$F&^P-f(#)>(TrnbE>Pefs9~@iN=|)Rz|V`sGfHNrJ)0gJb8xx+SBmRf@1l zvuzt=vGfI)<-F9!o&3l?>9~0QbUDT(wFdnQPv%xdD)m*g%!20>Bc9iYmGAp<9YAa( z0QgY<a!3GSVHw98r3tc|WLmCr=#k@b07--d0B^h;_*7huEOe@B5HbiIMnQNV2X-w6 zOrIHW*Nh!-3RJ{NFA7|xb7mLqy*mtQR%uj&==!8@USn{@{Ji@c`@7F#U6jIrqNF?z zhGG8IoU)VO(*u}!lcNr&IgdJw?)fXgkFy?t@!%{)3!Y}PHt9|Ph>gTWqf1qN++Gqp z8@AYPTB3E|6s=WLG?xw0tm|U!o=&zd+H0oRYE;Dbx+Na9s^STqX|Gnq%H8s(nGDGJ j8vwW|`Ts`)fSK|Kx=IK@RG@g200000NkvXXu0mjfauFEA literal 0 HcmV?d00001 diff --git a/C++/docs/html/functions.html b/C++/docs/html/functions.html new file mode 100644 index 0000000..69170e3 --- /dev/null +++ b/C++/docs/html/functions.html @@ -0,0 +1,310 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>libxdf: Class Members</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="navtree.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="resize.js"></script> +<script type="text/javascript" src="navtreedata.js"></script> +<script type="text/javascript" src="navtree.js"></script> +<script type="text/javascript"> + $(document).ready(initResizable); +</script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">libxdf +  <span id="projectnumber">0.92</span> + </div> + <div id="projectbrief">A static C++ library for loading XDF files</div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.12 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<div id="side-nav" class="ui-resizable side-nav-resizable"> + <div id="nav-tree"> + <div id="nav-tree-contents"> + <div id="nav-sync" class="sync"></div> + </div> + </div> + <div id="splitbar" style="-moz-user-select:none;" + class="ui-resizable-handle"> + </div> +</div> +<script type="text/javascript"> +$(document).ready(function(){initNavTree('functions.html','');}); +</script> +<div id="doc-content"> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="contents"> +<div class="textblock">Here is a list of all class members with links to the classes they belong to:</div> + +<h3><a id="index_a"></a>- a -</h3><ul> +<li>adjustTotalLength() +: <a class="el" href="class_xdf.html#aa7dc1ef8c04216d703604bf868146428">Xdf</a> +</li> +</ul> + + +<h3><a id="index_c"></a>- c -</h3><ul> +<li>calcTotalLength() +: <a class="el" href="class_xdf.html#a75ef15a72071fe0d36ef6311214518fe">Xdf</a> +</li> +<li>channel_count +: <a class="el" href="struct_xdf_1_1_stream.html#ab8fb7c3d645305e84f90d919f698082c">Xdf::Stream</a> +</li> +<li>channel_format +: <a class="el" href="struct_xdf_1_1_stream.html#ad7b61b077e247ba57a18c182e285d0ad">Xdf::Stream</a> +</li> +<li>channels +: <a class="el" href="struct_xdf_1_1_stream.html#a71d987a538d0819cdbd58120d1a79ef5">Xdf::Stream</a> +</li> +<li>clock_offsets +: <a class="el" href="struct_xdf_1_1_stream.html#a6f6328f0746591a3a471048b6b9bd258">Xdf::Stream</a> +</li> +<li>clock_times +: <a class="el" href="struct_xdf_1_1_stream.html#a6bc91dcf23e551a9adbc415b562f3a79">Xdf::Stream</a> +</li> +<li>clock_values +: <a class="el" href="struct_xdf_1_1_stream.html#a988989603854812cb693e56ff352a753">Xdf::Stream</a> +</li> +<li>createLabels() +: <a class="el" href="class_xdf.html#ad98829202c9ae64505c9ecc7796c8ddc">Xdf</a> +</li> +</ul> + + +<h3><a id="index_d"></a>- d -</h3><ul> +<li>detrend() +: <a class="el" href="class_xdf.html#a4d2c5859af84542a15a80c906465f4e3">Xdf</a> +</li> +<li>dictionary +: <a class="el" href="class_xdf.html#a26a2b517f020dc9f188c2277c76add85">Xdf</a> +</li> +</ul> + + +<h3><a id="index_e"></a>- e -</h3><ul> +<li>effective_sample_rate +: <a class="el" href="struct_xdf_1_1_stream.html#abeb1d2eb26a46eac34a478f04f5143d6">Xdf::Stream</a> +</li> +<li>eventMap +: <a class="el" href="class_xdf.html#a45004fc495cad33768fae80b996a68db">Xdf</a> +</li> +<li>eventName +: <a class="el" href="class_xdf.html#a4e3322abfe4d533d6b7a96cbbea7271a">Xdf</a> +</li> +<li>eventTimeStamp +: <a class="el" href="class_xdf.html#a1fbf3d641262cc1daade33eca1789990">Xdf</a> +</li> +<li>eventType +: <a class="el" href="class_xdf.html#a4acb87e86380bf7266976cd6c4cb3826">Xdf</a> +</li> +</ul> + + +<h3><a id="index_f"></a>- f -</h3><ul> +<li>fileHeader +: <a class="el" href="class_xdf.html#a1e46bbbf31121fb394aa8cf5c10d10b0">Xdf</a> +</li> +<li>first_timestamp +: <a class="el" href="struct_xdf_1_1_stream.html#a22a44cb3cd533ea668f9bb20dbc299de">Xdf::Stream</a> +</li> +<li>freeUpTimeStamps() +: <a class="el" href="class_xdf.html#a12332c25006e2c6d71883c368c3c1f61">Xdf</a> +</li> +</ul> + + +<h3><a id="index_i"></a>- i -</h3><ul> +<li>info +: <a class="el" href="struct_xdf_1_1_stream.html#a732d62cf3216a3bd4990625b0eb723cf">Xdf::Stream</a> +</li> +</ul> + + +<h3><a id="index_l"></a>- l -</h3><ul> +<li>labels +: <a class="el" href="class_xdf.html#a250d6f79d0333887393eab248fee3c93">Xdf</a> +</li> +<li>last_timestamp +: <a class="el" href="struct_xdf_1_1_stream.html#a9e05df342a36187ae492c75f10fc7713">Xdf::Stream</a> +</li> +<li>load_xdf() +: <a class="el" href="class_xdf.html#a993e94535d6d9e544a64ffbbb2bb4e8c">Xdf</a> +</li> +</ul> + + +<h3><a id="index_m"></a>- m -</h3><ul> +<li>majSR +: <a class="el" href="class_xdf.html#ac65175994e0e2eeec4dd2f4688cd2040">Xdf</a> +</li> +<li>maxSR +: <a class="el" href="class_xdf.html#a3cb480731a20caa480e3e6744acb562c">Xdf</a> +</li> +<li>maxTS +: <a class="el" href="class_xdf.html#a6874a847c980f296ebbcf703fa48096a">Xdf</a> +</li> +<li>measured_srate +: <a class="el" href="struct_xdf_1_1_stream.html#a9c1fbac049f7c15225de9fe9713abc0a">Xdf::Stream</a> +</li> +<li>minTS +: <a class="el" href="class_xdf.html#a44da046e191b2ae90b9bfe4de8d58ea3">Xdf</a> +</li> +</ul> + + +<h3><a id="index_n"></a>- n -</h3><ul> +<li>name +: <a class="el" href="struct_xdf_1_1_stream.html#a112e1dcc0e4b7f9583755366da8c3c64">Xdf::Stream</a> +</li> +<li>nominal_srate +: <a class="el" href="struct_xdf_1_1_stream.html#a17696fc2ee37c1d79601fac1736deb35">Xdf::Stream</a> +</li> +</ul> + + +<h3><a id="index_o"></a>- o -</h3><ul> +<li>offsets +: <a class="el" href="class_xdf.html#a1a2b080f29080a5c521de907769d9419">Xdf</a> +</li> +</ul> + + +<h3><a id="index_r"></a>- r -</h3><ul> +<li>resample() +: <a class="el" href="class_xdf.html#a67c5890ac84f257e91bdb93dcbe958ae">Xdf</a> +</li> +</ul> + + +<h3><a id="index_s"></a>- s -</h3><ul> +<li>sample_count +: <a class="el" href="struct_xdf_1_1_stream.html#a329234a46df00cd51a67a7f4f637c08a">Xdf::Stream</a> +</li> +<li>sampleRateMap +: <a class="el" href="class_xdf.html#add8aceaf68ad49b708f4df29f439778d">Xdf</a> +</li> +<li>sampling_interval +: <a class="el" href="struct_xdf_1_1_stream.html#a49bbcb0c3130c3efef27ece47084b327">Xdf::Stream</a> +</li> +<li>streamFooter +: <a class="el" href="struct_xdf_1_1_stream.html#aecd1fdf80d421e2362eeee58b31d4e11">Xdf::Stream</a> +</li> +<li>streamHeader +: <a class="el" href="struct_xdf_1_1_stream.html#a2dff1924d1f7de075df08c4001201d63">Xdf::Stream</a> +</li> +<li>streamMap +: <a class="el" href="class_xdf.html#aa02e5a435186cdabbaf2487068c53dbc">Xdf</a> +</li> +<li>streams +: <a class="el" href="class_xdf.html#acc12687ca26e8352afb960d459c5947a">Xdf</a> +</li> +</ul> + + +<h3><a id="index_t"></a>- t -</h3><ul> +<li>time_series +: <a class="el" href="struct_xdf_1_1_stream.html#adfdeb5f6220da9fe671d3f37e27ed0bb">Xdf::Stream</a> +</li> +<li>time_stamps +: <a class="el" href="struct_xdf_1_1_stream.html#a3f05ffb18a1feb56c248c391a69f104b">Xdf::Stream</a> +</li> +<li>totalCh +: <a class="el" href="class_xdf.html#a9b4fc485a140ba5020a48ca5fa2e45ea">Xdf</a> +</li> +<li>totalLen +: <a class="el" href="class_xdf.html#ac0b5d7d53fb28832594718cc16f65184">Xdf</a> +</li> +<li>type +: <a class="el" href="struct_xdf_1_1_stream.html#a7e5aa085e48de871ea6661651b28e097">Xdf::Stream</a> +</li> +</ul> + + +<h3><a id="index_u"></a>- u -</h3><ul> +<li>userAddedStream +: <a class="el" href="class_xdf.html#a83d5309d854b1052fa575b539a69c58d">Xdf</a> +</li> +<li>userCreatedEvents +: <a class="el" href="class_xdf.html#a7b1496a8667d67b90836696a1e2da618">Xdf</a> +</li> +</ul> + + +<h3><a id="index_v"></a>- v -</h3><ul> +<li>version +: <a class="el" href="class_xdf.html#a1d7401eb1557b2f34ac0ff4b9f79d04f">Xdf</a> +</li> +</ul> + + +<h3><a id="index_w"></a>- w -</h3><ul> +<li>writeEventsToXDF() +: <a class="el" href="class_xdf.html#a072e657d7620d61080a15a215c691210">Xdf</a> +</li> +</ul> + + +<h3><a id="index_x"></a>- x -</h3><ul> +<li>Xdf() +: <a class="el" href="class_xdf.html#a7900b5a4f3792b9d59a5d43db821607e">Xdf</a> +</li> +</ul> +</div><!-- contents --> +</div><!-- doc-content --> +<!-- start footer part --> +<div id="nav-path" class="navpath"><!-- id is needed for treeview function! --> + <ul> + <li class="footer">Generated by + <a href="http://www.doxygen.org/index.html"> + <img class="footer" src="doxygen.png" alt="doxygen"/></a> 1.8.12 </li> + </ul> +</div> +</body> +</html> diff --git a/C++/docs/html/functions_func.html b/C++/docs/html/functions_func.html new file mode 100644 index 0000000..f538984 --- /dev/null +++ b/C++/docs/html/functions_func.html @@ -0,0 +1,124 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>libxdf: Class Members - Functions</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="navtree.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="resize.js"></script> +<script type="text/javascript" src="navtreedata.js"></script> +<script type="text/javascript" src="navtree.js"></script> +<script type="text/javascript"> + $(document).ready(initResizable); +</script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">libxdf +  <span id="projectnumber">0.92</span> + </div> + <div id="projectbrief">A static C++ library for loading XDF files</div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.12 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<div id="side-nav" class="ui-resizable side-nav-resizable"> + <div id="nav-tree"> + <div id="nav-tree-contents"> + <div id="nav-sync" class="sync"></div> + </div> + </div> + <div id="splitbar" style="-moz-user-select:none;" + class="ui-resizable-handle"> + </div> +</div> +<script type="text/javascript"> +$(document).ready(function(){initNavTree('functions_func.html','');}); +</script> +<div id="doc-content"> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="contents"> + <ul> +<li>adjustTotalLength() +: <a class="el" href="class_xdf.html#aa7dc1ef8c04216d703604bf868146428">Xdf</a> +</li> +<li>calcTotalLength() +: <a class="el" href="class_xdf.html#a75ef15a72071fe0d36ef6311214518fe">Xdf</a> +</li> +<li>createLabels() +: <a class="el" href="class_xdf.html#ad98829202c9ae64505c9ecc7796c8ddc">Xdf</a> +</li> +<li>detrend() +: <a class="el" href="class_xdf.html#a4d2c5859af84542a15a80c906465f4e3">Xdf</a> +</li> +<li>freeUpTimeStamps() +: <a class="el" href="class_xdf.html#a12332c25006e2c6d71883c368c3c1f61">Xdf</a> +</li> +<li>load_xdf() +: <a class="el" href="class_xdf.html#a993e94535d6d9e544a64ffbbb2bb4e8c">Xdf</a> +</li> +<li>resample() +: <a class="el" href="class_xdf.html#a67c5890ac84f257e91bdb93dcbe958ae">Xdf</a> +</li> +<li>writeEventsToXDF() +: <a class="el" href="class_xdf.html#a072e657d7620d61080a15a215c691210">Xdf</a> +</li> +<li>Xdf() +: <a class="el" href="class_xdf.html#a7900b5a4f3792b9d59a5d43db821607e">Xdf</a> +</li> +</ul> +</div><!-- contents --> +</div><!-- doc-content --> +<!-- start footer part --> +<div id="nav-path" class="navpath"><!-- id is needed for treeview function! --> + <ul> + <li class="footer">Generated by + <a href="http://www.doxygen.org/index.html"> + <img class="footer" src="doxygen.png" alt="doxygen"/></a> 1.8.12 </li> + </ul> +</div> +</body> +</html> diff --git a/C++/docs/html/functions_type.html b/C++/docs/html/functions_type.html new file mode 100644 index 0000000..fe5d4f8 --- /dev/null +++ b/C++/docs/html/functions_type.html @@ -0,0 +1,103 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>libxdf: Class Members - Typedefs</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="navtree.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="resize.js"></script> +<script type="text/javascript" src="navtreedata.js"></script> +<script type="text/javascript" src="navtree.js"></script> +<script type="text/javascript"> + $(document).ready(initResizable); +</script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">libxdf +  <span id="projectnumber">0.92</span> + </div> + <div id="projectbrief">A static C++ library for loading XDF files</div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.12 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<div id="side-nav" class="ui-resizable side-nav-resizable"> + <div id="nav-tree"> + <div id="nav-tree-contents"> + <div id="nav-sync" class="sync"></div> + </div> + </div> + <div id="splitbar" style="-moz-user-select:none;" + class="ui-resizable-handle"> + </div> +</div> +<script type="text/javascript"> +$(document).ready(function(){initNavTree('functions_type.html','');}); +</script> +<div id="doc-content"> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="contents"> + <ul> +<li>eventName +: <a class="el" href="class_xdf.html#a4e3322abfe4d533d6b7a96cbbea7271a">Xdf</a> +</li> +<li>eventTimeStamp +: <a class="el" href="class_xdf.html#a1fbf3d641262cc1daade33eca1789990">Xdf</a> +</li> +</ul> +</div><!-- contents --> +</div><!-- doc-content --> +<!-- start footer part --> +<div id="nav-path" class="navpath"><!-- id is needed for treeview function! --> + <ul> + <li class="footer">Generated by + <a href="http://www.doxygen.org/index.html"> + <img class="footer" src="doxygen.png" alt="doxygen"/></a> 1.8.12 </li> + </ul> +</div> +</body> +</html> diff --git a/C++/docs/html/functions_vars.html b/C++/docs/html/functions_vars.html new file mode 100644 index 0000000..5e89b7f --- /dev/null +++ b/C++/docs/html/functions_vars.html @@ -0,0 +1,261 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>libxdf: Class Members - Variables</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="navtree.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="resize.js"></script> +<script type="text/javascript" src="navtreedata.js"></script> +<script type="text/javascript" src="navtree.js"></script> +<script type="text/javascript"> + $(document).ready(initResizable); +</script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">libxdf +  <span id="projectnumber">0.92</span> + </div> + <div id="projectbrief">A static C++ library for loading XDF files</div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.12 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<div id="side-nav" class="ui-resizable side-nav-resizable"> + <div id="nav-tree"> + <div id="nav-tree-contents"> + <div id="nav-sync" class="sync"></div> + </div> + </div> + <div id="splitbar" style="-moz-user-select:none;" + class="ui-resizable-handle"> + </div> +</div> +<script type="text/javascript"> +$(document).ready(function(){initNavTree('functions_vars.html','');}); +</script> +<div id="doc-content"> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="contents"> +  + +<h3><a id="index_c"></a>- c -</h3><ul> +<li>channel_count +: <a class="el" href="struct_xdf_1_1_stream.html#ab8fb7c3d645305e84f90d919f698082c">Xdf::Stream</a> +</li> +<li>channel_format +: <a class="el" href="struct_xdf_1_1_stream.html#ad7b61b077e247ba57a18c182e285d0ad">Xdf::Stream</a> +</li> +<li>channels +: <a class="el" href="struct_xdf_1_1_stream.html#a71d987a538d0819cdbd58120d1a79ef5">Xdf::Stream</a> +</li> +<li>clock_offsets +: <a class="el" href="struct_xdf_1_1_stream.html#a6f6328f0746591a3a471048b6b9bd258">Xdf::Stream</a> +</li> +<li>clock_times +: <a class="el" href="struct_xdf_1_1_stream.html#a6bc91dcf23e551a9adbc415b562f3a79">Xdf::Stream</a> +</li> +<li>clock_values +: <a class="el" href="struct_xdf_1_1_stream.html#a988989603854812cb693e56ff352a753">Xdf::Stream</a> +</li> +</ul> + + +<h3><a id="index_d"></a>- d -</h3><ul> +<li>dictionary +: <a class="el" href="class_xdf.html#a26a2b517f020dc9f188c2277c76add85">Xdf</a> +</li> +</ul> + + +<h3><a id="index_e"></a>- e -</h3><ul> +<li>effective_sample_rate +: <a class="el" href="struct_xdf_1_1_stream.html#abeb1d2eb26a46eac34a478f04f5143d6">Xdf::Stream</a> +</li> +<li>eventMap +: <a class="el" href="class_xdf.html#a45004fc495cad33768fae80b996a68db">Xdf</a> +</li> +<li>eventType +: <a class="el" href="class_xdf.html#a4acb87e86380bf7266976cd6c4cb3826">Xdf</a> +</li> +</ul> + + +<h3><a id="index_f"></a>- f -</h3><ul> +<li>fileHeader +: <a class="el" href="class_xdf.html#a1e46bbbf31121fb394aa8cf5c10d10b0">Xdf</a> +</li> +<li>first_timestamp +: <a class="el" href="struct_xdf_1_1_stream.html#a22a44cb3cd533ea668f9bb20dbc299de">Xdf::Stream</a> +</li> +</ul> + + +<h3><a id="index_i"></a>- i -</h3><ul> +<li>info +: <a class="el" href="struct_xdf_1_1_stream.html#a732d62cf3216a3bd4990625b0eb723cf">Xdf::Stream</a> +</li> +</ul> + + +<h3><a id="index_l"></a>- l -</h3><ul> +<li>labels +: <a class="el" href="class_xdf.html#a250d6f79d0333887393eab248fee3c93">Xdf</a> +</li> +<li>last_timestamp +: <a class="el" href="struct_xdf_1_1_stream.html#ab61b638cf490354db62fb7da999750cf">Xdf::Stream</a> +</li> +</ul> + + +<h3><a id="index_m"></a>- m -</h3><ul> +<li>majSR +: <a class="el" href="class_xdf.html#ac65175994e0e2eeec4dd2f4688cd2040">Xdf</a> +</li> +<li>maxSR +: <a class="el" href="class_xdf.html#a3cb480731a20caa480e3e6744acb562c">Xdf</a> +</li> +<li>maxTS +: <a class="el" href="class_xdf.html#a6874a847c980f296ebbcf703fa48096a">Xdf</a> +</li> +<li>measured_srate +: <a class="el" href="struct_xdf_1_1_stream.html#a9c1fbac049f7c15225de9fe9713abc0a">Xdf::Stream</a> +</li> +<li>minTS +: <a class="el" href="class_xdf.html#a44da046e191b2ae90b9bfe4de8d58ea3">Xdf</a> +</li> +</ul> + + +<h3><a id="index_n"></a>- n -</h3><ul> +<li>name +: <a class="el" href="struct_xdf_1_1_stream.html#a112e1dcc0e4b7f9583755366da8c3c64">Xdf::Stream</a> +</li> +<li>nominal_srate +: <a class="el" href="struct_xdf_1_1_stream.html#a17696fc2ee37c1d79601fac1736deb35">Xdf::Stream</a> +</li> +</ul> + + +<h3><a id="index_o"></a>- o -</h3><ul> +<li>offsets +: <a class="el" href="class_xdf.html#a1a2b080f29080a5c521de907769d9419">Xdf</a> +</li> +</ul> + + +<h3><a id="index_s"></a>- s -</h3><ul> +<li>sample_count +: <a class="el" href="struct_xdf_1_1_stream.html#a329234a46df00cd51a67a7f4f637c08a">Xdf::Stream</a> +</li> +<li>sampleRateMap +: <a class="el" href="class_xdf.html#add8aceaf68ad49b708f4df29f439778d">Xdf</a> +</li> +<li>sampling_interval +: <a class="el" href="struct_xdf_1_1_stream.html#a49bbcb0c3130c3efef27ece47084b327">Xdf::Stream</a> +</li> +<li>streamFooter +: <a class="el" href="struct_xdf_1_1_stream.html#aecd1fdf80d421e2362eeee58b31d4e11">Xdf::Stream</a> +</li> +<li>streamHeader +: <a class="el" href="struct_xdf_1_1_stream.html#a2dff1924d1f7de075df08c4001201d63">Xdf::Stream</a> +</li> +<li>streamMap +: <a class="el" href="class_xdf.html#aa02e5a435186cdabbaf2487068c53dbc">Xdf</a> +</li> +<li>streams +: <a class="el" href="class_xdf.html#acc12687ca26e8352afb960d459c5947a">Xdf</a> +</li> +</ul> + + +<h3><a id="index_t"></a>- t -</h3><ul> +<li>time_series +: <a class="el" href="struct_xdf_1_1_stream.html#adfdeb5f6220da9fe671d3f37e27ed0bb">Xdf::Stream</a> +</li> +<li>time_stamps +: <a class="el" href="struct_xdf_1_1_stream.html#a3f05ffb18a1feb56c248c391a69f104b">Xdf::Stream</a> +</li> +<li>totalCh +: <a class="el" href="class_xdf.html#a9b4fc485a140ba5020a48ca5fa2e45ea">Xdf</a> +</li> +<li>totalLen +: <a class="el" href="class_xdf.html#ac0b5d7d53fb28832594718cc16f65184">Xdf</a> +</li> +<li>type +: <a class="el" href="struct_xdf_1_1_stream.html#a7e5aa085e48de871ea6661651b28e097">Xdf::Stream</a> +</li> +</ul> + + +<h3><a id="index_u"></a>- u -</h3><ul> +<li>userAddedStream +: <a class="el" href="class_xdf.html#a83d5309d854b1052fa575b539a69c58d">Xdf</a> +</li> +<li>userCreatedEvents +: <a class="el" href="class_xdf.html#a7b1496a8667d67b90836696a1e2da618">Xdf</a> +</li> +</ul> + + +<h3><a id="index_v"></a>- v -</h3><ul> +<li>version +: <a class="el" href="class_xdf.html#a1d7401eb1557b2f34ac0ff4b9f79d04f">Xdf</a> +</li> +</ul> +</div><!-- contents --> +</div><!-- doc-content --> +<!-- start footer part --> +<div id="nav-path" class="navpath"><!-- id is needed for treeview function! --> + <ul> + <li class="footer">Generated by + <a href="http://www.doxygen.org/index.html"> + <img class="footer" src="doxygen.png" alt="doxygen"/></a> 1.8.12 </li> + </ul> +</div> +</body> +</html> diff --git a/C++/docs/html/globals.html b/C++/docs/html/globals.html new file mode 100644 index 0000000..ca98cdd --- /dev/null +++ b/C++/docs/html/globals.html @@ -0,0 +1,100 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>libxdf: File Members</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="navtree.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="resize.js"></script> +<script type="text/javascript" src="navtreedata.js"></script> +<script type="text/javascript" src="navtree.js"></script> +<script type="text/javascript"> + $(document).ready(initResizable); +</script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">libxdf +  <span id="projectnumber">0.92</span> + </div> + <div id="projectbrief">A static C++ library for loading XDF files</div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.12 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<div id="side-nav" class="ui-resizable side-nav-resizable"> + <div id="nav-tree"> + <div id="nav-tree-contents"> + <div id="nav-sync" class="sync"></div> + </div> + </div> + <div id="splitbar" style="-moz-user-select:none;" + class="ui-resizable-handle"> + </div> +</div> +<script type="text/javascript"> +$(document).ready(function(){initNavTree('globals.html','');}); +</script> +<div id="doc-content"> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="contents"> +<div class="textblock">Here is a list of all file members with links to the files they belong to:</div><ul> +<li>BUF_SIZE +: <a class="el" href="xdf_8cpp.html#a6821bafc3c88dfb2e433a095df9940c6">xdf.cpp</a> +</li> +</ul> +</div><!-- contents --> +</div><!-- doc-content --> +<!-- start footer part --> +<div id="nav-path" class="navpath"><!-- id is needed for treeview function! --> + <ul> + <li class="footer">Generated by + <a href="http://www.doxygen.org/index.html"> + <img class="footer" src="doxygen.png" alt="doxygen"/></a> 1.8.12 </li> + </ul> +</div> +</body> +</html> diff --git a/C++/docs/html/globals_defs.html b/C++/docs/html/globals_defs.html new file mode 100644 index 0000000..be2edc0 --- /dev/null +++ b/C++/docs/html/globals_defs.html @@ -0,0 +1,100 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>libxdf: File Members</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="navtree.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="resize.js"></script> +<script type="text/javascript" src="navtreedata.js"></script> +<script type="text/javascript" src="navtree.js"></script> +<script type="text/javascript"> + $(document).ready(initResizable); +</script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">libxdf +  <span id="projectnumber">0.92</span> + </div> + <div id="projectbrief">A static C++ library for loading XDF files</div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.12 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<div id="side-nav" class="ui-resizable side-nav-resizable"> + <div id="nav-tree"> + <div id="nav-tree-contents"> + <div id="nav-sync" class="sync"></div> + </div> + </div> + <div id="splitbar" style="-moz-user-select:none;" + class="ui-resizable-handle"> + </div> +</div> +<script type="text/javascript"> +$(document).ready(function(){initNavTree('globals_defs.html','');}); +</script> +<div id="doc-content"> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="contents"> + <ul> +<li>BUF_SIZE +: <a class="el" href="xdf_8cpp.html#a6821bafc3c88dfb2e433a095df9940c6">xdf.cpp</a> +</li> +</ul> +</div><!-- contents --> +</div><!-- doc-content --> +<!-- start footer part --> +<div id="nav-path" class="navpath"><!-- id is needed for treeview function! --> + <ul> + <li class="footer">Generated by + <a href="http://www.doxygen.org/index.html"> + <img class="footer" src="doxygen.png" alt="doxygen"/></a> 1.8.12 </li> + </ul> +</div> +</body> +</html> diff --git a/C++/docs/html/index.html b/C++/docs/html/index.html new file mode 100644 index 0000000..3f07825 --- /dev/null +++ b/C++/docs/html/index.html @@ -0,0 +1,99 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>libxdf: Main Page</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="navtree.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="resize.js"></script> +<script type="text/javascript" src="navtreedata.js"></script> +<script type="text/javascript" src="navtree.js"></script> +<script type="text/javascript"> + $(document).ready(initResizable); +</script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">libxdf +  <span id="projectnumber">0.92</span> + </div> + <div id="projectbrief">A static C++ library for loading XDF files</div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.12 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<div id="side-nav" class="ui-resizable side-nav-resizable"> + <div id="nav-tree"> + <div id="nav-tree-contents"> + <div id="nav-sync" class="sync"></div> + </div> + </div> + <div id="splitbar" style="-moz-user-select:none;" + class="ui-resizable-handle"> + </div> +</div> +<script type="text/javascript"> +$(document).ready(function(){initNavTree('index.html','');}); +</script> +<div id="doc-content"> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="header"> + <div class="headertitle"> +<div class="title">libxdf Documentation</div> </div> +</div><!--header--> +<div class="contents"> +</div><!-- contents --> +</div><!-- doc-content --> +<!-- start footer part --> +<div id="nav-path" class="navpath"><!-- id is needed for treeview function! --> + <ul> + <li class="footer">Generated by + <a href="http://www.doxygen.org/index.html"> + <img class="footer" src="doxygen.png" alt="doxygen"/></a> 1.8.12 </li> + </ul> +</div> +</body> +</html> diff --git a/C++/docs/html/jquery.js b/C++/docs/html/jquery.js new file mode 100644 index 0000000..f5343ed --- /dev/null +++ b/C++/docs/html/jquery.js @@ -0,0 +1,87 @@ +/*! + * jQuery JavaScript Library v1.7.1 + * http://jquery.com/ + * + * Copyright 2011, John Resig + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * + * Date: Mon Nov 21 21:11:03 2011 -0500 + */ +(function(bb,L){var av=bb.document,bu=bb.navigator,bl=bb.location;var b=(function(){var bF=function(b0,b1){return new bF.fn.init(b0,b1,bD)},bU=bb.jQuery,bH=bb.$,bD,bY=/^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,bM=/\S/,bI=/^\s+/,bE=/\s+$/,bA=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,bN=/^[\],:{}\s]*$/,bW=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,bP=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,bJ=/(?:^|:|,)(?:\s*\[)+/g,by=/(webkit)[ \/]([\w.]+)/,bR=/(opera)(?:.*version)?[ \/]([\w.]+)/,bQ=/(msie) ([\w.]+)/,bS=/(mozilla)(?:.*? rv:([\w.]+))?/,bB=/-([a-z]|[0-9])/ig,bZ=/^-ms-/,bT=function(b0,b1){return(b1+"").toUpperCase()},bX=bu.userAgent,bV,bC,e,bL=Object.prototype.toString,bG=Object.prototype.hasOwnProperty,bz=Array.prototype.push,bK=Array.prototype.slice,bO=String.prototype.trim,bv=Array.prototype.indexOf,bx={};bF.fn=bF.prototype={constructor:bF,init:function(b0,b4,b3){var b2,b5,b1,b6;if(!b0){return this}if(b0.nodeType){this.context=this[0]=b0;this.length=1;return this}if(b0==="body"&&!b4&&av.body){this.context=av;this[0]=av.body;this.selector=b0;this.length=1;return this}if(typeof b0==="string"){if(b0.charAt(0)==="<"&&b0.charAt(b0.length-1)===">"&&b0.length>=3){b2=[null,b0,null]}else{b2=bY.exec(b0)}if(b2&&(b2[1]||!b4)){if(b2[1]){b4=b4 instanceof bF?b4[0]:b4;b6=(b4?b4.ownerDocument||b4:av);b1=bA.exec(b0);if(b1){if(bF.isPlainObject(b4)){b0=[av.createElement(b1[1])];bF.fn.attr.call(b0,b4,true)}else{b0=[b6.createElement(b1[1])]}}else{b1=bF.buildFragment([b2[1]],[b6]);b0=(b1.cacheable?bF.clone(b1.fragment):b1.fragment).childNodes}return bF.merge(this,b0)}else{b5=av.getElementById(b2[2]);if(b5&&b5.parentNode){if(b5.id!==b2[2]){return b3.find(b0)}this.length=1;this[0]=b5}this.context=av;this.selector=b0;return this}}else{if(!b4||b4.jquery){return(b4||b3).find(b0)}else{return this.constructor(b4).find(b0)}}}else{if(bF.isFunction(b0)){return b3.ready(b0)}}if(b0.selector!==L){this.selector=b0.selector;this.context=b0.context}return bF.makeArray(b0,this)},selector:"",jquery:"1.7.1",length:0,size:function(){return this.length},toArray:function(){return bK.call(this,0)},get:function(b0){return b0==null?this.toArray():(b0<0?this[this.length+b0]:this[b0])},pushStack:function(b1,b3,b0){var b2=this.constructor();if(bF.isArray(b1)){bz.apply(b2,b1)}else{bF.merge(b2,b1)}b2.prevObject=this;b2.context=this.context;if(b3==="find"){b2.selector=this.selector+(this.selector?" ":"")+b0}else{if(b3){b2.selector=this.selector+"."+b3+"("+b0+")"}}return b2},each:function(b1,b0){return bF.each(this,b1,b0)},ready:function(b0){bF.bindReady();bC.add(b0);return this},eq:function(b0){b0=+b0;return b0===-1?this.slice(b0):this.slice(b0,b0+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(bK.apply(this,arguments),"slice",bK.call(arguments).join(","))},map:function(b0){return this.pushStack(bF.map(this,function(b2,b1){return b0.call(b2,b1,b2)}))},end:function(){return this.prevObject||this.constructor(null)},push:bz,sort:[].sort,splice:[].splice};bF.fn.init.prototype=bF.fn;bF.extend=bF.fn.extend=function(){var b9,b2,b0,b1,b6,b7,b5=arguments[0]||{},b4=1,b3=arguments.length,b8=false;if(typeof b5==="boolean"){b8=b5;b5=arguments[1]||{};b4=2}if(typeof b5!=="object"&&!bF.isFunction(b5)){b5={}}if(b3===b4){b5=this;--b4}for(;b4<b3;b4++){if((b9=arguments[b4])!=null){for(b2 in b9){b0=b5[b2];b1=b9[b2];if(b5===b1){continue}if(b8&&b1&&(bF.isPlainObject(b1)||(b6=bF.isArray(b1)))){if(b6){b6=false;b7=b0&&bF.isArray(b0)?b0:[]}else{b7=b0&&bF.isPlainObject(b0)?b0:{}}b5[b2]=bF.extend(b8,b7,b1)}else{if(b1!==L){b5[b2]=b1}}}}}return b5};bF.extend({noConflict:function(b0){if(bb.$===bF){bb.$=bH}if(b0&&bb.jQuery===bF){bb.jQuery=bU}return bF},isReady:false,readyWait:1,holdReady:function(b0){if(b0){bF.readyWait++}else{bF.ready(true)}},ready:function(b0){if((b0===true&&!--bF.readyWait)||(b0!==true&&!bF.isReady)){if(!av.body){return setTimeout(bF.ready,1)}bF.isReady=true;if(b0!==true&&--bF.readyWait>0){return}bC.fireWith(av,[bF]);if(bF.fn.trigger){bF(av).trigger("ready").off("ready")}}},bindReady:function(){if(bC){return}bC=bF.Callbacks("once memory");if(av.readyState==="complete"){return setTimeout(bF.ready,1)}if(av.addEventListener){av.addEventListener("DOMContentLoaded",e,false);bb.addEventListener("load",bF.ready,false)}else{if(av.attachEvent){av.attachEvent("onreadystatechange",e);bb.attachEvent("onload",bF.ready);var b0=false;try{b0=bb.frameElement==null}catch(b1){}if(av.documentElement.doScroll&&b0){bw()}}}},isFunction:function(b0){return bF.type(b0)==="function"},isArray:Array.isArray||function(b0){return bF.type(b0)==="array"},isWindow:function(b0){return b0&&typeof b0==="object"&&"setInterval" in b0},isNumeric:function(b0){return !isNaN(parseFloat(b0))&&isFinite(b0)},type:function(b0){return b0==null?String(b0):bx[bL.call(b0)]||"object"},isPlainObject:function(b2){if(!b2||bF.type(b2)!=="object"||b2.nodeType||bF.isWindow(b2)){return false}try{if(b2.constructor&&!bG.call(b2,"constructor")&&!bG.call(b2.constructor.prototype,"isPrototypeOf")){return false}}catch(b1){return false}var b0;for(b0 in b2){}return b0===L||bG.call(b2,b0)},isEmptyObject:function(b1){for(var b0 in b1){return false}return true},error:function(b0){throw new Error(b0)},parseJSON:function(b0){if(typeof b0!=="string"||!b0){return null}b0=bF.trim(b0);if(bb.JSON&&bb.JSON.parse){return bb.JSON.parse(b0)}if(bN.test(b0.replace(bW,"@").replace(bP,"]").replace(bJ,""))){return(new Function("return "+b0))()}bF.error("Invalid JSON: "+b0)},parseXML:function(b2){var b0,b1;try{if(bb.DOMParser){b1=new DOMParser();b0=b1.parseFromString(b2,"text/xml")}else{b0=new ActiveXObject("Microsoft.XMLDOM");b0.async="false";b0.loadXML(b2)}}catch(b3){b0=L}if(!b0||!b0.documentElement||b0.getElementsByTagName("parsererror").length){bF.error("Invalid XML: "+b2)}return b0},noop:function(){},globalEval:function(b0){if(b0&&bM.test(b0)){(bb.execScript||function(b1){bb["eval"].call(bb,b1)})(b0)}},camelCase:function(b0){return b0.replace(bZ,"ms-").replace(bB,bT)},nodeName:function(b1,b0){return b1.nodeName&&b1.nodeName.toUpperCase()===b0.toUpperCase()},each:function(b3,b6,b2){var b1,b4=0,b5=b3.length,b0=b5===L||bF.isFunction(b3);if(b2){if(b0){for(b1 in b3){if(b6.apply(b3[b1],b2)===false){break}}}else{for(;b4<b5;){if(b6.apply(b3[b4++],b2)===false){break}}}}else{if(b0){for(b1 in b3){if(b6.call(b3[b1],b1,b3[b1])===false){break}}}else{for(;b4<b5;){if(b6.call(b3[b4],b4,b3[b4++])===false){break}}}}return b3},trim:bO?function(b0){return b0==null?"":bO.call(b0)}:function(b0){return b0==null?"":b0.toString().replace(bI,"").replace(bE,"")},makeArray:function(b3,b1){var b0=b1||[];if(b3!=null){var b2=bF.type(b3);if(b3.length==null||b2==="string"||b2==="function"||b2==="regexp"||bF.isWindow(b3)){bz.call(b0,b3)}else{bF.merge(b0,b3)}}return b0},inArray:function(b2,b3,b1){var b0;if(b3){if(bv){return bv.call(b3,b2,b1)}b0=b3.length;b1=b1?b1<0?Math.max(0,b0+b1):b1:0;for(;b1<b0;b1++){if(b1 in b3&&b3[b1]===b2){return b1}}}return -1},merge:function(b4,b2){var b3=b4.length,b1=0;if(typeof b2.length==="number"){for(var b0=b2.length;b1<b0;b1++){b4[b3++]=b2[b1]}}else{while(b2[b1]!==L){b4[b3++]=b2[b1++]}}b4.length=b3;return b4},grep:function(b1,b6,b0){var b2=[],b5;b0=!!b0;for(var b3=0,b4=b1.length;b3<b4;b3++){b5=!!b6(b1[b3],b3);if(b0!==b5){b2.push(b1[b3])}}return b2},map:function(b0,b7,b8){var b5,b6,b4=[],b2=0,b1=b0.length,b3=b0 instanceof bF||b1!==L&&typeof b1==="number"&&((b1>0&&b0[0]&&b0[b1-1])||b1===0||bF.isArray(b0));if(b3){for(;b2<b1;b2++){b5=b7(b0[b2],b2,b8);if(b5!=null){b4[b4.length]=b5}}}else{for(b6 in b0){b5=b7(b0[b6],b6,b8);if(b5!=null){b4[b4.length]=b5}}}return b4.concat.apply([],b4)},guid:1,proxy:function(b4,b3){if(typeof b3==="string"){var b2=b4[b3];b3=b4;b4=b2}if(!bF.isFunction(b4)){return L}var b0=bK.call(arguments,2),b1=function(){return b4.apply(b3,b0.concat(bK.call(arguments)))};b1.guid=b4.guid=b4.guid||b1.guid||bF.guid++;return b1},access:function(b0,b8,b6,b2,b5,b7){var b1=b0.length;if(typeof b8==="object"){for(var b3 in b8){bF.access(b0,b3,b8[b3],b2,b5,b6)}return b0}if(b6!==L){b2=!b7&&b2&&bF.isFunction(b6);for(var b4=0;b4<b1;b4++){b5(b0[b4],b8,b2?b6.call(b0[b4],b4,b5(b0[b4],b8)):b6,b7)}return b0}return b1?b5(b0[0],b8):L},now:function(){return(new Date()).getTime()},uaMatch:function(b1){b1=b1.toLowerCase();var b0=by.exec(b1)||bR.exec(b1)||bQ.exec(b1)||b1.indexOf("compatible")<0&&bS.exec(b1)||[];return{browser:b0[1]||"",version:b0[2]||"0"}},sub:function(){function b0(b3,b4){return new b0.fn.init(b3,b4)}bF.extend(true,b0,this);b0.superclass=this;b0.fn=b0.prototype=this();b0.fn.constructor=b0;b0.sub=this.sub;b0.fn.init=function b2(b3,b4){if(b4&&b4 instanceof bF&&!(b4 instanceof b0)){b4=b0(b4)}return bF.fn.init.call(this,b3,b4,b1)};b0.fn.init.prototype=b0.fn;var b1=b0(av);return b0},browser:{}});bF.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(b1,b0){bx["[object "+b0+"]"]=b0.toLowerCase()});bV=bF.uaMatch(bX);if(bV.browser){bF.browser[bV.browser]=true;bF.browser.version=bV.version}if(bF.browser.webkit){bF.browser.safari=true}if(bM.test("\xA0")){bI=/^[\s\xA0]+/;bE=/[\s\xA0]+$/}bD=bF(av);if(av.addEventListener){e=function(){av.removeEventListener("DOMContentLoaded",e,false);bF.ready()}}else{if(av.attachEvent){e=function(){if(av.readyState==="complete"){av.detachEvent("onreadystatechange",e);bF.ready()}}}}function bw(){if(bF.isReady){return}try{av.documentElement.doScroll("left")}catch(b0){setTimeout(bw,1);return}bF.ready()}return bF})();var a2={};function X(e){var bv=a2[e]={},bw,bx;e=e.split(/\s+/);for(bw=0,bx=e.length;bw<bx;bw++){bv[e[bw]]=true}return bv}b.Callbacks=function(bw){bw=bw?(a2[bw]||X(bw)):{};var bB=[],bC=[],bx,by,bv,bz,bA,bE=function(bF){var bG,bJ,bI,bH,bK;for(bG=0,bJ=bF.length;bG<bJ;bG++){bI=bF[bG];bH=b.type(bI);if(bH==="array"){bE(bI)}else{if(bH==="function"){if(!bw.unique||!bD.has(bI)){bB.push(bI)}}}}},e=function(bG,bF){bF=bF||[];bx=!bw.memory||[bG,bF];by=true;bA=bv||0;bv=0;bz=bB.length;for(;bB&&bA<bz;bA++){if(bB[bA].apply(bG,bF)===false&&bw.stopOnFalse){bx=true;break}}by=false;if(bB){if(!bw.once){if(bC&&bC.length){bx=bC.shift();bD.fireWith(bx[0],bx[1])}}else{if(bx===true){bD.disable()}else{bB=[]}}}},bD={add:function(){if(bB){var bF=bB.length;bE(arguments);if(by){bz=bB.length}else{if(bx&&bx!==true){bv=bF;e(bx[0],bx[1])}}}return this},remove:function(){if(bB){var bF=arguments,bH=0,bI=bF.length;for(;bH<bI;bH++){for(var bG=0;bG<bB.length;bG++){if(bF[bH]===bB[bG]){if(by){if(bG<=bz){bz--;if(bG<=bA){bA--}}}bB.splice(bG--,1);if(bw.unique){break}}}}}return this},has:function(bG){if(bB){var bF=0,bH=bB.length;for(;bF<bH;bF++){if(bG===bB[bF]){return true}}}return false},empty:function(){bB=[];return this},disable:function(){bB=bC=bx=L;return this},disabled:function(){return !bB},lock:function(){bC=L;if(!bx||bx===true){bD.disable()}return this},locked:function(){return !bC},fireWith:function(bG,bF){if(bC){if(by){if(!bw.once){bC.push([bG,bF])}}else{if(!(bw.once&&bx)){e(bG,bF)}}}return this},fire:function(){bD.fireWith(this,arguments);return this},fired:function(){return !!bx}};return bD};var aJ=[].slice;b.extend({Deferred:function(by){var bx=b.Callbacks("once memory"),bw=b.Callbacks("once memory"),bv=b.Callbacks("memory"),e="pending",bA={resolve:bx,reject:bw,notify:bv},bC={done:bx.add,fail:bw.add,progress:bv.add,state:function(){return e},isResolved:bx.fired,isRejected:bw.fired,then:function(bE,bD,bF){bB.done(bE).fail(bD).progress(bF);return this},always:function(){bB.done.apply(bB,arguments).fail.apply(bB,arguments);return this},pipe:function(bF,bE,bD){return b.Deferred(function(bG){b.each({done:[bF,"resolve"],fail:[bE,"reject"],progress:[bD,"notify"]},function(bI,bL){var bH=bL[0],bK=bL[1],bJ;if(b.isFunction(bH)){bB[bI](function(){bJ=bH.apply(this,arguments);if(bJ&&b.isFunction(bJ.promise)){bJ.promise().then(bG.resolve,bG.reject,bG.notify)}else{bG[bK+"With"](this===bB?bG:this,[bJ])}})}else{bB[bI](bG[bK])}})}).promise()},promise:function(bE){if(bE==null){bE=bC}else{for(var bD in bC){bE[bD]=bC[bD]}}return bE}},bB=bC.promise({}),bz;for(bz in bA){bB[bz]=bA[bz].fire;bB[bz+"With"]=bA[bz].fireWith}bB.done(function(){e="resolved"},bw.disable,bv.lock).fail(function(){e="rejected"},bx.disable,bv.lock);if(by){by.call(bB,bB)}return bB},when:function(bA){var bx=aJ.call(arguments,0),bv=0,e=bx.length,bB=new Array(e),bw=e,by=e,bC=e<=1&&bA&&b.isFunction(bA.promise)?bA:b.Deferred(),bE=bC.promise();function bD(bF){return function(bG){bx[bF]=arguments.length>1?aJ.call(arguments,0):bG;if(!(--bw)){bC.resolveWith(bC,bx)}}}function bz(bF){return function(bG){bB[bF]=arguments.length>1?aJ.call(arguments,0):bG;bC.notifyWith(bE,bB)}}if(e>1){for(;bv<e;bv++){if(bx[bv]&&bx[bv].promise&&b.isFunction(bx[bv].promise)){bx[bv].promise().then(bD(bv),bC.reject,bz(bv))}else{--bw}}if(!bw){bC.resolveWith(bC,bx)}}else{if(bC!==bA){bC.resolveWith(bC,e?[bA]:[])}}return bE}});b.support=(function(){var bJ,bI,bF,bG,bx,bE,bA,bD,bz,bK,bB,by,bw,bv=av.createElement("div"),bH=av.documentElement;bv.setAttribute("className","t");bv.innerHTML=" <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>";bI=bv.getElementsByTagName("*");bF=bv.getElementsByTagName("a")[0];if(!bI||!bI.length||!bF){return{}}bG=av.createElement("select");bx=bG.appendChild(av.createElement("option"));bE=bv.getElementsByTagName("input")[0];bJ={leadingWhitespace:(bv.firstChild.nodeType===3),tbody:!bv.getElementsByTagName("tbody").length,htmlSerialize:!!bv.getElementsByTagName("link").length,style:/top/.test(bF.getAttribute("style")),hrefNormalized:(bF.getAttribute("href")==="/a"),opacity:/^0.55/.test(bF.style.opacity),cssFloat:!!bF.style.cssFloat,checkOn:(bE.value==="on"),optSelected:bx.selected,getSetAttribute:bv.className!=="t",enctype:!!av.createElement("form").enctype,html5Clone:av.createElement("nav").cloneNode(true).outerHTML!=="<:nav></:nav>",submitBubbles:true,changeBubbles:true,focusinBubbles:false,deleteExpando:true,noCloneEvent:true,inlineBlockNeedsLayout:false,shrinkWrapBlocks:false,reliableMarginRight:true};bE.checked=true;bJ.noCloneChecked=bE.cloneNode(true).checked;bG.disabled=true;bJ.optDisabled=!bx.disabled;try{delete bv.test}catch(bC){bJ.deleteExpando=false}if(!bv.addEventListener&&bv.attachEvent&&bv.fireEvent){bv.attachEvent("onclick",function(){bJ.noCloneEvent=false});bv.cloneNode(true).fireEvent("onclick")}bE=av.createElement("input");bE.value="t";bE.setAttribute("type","radio");bJ.radioValue=bE.value==="t";bE.setAttribute("checked","checked");bv.appendChild(bE);bD=av.createDocumentFragment();bD.appendChild(bv.lastChild);bJ.checkClone=bD.cloneNode(true).cloneNode(true).lastChild.checked;bJ.appendChecked=bE.checked;bD.removeChild(bE);bD.appendChild(bv);bv.innerHTML="";if(bb.getComputedStyle){bA=av.createElement("div");bA.style.width="0";bA.style.marginRight="0";bv.style.width="2px";bv.appendChild(bA);bJ.reliableMarginRight=(parseInt((bb.getComputedStyle(bA,null)||{marginRight:0}).marginRight,10)||0)===0}if(bv.attachEvent){for(by in {submit:1,change:1,focusin:1}){bB="on"+by;bw=(bB in bv);if(!bw){bv.setAttribute(bB,"return;");bw=(typeof bv[bB]==="function")}bJ[by+"Bubbles"]=bw}}bD.removeChild(bv);bD=bG=bx=bA=bv=bE=null;b(function(){var bM,bU,bV,bT,bN,bO,bL,bS,bR,e,bP,bQ=av.getElementsByTagName("body")[0];if(!bQ){return}bL=1;bS="position:absolute;top:0;left:0;width:1px;height:1px;margin:0;";bR="visibility:hidden;border:0;";e="style='"+bS+"border:5px solid #000;padding:0;'";bP="<div "+e+"><div></div></div><table "+e+" cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";bM=av.createElement("div");bM.style.cssText=bR+"width:0;height:0;position:static;top:0;margin-top:"+bL+"px";bQ.insertBefore(bM,bQ.firstChild);bv=av.createElement("div");bM.appendChild(bv);bv.innerHTML="<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>";bz=bv.getElementsByTagName("td");bw=(bz[0].offsetHeight===0);bz[0].style.display="";bz[1].style.display="none";bJ.reliableHiddenOffsets=bw&&(bz[0].offsetHeight===0);bv.innerHTML="";bv.style.width=bv.style.paddingLeft="1px";b.boxModel=bJ.boxModel=bv.offsetWidth===2;if(typeof bv.style.zoom!=="undefined"){bv.style.display="inline";bv.style.zoom=1;bJ.inlineBlockNeedsLayout=(bv.offsetWidth===2);bv.style.display="";bv.innerHTML="<div style='width:4px;'></div>";bJ.shrinkWrapBlocks=(bv.offsetWidth!==2)}bv.style.cssText=bS+bR;bv.innerHTML=bP;bU=bv.firstChild;bV=bU.firstChild;bN=bU.nextSibling.firstChild.firstChild;bO={doesNotAddBorder:(bV.offsetTop!==5),doesAddBorderForTableAndCells:(bN.offsetTop===5)};bV.style.position="fixed";bV.style.top="20px";bO.fixedPosition=(bV.offsetTop===20||bV.offsetTop===15);bV.style.position=bV.style.top="";bU.style.overflow="hidden";bU.style.position="relative";bO.subtractsBorderForOverflowNotVisible=(bV.offsetTop===-5);bO.doesNotIncludeMarginInBodyOffset=(bQ.offsetTop!==bL);bQ.removeChild(bM);bv=bM=null;b.extend(bJ,bO)});return bJ})();var aS=/^(?:\{.*\}|\[.*\])$/,aA=/([A-Z])/g;b.extend({cache:{},uuid:0,expando:"jQuery"+(b.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:true,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:true},hasData:function(e){e=e.nodeType?b.cache[e[b.expando]]:e[b.expando];return !!e&&!S(e)},data:function(bx,bv,bz,by){if(!b.acceptData(bx)){return}var bG,bA,bD,bE=b.expando,bC=typeof bv==="string",bF=bx.nodeType,e=bF?b.cache:bx,bw=bF?bx[bE]:bx[bE]&&bE,bB=bv==="events";if((!bw||!e[bw]||(!bB&&!by&&!e[bw].data))&&bC&&bz===L){return}if(!bw){if(bF){bx[bE]=bw=++b.uuid}else{bw=bE}}if(!e[bw]){e[bw]={};if(!bF){e[bw].toJSON=b.noop}}if(typeof bv==="object"||typeof bv==="function"){if(by){e[bw]=b.extend(e[bw],bv)}else{e[bw].data=b.extend(e[bw].data,bv)}}bG=bA=e[bw];if(!by){if(!bA.data){bA.data={}}bA=bA.data}if(bz!==L){bA[b.camelCase(bv)]=bz}if(bB&&!bA[bv]){return bG.events}if(bC){bD=bA[bv];if(bD==null){bD=bA[b.camelCase(bv)]}}else{bD=bA}return bD},removeData:function(bx,bv,by){if(!b.acceptData(bx)){return}var bB,bA,bz,bC=b.expando,bD=bx.nodeType,e=bD?b.cache:bx,bw=bD?bx[bC]:bC;if(!e[bw]){return}if(bv){bB=by?e[bw]:e[bw].data;if(bB){if(!b.isArray(bv)){if(bv in bB){bv=[bv]}else{bv=b.camelCase(bv);if(bv in bB){bv=[bv]}else{bv=bv.split(" ")}}}for(bA=0,bz=bv.length;bA<bz;bA++){delete bB[bv[bA]]}if(!(by?S:b.isEmptyObject)(bB)){return}}}if(!by){delete e[bw].data;if(!S(e[bw])){return}}if(b.support.deleteExpando||!e.setInterval){delete e[bw]}else{e[bw]=null}if(bD){if(b.support.deleteExpando){delete bx[bC]}else{if(bx.removeAttribute){bx.removeAttribute(bC)}else{bx[bC]=null}}}},_data:function(bv,e,bw){return b.data(bv,e,bw,true)},acceptData:function(bv){if(bv.nodeName){var e=b.noData[bv.nodeName.toLowerCase()];if(e){return !(e===true||bv.getAttribute("classid")!==e)}}return true}});b.fn.extend({data:function(by,bA){var bB,e,bw,bz=null;if(typeof by==="undefined"){if(this.length){bz=b.data(this[0]);if(this[0].nodeType===1&&!b._data(this[0],"parsedAttrs")){e=this[0].attributes;for(var bx=0,bv=e.length;bx<bv;bx++){bw=e[bx].name;if(bw.indexOf("data-")===0){bw=b.camelCase(bw.substring(5));a5(this[0],bw,bz[bw])}}b._data(this[0],"parsedAttrs",true)}}return bz}else{if(typeof by==="object"){return this.each(function(){b.data(this,by)})}}bB=by.split(".");bB[1]=bB[1]?"."+bB[1]:"";if(bA===L){bz=this.triggerHandler("getData"+bB[1]+"!",[bB[0]]);if(bz===L&&this.length){bz=b.data(this[0],by);bz=a5(this[0],by,bz)}return bz===L&&bB[1]?this.data(bB[0]):bz}else{return this.each(function(){var bC=b(this),bD=[bB[0],bA];bC.triggerHandler("setData"+bB[1]+"!",bD);b.data(this,by,bA);bC.triggerHandler("changeData"+bB[1]+"!",bD)})}},removeData:function(e){return this.each(function(){b.removeData(this,e)})}});function a5(bx,bw,by){if(by===L&&bx.nodeType===1){var bv="data-"+bw.replace(aA,"-$1").toLowerCase();by=bx.getAttribute(bv);if(typeof by==="string"){try{by=by==="true"?true:by==="false"?false:by==="null"?null:b.isNumeric(by)?parseFloat(by):aS.test(by)?b.parseJSON(by):by}catch(bz){}b.data(bx,bw,by)}else{by=L}}return by}function S(bv){for(var e in bv){if(e==="data"&&b.isEmptyObject(bv[e])){continue}if(e!=="toJSON"){return false}}return true}function bi(by,bx,bA){var bw=bx+"defer",bv=bx+"queue",e=bx+"mark",bz=b._data(by,bw);if(bz&&(bA==="queue"||!b._data(by,bv))&&(bA==="mark"||!b._data(by,e))){setTimeout(function(){if(!b._data(by,bv)&&!b._data(by,e)){b.removeData(by,bw,true);bz.fire()}},0)}}b.extend({_mark:function(bv,e){if(bv){e=(e||"fx")+"mark";b._data(bv,e,(b._data(bv,e)||0)+1)}},_unmark:function(by,bx,bv){if(by!==true){bv=bx;bx=by;by=false}if(bx){bv=bv||"fx";var e=bv+"mark",bw=by?0:((b._data(bx,e)||1)-1);if(bw){b._data(bx,e,bw)}else{b.removeData(bx,e,true);bi(bx,bv,"mark")}}},queue:function(bv,e,bx){var bw;if(bv){e=(e||"fx")+"queue";bw=b._data(bv,e);if(bx){if(!bw||b.isArray(bx)){bw=b._data(bv,e,b.makeArray(bx))}else{bw.push(bx)}}return bw||[]}},dequeue:function(by,bx){bx=bx||"fx";var bv=b.queue(by,bx),bw=bv.shift(),e={};if(bw==="inprogress"){bw=bv.shift()}if(bw){if(bx==="fx"){bv.unshift("inprogress")}b._data(by,bx+".run",e);bw.call(by,function(){b.dequeue(by,bx)},e)}if(!bv.length){b.removeData(by,bx+"queue "+bx+".run",true);bi(by,bx,"queue")}}});b.fn.extend({queue:function(e,bv){if(typeof e!=="string"){bv=e;e="fx"}if(bv===L){return b.queue(this[0],e)}return this.each(function(){var bw=b.queue(this,e,bv);if(e==="fx"&&bw[0]!=="inprogress"){b.dequeue(this,e)}})},dequeue:function(e){return this.each(function(){b.dequeue(this,e)})},delay:function(bv,e){bv=b.fx?b.fx.speeds[bv]||bv:bv;e=e||"fx";return this.queue(e,function(bx,bw){var by=setTimeout(bx,bv);bw.stop=function(){clearTimeout(by)}})},clearQueue:function(e){return this.queue(e||"fx",[])},promise:function(bD,bw){if(typeof bD!=="string"){bw=bD;bD=L}bD=bD||"fx";var e=b.Deferred(),bv=this,by=bv.length,bB=1,bz=bD+"defer",bA=bD+"queue",bC=bD+"mark",bx;function bE(){if(!(--bB)){e.resolveWith(bv,[bv])}}while(by--){if((bx=b.data(bv[by],bz,L,true)||(b.data(bv[by],bA,L,true)||b.data(bv[by],bC,L,true))&&b.data(bv[by],bz,b.Callbacks("once memory"),true))){bB++;bx.add(bE)}}bE();return e.promise()}});var aP=/[\n\t\r]/g,af=/\s+/,aU=/\r/g,g=/^(?:button|input)$/i,D=/^(?:button|input|object|select|textarea)$/i,l=/^a(?:rea)?$/i,ao=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,F=b.support.getSetAttribute,be,aY,aF;b.fn.extend({attr:function(e,bv){return b.access(this,e,bv,true,b.attr)},removeAttr:function(e){return this.each(function(){b.removeAttr(this,e)})},prop:function(e,bv){return b.access(this,e,bv,true,b.prop)},removeProp:function(e){e=b.propFix[e]||e;return this.each(function(){try{this[e]=L;delete this[e]}catch(bv){}})},addClass:function(by){var bA,bw,bv,bx,bz,bB,e;if(b.isFunction(by)){return this.each(function(bC){b(this).addClass(by.call(this,bC,this.className))})}if(by&&typeof by==="string"){bA=by.split(af);for(bw=0,bv=this.length;bw<bv;bw++){bx=this[bw];if(bx.nodeType===1){if(!bx.className&&bA.length===1){bx.className=by}else{bz=" "+bx.className+" ";for(bB=0,e=bA.length;bB<e;bB++){if(!~bz.indexOf(" "+bA[bB]+" ")){bz+=bA[bB]+" "}}bx.className=b.trim(bz)}}}}return this},removeClass:function(bz){var bA,bw,bv,by,bx,bB,e;if(b.isFunction(bz)){return this.each(function(bC){b(this).removeClass(bz.call(this,bC,this.className))})}if((bz&&typeof bz==="string")||bz===L){bA=(bz||"").split(af);for(bw=0,bv=this.length;bw<bv;bw++){by=this[bw];if(by.nodeType===1&&by.className){if(bz){bx=(" "+by.className+" ").replace(aP," ");for(bB=0,e=bA.length;bB<e;bB++){bx=bx.replace(" "+bA[bB]+" "," ")}by.className=b.trim(bx)}else{by.className=""}}}}return this},toggleClass:function(bx,bv){var bw=typeof bx,e=typeof bv==="boolean";if(b.isFunction(bx)){return this.each(function(by){b(this).toggleClass(bx.call(this,by,this.className,bv),bv)})}return this.each(function(){if(bw==="string"){var bA,bz=0,by=b(this),bB=bv,bC=bx.split(af);while((bA=bC[bz++])){bB=e?bB:!by.hasClass(bA);by[bB?"addClass":"removeClass"](bA)}}else{if(bw==="undefined"||bw==="boolean"){if(this.className){b._data(this,"__className__",this.className)}this.className=this.className||bx===false?"":b._data(this,"__className__")||""}}})},hasClass:function(e){var bx=" "+e+" ",bw=0,bv=this.length;for(;bw<bv;bw++){if(this[bw].nodeType===1&&(" "+this[bw].className+" ").replace(aP," ").indexOf(bx)>-1){return true}}return false},val:function(bx){var e,bv,by,bw=this[0];if(!arguments.length){if(bw){e=b.valHooks[bw.nodeName.toLowerCase()]||b.valHooks[bw.type];if(e&&"get" in e&&(bv=e.get(bw,"value"))!==L){return bv}bv=bw.value;return typeof bv==="string"?bv.replace(aU,""):bv==null?"":bv}return}by=b.isFunction(bx);return this.each(function(bA){var bz=b(this),bB;if(this.nodeType!==1){return}if(by){bB=bx.call(this,bA,bz.val())}else{bB=bx}if(bB==null){bB=""}else{if(typeof bB==="number"){bB+=""}else{if(b.isArray(bB)){bB=b.map(bB,function(bC){return bC==null?"":bC+""})}}}e=b.valHooks[this.nodeName.toLowerCase()]||b.valHooks[this.type];if(!e||!("set" in e)||e.set(this,bB,"value")===L){this.value=bB}})}});b.extend({valHooks:{option:{get:function(e){var bv=e.attributes.value;return !bv||bv.specified?e.value:e.text}},select:{get:function(e){var bA,bv,bz,bx,by=e.selectedIndex,bB=[],bC=e.options,bw=e.type==="select-one";if(by<0){return null}bv=bw?by:0;bz=bw?by+1:bC.length;for(;bv<bz;bv++){bx=bC[bv];if(bx.selected&&(b.support.optDisabled?!bx.disabled:bx.getAttribute("disabled")===null)&&(!bx.parentNode.disabled||!b.nodeName(bx.parentNode,"optgroup"))){bA=b(bx).val();if(bw){return bA}bB.push(bA)}}if(bw&&!bB.length&&bC.length){return b(bC[by]).val()}return bB},set:function(bv,bw){var e=b.makeArray(bw);b(bv).find("option").each(function(){this.selected=b.inArray(b(this).val(),e)>=0});if(!e.length){bv.selectedIndex=-1}return e}}},attrFn:{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true},attr:function(bA,bx,bB,bz){var bw,e,by,bv=bA.nodeType;if(!bA||bv===3||bv===8||bv===2){return}if(bz&&bx in b.attrFn){return b(bA)[bx](bB)}if(typeof bA.getAttribute==="undefined"){return b.prop(bA,bx,bB)}by=bv!==1||!b.isXMLDoc(bA);if(by){bx=bx.toLowerCase();e=b.attrHooks[bx]||(ao.test(bx)?aY:be)}if(bB!==L){if(bB===null){b.removeAttr(bA,bx);return}else{if(e&&"set" in e&&by&&(bw=e.set(bA,bB,bx))!==L){return bw}else{bA.setAttribute(bx,""+bB);return bB}}}else{if(e&&"get" in e&&by&&(bw=e.get(bA,bx))!==null){return bw}else{bw=bA.getAttribute(bx);return bw===null?L:bw}}},removeAttr:function(bx,bz){var by,bA,bv,e,bw=0;if(bz&&bx.nodeType===1){bA=bz.toLowerCase().split(af);e=bA.length;for(;bw<e;bw++){bv=bA[bw];if(bv){by=b.propFix[bv]||bv;b.attr(bx,bv,"");bx.removeAttribute(F?bv:by);if(ao.test(bv)&&by in bx){bx[by]=false}}}}},attrHooks:{type:{set:function(e,bv){if(g.test(e.nodeName)&&e.parentNode){b.error("type property can't be changed")}else{if(!b.support.radioValue&&bv==="radio"&&b.nodeName(e,"input")){var bw=e.value;e.setAttribute("type",bv);if(bw){e.value=bw}return bv}}}},value:{get:function(bv,e){if(be&&b.nodeName(bv,"button")){return be.get(bv,e)}return e in bv?bv.value:null},set:function(bv,bw,e){if(be&&b.nodeName(bv,"button")){return be.set(bv,bw,e)}bv.value=bw}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(bz,bx,bA){var bw,e,by,bv=bz.nodeType;if(!bz||bv===3||bv===8||bv===2){return}by=bv!==1||!b.isXMLDoc(bz);if(by){bx=b.propFix[bx]||bx;e=b.propHooks[bx]}if(bA!==L){if(e&&"set" in e&&(bw=e.set(bz,bA,bx))!==L){return bw}else{return(bz[bx]=bA)}}else{if(e&&"get" in e&&(bw=e.get(bz,bx))!==null){return bw}else{return bz[bx]}}},propHooks:{tabIndex:{get:function(bv){var e=bv.getAttributeNode("tabindex");return e&&e.specified?parseInt(e.value,10):D.test(bv.nodeName)||l.test(bv.nodeName)&&bv.href?0:L}}}});b.attrHooks.tabindex=b.propHooks.tabIndex;aY={get:function(bv,e){var bx,bw=b.prop(bv,e);return bw===true||typeof bw!=="boolean"&&(bx=bv.getAttributeNode(e))&&bx.nodeValue!==false?e.toLowerCase():L},set:function(bv,bx,e){var bw;if(bx===false){b.removeAttr(bv,e)}else{bw=b.propFix[e]||e;if(bw in bv){bv[bw]=true}bv.setAttribute(e,e.toLowerCase())}return e}};if(!F){aF={name:true,id:true};be=b.valHooks.button={get:function(bw,bv){var e;e=bw.getAttributeNode(bv);return e&&(aF[bv]?e.nodeValue!=="":e.specified)?e.nodeValue:L},set:function(bw,bx,bv){var e=bw.getAttributeNode(bv);if(!e){e=av.createAttribute(bv);bw.setAttributeNode(e)}return(e.nodeValue=bx+"")}};b.attrHooks.tabindex.set=be.set;b.each(["width","height"],function(bv,e){b.attrHooks[e]=b.extend(b.attrHooks[e],{set:function(bw,bx){if(bx===""){bw.setAttribute(e,"auto");return bx}}})});b.attrHooks.contenteditable={get:be.get,set:function(bv,bw,e){if(bw===""){bw="false"}be.set(bv,bw,e)}}}if(!b.support.hrefNormalized){b.each(["href","src","width","height"],function(bv,e){b.attrHooks[e]=b.extend(b.attrHooks[e],{get:function(bx){var bw=bx.getAttribute(e,2);return bw===null?L:bw}})})}if(!b.support.style){b.attrHooks.style={get:function(e){return e.style.cssText.toLowerCase()||L},set:function(e,bv){return(e.style.cssText=""+bv)}}}if(!b.support.optSelected){b.propHooks.selected=b.extend(b.propHooks.selected,{get:function(bv){var e=bv.parentNode;if(e){e.selectedIndex;if(e.parentNode){e.parentNode.selectedIndex}}return null}})}if(!b.support.enctype){b.propFix.enctype="encoding"}if(!b.support.checkOn){b.each(["radio","checkbox"],function(){b.valHooks[this]={get:function(e){return e.getAttribute("value")===null?"on":e.value}}})}b.each(["radio","checkbox"],function(){b.valHooks[this]=b.extend(b.valHooks[this],{set:function(e,bv){if(b.isArray(bv)){return(e.checked=b.inArray(b(e).val(),bv)>=0)}}})});var bd=/^(?:textarea|input|select)$/i,n=/^([^\.]*)?(?:\.(.+))?$/,J=/\bhover(\.\S+)?\b/,aO=/^key/,bf=/^(?:mouse|contextmenu)|click/,T=/^(?:focusinfocus|focusoutblur)$/,U=/^(\w*)(?:#([\w\-]+))?(?:\.([\w\-]+))?$/,Y=function(e){var bv=U.exec(e);if(bv){bv[1]=(bv[1]||"").toLowerCase();bv[3]=bv[3]&&new RegExp("(?:^|\\s)"+bv[3]+"(?:\\s|$)")}return bv},j=function(bw,e){var bv=bw.attributes||{};return((!e[1]||bw.nodeName.toLowerCase()===e[1])&&(!e[2]||(bv.id||{}).value===e[2])&&(!e[3]||e[3].test((bv["class"]||{}).value)))},bt=function(e){return b.event.special.hover?e:e.replace(J,"mouseenter$1 mouseleave$1")};b.event={add:function(bx,bC,bJ,bA,by){var bD,bB,bK,bI,bH,bF,e,bG,bv,bz,bw,bE;if(bx.nodeType===3||bx.nodeType===8||!bC||!bJ||!(bD=b._data(bx))){return}if(bJ.handler){bv=bJ;bJ=bv.handler}if(!bJ.guid){bJ.guid=b.guid++}bK=bD.events;if(!bK){bD.events=bK={}}bB=bD.handle;if(!bB){bD.handle=bB=function(bL){return typeof b!=="undefined"&&(!bL||b.event.triggered!==bL.type)?b.event.dispatch.apply(bB.elem,arguments):L};bB.elem=bx}bC=b.trim(bt(bC)).split(" ");for(bI=0;bI<bC.length;bI++){bH=n.exec(bC[bI])||[];bF=bH[1];e=(bH[2]||"").split(".").sort();bE=b.event.special[bF]||{};bF=(by?bE.delegateType:bE.bindType)||bF;bE=b.event.special[bF]||{};bG=b.extend({type:bF,origType:bH[1],data:bA,handler:bJ,guid:bJ.guid,selector:by,quick:Y(by),namespace:e.join(".")},bv);bw=bK[bF];if(!bw){bw=bK[bF]=[];bw.delegateCount=0;if(!bE.setup||bE.setup.call(bx,bA,e,bB)===false){if(bx.addEventListener){bx.addEventListener(bF,bB,false)}else{if(bx.attachEvent){bx.attachEvent("on"+bF,bB)}}}}if(bE.add){bE.add.call(bx,bG);if(!bG.handler.guid){bG.handler.guid=bJ.guid}}if(by){bw.splice(bw.delegateCount++,0,bG)}else{bw.push(bG)}b.event.global[bF]=true}bx=null},global:{},remove:function(bJ,bE,bv,bH,bB){var bI=b.hasData(bJ)&&b._data(bJ),bF,bx,bz,bL,bC,bA,bG,bw,by,bK,bD,e;if(!bI||!(bw=bI.events)){return}bE=b.trim(bt(bE||"")).split(" ");for(bF=0;bF<bE.length;bF++){bx=n.exec(bE[bF])||[];bz=bL=bx[1];bC=bx[2];if(!bz){for(bz in bw){b.event.remove(bJ,bz+bE[bF],bv,bH,true)}continue}by=b.event.special[bz]||{};bz=(bH?by.delegateType:by.bindType)||bz;bD=bw[bz]||[];bA=bD.length;bC=bC?new RegExp("(^|\\.)"+bC.split(".").sort().join("\\.(?:.*\\.)?")+"(\\.|$)"):null;for(bG=0;bG<bD.length;bG++){e=bD[bG];if((bB||bL===e.origType)&&(!bv||bv.guid===e.guid)&&(!bC||bC.test(e.namespace))&&(!bH||bH===e.selector||bH==="**"&&e.selector)){bD.splice(bG--,1);if(e.selector){bD.delegateCount--}if(by.remove){by.remove.call(bJ,e)}}}if(bD.length===0&&bA!==bD.length){if(!by.teardown||by.teardown.call(bJ,bC)===false){b.removeEvent(bJ,bz,bI.handle)}delete bw[bz]}}if(b.isEmptyObject(bw)){bK=bI.handle;if(bK){bK.elem=null}b.removeData(bJ,["events","handle"],true)}},customEvent:{getData:true,setData:true,changeData:true},trigger:function(bv,bD,bA,bJ){if(bA&&(bA.nodeType===3||bA.nodeType===8)){return}var bG=bv.type||bv,bx=[],e,bw,bC,bH,bz,by,bF,bE,bB,bI;if(T.test(bG+b.event.triggered)){return}if(bG.indexOf("!")>=0){bG=bG.slice(0,-1);bw=true}if(bG.indexOf(".")>=0){bx=bG.split(".");bG=bx.shift();bx.sort()}if((!bA||b.event.customEvent[bG])&&!b.event.global[bG]){return}bv=typeof bv==="object"?bv[b.expando]?bv:new b.Event(bG,bv):new b.Event(bG);bv.type=bG;bv.isTrigger=true;bv.exclusive=bw;bv.namespace=bx.join(".");bv.namespace_re=bv.namespace?new RegExp("(^|\\.)"+bx.join("\\.(?:.*\\.)?")+"(\\.|$)"):null;by=bG.indexOf(":")<0?"on"+bG:"";if(!bA){e=b.cache;for(bC in e){if(e[bC].events&&e[bC].events[bG]){b.event.trigger(bv,bD,e[bC].handle.elem,true)}}return}bv.result=L;if(!bv.target){bv.target=bA}bD=bD!=null?b.makeArray(bD):[];bD.unshift(bv);bF=b.event.special[bG]||{};if(bF.trigger&&bF.trigger.apply(bA,bD)===false){return}bB=[[bA,bF.bindType||bG]];if(!bJ&&!bF.noBubble&&!b.isWindow(bA)){bI=bF.delegateType||bG;bH=T.test(bI+bG)?bA:bA.parentNode;bz=null;for(;bH;bH=bH.parentNode){bB.push([bH,bI]);bz=bH}if(bz&&bz===bA.ownerDocument){bB.push([bz.defaultView||bz.parentWindow||bb,bI])}}for(bC=0;bC<bB.length&&!bv.isPropagationStopped();bC++){bH=bB[bC][0];bv.type=bB[bC][1];bE=(b._data(bH,"events")||{})[bv.type]&&b._data(bH,"handle");if(bE){bE.apply(bH,bD)}bE=by&&bH[by];if(bE&&b.acceptData(bH)&&bE.apply(bH,bD)===false){bv.preventDefault()}}bv.type=bG;if(!bJ&&!bv.isDefaultPrevented()){if((!bF._default||bF._default.apply(bA.ownerDocument,bD)===false)&&!(bG==="click"&&b.nodeName(bA,"a"))&&b.acceptData(bA)){if(by&&bA[bG]&&((bG!=="focus"&&bG!=="blur")||bv.target.offsetWidth!==0)&&!b.isWindow(bA)){bz=bA[by];if(bz){bA[by]=null}b.event.triggered=bG;bA[bG]();b.event.triggered=L;if(bz){bA[by]=bz}}}}return bv.result},dispatch:function(e){e=b.event.fix(e||bb.event);var bz=((b._data(this,"events")||{})[e.type]||[]),bA=bz.delegateCount,bG=[].slice.call(arguments,0),by=!e.exclusive&&!e.namespace,bH=[],bC,bB,bK,bx,bF,bE,bv,bD,bI,bw,bJ;bG[0]=e;e.delegateTarget=this;if(bA&&!e.target.disabled&&!(e.button&&e.type==="click")){bx=b(this);bx.context=this.ownerDocument||this;for(bK=e.target;bK!=this;bK=bK.parentNode||this){bE={};bD=[];bx[0]=bK;for(bC=0;bC<bA;bC++){bI=bz[bC];bw=bI.selector;if(bE[bw]===L){bE[bw]=(bI.quick?j(bK,bI.quick):bx.is(bw))}if(bE[bw]){bD.push(bI)}}if(bD.length){bH.push({elem:bK,matches:bD})}}}if(bz.length>bA){bH.push({elem:this,matches:bz.slice(bA)})}for(bC=0;bC<bH.length&&!e.isPropagationStopped();bC++){bv=bH[bC];e.currentTarget=bv.elem;for(bB=0;bB<bv.matches.length&&!e.isImmediatePropagationStopped();bB++){bI=bv.matches[bB];if(by||(!e.namespace&&!bI.namespace)||e.namespace_re&&e.namespace_re.test(bI.namespace)){e.data=bI.data;e.handleObj=bI;bF=((b.event.special[bI.origType]||{}).handle||bI.handler).apply(bv.elem,bG);if(bF!==L){e.result=bF;if(bF===false){e.preventDefault();e.stopPropagation()}}}}}return e.result},props:"attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),fixHooks:{},keyHooks:{props:"char charCode key keyCode".split(" "),filter:function(bv,e){if(bv.which==null){bv.which=e.charCode!=null?e.charCode:e.keyCode}return bv}},mouseHooks:{props:"button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),filter:function(bx,bw){var by,bz,e,bv=bw.button,bA=bw.fromElement;if(bx.pageX==null&&bw.clientX!=null){by=bx.target.ownerDocument||av;bz=by.documentElement;e=by.body;bx.pageX=bw.clientX+(bz&&bz.scrollLeft||e&&e.scrollLeft||0)-(bz&&bz.clientLeft||e&&e.clientLeft||0);bx.pageY=bw.clientY+(bz&&bz.scrollTop||e&&e.scrollTop||0)-(bz&&bz.clientTop||e&&e.clientTop||0)}if(!bx.relatedTarget&&bA){bx.relatedTarget=bA===bx.target?bw.toElement:bA}if(!bx.which&&bv!==L){bx.which=(bv&1?1:(bv&2?3:(bv&4?2:0)))}return bx}},fix:function(bw){if(bw[b.expando]){return bw}var bv,bz,e=bw,bx=b.event.fixHooks[bw.type]||{},by=bx.props?this.props.concat(bx.props):this.props;bw=b.Event(e);for(bv=by.length;bv;){bz=by[--bv];bw[bz]=e[bz]}if(!bw.target){bw.target=e.srcElement||av}if(bw.target.nodeType===3){bw.target=bw.target.parentNode}if(bw.metaKey===L){bw.metaKey=bw.ctrlKey}return bx.filter?bx.filter(bw,e):bw},special:{ready:{setup:b.bindReady},load:{noBubble:true},focus:{delegateType:"focusin"},blur:{delegateType:"focusout"},beforeunload:{setup:function(bw,bv,e){if(b.isWindow(this)){this.onbeforeunload=e}},teardown:function(bv,e){if(this.onbeforeunload===e){this.onbeforeunload=null}}}},simulate:function(bw,by,bx,bv){var bz=b.extend(new b.Event(),bx,{type:bw,isSimulated:true,originalEvent:{}});if(bv){b.event.trigger(bz,null,by)}else{b.event.dispatch.call(by,bz)}if(bz.isDefaultPrevented()){bx.preventDefault()}}};b.event.handle=b.event.dispatch;b.removeEvent=av.removeEventListener?function(bv,e,bw){if(bv.removeEventListener){bv.removeEventListener(e,bw,false)}}:function(bv,e,bw){if(bv.detachEvent){bv.detachEvent("on"+e,bw)}};b.Event=function(bv,e){if(!(this instanceof b.Event)){return new b.Event(bv,e)}if(bv&&bv.type){this.originalEvent=bv;this.type=bv.type;this.isDefaultPrevented=(bv.defaultPrevented||bv.returnValue===false||bv.getPreventDefault&&bv.getPreventDefault())?i:bk}else{this.type=bv}if(e){b.extend(this,e)}this.timeStamp=bv&&bv.timeStamp||b.now();this[b.expando]=true};function bk(){return false}function i(){return true}b.Event.prototype={preventDefault:function(){this.isDefaultPrevented=i;var bv=this.originalEvent;if(!bv){return}if(bv.preventDefault){bv.preventDefault()}else{bv.returnValue=false}},stopPropagation:function(){this.isPropagationStopped=i;var bv=this.originalEvent;if(!bv){return}if(bv.stopPropagation){bv.stopPropagation()}bv.cancelBubble=true},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=i;this.stopPropagation()},isDefaultPrevented:bk,isPropagationStopped:bk,isImmediatePropagationStopped:bk};b.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(bv,e){b.event.special[bv]={delegateType:e,bindType:e,handle:function(bz){var bB=this,bA=bz.relatedTarget,by=bz.handleObj,bw=by.selector,bx;if(!bA||(bA!==bB&&!b.contains(bB,bA))){bz.type=by.origType;bx=by.handler.apply(this,arguments);bz.type=e}return bx}}});if(!b.support.submitBubbles){b.event.special.submit={setup:function(){if(b.nodeName(this,"form")){return false}b.event.add(this,"click._submit keypress._submit",function(bx){var bw=bx.target,bv=b.nodeName(bw,"input")||b.nodeName(bw,"button")?bw.form:L;if(bv&&!bv._submit_attached){b.event.add(bv,"submit._submit",function(e){if(this.parentNode&&!e.isTrigger){b.event.simulate("submit",this.parentNode,e,true)}});bv._submit_attached=true}})},teardown:function(){if(b.nodeName(this,"form")){return false}b.event.remove(this,"._submit")}}}if(!b.support.changeBubbles){b.event.special.change={setup:function(){if(bd.test(this.nodeName)){if(this.type==="checkbox"||this.type==="radio"){b.event.add(this,"propertychange._change",function(e){if(e.originalEvent.propertyName==="checked"){this._just_changed=true}});b.event.add(this,"click._change",function(e){if(this._just_changed&&!e.isTrigger){this._just_changed=false;b.event.simulate("change",this,e,true)}})}return false}b.event.add(this,"beforeactivate._change",function(bw){var bv=bw.target;if(bd.test(bv.nodeName)&&!bv._change_attached){b.event.add(bv,"change._change",function(e){if(this.parentNode&&!e.isSimulated&&!e.isTrigger){b.event.simulate("change",this.parentNode,e,true)}});bv._change_attached=true}})},handle:function(bv){var e=bv.target;if(this!==e||bv.isSimulated||bv.isTrigger||(e.type!=="radio"&&e.type!=="checkbox")){return bv.handleObj.handler.apply(this,arguments)}},teardown:function(){b.event.remove(this,"._change");return bd.test(this.nodeName)}}}if(!b.support.focusinBubbles){b.each({focus:"focusin",blur:"focusout"},function(bx,e){var bv=0,bw=function(by){b.event.simulate(e,by.target,b.event.fix(by),true)};b.event.special[e]={setup:function(){if(bv++===0){av.addEventListener(bx,bw,true)}},teardown:function(){if(--bv===0){av.removeEventListener(bx,bw,true)}}}})}b.fn.extend({on:function(bw,e,bz,by,bv){var bA,bx;if(typeof bw==="object"){if(typeof e!=="string"){bz=e;e=L}for(bx in bw){this.on(bx,e,bz,bw[bx],bv)}return this}if(bz==null&&by==null){by=e;bz=e=L}else{if(by==null){if(typeof e==="string"){by=bz;bz=L}else{by=bz;bz=e;e=L}}}if(by===false){by=bk}else{if(!by){return this}}if(bv===1){bA=by;by=function(bB){b().off(bB);return bA.apply(this,arguments)};by.guid=bA.guid||(bA.guid=b.guid++)}return this.each(function(){b.event.add(this,bw,by,bz,e)})},one:function(bv,e,bx,bw){return this.on.call(this,bv,e,bx,bw,1)},off:function(bw,e,by){if(bw&&bw.preventDefault&&bw.handleObj){var bv=bw.handleObj;b(bw.delegateTarget).off(bv.namespace?bv.type+"."+bv.namespace:bv.type,bv.selector,bv.handler);return this}if(typeof bw==="object"){for(var bx in bw){this.off(bx,e,bw[bx])}return this}if(e===false||typeof e==="function"){by=e;e=L}if(by===false){by=bk}return this.each(function(){b.event.remove(this,bw,by,e)})},bind:function(e,bw,bv){return this.on(e,null,bw,bv)},unbind:function(e,bv){return this.off(e,null,bv)},live:function(e,bw,bv){b(this.context).on(e,this.selector,bw,bv);return this},die:function(e,bv){b(this.context).off(e,this.selector||"**",bv);return this},delegate:function(e,bv,bx,bw){return this.on(bv,e,bx,bw)},undelegate:function(e,bv,bw){return arguments.length==1?this.off(e,"**"):this.off(bv,e,bw)},trigger:function(e,bv){return this.each(function(){b.event.trigger(e,bv,this)})},triggerHandler:function(e,bv){if(this[0]){return b.event.trigger(e,bv,this[0],true)}},toggle:function(bx){var bv=arguments,e=bx.guid||b.guid++,bw=0,by=function(bz){var bA=(b._data(this,"lastToggle"+bx.guid)||0)%bw;b._data(this,"lastToggle"+bx.guid,bA+1);bz.preventDefault();return bv[bA].apply(this,arguments)||false};by.guid=e;while(bw<bv.length){bv[bw++].guid=e}return this.click(by)},hover:function(e,bv){return this.mouseenter(e).mouseleave(bv||e)}});b.each(("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error contextmenu").split(" "),function(bv,e){b.fn[e]=function(bx,bw){if(bw==null){bw=bx;bx=null}return arguments.length>0?this.on(e,null,bx,bw):this.trigger(e)};if(b.attrFn){b.attrFn[e]=true}if(aO.test(e)){b.event.fixHooks[e]=b.event.keyHooks}if(bf.test(e)){b.event.fixHooks[e]=b.event.mouseHooks}}); +/*! + * Sizzle CSS Selector Engine + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * More information: http://sizzlejs.com/ + */ +(function(){var bH=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,bC="sizcache"+(Math.random()+"").replace(".",""),bI=0,bL=Object.prototype.toString,bB=false,bA=true,bK=/\\/g,bO=/\r\n/g,bQ=/\W/;[0,0].sort(function(){bA=false;return 0});var by=function(bV,e,bY,bZ){bY=bY||[];e=e||av;var b1=e;if(e.nodeType!==1&&e.nodeType!==9){return[]}if(!bV||typeof bV!=="string"){return bY}var bS,b3,b6,bR,b2,b5,b4,bX,bU=true,bT=by.isXML(e),bW=[],b0=bV;do{bH.exec("");bS=bH.exec(b0);if(bS){b0=bS[3];bW.push(bS[1]);if(bS[2]){bR=bS[3];break}}}while(bS);if(bW.length>1&&bD.exec(bV)){if(bW.length===2&&bE.relative[bW[0]]){b3=bM(bW[0]+bW[1],e,bZ)}else{b3=bE.relative[bW[0]]?[e]:by(bW.shift(),e);while(bW.length){bV=bW.shift();if(bE.relative[bV]){bV+=bW.shift()}b3=bM(bV,b3,bZ)}}}else{if(!bZ&&bW.length>1&&e.nodeType===9&&!bT&&bE.match.ID.test(bW[0])&&!bE.match.ID.test(bW[bW.length-1])){b2=by.find(bW.shift(),e,bT);e=b2.expr?by.filter(b2.expr,b2.set)[0]:b2.set[0]}if(e){b2=bZ?{expr:bW.pop(),set:bF(bZ)}:by.find(bW.pop(),bW.length===1&&(bW[0]==="~"||bW[0]==="+")&&e.parentNode?e.parentNode:e,bT);b3=b2.expr?by.filter(b2.expr,b2.set):b2.set;if(bW.length>0){b6=bF(b3)}else{bU=false}while(bW.length){b5=bW.pop();b4=b5;if(!bE.relative[b5]){b5=""}else{b4=bW.pop()}if(b4==null){b4=e}bE.relative[b5](b6,b4,bT)}}else{b6=bW=[]}}if(!b6){b6=b3}if(!b6){by.error(b5||bV)}if(bL.call(b6)==="[object Array]"){if(!bU){bY.push.apply(bY,b6)}else{if(e&&e.nodeType===1){for(bX=0;b6[bX]!=null;bX++){if(b6[bX]&&(b6[bX]===true||b6[bX].nodeType===1&&by.contains(e,b6[bX]))){bY.push(b3[bX])}}}else{for(bX=0;b6[bX]!=null;bX++){if(b6[bX]&&b6[bX].nodeType===1){bY.push(b3[bX])}}}}}else{bF(b6,bY)}if(bR){by(bR,b1,bY,bZ);by.uniqueSort(bY)}return bY};by.uniqueSort=function(bR){if(bJ){bB=bA;bR.sort(bJ);if(bB){for(var e=1;e<bR.length;e++){if(bR[e]===bR[e-1]){bR.splice(e--,1)}}}}return bR};by.matches=function(e,bR){return by(e,null,null,bR)};by.matchesSelector=function(e,bR){return by(bR,null,null,[e]).length>0};by.find=function(bX,e,bY){var bW,bS,bU,bT,bV,bR;if(!bX){return[]}for(bS=0,bU=bE.order.length;bS<bU;bS++){bV=bE.order[bS];if((bT=bE.leftMatch[bV].exec(bX))){bR=bT[1];bT.splice(1,1);if(bR.substr(bR.length-1)!=="\\"){bT[1]=(bT[1]||"").replace(bK,"");bW=bE.find[bV](bT,e,bY);if(bW!=null){bX=bX.replace(bE.match[bV],"");break}}}}if(!bW){bW=typeof e.getElementsByTagName!=="undefined"?e.getElementsByTagName("*"):[]}return{set:bW,expr:bX}};by.filter=function(b1,b0,b4,bU){var bW,e,bZ,b6,b3,bR,bT,bV,b2,bS=b1,b5=[],bY=b0,bX=b0&&b0[0]&&by.isXML(b0[0]);while(b1&&b0.length){for(bZ in bE.filter){if((bW=bE.leftMatch[bZ].exec(b1))!=null&&bW[2]){bR=bE.filter[bZ];bT=bW[1];e=false;bW.splice(1,1);if(bT.substr(bT.length-1)==="\\"){continue}if(bY===b5){b5=[]}if(bE.preFilter[bZ]){bW=bE.preFilter[bZ](bW,bY,b4,b5,bU,bX);if(!bW){e=b6=true}else{if(bW===true){continue}}}if(bW){for(bV=0;(b3=bY[bV])!=null;bV++){if(b3){b6=bR(b3,bW,bV,bY);b2=bU^b6;if(b4&&b6!=null){if(b2){e=true}else{bY[bV]=false}}else{if(b2){b5.push(b3);e=true}}}}}if(b6!==L){if(!b4){bY=b5}b1=b1.replace(bE.match[bZ],"");if(!e){return[]}break}}}if(b1===bS){if(e==null){by.error(b1)}else{break}}bS=b1}return bY};by.error=function(e){throw new Error("Syntax error, unrecognized expression: "+e)};var bw=by.getText=function(bU){var bS,bT,e=bU.nodeType,bR="";if(e){if(e===1||e===9){if(typeof bU.textContent==="string"){return bU.textContent}else{if(typeof bU.innerText==="string"){return bU.innerText.replace(bO,"")}else{for(bU=bU.firstChild;bU;bU=bU.nextSibling){bR+=bw(bU)}}}}else{if(e===3||e===4){return bU.nodeValue}}}else{for(bS=0;(bT=bU[bS]);bS++){if(bT.nodeType!==8){bR+=bw(bT)}}}return bR};var bE=by.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(e){return e.getAttribute("href")},type:function(e){return e.getAttribute("type")}},relative:{"+":function(bW,bR){var bT=typeof bR==="string",bV=bT&&!bQ.test(bR),bX=bT&&!bV;if(bV){bR=bR.toLowerCase()}for(var bS=0,e=bW.length,bU;bS<e;bS++){if((bU=bW[bS])){while((bU=bU.previousSibling)&&bU.nodeType!==1){}bW[bS]=bX||bU&&bU.nodeName.toLowerCase()===bR?bU||false:bU===bR}}if(bX){by.filter(bR,bW,true)}},">":function(bW,bR){var bV,bU=typeof bR==="string",bS=0,e=bW.length;if(bU&&!bQ.test(bR)){bR=bR.toLowerCase();for(;bS<e;bS++){bV=bW[bS];if(bV){var bT=bV.parentNode;bW[bS]=bT.nodeName.toLowerCase()===bR?bT:false}}}else{for(;bS<e;bS++){bV=bW[bS];if(bV){bW[bS]=bU?bV.parentNode:bV.parentNode===bR}}if(bU){by.filter(bR,bW,true)}}},"":function(bT,bR,bV){var bU,bS=bI++,e=bN;if(typeof bR==="string"&&!bQ.test(bR)){bR=bR.toLowerCase();bU=bR;e=bv}e("parentNode",bR,bS,bT,bU,bV)},"~":function(bT,bR,bV){var bU,bS=bI++,e=bN;if(typeof bR==="string"&&!bQ.test(bR)){bR=bR.toLowerCase();bU=bR;e=bv}e("previousSibling",bR,bS,bT,bU,bV)}},find:{ID:function(bR,bS,bT){if(typeof bS.getElementById!=="undefined"&&!bT){var e=bS.getElementById(bR[1]);return e&&e.parentNode?[e]:[]}},NAME:function(bS,bV){if(typeof bV.getElementsByName!=="undefined"){var bR=[],bU=bV.getElementsByName(bS[1]);for(var bT=0,e=bU.length;bT<e;bT++){if(bU[bT].getAttribute("name")===bS[1]){bR.push(bU[bT])}}return bR.length===0?null:bR}},TAG:function(e,bR){if(typeof bR.getElementsByTagName!=="undefined"){return bR.getElementsByTagName(e[1])}}},preFilter:{CLASS:function(bT,bR,bS,e,bW,bX){bT=" "+bT[1].replace(bK,"")+" ";if(bX){return bT}for(var bU=0,bV;(bV=bR[bU])!=null;bU++){if(bV){if(bW^(bV.className&&(" "+bV.className+" ").replace(/[\t\n\r]/g," ").indexOf(bT)>=0)){if(!bS){e.push(bV)}}else{if(bS){bR[bU]=false}}}}return false},ID:function(e){return e[1].replace(bK,"")},TAG:function(bR,e){return bR[1].replace(bK,"").toLowerCase()},CHILD:function(e){if(e[1]==="nth"){if(!e[2]){by.error(e[0])}e[2]=e[2].replace(/^\+|\s*/g,"");var bR=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(e[2]==="even"&&"2n"||e[2]==="odd"&&"2n+1"||!/\D/.test(e[2])&&"0n+"+e[2]||e[2]);e[2]=(bR[1]+(bR[2]||1))-0;e[3]=bR[3]-0}else{if(e[2]){by.error(e[0])}}e[0]=bI++;return e},ATTR:function(bU,bR,bS,e,bV,bW){var bT=bU[1]=bU[1].replace(bK,"");if(!bW&&bE.attrMap[bT]){bU[1]=bE.attrMap[bT]}bU[4]=(bU[4]||bU[5]||"").replace(bK,"");if(bU[2]==="~="){bU[4]=" "+bU[4]+" "}return bU},PSEUDO:function(bU,bR,bS,e,bV){if(bU[1]==="not"){if((bH.exec(bU[3])||"").length>1||/^\w/.test(bU[3])){bU[3]=by(bU[3],null,null,bR)}else{var bT=by.filter(bU[3],bR,bS,true^bV);if(!bS){e.push.apply(e,bT)}return false}}else{if(bE.match.POS.test(bU[0])||bE.match.CHILD.test(bU[0])){return true}}return bU},POS:function(e){e.unshift(true);return e}},filters:{enabled:function(e){return e.disabled===false&&e.type!=="hidden"},disabled:function(e){return e.disabled===true},checked:function(e){return e.checked===true},selected:function(e){if(e.parentNode){e.parentNode.selectedIndex}return e.selected===true},parent:function(e){return !!e.firstChild},empty:function(e){return !e.firstChild},has:function(bS,bR,e){return !!by(e[3],bS).length},header:function(e){return(/h\d/i).test(e.nodeName)},text:function(bS){var e=bS.getAttribute("type"),bR=bS.type;return bS.nodeName.toLowerCase()==="input"&&"text"===bR&&(e===bR||e===null)},radio:function(e){return e.nodeName.toLowerCase()==="input"&&"radio"===e.type},checkbox:function(e){return e.nodeName.toLowerCase()==="input"&&"checkbox"===e.type},file:function(e){return e.nodeName.toLowerCase()==="input"&&"file"===e.type},password:function(e){return e.nodeName.toLowerCase()==="input"&&"password"===e.type},submit:function(bR){var e=bR.nodeName.toLowerCase();return(e==="input"||e==="button")&&"submit"===bR.type},image:function(e){return e.nodeName.toLowerCase()==="input"&&"image"===e.type},reset:function(bR){var e=bR.nodeName.toLowerCase();return(e==="input"||e==="button")&&"reset"===bR.type},button:function(bR){var e=bR.nodeName.toLowerCase();return e==="input"&&"button"===bR.type||e==="button"},input:function(e){return(/input|select|textarea|button/i).test(e.nodeName)},focus:function(e){return e===e.ownerDocument.activeElement}},setFilters:{first:function(bR,e){return e===0},last:function(bS,bR,e,bT){return bR===bT.length-1},even:function(bR,e){return e%2===0},odd:function(bR,e){return e%2===1},lt:function(bS,bR,e){return bR<e[3]-0},gt:function(bS,bR,e){return bR>e[3]-0},nth:function(bS,bR,e){return e[3]-0===bR},eq:function(bS,bR,e){return e[3]-0===bR}},filter:{PSEUDO:function(bS,bX,bW,bY){var e=bX[1],bR=bE.filters[e];if(bR){return bR(bS,bW,bX,bY)}else{if(e==="contains"){return(bS.textContent||bS.innerText||bw([bS])||"").indexOf(bX[3])>=0}else{if(e==="not"){var bT=bX[3];for(var bV=0,bU=bT.length;bV<bU;bV++){if(bT[bV]===bS){return false}}return true}else{by.error(e)}}}},CHILD:function(bS,bU){var bT,b0,bW,bZ,e,bV,bY,bX=bU[1],bR=bS;switch(bX){case"only":case"first":while((bR=bR.previousSibling)){if(bR.nodeType===1){return false}}if(bX==="first"){return true}bR=bS;case"last":while((bR=bR.nextSibling)){if(bR.nodeType===1){return false}}return true;case"nth":bT=bU[2];b0=bU[3];if(bT===1&&b0===0){return true}bW=bU[0];bZ=bS.parentNode;if(bZ&&(bZ[bC]!==bW||!bS.nodeIndex)){bV=0;for(bR=bZ.firstChild;bR;bR=bR.nextSibling){if(bR.nodeType===1){bR.nodeIndex=++bV}}bZ[bC]=bW}bY=bS.nodeIndex-b0;if(bT===0){return bY===0}else{return(bY%bT===0&&bY/bT>=0)}}},ID:function(bR,e){return bR.nodeType===1&&bR.getAttribute("id")===e},TAG:function(bR,e){return(e==="*"&&bR.nodeType===1)||!!bR.nodeName&&bR.nodeName.toLowerCase()===e},CLASS:function(bR,e){return(" "+(bR.className||bR.getAttribute("class"))+" ").indexOf(e)>-1},ATTR:function(bV,bT){var bS=bT[1],e=by.attr?by.attr(bV,bS):bE.attrHandle[bS]?bE.attrHandle[bS](bV):bV[bS]!=null?bV[bS]:bV.getAttribute(bS),bW=e+"",bU=bT[2],bR=bT[4];return e==null?bU==="!=":!bU&&by.attr?e!=null:bU==="="?bW===bR:bU==="*="?bW.indexOf(bR)>=0:bU==="~="?(" "+bW+" ").indexOf(bR)>=0:!bR?bW&&e!==false:bU==="!="?bW!==bR:bU==="^="?bW.indexOf(bR)===0:bU==="$="?bW.substr(bW.length-bR.length)===bR:bU==="|="?bW===bR||bW.substr(0,bR.length+1)===bR+"-":false},POS:function(bU,bR,bS,bV){var e=bR[2],bT=bE.setFilters[e];if(bT){return bT(bU,bS,bR,bV)}}}};var bD=bE.match.POS,bx=function(bR,e){return"\\"+(e-0+1)};for(var bz in bE.match){bE.match[bz]=new RegExp(bE.match[bz].source+(/(?![^\[]*\])(?![^\(]*\))/.source));bE.leftMatch[bz]=new RegExp(/(^(?:.|\r|\n)*?)/.source+bE.match[bz].source.replace(/\\(\d+)/g,bx))}var bF=function(bR,e){bR=Array.prototype.slice.call(bR,0);if(e){e.push.apply(e,bR);return e}return bR};try{Array.prototype.slice.call(av.documentElement.childNodes,0)[0].nodeType}catch(bP){bF=function(bU,bT){var bS=0,bR=bT||[];if(bL.call(bU)==="[object Array]"){Array.prototype.push.apply(bR,bU)}else{if(typeof bU.length==="number"){for(var e=bU.length;bS<e;bS++){bR.push(bU[bS])}}else{for(;bU[bS];bS++){bR.push(bU[bS])}}}return bR}}var bJ,bG;if(av.documentElement.compareDocumentPosition){bJ=function(bR,e){if(bR===e){bB=true;return 0}if(!bR.compareDocumentPosition||!e.compareDocumentPosition){return bR.compareDocumentPosition?-1:1}return bR.compareDocumentPosition(e)&4?-1:1}}else{bJ=function(bY,bX){if(bY===bX){bB=true;return 0}else{if(bY.sourceIndex&&bX.sourceIndex){return bY.sourceIndex-bX.sourceIndex}}var bV,bR,bS=[],e=[],bU=bY.parentNode,bW=bX.parentNode,bZ=bU;if(bU===bW){return bG(bY,bX)}else{if(!bU){return -1}else{if(!bW){return 1}}}while(bZ){bS.unshift(bZ);bZ=bZ.parentNode}bZ=bW;while(bZ){e.unshift(bZ);bZ=bZ.parentNode}bV=bS.length;bR=e.length;for(var bT=0;bT<bV&&bT<bR;bT++){if(bS[bT]!==e[bT]){return bG(bS[bT],e[bT])}}return bT===bV?bG(bY,e[bT],-1):bG(bS[bT],bX,1)};bG=function(bR,e,bS){if(bR===e){return bS}var bT=bR.nextSibling;while(bT){if(bT===e){return -1}bT=bT.nextSibling}return 1}}(function(){var bR=av.createElement("div"),bS="script"+(new Date()).getTime(),e=av.documentElement;bR.innerHTML="<a name='"+bS+"'/>";e.insertBefore(bR,e.firstChild);if(av.getElementById(bS)){bE.find.ID=function(bU,bV,bW){if(typeof bV.getElementById!=="undefined"&&!bW){var bT=bV.getElementById(bU[1]);return bT?bT.id===bU[1]||typeof bT.getAttributeNode!=="undefined"&&bT.getAttributeNode("id").nodeValue===bU[1]?[bT]:L:[]}};bE.filter.ID=function(bV,bT){var bU=typeof bV.getAttributeNode!=="undefined"&&bV.getAttributeNode("id");return bV.nodeType===1&&bU&&bU.nodeValue===bT}}e.removeChild(bR);e=bR=null})();(function(){var e=av.createElement("div");e.appendChild(av.createComment(""));if(e.getElementsByTagName("*").length>0){bE.find.TAG=function(bR,bV){var bU=bV.getElementsByTagName(bR[1]);if(bR[1]==="*"){var bT=[];for(var bS=0;bU[bS];bS++){if(bU[bS].nodeType===1){bT.push(bU[bS])}}bU=bT}return bU}}e.innerHTML="<a href='#'></a>";if(e.firstChild&&typeof e.firstChild.getAttribute!=="undefined"&&e.firstChild.getAttribute("href")!=="#"){bE.attrHandle.href=function(bR){return bR.getAttribute("href",2)}}e=null})();if(av.querySelectorAll){(function(){var e=by,bT=av.createElement("div"),bS="__sizzle__";bT.innerHTML="<p class='TEST'></p>";if(bT.querySelectorAll&&bT.querySelectorAll(".TEST").length===0){return}by=function(b4,bV,bZ,b3){bV=bV||av;if(!b3&&!by.isXML(bV)){var b2=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b4);if(b2&&(bV.nodeType===1||bV.nodeType===9)){if(b2[1]){return bF(bV.getElementsByTagName(b4),bZ)}else{if(b2[2]&&bE.find.CLASS&&bV.getElementsByClassName){return bF(bV.getElementsByClassName(b2[2]),bZ)}}}if(bV.nodeType===9){if(b4==="body"&&bV.body){return bF([bV.body],bZ)}else{if(b2&&b2[3]){var bY=bV.getElementById(b2[3]);if(bY&&bY.parentNode){if(bY.id===b2[3]){return bF([bY],bZ)}}else{return bF([],bZ)}}}try{return bF(bV.querySelectorAll(b4),bZ)}catch(b0){}}else{if(bV.nodeType===1&&bV.nodeName.toLowerCase()!=="object"){var bW=bV,bX=bV.getAttribute("id"),bU=bX||bS,b6=bV.parentNode,b5=/^\s*[+~]/.test(b4);if(!bX){bV.setAttribute("id",bU)}else{bU=bU.replace(/'/g,"\\$&")}if(b5&&b6){bV=bV.parentNode}try{if(!b5||b6){return bF(bV.querySelectorAll("[id='"+bU+"'] "+b4),bZ)}}catch(b1){}finally{if(!bX){bW.removeAttribute("id")}}}}}return e(b4,bV,bZ,b3)};for(var bR in e){by[bR]=e[bR]}bT=null})()}(function(){var e=av.documentElement,bS=e.matchesSelector||e.mozMatchesSelector||e.webkitMatchesSelector||e.msMatchesSelector;if(bS){var bU=!bS.call(av.createElement("div"),"div"),bR=false;try{bS.call(av.documentElement,"[test!='']:sizzle")}catch(bT){bR=true}by.matchesSelector=function(bW,bY){bY=bY.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!by.isXML(bW)){try{if(bR||!bE.match.PSEUDO.test(bY)&&!/!=/.test(bY)){var bV=bS.call(bW,bY);if(bV||!bU||bW.document&&bW.document.nodeType!==11){return bV}}}catch(bX){}}return by(bY,null,null,[bW]).length>0}}})();(function(){var e=av.createElement("div");e.innerHTML="<div class='test e'></div><div class='test'></div>";if(!e.getElementsByClassName||e.getElementsByClassName("e").length===0){return}e.lastChild.className="e";if(e.getElementsByClassName("e").length===1){return}bE.order.splice(1,0,"CLASS");bE.find.CLASS=function(bR,bS,bT){if(typeof bS.getElementsByClassName!=="undefined"&&!bT){return bS.getElementsByClassName(bR[1])}};e=null})();function bv(bR,bW,bV,bZ,bX,bY){for(var bT=0,bS=bZ.length;bT<bS;bT++){var e=bZ[bT];if(e){var bU=false;e=e[bR];while(e){if(e[bC]===bV){bU=bZ[e.sizset];break}if(e.nodeType===1&&!bY){e[bC]=bV;e.sizset=bT}if(e.nodeName.toLowerCase()===bW){bU=e;break}e=e[bR]}bZ[bT]=bU}}}function bN(bR,bW,bV,bZ,bX,bY){for(var bT=0,bS=bZ.length;bT<bS;bT++){var e=bZ[bT];if(e){var bU=false;e=e[bR];while(e){if(e[bC]===bV){bU=bZ[e.sizset];break}if(e.nodeType===1){if(!bY){e[bC]=bV;e.sizset=bT}if(typeof bW!=="string"){if(e===bW){bU=true;break}}else{if(by.filter(bW,[e]).length>0){bU=e;break}}}e=e[bR]}bZ[bT]=bU}}}if(av.documentElement.contains){by.contains=function(bR,e){return bR!==e&&(bR.contains?bR.contains(e):true)}}else{if(av.documentElement.compareDocumentPosition){by.contains=function(bR,e){return !!(bR.compareDocumentPosition(e)&16)}}else{by.contains=function(){return false}}}by.isXML=function(e){var bR=(e?e.ownerDocument||e:0).documentElement;return bR?bR.nodeName!=="HTML":false};var bM=function(bS,e,bW){var bV,bX=[],bU="",bY=e.nodeType?[e]:e;while((bV=bE.match.PSEUDO.exec(bS))){bU+=bV[0];bS=bS.replace(bE.match.PSEUDO,"")}bS=bE.relative[bS]?bS+"*":bS;for(var bT=0,bR=bY.length;bT<bR;bT++){by(bS,bY[bT],bX,bW)}return by.filter(bU,bX)};by.attr=b.attr;by.selectors.attrMap={};b.find=by;b.expr=by.selectors;b.expr[":"]=b.expr.filters;b.unique=by.uniqueSort;b.text=by.getText;b.isXMLDoc=by.isXML;b.contains=by.contains})();var ab=/Until$/,aq=/^(?:parents|prevUntil|prevAll)/,a9=/,/,bp=/^.[^:#\[\.,]*$/,P=Array.prototype.slice,H=b.expr.match.POS,ay={children:true,contents:true,next:true,prev:true};b.fn.extend({find:function(e){var bw=this,by,bv;if(typeof e!=="string"){return b(e).filter(function(){for(by=0,bv=bw.length;by<bv;by++){if(b.contains(bw[by],this)){return true}}})}var bx=this.pushStack("","find",e),bA,bB,bz;for(by=0,bv=this.length;by<bv;by++){bA=bx.length;b.find(e,this[by],bx);if(by>0){for(bB=bA;bB<bx.length;bB++){for(bz=0;bz<bA;bz++){if(bx[bz]===bx[bB]){bx.splice(bB--,1);break}}}}}return bx},has:function(bv){var e=b(bv);return this.filter(function(){for(var bx=0,bw=e.length;bx<bw;bx++){if(b.contains(this,e[bx])){return true}}})},not:function(e){return this.pushStack(aG(this,e,false),"not",e)},filter:function(e){return this.pushStack(aG(this,e,true),"filter",e)},is:function(e){return !!e&&(typeof e==="string"?H.test(e)?b(e,this.context).index(this[0])>=0:b.filter(e,this).length>0:this.filter(e).length>0)},closest:function(by,bx){var bv=[],bw,e,bz=this[0];if(b.isArray(by)){var bB=1;while(bz&&bz.ownerDocument&&bz!==bx){for(bw=0;bw<by.length;bw++){if(b(bz).is(by[bw])){bv.push({selector:by[bw],elem:bz,level:bB})}}bz=bz.parentNode;bB++}return bv}var bA=H.test(by)||typeof by!=="string"?b(by,bx||this.context):0;for(bw=0,e=this.length;bw<e;bw++){bz=this[bw];while(bz){if(bA?bA.index(bz)>-1:b.find.matchesSelector(bz,by)){bv.push(bz);break}else{bz=bz.parentNode;if(!bz||!bz.ownerDocument||bz===bx||bz.nodeType===11){break}}}}bv=bv.length>1?b.unique(bv):bv;return this.pushStack(bv,"closest",by)},index:function(e){if(!e){return(this[0]&&this[0].parentNode)?this.prevAll().length:-1}if(typeof e==="string"){return b.inArray(this[0],b(e))}return b.inArray(e.jquery?e[0]:e,this)},add:function(e,bv){var bx=typeof e==="string"?b(e,bv):b.makeArray(e&&e.nodeType?[e]:e),bw=b.merge(this.get(),bx);return this.pushStack(C(bx[0])||C(bw[0])?bw:b.unique(bw))},andSelf:function(){return this.add(this.prevObject)}});function C(e){return !e||!e.parentNode||e.parentNode.nodeType===11}b.each({parent:function(bv){var e=bv.parentNode;return e&&e.nodeType!==11?e:null},parents:function(e){return b.dir(e,"parentNode")},parentsUntil:function(bv,e,bw){return b.dir(bv,"parentNode",bw)},next:function(e){return b.nth(e,2,"nextSibling")},prev:function(e){return b.nth(e,2,"previousSibling")},nextAll:function(e){return b.dir(e,"nextSibling")},prevAll:function(e){return b.dir(e,"previousSibling")},nextUntil:function(bv,e,bw){return b.dir(bv,"nextSibling",bw)},prevUntil:function(bv,e,bw){return b.dir(bv,"previousSibling",bw)},siblings:function(e){return b.sibling(e.parentNode.firstChild,e)},children:function(e){return b.sibling(e.firstChild)},contents:function(e){return b.nodeName(e,"iframe")?e.contentDocument||e.contentWindow.document:b.makeArray(e.childNodes)}},function(e,bv){b.fn[e]=function(by,bw){var bx=b.map(this,bv,by);if(!ab.test(e)){bw=by}if(bw&&typeof bw==="string"){bx=b.filter(bw,bx)}bx=this.length>1&&!ay[e]?b.unique(bx):bx;if((this.length>1||a9.test(bw))&&aq.test(e)){bx=bx.reverse()}return this.pushStack(bx,e,P.call(arguments).join(","))}});b.extend({filter:function(bw,e,bv){if(bv){bw=":not("+bw+")"}return e.length===1?b.find.matchesSelector(e[0],bw)?[e[0]]:[]:b.find.matches(bw,e)},dir:function(bw,bv,by){var e=[],bx=bw[bv];while(bx&&bx.nodeType!==9&&(by===L||bx.nodeType!==1||!b(bx).is(by))){if(bx.nodeType===1){e.push(bx)}bx=bx[bv]}return e},nth:function(by,e,bw,bx){e=e||1;var bv=0;for(;by;by=by[bw]){if(by.nodeType===1&&++bv===e){break}}return by},sibling:function(bw,bv){var e=[];for(;bw;bw=bw.nextSibling){if(bw.nodeType===1&&bw!==bv){e.push(bw)}}return e}});function aG(bx,bw,e){bw=bw||0;if(b.isFunction(bw)){return b.grep(bx,function(bz,by){var bA=!!bw.call(bz,by,bz);return bA===e})}else{if(bw.nodeType){return b.grep(bx,function(bz,by){return(bz===bw)===e})}else{if(typeof bw==="string"){var bv=b.grep(bx,function(by){return by.nodeType===1});if(bp.test(bw)){return b.filter(bw,bv,!e)}else{bw=b.filter(bw,bv)}}}}return b.grep(bx,function(bz,by){return(b.inArray(bz,bw)>=0)===e})}function a(e){var bw=aR.split("|"),bv=e.createDocumentFragment();if(bv.createElement){while(bw.length){bv.createElement(bw.pop())}}return bv}var aR="abbr|article|aside|audio|canvas|datalist|details|figcaption|figure|footer|header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",ag=/ jQuery\d+="(?:\d+|null)"/g,ar=/^\s+/,R=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,d=/<([\w:]+)/,w=/<tbody/i,W=/<|&#?\w+;/,ae=/<(?:script|style)/i,O=/<(?:script|object|embed|option|style)/i,ah=new RegExp("<(?:"+aR+")","i"),o=/checked\s*(?:[^=]|=\s*.checked.)/i,bm=/\/(java|ecma)script/i,aN=/^\s*<!(?:\[CDATA\[|\-\-)/,ax={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]},ac=a(av);ax.optgroup=ax.option;ax.tbody=ax.tfoot=ax.colgroup=ax.caption=ax.thead;ax.th=ax.td;if(!b.support.htmlSerialize){ax._default=[1,"div<div>","</div>"]}b.fn.extend({text:function(e){if(b.isFunction(e)){return this.each(function(bw){var bv=b(this);bv.text(e.call(this,bw,bv.text()))})}if(typeof e!=="object"&&e!==L){return this.empty().append((this[0]&&this[0].ownerDocument||av).createTextNode(e))}return b.text(this)},wrapAll:function(e){if(b.isFunction(e)){return this.each(function(bw){b(this).wrapAll(e.call(this,bw))})}if(this[0]){var bv=b(e,this[0].ownerDocument).eq(0).clone(true);if(this[0].parentNode){bv.insertBefore(this[0])}bv.map(function(){var bw=this;while(bw.firstChild&&bw.firstChild.nodeType===1){bw=bw.firstChild}return bw}).append(this)}return this},wrapInner:function(e){if(b.isFunction(e)){return this.each(function(bv){b(this).wrapInner(e.call(this,bv))})}return this.each(function(){var bv=b(this),bw=bv.contents();if(bw.length){bw.wrapAll(e)}else{bv.append(e)}})},wrap:function(e){var bv=b.isFunction(e);return this.each(function(bw){b(this).wrapAll(bv?e.call(this,bw):e)})},unwrap:function(){return this.parent().each(function(){if(!b.nodeName(this,"body")){b(this).replaceWith(this.childNodes)}}).end()},append:function(){return this.domManip(arguments,true,function(e){if(this.nodeType===1){this.appendChild(e)}})},prepend:function(){return this.domManip(arguments,true,function(e){if(this.nodeType===1){this.insertBefore(e,this.firstChild)}})},before:function(){if(this[0]&&this[0].parentNode){return this.domManip(arguments,false,function(bv){this.parentNode.insertBefore(bv,this)})}else{if(arguments.length){var e=b.clean(arguments);e.push.apply(e,this.toArray());return this.pushStack(e,"before",arguments)}}},after:function(){if(this[0]&&this[0].parentNode){return this.domManip(arguments,false,function(bv){this.parentNode.insertBefore(bv,this.nextSibling)})}else{if(arguments.length){var e=this.pushStack(this,"after",arguments);e.push.apply(e,b.clean(arguments));return e}}},remove:function(e,bx){for(var bv=0,bw;(bw=this[bv])!=null;bv++){if(!e||b.filter(e,[bw]).length){if(!bx&&bw.nodeType===1){b.cleanData(bw.getElementsByTagName("*"));b.cleanData([bw])}if(bw.parentNode){bw.parentNode.removeChild(bw)}}}return this},empty:function(){for(var e=0,bv;(bv=this[e])!=null;e++){if(bv.nodeType===1){b.cleanData(bv.getElementsByTagName("*"))}while(bv.firstChild){bv.removeChild(bv.firstChild)}}return this},clone:function(bv,e){bv=bv==null?false:bv;e=e==null?bv:e;return this.map(function(){return b.clone(this,bv,e)})},html:function(bx){if(bx===L){return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(ag,""):null}else{if(typeof bx==="string"&&!ae.test(bx)&&(b.support.leadingWhitespace||!ar.test(bx))&&!ax[(d.exec(bx)||["",""])[1].toLowerCase()]){bx=bx.replace(R,"<$1></$2>");try{for(var bw=0,bv=this.length;bw<bv;bw++){if(this[bw].nodeType===1){b.cleanData(this[bw].getElementsByTagName("*"));this[bw].innerHTML=bx}}}catch(by){this.empty().append(bx)}}else{if(b.isFunction(bx)){this.each(function(bz){var e=b(this);e.html(bx.call(this,bz,e.html()))})}else{this.empty().append(bx)}}}return this},replaceWith:function(e){if(this[0]&&this[0].parentNode){if(b.isFunction(e)){return this.each(function(bx){var bw=b(this),bv=bw.html();bw.replaceWith(e.call(this,bx,bv))})}if(typeof e!=="string"){e=b(e).detach()}return this.each(function(){var bw=this.nextSibling,bv=this.parentNode;b(this).remove();if(bw){b(bw).before(e)}else{b(bv).append(e)}})}else{return this.length?this.pushStack(b(b.isFunction(e)?e():e),"replaceWith",e):this}},detach:function(e){return this.remove(e,true)},domManip:function(bB,bF,bE){var bx,by,bA,bD,bC=bB[0],bv=[];if(!b.support.checkClone&&arguments.length===3&&typeof bC==="string"&&o.test(bC)){return this.each(function(){b(this).domManip(bB,bF,bE,true)})}if(b.isFunction(bC)){return this.each(function(bH){var bG=b(this);bB[0]=bC.call(this,bH,bF?bG.html():L);bG.domManip(bB,bF,bE)})}if(this[0]){bD=bC&&bC.parentNode;if(b.support.parentNode&&bD&&bD.nodeType===11&&bD.childNodes.length===this.length){bx={fragment:bD}}else{bx=b.buildFragment(bB,this,bv)}bA=bx.fragment;if(bA.childNodes.length===1){by=bA=bA.firstChild}else{by=bA.firstChild}if(by){bF=bF&&b.nodeName(by,"tr");for(var bw=0,e=this.length,bz=e-1;bw<e;bw++){bE.call(bF?ba(this[bw],by):this[bw],bx.cacheable||(e>1&&bw<bz)?b.clone(bA,true,true):bA)}}if(bv.length){b.each(bv,bo)}}return this}});function ba(e,bv){return b.nodeName(e,"table")?(e.getElementsByTagName("tbody")[0]||e.appendChild(e.ownerDocument.createElement("tbody"))):e}function t(bB,bv){if(bv.nodeType!==1||!b.hasData(bB)){return}var by,bx,e,bA=b._data(bB),bz=b._data(bv,bA),bw=bA.events;if(bw){delete bz.handle;bz.events={};for(by in bw){for(bx=0,e=bw[by].length;bx<e;bx++){b.event.add(bv,by+(bw[by][bx].namespace?".":"")+bw[by][bx].namespace,bw[by][bx],bw[by][bx].data)}}}if(bz.data){bz.data=b.extend({},bz.data)}}function ai(bv,e){var bw;if(e.nodeType!==1){return}if(e.clearAttributes){e.clearAttributes()}if(e.mergeAttributes){e.mergeAttributes(bv)}bw=e.nodeName.toLowerCase();if(bw==="object"){e.outerHTML=bv.outerHTML}else{if(bw==="input"&&(bv.type==="checkbox"||bv.type==="radio")){if(bv.checked){e.defaultChecked=e.checked=bv.checked}if(e.value!==bv.value){e.value=bv.value}}else{if(bw==="option"){e.selected=bv.defaultSelected}else{if(bw==="input"||bw==="textarea"){e.defaultValue=bv.defaultValue}}}}e.removeAttribute(b.expando)}b.buildFragment=function(bz,bx,bv){var by,e,bw,bA,bB=bz[0];if(bx&&bx[0]){bA=bx[0].ownerDocument||bx[0]}if(!bA.createDocumentFragment){bA=av}if(bz.length===1&&typeof bB==="string"&&bB.length<512&&bA===av&&bB.charAt(0)==="<"&&!O.test(bB)&&(b.support.checkClone||!o.test(bB))&&(b.support.html5Clone||!ah.test(bB))){e=true;bw=b.fragments[bB];if(bw&&bw!==1){by=bw}}if(!by){by=bA.createDocumentFragment();b.clean(bz,bA,by,bv)}if(e){b.fragments[bB]=bw?by:1}return{fragment:by,cacheable:e}};b.fragments={};b.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(e,bv){b.fn[e]=function(bw){var bz=[],bC=b(bw),bB=this.length===1&&this[0].parentNode;if(bB&&bB.nodeType===11&&bB.childNodes.length===1&&bC.length===1){bC[bv](this[0]);return this}else{for(var bA=0,bx=bC.length;bA<bx;bA++){var by=(bA>0?this.clone(true):this).get();b(bC[bA])[bv](by);bz=bz.concat(by)}return this.pushStack(bz,e,bC.selector)}}});function bg(e){if(typeof e.getElementsByTagName!=="undefined"){return e.getElementsByTagName("*")}else{if(typeof e.querySelectorAll!=="undefined"){return e.querySelectorAll("*")}else{return[]}}}function az(e){if(e.type==="checkbox"||e.type==="radio"){e.defaultChecked=e.checked}}function E(e){var bv=(e.nodeName||"").toLowerCase();if(bv==="input"){az(e)}else{if(bv!=="script"&&typeof e.getElementsByTagName!=="undefined"){b.grep(e.getElementsByTagName("input"),az)}}}function al(e){var bv=av.createElement("div");ac.appendChild(bv);bv.innerHTML=e.outerHTML;return bv.firstChild}b.extend({clone:function(by,bA,bw){var e,bv,bx,bz=b.support.html5Clone||!ah.test("<"+by.nodeName)?by.cloneNode(true):al(by);if((!b.support.noCloneEvent||!b.support.noCloneChecked)&&(by.nodeType===1||by.nodeType===11)&&!b.isXMLDoc(by)){ai(by,bz);e=bg(by);bv=bg(bz);for(bx=0;e[bx];++bx){if(bv[bx]){ai(e[bx],bv[bx])}}}if(bA){t(by,bz);if(bw){e=bg(by);bv=bg(bz);for(bx=0;e[bx];++bx){t(e[bx],bv[bx])}}}e=bv=null;return bz},clean:function(bw,by,bH,bA){var bF;by=by||av;if(typeof by.createElement==="undefined"){by=by.ownerDocument||by[0]&&by[0].ownerDocument||av}var bI=[],bB;for(var bE=0,bz;(bz=bw[bE])!=null;bE++){if(typeof bz==="number"){bz+=""}if(!bz){continue}if(typeof bz==="string"){if(!W.test(bz)){bz=by.createTextNode(bz)}else{bz=bz.replace(R,"<$1></$2>");var bK=(d.exec(bz)||["",""])[1].toLowerCase(),bx=ax[bK]||ax._default,bD=bx[0],bv=by.createElement("div");if(by===av){ac.appendChild(bv)}else{a(by).appendChild(bv)}bv.innerHTML=bx[1]+bz+bx[2];while(bD--){bv=bv.lastChild}if(!b.support.tbody){var e=w.test(bz),bC=bK==="table"&&!e?bv.firstChild&&bv.firstChild.childNodes:bx[1]==="<table>"&&!e?bv.childNodes:[];for(bB=bC.length-1;bB>=0;--bB){if(b.nodeName(bC[bB],"tbody")&&!bC[bB].childNodes.length){bC[bB].parentNode.removeChild(bC[bB])}}}if(!b.support.leadingWhitespace&&ar.test(bz)){bv.insertBefore(by.createTextNode(ar.exec(bz)[0]),bv.firstChild)}bz=bv.childNodes}}var bG;if(!b.support.appendChecked){if(bz[0]&&typeof(bG=bz.length)==="number"){for(bB=0;bB<bG;bB++){E(bz[bB])}}else{E(bz)}}if(bz.nodeType){bI.push(bz)}else{bI=b.merge(bI,bz)}}if(bH){bF=function(bL){return !bL.type||bm.test(bL.type)};for(bE=0;bI[bE];bE++){if(bA&&b.nodeName(bI[bE],"script")&&(!bI[bE].type||bI[bE].type.toLowerCase()==="text/javascript")){bA.push(bI[bE].parentNode?bI[bE].parentNode.removeChild(bI[bE]):bI[bE])}else{if(bI[bE].nodeType===1){var bJ=b.grep(bI[bE].getElementsByTagName("script"),bF);bI.splice.apply(bI,[bE+1,0].concat(bJ))}bH.appendChild(bI[bE])}}}return bI},cleanData:function(bv){var by,bw,e=b.cache,bB=b.event.special,bA=b.support.deleteExpando;for(var bz=0,bx;(bx=bv[bz])!=null;bz++){if(bx.nodeName&&b.noData[bx.nodeName.toLowerCase()]){continue}bw=bx[b.expando];if(bw){by=e[bw];if(by&&by.events){for(var bC in by.events){if(bB[bC]){b.event.remove(bx,bC)}else{b.removeEvent(bx,bC,by.handle)}}if(by.handle){by.handle.elem=null}}if(bA){delete bx[b.expando]}else{if(bx.removeAttribute){bx.removeAttribute(b.expando)}}delete e[bw]}}}});function bo(e,bv){if(bv.src){b.ajax({url:bv.src,async:false,dataType:"script"})}else{b.globalEval((bv.text||bv.textContent||bv.innerHTML||"").replace(aN,"/*$0*/"))}if(bv.parentNode){bv.parentNode.removeChild(bv)}}var ak=/alpha\([^)]*\)/i,au=/opacity=([^)]*)/,z=/([A-Z]|^ms)/g,bc=/^-?\d+(?:px)?$/i,bn=/^-?\d/,I=/^([\-+])=([\-+.\de]+)/,a7={position:"absolute",visibility:"hidden",display:"block"},an=["Left","Right"],a1=["Top","Bottom"],Z,aI,aX;b.fn.css=function(e,bv){if(arguments.length===2&&bv===L){return this}return b.access(this,e,bv,true,function(bx,bw,by){return by!==L?b.style(bx,bw,by):b.css(bx,bw)})};b.extend({cssHooks:{opacity:{get:function(bw,bv){if(bv){var e=Z(bw,"opacity","opacity");return e===""?"1":e}else{return bw.style.opacity}}}},cssNumber:{fillOpacity:true,fontWeight:true,lineHeight:true,opacity:true,orphans:true,widows:true,zIndex:true,zoom:true},cssProps:{"float":b.support.cssFloat?"cssFloat":"styleFloat"},style:function(bx,bw,bD,by){if(!bx||bx.nodeType===3||bx.nodeType===8||!bx.style){return}var bB,bC,bz=b.camelCase(bw),bv=bx.style,bE=b.cssHooks[bz];bw=b.cssProps[bz]||bz;if(bD!==L){bC=typeof bD;if(bC==="string"&&(bB=I.exec(bD))){bD=(+(bB[1]+1)*+bB[2])+parseFloat(b.css(bx,bw));bC="number"}if(bD==null||bC==="number"&&isNaN(bD)){return}if(bC==="number"&&!b.cssNumber[bz]){bD+="px"}if(!bE||!("set" in bE)||(bD=bE.set(bx,bD))!==L){try{bv[bw]=bD}catch(bA){}}}else{if(bE&&"get" in bE&&(bB=bE.get(bx,false,by))!==L){return bB}return bv[bw]}},css:function(by,bx,bv){var bw,e;bx=b.camelCase(bx);e=b.cssHooks[bx];bx=b.cssProps[bx]||bx;if(bx==="cssFloat"){bx="float"}if(e&&"get" in e&&(bw=e.get(by,true,bv))!==L){return bw}else{if(Z){return Z(by,bx)}}},swap:function(bx,bw,by){var e={};for(var bv in bw){e[bv]=bx.style[bv];bx.style[bv]=bw[bv]}by.call(bx);for(bv in bw){bx.style[bv]=e[bv]}}});b.curCSS=b.css;b.each(["height","width"],function(bv,e){b.cssHooks[e]={get:function(by,bx,bw){var bz;if(bx){if(by.offsetWidth!==0){return p(by,e,bw)}else{b.swap(by,a7,function(){bz=p(by,e,bw)})}return bz}},set:function(bw,bx){if(bc.test(bx)){bx=parseFloat(bx);if(bx>=0){return bx+"px"}}else{return bx}}}});if(!b.support.opacity){b.cssHooks.opacity={get:function(bv,e){return au.test((e&&bv.currentStyle?bv.currentStyle.filter:bv.style.filter)||"")?(parseFloat(RegExp.$1)/100)+"":e?"1":""},set:function(by,bz){var bx=by.style,bv=by.currentStyle,e=b.isNumeric(bz)?"alpha(opacity="+bz*100+")":"",bw=bv&&bv.filter||bx.filter||"";bx.zoom=1;if(bz>=1&&b.trim(bw.replace(ak,""))===""){bx.removeAttribute("filter");if(bv&&!bv.filter){return}}bx.filter=ak.test(bw)?bw.replace(ak,e):bw+" "+e}}}b(function(){if(!b.support.reliableMarginRight){b.cssHooks.marginRight={get:function(bw,bv){var e;b.swap(bw,{display:"inline-block"},function(){if(bv){e=Z(bw,"margin-right","marginRight")}else{e=bw.style.marginRight}});return e}}}});if(av.defaultView&&av.defaultView.getComputedStyle){aI=function(by,bw){var bv,bx,e;bw=bw.replace(z,"-$1").toLowerCase();if((bx=by.ownerDocument.defaultView)&&(e=bx.getComputedStyle(by,null))){bv=e.getPropertyValue(bw);if(bv===""&&!b.contains(by.ownerDocument.documentElement,by)){bv=b.style(by,bw)}}return bv}}if(av.documentElement.currentStyle){aX=function(bz,bw){var bA,e,by,bv=bz.currentStyle&&bz.currentStyle[bw],bx=bz.style;if(bv===null&&bx&&(by=bx[bw])){bv=by}if(!bc.test(bv)&&bn.test(bv)){bA=bx.left;e=bz.runtimeStyle&&bz.runtimeStyle.left;if(e){bz.runtimeStyle.left=bz.currentStyle.left}bx.left=bw==="fontSize"?"1em":(bv||0);bv=bx.pixelLeft+"px";bx.left=bA;if(e){bz.runtimeStyle.left=e}}return bv===""?"auto":bv}}Z=aI||aX;function p(by,bw,bv){var bA=bw==="width"?by.offsetWidth:by.offsetHeight,bz=bw==="width"?an:a1,bx=0,e=bz.length;if(bA>0){if(bv!=="border"){for(;bx<e;bx++){if(!bv){bA-=parseFloat(b.css(by,"padding"+bz[bx]))||0}if(bv==="margin"){bA+=parseFloat(b.css(by,bv+bz[bx]))||0}else{bA-=parseFloat(b.css(by,"border"+bz[bx]+"Width"))||0}}}return bA+"px"}bA=Z(by,bw,bw);if(bA<0||bA==null){bA=by.style[bw]||0}bA=parseFloat(bA)||0;if(bv){for(;bx<e;bx++){bA+=parseFloat(b.css(by,"padding"+bz[bx]))||0;if(bv!=="padding"){bA+=parseFloat(b.css(by,"border"+bz[bx]+"Width"))||0}if(bv==="margin"){bA+=parseFloat(b.css(by,bv+bz[bx]))||0}}}return bA+"px"}if(b.expr&&b.expr.filters){b.expr.filters.hidden=function(bw){var bv=bw.offsetWidth,e=bw.offsetHeight;return(bv===0&&e===0)||(!b.support.reliableHiddenOffsets&&((bw.style&&bw.style.display)||b.css(bw,"display"))==="none")};b.expr.filters.visible=function(e){return !b.expr.filters.hidden(e)}}var k=/%20/g,ap=/\[\]$/,bs=/\r?\n/g,bq=/#.*$/,aD=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,aZ=/^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,aM=/^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/,aQ=/^(?:GET|HEAD)$/,c=/^\/\//,M=/\?/,a6=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,q=/^(?:select|textarea)/i,h=/\s+/,br=/([?&])_=[^&]*/,K=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,A=b.fn.load,aa={},r={},aE,s,aV=["*/"]+["*"];try{aE=bl.href}catch(aw){aE=av.createElement("a");aE.href="";aE=aE.href}s=K.exec(aE.toLowerCase())||[];function f(e){return function(by,bA){if(typeof by!=="string"){bA=by;by="*"}if(b.isFunction(bA)){var bx=by.toLowerCase().split(h),bw=0,bz=bx.length,bv,bB,bC;for(;bw<bz;bw++){bv=bx[bw];bC=/^\+/.test(bv);if(bC){bv=bv.substr(1)||"*"}bB=e[bv]=e[bv]||[];bB[bC?"unshift":"push"](bA)}}}}function aW(bv,bE,bz,bD,bB,bx){bB=bB||bE.dataTypes[0];bx=bx||{};bx[bB]=true;var bA=bv[bB],bw=0,e=bA?bA.length:0,by=(bv===aa),bC;for(;bw<e&&(by||!bC);bw++){bC=bA[bw](bE,bz,bD);if(typeof bC==="string"){if(!by||bx[bC]){bC=L}else{bE.dataTypes.unshift(bC);bC=aW(bv,bE,bz,bD,bC,bx)}}}if((by||!bC)&&!bx["*"]){bC=aW(bv,bE,bz,bD,"*",bx)}return bC}function am(bw,bx){var bv,e,by=b.ajaxSettings.flatOptions||{};for(bv in bx){if(bx[bv]!==L){(by[bv]?bw:(e||(e={})))[bv]=bx[bv]}}if(e){b.extend(true,bw,e)}}b.fn.extend({load:function(bw,bz,bA){if(typeof bw!=="string"&&A){return A.apply(this,arguments)}else{if(!this.length){return this}}var by=bw.indexOf(" ");if(by>=0){var e=bw.slice(by,bw.length);bw=bw.slice(0,by)}var bx="GET";if(bz){if(b.isFunction(bz)){bA=bz;bz=L}else{if(typeof bz==="object"){bz=b.param(bz,b.ajaxSettings.traditional);bx="POST"}}}var bv=this;b.ajax({url:bw,type:bx,dataType:"html",data:bz,complete:function(bC,bB,bD){bD=bC.responseText;if(bC.isResolved()){bC.done(function(bE){bD=bE});bv.html(e?b("<div>").append(bD.replace(a6,"")).find(e):bD)}if(bA){bv.each(bA,[bD,bB,bC])}}});return this},serialize:function(){return b.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?b.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||q.test(this.nodeName)||aZ.test(this.type))}).map(function(e,bv){var bw=b(this).val();return bw==null?null:b.isArray(bw)?b.map(bw,function(by,bx){return{name:bv.name,value:by.replace(bs,"\r\n")}}):{name:bv.name,value:bw.replace(bs,"\r\n")}}).get()}});b.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(e,bv){b.fn[bv]=function(bw){return this.on(bv,bw)}});b.each(["get","post"],function(e,bv){b[bv]=function(bw,by,bz,bx){if(b.isFunction(by)){bx=bx||bz;bz=by;by=L}return b.ajax({type:bv,url:bw,data:by,success:bz,dataType:bx})}});b.extend({getScript:function(e,bv){return b.get(e,L,bv,"script")},getJSON:function(e,bv,bw){return b.get(e,bv,bw,"json")},ajaxSetup:function(bv,e){if(e){am(bv,b.ajaxSettings)}else{e=bv;bv=b.ajaxSettings}am(bv,e);return bv},ajaxSettings:{url:aE,isLocal:aM.test(s[1]),global:true,type:"GET",contentType:"application/x-www-form-urlencoded",processData:true,async:true,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":aV},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":bb.String,"text html":true,"text json":b.parseJSON,"text xml":b.parseXML},flatOptions:{context:true,url:true}},ajaxPrefilter:f(aa),ajaxTransport:f(r),ajax:function(bz,bx){if(typeof bz==="object"){bx=bz;bz=L}bx=bx||{};var bD=b.ajaxSetup({},bx),bS=bD.context||bD,bG=bS!==bD&&(bS.nodeType||bS instanceof b)?b(bS):b.event,bR=b.Deferred(),bN=b.Callbacks("once memory"),bB=bD.statusCode||{},bC,bH={},bO={},bQ,by,bL,bE,bI,bA=0,bw,bK,bJ={readyState:0,setRequestHeader:function(bT,bU){if(!bA){var e=bT.toLowerCase();bT=bO[e]=bO[e]||bT;bH[bT]=bU}return this},getAllResponseHeaders:function(){return bA===2?bQ:null},getResponseHeader:function(bT){var e;if(bA===2){if(!by){by={};while((e=aD.exec(bQ))){by[e[1].toLowerCase()]=e[2]}}e=by[bT.toLowerCase()]}return e===L?null:e},overrideMimeType:function(e){if(!bA){bD.mimeType=e}return this},abort:function(e){e=e||"abort";if(bL){bL.abort(e)}bF(0,e);return this}};function bF(bZ,bU,b0,bW){if(bA===2){return}bA=2;if(bE){clearTimeout(bE)}bL=L;bQ=bW||"";bJ.readyState=bZ>0?4:0;var bT,b4,b3,bX=bU,bY=b0?bj(bD,bJ,b0):L,bV,b2;if(bZ>=200&&bZ<300||bZ===304){if(bD.ifModified){if((bV=bJ.getResponseHeader("Last-Modified"))){b.lastModified[bC]=bV}if((b2=bJ.getResponseHeader("Etag"))){b.etag[bC]=b2}}if(bZ===304){bX="notmodified";bT=true}else{try{b4=G(bD,bY);bX="success";bT=true}catch(b1){bX="parsererror";b3=b1}}}else{b3=bX;if(!bX||bZ){bX="error";if(bZ<0){bZ=0}}}bJ.status=bZ;bJ.statusText=""+(bU||bX);if(bT){bR.resolveWith(bS,[b4,bX,bJ])}else{bR.rejectWith(bS,[bJ,bX,b3])}bJ.statusCode(bB);bB=L;if(bw){bG.trigger("ajax"+(bT?"Success":"Error"),[bJ,bD,bT?b4:b3])}bN.fireWith(bS,[bJ,bX]);if(bw){bG.trigger("ajaxComplete",[bJ,bD]);if(!(--b.active)){b.event.trigger("ajaxStop")}}}bR.promise(bJ);bJ.success=bJ.done;bJ.error=bJ.fail;bJ.complete=bN.add;bJ.statusCode=function(bT){if(bT){var e;if(bA<2){for(e in bT){bB[e]=[bB[e],bT[e]]}}else{e=bT[bJ.status];bJ.then(e,e)}}return this};bD.url=((bz||bD.url)+"").replace(bq,"").replace(c,s[1]+"//");bD.dataTypes=b.trim(bD.dataType||"*").toLowerCase().split(h);if(bD.crossDomain==null){bI=K.exec(bD.url.toLowerCase());bD.crossDomain=!!(bI&&(bI[1]!=s[1]||bI[2]!=s[2]||(bI[3]||(bI[1]==="http:"?80:443))!=(s[3]||(s[1]==="http:"?80:443))))}if(bD.data&&bD.processData&&typeof bD.data!=="string"){bD.data=b.param(bD.data,bD.traditional)}aW(aa,bD,bx,bJ);if(bA===2){return false}bw=bD.global;bD.type=bD.type.toUpperCase();bD.hasContent=!aQ.test(bD.type);if(bw&&b.active++===0){b.event.trigger("ajaxStart")}if(!bD.hasContent){if(bD.data){bD.url+=(M.test(bD.url)?"&":"?")+bD.data;delete bD.data}bC=bD.url;if(bD.cache===false){var bv=b.now(),bP=bD.url.replace(br,"$1_="+bv);bD.url=bP+((bP===bD.url)?(M.test(bD.url)?"&":"?")+"_="+bv:"")}}if(bD.data&&bD.hasContent&&bD.contentType!==false||bx.contentType){bJ.setRequestHeader("Content-Type",bD.contentType)}if(bD.ifModified){bC=bC||bD.url;if(b.lastModified[bC]){bJ.setRequestHeader("If-Modified-Since",b.lastModified[bC])}if(b.etag[bC]){bJ.setRequestHeader("If-None-Match",b.etag[bC])}}bJ.setRequestHeader("Accept",bD.dataTypes[0]&&bD.accepts[bD.dataTypes[0]]?bD.accepts[bD.dataTypes[0]]+(bD.dataTypes[0]!=="*"?", "+aV+"; q=0.01":""):bD.accepts["*"]);for(bK in bD.headers){bJ.setRequestHeader(bK,bD.headers[bK])}if(bD.beforeSend&&(bD.beforeSend.call(bS,bJ,bD)===false||bA===2)){bJ.abort();return false}for(bK in {success:1,error:1,complete:1}){bJ[bK](bD[bK])}bL=aW(r,bD,bx,bJ);if(!bL){bF(-1,"No Transport")}else{bJ.readyState=1;if(bw){bG.trigger("ajaxSend",[bJ,bD])}if(bD.async&&bD.timeout>0){bE=setTimeout(function(){bJ.abort("timeout")},bD.timeout)}try{bA=1;bL.send(bH,bF)}catch(bM){if(bA<2){bF(-1,bM)}else{throw bM}}}return bJ},param:function(e,bw){var bv=[],by=function(bz,bA){bA=b.isFunction(bA)?bA():bA;bv[bv.length]=encodeURIComponent(bz)+"="+encodeURIComponent(bA)};if(bw===L){bw=b.ajaxSettings.traditional}if(b.isArray(e)||(e.jquery&&!b.isPlainObject(e))){b.each(e,function(){by(this.name,this.value)})}else{for(var bx in e){v(bx,e[bx],bw,by)}}return bv.join("&").replace(k,"+")}});function v(bw,by,bv,bx){if(b.isArray(by)){b.each(by,function(bA,bz){if(bv||ap.test(bw)){bx(bw,bz)}else{v(bw+"["+(typeof bz==="object"||b.isArray(bz)?bA:"")+"]",bz,bv,bx)}})}else{if(!bv&&by!=null&&typeof by==="object"){for(var e in by){v(bw+"["+e+"]",by[e],bv,bx)}}else{bx(bw,by)}}}b.extend({active:0,lastModified:{},etag:{}});function bj(bD,bC,bz){var bv=bD.contents,bB=bD.dataTypes,bw=bD.responseFields,by,bA,bx,e;for(bA in bw){if(bA in bz){bC[bw[bA]]=bz[bA]}}while(bB[0]==="*"){bB.shift();if(by===L){by=bD.mimeType||bC.getResponseHeader("content-type")}}if(by){for(bA in bv){if(bv[bA]&&bv[bA].test(by)){bB.unshift(bA);break}}}if(bB[0] in bz){bx=bB[0]}else{for(bA in bz){if(!bB[0]||bD.converters[bA+" "+bB[0]]){bx=bA;break}if(!e){e=bA}}bx=bx||e}if(bx){if(bx!==bB[0]){bB.unshift(bx)}return bz[bx]}}function G(bH,bz){if(bH.dataFilter){bz=bH.dataFilter(bz,bH.dataType)}var bD=bH.dataTypes,bG={},bA,bE,bw=bD.length,bB,bC=bD[0],bx,by,bF,bv,e;for(bA=1;bA<bw;bA++){if(bA===1){for(bE in bH.converters){if(typeof bE==="string"){bG[bE.toLowerCase()]=bH.converters[bE]}}}bx=bC;bC=bD[bA];if(bC==="*"){bC=bx}else{if(bx!=="*"&&bx!==bC){by=bx+" "+bC;bF=bG[by]||bG["* "+bC];if(!bF){e=L;for(bv in bG){bB=bv.split(" ");if(bB[0]===bx||bB[0]==="*"){e=bG[bB[1]+" "+bC];if(e){bv=bG[bv];if(bv===true){bF=e}else{if(e===true){bF=bv}}break}}}}if(!(bF||e)){b.error("No conversion from "+by.replace(" "," to "))}if(bF!==true){bz=bF?bF(bz):e(bv(bz))}}}}return bz}var aC=b.now(),u=/(\=)\?(&|$)|\?\?/i;b.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return b.expando+"_"+(aC++)}});b.ajaxPrefilter("json jsonp",function(bD,bA,bC){var bx=bD.contentType==="application/x-www-form-urlencoded"&&(typeof bD.data==="string");if(bD.dataTypes[0]==="jsonp"||bD.jsonp!==false&&(u.test(bD.url)||bx&&u.test(bD.data))){var bB,bw=bD.jsonpCallback=b.isFunction(bD.jsonpCallback)?bD.jsonpCallback():bD.jsonpCallback,bz=bb[bw],e=bD.url,by=bD.data,bv="$1"+bw+"$2";if(bD.jsonp!==false){e=e.replace(u,bv);if(bD.url===e){if(bx){by=by.replace(u,bv)}if(bD.data===by){e+=(/\?/.test(e)?"&":"?")+bD.jsonp+"="+bw}}}bD.url=e;bD.data=by;bb[bw]=function(bE){bB=[bE]};bC.always(function(){bb[bw]=bz;if(bB&&b.isFunction(bz)){bb[bw](bB[0])}});bD.converters["script json"]=function(){if(!bB){b.error(bw+" was not called")}return bB[0]};bD.dataTypes[0]="json";return"script"}});b.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(e){b.globalEval(e);return e}}});b.ajaxPrefilter("script",function(e){if(e.cache===L){e.cache=false}if(e.crossDomain){e.type="GET";e.global=false}});b.ajaxTransport("script",function(bw){if(bw.crossDomain){var e,bv=av.head||av.getElementsByTagName("head")[0]||av.documentElement;return{send:function(bx,by){e=av.createElement("script");e.async="async";if(bw.scriptCharset){e.charset=bw.scriptCharset}e.src=bw.url;e.onload=e.onreadystatechange=function(bA,bz){if(bz||!e.readyState||/loaded|complete/.test(e.readyState)){e.onload=e.onreadystatechange=null;if(bv&&e.parentNode){bv.removeChild(e)}e=L;if(!bz){by(200,"success")}}};bv.insertBefore(e,bv.firstChild)},abort:function(){if(e){e.onload(0,1)}}}}});var B=bb.ActiveXObject?function(){for(var e in N){N[e](0,1)}}:false,y=0,N;function aL(){try{return new bb.XMLHttpRequest()}catch(bv){}}function aj(){try{return new bb.ActiveXObject("Microsoft.XMLHTTP")}catch(bv){}}b.ajaxSettings.xhr=bb.ActiveXObject?function(){return !this.isLocal&&aL()||aj()}:aL;(function(e){b.extend(b.support,{ajax:!!e,cors:!!e&&("withCredentials" in e)})})(b.ajaxSettings.xhr());if(b.support.ajax){b.ajaxTransport(function(e){if(!e.crossDomain||b.support.cors){var bv;return{send:function(bB,bw){var bA=e.xhr(),bz,by;if(e.username){bA.open(e.type,e.url,e.async,e.username,e.password)}else{bA.open(e.type,e.url,e.async)}if(e.xhrFields){for(by in e.xhrFields){bA[by]=e.xhrFields[by]}}if(e.mimeType&&bA.overrideMimeType){bA.overrideMimeType(e.mimeType)}if(!e.crossDomain&&!bB["X-Requested-With"]){bB["X-Requested-With"]="XMLHttpRequest"}try{for(by in bB){bA.setRequestHeader(by,bB[by])}}catch(bx){}bA.send((e.hasContent&&e.data)||null);bv=function(bK,bE){var bF,bD,bC,bI,bH;try{if(bv&&(bE||bA.readyState===4)){bv=L;if(bz){bA.onreadystatechange=b.noop;if(B){delete N[bz]}}if(bE){if(bA.readyState!==4){bA.abort()}}else{bF=bA.status;bC=bA.getAllResponseHeaders();bI={};bH=bA.responseXML;if(bH&&bH.documentElement){bI.xml=bH}bI.text=bA.responseText;try{bD=bA.statusText}catch(bJ){bD=""}if(!bF&&e.isLocal&&!e.crossDomain){bF=bI.text?200:404}else{if(bF===1223){bF=204}}}}}catch(bG){if(!bE){bw(-1,bG)}}if(bI){bw(bF,bD,bI,bC)}};if(!e.async||bA.readyState===4){bv()}else{bz=++y;if(B){if(!N){N={};b(bb).unload(B)}N[bz]=bv}bA.onreadystatechange=bv}},abort:function(){if(bv){bv(0,1)}}}}})}var Q={},a8,m,aB=/^(?:toggle|show|hide)$/,aT=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,a3,aH=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],a4;b.fn.extend({show:function(bx,bA,bz){var bw,by;if(bx||bx===0){return this.animate(a0("show",3),bx,bA,bz)}else{for(var bv=0,e=this.length;bv<e;bv++){bw=this[bv];if(bw.style){by=bw.style.display;if(!b._data(bw,"olddisplay")&&by==="none"){by=bw.style.display=""}if(by===""&&b.css(bw,"display")==="none"){b._data(bw,"olddisplay",x(bw.nodeName))}}}for(bv=0;bv<e;bv++){bw=this[bv];if(bw.style){by=bw.style.display;if(by===""||by==="none"){bw.style.display=b._data(bw,"olddisplay")||""}}}return this}},hide:function(bx,bA,bz){if(bx||bx===0){return this.animate(a0("hide",3),bx,bA,bz)}else{var bw,by,bv=0,e=this.length;for(;bv<e;bv++){bw=this[bv];if(bw.style){by=b.css(bw,"display");if(by!=="none"&&!b._data(bw,"olddisplay")){b._data(bw,"olddisplay",by)}}}for(bv=0;bv<e;bv++){if(this[bv].style){this[bv].style.display="none"}}return this}},_toggle:b.fn.toggle,toggle:function(bw,bv,bx){var e=typeof bw==="boolean";if(b.isFunction(bw)&&b.isFunction(bv)){this._toggle.apply(this,arguments)}else{if(bw==null||e){this.each(function(){var by=e?bw:b(this).is(":hidden");b(this)[by?"show":"hide"]()})}else{this.animate(a0("toggle",3),bw,bv,bx)}}return this},fadeTo:function(e,bx,bw,bv){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:bx},e,bw,bv)},animate:function(bz,bw,by,bx){var e=b.speed(bw,by,bx);if(b.isEmptyObject(bz)){return this.each(e.complete,[false])}bz=b.extend({},bz);function bv(){if(e.queue===false){b._mark(this)}var bE=b.extend({},e),bK=this.nodeType===1,bI=bK&&b(this).is(":hidden"),bB,bF,bD,bJ,bH,bC,bG,bL,bA;bE.animatedProperties={};for(bD in bz){bB=b.camelCase(bD);if(bD!==bB){bz[bB]=bz[bD];delete bz[bD]}bF=bz[bB];if(b.isArray(bF)){bE.animatedProperties[bB]=bF[1];bF=bz[bB]=bF[0]}else{bE.animatedProperties[bB]=bE.specialEasing&&bE.specialEasing[bB]||bE.easing||"swing"}if(bF==="hide"&&bI||bF==="show"&&!bI){return bE.complete.call(this)}if(bK&&(bB==="height"||bB==="width")){bE.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY];if(b.css(this,"display")==="inline"&&b.css(this,"float")==="none"){if(!b.support.inlineBlockNeedsLayout||x(this.nodeName)==="inline"){this.style.display="inline-block"}else{this.style.zoom=1}}}}if(bE.overflow!=null){this.style.overflow="hidden"}for(bD in bz){bJ=new b.fx(this,bE,bD);bF=bz[bD];if(aB.test(bF)){bA=b._data(this,"toggle"+bD)||(bF==="toggle"?bI?"show":"hide":0);if(bA){b._data(this,"toggle"+bD,bA==="show"?"hide":"show");bJ[bA]()}else{bJ[bF]()}}else{bH=aT.exec(bF);bC=bJ.cur();if(bH){bG=parseFloat(bH[2]);bL=bH[3]||(b.cssNumber[bD]?"":"px");if(bL!=="px"){b.style(this,bD,(bG||1)+bL);bC=((bG||1)/bJ.cur())*bC;b.style(this,bD,bC+bL)}if(bH[1]){bG=((bH[1]==="-="?-1:1)*bG)+bC}bJ.custom(bC,bG,bL)}else{bJ.custom(bC,bF,"")}}}return true}return e.queue===false?this.each(bv):this.queue(e.queue,bv)},stop:function(bw,bv,e){if(typeof bw!=="string"){e=bv;bv=bw;bw=L}if(bv&&bw!==false){this.queue(bw||"fx",[])}return this.each(function(){var bx,by=false,bA=b.timers,bz=b._data(this);if(!e){b._unmark(true,this)}function bB(bE,bF,bD){var bC=bF[bD];b.removeData(bE,bD,true);bC.stop(e)}if(bw==null){for(bx in bz){if(bz[bx]&&bz[bx].stop&&bx.indexOf(".run")===bx.length-4){bB(this,bz,bx)}}}else{if(bz[bx=bw+".run"]&&bz[bx].stop){bB(this,bz,bx)}}for(bx=bA.length;bx--;){if(bA[bx].elem===this&&(bw==null||bA[bx].queue===bw)){if(e){bA[bx](true)}else{bA[bx].saveState()}by=true;bA.splice(bx,1)}}if(!(e&&by)){b.dequeue(this,bw)}})}});function bh(){setTimeout(at,0);return(a4=b.now())}function at(){a4=L}function a0(bv,e){var bw={};b.each(aH.concat.apply([],aH.slice(0,e)),function(){bw[this]=bv});return bw}b.each({slideDown:a0("show",1),slideUp:a0("hide",1),slideToggle:a0("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(e,bv){b.fn[e]=function(bw,by,bx){return this.animate(bv,bw,by,bx)}});b.extend({speed:function(bw,bx,bv){var e=bw&&typeof bw==="object"?b.extend({},bw):{complete:bv||!bv&&bx||b.isFunction(bw)&&bw,duration:bw,easing:bv&&bx||bx&&!b.isFunction(bx)&&bx};e.duration=b.fx.off?0:typeof e.duration==="number"?e.duration:e.duration in b.fx.speeds?b.fx.speeds[e.duration]:b.fx.speeds._default;if(e.queue==null||e.queue===true){e.queue="fx"}e.old=e.complete;e.complete=function(by){if(b.isFunction(e.old)){e.old.call(this)}if(e.queue){b.dequeue(this,e.queue)}else{if(by!==false){b._unmark(this)}}};return e},easing:{linear:function(bw,bx,e,bv){return e+bv*bw},swing:function(bw,bx,e,bv){return((-Math.cos(bw*Math.PI)/2)+0.5)*bv+e}},timers:[],fx:function(bv,e,bw){this.options=e;this.elem=bv;this.prop=bw;e.orig=e.orig||{}}});b.fx.prototype={update:function(){if(this.options.step){this.options.step.call(this.elem,this.now,this)}(b.fx.step[this.prop]||b.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null)){return this.elem[this.prop]}var e,bv=b.css(this.elem,this.prop);return isNaN(e=parseFloat(bv))?!bv||bv==="auto"?0:bv:e},custom:function(bz,by,bx){var e=this,bw=b.fx;this.startTime=a4||bh();this.end=by;this.now=this.start=bz;this.pos=this.state=0;this.unit=bx||this.unit||(b.cssNumber[this.prop]?"":"px");function bv(bA){return e.step(bA)}bv.queue=this.options.queue;bv.elem=this.elem;bv.saveState=function(){if(e.options.hide&&b._data(e.elem,"fxshow"+e.prop)===L){b._data(e.elem,"fxshow"+e.prop,e.start)}};if(bv()&&b.timers.push(bv)&&!a3){a3=setInterval(bw.tick,bw.interval)}},show:function(){var e=b._data(this.elem,"fxshow"+this.prop);this.options.orig[this.prop]=e||b.style(this.elem,this.prop);this.options.show=true;if(e!==L){this.custom(this.cur(),e)}else{this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur())}b(this.elem).show()},hide:function(){this.options.orig[this.prop]=b._data(this.elem,"fxshow"+this.prop)||b.style(this.elem,this.prop);this.options.hide=true;this.custom(this.cur(),0)},step:function(by){var bA,bB,bv,bx=a4||bh(),e=true,bz=this.elem,bw=this.options;if(by||bx>=bw.duration+this.startTime){this.now=this.end;this.pos=this.state=1;this.update();bw.animatedProperties[this.prop]=true;for(bA in bw.animatedProperties){if(bw.animatedProperties[bA]!==true){e=false}}if(e){if(bw.overflow!=null&&!b.support.shrinkWrapBlocks){b.each(["","X","Y"],function(bC,bD){bz.style["overflow"+bD]=bw.overflow[bC]})}if(bw.hide){b(bz).hide()}if(bw.hide||bw.show){for(bA in bw.animatedProperties){b.style(bz,bA,bw.orig[bA]);b.removeData(bz,"fxshow"+bA,true);b.removeData(bz,"toggle"+bA,true)}}bv=bw.complete;if(bv){bw.complete=false;bv.call(bz)}}return false}else{if(bw.duration==Infinity){this.now=bx}else{bB=bx-this.startTime;this.state=bB/bw.duration;this.pos=b.easing[bw.animatedProperties[this.prop]](this.state,bB,0,1,bw.duration);this.now=this.start+((this.end-this.start)*this.pos)}this.update()}return true}};b.extend(b.fx,{tick:function(){var bw,bv=b.timers,e=0;for(;e<bv.length;e++){bw=bv[e];if(!bw()&&bv[e]===bw){bv.splice(e--,1)}}if(!bv.length){b.fx.stop()}},interval:13,stop:function(){clearInterval(a3);a3=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(e){b.style(e.elem,"opacity",e.now)},_default:function(e){if(e.elem.style&&e.elem.style[e.prop]!=null){e.elem.style[e.prop]=e.now+e.unit}else{e.elem[e.prop]=e.now}}}});b.each(["width","height"],function(e,bv){b.fx.step[bv]=function(bw){b.style(bw.elem,bv,Math.max(0,bw.now)+bw.unit)}});if(b.expr&&b.expr.filters){b.expr.filters.animated=function(e){return b.grep(b.timers,function(bv){return e===bv.elem}).length}}function x(bx){if(!Q[bx]){var e=av.body,bv=b("<"+bx+">").appendTo(e),bw=bv.css("display");bv.remove();if(bw==="none"||bw===""){if(!a8){a8=av.createElement("iframe");a8.frameBorder=a8.width=a8.height=0}e.appendChild(a8);if(!m||!a8.createElement){m=(a8.contentWindow||a8.contentDocument).document;m.write((av.compatMode==="CSS1Compat"?"<!doctype html>":"")+"<html><body>");m.close()}bv=m.createElement(bx);m.body.appendChild(bv);bw=b.css(bv,"display");e.removeChild(a8)}Q[bx]=bw}return Q[bx]}var V=/^t(?:able|d|h)$/i,ad=/^(?:body|html)$/i;if("getBoundingClientRect" in av.documentElement){b.fn.offset=function(bI){var by=this[0],bB;if(bI){return this.each(function(e){b.offset.setOffset(this,bI,e)})}if(!by||!by.ownerDocument){return null}if(by===by.ownerDocument.body){return b.offset.bodyOffset(by)}try{bB=by.getBoundingClientRect()}catch(bF){}var bH=by.ownerDocument,bw=bH.documentElement;if(!bB||!b.contains(bw,by)){return bB?{top:bB.top,left:bB.left}:{top:0,left:0}}var bC=bH.body,bD=aK(bH),bA=bw.clientTop||bC.clientTop||0,bE=bw.clientLeft||bC.clientLeft||0,bv=bD.pageYOffset||b.support.boxModel&&bw.scrollTop||bC.scrollTop,bz=bD.pageXOffset||b.support.boxModel&&bw.scrollLeft||bC.scrollLeft,bG=bB.top+bv-bA,bx=bB.left+bz-bE;return{top:bG,left:bx}}}else{b.fn.offset=function(bF){var bz=this[0];if(bF){return this.each(function(bG){b.offset.setOffset(this,bF,bG)})}if(!bz||!bz.ownerDocument){return null}if(bz===bz.ownerDocument.body){return b.offset.bodyOffset(bz)}var bC,bw=bz.offsetParent,bv=bz,bE=bz.ownerDocument,bx=bE.documentElement,bA=bE.body,bB=bE.defaultView,e=bB?bB.getComputedStyle(bz,null):bz.currentStyle,bD=bz.offsetTop,by=bz.offsetLeft;while((bz=bz.parentNode)&&bz!==bA&&bz!==bx){if(b.support.fixedPosition&&e.position==="fixed"){break}bC=bB?bB.getComputedStyle(bz,null):bz.currentStyle;bD-=bz.scrollTop;by-=bz.scrollLeft;if(bz===bw){bD+=bz.offsetTop;by+=bz.offsetLeft;if(b.support.doesNotAddBorder&&!(b.support.doesAddBorderForTableAndCells&&V.test(bz.nodeName))){bD+=parseFloat(bC.borderTopWidth)||0;by+=parseFloat(bC.borderLeftWidth)||0}bv=bw;bw=bz.offsetParent}if(b.support.subtractsBorderForOverflowNotVisible&&bC.overflow!=="visible"){bD+=parseFloat(bC.borderTopWidth)||0;by+=parseFloat(bC.borderLeftWidth)||0}e=bC}if(e.position==="relative"||e.position==="static"){bD+=bA.offsetTop;by+=bA.offsetLeft}if(b.support.fixedPosition&&e.position==="fixed"){bD+=Math.max(bx.scrollTop,bA.scrollTop);by+=Math.max(bx.scrollLeft,bA.scrollLeft)}return{top:bD,left:by}}}b.offset={bodyOffset:function(e){var bw=e.offsetTop,bv=e.offsetLeft;if(b.support.doesNotIncludeMarginInBodyOffset){bw+=parseFloat(b.css(e,"marginTop"))||0;bv+=parseFloat(b.css(e,"marginLeft"))||0}return{top:bw,left:bv}},setOffset:function(bx,bG,bA){var bB=b.css(bx,"position");if(bB==="static"){bx.style.position="relative"}var bz=b(bx),bv=bz.offset(),e=b.css(bx,"top"),bE=b.css(bx,"left"),bF=(bB==="absolute"||bB==="fixed")&&b.inArray("auto",[e,bE])>-1,bD={},bC={},bw,by;if(bF){bC=bz.position();bw=bC.top;by=bC.left}else{bw=parseFloat(e)||0;by=parseFloat(bE)||0}if(b.isFunction(bG)){bG=bG.call(bx,bA,bv)}if(bG.top!=null){bD.top=(bG.top-bv.top)+bw}if(bG.left!=null){bD.left=(bG.left-bv.left)+by}if("using" in bG){bG.using.call(bx,bD)}else{bz.css(bD)}}};b.fn.extend({position:function(){if(!this[0]){return null}var bw=this[0],bv=this.offsetParent(),bx=this.offset(),e=ad.test(bv[0].nodeName)?{top:0,left:0}:bv.offset();bx.top-=parseFloat(b.css(bw,"marginTop"))||0;bx.left-=parseFloat(b.css(bw,"marginLeft"))||0;e.top+=parseFloat(b.css(bv[0],"borderTopWidth"))||0;e.left+=parseFloat(b.css(bv[0],"borderLeftWidth"))||0;return{top:bx.top-e.top,left:bx.left-e.left}},offsetParent:function(){return this.map(function(){var e=this.offsetParent||av.body;while(e&&(!ad.test(e.nodeName)&&b.css(e,"position")==="static")){e=e.offsetParent}return e})}});b.each(["Left","Top"],function(bv,e){var bw="scroll"+e;b.fn[bw]=function(bz){var bx,by;if(bz===L){bx=this[0];if(!bx){return null}by=aK(bx);return by?("pageXOffset" in by)?by[bv?"pageYOffset":"pageXOffset"]:b.support.boxModel&&by.document.documentElement[bw]||by.document.body[bw]:bx[bw]}return this.each(function(){by=aK(this);if(by){by.scrollTo(!bv?bz:b(by).scrollLeft(),bv?bz:b(by).scrollTop())}else{this[bw]=bz}})}});function aK(e){return b.isWindow(e)?e:e.nodeType===9?e.defaultView||e.parentWindow:false}b.each(["Height","Width"],function(bv,e){var bw=e.toLowerCase();b.fn["inner"+e]=function(){var bx=this[0];return bx?bx.style?parseFloat(b.css(bx,bw,"padding")):this[bw]():null};b.fn["outer"+e]=function(by){var bx=this[0];return bx?bx.style?parseFloat(b.css(bx,bw,by?"margin":"border")):this[bw]():null};b.fn[bw]=function(bz){var bA=this[0];if(!bA){return bz==null?null:this}if(b.isFunction(bz)){return this.each(function(bE){var bD=b(this);bD[bw](bz.call(this,bE,bD[bw]()))})}if(b.isWindow(bA)){var bB=bA.document.documentElement["client"+e],bx=bA.document.body;return bA.document.compatMode==="CSS1Compat"&&bB||bx&&bx["client"+e]||bB}else{if(bA.nodeType===9){return Math.max(bA.documentElement["client"+e],bA.body["scroll"+e],bA.documentElement["scroll"+e],bA.body["offset"+e],bA.documentElement["offset"+e])}else{if(bz===L){var bC=b.css(bA,bw),by=parseFloat(bC);return b.isNumeric(by)?by:bC}else{return this.css(bw,typeof bz==="string"?bz:bz+"px")}}}}});bb.jQuery=bb.$=b;if(typeof define==="function"&&define.amd&&define.amd.jQuery){define("jquery",[],function(){return b})}})(window);/*! + * jQuery UI 1.8.18 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function(a,d){a.ui=a.ui||{};if(a.ui.version){return}a.extend(a.ui,{version:"1.8.18",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});a.fn.extend({propAttr:a.fn.prop||a.fn.attr,_focus:a.fn.focus,focus:function(e,f){return typeof e==="number"?this.each(function(){var g=this;setTimeout(function(){a(g).focus();if(f){f.call(g)}},e)}):this._focus.apply(this,arguments)},scrollParent:function(){var e;if((a.browser.msie&&(/(static|relative)/).test(this.css("position")))||(/absolute/).test(this.css("position"))){e=this.parents().filter(function(){return(/(relative|absolute|fixed)/).test(a.curCSS(this,"position",1))&&(/(auto|scroll)/).test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0)}else{e=this.parents().filter(function(){return(/(auto|scroll)/).test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0)}return(/fixed/).test(this.css("position"))||!e.length?a(document):e},zIndex:function(h){if(h!==d){return this.css("zIndex",h)}if(this.length){var f=a(this[0]),e,g;while(f.length&&f[0]!==document){e=f.css("position");if(e==="absolute"||e==="relative"||e==="fixed"){g=parseInt(f.css("zIndex"),10);if(!isNaN(g)&&g!==0){return g}}f=f.parent()}}return 0},disableSelection:function(){return this.bind((a.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(e){e.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});a.each(["Width","Height"],function(g,e){var f=e==="Width"?["Left","Right"]:["Top","Bottom"],h=e.toLowerCase(),k={innerWidth:a.fn.innerWidth,innerHeight:a.fn.innerHeight,outerWidth:a.fn.outerWidth,outerHeight:a.fn.outerHeight};function j(m,l,i,n){a.each(f,function(){l-=parseFloat(a.curCSS(m,"padding"+this,true))||0;if(i){l-=parseFloat(a.curCSS(m,"border"+this+"Width",true))||0}if(n){l-=parseFloat(a.curCSS(m,"margin"+this,true))||0}});return l}a.fn["inner"+e]=function(i){if(i===d){return k["inner"+e].call(this)}return this.each(function(){a(this).css(h,j(this,i)+"px")})};a.fn["outer"+e]=function(i,l){if(typeof i!=="number"){return k["outer"+e].call(this,i)}return this.each(function(){a(this).css(h,j(this,i,true,l)+"px")})}});function c(g,e){var j=g.nodeName.toLowerCase();if("area"===j){var i=g.parentNode,h=i.name,f;if(!g.href||!h||i.nodeName.toLowerCase()!=="map"){return false}f=a("img[usemap=#"+h+"]")[0];return !!f&&b(f)}return(/input|select|textarea|button|object/.test(j)?!g.disabled:"a"==j?g.href||e:e)&&b(g)}function b(e){return !a(e).parents().andSelf().filter(function(){return a.curCSS(this,"visibility")==="hidden"||a.expr.filters.hidden(this)}).length}a.extend(a.expr[":"],{data:function(g,f,e){return !!a.data(g,e[3])},focusable:function(e){return c(e,!isNaN(a.attr(e,"tabindex")))},tabbable:function(g){var e=a.attr(g,"tabindex"),f=isNaN(e);return(f||e>=0)&&c(g,!f)}});a(function(){var e=document.body,f=e.appendChild(f=document.createElement("div"));f.offsetHeight;a.extend(f.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});a.support.minHeight=f.offsetHeight===100;a.support.selectstart="onselectstart" in f;e.removeChild(f).style.display="none"});a.extend(a.ui,{plugin:{add:function(f,g,j){var h=a.ui[f].prototype;for(var e in j){h.plugins[e]=h.plugins[e]||[];h.plugins[e].push([g,j[e]])}},call:function(e,g,f){var j=e.plugins[g];if(!j||!e.element[0].parentNode){return}for(var h=0;h<j.length;h++){if(e.options[j[h][0]]){j[h][1].apply(e.element,f)}}}},contains:function(f,e){return document.compareDocumentPosition?f.compareDocumentPosition(e)&16:f!==e&&f.contains(e)},hasScroll:function(h,f){if(a(h).css("overflow")==="hidden"){return false}var e=(f&&f==="left")?"scrollLeft":"scrollTop",g=false;if(h[e]>0){return true}h[e]=1;g=(h[e]>0);h[e]=0;return g},isOverAxis:function(f,e,g){return(f>e)&&(f<(e+g))},isOver:function(j,f,i,h,e,g){return a.ui.isOverAxis(j,i,e)&&a.ui.isOverAxis(f,h,g)}})})(jQuery);/*! + * jQuery UI Widget 1.8.18 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Widget + */ +(function(b,d){if(b.cleanData){var c=b.cleanData;b.cleanData=function(f){for(var g=0,h;(h=f[g])!=null;g++){try{b(h).triggerHandler("remove")}catch(j){}}c(f)}}else{var a=b.fn.remove;b.fn.remove=function(e,f){return this.each(function(){if(!f){if(!e||b.filter(e,[this]).length){b("*",this).add([this]).each(function(){try{b(this).triggerHandler("remove")}catch(g){}})}}return a.call(b(this),e,f)})}}b.widget=function(f,h,e){var g=f.split(".")[0],j;f=f.split(".")[1];j=g+"-"+f;if(!e){e=h;h=b.Widget}b.expr[":"][j]=function(k){return !!b.data(k,f)};b[g]=b[g]||{};b[g][f]=function(k,l){if(arguments.length){this._createWidget(k,l)}};var i=new h();i.options=b.extend(true,{},i.options);b[g][f].prototype=b.extend(true,i,{namespace:g,widgetName:f,widgetEventPrefix:b[g][f].prototype.widgetEventPrefix||f,widgetBaseClass:j},e);b.widget.bridge(f,b[g][f])};b.widget.bridge=function(f,e){b.fn[f]=function(i){var g=typeof i==="string",h=Array.prototype.slice.call(arguments,1),j=this;i=!g&&h.length?b.extend.apply(null,[true,i].concat(h)):i;if(g&&i.charAt(0)==="_"){return j}if(g){this.each(function(){var k=b.data(this,f),l=k&&b.isFunction(k[i])?k[i].apply(k,h):k;if(l!==k&&l!==d){j=l;return false}})}else{this.each(function(){var k=b.data(this,f);if(k){k.option(i||{})._init()}else{b.data(this,f,new e(i,this))}})}return j}};b.Widget=function(e,f){if(arguments.length){this._createWidget(e,f)}};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(f,g){b.data(g,this.widgetName,this);this.element=b(g);this.options=b.extend(true,{},this.options,this._getCreateOptions(),f);var e=this;this.element.bind("remove."+this.widgetName,function(){e.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},widget:function(){return this.element},option:function(f,g){var e=f;if(arguments.length===0){return b.extend({},this.options)}if(typeof f==="string"){if(g===d){return this.options[f]}e={};e[f]=g}this._setOptions(e);return this},_setOptions:function(f){var e=this;b.each(f,function(g,h){e._setOption(g,h)});return this},_setOption:function(e,f){this.options[e]=f;if(e==="disabled"){this.widget()[f?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",f)}return this},enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(e,f,g){var j,i,h=this.options[e];g=g||{};f=b.Event(f);f.type=(e===this.widgetEventPrefix?e:this.widgetEventPrefix+e).toLowerCase();f.target=this.element[0];i=f.originalEvent;if(i){for(j in i){if(!(j in f)){f[j]=i[j]}}}this.element.trigger(f,g);return !(b.isFunction(h)&&h.call(this.element[0],f,g)===false||f.isDefaultPrevented())}}})(jQuery);/*! + * jQuery UI Mouse 1.8.18 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Mouse + * + * Depends: + * jquery.ui.widget.js + */ +(function(b,c){var a=false;b(document).mouseup(function(d){a=false});b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var d=this;this.element.bind("mousedown."+this.widgetName,function(e){return d._mouseDown(e)}).bind("click."+this.widgetName,function(e){if(true===b.data(e.target,d.widgetName+".preventClickEvent")){b.removeData(e.target,d.widgetName+".preventClickEvent");e.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName)},_mouseDown:function(f){if(a){return}(this._mouseStarted&&this._mouseUp(f));this._mouseDownEvent=f;var e=this,g=(f.which==1),d=(typeof this.options.cancel=="string"&&f.target.nodeName?b(f.target).closest(this.options.cancel).length:false);if(!g||d||!this._mouseCapture(f)){return true}this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet){this._mouseDelayTimer=setTimeout(function(){e.mouseDelayMet=true},this.options.delay)}if(this._mouseDistanceMet(f)&&this._mouseDelayMet(f)){this._mouseStarted=(this._mouseStart(f)!==false);if(!this._mouseStarted){f.preventDefault();return true}}if(true===b.data(f.target,this.widgetName+".preventClickEvent")){b.removeData(f.target,this.widgetName+".preventClickEvent")}this._mouseMoveDelegate=function(h){return e._mouseMove(h)};this._mouseUpDelegate=function(h){return e._mouseUp(h)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);f.preventDefault();a=true;return true},_mouseMove:function(d){if(b.browser.msie&&!(document.documentMode>=9)&&!d.button){return this._mouseUp(d)}if(this._mouseStarted){this._mouseDrag(d);return d.preventDefault()}if(this._mouseDistanceMet(d)&&this._mouseDelayMet(d)){this._mouseStarted=(this._mouseStart(this._mouseDownEvent,d)!==false);(this._mouseStarted?this._mouseDrag(d):this._mouseUp(d))}return !this._mouseStarted},_mouseUp:function(d){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;if(d.target==this._mouseDownEvent.target){b.data(d.target,this.widgetName+".preventClickEvent",true)}this._mouseStop(d)}return false},_mouseDistanceMet:function(d){return(Math.max(Math.abs(this._mouseDownEvent.pageX-d.pageX),Math.abs(this._mouseDownEvent.pageY-d.pageY))>=this.options.distance)},_mouseDelayMet:function(d){return this.mouseDelayMet},_mouseStart:function(d){},_mouseDrag:function(d){},_mouseStop:function(d){},_mouseCapture:function(d){return true}})})(jQuery);(function(c,d){c.widget("ui.resizable",c.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1000},_create:function(){var f=this,k=this.options;this.element.addClass("ui-resizable");c.extend(this,{_aspectRatio:!!(k.aspectRatio),aspectRatio:k.aspectRatio,originalElement:this.element,_proportionallyResizeElements:[],_helper:k.helper||k.ghost||k.animate?k.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){this.element.wrap(c('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=k.handles||(!c(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all"){this.handles="n,e,s,w,se,sw,ne,nw"}var l=this.handles.split(",");this.handles={};for(var g=0;g<l.length;g++){var j=c.trim(l[g]),e="ui-resizable-"+j;var h=c('<div class="ui-resizable-handle '+e+'"></div>');if(/sw|se|ne|nw/.test(j)){h.css({zIndex:++k.zIndex})}if("se"==j){h.addClass("ui-icon ui-icon-gripsmall-diagonal-se")}this.handles[j]=".ui-resizable-"+j;this.element.append(h)}}this._renderAxis=function(q){q=q||this.element;for(var n in this.handles){if(this.handles[n].constructor==String){this.handles[n]=c(this.handles[n],this.element).show()}if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var o=c(this.handles[n],this.element),p=0;p=/sw|ne|nw|se|n|s/.test(n)?o.outerHeight():o.outerWidth();var m=["padding",/ne|nw|n/.test(n)?"Top":/se|sw|s/.test(n)?"Bottom":/^e$/.test(n)?"Right":"Left"].join("");q.css(m,p);this._proportionallyResize()}if(!c(this.handles[n]).length){continue}}};this._renderAxis(this.element);this._handles=c(".ui-resizable-handle",this.element).disableSelection();this._handles.mouseover(function(){if(!f.resizing){if(this.className){var i=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i)}f.axis=i&&i[1]?i[1]:"se"}});if(k.autoHide){this._handles.hide();c(this.element).addClass("ui-resizable-autohide").hover(function(){if(k.disabled){return}c(this).removeClass("ui-resizable-autohide");f._handles.show()},function(){if(k.disabled){return}if(!f.resizing){c(this).addClass("ui-resizable-autohide");f._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var e=function(g){c(g).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){e(this.element);var f=this.element;f.after(this.originalElement.css({position:f.css("position"),width:f.outerWidth(),height:f.outerHeight(),top:f.css("top"),left:f.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);e(this.originalElement);return this},_mouseCapture:function(f){var g=false;for(var e in this.handles){if(c(this.handles[e])[0]==f.target){g=true}}return !this.options.disabled&&g},_mouseStart:function(g){var j=this.options,f=this.element.position(),e=this.element;this.resizing=true;this.documentScroll={top:c(document).scrollTop(),left:c(document).scrollLeft()};if(e.is(".ui-draggable")||(/absolute/).test(e.css("position"))){e.css({position:"absolute",top:f.top,left:f.left})}this._renderProxy();var k=b(this.helper.css("left")),h=b(this.helper.css("top"));if(j.containment){k+=c(j.containment).scrollLeft()||0;h+=c(j.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:k,top:h};this.size=this._helper?{width:e.outerWidth(),height:e.outerHeight()}:{width:e.width(),height:e.height()};this.originalSize=this._helper?{width:e.outerWidth(),height:e.outerHeight()}:{width:e.width(),height:e.height()};this.originalPosition={left:k,top:h};this.sizeDiff={width:e.outerWidth()-e.width(),height:e.outerHeight()-e.height()};this.originalMousePosition={left:g.pageX,top:g.pageY};this.aspectRatio=(typeof j.aspectRatio=="number")?j.aspectRatio:((this.originalSize.width/this.originalSize.height)||1);var i=c(".ui-resizable-"+this.axis).css("cursor");c("body").css("cursor",i=="auto"?this.axis+"-resize":i);e.addClass("ui-resizable-resizing");this._propagate("start",g);return true},_mouseDrag:function(e){var h=this.helper,g=this.options,m={},q=this,j=this.originalMousePosition,n=this.axis;var r=(e.pageX-j.left)||0,p=(e.pageY-j.top)||0;var i=this._change[n];if(!i){return false}var l=i.apply(this,[e,r,p]),k=c.browser.msie&&c.browser.version<7,f=this.sizeDiff;this._updateVirtualBoundaries(e.shiftKey);if(this._aspectRatio||e.shiftKey){l=this._updateRatio(l,e)}l=this._respectSize(l,e);this._propagate("resize",e);h.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});if(!this._helper&&this._proportionallyResizeElements.length){this._proportionallyResize()}this._updateCache(l);this._trigger("resize",e,this.ui());return false},_mouseStop:function(h){this.resizing=false;var i=this.options,m=this;if(this._helper){var g=this._proportionallyResizeElements,e=g.length&&(/textarea/i).test(g[0].nodeName),f=e&&c.ui.hasScroll(g[0],"left")?0:m.sizeDiff.height,k=e?0:m.sizeDiff.width;var n={width:(m.helper.width()-k),height:(m.helper.height()-f)},j=(parseInt(m.element.css("left"),10)+(m.position.left-m.originalPosition.left))||null,l=(parseInt(m.element.css("top"),10)+(m.position.top-m.originalPosition.top))||null;if(!i.animate){this.element.css(c.extend(n,{top:l,left:j}))}m.helper.height(m.size.height);m.helper.width(m.size.width);if(this._helper&&!i.animate){this._proportionallyResize()}}c("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",h);if(this._helper){this.helper.remove()}return false},_updateVirtualBoundaries:function(g){var j=this.options,i,h,f,k,e;e={minWidth:a(j.minWidth)?j.minWidth:0,maxWidth:a(j.maxWidth)?j.maxWidth:Infinity,minHeight:a(j.minHeight)?j.minHeight:0,maxHeight:a(j.maxHeight)?j.maxHeight:Infinity};if(this._aspectRatio||g){i=e.minHeight*this.aspectRatio;f=e.minWidth/this.aspectRatio;h=e.maxHeight*this.aspectRatio;k=e.maxWidth/this.aspectRatio;if(i>e.minWidth){e.minWidth=i}if(f>e.minHeight){e.minHeight=f}if(h<e.maxWidth){e.maxWidth=h}if(k<e.maxHeight){e.maxHeight=k}}this._vBoundaries=e},_updateCache:function(e){var f=this.options;this.offset=this.helper.offset();if(a(e.left)){this.position.left=e.left}if(a(e.top)){this.position.top=e.top}if(a(e.height)){this.size.height=e.height}if(a(e.width)){this.size.width=e.width}},_updateRatio:function(h,g){var i=this.options,j=this.position,f=this.size,e=this.axis;if(a(h.height)){h.width=(h.height*this.aspectRatio)}else{if(a(h.width)){h.height=(h.width/this.aspectRatio)}}if(e=="sw"){h.left=j.left+(f.width-h.width);h.top=null}if(e=="nw"){h.top=j.top+(f.height-h.height);h.left=j.left+(f.width-h.width)}return h},_respectSize:function(l,g){var j=this.helper,i=this._vBoundaries,r=this._aspectRatio||g.shiftKey,q=this.axis,t=a(l.width)&&i.maxWidth&&(i.maxWidth<l.width),m=a(l.height)&&i.maxHeight&&(i.maxHeight<l.height),h=a(l.width)&&i.minWidth&&(i.minWidth>l.width),s=a(l.height)&&i.minHeight&&(i.minHeight>l.height);if(h){l.width=i.minWidth}if(s){l.height=i.minHeight}if(t){l.width=i.maxWidth}if(m){l.height=i.maxHeight}var f=this.originalPosition.left+this.originalSize.width,p=this.position.top+this.size.height;var k=/sw|nw|w/.test(q),e=/nw|ne|n/.test(q);if(h&&k){l.left=f-i.minWidth}if(t&&k){l.left=f-i.maxWidth}if(s&&e){l.top=p-i.minHeight}if(m&&e){l.top=p-i.maxHeight}var n=!l.width&&!l.height;if(n&&!l.left&&l.top){l.top=null}else{if(n&&!l.top&&l.left){l.left=null}}return l},_proportionallyResize:function(){var k=this.options;if(!this._proportionallyResizeElements.length){return}var g=this.helper||this.element;for(var f=0;f<this._proportionallyResizeElements.length;f++){var h=this._proportionallyResizeElements[f];if(!this.borderDif){var e=[h.css("borderTopWidth"),h.css("borderRightWidth"),h.css("borderBottomWidth"),h.css("borderLeftWidth")],j=[h.css("paddingTop"),h.css("paddingRight"),h.css("paddingBottom"),h.css("paddingLeft")];this.borderDif=c.map(e,function(l,n){var m=parseInt(l,10)||0,o=parseInt(j[n],10)||0;return m+o})}if(c.browser.msie&&!(!(c(g).is(":hidden")||c(g).parents(":hidden").length))){continue}h.css({height:(g.height()-this.borderDif[0]-this.borderDif[2])||0,width:(g.width()-this.borderDif[1]-this.borderDif[3])||0})}},_renderProxy:function(){var f=this.element,i=this.options;this.elementOffset=f.offset();if(this._helper){this.helper=this.helper||c('<div style="overflow:hidden;"></div>');var e=c.browser.msie&&c.browser.version<7,g=(e?1:0),h=(e?2:-1);this.helper.addClass(this._helper).css({width:this.element.outerWidth()+h,height:this.element.outerHeight()+h,position:"absolute",left:this.elementOffset.left-g+"px",top:this.elementOffset.top-g+"px",zIndex:++i.zIndex});this.helper.appendTo("body").disableSelection()}else{this.helper=this.element}},_change:{e:function(g,f,e){return{width:this.originalSize.width+f}},w:function(h,f,e){var j=this.options,g=this.originalSize,i=this.originalPosition;return{left:i.left+f,width:g.width-f}},n:function(h,f,e){var j=this.options,g=this.originalSize,i=this.originalPosition;return{top:i.top+e,height:g.height-e}},s:function(g,f,e){return{height:this.originalSize.height+e}},se:function(g,f,e){return c.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[g,f,e]))},sw:function(g,f,e){return c.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[g,f,e]))},ne:function(g,f,e){return c.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[g,f,e]))},nw:function(g,f,e){return c.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[g,f,e]))}},_propagate:function(f,e){c.ui.plugin.call(this,f,[e,this.ui()]);(f!="resize"&&this._trigger(f,e,this.ui()))},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});c.extend(c.ui.resizable,{version:"1.8.18"});c.ui.plugin.add("resizable","alsoResize",{start:function(f,g){var e=c(this).data("resizable"),i=e.options;var h=function(j){c(j).each(function(){var k=c(this);k.data("resizable-alsoresize",{width:parseInt(k.width(),10),height:parseInt(k.height(),10),left:parseInt(k.css("left"),10),top:parseInt(k.css("top"),10)})})};if(typeof(i.alsoResize)=="object"&&!i.alsoResize.parentNode){if(i.alsoResize.length){i.alsoResize=i.alsoResize[0];h(i.alsoResize)}else{c.each(i.alsoResize,function(j){h(j)})}}else{h(i.alsoResize)}},resize:function(g,i){var f=c(this).data("resizable"),j=f.options,h=f.originalSize,l=f.originalPosition;var k={height:(f.size.height-h.height)||0,width:(f.size.width-h.width)||0,top:(f.position.top-l.top)||0,left:(f.position.left-l.left)||0},e=function(m,n){c(m).each(function(){var q=c(this),r=c(this).data("resizable-alsoresize"),p={},o=n&&n.length?n:q.parents(i.originalElement[0]).length?["width","height"]:["width","height","top","left"];c.each(o,function(s,u){var t=(r[u]||0)+(k[u]||0);if(t&&t>=0){p[u]=t||null}});q.css(p)})};if(typeof(j.alsoResize)=="object"&&!j.alsoResize.nodeType){c.each(j.alsoResize,function(m,n){e(m,n)})}else{e(j.alsoResize)}},stop:function(e,f){c(this).removeData("resizable-alsoresize")}});c.ui.plugin.add("resizable","animate",{stop:function(i,n){var p=c(this).data("resizable"),j=p.options;var h=p._proportionallyResizeElements,e=h.length&&(/textarea/i).test(h[0].nodeName),f=e&&c.ui.hasScroll(h[0],"left")?0:p.sizeDiff.height,l=e?0:p.sizeDiff.width;var g={width:(p.size.width-l),height:(p.size.height-f)},k=(parseInt(p.element.css("left"),10)+(p.position.left-p.originalPosition.left))||null,m=(parseInt(p.element.css("top"),10)+(p.position.top-p.originalPosition.top))||null;p.element.animate(c.extend(g,m&&k?{top:m,left:k}:{}),{duration:j.animateDuration,easing:j.animateEasing,step:function(){var o={width:parseInt(p.element.css("width"),10),height:parseInt(p.element.css("height"),10),top:parseInt(p.element.css("top"),10),left:parseInt(p.element.css("left"),10)};if(h&&h.length){c(h[0]).css({width:o.width,height:o.height})}p._updateCache(o);p._propagate("resize",i)}})}});c.ui.plugin.add("resizable","containment",{start:function(f,r){var t=c(this).data("resizable"),j=t.options,l=t.element;var g=j.containment,k=(g instanceof c)?g.get(0):(/parent/.test(g))?l.parent().get(0):g;if(!k){return}t.containerElement=c(k);if(/document/.test(g)||g==document){t.containerOffset={left:0,top:0};t.containerPosition={left:0,top:0};t.parentData={element:c(document),left:0,top:0,width:c(document).width(),height:c(document).height()||document.body.parentNode.scrollHeight}}else{var n=c(k),i=[];c(["Top","Right","Left","Bottom"]).each(function(p,o){i[p]=b(n.css("padding"+o))});t.containerOffset=n.offset();t.containerPosition=n.position();t.containerSize={height:(n.innerHeight()-i[3]),width:(n.innerWidth()-i[1])};var q=t.containerOffset,e=t.containerSize.height,m=t.containerSize.width,h=(c.ui.hasScroll(k,"left")?k.scrollWidth:m),s=(c.ui.hasScroll(k)?k.scrollHeight:e);t.parentData={element:k,left:q.left,top:q.top,width:h,height:s}}},resize:function(g,q){var t=c(this).data("resizable"),i=t.options,f=t.containerSize,p=t.containerOffset,m=t.size,n=t.position,r=t._aspectRatio||g.shiftKey,e={top:0,left:0},h=t.containerElement;if(h[0]!=document&&(/static/).test(h.css("position"))){e=p}if(n.left<(t._helper?p.left:0)){t.size.width=t.size.width+(t._helper?(t.position.left-p.left):(t.position.left-e.left));if(r){t.size.height=t.size.width/i.aspectRatio}t.position.left=i.helper?p.left:0}if(n.top<(t._helper?p.top:0)){t.size.height=t.size.height+(t._helper?(t.position.top-p.top):t.position.top);if(r){t.size.width=t.size.height*i.aspectRatio}t.position.top=t._helper?p.top:0}t.offset.left=t.parentData.left+t.position.left;t.offset.top=t.parentData.top+t.position.top;var l=Math.abs((t._helper?t.offset.left-e.left:(t.offset.left-e.left))+t.sizeDiff.width),s=Math.abs((t._helper?t.offset.top-e.top:(t.offset.top-p.top))+t.sizeDiff.height);var k=t.containerElement.get(0)==t.element.parent().get(0),j=/relative|absolute/.test(t.containerElement.css("position"));if(k&&j){l-=t.parentData.left}if(l+t.size.width>=t.parentData.width){t.size.width=t.parentData.width-l;if(r){t.size.height=t.size.width/t.aspectRatio}}if(s+t.size.height>=t.parentData.height){t.size.height=t.parentData.height-s;if(r){t.size.width=t.size.height*t.aspectRatio}}},stop:function(f,n){var q=c(this).data("resizable"),g=q.options,l=q.position,m=q.containerOffset,e=q.containerPosition,i=q.containerElement;var j=c(q.helper),r=j.offset(),p=j.outerWidth()-q.sizeDiff.width,k=j.outerHeight()-q.sizeDiff.height;if(q._helper&&!g.animate&&(/relative/).test(i.css("position"))){c(this).css({left:r.left-e.left-m.left,width:p,height:k})}if(q._helper&&!g.animate&&(/static/).test(i.css("position"))){c(this).css({left:r.left-e.left-m.left,width:p,height:k})}}});c.ui.plugin.add("resizable","ghost",{start:function(g,h){var e=c(this).data("resizable"),i=e.options,f=e.size;e.ghost=e.originalElement.clone();e.ghost.css({opacity:0.25,display:"block",position:"relative",height:f.height,width:f.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof i.ghost=="string"?i.ghost:"");e.ghost.appendTo(e.helper)},resize:function(f,g){var e=c(this).data("resizable"),h=e.options;if(e.ghost){e.ghost.css({position:"relative",height:e.size.height,width:e.size.width})}},stop:function(f,g){var e=c(this).data("resizable"),h=e.options;if(e.ghost&&e.helper){e.helper.get(0).removeChild(e.ghost.get(0))}}});c.ui.plugin.add("resizable","grid",{resize:function(e,m){var p=c(this).data("resizable"),h=p.options,k=p.size,i=p.originalSize,j=p.originalPosition,n=p.axis,l=h._aspectRatio||e.shiftKey;h.grid=typeof h.grid=="number"?[h.grid,h.grid]:h.grid;var g=Math.round((k.width-i.width)/(h.grid[0]||1))*(h.grid[0]||1),f=Math.round((k.height-i.height)/(h.grid[1]||1))*(h.grid[1]||1);if(/^(se|s|e)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f}else{if(/^(ne)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f;p.position.top=j.top-f}else{if(/^(sw)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f;p.position.left=j.left-g}else{p.size.width=i.width+g;p.size.height=i.height+f;p.position.top=j.top-f;p.position.left=j.left-g}}}}});var b=function(e){return parseInt(e,10)||0};var a=function(e){return !isNaN(parseInt(e,10))}})(jQuery);/*! + * jQuery hashchange event - v1.3 - 7/21/2010 + * http://benalman.com/projects/jquery-hashchange-plugin/ + * + * Copyright (c) 2010 "Cowboy" Ben Alman + * Dual licensed under the MIT and GPL licenses. + * http://benalman.com/about/license/ + */ +(function($,e,b){var c="hashchange",h=document,f,g=$.event.special,i=h.documentMode,d="on"+c in e&&(i===b||i>7);function a(j){j=j||location.href;return"#"+j.replace(/^[^#]*#?(.*)$/,"$1")}$.fn[c]=function(j){return j?this.bind(c,j):this.trigger(c)};$.fn[c].delay=50;g[c]=$.extend(g[c],{setup:function(){if(d){return false}$(f.start)},teardown:function(){if(d){return false}$(f.stop)}});f=(function(){var j={},p,m=a(),k=function(q){return q},l=k,o=k;j.start=function(){p||n()};j.stop=function(){p&&clearTimeout(p);p=b};function n(){var r=a(),q=o(m);if(r!==m){l(m=r,q);$(e).trigger(c)}else{if(q!==m){location.href=location.href.replace(/#.*/,"")+q}}p=setTimeout(n,$.fn[c].delay)}$.browser.msie&&!d&&(function(){var q,r;j.start=function(){if(!q){r=$.fn[c].src;r=r&&r+a();q=$('<iframe tabindex="-1" title="empty"/>').hide().one("load",function(){r||l(a());n()}).attr("src",r||"javascript:0").insertAfter("body")[0].contentWindow;h.onpropertychange=function(){try{if(event.propertyName==="title"){q.document.title=h.title}}catch(s){}}}};j.stop=k;o=function(){return a(q.location.href)};l=function(v,s){var u=q.document,t=$.fn[c].domain;if(v!==s){u.title=h.title;u.open();t&&u.write('<script>document.domain="'+t+'"<\/script>');u.close();q.location.hash=v}}})();return j})()})(jQuery,this);(function(c){var a=c.scrollTo=function(f,e,d){c(window).scrollTo(f,e,d)};a.defaults={axis:"xy",duration:parseFloat(c.fn.jquery)>=1.3?0:1};a.window=function(d){return c(window)._scrollable()};c.fn._scrollable=function(){return this.map(function(){var e=this,d=!e.nodeName||c.inArray(e.nodeName.toLowerCase(),["iframe","#document","html","body"])!=-1;if(!d){return e}var f=(e.contentWindow||e).document||e.ownerDocument||e;return c.browser.safari||f.compatMode=="BackCompat"?f.body:f.documentElement})};c.fn.scrollTo=function(f,e,d){if(typeof e=="object"){d=e;e=0}if(typeof d=="function"){d={onAfter:d}}if(f=="max"){f=9000000000}d=c.extend({},a.defaults,d);e=e||d.speed||d.duration;d.queue=d.queue&&d.axis.length>1;if(d.queue){e/=2}d.offset=b(d.offset);d.over=b(d.over);return this._scrollable().each(function(){var l=this,j=c(l),k=f,i,g={},m=j.is("html,body");switch(typeof k){case"number":case"string":if(/^([+-]=)?\d+(\.\d+)?(px|%)?$/.test(k)){k=b(k);break}k=c(k,this);case"object":if(k.is||k.style){i=(k=c(k)).offset()}}c.each(d.axis.split(""),function(q,r){var s=r=="x"?"Left":"Top",u=s.toLowerCase(),p="scroll"+s,o=l[p],n=a.max(l,r);if(i){g[p]=i[u]+(m?0:o-j.offset()[u]);if(d.margin){g[p]-=parseInt(k.css("margin"+s))||0;g[p]-=parseInt(k.css("border"+s+"Width"))||0}g[p]+=d.offset[u]||0;if(d.over[u]){g[p]+=k[r=="x"?"width":"height"]()*d.over[u]}}else{var t=k[u];g[p]=t.slice&&t.slice(-1)=="%"?parseFloat(t)/100*n:t}if(/^\d+$/.test(g[p])){g[p]=g[p]<=0?0:Math.min(g[p],n)}if(!q&&d.queue){if(o!=g[p]){h(d.onAfterFirst)}delete g[p]}});h(d.onAfter);function h(n){j.animate(g,e,d.easing,n&&function(){n.call(this,f,d)})}}).end()};a.max=function(j,i){var h=i=="x"?"Width":"Height",e="scroll"+h;if(!c(j).is("html,body")){return j[e]-c(j)[h.toLowerCase()]()}var g="client"+h,f=j.ownerDocument.documentElement,d=j.ownerDocument.body;return Math.max(f[e],d[e])-Math.min(f[g],d[g])};function b(d){return typeof d=="object"?d:{top:d,left:d}}})(jQuery);/*! + PowerTip - v1.2.0 - 2013-04-03 + http://stevenbenner.github.com/jquery-powertip/ + Copyright (c) 2013 Steven Benner (http://stevenbenner.com/). + Released under MIT license. + https://raw.github.com/stevenbenner/jquery-powertip/master/LICENSE.txt +*/ +(function(a){if(typeof define==="function"&&define.amd){define(["jquery"],a)}else{a(jQuery)}}(function(k){var A=k(document),s=k(window),w=k("body");var n="displayController",e="hasActiveHover",d="forcedOpen",u="hasMouseMove",f="mouseOnToPopup",g="originalTitle",y="powertip",o="powertipjq",l="powertiptarget",E=180/Math.PI;var c={isTipOpen:false,isFixedTipOpen:false,isClosing:false,tipOpenImminent:false,activeHover:null,currentX:0,currentY:0,previousX:0,previousY:0,desyncTimeout:null,mouseTrackingActive:false,delayInProgress:false,windowWidth:0,windowHeight:0,scrollTop:0,scrollLeft:0};var p={none:0,top:1,bottom:2,left:4,right:8};k.fn.powerTip=function(F,N){if(!this.length){return this}if(k.type(F)==="string"&&k.powerTip[F]){return k.powerTip[F].call(this,this,N)}var O=k.extend({},k.fn.powerTip.defaults,F),G=new x(O);h();this.each(function M(){var R=k(this),Q=R.data(y),P=R.data(o),T=R.data(l),S;if(R.data(n)){k.powerTip.destroy(R)}S=R.attr("title");if(!Q&&!T&&!P&&S){R.data(y,S);R.data(g,S);R.removeAttr("title")}R.data(n,new t(R,O,G))});if(!O.manual){this.on({"mouseenter.powertip":function J(P){k.powerTip.show(this,P)},"mouseleave.powertip":function L(){k.powerTip.hide(this)},"focus.powertip":function K(){k.powerTip.show(this)},"blur.powertip":function H(){k.powerTip.hide(this,true)},"keydown.powertip":function I(P){if(P.keyCode===27){k.powerTip.hide(this,true)}}})}return this};k.fn.powerTip.defaults={fadeInTime:200,fadeOutTime:100,followMouse:false,popupId:"powerTip",intentSensitivity:7,intentPollInterval:100,closeDelay:100,placement:"n",smartPlacement:false,offset:10,mouseOnToPopup:false,manual:false};k.fn.powerTip.smartPlacementLists={n:["n","ne","nw","s"],e:["e","ne","se","w","nw","sw","n","s","e"],s:["s","se","sw","n"],w:["w","nw","sw","e","ne","se","n","s","w"],nw:["nw","w","sw","n","s","se","nw"],ne:["ne","e","se","n","s","sw","ne"],sw:["sw","w","nw","s","n","ne","sw"],se:["se","e","ne","s","n","nw","se"],"nw-alt":["nw-alt","n","ne-alt","sw-alt","s","se-alt","w","e"],"ne-alt":["ne-alt","n","nw-alt","se-alt","s","sw-alt","e","w"],"sw-alt":["sw-alt","s","se-alt","nw-alt","n","ne-alt","w","e"],"se-alt":["se-alt","s","sw-alt","ne-alt","n","nw-alt","e","w"]};k.powerTip={show:function z(F,G){if(G){i(G);c.previousX=G.pageX;c.previousY=G.pageY;k(F).data(n).show()}else{k(F).first().data(n).show(true,true)}return F},reposition:function r(F){k(F).first().data(n).resetPosition();return F},hide:function D(G,F){if(G){k(G).first().data(n).hide(F)}else{if(c.activeHover){c.activeHover.data(n).hide(true)}}return G},destroy:function C(G){k(G).off(".powertip").each(function F(){var I=k(this),H=[g,n,e,d];if(I.data(g)){I.attr("title",I.data(g));H.push(y)}I.removeData(H)});return G}};k.powerTip.showTip=k.powerTip.show;k.powerTip.closeTip=k.powerTip.hide;function b(){var F=this;F.top="auto";F.left="auto";F.right="auto";F.bottom="auto";F.set=function(H,G){if(k.isNumeric(G)){F[H]=Math.round(G)}}}function t(K,N,F){var J=null;function L(P,Q){M();if(!K.data(e)){if(!P){c.tipOpenImminent=true;J=setTimeout(function O(){J=null;I()},N.intentPollInterval)}else{if(Q){K.data(d,true)}F.showTip(K)}}}function G(P){M();c.tipOpenImminent=false;if(K.data(e)){K.data(d,false);if(!P){c.delayInProgress=true;J=setTimeout(function O(){J=null;F.hideTip(K);c.delayInProgress=false},N.closeDelay)}else{F.hideTip(K)}}}function I(){var Q=Math.abs(c.previousX-c.currentX),O=Math.abs(c.previousY-c.currentY),P=Q+O;if(P<N.intentSensitivity){F.showTip(K)}else{c.previousX=c.currentX;c.previousY=c.currentY;L()}}function M(){J=clearTimeout(J);c.delayInProgress=false}function H(){F.resetPosition(K)}this.show=L;this.hide=G;this.cancel=M;this.resetPosition=H}function j(){function G(M,L,J,O,P){var K=L.split("-")[0],N=new b(),I;if(q(M)){I=H(M,K)}else{I=F(M,K)}switch(L){case"n":N.set("left",I.left-(J/2));N.set("bottom",c.windowHeight-I.top+P);break;case"e":N.set("left",I.left+P);N.set("top",I.top-(O/2));break;case"s":N.set("left",I.left-(J/2));N.set("top",I.top+P);break;case"w":N.set("top",I.top-(O/2));N.set("right",c.windowWidth-I.left+P);break;case"nw":N.set("bottom",c.windowHeight-I.top+P);N.set("right",c.windowWidth-I.left-20);break;case"nw-alt":N.set("left",I.left);N.set("bottom",c.windowHeight-I.top+P);break;case"ne":N.set("left",I.left-20);N.set("bottom",c.windowHeight-I.top+P);break;case"ne-alt":N.set("bottom",c.windowHeight-I.top+P);N.set("right",c.windowWidth-I.left);break;case"sw":N.set("top",I.top+P);N.set("right",c.windowWidth-I.left-20);break;case"sw-alt":N.set("left",I.left);N.set("top",I.top+P);break;case"se":N.set("left",I.left-20);N.set("top",I.top+P);break;case"se-alt":N.set("top",I.top+P);N.set("right",c.windowWidth-I.left);break}return N}function F(K,J){var O=K.offset(),N=K.outerWidth(),I=K.outerHeight(),M,L;switch(J){case"n":M=O.left+N/2;L=O.top;break;case"e":M=O.left+N;L=O.top+I/2;break;case"s":M=O.left+N/2;L=O.top+I;break;case"w":M=O.left;L=O.top+I/2;break;case"nw":M=O.left;L=O.top;break;case"ne":M=O.left+N;L=O.top;break;case"sw":M=O.left;L=O.top+I;break;case"se":M=O.left+N;L=O.top+I;break}return{top:L,left:M}}function H(O,K){var S=O.closest("svg")[0],N=O[0],W=S.createSVGPoint(),L=N.getBBox(),V=N.getScreenCTM(),M=L.width/2,Q=L.height/2,P=[],I=["nw","n","ne","e","se","s","sw","w"],U,X,R,T;function J(){P.push(W.matrixTransform(V))}W.x=L.x;W.y=L.y;J();W.x+=M;J();W.x+=M;J();W.y+=Q;J();W.y+=Q;J();W.x-=M;J();W.x-=M;J();W.y-=Q;J();if(P[0].y!==P[1].y||P[0].x!==P[7].x){X=Math.atan2(V.b,V.a)*E;R=Math.ceil(((X%360)-22.5)/45);if(R<1){R+=8}while(R--){I.push(I.shift())}}for(T=0;T<P.length;T++){if(I[T]===K){U=P[T];break}}return{top:U.y+c.scrollTop,left:U.x+c.scrollLeft}}this.compute=G}function x(Q){var P=new j(),O=k("#"+Q.popupId);if(O.length===0){O=k("<div/>",{id:Q.popupId});if(w.length===0){w=k("body")}w.append(O)}if(Q.followMouse){if(!O.data(u)){A.on("mousemove",M);s.on("scroll",M);O.data(u,true)}}if(Q.mouseOnToPopup){O.on({mouseenter:function L(){if(O.data(f)){if(c.activeHover){c.activeHover.data(n).cancel()}}},mouseleave:function N(){if(c.activeHover){c.activeHover.data(n).hide()}}})}function I(S){S.data(e,true);O.queue(function R(T){H(S);T()})}function H(S){var U;if(!S.data(e)){return}if(c.isTipOpen){if(!c.isClosing){K(c.activeHover)}O.delay(100).queue(function R(V){H(S);V()});return}S.trigger("powerTipPreRender");U=B(S);if(U){O.empty().append(U)}else{return}S.trigger("powerTipRender");c.activeHover=S;c.isTipOpen=true;O.data(f,Q.mouseOnToPopup);if(!Q.followMouse){G(S);c.isFixedTipOpen=true}else{M()}O.fadeIn(Q.fadeInTime,function T(){if(!c.desyncTimeout){c.desyncTimeout=setInterval(J,500)}S.trigger("powerTipOpen")})}function K(R){c.isClosing=true;c.activeHover=null;c.isTipOpen=false;c.desyncTimeout=clearInterval(c.desyncTimeout);R.data(e,false);R.data(d,false);O.fadeOut(Q.fadeOutTime,function S(){var T=new b();c.isClosing=false;c.isFixedTipOpen=false;O.removeClass();T.set("top",c.currentY+Q.offset);T.set("left",c.currentX+Q.offset);O.css(T);R.trigger("powerTipClose")})}function M(){if(!c.isFixedTipOpen&&(c.isTipOpen||(c.tipOpenImminent&&O.data(u)))){var R=O.outerWidth(),V=O.outerHeight(),U=new b(),S,T;U.set("top",c.currentY+Q.offset);U.set("left",c.currentX+Q.offset);S=m(U,R,V);if(S!==p.none){T=a(S);if(T===1){if(S===p.right){U.set("left",c.windowWidth-R)}else{if(S===p.bottom){U.set("top",c.scrollTop+c.windowHeight-V)}}}else{U.set("left",c.currentX-R-Q.offset);U.set("top",c.currentY-V-Q.offset)}}O.css(U)}}function G(S){var R,T;if(Q.smartPlacement){R=k.fn.powerTip.smartPlacementLists[Q.placement];k.each(R,function(U,W){var V=m(F(S,W),O.outerWidth(),O.outerHeight());T=W;if(V===p.none){return false}})}else{F(S,Q.placement);T=Q.placement}O.addClass(T)}function F(U,T){var R=0,S,W,V=new b();V.set("top",0);V.set("left",0);O.css(V);do{S=O.outerWidth();W=O.outerHeight();V=P.compute(U,T,S,W,Q.offset);O.css(V)}while(++R<=5&&(S!==O.outerWidth()||W!==O.outerHeight()));return V}function J(){var R=false;if(c.isTipOpen&&!c.isClosing&&!c.delayInProgress){if(c.activeHover.data(e)===false||c.activeHover.is(":disabled")){R=true}else{if(!v(c.activeHover)&&!c.activeHover.is(":focus")&&!c.activeHover.data(d)){if(O.data(f)){if(!v(O)){R=true}}else{R=true}}}if(R){K(c.activeHover)}}}this.showTip=I;this.hideTip=K;this.resetPosition=G}function q(F){return window.SVGElement&&F[0] instanceof SVGElement}function h(){if(!c.mouseTrackingActive){c.mouseTrackingActive=true;k(function H(){c.scrollLeft=s.scrollLeft();c.scrollTop=s.scrollTop();c.windowWidth=s.width();c.windowHeight=s.height()});A.on("mousemove",i);s.on({resize:function G(){c.windowWidth=s.width();c.windowHeight=s.height()},scroll:function F(){var I=s.scrollLeft(),J=s.scrollTop();if(I!==c.scrollLeft){c.currentX+=I-c.scrollLeft;c.scrollLeft=I}if(J!==c.scrollTop){c.currentY+=J-c.scrollTop;c.scrollTop=J}}})}}function i(F){c.currentX=F.pageX;c.currentY=F.pageY}function v(F){var H=F.offset(),J=F[0].getBoundingClientRect(),I=J.right-J.left,G=J.bottom-J.top;return c.currentX>=H.left&&c.currentX<=H.left+I&&c.currentY>=H.top&&c.currentY<=H.top+G}function B(I){var G=I.data(y),F=I.data(o),K=I.data(l),H,J;if(G){if(k.isFunction(G)){G=G.call(I[0])}J=G}else{if(F){if(k.isFunction(F)){F=F.call(I[0])}if(F.length>0){J=F.clone(true,true)}}else{if(K){H=k("#"+K);if(H.length>0){J=H.html()}}}}return J}function m(M,L,K){var G=c.scrollTop,J=c.scrollLeft,I=G+c.windowHeight,F=J+c.windowWidth,H=p.none;if(M.top<G||Math.abs(M.bottom-c.windowHeight)-K<G){H|=p.top}if(M.top+K>I||Math.abs(M.bottom-c.windowHeight)>I){H|=p.bottom}if(M.left<J||M.right+L>F){H|=p.left}if(M.left+L>F||M.right<J){H|=p.right}return H}function a(G){var F=0;while(G){G&=G-1;F++}return F}}));/*! + * jQuery UI Touch Punch 0.2.3 + * + * Copyright 2011–2014, Dave Furfero + * Dual licensed under the MIT or GPL Version 2 licenses. + * + * Depends: + * jquery.ui.widget.js + * jquery.ui.mouse.js + */ +(function(b){b.support.touch="ontouchend" in document;if(!b.support.touch){return}var d=b.ui.mouse.prototype,f=d._mouseInit,c=d._mouseDestroy,a;function e(h,i){if(h.originalEvent.touches.length>1){return}h.preventDefault();var j=h.originalEvent.changedTouches[0],g=document.createEvent("MouseEvents");g.initMouseEvent(i,true,true,window,1,j.screenX,j.screenY,j.clientX,j.clientY,false,false,false,false,0,null);h.target.dispatchEvent(g)}d._touchStart=function(h){var g=this;if(a||!g._mouseCapture(h.originalEvent.changedTouches[0])){return}a=true;g._touchMoved=false;e(h,"mouseover");e(h,"mousemove");e(h,"mousedown")};d._touchMove=function(g){if(!a){return}this._touchMoved=true;e(g,"mousemove")};d._touchEnd=function(g){if(!a){return}e(g,"mouseup");e(g,"mouseout");if(!this._touchMoved){e(g,"click")}a=false};d._mouseInit=function(){var g=this;g.element.bind({touchstart:b.proxy(g,"_touchStart"),touchmove:b.proxy(g,"_touchMove"),touchend:b.proxy(g,"_touchEnd")});f.call(g)};d._mouseDestroy=function(){var g=this;g.element.unbind({touchstart:b.proxy(g,"_touchStart"),touchmove:b.proxy(g,"_touchMove"),touchend:b.proxy(g,"_touchEnd")});c.call(g)}})(jQuery);/*! + * SmartMenus jQuery Plugin - v1.0.0 - January 27, 2016 + * http://www.smartmenus.org/ + * + * Copyright Vasil Dinkov, Vadikom Web Ltd. + * http://vadikom.com + * + * Licensed MIT + */ +(function(a){if(typeof define==="function"&&define.amd){define(["jquery"],a)}else{if(typeof module==="object"&&typeof module.exports==="object"){module.exports=a(require("jquery"))}else{a(jQuery)}}}(function(a){var b=[],e=!!window.createPopup,f=false,d="ontouchstart" in window,h=false,g=window.requestAnimationFrame||function(l){return setTimeout(l,1000/60)},c=window.cancelAnimationFrame||function(l){clearTimeout(l)};function k(m){var n=".smartmenus_mouse";if(!h&&!m){var o=true,l=null;a(document).bind(i([["mousemove",function(s){var t={x:s.pageX,y:s.pageY,timeStamp:new Date().getTime()};if(l){var q=Math.abs(l.x-t.x),p=Math.abs(l.y-t.y);if((q>0||p>0)&&q<=2&&p<=2&&t.timeStamp-l.timeStamp<=300){f=true;if(o){var r=a(s.target).closest("a");if(r.is("a")){a.each(b,function(){if(a.contains(this.$root[0],r[0])){this.itemEnter({currentTarget:r[0]});return false}})}o=false}}}l=t}],[d?"touchstart":"pointerover pointermove pointerout MSPointerOver MSPointerMove MSPointerOut",function(p){if(j(p.originalEvent)){f=false}}]],n));h=true}else{if(h&&m){a(document).unbind(n);h=false}}}function j(l){return !/^(4|mouse)$/.test(l.pointerType)}function i(l,n){if(!n){n=""}var m={};a.each(l,function(o,p){m[p[0].split(" ").join(n+" ")+n]=p[1]});return m}a.SmartMenus=function(m,l){this.$root=a(m);this.opts=l;this.rootId="";this.accessIdPrefix="";this.$subArrow=null;this.activatedItems=[];this.visibleSubMenus=[];this.showTimeout=0;this.hideTimeout=0;this.scrollTimeout=0;this.clickActivated=false;this.focusActivated=false;this.zIndexInc=0;this.idInc=0;this.$firstLink=null;this.$firstSub=null;this.disabled=false;this.$disableOverlay=null;this.$touchScrollingSub=null;this.cssTransforms3d="perspective" in m.style||"webkitPerspective" in m.style;this.wasCollapsible=false;this.init()};a.extend(a.SmartMenus,{hideAll:function(){a.each(b,function(){this.menuHideAll()})},destroy:function(){while(b.length){b[0].destroy()}k(true)},prototype:{init:function(n){var l=this;if(!n){b.push(this);this.rootId=(new Date().getTime()+Math.random()+"").replace(/\D/g,"");this.accessIdPrefix="sm-"+this.rootId+"-";if(this.$root.hasClass("sm-rtl")){this.opts.rightToLeftSubMenus=true}var r=".smartmenus";this.$root.data("smartmenus",this).attr("data-smartmenus-id",this.rootId).dataSM("level",1).bind(i([["mouseover focusin",a.proxy(this.rootOver,this)],["mouseout focusout",a.proxy(this.rootOut,this)],["keydown",a.proxy(this.rootKeyDown,this)]],r)).delegate("a",i([["mouseenter",a.proxy(this.itemEnter,this)],["mouseleave",a.proxy(this.itemLeave,this)],["mousedown",a.proxy(this.itemDown,this)],["focus",a.proxy(this.itemFocus,this)],["blur",a.proxy(this.itemBlur,this)],["click",a.proxy(this.itemClick,this)]],r));r+=this.rootId;if(this.opts.hideOnClick){a(document).bind(i([["touchstart",a.proxy(this.docTouchStart,this)],["touchmove",a.proxy(this.docTouchMove,this)],["touchend",a.proxy(this.docTouchEnd,this)],["click",a.proxy(this.docClick,this)]],r))}a(window).bind(i([["resize orientationchange",a.proxy(this.winResize,this)]],r));if(this.opts.subIndicators){this.$subArrow=a("<span/>").addClass("sub-arrow");if(this.opts.subIndicatorsText){this.$subArrow.html(this.opts.subIndicatorsText)}}k()}this.$firstSub=this.$root.find("ul").each(function(){l.menuInit(a(this))}).eq(0);this.$firstLink=this.$root.find("a").eq(0);if(this.opts.markCurrentItem){var p=/(index|default)\.[^#\?\/]*/i,m=/#.*/,q=window.location.href.replace(p,""),o=q.replace(m,"");this.$root.find("a").each(function(){var s=this.href.replace(p,""),t=a(this);if(s==q||s==o){t.addClass("current");if(l.opts.markCurrentTree){t.parentsUntil("[data-smartmenus-id]","ul").each(function(){a(this).dataSM("parent-a").addClass("current")})}}})}this.wasCollapsible=this.isCollapsible()},destroy:function(m){if(!m){var n=".smartmenus";this.$root.removeData("smartmenus").removeAttr("data-smartmenus-id").removeDataSM("level").unbind(n).undelegate(n);n+=this.rootId;a(document).unbind(n);a(window).unbind(n);if(this.opts.subIndicators){this.$subArrow=null}}this.menuHideAll();var l=this;this.$root.find("ul").each(function(){var o=a(this);if(o.dataSM("scroll-arrows")){o.dataSM("scroll-arrows").remove()}if(o.dataSM("shown-before")){if(l.opts.subMenusMinWidth||l.opts.subMenusMaxWidth){o.css({width:"",minWidth:"",maxWidth:""}).removeClass("sm-nowrap")}if(o.dataSM("scroll-arrows")){o.dataSM("scroll-arrows").remove()}o.css({zIndex:"",top:"",left:"",marginLeft:"",marginTop:"",display:""})}if((o.attr("id")||"").indexOf(l.accessIdPrefix)==0){o.removeAttr("id")}}).removeDataSM("in-mega").removeDataSM("shown-before").removeDataSM("ie-shim").removeDataSM("scroll-arrows").removeDataSM("parent-a").removeDataSM("level").removeDataSM("beforefirstshowfired").removeAttr("role").removeAttr("aria-hidden").removeAttr("aria-labelledby").removeAttr("aria-expanded");this.$root.find("a.has-submenu").each(function(){var o=a(this);if(o.attr("id").indexOf(l.accessIdPrefix)==0){o.removeAttr("id")}}).removeClass("has-submenu").removeDataSM("sub").removeAttr("aria-haspopup").removeAttr("aria-controls").removeAttr("aria-expanded").closest("li").removeDataSM("sub");if(this.opts.subIndicators){this.$root.find("span.sub-arrow").remove()}if(this.opts.markCurrentItem){this.$root.find("a.current").removeClass("current")}if(!m){this.$root=null;this.$firstLink=null;this.$firstSub=null;if(this.$disableOverlay){this.$disableOverlay.remove();this.$disableOverlay=null}b.splice(a.inArray(this,b),1)}},disable:function(l){if(!this.disabled){this.menuHideAll();if(!l&&!this.opts.isPopup&&this.$root.is(":visible")){var m=this.$root.offset();this.$disableOverlay=a('<div class="sm-jquery-disable-overlay"/>').css({position:"absolute",top:m.top,left:m.left,width:this.$root.outerWidth(),height:this.$root.outerHeight(),zIndex:this.getStartZIndex(true),opacity:0}).appendTo(document.body)}this.disabled=true}},docClick:function(l){if(this.$touchScrollingSub){this.$touchScrollingSub=null;return}if(this.visibleSubMenus.length&&!a.contains(this.$root[0],l.target)||a(l.target).is("a")){this.menuHideAll()}},docTouchEnd:function(m){if(!this.lastTouch){return}if(this.visibleSubMenus.length&&(this.lastTouch.x2===undefined||this.lastTouch.x1==this.lastTouch.x2)&&(this.lastTouch.y2===undefined||this.lastTouch.y1==this.lastTouch.y2)&&(!this.lastTouch.target||!a.contains(this.$root[0],this.lastTouch.target))){if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}var l=this;this.hideTimeout=setTimeout(function(){l.menuHideAll()},350)}this.lastTouch=null},docTouchMove:function(m){if(!this.lastTouch){return}var l=m.originalEvent.touches[0];this.lastTouch.x2=l.pageX;this.lastTouch.y2=l.pageY},docTouchStart:function(m){var l=m.originalEvent.touches[0];this.lastTouch={x1:l.pageX,y1:l.pageY,target:l.target}},enable:function(){if(this.disabled){if(this.$disableOverlay){this.$disableOverlay.remove();this.$disableOverlay=null}this.disabled=false}},getClosestMenu:function(m){var l=a(m).closest("ul");while(l.dataSM("in-mega")){l=l.parent().closest("ul")}return l[0]||null},getHeight:function(l){return this.getOffset(l,true)},getOffset:function(n,l){var m;if(n.css("display")=="none"){m={position:n[0].style.position,visibility:n[0].style.visibility};n.css({position:"absolute",visibility:"hidden"}).show()}var o=n[0].getBoundingClientRect&&n[0].getBoundingClientRect(),p=o&&(l?o.height||o.bottom-o.top:o.width||o.right-o.left);if(!p&&p!==0){p=l?n[0].offsetHeight:n[0].offsetWidth}if(m){n.hide().css(m)}return p},getStartZIndex:function(l){var m=parseInt(this[l?"$root":"$firstSub"].css("z-index"));if(!l&&isNaN(m)){m=parseInt(this.$root.css("z-index"))}return !isNaN(m)?m:1},getTouchPoint:function(l){return l.touches&&l.touches[0]||l.changedTouches&&l.changedTouches[0]||l},getViewport:function(l){var m=l?"Height":"Width",o=document.documentElement["client"+m],n=window["inner"+m];if(n){o=Math.min(o,n)}return o},getViewportHeight:function(){return this.getViewport(true)},getViewportWidth:function(){return this.getViewport()},getWidth:function(l){return this.getOffset(l)},handleEvents:function(){return !this.disabled&&this.isCSSOn()},handleItemEvents:function(l){return this.handleEvents()&&!this.isLinkInMegaMenu(l)},isCollapsible:function(){return this.$firstSub.css("position")=="static"},isCSSOn:function(){return this.$firstLink.css("display")=="block"},isFixed:function(){var l=this.$root.css("position")=="fixed";if(!l){this.$root.parentsUntil("body").each(function(){if(a(this).css("position")=="fixed"){l=true;return false}})}return l},isLinkInMegaMenu:function(l){return a(this.getClosestMenu(l[0])).hasClass("mega-menu")},isTouchMode:function(){return !f||this.opts.noMouseOver||this.isCollapsible()},itemActivate:function(p,l){var n=p.closest("ul"),q=n.dataSM("level");if(q>1&&(!this.activatedItems[q-2]||this.activatedItems[q-2][0]!=n.dataSM("parent-a")[0])){var m=this;a(n.parentsUntil("[data-smartmenus-id]","ul").get().reverse()).add(n).each(function(){m.itemActivate(a(this).dataSM("parent-a"))})}if(!this.isCollapsible()||l){this.menuHideSubMenus(!this.activatedItems[q-1]||this.activatedItems[q-1][0]!=p[0]?q-1:q)}this.activatedItems[q-1]=p;if(this.$root.triggerHandler("activate.smapi",p[0])===false){return}var o=p.dataSM("sub");if(o&&(this.isTouchMode()||(!this.opts.showOnClick||this.clickActivated))){this.menuShow(o)}},itemBlur:function(m){var l=a(m.currentTarget);if(!this.handleItemEvents(l)){return}this.$root.triggerHandler("blur.smapi",l[0])},itemClick:function(o){var n=a(o.currentTarget);if(!this.handleItemEvents(n)){return}if(this.$touchScrollingSub&&this.$touchScrollingSub[0]==n.closest("ul")[0]){this.$touchScrollingSub=null;o.stopPropagation();return false}if(this.$root.triggerHandler("click.smapi",n[0])===false){return false}var p=a(o.target).is("span.sub-arrow"),m=n.dataSM("sub"),l=m?m.dataSM("level")==2:false;if(m&&!m.is(":visible")){if(this.opts.showOnClick&&l){this.clickActivated=true}this.itemActivate(n);if(m.is(":visible")){this.focusActivated=true;return false}}else{if(this.isCollapsible()&&p){this.itemActivate(n);this.menuHide(m);return false}}if(this.opts.showOnClick&&l||n.hasClass("disabled")||this.$root.triggerHandler("select.smapi",n[0])===false){return false}},itemDown:function(m){var l=a(m.currentTarget);if(!this.handleItemEvents(l)){return}l.dataSM("mousedown",true)},itemEnter:function(n){var m=a(n.currentTarget);if(!this.handleItemEvents(m)){return}if(!this.isTouchMode()){if(this.showTimeout){clearTimeout(this.showTimeout);this.showTimeout=0}var l=this;this.showTimeout=setTimeout(function(){l.itemActivate(m)},this.opts.showOnClick&&m.closest("ul").dataSM("level")==1?1:this.opts.showTimeout)}this.$root.triggerHandler("mouseenter.smapi",m[0])},itemFocus:function(m){var l=a(m.currentTarget);if(!this.handleItemEvents(l)){return}if(this.focusActivated&&(!this.isTouchMode()||!l.dataSM("mousedown"))&&(!this.activatedItems.length||this.activatedItems[this.activatedItems.length-1][0]!=l[0])){this.itemActivate(l,true)}this.$root.triggerHandler("focus.smapi",l[0])},itemLeave:function(m){var l=a(m.currentTarget);if(!this.handleItemEvents(l)){return}if(!this.isTouchMode()){l[0].blur();if(this.showTimeout){clearTimeout(this.showTimeout);this.showTimeout=0}}l.removeDataSM("mousedown");this.$root.triggerHandler("mouseleave.smapi",l[0])},menuHide:function(m){if(this.$root.triggerHandler("beforehide.smapi",m[0])===false){return}m.stop(true,true);if(m.css("display")!="none"){var l=function(){m.css("z-index","")};if(this.isCollapsible()){if(this.opts.collapsibleHideFunction){this.opts.collapsibleHideFunction.call(this,m,l)}else{m.hide(this.opts.collapsibleHideDuration,l)}}else{if(this.opts.hideFunction){this.opts.hideFunction.call(this,m,l)}else{m.hide(this.opts.hideDuration,l)}}if(m.dataSM("ie-shim")){m.dataSM("ie-shim").remove().css({"-webkit-transform":"",transform:""})}if(m.dataSM("scroll")){this.menuScrollStop(m);m.css({"touch-action":"","-ms-touch-action":"","-webkit-transform":"",transform:""}).unbind(".smartmenus_scroll").removeDataSM("scroll").dataSM("scroll-arrows").hide()}m.dataSM("parent-a").removeClass("highlighted").attr("aria-expanded","false");m.attr({"aria-expanded":"false","aria-hidden":"true"});var n=m.dataSM("level");this.activatedItems.splice(n-1,1);this.visibleSubMenus.splice(a.inArray(m,this.visibleSubMenus),1);this.$root.triggerHandler("hide.smapi",m[0])}},menuHideAll:function(){if(this.showTimeout){clearTimeout(this.showTimeout);this.showTimeout=0}var m=this.opts.isPopup?1:0;for(var l=this.visibleSubMenus.length-1;l>=m;l--){this.menuHide(this.visibleSubMenus[l])}if(this.opts.isPopup){this.$root.stop(true,true);if(this.$root.is(":visible")){if(this.opts.hideFunction){this.opts.hideFunction.call(this,this.$root)}else{this.$root.hide(this.opts.hideDuration)}if(this.$root.dataSM("ie-shim")){this.$root.dataSM("ie-shim").remove()}}}this.activatedItems=[];this.visibleSubMenus=[];this.clickActivated=false;this.focusActivated=false;this.zIndexInc=0;this.$root.triggerHandler("hideAll.smapi")},menuHideSubMenus:function(n){for(var l=this.activatedItems.length-1;l>=n;l--){var m=this.activatedItems[l].dataSM("sub");if(m){this.menuHide(m)}}},menuIframeShim:function(l){if(e&&this.opts.overlapControlsInIE&&!l.dataSM("ie-shim")){l.dataSM("ie-shim",a("<iframe/>").attr({src:"javascript:0",tabindex:-9}).css({position:"absolute",top:"auto",left:"0",opacity:0,border:"0"}))}},menuInit:function(l){if(!l.dataSM("in-mega")){if(l.hasClass("mega-menu")){l.find("ul").dataSM("in-mega",true)}var q=2,m=l[0];while((m=m.parentNode.parentNode)!=this.$root[0]){q++}var n=l.prevAll("a").eq(-1);if(!n.length){n=l.prevAll().find("a").eq(-1)}n.addClass("has-submenu").dataSM("sub",l);l.dataSM("parent-a",n).dataSM("level",q).parent().dataSM("sub",l);var o=n.attr("id")||this.accessIdPrefix+(++this.idInc),p=l.attr("id")||this.accessIdPrefix+(++this.idInc);n.attr({id:o,"aria-haspopup":"true","aria-controls":p,"aria-expanded":"false"});l.attr({id:p,role:"group","aria-hidden":"true","aria-labelledby":o,"aria-expanded":"false"});if(this.opts.subIndicators){n[this.opts.subIndicatorsPos](this.$subArrow.clone())}}},menuPosition:function(K){var r=K.dataSM("parent-a"),D=r.closest("li"),E=D.parent(),l=K.dataSM("level"),t=this.getWidth(K),J=this.getHeight(K),u=r.offset(),o=u.left,m=u.top,q=this.getWidth(r),F=this.getHeight(r),H=a(window),v=H.scrollLeft(),s=H.scrollTop(),z=this.getViewportWidth(),L=this.getViewportHeight(),w=E.parent().is("[data-sm-horizontal-sub]")||l==2&&!E.hasClass("sm-vertical"),B=this.opts.rightToLeftSubMenus&&!D.is("[data-sm-reverse]")||!this.opts.rightToLeftSubMenus&&D.is("[data-sm-reverse]"),p=l==2?this.opts.mainMenuSubOffsetX:this.opts.subMenusSubOffsetX,n=l==2?this.opts.mainMenuSubOffsetY:this.opts.subMenusSubOffsetY,C,A;if(w){C=B?q-t-p:p;A=this.opts.bottomToTopSubMenus?-J-n:F+n}else{C=B?p-t:q-p;A=this.opts.bottomToTopSubMenus?F-n-J:n}if(this.opts.keepInViewport){var N=o+C,M=m+A;if(B&&N<v){C=w?v-N+C:q-p}else{if(!B&&N+t>v+z){C=w?v+z-t-N+C:p-t}}if(!w){if(J<L&&M+J>s+L){A+=s+L-J-M}else{if(J>=L||M<s){A+=s-M}}}if(w&&(M+J>s+L+0.49||M<s)||!w&&J>L+0.49){var G=this;if(!K.dataSM("scroll-arrows")){K.dataSM("scroll-arrows",a([a('<span class="scroll-up"><span class="scroll-up-arrow"></span></span>')[0],a('<span class="scroll-down"><span class="scroll-down-arrow"></span></span>')[0]]).bind({mouseenter:function(){K.dataSM("scroll").up=a(this).hasClass("scroll-up");G.menuScroll(K)},mouseleave:function(x){G.menuScrollStop(K);G.menuScrollOut(K,x)},"mousewheel DOMMouseScroll":function(x){x.preventDefault()}}).insertAfter(K))}var I=".smartmenus_scroll";K.dataSM("scroll",{y:this.cssTransforms3d?0:A-F,step:1,itemH:F,subH:J,arrowDownH:this.getHeight(K.dataSM("scroll-arrows").eq(1))}).bind(i([["mouseover",function(x){G.menuScrollOver(K,x)}],["mouseout",function(x){G.menuScrollOut(K,x)}],["mousewheel DOMMouseScroll",function(x){G.menuScrollMousewheel(K,x)}]],I)).dataSM("scroll-arrows").css({top:"auto",left:"0",marginLeft:C+(parseInt(K.css("border-left-width"))||0),width:t-(parseInt(K.css("border-left-width"))||0)-(parseInt(K.css("border-right-width"))||0),zIndex:K.css("z-index")}).eq(w&&this.opts.bottomToTopSubMenus?0:1).show();if(this.isFixed()){K.css({"touch-action":"none","-ms-touch-action":"none"}).bind(i([[d?"touchstart touchmove touchend":"pointerdown pointermove pointerup MSPointerDown MSPointerMove MSPointerUp",function(x){G.menuScrollTouch(K,x)}]],I))}}}K.css({top:"auto",left:"0",marginLeft:C,marginTop:A-F});this.menuIframeShim(K);if(K.dataSM("ie-shim")){K.dataSM("ie-shim").css({zIndex:K.css("z-index"),width:t,height:J,marginLeft:C,marginTop:A-F})}},menuScroll:function(r,m,n){var p=r.dataSM("scroll"),q=r.dataSM("scroll-arrows"),o=p.up?p.upEnd:p.downEnd,s;if(!m&&p.momentum){p.momentum*=0.92;s=p.momentum;if(s<0.5){this.menuScrollStop(r);return}}else{s=n||(m||!this.opts.scrollAccelerate?this.opts.scrollStep:Math.floor(p.step))}var l=r.dataSM("level");if(this.activatedItems[l-1]&&this.activatedItems[l-1].dataSM("sub")&&this.activatedItems[l-1].dataSM("sub").is(":visible")){this.menuHideSubMenus(l-1)}p.y=p.up&&o<=p.y||!p.up&&o>=p.y?p.y:(Math.abs(o-p.y)>s?p.y+(p.up?s:-s):o);r.add(r.dataSM("ie-shim")).css(this.cssTransforms3d?{"-webkit-transform":"translate3d(0, "+p.y+"px, 0)",transform:"translate3d(0, "+p.y+"px, 0)"}:{marginTop:p.y});if(f&&(p.up&&p.y>p.downEnd||!p.up&&p.y<p.upEnd)){q.eq(p.up?1:0).show()}if(p.y==o){if(f){q.eq(p.up?0:1).hide()}this.menuScrollStop(r)}else{if(!m){if(this.opts.scrollAccelerate&&p.step<this.opts.scrollStep){p.step+=0.2}var t=this;this.scrollTimeout=g(function(){t.menuScroll(r)})}}},menuScrollMousewheel:function(m,n){if(this.getClosestMenu(n.target)==m[0]){n=n.originalEvent;var l=(n.wheelDelta||-n.detail)>0;if(m.dataSM("scroll-arrows").eq(l?0:1).is(":visible")){m.dataSM("scroll").up=l;this.menuScroll(m,true)}}n.preventDefault()},menuScrollOut:function(l,m){if(f){if(!/^scroll-(up|down)/.test((m.relatedTarget||"").className)&&(l[0]!=m.relatedTarget&&!a.contains(l[0],m.relatedTarget)||this.getClosestMenu(m.relatedTarget)!=l[0])){l.dataSM("scroll-arrows").css("visibility","hidden")}}},menuScrollOver:function(n,o){if(f){if(!/^scroll-(up|down)/.test(o.target.className)&&this.getClosestMenu(o.target)==n[0]){this.menuScrollRefreshData(n);var m=n.dataSM("scroll"),l=a(window).scrollTop()-n.dataSM("parent-a").offset().top-m.itemH;n.dataSM("scroll-arrows").eq(0).css("margin-top",l).end().eq(1).css("margin-top",l+this.getViewportHeight()-m.arrowDownH).end().css("visibility","visible")}}},menuScrollRefreshData:function(n){var m=n.dataSM("scroll"),l=a(window).scrollTop()-n.dataSM("parent-a").offset().top-m.itemH;if(this.cssTransforms3d){l=-(parseFloat(n.css("margin-top"))-l)}a.extend(m,{upEnd:l,downEnd:l+this.getViewportHeight()-m.subH})},menuScrollStop:function(l){if(this.scrollTimeout){c(this.scrollTimeout);this.scrollTimeout=0;l.dataSM("scroll").step=1;return true}},menuScrollTouch:function(p,q){q=q.originalEvent;if(j(q)){var m=this.getTouchPoint(q);if(this.getClosestMenu(m.target)==p[0]){var o=p.dataSM("scroll");if(/(start|down)$/i.test(q.type)){if(this.menuScrollStop(p)){q.preventDefault();this.$touchScrollingSub=p}else{this.$touchScrollingSub=null}this.menuScrollRefreshData(p);a.extend(o,{touchStartY:m.pageY,touchStartTime:q.timeStamp})}else{if(/move$/i.test(q.type)){var n=o.touchY!==undefined?o.touchY:o.touchStartY;if(n!==undefined&&n!=m.pageY){this.$touchScrollingSub=p;var l=n<m.pageY;if(o.up!==undefined&&o.up!=l){a.extend(o,{touchStartY:m.pageY,touchStartTime:q.timeStamp})}a.extend(o,{up:l,touchY:m.pageY});this.menuScroll(p,true,Math.abs(m.pageY-n))}q.preventDefault()}else{if(o.touchY!==undefined){if(o.momentum=Math.pow(Math.abs(m.pageY-o.touchStartY)/(q.timeStamp-o.touchStartTime),2)*15){this.menuScrollStop(p);this.menuScroll(p);q.preventDefault()}delete o.touchY}}}}}},menuShow:function(n){if(!n.dataSM("beforefirstshowfired")){n.dataSM("beforefirstshowfired",true);if(this.$root.triggerHandler("beforefirstshow.smapi",n[0])===false){return}}if(this.$root.triggerHandler("beforeshow.smapi",n[0])===false){return}n.dataSM("shown-before",true).stop(true,true);if(!n.is(":visible")){var m=n.dataSM("parent-a");if(this.opts.keepHighlighted||this.isCollapsible()){m.addClass("highlighted")}if(this.isCollapsible()){n.removeClass("sm-nowrap").css({zIndex:"",width:"auto",minWidth:"",maxWidth:"",top:"",left:"",marginLeft:"",marginTop:""})}else{n.css("z-index",this.zIndexInc=(this.zIndexInc||this.getStartZIndex())+1);if(this.opts.subMenusMinWidth||this.opts.subMenusMaxWidth){n.css({width:"auto",minWidth:"",maxWidth:""}).addClass("sm-nowrap");if(this.opts.subMenusMinWidth){n.css("min-width",this.opts.subMenusMinWidth)}if(this.opts.subMenusMaxWidth){var o=this.getWidth(n);n.css("max-width",this.opts.subMenusMaxWidth);if(o>this.getWidth(n)){n.removeClass("sm-nowrap").css("width",this.opts.subMenusMaxWidth)}}}this.menuPosition(n);if(n.dataSM("ie-shim")){n.dataSM("ie-shim").insertBefore(n)}}var l=function(){n.css("overflow","")};if(this.isCollapsible()){if(this.opts.collapsibleShowFunction){this.opts.collapsibleShowFunction.call(this,n,l)}else{n.show(this.opts.collapsibleShowDuration,l)}}else{if(this.opts.showFunction){this.opts.showFunction.call(this,n,l)}else{n.show(this.opts.showDuration,l)}}m.attr("aria-expanded","true");n.attr({"aria-expanded":"true","aria-hidden":"false"});this.visibleSubMenus.push(n);this.$root.triggerHandler("show.smapi",n[0])}},popupHide:function(l){if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}var m=this;this.hideTimeout=setTimeout(function(){m.menuHideAll()},l?1:this.opts.hideTimeout)},popupShow:function(o,n){if(!this.opts.isPopup){alert('SmartMenus jQuery Error:\n\nIf you want to show this menu via the "popupShow" method, set the isPopup:true option.');return}if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}this.$root.dataSM("shown-before",true).stop(true,true);if(!this.$root.is(":visible")){this.$root.css({left:o,top:n});this.menuIframeShim(this.$root);if(this.$root.dataSM("ie-shim")){this.$root.dataSM("ie-shim").css({zIndex:this.$root.css("z-index"),width:this.getWidth(this.$root),height:this.getHeight(this.$root),left:o,top:n}).insertBefore(this.$root)}var m=this,l=function(){m.$root.css("overflow","")};if(this.opts.showFunction){this.opts.showFunction.call(this,this.$root,l)}else{this.$root.show(this.opts.showDuration,l)}this.visibleSubMenus[0]=this.$root}},refresh:function(){this.destroy(true);this.init(true)},rootKeyDown:function(o){if(!this.handleEvents()){return}switch(o.keyCode){case 27:var m=this.activatedItems[0];if(m){this.menuHideAll();m[0].focus();var n=m.dataSM("sub");if(n){this.menuHide(n)}}break;case 32:var l=a(o.target);if(l.is("a")&&this.handleItemEvents(l)){var n=l.dataSM("sub");if(n&&!n.is(":visible")){this.itemClick({currentTarget:o.target});o.preventDefault()}}break}},rootOut:function(m){if(!this.handleEvents()||this.isTouchMode()||m.target==this.$root[0]){return}if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}if(!this.opts.showOnClick||!this.opts.hideOnClick){var l=this;this.hideTimeout=setTimeout(function(){l.menuHideAll()},this.opts.hideTimeout)}},rootOver:function(l){if(!this.handleEvents()||this.isTouchMode()||l.target==this.$root[0]){return}if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}},winResize:function(m){if(!this.handleEvents()){if(this.$disableOverlay){var n=this.$root.offset();this.$disableOverlay.css({top:n.top,left:n.left,width:this.$root.outerWidth(),height:this.$root.outerHeight()})}return}if(!("onorientationchange" in window)||m.type=="orientationchange"){var l=this.isCollapsible();if(!(this.wasCollapsible&&l)){if(this.activatedItems.length){this.activatedItems[this.activatedItems.length-1][0].blur()}this.menuHideAll()}this.wasCollapsible=l}}}});a.fn.dataSM=function(l,m){if(m){return this.data(l+"_smartmenus",m)}return this.data(l+"_smartmenus")};a.fn.removeDataSM=function(l){return this.removeData(l+"_smartmenus")};a.fn.smartmenus=function(m){if(typeof m=="string"){var l=arguments,o=m;Array.prototype.shift.call(l);return this.each(function(){var p=a(this).data("smartmenus");if(p&&p[o]){p[o].apply(p,l)}})}var n=a.extend({},a.fn.smartmenus.defaults,m);return this.each(function(){new a.SmartMenus(this,n)})};a.fn.smartmenus.defaults={isPopup:false,mainMenuSubOffsetX:0,mainMenuSubOffsetY:0,subMenusSubOffsetX:0,subMenusSubOffsetY:0,subMenusMinWidth:"10em",subMenusMaxWidth:"20em",subIndicators:true,subIndicatorsPos:"prepend",subIndicatorsText:"+",scrollStep:30,scrollAccelerate:true,showTimeout:250,hideTimeout:500,showDuration:0,showFunction:null,hideDuration:0,hideFunction:function(m,l){m.fadeOut(200,l)},collapsibleShowDuration:0,collapsibleShowFunction:function(m,l){m.slideDown(200,l)},collapsibleHideDuration:0,collapsibleHideFunction:function(m,l){m.slideUp(200,l)},showOnClick:false,hideOnClick:true,noMouseOver:false,keepInViewport:true,keepHighlighted:true,markCurrentItem:false,markCurrentTree:true,rightToLeftSubMenus:false,bottomToTopSubMenus:false,overlapControlsInIE:true};return a})); \ No newline at end of file diff --git a/C++/docs/html/md__c_1__users__yida__lin__documents__git_hub_libxdf_libxdf__r_e_a_d_m_e.html b/C++/docs/html/md__c_1__users__yida__lin__documents__git_hub_libxdf_libxdf__r_e_a_d_m_e.html new file mode 100644 index 0000000..e147fe9 --- /dev/null +++ b/C++/docs/html/md__c_1__users__yida__lin__documents__git_hub_libxdf_libxdf__r_e_a_d_m_e.html @@ -0,0 +1,142 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>libxdf: libxdf</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="navtree.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="resize.js"></script> +<script type="text/javascript" src="navtreedata.js"></script> +<script type="text/javascript" src="navtree.js"></script> +<script type="text/javascript"> + $(document).ready(initResizable); +</script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">libxdf +  <span id="projectnumber">0.92</span> + </div> + <div id="projectbrief">A static C++ library for loading XDF files</div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.12 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<div id="side-nav" class="ui-resizable side-nav-resizable"> + <div id="nav-tree"> + <div id="nav-tree-contents"> + <div id="nav-sync" class="sync"></div> + </div> + </div> + <div id="splitbar" style="-moz-user-select:none;" + class="ui-resizable-handle"> + </div> +</div> +<script type="text/javascript"> +$(document).ready(function(){initNavTree('md__c_1__users__yida__lin__documents__git_hub_libxdf_libxdf__r_e_a_d_m_e.html','');}); +</script> +<div id="doc-content"> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="header"> + <div class="headertitle"> +<div class="title">libxdf </div> </div> +</div><!--header--> +<div class="contents"> +<div class="textblock"><h2>*A static C++ library for loading <a href="https://github.com/sccn/xdf/wiki/Specifications" title="Extensible Data Format">XDF</a> files*</h2> +<ul> +<li><a href="#intro">Introduction</a></li> +<li><a href="#download">Download</a></li> +<li><a href="#quick">Quick-Start Guide</a></li> +<li><a href="#doc">Documentation</a></li> +<li><a href="#support">Support</a></li> +</ul> +<h2><a class="anchor" id="intro"></a>Introduction</h2> +<p>Libxdf is a cross-platform C++ library for loading multimodal, multi-rate signals stored in <a href="https://github.com/sccn/xdf/wiki/Specifications" title="Extensible Data Format">XDF</a> files. Libxdf is a core component of bio-signal viewing application <a href="https://github.com/cbrnr/sigviewer">SigViewer</a>. It can also be integrated into other C++ applications.</p> +<p>Libxdf is open-source, free, and actively maintained.</p> +<h2><a class="anchor" id="download"></a>Download</h2> +<p><a href="https://github.com/Yida-Lin/libxdf/archive/v0.9.zip">Source code (zip)</a></p> +<p><a href="https://github.com/Yida-Lin/libxdf/archive/v0.9.tar.gz">Source code (tar.gz)</a></p> +<p><a href="https://github.com/Yida-Lin/libxdf/releases">Pre-built package</a></p> +<h2><a class="anchor" id="quick"></a>Quick-Start Guide</h2> +<h3>Use in conjunction with <a href="https://github.com/cbrnr/sigviewer">SigViewer</a>:</h3> +<p>Libxdf is a built-in component of <a href="https://github.com/cbrnr/sigviewer">SigViewer</a>. If you wish to build SigViewer from source, follow these steps:</p> +<ol type="1"> +<li>Download <code><a class="el" href="xdf_8h.html" title="The header file of Xdf class. ">xdf.h</a></code> and <code>libxdf.a</code> from the <a href="https://github.com/Yida-Lin/libxdf/releases">release</a> page.</li> +<li>Copy <code><a class="el" href="xdf_8h.html" title="The header file of Xdf class. ">xdf.h</a></code> into <code>sigviewer/external/include</code></li> +<li>Copy <code>libxdf.a</code> into <code>sigviewer/external/lib</code></li> +<li>Choose <a href="https://www.qt.io/download-open-source/#section-2">Qt 5.8 MinGW 5.3</a> as the toolkit to configure SigViewer.</li> +<li>Build and run Sigviewer!</li> +</ol> +<div class="image"> +<img src="docs/Example.png" alt="SigViewer using _libxdf_ to display signals in XDF files"/> +</div> +<p>Example: SigViewer using <em>libxdf</em> to display signals in an XDF file.</p> +<h3>Use in other C++ applications:</h3> +<ol type="1"> +<li>Clone the repo and build with <a href="https://www.qt.io/download-open-source/#section-2">Qt 5.8 MinGW 5.3</a>, or use the pre-built binary release.</li> +<li>Instantiate an object of <code><a class="el" href="class_xdf.html">Xdf</a></code> class and call the load_xdf() method.</li> +</ol> +<p>Example:</p> +<div class="fragment"><div class="line">{C++}</div><div class="line">#include "xdf.h"</div><div class="line"></div><div class="line">Xdf XDFdata; //the object to store XDF data</div><div class="line">XDFdata.load_xdf("C:/example.xdf"); //parameter is the path to the target XDF file</div></div><!-- fragment --><p>If you would like to resample the signals, call:</p> +<div class="fragment"><div class="line">{C++}</div><div class="line"></div><div class="line">XDFdata.resample(100); //resample to 100Hz</div></div><!-- fragment --><p>The functions in libxdf must be called following certain order. For instance, if you call the <code>subtractMean()</code> function before you load any data into the object, it will cause undefined behavior.</p> +<p>The recommended order is shown as following. Only <code>load_xdf()</code> is mandatory.</p> +<div class="fragment"><div class="line">{C++}</div><div class="line">XDFdata.load_xdf(std::string filepath);</div><div class="line">XDFdata.subtractMean();</div><div class="line">XDFdata.createLabels();</div><div class="line">XDFdata.resample(int sampleRate);</div><div class="line">XDFdata.freeUpTimeStamps();</div></div><!-- fragment --><p>Libxdf depends on third party libraries <a href="http://pugixml.org/">Pugixml v1.8</a> for XML parsing and <a href="http://audio-smarc.sourceforge.net/">Smarc</a> for resampling.</p> +<h2><a class="anchor" id="doc"></a> Documentation</h2> +<p>Detailed documentation was generated via <a href="http://www.stack.nl/~dimitri/doxygen/index.html">Doxygen</a> and is available <a href="docs/html/class_xdf.html"><b>here</b></a>.</p> +<h2><a class="anchor" id="support"></a>Support</h2> +<p><a href="#" onclick="location.href='mai'+'lto:'+'ita'+'l_'+'faz'+'io'+'li@'+'ho'+'tma'+'il'+'.co'+'m'; return false;">Email author</a> </p> +</div></div><!-- contents --> +</div><!-- doc-content --> +<!-- start footer part --> +<div id="nav-path" class="navpath"><!-- id is needed for treeview function! --> + <ul> + <li class="footer">Generated by + <a href="http://www.doxygen.org/index.html"> + <img class="footer" src="doxygen.png" alt="doxygen"/></a> 1.8.12 </li> + </ul> +</div> +</body> +</html> diff --git a/C++/docs/html/menu.js b/C++/docs/html/menu.js new file mode 100644 index 0000000..97db4c2 --- /dev/null +++ b/C++/docs/html/menu.js @@ -0,0 +1,26 @@ +function initMenu(relPath,searchEnabled,serverSide,searchPage,search) { + function makeTree(data,relPath) { + var result=''; + if ('children' in data) { + result+='<ul>'; + for (var i in data.children) { + result+='<li><a href="'+relPath+data.children[i].url+'">'+ + data.children[i].text+'</a>'+ + makeTree(data.children[i],relPath)+'</li>'; + } + result+='</ul>'; + } + return result; + } + + $('#main-nav').append(makeTree(menudata,relPath)); + $('#main-nav').children(':first').addClass('sm sm-dox').attr('id','main-menu'); + if (searchEnabled) { + if (serverSide) { + $('#main-menu').append('<li style="float:right"><div id="MSearchBox" class="MSearchBoxInactive"><div class="left"><form id="FSearchBox" action="'+searchPage+'" method="get"><img id="MSearchSelect" src="'+relPath+'search/mag.png" alt=""/><input type="text" id="MSearchField" name="query" value="'+search+'" size="20" accesskey="S" onfocus="searchBox.OnSearchFieldFocus(true)" onblur="searchBox.OnSearchFieldFocus(false)"></form></div><div class="right"></div></div></li>'); + } else { + $('#main-menu').append('<li style="float:right"><div id="MSearchBox" class="MSearchBoxInactive"><span class="left"><img id="MSearchSelect" src="'+relPath+'search/mag_sel.png" onmouseover="return searchBox.OnSearchSelectShow()" onmouseout="return searchBox.OnSearchSelectHide()" alt=""/><input type="text" id="MSearchField" value="'+search+'" accesskey="S" onfocus="searchBox.OnSearchFieldFocus(true)" onblur="searchBox.OnSearchFieldFocus(false)" onkeyup="searchBox.OnSearchFieldChange(event)"/></span><span class="right"><a id="MSearchClose" href="javascript:searchBox.CloseResultsWindow()"><img id="MSearchCloseImg" border="0" src="'+relPath+'search/close.png" alt=""/></a></span></div></li>'); + } + } + $('#main-menu').smartmenus(); +} diff --git a/C++/docs/html/menudata.js b/C++/docs/html/menudata.js new file mode 100644 index 0000000..74ef9c9 --- /dev/null +++ b/C++/docs/html/menudata.js @@ -0,0 +1,46 @@ +var menudata={children:[ +{text:'Main Page',url:'index.html'}, +{text:'Related Pages',url:'pages.html'}, +{text:'Classes',url:'annotated.html',children:[ +{text:'Class List',url:'annotated.html'}, +{text:'Class Index',url:'classes.html'}, +{text:'Class Members',url:'functions.html',children:[ +{text:'All',url:'functions.html',children:[ +{text:'a',url:'functions.html#index_a'}, +{text:'c',url:'functions.html#index_c'}, +{text:'d',url:'functions.html#index_d'}, +{text:'e',url:'functions.html#index_e'}, +{text:'f',url:'functions.html#index_f'}, +{text:'i',url:'functions.html#index_i'}, +{text:'l',url:'functions.html#index_l'}, +{text:'m',url:'functions.html#index_m'}, +{text:'n',url:'functions.html#index_n'}, +{text:'o',url:'functions.html#index_o'}, +{text:'r',url:'functions.html#index_r'}, +{text:'s',url:'functions.html#index_s'}, +{text:'t',url:'functions.html#index_t'}, +{text:'u',url:'functions.html#index_u'}, +{text:'v',url:'functions.html#index_v'}, +{text:'w',url:'functions.html#index_w'}, +{text:'x',url:'functions.html#index_x'}]}, +{text:'Functions',url:'functions_func.html'}, +{text:'Variables',url:'functions_vars.html',children:[ +{text:'c',url:'functions_vars.html#index_c'}, +{text:'d',url:'functions_vars.html#index_d'}, +{text:'e',url:'functions_vars.html#index_e'}, +{text:'f',url:'functions_vars.html#index_f'}, +{text:'i',url:'functions_vars.html#index_i'}, +{text:'l',url:'functions_vars.html#index_l'}, +{text:'m',url:'functions_vars.html#index_m'}, +{text:'n',url:'functions_vars.html#index_n'}, +{text:'o',url:'functions_vars.html#index_o'}, +{text:'s',url:'functions_vars.html#index_s'}, +{text:'t',url:'functions_vars.html#index_t'}, +{text:'u',url:'functions_vars.html#index_u'}, +{text:'v',url:'functions_vars.html#index_v'}]}, +{text:'Typedefs',url:'functions_type.html'}]}]}, +{text:'Files',url:'files.html',children:[ +{text:'File List',url:'files.html'}, +{text:'File Members',url:'globals.html',children:[ +{text:'All',url:'globals.html'}, +{text:'Macros',url:'globals_defs.html'}]}]}]} diff --git a/C++/docs/html/nav_f.png b/C++/docs/html/nav_f.png new file mode 100644 index 0000000000000000000000000000000000000000..72a58a529ed3a9ed6aa0c51a79cf207e026deee2 GIT binary patch literal 153 zcmeAS@N?(olHy`uVBq!ia0vp^j6iI`!2~2XGqLUlQVE_ejv*C{Z|{2ZH7M}7UYxc) zn!W8uqtnIQ>_<lqdB{jiFDSaaN3W^xbJMH7CDK7=Q3_$6tQ&<~Cp4L6ZEndC`8;cO zrss?`_g+2sGU&M|cu~La_w1Rnf~7w`e!jQgteDwDLg6kW!`DinT@0SCelF{r5}E+Y CM>z8U literal 0 HcmV?d00001 diff --git a/C++/docs/html/nav_g.png b/C++/docs/html/nav_g.png new file mode 100644 index 0000000000000000000000000000000000000000..2093a237a94f6c83e19ec6e5fd42f7ddabdafa81 GIT binary patch literal 95 zcmeAS@N?(olHy`uVBq!ia0vp^j6lrB!3HFm1ilyoDK$?Q$B+ufw|5PB85lU25BhtE tr?otc=hd~V+ws&_A@j8Fiv!K<?EJwDd;c`qumW{3c)I$ztaD0e0syCC7$E=v literal 0 HcmV?d00001 diff --git a/C++/docs/html/nav_h.png b/C++/docs/html/nav_h.png new file mode 100644 index 0000000000000000000000000000000000000000..33389b101d9cd9b4c98ad286b5d9c46a6671f650 GIT binary patch literal 98 zcmeAS@N?(olHy`uVBq!ia0vp^j6lr8!2~3AUOE6t22D>F$B+ufw|5=67#uj90@pIL wZ=Q8~_Ju`#59=RjDrmm`tMD@M=!-l18IR?&v<Kx}xDV3h>FVdQ&MBb@0HFXL<NyEw literal 0 HcmV?d00001 diff --git a/C++/docs/html/navtree.css b/C++/docs/html/navtree.css new file mode 100644 index 0000000..0cc7e77 --- /dev/null +++ b/C++/docs/html/navtree.css @@ -0,0 +1,146 @@ +#nav-tree .children_ul { + margin:0; + padding:4px; +} + +#nav-tree ul { + list-style:none outside none; + margin:0px; + padding:0px; +} + +#nav-tree li { + white-space:nowrap; + margin:0px; + padding:0px; +} + +#nav-tree .plus { + margin:0px; +} + +#nav-tree .selected { + background-image: url('tab_a.png'); + background-repeat:repeat-x; + color: #fff; + text-shadow: 0px 1px 1px rgba(0, 0, 0, 1.0); +} + +#nav-tree img { + margin:0px; + padding:0px; + border:0px; + vertical-align: middle; +} + +#nav-tree a { + text-decoration:none; + padding:0px; + margin:0px; + outline:none; +} + +#nav-tree .label { + margin:0px; + padding:0px; + font: 12px 'Lucida Grande',Geneva,Helvetica,Arial,sans-serif; +} + +#nav-tree .label a { + padding:2px; +} + +#nav-tree .selected a { + text-decoration:none; + color:#fff; +} + +#nav-tree .children_ul { + margin:0px; + padding:0px; +} + +#nav-tree .item { + margin:0px; + padding:0px; +} + +#nav-tree { + padding: 0px 0px; + background-color: #FAFAFF; + font-size:14px; + overflow:auto; +} + +#doc-content { + overflow:auto; + display:block; + padding:0px; + margin:0px; + -webkit-overflow-scrolling : touch; /* iOS 5+ */ +} + +#side-nav { + padding:0 6px 0 0; + margin: 0px; + display:block; + position: absolute; + left: 0px; + width: 250px; +} + +.ui-resizable .ui-resizable-handle { + display:block; +} + +.ui-resizable-e { + background-image:url("splitbar.png"); + background-size:100%; + background-repeat:no-repeat; + background-attachment: scroll; + cursor:ew-resize; + height:100%; + right:0; + top:0; + width:6px; +} + +.ui-resizable-handle { + display:none; + font-size:0.1px; + position:absolute; + z-index:1; +} + +#nav-tree-contents { + margin: 6px 0px 0px 0px; +} + +#nav-tree { + background-image:url('nav_h.png'); + background-repeat:repeat-x; + background-color: #F9FAFC; + -webkit-overflow-scrolling : touch; /* iOS 5+ */ +} + +#nav-sync { + position:absolute; + top:5px; + right:24px; + z-index:0; +} + +#nav-sync img { + opacity:0.3; +} + +#nav-sync img:hover { + opacity:0.9; +} + +@media print +{ + #nav-tree { display: none; } + div.ui-resizable-handle { display: none; position: relative; } +} + diff --git a/C++/docs/html/navtree.js b/C++/docs/html/navtree.js new file mode 100644 index 0000000..e6d31b0 --- /dev/null +++ b/C++/docs/html/navtree.js @@ -0,0 +1,517 @@ +var navTreeSubIndices = new Array(); +var arrowDown = '▼'; +var arrowRight = '►'; + +function getData(varName) +{ + var i = varName.lastIndexOf('/'); + var n = i>=0 ? varName.substring(i+1) : varName; + return eval(n.replace(/\-/g,'_')); +} + +function stripPath(uri) +{ + return uri.substring(uri.lastIndexOf('/')+1); +} + +function stripPath2(uri) +{ + var i = uri.lastIndexOf('/'); + var s = uri.substring(i+1); + var m = uri.substring(0,i+1).match(/\/d\w\/d\w\w\/$/); + return m ? uri.substring(i-6) : s; +} + +function hashValue() +{ + return $(location).attr('hash').substring(1).replace(/[^\w\-]/g,''); +} + +function hashUrl() +{ + return '#'+hashValue(); +} + +function pathName() +{ + return $(location).attr('pathname').replace(/[^-A-Za-z0-9+&@#/%?=~_|!:,.;\(\)]/g, ''); +} + +function localStorageSupported() +{ + try { + return 'localStorage' in window && window['localStorage'] !== null && window.localStorage.getItem; + } + catch(e) { + return false; + } +} + + +function storeLink(link) +{ + if (!$("#nav-sync").hasClass('sync') && localStorageSupported()) { + window.localStorage.setItem('navpath',link); + } +} + +function deleteLink() +{ + if (localStorageSupported()) { + window.localStorage.setItem('navpath',''); + } +} + +function cachedLink() +{ + if (localStorageSupported()) { + return window.localStorage.getItem('navpath'); + } else { + return ''; + } +} + +function getScript(scriptName,func,show) +{ + var head = document.getElementsByTagName("head")[0]; + var script = document.createElement('script'); + script.id = scriptName; + script.type = 'text/javascript'; + script.onload = func; + script.src = scriptName+'.js'; + if ($.browser.msie && $.browser.version<=8) { + // script.onload does not work with older versions of IE + script.onreadystatechange = function() { + if (script.readyState=='complete' || script.readyState=='loaded') { + func(); if (show) showRoot(); + } + } + } + head.appendChild(script); +} + +function createIndent(o,domNode,node,level) +{ + var level=-1; + var n = node; + while (n.parentNode) { level++; n=n.parentNode; } + if (node.childrenData) { + var imgNode = document.createElement("span"); + imgNode.className = 'arrow'; + imgNode.style.paddingLeft=(16*level).toString()+'px'; + imgNode.innerHTML=arrowRight; + node.plus_img = imgNode; + node.expandToggle = document.createElement("a"); + node.expandToggle.href = "javascript:void(0)"; + node.expandToggle.onclick = function() { + if (node.expanded) { + $(node.getChildrenUL()).slideUp("fast"); + node.plus_img.innerHTML=arrowRight; + node.expanded = false; + } else { + expandNode(o, node, false, false); + } + } + node.expandToggle.appendChild(imgNode); + domNode.appendChild(node.expandToggle); + } else { + var span = document.createElement("span"); + span.className = 'arrow'; + span.style.width = 16*(level+1)+'px'; + span.innerHTML = ' '; + domNode.appendChild(span); + } +} + +var animationInProgress = false; + +function gotoAnchor(anchor,aname,updateLocation) +{ + var pos, docContent = $('#doc-content'); + var ancParent = $(anchor.parent()); + if (ancParent.hasClass('memItemLeft') || + ancParent.hasClass('fieldname') || + ancParent.hasClass('fieldtype') || + ancParent.is(':header')) + { + pos = ancParent.position().top; + } else if (anchor.position()) { + pos = anchor.position().top; + } + if (pos) { + var dist = Math.abs(Math.min( + pos-docContent.offset().top, + docContent[0].scrollHeight- + docContent.height()-docContent.scrollTop())); + animationInProgress=true; + docContent.animate({ + scrollTop: pos + docContent.scrollTop() - docContent.offset().top + },Math.max(50,Math.min(500,dist)),function(){ + if (updateLocation) window.location.href=aname; + animationInProgress=false; + }); + } +} + +function newNode(o, po, text, link, childrenData, lastNode) +{ + var node = new Object(); + node.children = Array(); + node.childrenData = childrenData; + node.depth = po.depth + 1; + node.relpath = po.relpath; + node.isLast = lastNode; + + node.li = document.createElement("li"); + po.getChildrenUL().appendChild(node.li); + node.parentNode = po; + + node.itemDiv = document.createElement("div"); + node.itemDiv.className = "item"; + + node.labelSpan = document.createElement("span"); + node.labelSpan.className = "label"; + + createIndent(o,node.itemDiv,node,0); + node.itemDiv.appendChild(node.labelSpan); + node.li.appendChild(node.itemDiv); + + var a = document.createElement("a"); + node.labelSpan.appendChild(a); + node.label = document.createTextNode(text); + node.expanded = false; + a.appendChild(node.label); + if (link) { + var url; + if (link.substring(0,1)=='^') { + url = link.substring(1); + link = url; + } else { + url = node.relpath+link; + } + a.className = stripPath(link.replace('#',':')); + if (link.indexOf('#')!=-1) { + var aname = '#'+link.split('#')[1]; + var srcPage = stripPath(pathName()); + var targetPage = stripPath(link.split('#')[0]); + a.href = srcPage!=targetPage ? url : "javascript:void(0)"; + a.onclick = function(){ + storeLink(link); + if (!$(a).parent().parent().hasClass('selected')) + { + $('.item').removeClass('selected'); + $('.item').removeAttr('id'); + $(a).parent().parent().addClass('selected'); + $(a).parent().parent().attr('id','selected'); + } + var anchor = $(aname); + gotoAnchor(anchor,aname,true); + }; + } else { + a.href = url; + a.onclick = function() { storeLink(link); } + } + } else { + if (childrenData != null) + { + a.className = "nolink"; + a.href = "javascript:void(0)"; + a.onclick = node.expandToggle.onclick; + } + } + + node.childrenUL = null; + node.getChildrenUL = function() { + if (!node.childrenUL) { + node.childrenUL = document.createElement("ul"); + node.childrenUL.className = "children_ul"; + node.childrenUL.style.display = "none"; + node.li.appendChild(node.childrenUL); + } + return node.childrenUL; + }; + + return node; +} + +function showRoot() +{ + var headerHeight = $("#top").height(); + var footerHeight = $("#nav-path").height(); + var windowHeight = $(window).height() - headerHeight - footerHeight; + (function (){ // retry until we can scroll to the selected item + try { + var navtree=$('#nav-tree'); + navtree.scrollTo('#selected',0,{offset:-windowHeight/2}); + } catch (err) { + setTimeout(arguments.callee, 0); + } + })(); +} + +function expandNode(o, node, imm, showRoot) +{ + if (node.childrenData && !node.expanded) { + if (typeof(node.childrenData)==='string') { + var varName = node.childrenData; + getScript(node.relpath+varName,function(){ + node.childrenData = getData(varName); + expandNode(o, node, imm, showRoot); + }, showRoot); + } else { + if (!node.childrenVisited) { + getNode(o, node); + } if (imm || ($.browser.msie && $.browser.version>8)) { + // somehow slideDown jumps to the start of tree for IE9 :-( + $(node.getChildrenUL()).show(); + } else { + $(node.getChildrenUL()).slideDown("fast"); + } + node.plus_img.innerHTML = arrowDown; + node.expanded = true; + } + } +} + +function glowEffect(n,duration) +{ + n.addClass('glow').delay(duration).queue(function(next){ + $(this).removeClass('glow');next(); + }); +} + +function highlightAnchor() +{ + var aname = hashUrl(); + var anchor = $(aname); + if (anchor.parent().attr('class')=='memItemLeft'){ + var rows = $('.memberdecls tr[class$="'+hashValue()+'"]'); + glowEffect(rows.children(),300); // member without details + } else if (anchor.parent().attr('class')=='fieldname'){ + glowEffect(anchor.parent().parent(),1000); // enum value + } else if (anchor.parent().attr('class')=='fieldtype'){ + glowEffect(anchor.parent().parent(),1000); // struct field + } else if (anchor.parent().is(":header")) { + glowEffect(anchor.parent(),1000); // section header + } else { + glowEffect(anchor.next(),1000); // normal member + } + gotoAnchor(anchor,aname,false); +} + +function selectAndHighlight(hash,n) +{ + var a; + if (hash) { + var link=stripPath(pathName())+':'+hash.substring(1); + a=$('.item a[class$="'+link+'"]'); + } + if (a && a.length) { + a.parent().parent().addClass('selected'); + a.parent().parent().attr('id','selected'); + highlightAnchor(); + } else if (n) { + $(n.itemDiv).addClass('selected'); + $(n.itemDiv).attr('id','selected'); + } + if ($('#nav-tree-contents .item:first').hasClass('selected')) { + $('#nav-sync').css('top','30px'); + } else { + $('#nav-sync').css('top','5px'); + } + showRoot(); +} + +function showNode(o, node, index, hash) +{ + if (node && node.childrenData) { + if (typeof(node.childrenData)==='string') { + var varName = node.childrenData; + getScript(node.relpath+varName,function(){ + node.childrenData = getData(varName); + showNode(o,node,index,hash); + },true); + } else { + if (!node.childrenVisited) { + getNode(o, node); + } + $(node.getChildrenUL()).css({'display':'block'}); + node.plus_img.innerHTML = arrowDown; + node.expanded = true; + var n = node.children[o.breadcrumbs[index]]; + if (index+1<o.breadcrumbs.length) { + showNode(o,n,index+1,hash); + } else { + if (typeof(n.childrenData)==='string') { + var varName = n.childrenData; + getScript(n.relpath+varName,function(){ + n.childrenData = getData(varName); + node.expanded=false; + showNode(o,node,index,hash); // retry with child node expanded + },true); + } else { + var rootBase = stripPath(o.toroot.replace(/\..+$/, '')); + if (rootBase=="index" || rootBase=="pages" || rootBase=="search") { + expandNode(o, n, true, true); + } + selectAndHighlight(hash,n); + } + } + } + } else { + selectAndHighlight(hash); + } +} + +function removeToInsertLater(element) { + var parentNode = element.parentNode; + var nextSibling = element.nextSibling; + parentNode.removeChild(element); + return function() { + if (nextSibling) { + parentNode.insertBefore(element, nextSibling); + } else { + parentNode.appendChild(element); + } + }; +} + +function getNode(o, po) +{ + var insertFunction = removeToInsertLater(po.li); + po.childrenVisited = true; + var l = po.childrenData.length-1; + for (var i in po.childrenData) { + var nodeData = po.childrenData[i]; + po.children[i] = newNode(o, po, nodeData[0], nodeData[1], nodeData[2], + i==l); + } + insertFunction(); +} + +function gotoNode(o,subIndex,root,hash,relpath) +{ + var nti = navTreeSubIndices[subIndex][root+hash]; + o.breadcrumbs = $.extend(true, [], nti ? nti : navTreeSubIndices[subIndex][root]); + if (!o.breadcrumbs && root!=NAVTREE[0][1]) { // fallback: show index + navTo(o,NAVTREE[0][1],"",relpath); + $('.item').removeClass('selected'); + $('.item').removeAttr('id'); + } + if (o.breadcrumbs) { + o.breadcrumbs.unshift(0); // add 0 for root node + showNode(o, o.node, 0, hash); + } +} + +function navTo(o,root,hash,relpath) +{ + var link = cachedLink(); + if (link) { + var parts = link.split('#'); + root = parts[0]; + if (parts.length>1) hash = '#'+parts[1].replace(/[^\w\-]/g,''); + else hash=''; + } + if (hash.match(/^#l\d+$/)) { + var anchor=$('a[name='+hash.substring(1)+']'); + glowEffect(anchor.parent(),1000); // line number + hash=''; // strip line number anchors + } + var url=root+hash; + var i=-1; + while (NAVTREEINDEX[i+1]<=url) i++; + if (i==-1) { i=0; root=NAVTREE[0][1]; } // fallback: show index + if (navTreeSubIndices[i]) { + gotoNode(o,i,root,hash,relpath) + } else { + getScript(relpath+'navtreeindex'+i,function(){ + navTreeSubIndices[i] = eval('NAVTREEINDEX'+i); + if (navTreeSubIndices[i]) { + gotoNode(o,i,root,hash,relpath); + } + },true); + } +} + +function showSyncOff(n,relpath) +{ + n.html('<img src="'+relpath+'sync_off.png" title="'+SYNCOFFMSG+'"/>'); +} + +function showSyncOn(n,relpath) +{ + n.html('<img src="'+relpath+'sync_on.png" title="'+SYNCONMSG+'"/>'); +} + +function toggleSyncButton(relpath) +{ + var navSync = $('#nav-sync'); + if (navSync.hasClass('sync')) { + navSync.removeClass('sync'); + showSyncOff(navSync,relpath); + storeLink(stripPath2(pathName())+hashUrl()); + } else { + navSync.addClass('sync'); + showSyncOn(navSync,relpath); + deleteLink(); + } +} + +function initNavTree(toroot,relpath) +{ + var o = new Object(); + o.toroot = toroot; + o.node = new Object(); + o.node.li = document.getElementById("nav-tree-contents"); + o.node.childrenData = NAVTREE; + o.node.children = new Array(); + o.node.childrenUL = document.createElement("ul"); + o.node.getChildrenUL = function() { return o.node.childrenUL; }; + o.node.li.appendChild(o.node.childrenUL); + o.node.depth = 0; + o.node.relpath = relpath; + o.node.expanded = false; + o.node.isLast = true; + o.node.plus_img = document.createElement("span"); + o.node.plus_img.className = 'arrow'; + o.node.plus_img.innerHTML = arrowRight; + + if (localStorageSupported()) { + var navSync = $('#nav-sync'); + if (cachedLink()) { + showSyncOff(navSync,relpath); + navSync.removeClass('sync'); + } else { + showSyncOn(navSync,relpath); + } + navSync.click(function(){ toggleSyncButton(relpath); }); + } + + $(window).load(function(){ + navTo(o,toroot,hashUrl(),relpath); + showRoot(); + }); + + $(window).bind('hashchange', function(){ + if (window.location.hash && window.location.hash.length>1){ + var a; + if ($(location).attr('hash')){ + var clslink=stripPath(pathName())+':'+hashValue(); + a=$('.item a[class$="'+clslink.replace(/</g,'\\3c ')+'"]'); + } + if (a==null || !$(a).parent().parent().hasClass('selected')){ + $('.item').removeClass('selected'); + $('.item').removeAttr('id'); + } + var link=stripPath2(pathName()); + navTo(o,link,hashUrl(),relpath); + } else if (!animationInProgress) { + $('#doc-content').scrollTop(0); + $('.item').removeClass('selected'); + $('.item').removeAttr('id'); + navTo(o,toroot,hashUrl(),relpath); + } + }) +} + diff --git a/C++/docs/html/navtreedata.js b/C++/docs/html/navtreedata.js new file mode 100644 index 0000000..d31ff89 --- /dev/null +++ b/C++/docs/html/navtreedata.js @@ -0,0 +1,31 @@ +var NAVTREE = +[ + [ "libxdf", "index.html", [ + [ "libxdf", "md__c_1__users__yida__lin__documents__git_hub_libxdf_libxdf__r_e_a_d_m_e.html", null ], + [ "Classes", "annotated.html", [ + [ "Class List", "annotated.html", "annotated_dup" ], + [ "Class Index", "classes.html", null ], + [ "Class Members", "functions.html", [ + [ "All", "functions.html", null ], + [ "Functions", "functions_func.html", null ], + [ "Variables", "functions_vars.html", null ], + [ "Typedefs", "functions_type.html", null ] + ] ] + ] ], + [ "Files", null, [ + [ "File List", "files.html", "files" ], + [ "File Members", "globals.html", [ + [ "All", "globals.html", null ], + [ "Macros", "globals_defs.html", null ] + ] ] + ] ] + ] ] +]; + +var NAVTREEINDEX = +[ +"annotated.html" +]; + +var SYNCONMSG = 'click to disable panel synchronisation'; +var SYNCOFFMSG = 'click to enable panel synchronisation'; \ No newline at end of file diff --git a/C++/docs/html/navtreeindex0.js b/C++/docs/html/navtreeindex0.js new file mode 100644 index 0000000..50fe3d2 --- /dev/null +++ b/C++/docs/html/navtreeindex0.js @@ -0,0 +1,75 @@ +var NAVTREEINDEX0 = +{ +"annotated.html":[1,0], +"class_xdf.html":[1,0,0], +"class_xdf.html#a072e657d7620d61080a15a215c691210":[1,0,0,11], +"class_xdf.html#a12332c25006e2c6d71883c368c3c1f61":[1,0,0,8], +"class_xdf.html#a1a2b080f29080a5c521de907769d9419":[1,0,0,21], +"class_xdf.html#a1d7401eb1557b2f34ac0ff4b9f79d04f":[1,0,0,29], +"class_xdf.html#a1e46bbbf31121fb394aa8cf5c10d10b0":[1,0,0,15], +"class_xdf.html#a1fbf3d641262cc1daade33eca1789990":[1,0,0,2], +"class_xdf.html#a250d6f79d0333887393eab248fee3c93":[1,0,0,16], +"class_xdf.html#a26a2b517f020dc9f188c2277c76add85":[1,0,0,12], +"class_xdf.html#a3cb480731a20caa480e3e6744acb562c":[1,0,0,18], +"class_xdf.html#a44da046e191b2ae90b9bfe4de8d58ea3":[1,0,0,20], +"class_xdf.html#a45004fc495cad33768fae80b996a68db":[1,0,0,13], +"class_xdf.html#a4acb87e86380bf7266976cd6c4cb3826":[1,0,0,14], +"class_xdf.html#a4d2c5859af84542a15a80c906465f4e3":[1,0,0,7], +"class_xdf.html#a4e3322abfe4d533d6b7a96cbbea7271a":[1,0,0,1], +"class_xdf.html#a67c5890ac84f257e91bdb93dcbe958ae":[1,0,0,10], +"class_xdf.html#a6874a847c980f296ebbcf703fa48096a":[1,0,0,19], +"class_xdf.html#a75ef15a72071fe0d36ef6311214518fe":[1,0,0,5], +"class_xdf.html#a7900b5a4f3792b9d59a5d43db821607e":[1,0,0,3], +"class_xdf.html#a7b1496a8667d67b90836696a1e2da618":[1,0,0,28], +"class_xdf.html#a83d5309d854b1052fa575b539a69c58d":[1,0,0,27], +"class_xdf.html#a993e94535d6d9e544a64ffbbb2bb4e8c":[1,0,0,9], +"class_xdf.html#a9b4fc485a140ba5020a48ca5fa2e45ea":[1,0,0,25], +"class_xdf.html#aa02e5a435186cdabbaf2487068c53dbc":[1,0,0,23], +"class_xdf.html#aa7dc1ef8c04216d703604bf868146428":[1,0,0,4], +"class_xdf.html#ac0b5d7d53fb28832594718cc16f65184":[1,0,0,26], +"class_xdf.html#ac65175994e0e2eeec4dd2f4688cd2040":[1,0,0,17], +"class_xdf.html#acc12687ca26e8352afb960d459c5947a":[1,0,0,24], +"class_xdf.html#ad98829202c9ae64505c9ecc7796c8ddc":[1,0,0,6], +"class_xdf.html#add8aceaf68ad49b708f4df29f439778d":[1,0,0,22], +"classes.html":[1,1], +"dir_689ecbe789caf2e46799b15492db205c.html":[2,0,0,0,0,0], +"dir_72e8b74943c3b26541b5ac1c7338ef6f.html":[2,0,0,0,0], +"dir_7e17ac9cf8fba2cb04bc248c85b0ceb7.html":[2,0,0,0], +"dir_f396504afdc959660871b003fa10164d.html":[2,0,0], +"files.html":[2,0], +"functions.html":[1,2,0], +"functions_func.html":[1,2,1], +"functions_type.html":[1,2,3], +"functions_vars.html":[1,2,2], +"globals.html":[2,1,0], +"globals_defs.html":[2,1,1], +"index.html":[], +"md__c_1__users__yida__lin__documents__git_hub_libxdf_libxdf__r_e_a_d_m_e.html":[0], +"pages.html":[], +"struct_xdf_1_1_stream.html":[1,0,0,0], +"struct_xdf_1_1_stream.html#a112e1dcc0e4b7f9583755366da8c3c64":[1,0,0,0,12], +"struct_xdf_1_1_stream.html#a17696fc2ee37c1d79601fac1736deb35":[1,0,0,0,13], +"struct_xdf_1_1_stream.html#a22a44cb3cd533ea668f9bb20dbc299de":[1,0,0,0,7], +"struct_xdf_1_1_stream.html#a2dff1924d1f7de075df08c4001201d63":[1,0,0,0,17], +"struct_xdf_1_1_stream.html#a329234a46df00cd51a67a7f4f637c08a":[1,0,0,0,14], +"struct_xdf_1_1_stream.html#a3f05ffb18a1feb56c248c391a69f104b":[1,0,0,0,19], +"struct_xdf_1_1_stream.html#a49bbcb0c3130c3efef27ece47084b327":[1,0,0,0,15], +"struct_xdf_1_1_stream.html#a6bc91dcf23e551a9adbc415b562f3a79":[1,0,0,0,4], +"struct_xdf_1_1_stream.html#a6f6328f0746591a3a471048b6b9bd258":[1,0,0,0,3], +"struct_xdf_1_1_stream.html#a71d987a538d0819cdbd58120d1a79ef5":[1,0,0,0,2], +"struct_xdf_1_1_stream.html#a732d62cf3216a3bd4990625b0eb723cf":[1,0,0,0,8], +"struct_xdf_1_1_stream.html#a7e5aa085e48de871ea6661651b28e097":[1,0,0,0,20], +"struct_xdf_1_1_stream.html#a988989603854812cb693e56ff352a753":[1,0,0,0,5], +"struct_xdf_1_1_stream.html#a9c1fbac049f7c15225de9fe9713abc0a":[1,0,0,0,11], +"struct_xdf_1_1_stream.html#a9e05df342a36187ae492c75f10fc7713":[1,0,0,0,9], +"struct_xdf_1_1_stream.html#ab61b638cf490354db62fb7da999750cf":[1,0,0,0,10], +"struct_xdf_1_1_stream.html#ab8fb7c3d645305e84f90d919f698082c":[1,0,0,0,0], +"struct_xdf_1_1_stream.html#abeb1d2eb26a46eac34a478f04f5143d6":[1,0,0,0,6], +"struct_xdf_1_1_stream.html#ad7b61b077e247ba57a18c182e285d0ad":[1,0,0,0,1], +"struct_xdf_1_1_stream.html#adfdeb5f6220da9fe671d3f37e27ed0bb":[1,0,0,0,18], +"struct_xdf_1_1_stream.html#aecd1fdf80d421e2362eeee58b31d4e11":[1,0,0,0,16], +"xdf_8cpp.html":[2,0,0,0,0,0,0], +"xdf_8cpp.html#a6821bafc3c88dfb2e433a095df9940c6":[2,0,0,0,0,0,0,0], +"xdf_8h.html":[2,0,0,0,0,0,1], +"xdf_8h_source.html":[2,0,0,0,0,0,1] +}; diff --git a/C++/docs/html/open.png b/C++/docs/html/open.png new file mode 100644 index 0000000000000000000000000000000000000000..30f75c7efe2dd0c9e956e35b69777a02751f048b GIT binary patch literal 123 zcmeAS@N?(olHy`uVBq!ia0vp^oFL4>1|%O$WD@{VPM$7~Ar*{o?;hlAFyLXmaDC0y znK1_#cQqJWPES%4Uujug^TE?jMft$}Eq^WaR~)%f)vSNs&gek&x%A9X9sM<Rdl=8h W@EqZ{ytxBt8iS{+pUXO@geCxcDJg#d literal 0 HcmV?d00001 diff --git a/C++/docs/html/pages.html b/C++/docs/html/pages.html new file mode 100644 index 0000000..bb0b702 --- /dev/null +++ b/C++/docs/html/pages.html @@ -0,0 +1,104 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>libxdf: Related Pages</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="navtree.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="resize.js"></script> +<script type="text/javascript" src="navtreedata.js"></script> +<script type="text/javascript" src="navtree.js"></script> +<script type="text/javascript"> + $(document).ready(initResizable); +</script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">libxdf +  <span id="projectnumber">0.92</span> + </div> + <div id="projectbrief">A static C++ library for loading XDF files</div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.12 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<div id="side-nav" class="ui-resizable side-nav-resizable"> + <div id="nav-tree"> + <div id="nav-tree-contents"> + <div id="nav-sync" class="sync"></div> + </div> + </div> + <div id="splitbar" style="-moz-user-select:none;" + class="ui-resizable-handle"> + </div> +</div> +<script type="text/javascript"> +$(document).ready(function(){initNavTree('pages.html','');}); +</script> +<div id="doc-content"> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="header"> + <div class="headertitle"> +<div class="title">Related Pages</div> </div> +</div><!--header--> +<div class="contents"> +<div class="textblock">Here is a list of all related documentation pages:</div><div class="directory"> +<table class="directory"> +<tr id="row_0_" class="even"><td class="entry"><span style="width:16px;display:inline-block;"> </span><a class="el" href="md__c_1__users__yida__lin__documents__git_hub_libxdf_libxdf__r_e_a_d_m_e.html" target="_self">libxdf</a></td><td class="desc"></td></tr> +</table> +</div><!-- directory --> +</div><!-- contents --> +</div><!-- doc-content --> +<!-- start footer part --> +<div id="nav-path" class="navpath"><!-- id is needed for treeview function! --> + <ul> + <li class="footer">Generated by + <a href="http://www.doxygen.org/index.html"> + <img class="footer" src="doxygen.png" alt="doxygen"/></a> 1.8.12 </li> + </ul> +</div> +</body> +</html> diff --git a/C++/docs/html/resize.js b/C++/docs/html/resize.js new file mode 100644 index 0000000..6d78f5b --- /dev/null +++ b/C++/docs/html/resize.js @@ -0,0 +1,113 @@ +function initResizable() +{ + var cookie_namespace = 'doxygen'; + var sidenav,navtree,content,header,collapsed,collapsedWidth=0,barWidth=6,desktop_vp=768,titleHeight; + + function readCookie(cookie) + { + var myCookie = cookie_namespace+"_"+cookie+"="; + if (document.cookie) { + var index = document.cookie.indexOf(myCookie); + if (index != -1) { + var valStart = index + myCookie.length; + var valEnd = document.cookie.indexOf(";", valStart); + if (valEnd == -1) { + valEnd = document.cookie.length; + } + var val = document.cookie.substring(valStart, valEnd); + return val; + } + } + return 0; + } + + function writeCookie(cookie, val, expiration) + { + if (val==undefined) return; + if (expiration == null) { + var date = new Date(); + date.setTime(date.getTime()+(10*365*24*60*60*1000)); // default expiration is one week + expiration = date.toGMTString(); + } + document.cookie = cookie_namespace + "_" + cookie + "=" + val + "; expires=" + expiration+"; path=/"; + } + + function resizeWidth() + { + var windowWidth = $(window).width() + "px"; + var sidenavWidth = $(sidenav).outerWidth(); + content.css({marginLeft:parseInt(sidenavWidth)+"px"}); + writeCookie('width',sidenavWidth-barWidth, null); + } + + function restoreWidth(navWidth) + { + var windowWidth = $(window).width() + "px"; + content.css({marginLeft:parseInt(navWidth)+barWidth+"px"}); + sidenav.css({width:navWidth + "px"}); + } + + function resizeHeight() + { + var headerHeight = header.outerHeight(); + var footerHeight = footer.outerHeight(); + var windowHeight = $(window).height() - headerHeight - footerHeight; + content.css({height:windowHeight + "px"}); + navtree.css({height:windowHeight + "px"}); + sidenav.css({height:windowHeight + "px"}); + var width=$(window).width(); + if (width!=collapsedWidth) { + if (width<desktop_vp && collapsedWidth>=desktop_vp) { + if (!collapsed) { + collapseExpand(); + } + } else if (width>desktop_vp && collapsedWidth<desktop_vp) { + if (collapsed) { + collapseExpand(); + } + } + collapsedWidth=width; + } + } + + function collapseExpand() + { + if (sidenav.width()>0) { + restoreWidth(0); + collapsed=true; + } + else { + var width = readCookie('width'); + if (width>200 && width<$(window).width()) { restoreWidth(width); } else { restoreWidth(200); } + collapsed=false; + } + } + + header = $("#top"); + sidenav = $("#side-nav"); + content = $("#doc-content"); + navtree = $("#nav-tree"); + footer = $("#nav-path"); + $(".side-nav-resizable").resizable({resize: function(e, ui) { resizeWidth(); } }); + $(sidenav).resizable({ minWidth: 0 }); + $(window).resize(function() { resizeHeight(); }); + var device = navigator.userAgent.toLowerCase(); + var touch_device = device.match(/(iphone|ipod|ipad|android)/); + if (touch_device) { /* wider split bar for touch only devices */ + $(sidenav).css({ paddingRight:'20px' }); + $('.ui-resizable-e').css({ width:'20px' }); + $('#nav-sync').css({ right:'34px' }); + barWidth=20; + } + var width = readCookie('width'); + if (width) { restoreWidth(width); } else { resizeWidth(); } + var url = location.href; + var i=url.indexOf("#"); + if (i>=0) window.location.hash=url.substr(i); + var _preventDefault = function(evt) { evt.preventDefault(); }; + $("#splitbar").bind("dragstart", _preventDefault).bind("selectstart", _preventDefault); + $(".ui-resizable-handle").dblclick(collapseExpand); + $(window).load(resizeHeight); +} + + diff --git a/C++/docs/html/search/all_0.html b/C++/docs/html/search/all_0.html new file mode 100644 index 0000000..4359463 --- /dev/null +++ b/C++/docs/html/search/all_0.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="all_0.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/all_0.js b/C++/docs/html/search/all_0.js new file mode 100644 index 0000000..e8f97bc --- /dev/null +++ b/C++/docs/html/search/all_0.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['adjusttotallength',['adjustTotalLength',['../class_xdf.html#aa7dc1ef8c04216d703604bf868146428',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/all_1.html b/C++/docs/html/search/all_1.html new file mode 100644 index 0000000..bc87ea8 --- /dev/null +++ b/C++/docs/html/search/all_1.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="all_1.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/all_1.js b/C++/docs/html/search/all_1.js new file mode 100644 index 0000000..aaf7538 --- /dev/null +++ b/C++/docs/html/search/all_1.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['buf_5fsize',['BUF_SIZE',['../xdf_8cpp.html#a6821bafc3c88dfb2e433a095df9940c6',1,'xdf.cpp']]] +]; diff --git a/C++/docs/html/search/all_10.html b/C++/docs/html/search/all_10.html new file mode 100644 index 0000000..16ffd9a --- /dev/null +++ b/C++/docs/html/search/all_10.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="all_10.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/all_10.js b/C++/docs/html/search/all_10.js new file mode 100644 index 0000000..63ddc8e --- /dev/null +++ b/C++/docs/html/search/all_10.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['writeeventstoxdf',['writeEventsToXDF',['../class_xdf.html#a072e657d7620d61080a15a215c691210',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/all_11.html b/C++/docs/html/search/all_11.html new file mode 100644 index 0000000..d689820 --- /dev/null +++ b/C++/docs/html/search/all_11.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="all_11.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/all_11.js b/C++/docs/html/search/all_11.js new file mode 100644 index 0000000..6cceb3c --- /dev/null +++ b/C++/docs/html/search/all_11.js @@ -0,0 +1,6 @@ +var searchData= +[ + ['xdf',['Xdf',['../class_xdf.html',1,'Xdf'],['../class_xdf.html#a7900b5a4f3792b9d59a5d43db821607e',1,'Xdf::Xdf()']]], + ['xdf_2ecpp',['xdf.cpp',['../xdf_8cpp.html',1,'']]], + ['xdf_2eh',['xdf.h',['../xdf_8h.html',1,'']]] +]; diff --git a/C++/docs/html/search/all_12.html b/C++/docs/html/search/all_12.html new file mode 100644 index 0000000..698e2c5 --- /dev/null +++ b/C++/docs/html/search/all_12.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="all_12.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/all_12.js b/C++/docs/html/search/all_12.js new file mode 100644 index 0000000..6cceb3c --- /dev/null +++ b/C++/docs/html/search/all_12.js @@ -0,0 +1,6 @@ +var searchData= +[ + ['xdf',['Xdf',['../class_xdf.html',1,'Xdf'],['../class_xdf.html#a7900b5a4f3792b9d59a5d43db821607e',1,'Xdf::Xdf()']]], + ['xdf_2ecpp',['xdf.cpp',['../xdf_8cpp.html',1,'']]], + ['xdf_2eh',['xdf.h',['../xdf_8h.html',1,'']]] +]; diff --git a/C++/docs/html/search/all_2.html b/C++/docs/html/search/all_2.html new file mode 100644 index 0000000..0f777c2 --- /dev/null +++ b/C++/docs/html/search/all_2.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="all_2.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/all_2.js b/C++/docs/html/search/all_2.js new file mode 100644 index 0000000..d0b785d --- /dev/null +++ b/C++/docs/html/search/all_2.js @@ -0,0 +1,11 @@ +var searchData= +[ + ['calctotallength',['calcTotalLength',['../class_xdf.html#a75ef15a72071fe0d36ef6311214518fe',1,'Xdf']]], + ['channel_5fcount',['channel_count',['../struct_xdf_1_1_stream.html#ab8fb7c3d645305e84f90d919f698082c',1,'Xdf::Stream']]], + ['channel_5fformat',['channel_format',['../struct_xdf_1_1_stream.html#ad7b61b077e247ba57a18c182e285d0ad',1,'Xdf::Stream']]], + ['channels',['channels',['../struct_xdf_1_1_stream.html#a71d987a538d0819cdbd58120d1a79ef5',1,'Xdf::Stream']]], + ['clock_5foffsets',['clock_offsets',['../struct_xdf_1_1_stream.html#a6f6328f0746591a3a471048b6b9bd258',1,'Xdf::Stream']]], + ['clock_5ftimes',['clock_times',['../struct_xdf_1_1_stream.html#a6bc91dcf23e551a9adbc415b562f3a79',1,'Xdf::Stream']]], + ['clock_5fvalues',['clock_values',['../struct_xdf_1_1_stream.html#a988989603854812cb693e56ff352a753',1,'Xdf::Stream']]], + ['createlabels',['createLabels',['../class_xdf.html#ad98829202c9ae64505c9ecc7796c8ddc',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/all_3.html b/C++/docs/html/search/all_3.html new file mode 100644 index 0000000..ac9dbf9 --- /dev/null +++ b/C++/docs/html/search/all_3.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="all_3.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/all_3.js b/C++/docs/html/search/all_3.js new file mode 100644 index 0000000..70ce471 --- /dev/null +++ b/C++/docs/html/search/all_3.js @@ -0,0 +1,5 @@ +var searchData= +[ + ['detrend',['detrend',['../class_xdf.html#a4d2c5859af84542a15a80c906465f4e3',1,'Xdf']]], + ['dictionary',['dictionary',['../class_xdf.html#a26a2b517f020dc9f188c2277c76add85',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/all_4.html b/C++/docs/html/search/all_4.html new file mode 100644 index 0000000..8308168 --- /dev/null +++ b/C++/docs/html/search/all_4.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="all_4.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/all_4.js b/C++/docs/html/search/all_4.js new file mode 100644 index 0000000..4f5d3a3 --- /dev/null +++ b/C++/docs/html/search/all_4.js @@ -0,0 +1,8 @@ +var searchData= +[ + ['effective_5fsample_5frate',['effective_sample_rate',['../struct_xdf_1_1_stream.html#abeb1d2eb26a46eac34a478f04f5143d6',1,'Xdf::Stream']]], + ['eventmap',['eventMap',['../class_xdf.html#a45004fc495cad33768fae80b996a68db',1,'Xdf']]], + ['eventname',['eventName',['../class_xdf.html#a4e3322abfe4d533d6b7a96cbbea7271a',1,'Xdf']]], + ['eventtimestamp',['eventTimeStamp',['../class_xdf.html#a1fbf3d641262cc1daade33eca1789990',1,'Xdf']]], + ['eventtype',['eventType',['../class_xdf.html#a4acb87e86380bf7266976cd6c4cb3826',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/all_5.html b/C++/docs/html/search/all_5.html new file mode 100644 index 0000000..7919cd4 --- /dev/null +++ b/C++/docs/html/search/all_5.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="all_5.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/all_5.js b/C++/docs/html/search/all_5.js new file mode 100644 index 0000000..13c9097 --- /dev/null +++ b/C++/docs/html/search/all_5.js @@ -0,0 +1,6 @@ +var searchData= +[ + ['fileheader',['fileHeader',['../class_xdf.html#a1e46bbbf31121fb394aa8cf5c10d10b0',1,'Xdf']]], + ['first_5ftimestamp',['first_timestamp',['../struct_xdf_1_1_stream.html#a22a44cb3cd533ea668f9bb20dbc299de',1,'Xdf::Stream']]], + ['freeuptimestamps',['freeUpTimeStamps',['../class_xdf.html#a12332c25006e2c6d71883c368c3c1f61',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/all_6.html b/C++/docs/html/search/all_6.html new file mode 100644 index 0000000..89d590c --- /dev/null +++ b/C++/docs/html/search/all_6.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="all_6.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/all_6.js b/C++/docs/html/search/all_6.js new file mode 100644 index 0000000..136d71c --- /dev/null +++ b/C++/docs/html/search/all_6.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['info',['info',['../struct_xdf_1_1_stream.html#a732d62cf3216a3bd4990625b0eb723cf',1,'Xdf::Stream']]] +]; diff --git a/C++/docs/html/search/all_7.html b/C++/docs/html/search/all_7.html new file mode 100644 index 0000000..0e8c527 --- /dev/null +++ b/C++/docs/html/search/all_7.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="all_7.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/all_7.js b/C++/docs/html/search/all_7.js new file mode 100644 index 0000000..7b216e2 --- /dev/null +++ b/C++/docs/html/search/all_7.js @@ -0,0 +1,7 @@ +var searchData= +[ + ['labels',['labels',['../class_xdf.html#a250d6f79d0333887393eab248fee3c93',1,'Xdf']]], + ['last_5ftimestamp',['last_timestamp',['../struct_xdf_1_1_stream.html#a9e05df342a36187ae492c75f10fc7713',1,'Xdf::Stream::last_timestamp()'],['../struct_xdf_1_1_stream.html#ab61b638cf490354db62fb7da999750cf',1,'Xdf::Stream::last_timestamp()']]], + ['load_5fxdf',['load_xdf',['../class_xdf.html#a993e94535d6d9e544a64ffbbb2bb4e8c',1,'Xdf']]], + ['libxdf',['libxdf',['../md__c_1__users__yida__lin__documents__git_hub_libxdf_libxdf__r_e_a_d_m_e.html',1,'']]] +]; diff --git a/C++/docs/html/search/all_8.html b/C++/docs/html/search/all_8.html new file mode 100644 index 0000000..80bda06 --- /dev/null +++ b/C++/docs/html/search/all_8.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="all_8.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/all_8.js b/C++/docs/html/search/all_8.js new file mode 100644 index 0000000..1a931e0 --- /dev/null +++ b/C++/docs/html/search/all_8.js @@ -0,0 +1,8 @@ +var searchData= +[ + ['majsr',['majSR',['../class_xdf.html#ac65175994e0e2eeec4dd2f4688cd2040',1,'Xdf']]], + ['maxsr',['maxSR',['../class_xdf.html#a3cb480731a20caa480e3e6744acb562c',1,'Xdf']]], + ['maxts',['maxTS',['../class_xdf.html#a6874a847c980f296ebbcf703fa48096a',1,'Xdf']]], + ['measured_5fsrate',['measured_srate',['../struct_xdf_1_1_stream.html#a9c1fbac049f7c15225de9fe9713abc0a',1,'Xdf::Stream']]], + ['mints',['minTS',['../class_xdf.html#a44da046e191b2ae90b9bfe4de8d58ea3',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/all_9.html b/C++/docs/html/search/all_9.html new file mode 100644 index 0000000..8ebc8a2 --- /dev/null +++ b/C++/docs/html/search/all_9.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="all_9.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/all_9.js b/C++/docs/html/search/all_9.js new file mode 100644 index 0000000..aee204e --- /dev/null +++ b/C++/docs/html/search/all_9.js @@ -0,0 +1,5 @@ +var searchData= +[ + ['name',['name',['../struct_xdf_1_1_stream.html#a112e1dcc0e4b7f9583755366da8c3c64',1,'Xdf::Stream']]], + ['nominal_5fsrate',['nominal_srate',['../struct_xdf_1_1_stream.html#a17696fc2ee37c1d79601fac1736deb35',1,'Xdf::Stream']]] +]; diff --git a/C++/docs/html/search/all_a.html b/C++/docs/html/search/all_a.html new file mode 100644 index 0000000..f17bf66 --- /dev/null +++ b/C++/docs/html/search/all_a.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="all_a.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/all_a.js b/C++/docs/html/search/all_a.js new file mode 100644 index 0000000..eaf8cb6 --- /dev/null +++ b/C++/docs/html/search/all_a.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['offsets',['offsets',['../class_xdf.html#a1a2b080f29080a5c521de907769d9419',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/all_b.html b/C++/docs/html/search/all_b.html new file mode 100644 index 0000000..6ef469e --- /dev/null +++ b/C++/docs/html/search/all_b.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="all_b.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/all_b.js b/C++/docs/html/search/all_b.js new file mode 100644 index 0000000..56ec070 --- /dev/null +++ b/C++/docs/html/search/all_b.js @@ -0,0 +1,5 @@ +var searchData= +[ + ['readme_2emd',['README.md',['../_r_e_a_d_m_e_8md.html',1,'']]], + ['resample',['resample',['../class_xdf.html#a67c5890ac84f257e91bdb93dcbe958ae',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/all_c.html b/C++/docs/html/search/all_c.html new file mode 100644 index 0000000..4ca7bb9 --- /dev/null +++ b/C++/docs/html/search/all_c.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="all_c.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/all_c.js b/C++/docs/html/search/all_c.js new file mode 100644 index 0000000..4866ed0 --- /dev/null +++ b/C++/docs/html/search/all_c.js @@ -0,0 +1,11 @@ +var searchData= +[ + ['sample_5fcount',['sample_count',['../struct_xdf_1_1_stream.html#a329234a46df00cd51a67a7f4f637c08a',1,'Xdf::Stream']]], + ['sampleratemap',['sampleRateMap',['../class_xdf.html#add8aceaf68ad49b708f4df29f439778d',1,'Xdf']]], + ['sampling_5finterval',['sampling_interval',['../struct_xdf_1_1_stream.html#a49bbcb0c3130c3efef27ece47084b327',1,'Xdf::Stream']]], + ['stream',['Stream',['../struct_xdf_1_1_stream.html',1,'Xdf']]], + ['streamfooter',['streamFooter',['../struct_xdf_1_1_stream.html#aecd1fdf80d421e2362eeee58b31d4e11',1,'Xdf::Stream']]], + ['streamheader',['streamHeader',['../struct_xdf_1_1_stream.html#a2dff1924d1f7de075df08c4001201d63',1,'Xdf::Stream']]], + ['streammap',['streamMap',['../class_xdf.html#aa02e5a435186cdabbaf2487068c53dbc',1,'Xdf']]], + ['streams',['streams',['../class_xdf.html#acc12687ca26e8352afb960d459c5947a',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/all_d.html b/C++/docs/html/search/all_d.html new file mode 100644 index 0000000..fedf606 --- /dev/null +++ b/C++/docs/html/search/all_d.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="all_d.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/all_d.js b/C++/docs/html/search/all_d.js new file mode 100644 index 0000000..79c8cc5 --- /dev/null +++ b/C++/docs/html/search/all_d.js @@ -0,0 +1,8 @@ +var searchData= +[ + ['time_5fseries',['time_series',['../struct_xdf_1_1_stream.html#adfdeb5f6220da9fe671d3f37e27ed0bb',1,'Xdf::Stream']]], + ['time_5fstamps',['time_stamps',['../struct_xdf_1_1_stream.html#a3f05ffb18a1feb56c248c391a69f104b',1,'Xdf::Stream']]], + ['totalch',['totalCh',['../class_xdf.html#a9b4fc485a140ba5020a48ca5fa2e45ea',1,'Xdf']]], + ['totallen',['totalLen',['../class_xdf.html#ac0b5d7d53fb28832594718cc16f65184',1,'Xdf']]], + ['type',['type',['../struct_xdf_1_1_stream.html#a7e5aa085e48de871ea6661651b28e097',1,'Xdf::Stream']]] +]; diff --git a/C++/docs/html/search/all_e.html b/C++/docs/html/search/all_e.html new file mode 100644 index 0000000..9b78086 --- /dev/null +++ b/C++/docs/html/search/all_e.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="all_e.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/all_e.js b/C++/docs/html/search/all_e.js new file mode 100644 index 0000000..fc8fdee --- /dev/null +++ b/C++/docs/html/search/all_e.js @@ -0,0 +1,5 @@ +var searchData= +[ + ['useraddedstream',['userAddedStream',['../class_xdf.html#a83d5309d854b1052fa575b539a69c58d',1,'Xdf']]], + ['usercreatedevents',['userCreatedEvents',['../class_xdf.html#a7b1496a8667d67b90836696a1e2da618',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/all_f.html b/C++/docs/html/search/all_f.html new file mode 100644 index 0000000..3bf97c6 --- /dev/null +++ b/C++/docs/html/search/all_f.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="all_f.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/all_f.js b/C++/docs/html/search/all_f.js new file mode 100644 index 0000000..e683aa5 --- /dev/null +++ b/C++/docs/html/search/all_f.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['version',['version',['../class_xdf.html#a1d7401eb1557b2f34ac0ff4b9f79d04f',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/classes_0.html b/C++/docs/html/search/classes_0.html new file mode 100644 index 0000000..2e45b2c --- /dev/null +++ b/C++/docs/html/search/classes_0.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="classes_0.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/classes_0.js b/C++/docs/html/search/classes_0.js new file mode 100644 index 0000000..f828873 --- /dev/null +++ b/C++/docs/html/search/classes_0.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['stream',['Stream',['../struct_xdf_1_1_stream.html',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/classes_1.html b/C++/docs/html/search/classes_1.html new file mode 100644 index 0000000..5f1bc63 --- /dev/null +++ b/C++/docs/html/search/classes_1.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="classes_1.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/classes_1.js b/C++/docs/html/search/classes_1.js new file mode 100644 index 0000000..0d5965a --- /dev/null +++ b/C++/docs/html/search/classes_1.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['xdf',['Xdf',['../class_xdf.html',1,'']]] +]; diff --git a/C++/docs/html/search/close.png b/C++/docs/html/search/close.png new file mode 100644 index 0000000000000000000000000000000000000000..9342d3dfeea7b7c4ee610987e717804b5a42ceb9 GIT binary patch literal 273 zcmV+s0q*{ZP)<h;3K|Lk000e1NJLTq000XB000XJ1^@s6sjPP<0002kNkl<Z7#Vd@ zy%I)14BQwM3KSF?L+drXf2Tud1~Vwo-gkQ=D&H2DpWDkOIl+T{-_5ct*tQMlc_NA; z#Bq!~&yl97kminQn#?$kxUNgzzBUX)lx2ycD8xIC<1djfsKP>4(RlMby96)VwnbG{ zbe&}^BDn7x>$<{ck4zAK-=nT;=hHG)kmplIF${xqm8db3oX6wT3bvp`TE@m0cg;b) zBuSL}5?N7O(iZLdAlz@)b)Rd~DnSsSX&P5qC`XwuFwcAYLC+d2>+1(8on;wpt8QIC X2MT$R4iQDd00000NkvXXu0mjfia~GN literal 0 HcmV?d00001 diff --git a/C++/docs/html/search/defines_0.html b/C++/docs/html/search/defines_0.html new file mode 100644 index 0000000..e53ef23 --- /dev/null +++ b/C++/docs/html/search/defines_0.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="defines_0.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/defines_0.js b/C++/docs/html/search/defines_0.js new file mode 100644 index 0000000..aaf7538 --- /dev/null +++ b/C++/docs/html/search/defines_0.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['buf_5fsize',['BUF_SIZE',['../xdf_8cpp.html#a6821bafc3c88dfb2e433a095df9940c6',1,'xdf.cpp']]] +]; diff --git a/C++/docs/html/search/files_0.html b/C++/docs/html/search/files_0.html new file mode 100644 index 0000000..63c6ce0 --- /dev/null +++ b/C++/docs/html/search/files_0.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="files_0.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/files_0.js b/C++/docs/html/search/files_0.js new file mode 100644 index 0000000..66a27ec --- /dev/null +++ b/C++/docs/html/search/files_0.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['readme_2emd',['README.md',['../_r_e_a_d_m_e_8md.html',1,'']]] +]; diff --git a/C++/docs/html/search/files_1.html b/C++/docs/html/search/files_1.html new file mode 100644 index 0000000..5b37391 --- /dev/null +++ b/C++/docs/html/search/files_1.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="files_1.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/files_1.js b/C++/docs/html/search/files_1.js new file mode 100644 index 0000000..a469fb3 --- /dev/null +++ b/C++/docs/html/search/files_1.js @@ -0,0 +1,5 @@ +var searchData= +[ + ['xdf_2ecpp',['xdf.cpp',['../xdf_8cpp.html',1,'']]], + ['xdf_2eh',['xdf.h',['../xdf_8h.html',1,'']]] +]; diff --git a/C++/docs/html/search/functions_0.html b/C++/docs/html/search/functions_0.html new file mode 100644 index 0000000..03cae5d --- /dev/null +++ b/C++/docs/html/search/functions_0.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="functions_0.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/functions_0.js b/C++/docs/html/search/functions_0.js new file mode 100644 index 0000000..e8f97bc --- /dev/null +++ b/C++/docs/html/search/functions_0.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['adjusttotallength',['adjustTotalLength',['../class_xdf.html#aa7dc1ef8c04216d703604bf868146428',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/functions_1.html b/C++/docs/html/search/functions_1.html new file mode 100644 index 0000000..5d7a2e3 --- /dev/null +++ b/C++/docs/html/search/functions_1.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="functions_1.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/functions_1.js b/C++/docs/html/search/functions_1.js new file mode 100644 index 0000000..4ca8aaf --- /dev/null +++ b/C++/docs/html/search/functions_1.js @@ -0,0 +1,5 @@ +var searchData= +[ + ['calctotallength',['calcTotalLength',['../class_xdf.html#a75ef15a72071fe0d36ef6311214518fe',1,'Xdf']]], + ['createlabels',['createLabels',['../class_xdf.html#ad98829202c9ae64505c9ecc7796c8ddc',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/functions_2.html b/C++/docs/html/search/functions_2.html new file mode 100644 index 0000000..c21af16 --- /dev/null +++ b/C++/docs/html/search/functions_2.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="functions_2.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/functions_2.js b/C++/docs/html/search/functions_2.js new file mode 100644 index 0000000..f7362ff --- /dev/null +++ b/C++/docs/html/search/functions_2.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['detrend',['detrend',['../class_xdf.html#a4d2c5859af84542a15a80c906465f4e3',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/functions_3.html b/C++/docs/html/search/functions_3.html new file mode 100644 index 0000000..e6f4744 --- /dev/null +++ b/C++/docs/html/search/functions_3.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="functions_3.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/functions_3.js b/C++/docs/html/search/functions_3.js new file mode 100644 index 0000000..c480870 --- /dev/null +++ b/C++/docs/html/search/functions_3.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['freeuptimestamps',['freeUpTimeStamps',['../class_xdf.html#a12332c25006e2c6d71883c368c3c1f61',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/functions_4.html b/C++/docs/html/search/functions_4.html new file mode 100644 index 0000000..9ae34ff --- /dev/null +++ b/C++/docs/html/search/functions_4.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="functions_4.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/functions_4.js b/C++/docs/html/search/functions_4.js new file mode 100644 index 0000000..7a68cf0 --- /dev/null +++ b/C++/docs/html/search/functions_4.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['load_5fxdf',['load_xdf',['../class_xdf.html#a993e94535d6d9e544a64ffbbb2bb4e8c',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/functions_5.html b/C++/docs/html/search/functions_5.html new file mode 100644 index 0000000..54f53d0 --- /dev/null +++ b/C++/docs/html/search/functions_5.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="functions_5.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/functions_5.js b/C++/docs/html/search/functions_5.js new file mode 100644 index 0000000..f8577d5 --- /dev/null +++ b/C++/docs/html/search/functions_5.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['resample',['resample',['../class_xdf.html#a67c5890ac84f257e91bdb93dcbe958ae',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/functions_6.html b/C++/docs/html/search/functions_6.html new file mode 100644 index 0000000..c7bc6fb --- /dev/null +++ b/C++/docs/html/search/functions_6.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="functions_6.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/functions_6.js b/C++/docs/html/search/functions_6.js new file mode 100644 index 0000000..63ddc8e --- /dev/null +++ b/C++/docs/html/search/functions_6.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['writeeventstoxdf',['writeEventsToXDF',['../class_xdf.html#a072e657d7620d61080a15a215c691210',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/functions_7.html b/C++/docs/html/search/functions_7.html new file mode 100644 index 0000000..7f10e2b --- /dev/null +++ b/C++/docs/html/search/functions_7.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="functions_7.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/functions_7.js b/C++/docs/html/search/functions_7.js new file mode 100644 index 0000000..02ca204 --- /dev/null +++ b/C++/docs/html/search/functions_7.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['xdf',['Xdf',['../class_xdf.html#a7900b5a4f3792b9d59a5d43db821607e',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/functions_8.html b/C++/docs/html/search/functions_8.html new file mode 100644 index 0000000..347734a --- /dev/null +++ b/C++/docs/html/search/functions_8.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="functions_8.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/functions_8.js b/C++/docs/html/search/functions_8.js new file mode 100644 index 0000000..02ca204 --- /dev/null +++ b/C++/docs/html/search/functions_8.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['xdf',['Xdf',['../class_xdf.html#a7900b5a4f3792b9d59a5d43db821607e',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/mag_sel.png b/C++/docs/html/search/mag_sel.png new file mode 100644 index 0000000000000000000000000000000000000000..81f6040a2092402b4d98f9ffa8855d12a0d4ca17 GIT binary patch literal 563 zcmV-30?hr1P)<h;3K|Lk000e1NJLTq000yK000vR1^@s6kc=(000009a7bBm000XU z000XU0RWnu7ytkOAY({UO#lFGm;eBCjsO7QH~;{G)c^o`2LJ%dv;Y7zL;wIBc7!%6 zy#N3Kxk*GpRCwCtl)H)|K@^6++7>zxx&tqG15pu7)IiiXFflOc2k;dXd>%13GZAy? zRz!q0=|E6a6vV)&ZBS~G9oe0kbqyw1*gvY`{Pop2oKq#FlzgXt@Xh-7fxh>}`Fxg> z$%N%{$!4=5nM{(;=c!aG1Ofr^Do{u%Ih{^&Fc@H2)+a-?TBXrw5DW&z%Nb6mQ!L9O zl}b@6mB?f=tX3;#vl)}ggh(Vpy<UI4WZSj@D3{ArDit(M6QNK@DvH8-y~eg}>h(IK z(Mb0D{l{U$FsRjP;!{($+bsaaVi8T#1c0V#qEIOCYa9@UVLV`f__E81L;?WEaRA;Y zUH;rZ;vb;mk7JX|<p3Cu$C##x>$=i3O~&If0O@oZfLg8gfIjW=dcBsz;gI=!{-r4# z4%6v$&~;q^j7Fo67yJ(NJWuX+I~I!tj^nW3?}^9bq|<3^+vapS5sgM^x7!cs(+mMT z&y%j};&~po+YO)3hoUH4E*E;e9>?R6SS&`X)p`njycAVcg{rEb41T{~Hk(bl-7eSb zmFxA2uIqo#@R?lKm50ND`~6Nfn|-b1|L6O98vt3Tx@gKz#isxO002ovPDHLkV1kyW B_l^Jn literal 0 HcmV?d00001 diff --git a/C++/docs/html/search/nomatches.html b/C++/docs/html/search/nomatches.html new file mode 100644 index 0000000..b1ded27 --- /dev/null +++ b/C++/docs/html/search/nomatches.html @@ -0,0 +1,12 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="NoMatches">No Matches</div> +</div> +</body> +</html> diff --git a/C++/docs/html/search/pages_0.html b/C++/docs/html/search/pages_0.html new file mode 100644 index 0000000..d0102ff --- /dev/null +++ b/C++/docs/html/search/pages_0.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="pages_0.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/pages_0.js b/C++/docs/html/search/pages_0.js new file mode 100644 index 0000000..25e9578 --- /dev/null +++ b/C++/docs/html/search/pages_0.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['libxdf',['libxdf',['../md__c_1__users__yida__lin__documents__git_hub_libxdf_libxdf__r_e_a_d_m_e.html',1,'']]] +]; diff --git a/C++/docs/html/search/search.css b/C++/docs/html/search/search.css new file mode 100644 index 0000000..3cf9df9 --- /dev/null +++ b/C++/docs/html/search/search.css @@ -0,0 +1,271 @@ +/*---------------- Search Box */ + +#FSearchBox { + float: left; +} + +#MSearchBox { + white-space : nowrap; + float: none; + margin-top: 8px; + right: 0px; + width: 170px; + height: 24px; + z-index: 102; +} + +#MSearchBox .left +{ + display:block; + position:absolute; + left:10px; + width:20px; + height:19px; + background:url('search_l.png') no-repeat; + background-position:right; +} + +#MSearchSelect { + display:block; + position:absolute; + width:20px; + height:19px; +} + +.left #MSearchSelect { + left:4px; +} + +.right #MSearchSelect { + right:5px; +} + +#MSearchField { + display:block; + position:absolute; + height:19px; + background:url('search_m.png') repeat-x; + border:none; + width:115px; + margin-left:20px; + padding-left:4px; + color: #909090; + outline: none; + font: 9pt Arial, Verdana, sans-serif; + -webkit-border-radius: 0px; +} + +#FSearchBox #MSearchField { + margin-left:15px; +} + +#MSearchBox .right { + display:block; + position:absolute; + right:10px; + top:8px; + width:20px; + height:19px; + background:url('search_r.png') no-repeat; + background-position:left; +} + +#MSearchClose { + display: none; + position: absolute; + top: 4px; + background : none; + border: none; + margin: 0px 4px 0px 0px; + padding: 0px 0px; + outline: none; +} + +.left #MSearchClose { + left: 6px; +} + +.right #MSearchClose { + right: 2px; +} + +.MSearchBoxActive #MSearchField { + color: #000000; +} + +/*---------------- Search filter selection */ + +#MSearchSelectWindow { + display: none; + position: absolute; + left: 0; top: 0; + border: 1px solid #90A5CE; + background-color: #F9FAFC; + z-index: 10001; + padding-top: 4px; + padding-bottom: 4px; + -moz-border-radius: 4px; + -webkit-border-top-left-radius: 4px; + -webkit-border-top-right-radius: 4px; + -webkit-border-bottom-left-radius: 4px; + -webkit-border-bottom-right-radius: 4px; + -webkit-box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15); +} + +.SelectItem { + font: 8pt Arial, Verdana, sans-serif; + padding-left: 2px; + padding-right: 12px; + border: 0px; +} + +span.SelectionMark { + margin-right: 4px; + font-family: monospace; + outline-style: none; + text-decoration: none; +} + +a.SelectItem { + display: block; + outline-style: none; + color: #000000; + text-decoration: none; + padding-left: 6px; + padding-right: 12px; +} + +a.SelectItem:focus, +a.SelectItem:active { + color: #000000; + outline-style: none; + text-decoration: none; +} + +a.SelectItem:hover { + color: #FFFFFF; + background-color: #3D578C; + outline-style: none; + text-decoration: none; + cursor: pointer; + display: block; +} + +/*---------------- Search results window */ + +iframe#MSearchResults { + width: 60ex; + height: 15em; +} + +#MSearchResultsWindow { + display: none; + position: absolute; + left: 0; top: 0; + border: 1px solid #000; + background-color: #EEF1F7; + z-index:10000; +} + +/* ----------------------------------- */ + + +#SRIndex { + clear:both; + padding-bottom: 15px; +} + +.SREntry { + font-size: 10pt; + padding-left: 1ex; +} + +.SRPage .SREntry { + font-size: 8pt; + padding: 1px 5px; +} + +body.SRPage { + margin: 5px 2px; +} + +.SRChildren { + padding-left: 3ex; padding-bottom: .5em +} + +.SRPage .SRChildren { + display: none; +} + +.SRSymbol { + font-weight: bold; + color: #425E97; + font-family: Arial, Verdana, sans-serif; + text-decoration: none; + outline: none; +} + +a.SRScope { + display: block; + color: #425E97; + font-family: Arial, Verdana, sans-serif; + text-decoration: none; + outline: none; +} + +a.SRSymbol:focus, a.SRSymbol:active, +a.SRScope:focus, a.SRScope:active { + text-decoration: underline; +} + +span.SRScope { + padding-left: 4px; +} + +.SRPage .SRStatus { + padding: 2px 5px; + font-size: 8pt; + font-style: italic; +} + +.SRResult { + display: none; +} + +DIV.searchresults { + margin-left: 10px; + margin-right: 10px; +} + +/*---------------- External search page results */ + +.searchresult { + background-color: #F0F3F8; +} + +.pages b { + color: white; + padding: 5px 5px 3px 5px; + background-image: url("../tab_a.png"); + background-repeat: repeat-x; + text-shadow: 0 1px 1px #000000; +} + +.pages { + line-height: 17px; + margin-left: 4px; + text-decoration: none; +} + +.hl { + font-weight: bold; +} + +#searchresults { + margin-bottom: 20px; +} + +.searchpages { + margin-top: 10px; +} + diff --git a/C++/docs/html/search/search.js b/C++/docs/html/search/search.js new file mode 100644 index 0000000..dedce3b --- /dev/null +++ b/C++/docs/html/search/search.js @@ -0,0 +1,791 @@ +function convertToId(search) +{ + var result = ''; + for (i=0;i<search.length;i++) + { + var c = search.charAt(i); + var cn = c.charCodeAt(0); + if (c.match(/[a-z0-9\u0080-\uFFFF]/)) + { + result+=c; + } + else if (cn<16) + { + result+="_0"+cn.toString(16); + } + else + { + result+="_"+cn.toString(16); + } + } + return result; +} + +function getXPos(item) +{ + var x = 0; + if (item.offsetWidth) + { + while (item && item!=document.body) + { + x += item.offsetLeft; + item = item.offsetParent; + } + } + return x; +} + +function getYPos(item) +{ + var y = 0; + if (item.offsetWidth) + { + while (item && item!=document.body) + { + y += item.offsetTop; + item = item.offsetParent; + } + } + return y; +} + +/* A class handling everything associated with the search panel. + + Parameters: + name - The name of the global variable that will be + storing this instance. Is needed to be able to set timeouts. + resultPath - path to use for external files +*/ +function SearchBox(name, resultsPath, inFrame, label) +{ + if (!name || !resultsPath) { alert("Missing parameters to SearchBox."); } + + // ---------- Instance variables + this.name = name; + this.resultsPath = resultsPath; + this.keyTimeout = 0; + this.keyTimeoutLength = 500; + this.closeSelectionTimeout = 300; + this.lastSearchValue = ""; + this.lastResultsPage = ""; + this.hideTimeout = 0; + this.searchIndex = 0; + this.searchActive = false; + this.insideFrame = inFrame; + this.searchLabel = label; + + // ----------- DOM Elements + + this.DOMSearchField = function() + { return document.getElementById("MSearchField"); } + + this.DOMSearchSelect = function() + { return document.getElementById("MSearchSelect"); } + + this.DOMSearchSelectWindow = function() + { return document.getElementById("MSearchSelectWindow"); } + + this.DOMPopupSearchResults = function() + { return document.getElementById("MSearchResults"); } + + this.DOMPopupSearchResultsWindow = function() + { return document.getElementById("MSearchResultsWindow"); } + + this.DOMSearchClose = function() + { return document.getElementById("MSearchClose"); } + + this.DOMSearchBox = function() + { return document.getElementById("MSearchBox"); } + + // ------------ Event Handlers + + // Called when focus is added or removed from the search field. + this.OnSearchFieldFocus = function(isActive) + { + this.Activate(isActive); + } + + this.OnSearchSelectShow = function() + { + var searchSelectWindow = this.DOMSearchSelectWindow(); + var searchField = this.DOMSearchSelect(); + + if (this.insideFrame) + { + var left = getXPos(searchField); + var top = getYPos(searchField); + left += searchField.offsetWidth + 6; + top += searchField.offsetHeight; + + // show search selection popup + searchSelectWindow.style.display='block'; + left -= searchSelectWindow.offsetWidth; + searchSelectWindow.style.left = left + 'px'; + searchSelectWindow.style.top = top + 'px'; + } + else + { + var left = getXPos(searchField); + var top = getYPos(searchField); + top += searchField.offsetHeight; + + // show search selection popup + searchSelectWindow.style.display='block'; + searchSelectWindow.style.left = left + 'px'; + searchSelectWindow.style.top = top + 'px'; + } + + // stop selection hide timer + if (this.hideTimeout) + { + clearTimeout(this.hideTimeout); + this.hideTimeout=0; + } + return false; // to avoid "image drag" default event + } + + this.OnSearchSelectHide = function() + { + this.hideTimeout = setTimeout(this.name +".CloseSelectionWindow()", + this.closeSelectionTimeout); + } + + // Called when the content of the search field is changed. + this.OnSearchFieldChange = function(evt) + { + if (this.keyTimeout) // kill running timer + { + clearTimeout(this.keyTimeout); + this.keyTimeout = 0; + } + + var e = (evt) ? evt : window.event; // for IE + if (e.keyCode==40 || e.keyCode==13) + { + if (e.shiftKey==1) + { + this.OnSearchSelectShow(); + var win=this.DOMSearchSelectWindow(); + for (i=0;i<win.childNodes.length;i++) + { + var child = win.childNodes[i]; // get span within a + if (child.className=='SelectItem') + { + child.focus(); + return; + } + } + return; + } + else if (window.frames.MSearchResults.searchResults) + { + var elem = window.frames.MSearchResults.searchResults.NavNext(0); + if (elem) elem.focus(); + } + } + else if (e.keyCode==27) // Escape out of the search field + { + this.DOMSearchField().blur(); + this.DOMPopupSearchResultsWindow().style.display = 'none'; + this.DOMSearchClose().style.display = 'none'; + this.lastSearchValue = ''; + this.Activate(false); + return; + } + + // strip whitespaces + var searchValue = this.DOMSearchField().value.replace(/ +/g, ""); + + if (searchValue != this.lastSearchValue) // search value has changed + { + if (searchValue != "") // non-empty search + { + // set timer for search update + this.keyTimeout = setTimeout(this.name + '.Search()', + this.keyTimeoutLength); + } + else // empty search field + { + this.DOMPopupSearchResultsWindow().style.display = 'none'; + this.DOMSearchClose().style.display = 'none'; + this.lastSearchValue = ''; + } + } + } + + this.SelectItemCount = function(id) + { + var count=0; + var win=this.DOMSearchSelectWindow(); + for (i=0;i<win.childNodes.length;i++) + { + var child = win.childNodes[i]; // get span within a + if (child.className=='SelectItem') + { + count++; + } + } + return count; + } + + this.SelectItemSet = function(id) + { + var i,j=0; + var win=this.DOMSearchSelectWindow(); + for (i=0;i<win.childNodes.length;i++) + { + var child = win.childNodes[i]; // get span within a + if (child.className=='SelectItem') + { + var node = child.firstChild; + if (j==id) + { + node.innerHTML='•'; + } + else + { + node.innerHTML=' '; + } + j++; + } + } + } + + // Called when an search filter selection is made. + // set item with index id as the active item + this.OnSelectItem = function(id) + { + this.searchIndex = id; + this.SelectItemSet(id); + var searchValue = this.DOMSearchField().value.replace(/ +/g, ""); + if (searchValue!="" && this.searchActive) // something was found -> do a search + { + this.Search(); + } + } + + this.OnSearchSelectKey = function(evt) + { + var e = (evt) ? evt : window.event; // for IE + if (e.keyCode==40 && this.searchIndex<this.SelectItemCount()) // Down + { + this.searchIndex++; + this.OnSelectItem(this.searchIndex); + } + else if (e.keyCode==38 && this.searchIndex>0) // Up + { + this.searchIndex--; + this.OnSelectItem(this.searchIndex); + } + else if (e.keyCode==13 || e.keyCode==27) + { + this.OnSelectItem(this.searchIndex); + this.CloseSelectionWindow(); + this.DOMSearchField().focus(); + } + return false; + } + + // --------- Actions + + // Closes the results window. + this.CloseResultsWindow = function() + { + this.DOMPopupSearchResultsWindow().style.display = 'none'; + this.DOMSearchClose().style.display = 'none'; + this.Activate(false); + } + + this.CloseSelectionWindow = function() + { + this.DOMSearchSelectWindow().style.display = 'none'; + } + + // Performs a search. + this.Search = function() + { + this.keyTimeout = 0; + + // strip leading whitespace + var searchValue = this.DOMSearchField().value.replace(/^ +/, ""); + + var code = searchValue.toLowerCase().charCodeAt(0); + var idxChar = searchValue.substr(0, 1).toLowerCase(); + if ( 0xD800 <= code && code <= 0xDBFF && searchValue > 1) // surrogate pair + { + idxChar = searchValue.substr(0, 2); + } + + var resultsPage; + var resultsPageWithSearch; + var hasResultsPage; + + var idx = indexSectionsWithContent[this.searchIndex].indexOf(idxChar); + if (idx!=-1) + { + var hexCode=idx.toString(16); + resultsPage = this.resultsPath + '/' + indexSectionNames[this.searchIndex] + '_' + hexCode + '.html'; + resultsPageWithSearch = resultsPage+'?'+escape(searchValue); + hasResultsPage = true; + } + else // nothing available for this search term + { + resultsPage = this.resultsPath + '/nomatches.html'; + resultsPageWithSearch = resultsPage; + hasResultsPage = false; + } + + window.frames.MSearchResults.location = resultsPageWithSearch; + var domPopupSearchResultsWindow = this.DOMPopupSearchResultsWindow(); + + if (domPopupSearchResultsWindow.style.display!='block') + { + var domSearchBox = this.DOMSearchBox(); + this.DOMSearchClose().style.display = 'inline'; + if (this.insideFrame) + { + var domPopupSearchResults = this.DOMPopupSearchResults(); + domPopupSearchResultsWindow.style.position = 'relative'; + domPopupSearchResultsWindow.style.display = 'block'; + var width = document.body.clientWidth - 8; // the -8 is for IE :-( + domPopupSearchResultsWindow.style.width = width + 'px'; + domPopupSearchResults.style.width = width + 'px'; + } + else + { + var domPopupSearchResults = this.DOMPopupSearchResults(); + var left = getXPos(domSearchBox) + 150; // domSearchBox.offsetWidth; + var top = getYPos(domSearchBox) + 20; // domSearchBox.offsetHeight + 1; + domPopupSearchResultsWindow.style.display = 'block'; + left -= domPopupSearchResults.offsetWidth; + domPopupSearchResultsWindow.style.top = top + 'px'; + domPopupSearchResultsWindow.style.left = left + 'px'; + } + } + + this.lastSearchValue = searchValue; + this.lastResultsPage = resultsPage; + } + + // -------- Activation Functions + + // Activates or deactivates the search panel, resetting things to + // their default values if necessary. + this.Activate = function(isActive) + { + if (isActive || // open it + this.DOMPopupSearchResultsWindow().style.display == 'block' + ) + { + this.DOMSearchBox().className = 'MSearchBoxActive'; + + var searchField = this.DOMSearchField(); + + if (searchField.value == this.searchLabel) // clear "Search" term upon entry + { + searchField.value = ''; + this.searchActive = true; + } + } + else if (!isActive) // directly remove the panel + { + this.DOMSearchBox().className = 'MSearchBoxInactive'; + this.DOMSearchField().value = this.searchLabel; + this.searchActive = false; + this.lastSearchValue = '' + this.lastResultsPage = ''; + } + } +} + +// ----------------------------------------------------------------------- + +// The class that handles everything on the search results page. +function SearchResults(name) +{ + // The number of matches from the last run of <Search()>. + this.lastMatchCount = 0; + this.lastKey = 0; + this.repeatOn = false; + + // Toggles the visibility of the passed element ID. + this.FindChildElement = function(id) + { + var parentElement = document.getElementById(id); + var element = parentElement.firstChild; + + while (element && element!=parentElement) + { + if (element.nodeName == 'DIV' && element.className == 'SRChildren') + { + return element; + } + + if (element.nodeName == 'DIV' && element.hasChildNodes()) + { + element = element.firstChild; + } + else if (element.nextSibling) + { + element = element.nextSibling; + } + else + { + do + { + element = element.parentNode; + } + while (element && element!=parentElement && !element.nextSibling); + + if (element && element!=parentElement) + { + element = element.nextSibling; + } + } + } + } + + this.Toggle = function(id) + { + var element = this.FindChildElement(id); + if (element) + { + if (element.style.display == 'block') + { + element.style.display = 'none'; + } + else + { + element.style.display = 'block'; + } + } + } + + // Searches for the passed string. If there is no parameter, + // it takes it from the URL query. + // + // Always returns true, since other documents may try to call it + // and that may or may not be possible. + this.Search = function(search) + { + if (!search) // get search word from URL + { + search = window.location.search; + search = search.substring(1); // Remove the leading '?' + search = unescape(search); + } + + search = search.replace(/^ +/, ""); // strip leading spaces + search = search.replace(/ +$/, ""); // strip trailing spaces + search = search.toLowerCase(); + search = convertToId(search); + + var resultRows = document.getElementsByTagName("div"); + var matches = 0; + + var i = 0; + while (i < resultRows.length) + { + var row = resultRows.item(i); + if (row.className == "SRResult") + { + var rowMatchName = row.id.toLowerCase(); + rowMatchName = rowMatchName.replace(/^sr\d*_/, ''); // strip 'sr123_' + + if (search.length<=rowMatchName.length && + rowMatchName.substr(0, search.length)==search) + { + row.style.display = 'block'; + matches++; + } + else + { + row.style.display = 'none'; + } + } + i++; + } + document.getElementById("Searching").style.display='none'; + if (matches == 0) // no results + { + document.getElementById("NoMatches").style.display='block'; + } + else // at least one result + { + document.getElementById("NoMatches").style.display='none'; + } + this.lastMatchCount = matches; + return true; + } + + // return the first item with index index or higher that is visible + this.NavNext = function(index) + { + var focusItem; + while (1) + { + var focusName = 'Item'+index; + focusItem = document.getElementById(focusName); + if (focusItem && focusItem.parentNode.parentNode.style.display=='block') + { + break; + } + else if (!focusItem) // last element + { + break; + } + focusItem=null; + index++; + } + return focusItem; + } + + this.NavPrev = function(index) + { + var focusItem; + while (1) + { + var focusName = 'Item'+index; + focusItem = document.getElementById(focusName); + if (focusItem && focusItem.parentNode.parentNode.style.display=='block') + { + break; + } + else if (!focusItem) // last element + { + break; + } + focusItem=null; + index--; + } + return focusItem; + } + + this.ProcessKeys = function(e) + { + if (e.type == "keydown") + { + this.repeatOn = false; + this.lastKey = e.keyCode; + } + else if (e.type == "keypress") + { + if (!this.repeatOn) + { + if (this.lastKey) this.repeatOn = true; + return false; // ignore first keypress after keydown + } + } + else if (e.type == "keyup") + { + this.lastKey = 0; + this.repeatOn = false; + } + return this.lastKey!=0; + } + + this.Nav = function(evt,itemIndex) + { + var e = (evt) ? evt : window.event; // for IE + if (e.keyCode==13) return true; + if (!this.ProcessKeys(e)) return false; + + if (this.lastKey==38) // Up + { + var newIndex = itemIndex-1; + var focusItem = this.NavPrev(newIndex); + if (focusItem) + { + var child = this.FindChildElement(focusItem.parentNode.parentNode.id); + if (child && child.style.display == 'block') // children visible + { + var n=0; + var tmpElem; + while (1) // search for last child + { + tmpElem = document.getElementById('Item'+newIndex+'_c'+n); + if (tmpElem) + { + focusItem = tmpElem; + } + else // found it! + { + break; + } + n++; + } + } + } + if (focusItem) + { + focusItem.focus(); + } + else // return focus to search field + { + parent.document.getElementById("MSearchField").focus(); + } + } + else if (this.lastKey==40) // Down + { + var newIndex = itemIndex+1; + var focusItem; + var item = document.getElementById('Item'+itemIndex); + var elem = this.FindChildElement(item.parentNode.parentNode.id); + if (elem && elem.style.display == 'block') // children visible + { + focusItem = document.getElementById('Item'+itemIndex+'_c0'); + } + if (!focusItem) focusItem = this.NavNext(newIndex); + if (focusItem) focusItem.focus(); + } + else if (this.lastKey==39) // Right + { + var item = document.getElementById('Item'+itemIndex); + var elem = this.FindChildElement(item.parentNode.parentNode.id); + if (elem) elem.style.display = 'block'; + } + else if (this.lastKey==37) // Left + { + var item = document.getElementById('Item'+itemIndex); + var elem = this.FindChildElement(item.parentNode.parentNode.id); + if (elem) elem.style.display = 'none'; + } + else if (this.lastKey==27) // Escape + { + parent.searchBox.CloseResultsWindow(); + parent.document.getElementById("MSearchField").focus(); + } + else if (this.lastKey==13) // Enter + { + return true; + } + return false; + } + + this.NavChild = function(evt,itemIndex,childIndex) + { + var e = (evt) ? evt : window.event; // for IE + if (e.keyCode==13) return true; + if (!this.ProcessKeys(e)) return false; + + if (this.lastKey==38) // Up + { + if (childIndex>0) + { + var newIndex = childIndex-1; + document.getElementById('Item'+itemIndex+'_c'+newIndex).focus(); + } + else // already at first child, jump to parent + { + document.getElementById('Item'+itemIndex).focus(); + } + } + else if (this.lastKey==40) // Down + { + var newIndex = childIndex+1; + var elem = document.getElementById('Item'+itemIndex+'_c'+newIndex); + if (!elem) // last child, jump to parent next parent + { + elem = this.NavNext(itemIndex+1); + } + if (elem) + { + elem.focus(); + } + } + else if (this.lastKey==27) // Escape + { + parent.searchBox.CloseResultsWindow(); + parent.document.getElementById("MSearchField").focus(); + } + else if (this.lastKey==13) // Enter + { + return true; + } + return false; + } +} + +function setKeyActions(elem,action) +{ + elem.setAttribute('onkeydown',action); + elem.setAttribute('onkeypress',action); + elem.setAttribute('onkeyup',action); +} + +function setClassAttr(elem,attr) +{ + elem.setAttribute('class',attr); + elem.setAttribute('className',attr); +} + +function createResults() +{ + var results = document.getElementById("SRResults"); + for (var e=0; e<searchData.length; e++) + { + var id = searchData[e][0]; + var srResult = document.createElement('div'); + srResult.setAttribute('id','SR_'+id); + setClassAttr(srResult,'SRResult'); + var srEntry = document.createElement('div'); + setClassAttr(srEntry,'SREntry'); + var srLink = document.createElement('a'); + srLink.setAttribute('id','Item'+e); + setKeyActions(srLink,'return searchResults.Nav(event,'+e+')'); + setClassAttr(srLink,'SRSymbol'); + srLink.innerHTML = searchData[e][1][0]; + srEntry.appendChild(srLink); + if (searchData[e][1].length==2) // single result + { + srLink.setAttribute('href',searchData[e][1][1][0]); + if (searchData[e][1][1][1]) + { + srLink.setAttribute('target','_parent'); + } + var srScope = document.createElement('span'); + setClassAttr(srScope,'SRScope'); + srScope.innerHTML = searchData[e][1][1][2]; + srEntry.appendChild(srScope); + } + else // multiple results + { + srLink.setAttribute('href','javascript:searchResults.Toggle("SR_'+id+'")'); + var srChildren = document.createElement('div'); + setClassAttr(srChildren,'SRChildren'); + for (var c=0; c<searchData[e][1].length-1; c++) + { + var srChild = document.createElement('a'); + srChild.setAttribute('id','Item'+e+'_c'+c); + setKeyActions(srChild,'return searchResults.NavChild(event,'+e+','+c+')'); + setClassAttr(srChild,'SRScope'); + srChild.setAttribute('href',searchData[e][1][c+1][0]); + if (searchData[e][1][c+1][1]) + { + srChild.setAttribute('target','_parent'); + } + srChild.innerHTML = searchData[e][1][c+1][2]; + srChildren.appendChild(srChild); + } + srEntry.appendChild(srChildren); + } + srResult.appendChild(srEntry); + results.appendChild(srResult); + } +} + +function init_search() +{ + var results = document.getElementById("MSearchSelectWindow"); + for (var key in indexSectionLabels) + { + var link = document.createElement('a'); + link.setAttribute('class','SelectItem'); + link.setAttribute('onclick','searchBox.OnSelectItem('+key+')'); + link.href='javascript:void(0)'; + link.innerHTML='<span class="SelectionMark"> </span>'+indexSectionLabels[key]; + results.appendChild(link); + } + searchBox.OnSelectItem(0); +} + diff --git a/C++/docs/html/search/search_l.png b/C++/docs/html/search/search_l.png new file mode 100644 index 0000000000000000000000000000000000000000..c872f4da4a01d0754f923e6c94fd8159c0621bd1 GIT binary patch literal 604 zcmV-i0;BzjP)<h;3K|Lk000e1NJLTq000yK000vR1^@s6kc=(000009a7bBm000XU z000XU0RWnu7ytkOAY({UO#lFGm;eBCjsO7QH~;{G)c^o`2LJ%dv;Y7zL;wIBc7!%6 zy#N3K;z>k7RCwB~R6VQOP#AvB$vH7i{6H{96zot$7cZT<7246EF5Np6N}+$IbiG6W zg#87A+NFaX+=_^xM1#gCtshC=E{%9^uQX_%?YwXvo{#q&MnpJ8uh(O?ZRc&<Zo01f zZnN3kY`5D4=NybN{0l51>~_1%^SsPxG<xm2?uTqPdy~uML^_>@rfE<VB|c%N(_!=Z z{K<GczSVX8d8JYjrfDLTN<q^!2qC~2i$y2^V6|GMCzHviVzKzLTCF0V&%-bbNGZWN zM_juAAlmIVpH8Q*Ow)W(uh(H&7Ia;QloFRfEEWrsh~Cy}HQll-7={5M1TF>lJg-?U zm!Cz-IOn(qJP3kDp-^~qt+FGbl=5jNli^Wj_xIBG{Rc0en{!oFvyoNC7{V~T8}b>| z=jL2WIR<cCi@57?)-n-w_WS+O>eZzX(YN(_9fV;BBD$VXQIxNa<NVz1cK9FQiA3VZ za=HBOI1YT@KU%-vc5K2%qwy;Ug4^M6=qwfs1VI2Iy0{$vX9d1^p7(h$7>sAL8AT<X zQ%OWP91b`w^UiMrU@3(7=y{&o@Au!AN~OoqQ&d$IQp&#+3n3nihn*f;t(E{#C!#m1 qsx}S7C?=Chp=p}JIggdW?*RZc<<(x$?F{_@0000<MNUMnLSTX?9|#Tr literal 0 HcmV?d00001 diff --git a/C++/docs/html/search/search_m.png b/C++/docs/html/search/search_m.png new file mode 100644 index 0000000000000000000000000000000000000000..b429a16ba641960da1e52e5da85dc80fd82635c8 GIT binary patch literal 158 zcmeAS@N?(olHy`uVBq!ia0vp^Oh7Em0U}M~ynTTbOS+@4BLl;=8&~`zjDUQ}64!{5 z;QX|b^2DN42FH~Aq*MjZ+{E<Mpwz^a%EFVWHb6xNo-U3d6}OUf^!3vd5)y3c{#bPU z`teb@<JbTH_7jql7?`61bOfX$^6u_pUBbY`!?2W{-=^-N>vEu822WQ%mvv4FO#qs` BFGc_W literal 0 HcmV?d00001 diff --git a/C++/docs/html/search/search_r.png b/C++/docs/html/search/search_r.png new file mode 100644 index 0000000000000000000000000000000000000000..97ee8b439687084201b79c6f776a41f495c6392a GIT binary patch literal 612 zcmV-q0-ODbP)<h;3K|Lk000e1NJLTq000sI000vR1^@s6oswPh00009a7bBm000XU z000XU0RWnu7ytkOAY({UO#lFGm;eBCjsO7QH~;{G)c^o`2LJ%dv;Y7zL;wIBc7!%6 zy#N3K>PbXFRCwB?)W514K@<k?Z}y+E3TvfSi=>j&X?z2*SxFI6-@HT2E2K=9X9%Pb zEK*!TBw&g(DMC;|A)uGlRkOS9vd-?zNs%bR4d$w+ox_iFnE8fvIvv7^5<(>Te12Li z7C)9srCzmK{ZcNM{YIl9j{DePFgOWiS%xG@5CnnnJa4nvY<^glbz7^|-ZY!dUkAwd z{gaTC@_>b5h~;ug<MCL=as0uy?dOi;gaE*#lqVq~f|L?cN~CFuD2lLHEHE4nh3mTS zYqi=<tJR7$#@Hzbj4>#R0wRL0>o5!hxm*s0VW?8dr}O#zXTRTnrQm_Z7z1Mrnx>&p zD4<fQpkA+Q0A8%u>qifUjzLvbVVWi?l?rUzwt^sdb~d!f_LEhsRVIXZtQ=qSxuxqm zEX#tf>$?M_Y1-LSDT)HqG?`%-%ZpY!#{N!rcNIiL;G7F0`l?)mNGTD9;f9F5Up3Kg zw}a<-JylhG&;=!>B+fZaCX+?C+kHYrP%c?X2!Zu_olK|GcS4A70HEy;vn)I0>0kLH z`jc(WIaaHc7!HS@f*^R^Znx8W=_jIl2oWJoQ*h1^$FX!>*PqR1J<j<{$8qis?{G94 y;eY>8k|fw}w_y}TpE>7m8DqDO<3z`OzXt$ccSejbEZCg@0000<MNUMnLSTZ*_y_g? literal 0 HcmV?d00001 diff --git a/C++/docs/html/search/searchdata.js b/C++/docs/html/search/searchdata.js new file mode 100644 index 0000000..3ca3a76 --- /dev/null +++ b/C++/docs/html/search/searchdata.js @@ -0,0 +1,36 @@ +var indexSectionsWithContent = +{ + 0: "abcdefilmnorstuvwx", + 1: "sx", + 2: "rx", + 3: "acdflrwx", + 4: "cdefilmnostuv", + 5: "e", + 6: "b", + 7: "l" +}; + +var indexSectionNames = +{ + 0: "all", + 1: "classes", + 2: "files", + 3: "functions", + 4: "variables", + 5: "typedefs", + 6: "defines", + 7: "pages" +}; + +var indexSectionLabels = +{ + 0: "All", + 1: "Classes", + 2: "Files", + 3: "Functions", + 4: "Variables", + 5: "Typedefs", + 6: "Macros", + 7: "Pages" +}; + diff --git a/C++/docs/html/search/typedefs_0.html b/C++/docs/html/search/typedefs_0.html new file mode 100644 index 0000000..3a58062 --- /dev/null +++ b/C++/docs/html/search/typedefs_0.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="typedefs_0.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/typedefs_0.js b/C++/docs/html/search/typedefs_0.js new file mode 100644 index 0000000..8a339a1 --- /dev/null +++ b/C++/docs/html/search/typedefs_0.js @@ -0,0 +1,5 @@ +var searchData= +[ + ['eventname',['eventName',['../class_xdf.html#a4e3322abfe4d533d6b7a96cbbea7271a',1,'Xdf']]], + ['eventtimestamp',['eventTimeStamp',['../class_xdf.html#a1fbf3d641262cc1daade33eca1789990',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/variables_0.html b/C++/docs/html/search/variables_0.html new file mode 100644 index 0000000..164aa54 --- /dev/null +++ b/C++/docs/html/search/variables_0.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="variables_0.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/variables_0.js b/C++/docs/html/search/variables_0.js new file mode 100644 index 0000000..5e0ccf2 --- /dev/null +++ b/C++/docs/html/search/variables_0.js @@ -0,0 +1,9 @@ +var searchData= +[ + ['channel_5fcount',['channel_count',['../struct_xdf_1_1_stream.html#ab8fb7c3d645305e84f90d919f698082c',1,'Xdf::Stream']]], + ['channel_5fformat',['channel_format',['../struct_xdf_1_1_stream.html#ad7b61b077e247ba57a18c182e285d0ad',1,'Xdf::Stream']]], + ['channels',['channels',['../struct_xdf_1_1_stream.html#a71d987a538d0819cdbd58120d1a79ef5',1,'Xdf::Stream']]], + ['clock_5foffsets',['clock_offsets',['../struct_xdf_1_1_stream.html#a6f6328f0746591a3a471048b6b9bd258',1,'Xdf::Stream']]], + ['clock_5ftimes',['clock_times',['../struct_xdf_1_1_stream.html#a6bc91dcf23e551a9adbc415b562f3a79',1,'Xdf::Stream']]], + ['clock_5fvalues',['clock_values',['../struct_xdf_1_1_stream.html#a988989603854812cb693e56ff352a753',1,'Xdf::Stream']]] +]; diff --git a/C++/docs/html/search/variables_1.html b/C++/docs/html/search/variables_1.html new file mode 100644 index 0000000..857fbbd --- /dev/null +++ b/C++/docs/html/search/variables_1.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="variables_1.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/variables_1.js b/C++/docs/html/search/variables_1.js new file mode 100644 index 0000000..f2ae8ee --- /dev/null +++ b/C++/docs/html/search/variables_1.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['dictionary',['dictionary',['../class_xdf.html#a26a2b517f020dc9f188c2277c76add85',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/variables_2.html b/C++/docs/html/search/variables_2.html new file mode 100644 index 0000000..35233e3 --- /dev/null +++ b/C++/docs/html/search/variables_2.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="variables_2.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/variables_2.js b/C++/docs/html/search/variables_2.js new file mode 100644 index 0000000..19ed5b6 --- /dev/null +++ b/C++/docs/html/search/variables_2.js @@ -0,0 +1,6 @@ +var searchData= +[ + ['effective_5fsample_5frate',['effective_sample_rate',['../struct_xdf_1_1_stream.html#abeb1d2eb26a46eac34a478f04f5143d6',1,'Xdf::Stream']]], + ['eventmap',['eventMap',['../class_xdf.html#a45004fc495cad33768fae80b996a68db',1,'Xdf']]], + ['eventtype',['eventType',['../class_xdf.html#a4acb87e86380bf7266976cd6c4cb3826',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/variables_3.html b/C++/docs/html/search/variables_3.html new file mode 100644 index 0000000..e45e613 --- /dev/null +++ b/C++/docs/html/search/variables_3.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="variables_3.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/variables_3.js b/C++/docs/html/search/variables_3.js new file mode 100644 index 0000000..792c548 --- /dev/null +++ b/C++/docs/html/search/variables_3.js @@ -0,0 +1,5 @@ +var searchData= +[ + ['fileheader',['fileHeader',['../class_xdf.html#a1e46bbbf31121fb394aa8cf5c10d10b0',1,'Xdf']]], + ['first_5ftimestamp',['first_timestamp',['../struct_xdf_1_1_stream.html#a22a44cb3cd533ea668f9bb20dbc299de',1,'Xdf::Stream']]] +]; diff --git a/C++/docs/html/search/variables_4.html b/C++/docs/html/search/variables_4.html new file mode 100644 index 0000000..97ec255 --- /dev/null +++ b/C++/docs/html/search/variables_4.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="variables_4.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/variables_4.js b/C++/docs/html/search/variables_4.js new file mode 100644 index 0000000..136d71c --- /dev/null +++ b/C++/docs/html/search/variables_4.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['info',['info',['../struct_xdf_1_1_stream.html#a732d62cf3216a3bd4990625b0eb723cf',1,'Xdf::Stream']]] +]; diff --git a/C++/docs/html/search/variables_5.html b/C++/docs/html/search/variables_5.html new file mode 100644 index 0000000..d77fa84 --- /dev/null +++ b/C++/docs/html/search/variables_5.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="variables_5.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/variables_5.js b/C++/docs/html/search/variables_5.js new file mode 100644 index 0000000..54688db --- /dev/null +++ b/C++/docs/html/search/variables_5.js @@ -0,0 +1,5 @@ +var searchData= +[ + ['labels',['labels',['../class_xdf.html#a250d6f79d0333887393eab248fee3c93',1,'Xdf']]], + ['last_5ftimestamp',['last_timestamp',['../struct_xdf_1_1_stream.html#a9e05df342a36187ae492c75f10fc7713',1,'Xdf::Stream::last_timestamp()'],['../struct_xdf_1_1_stream.html#ab61b638cf490354db62fb7da999750cf',1,'Xdf::Stream::last_timestamp()']]] +]; diff --git a/C++/docs/html/search/variables_6.html b/C++/docs/html/search/variables_6.html new file mode 100644 index 0000000..c656bb6 --- /dev/null +++ b/C++/docs/html/search/variables_6.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="variables_6.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/variables_6.js b/C++/docs/html/search/variables_6.js new file mode 100644 index 0000000..1a931e0 --- /dev/null +++ b/C++/docs/html/search/variables_6.js @@ -0,0 +1,8 @@ +var searchData= +[ + ['majsr',['majSR',['../class_xdf.html#ac65175994e0e2eeec4dd2f4688cd2040',1,'Xdf']]], + ['maxsr',['maxSR',['../class_xdf.html#a3cb480731a20caa480e3e6744acb562c',1,'Xdf']]], + ['maxts',['maxTS',['../class_xdf.html#a6874a847c980f296ebbcf703fa48096a',1,'Xdf']]], + ['measured_5fsrate',['measured_srate',['../struct_xdf_1_1_stream.html#a9c1fbac049f7c15225de9fe9713abc0a',1,'Xdf::Stream']]], + ['mints',['minTS',['../class_xdf.html#a44da046e191b2ae90b9bfe4de8d58ea3',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/variables_7.html b/C++/docs/html/search/variables_7.html new file mode 100644 index 0000000..8aac836 --- /dev/null +++ b/C++/docs/html/search/variables_7.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="variables_7.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/variables_7.js b/C++/docs/html/search/variables_7.js new file mode 100644 index 0000000..aee204e --- /dev/null +++ b/C++/docs/html/search/variables_7.js @@ -0,0 +1,5 @@ +var searchData= +[ + ['name',['name',['../struct_xdf_1_1_stream.html#a112e1dcc0e4b7f9583755366da8c3c64',1,'Xdf::Stream']]], + ['nominal_5fsrate',['nominal_srate',['../struct_xdf_1_1_stream.html#a17696fc2ee37c1d79601fac1736deb35',1,'Xdf::Stream']]] +]; diff --git a/C++/docs/html/search/variables_8.html b/C++/docs/html/search/variables_8.html new file mode 100644 index 0000000..a74c6ca --- /dev/null +++ b/C++/docs/html/search/variables_8.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="variables_8.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/variables_8.js b/C++/docs/html/search/variables_8.js new file mode 100644 index 0000000..eaf8cb6 --- /dev/null +++ b/C++/docs/html/search/variables_8.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['offsets',['offsets',['../class_xdf.html#a1a2b080f29080a5c521de907769d9419',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/variables_9.html b/C++/docs/html/search/variables_9.html new file mode 100644 index 0000000..3968526 --- /dev/null +++ b/C++/docs/html/search/variables_9.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="variables_9.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/variables_9.js b/C++/docs/html/search/variables_9.js new file mode 100644 index 0000000..078595c --- /dev/null +++ b/C++/docs/html/search/variables_9.js @@ -0,0 +1,10 @@ +var searchData= +[ + ['sample_5fcount',['sample_count',['../struct_xdf_1_1_stream.html#a329234a46df00cd51a67a7f4f637c08a',1,'Xdf::Stream']]], + ['sampleratemap',['sampleRateMap',['../class_xdf.html#add8aceaf68ad49b708f4df29f439778d',1,'Xdf']]], + ['sampling_5finterval',['sampling_interval',['../struct_xdf_1_1_stream.html#a49bbcb0c3130c3efef27ece47084b327',1,'Xdf::Stream']]], + ['streamfooter',['streamFooter',['../struct_xdf_1_1_stream.html#aecd1fdf80d421e2362eeee58b31d4e11',1,'Xdf::Stream']]], + ['streamheader',['streamHeader',['../struct_xdf_1_1_stream.html#a2dff1924d1f7de075df08c4001201d63',1,'Xdf::Stream']]], + ['streammap',['streamMap',['../class_xdf.html#aa02e5a435186cdabbaf2487068c53dbc',1,'Xdf']]], + ['streams',['streams',['../class_xdf.html#acc12687ca26e8352afb960d459c5947a',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/variables_a.html b/C++/docs/html/search/variables_a.html new file mode 100644 index 0000000..ce54923 --- /dev/null +++ b/C++/docs/html/search/variables_a.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="variables_a.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/variables_a.js b/C++/docs/html/search/variables_a.js new file mode 100644 index 0000000..79c8cc5 --- /dev/null +++ b/C++/docs/html/search/variables_a.js @@ -0,0 +1,8 @@ +var searchData= +[ + ['time_5fseries',['time_series',['../struct_xdf_1_1_stream.html#adfdeb5f6220da9fe671d3f37e27ed0bb',1,'Xdf::Stream']]], + ['time_5fstamps',['time_stamps',['../struct_xdf_1_1_stream.html#a3f05ffb18a1feb56c248c391a69f104b',1,'Xdf::Stream']]], + ['totalch',['totalCh',['../class_xdf.html#a9b4fc485a140ba5020a48ca5fa2e45ea',1,'Xdf']]], + ['totallen',['totalLen',['../class_xdf.html#ac0b5d7d53fb28832594718cc16f65184',1,'Xdf']]], + ['type',['type',['../struct_xdf_1_1_stream.html#a7e5aa085e48de871ea6661651b28e097',1,'Xdf::Stream']]] +]; diff --git a/C++/docs/html/search/variables_b.html b/C++/docs/html/search/variables_b.html new file mode 100644 index 0000000..4825aed --- /dev/null +++ b/C++/docs/html/search/variables_b.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="variables_b.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/variables_b.js b/C++/docs/html/search/variables_b.js new file mode 100644 index 0000000..fc8fdee --- /dev/null +++ b/C++/docs/html/search/variables_b.js @@ -0,0 +1,5 @@ +var searchData= +[ + ['useraddedstream',['userAddedStream',['../class_xdf.html#a83d5309d854b1052fa575b539a69c58d',1,'Xdf']]], + ['usercreatedevents',['userCreatedEvents',['../class_xdf.html#a7b1496a8667d67b90836696a1e2da618',1,'Xdf']]] +]; diff --git a/C++/docs/html/search/variables_c.html b/C++/docs/html/search/variables_c.html new file mode 100644 index 0000000..40b9b9a --- /dev/null +++ b/C++/docs/html/search/variables_c.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="variables_c.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/C++/docs/html/search/variables_c.js b/C++/docs/html/search/variables_c.js new file mode 100644 index 0000000..e683aa5 --- /dev/null +++ b/C++/docs/html/search/variables_c.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['version',['version',['../class_xdf.html#a1d7401eb1557b2f34ac0ff4b9f79d04f',1,'Xdf']]] +]; diff --git a/C++/docs/html/splitbar.png b/C++/docs/html/splitbar.png new file mode 100644 index 0000000000000000000000000000000000000000..fe895f2c58179b471a22d8320b39a4bd7312ec8e GIT binary patch literal 314 zcmeAS@N?(olHy`uVBq!ia0vp^Yzz!63>-{AmhX=Jf(#6djGiuzAr*{o?=JLmPLyc> z_*`QK&+BH@jW<lVxsx`Ym~nPnqw$O~`M84{XS6<Mm0<Zit<Tk``D^RashfFq{wG<# zZG2vRxL<$IhkFMSBd@N1`uRtp)t>rYJ7>r6%keRM@)Qyv8R=enp0jiI>aWlGyB58O zFVR20d+y`K7vDw(hJF3;>dD*3-?v=<8M)@x|E<fHWtM%;-WUJ&>EGLnJsniYK!2U1 Y!`|5biEc?d1`HDhPgg&ebxsLQ02F6;9RL6T literal 0 HcmV?d00001 diff --git a/C++/docs/html/struct_xdf_1_1_stream-members.html b/C++/docs/html/struct_xdf_1_1_stream-members.html new file mode 100644 index 0000000..c931197 --- /dev/null +++ b/C++/docs/html/struct_xdf_1_1_stream-members.html @@ -0,0 +1,123 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>libxdf: Member List</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="navtree.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="resize.js"></script> +<script type="text/javascript" src="navtreedata.js"></script> +<script type="text/javascript" src="navtree.js"></script> +<script type="text/javascript"> + $(document).ready(initResizable); +</script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">libxdf +  <span id="projectnumber">0.92</span> + </div> + <div id="projectbrief">A static C++ library for loading XDF files</div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.12 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<div id="side-nav" class="ui-resizable side-nav-resizable"> + <div id="nav-tree"> + <div id="nav-tree-contents"> + <div id="nav-sync" class="sync"></div> + </div> + </div> + <div id="splitbar" style="-moz-user-select:none;" + class="ui-resizable-handle"> + </div> +</div> +<script type="text/javascript"> +$(document).ready(function(){initNavTree('struct_xdf_1_1_stream.html','');}); +</script> +<div id="doc-content"> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="header"> + <div class="headertitle"> +<div class="title">Xdf::Stream Member List</div> </div> +</div><!--header--> +<div class="contents"> + +<p>This is the complete list of members for <a class="el" href="struct_xdf_1_1_stream.html">Xdf::Stream</a>, including all inherited members.</p> +<table class="directory"> + <tr class="even"><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html#ab8fb7c3d645305e84f90d919f698082c">channel_count</a></td><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html">Xdf::Stream</a></td><td class="entry"></td></tr> + <tr><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html#ad7b61b077e247ba57a18c182e285d0ad">channel_format</a></td><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html">Xdf::Stream</a></td><td class="entry"></td></tr> + <tr class="even"><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html#a71d987a538d0819cdbd58120d1a79ef5">channels</a></td><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html">Xdf::Stream</a></td><td class="entry"></td></tr> + <tr><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html#a6f6328f0746591a3a471048b6b9bd258">clock_offsets</a></td><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html">Xdf::Stream</a></td><td class="entry"></td></tr> + <tr class="even"><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html#a6bc91dcf23e551a9adbc415b562f3a79">clock_times</a></td><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html">Xdf::Stream</a></td><td class="entry"></td></tr> + <tr><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html#a988989603854812cb693e56ff352a753">clock_values</a></td><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html">Xdf::Stream</a></td><td class="entry"></td></tr> + <tr class="even"><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html#abeb1d2eb26a46eac34a478f04f5143d6">effective_sample_rate</a></td><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html">Xdf::Stream</a></td><td class="entry"></td></tr> + <tr><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html#a22a44cb3cd533ea668f9bb20dbc299de">first_timestamp</a></td><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html">Xdf::Stream</a></td><td class="entry"></td></tr> + <tr class="even"><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html#a732d62cf3216a3bd4990625b0eb723cf">info</a></td><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html">Xdf::Stream</a></td><td class="entry"></td></tr> + <tr><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html#a9e05df342a36187ae492c75f10fc7713">last_timestamp</a></td><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html">Xdf::Stream</a></td><td class="entry"></td></tr> + <tr class="even"><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html#ab61b638cf490354db62fb7da999750cf">last_timestamp</a></td><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html">Xdf::Stream</a></td><td class="entry"></td></tr> + <tr><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html#a9c1fbac049f7c15225de9fe9713abc0a">measured_srate</a></td><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html">Xdf::Stream</a></td><td class="entry"></td></tr> + <tr class="even"><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html#a112e1dcc0e4b7f9583755366da8c3c64">name</a></td><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html">Xdf::Stream</a></td><td class="entry"></td></tr> + <tr><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html#a17696fc2ee37c1d79601fac1736deb35">nominal_srate</a></td><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html">Xdf::Stream</a></td><td class="entry"></td></tr> + <tr class="even"><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html#a329234a46df00cd51a67a7f4f637c08a">sample_count</a></td><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html">Xdf::Stream</a></td><td class="entry"></td></tr> + <tr><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html#a49bbcb0c3130c3efef27ece47084b327">sampling_interval</a></td><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html">Xdf::Stream</a></td><td class="entry"></td></tr> + <tr class="even"><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html#aecd1fdf80d421e2362eeee58b31d4e11">streamFooter</a></td><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html">Xdf::Stream</a></td><td class="entry"></td></tr> + <tr><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html#a2dff1924d1f7de075df08c4001201d63">streamHeader</a></td><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html">Xdf::Stream</a></td><td class="entry"></td></tr> + <tr class="even"><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html#adfdeb5f6220da9fe671d3f37e27ed0bb">time_series</a></td><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html">Xdf::Stream</a></td><td class="entry"></td></tr> + <tr><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html#a3f05ffb18a1feb56c248c391a69f104b">time_stamps</a></td><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html">Xdf::Stream</a></td><td class="entry"></td></tr> + <tr class="even"><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html#a7e5aa085e48de871ea6661651b28e097">type</a></td><td class="entry"><a class="el" href="struct_xdf_1_1_stream.html">Xdf::Stream</a></td><td class="entry"></td></tr> +</table></div><!-- contents --> +</div><!-- doc-content --> +<!-- start footer part --> +<div id="nav-path" class="navpath"><!-- id is needed for treeview function! --> + <ul> + <li class="footer">Generated by + <a href="http://www.doxygen.org/index.html"> + <img class="footer" src="doxygen.png" alt="doxygen"/></a> 1.8.12 </li> + </ul> +</div> +</body> +</html> diff --git a/C++/docs/html/struct_xdf_1_1_stream.html b/C++/docs/html/struct_xdf_1_1_stream.html new file mode 100644 index 0000000..688138a --- /dev/null +++ b/C++/docs/html/struct_xdf_1_1_stream.html @@ -0,0 +1,475 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>libxdf: Xdf::Stream Class Reference</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="navtree.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="resize.js"></script> +<script type="text/javascript" src="navtreedata.js"></script> +<script type="text/javascript" src="navtree.js"></script> +<script type="text/javascript"> + $(document).ready(initResizable); +</script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">libxdf +  <span id="projectnumber">0.92</span> + </div> + <div id="projectbrief">A static C++ library for loading XDF files</div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.12 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<div id="side-nav" class="ui-resizable side-nav-resizable"> + <div id="nav-tree"> + <div id="nav-tree-contents"> + <div id="nav-sync" class="sync"></div> + </div> + </div> + <div id="splitbar" style="-moz-user-select:none;" + class="ui-resizable-handle"> + </div> +</div> +<script type="text/javascript"> +$(document).ready(function(){initNavTree('struct_xdf_1_1_stream.html','');}); +</script> +<div id="doc-content"> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="header"> + <div class="summary"> +<a href="#pub-attribs">Public Attributes</a> | +<a href="struct_xdf_1_1_stream-members.html">List of all members</a> </div> + <div class="headertitle"> +<div class="title">Xdf::Stream Class Reference</div> </div> +</div><!--header--> +<div class="contents"> + +<p><code>#include <<a class="el" href="xdf_8h_source.html">xdf.h</a>></code></p> +<table class="memberdecls"> +<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="pub-attribs"></a> +Public Attributes</h2></td></tr> +<tr class="memitem:adfdeb5f6220da9fe671d3f37e27ed0bb"><td class="memItemLeft" align="right" valign="top">std::vector< std::vector< float > > </td><td class="memItemRight" valign="bottom"><a class="el" href="struct_xdf_1_1_stream.html#adfdeb5f6220da9fe671d3f37e27ed0bb">time_series</a></td></tr> +<tr class="memdesc:adfdeb5f6220da9fe671d3f37e27ed0bb"><td class="mdescLeft"> </td><td class="mdescRight">A 2D vector which stores the time series of a stream. Each row represents a channel. <a href="#adfdeb5f6220da9fe671d3f37e27ed0bb">More...</a><br /></td></tr> +<tr class="separator:adfdeb5f6220da9fe671d3f37e27ed0bb"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a3f05ffb18a1feb56c248c391a69f104b"><td class="memItemLeft" align="right" valign="top">std::vector< float > </td><td class="memItemRight" valign="bottom"><a class="el" href="struct_xdf_1_1_stream.html#a3f05ffb18a1feb56c248c391a69f104b">time_stamps</a></td></tr> +<tr class="separator:a3f05ffb18a1feb56c248c391a69f104b"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a2dff1924d1f7de075df08c4001201d63"><td class="memItemLeft" align="right" valign="top">std::string </td><td class="memItemRight" valign="bottom"><a class="el" href="struct_xdf_1_1_stream.html#a2dff1924d1f7de075df08c4001201d63">streamHeader</a></td></tr> +<tr class="separator:a2dff1924d1f7de075df08c4001201d63"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:aecd1fdf80d421e2362eeee58b31d4e11"><td class="memItemLeft" align="right" valign="top">std::string </td><td class="memItemRight" valign="bottom"><a class="el" href="struct_xdf_1_1_stream.html#aecd1fdf80d421e2362eeee58b31d4e11">streamFooter</a></td></tr> +<tr class="separator:aecd1fdf80d421e2362eeee58b31d4e11"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a732d62cf3216a3bd4990625b0eb723cf"><td class="memItemLeft" >struct {</td></tr> +<tr class="memitem:a62b8e68059dc20193131eb228bda816a"><td class="memItemLeft" >   int   <a class="el" href="struct_xdf_1_1_stream.html#ab8fb7c3d645305e84f90d919f698082c">channel_count</a></td></tr> +<tr class="separator:a62b8e68059dc20193131eb228bda816a"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:aeac222dd96684bce5717d2c11e8c50bb"><td class="memItemLeft" >   double   <a class="el" href="struct_xdf_1_1_stream.html#a17696fc2ee37c1d79601fac1736deb35">nominal_srate</a></td></tr> +<tr class="separator:aeac222dd96684bce5717d2c11e8c50bb"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:aea0560d70b4f2ea1ec6f07533d3614c8"><td class="memItemLeft" >   std::string   <a class="el" href="struct_xdf_1_1_stream.html#a112e1dcc0e4b7f9583755366da8c3c64">name</a></td></tr> +<tr class="separator:aea0560d70b4f2ea1ec6f07533d3614c8"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a5c33b7b5e86ec1914c541ca4bd42b731"><td class="memItemLeft" >   std::string   <a class="el" href="struct_xdf_1_1_stream.html#a7e5aa085e48de871ea6661651b28e097">type</a></td></tr> +<tr class="separator:a5c33b7b5e86ec1914c541ca4bd42b731"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:ac8f887e6539a99eeb13bb21d56a532b9"><td class="memItemLeft" >   std::string   <a class="el" href="struct_xdf_1_1_stream.html#ad7b61b077e247ba57a18c182e285d0ad">channel_format</a></td></tr> +<tr class="separator:ac8f887e6539a99eeb13bb21d56a532b9"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a7815c9114cf1a066275f03ab172cd194"><td class="memItemLeft" >   std::vector< std::map< std::string, std::string > >   <a class="el" href="struct_xdf_1_1_stream.html#a71d987a538d0819cdbd58120d1a79ef5">channels</a></td></tr> +<tr class="separator:a7815c9114cf1a066275f03ab172cd194"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:ae5734ffe7ed9e32e465ef933610798f0"><td class="memItemLeft" >   std::vector< std::pair< double, double > >   <a class="el" href="struct_xdf_1_1_stream.html#a6f6328f0746591a3a471048b6b9bd258">clock_offsets</a></td></tr> +<tr class="separator:ae5734ffe7ed9e32e465ef933610798f0"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:ac3fbfe08ef412752eef0aea3d995f258"><td class="memItemLeft" >   double   <a class="el" href="struct_xdf_1_1_stream.html#a22a44cb3cd533ea668f9bb20dbc299de">first_timestamp</a></td></tr> +<tr class="separator:ac3fbfe08ef412752eef0aea3d995f258"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a03a5323361749674438e700afe853b99"><td class="memItemLeft" >   double   <a class="el" href="struct_xdf_1_1_stream.html#a9e05df342a36187ae492c75f10fc7713">last_timestamp</a></td></tr> +<tr class="separator:a03a5323361749674438e700afe853b99"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:ad63e8eb2370eaece6c5e594d631cadce"><td class="memItemLeft" >   int   <a class="el" href="struct_xdf_1_1_stream.html#a329234a46df00cd51a67a7f4f637c08a">sample_count</a></td></tr> +<tr class="separator:ad63e8eb2370eaece6c5e594d631cadce"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a26a74e3c0ee253553cef227c8e437191"><td class="memItemLeft" >   double   <a class="el" href="struct_xdf_1_1_stream.html#a9c1fbac049f7c15225de9fe9713abc0a">measured_srate</a></td></tr> +<tr class="separator:a26a74e3c0ee253553cef227c8e437191"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:aa0a35d52303f5320e0354c783be86232"><td class="memItemLeft" >   double   <a class="el" href="struct_xdf_1_1_stream.html#abeb1d2eb26a46eac34a478f04f5143d6">effective_sample_rate</a></td></tr> +<tr class="separator:aa0a35d52303f5320e0354c783be86232"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a732d62cf3216a3bd4990625b0eb723cf"><td class="memItemLeft" valign="top">} </td><td class="memItemRight" valign="bottom"><a class="el" href="struct_xdf_1_1_stream.html#a732d62cf3216a3bd4990625b0eb723cf">info</a></td></tr> +<tr class="separator:a732d62cf3216a3bd4990625b0eb723cf"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:ab61b638cf490354db62fb7da999750cf"><td class="memItemLeft" align="right" valign="top">float </td><td class="memItemRight" valign="bottom"><a class="el" href="struct_xdf_1_1_stream.html#ab61b638cf490354db62fb7da999750cf">last_timestamp</a> { 0 }</td></tr> +<tr class="separator:ab61b638cf490354db62fb7da999750cf"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a49bbcb0c3130c3efef27ece47084b327"><td class="memItemLeft" align="right" valign="top">float </td><td class="memItemRight" valign="bottom"><a class="el" href="struct_xdf_1_1_stream.html#a49bbcb0c3130c3efef27ece47084b327">sampling_interval</a></td></tr> +<tr class="separator:a49bbcb0c3130c3efef27ece47084b327"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a6bc91dcf23e551a9adbc415b562f3a79"><td class="memItemLeft" align="right" valign="top">std::vector< double > </td><td class="memItemRight" valign="bottom"><a class="el" href="struct_xdf_1_1_stream.html#a6bc91dcf23e551a9adbc415b562f3a79">clock_times</a></td></tr> +<tr class="separator:a6bc91dcf23e551a9adbc415b562f3a79"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a988989603854812cb693e56ff352a753"><td class="memItemLeft" align="right" valign="top">std::vector< double > </td><td class="memItemRight" valign="bottom"><a class="el" href="struct_xdf_1_1_stream.html#a988989603854812cb693e56ff352a753">clock_values</a></td></tr> +<tr class="separator:a988989603854812cb693e56ff352a753"><td class="memSeparator" colspan="2"> </td></tr> +</table> +<a name="details" id="details"></a><h2 class="groupheader">Detailed Description</h2> +<div class="textblock"><p>XDF files uses stream as the unit to store data. An XDF file usually contains multiple streams, while each of them may contain one or more channels. The <a class="el" href="struct_xdf_1_1_stream.html">Stream</a> class provides a handy way to store all the meta-data, time-series, time-stamps and all other information of a single stream from an XDF file. </p> +</div><h2 class="groupheader">Member Data Documentation</h2> +<a id="ab8fb7c3d645305e84f90d919f698082c"></a> +<h2 class="memtitle"><span class="permalink"><a href="#ab8fb7c3d645305e84f90d919f698082c">§ </a></span>channel_count</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">int Xdf::Stream::channel_count</td> + </tr> + </table> +</div><div class="memdoc"> +<p>Number of channels of the current stream </p> + +</div> +</div> +<a id="ad7b61b077e247ba57a18c182e285d0ad"></a> +<h2 class="memtitle"><span class="permalink"><a href="#ad7b61b077e247ba57a18c182e285d0ad">§ </a></span>channel_format</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">std::string Xdf::Stream::channel_format</td> + </tr> + </table> +</div><div class="memdoc"> +<p>Channel format of the current stream. </p> + +</div> +</div> +<a id="a71d987a538d0819cdbd58120d1a79ef5"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a71d987a538d0819cdbd58120d1a79ef5">§ </a></span>channels</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">std::vector<std::map<std::string, std::string> > Xdf::Stream::channels</td> + </tr> + </table> +</div><div class="memdoc"> +<p>A vector to store the meta-data of the channels of the current stream. </p> + +</div> +</div> +<a id="a6f6328f0746591a3a471048b6b9bd258"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a6f6328f0746591a3a471048b6b9bd258">§ </a></span>clock_offsets</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">std::vector<std::pair<double, double> > Xdf::Stream::clock_offsets</td> + </tr> + </table> +</div><div class="memdoc"> +<p>A vector to store clock offsets from the ClockOffset chunk. </p> + +</div> +</div> +<a id="a6bc91dcf23e551a9adbc415b562f3a79"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a6bc91dcf23e551a9adbc415b562f3a79">§ </a></span>clock_times</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">std::vector<double> Xdf::Stream::clock_times</td> + </tr> + </table> +</div><div class="memdoc"> +<p>Vector of clock times from clock offset chunk (Tag 4). </p> + +</div> +</div> +<a id="a988989603854812cb693e56ff352a753"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a988989603854812cb693e56ff352a753">§ </a></span>clock_values</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">std::vector<double> Xdf::Stream::clock_values</td> + </tr> + </table> +</div><div class="memdoc"> +<p>Vector of clock values from clock offset chunk (Tag 4). </p> + +</div> +</div> +<a id="abeb1d2eb26a46eac34a478f04f5143d6"></a> +<h2 class="memtitle"><span class="permalink"><a href="#abeb1d2eb26a46eac34a478f04f5143d6">§ </a></span>effective_sample_rate</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">double Xdf::Stream::effective_sample_rate</td> + </tr> + </table> +</div><div class="memdoc"> +<p>Effective sample rate. </p> + +</div> +</div> +<a id="a22a44cb3cd533ea668f9bb20dbc299de"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a22a44cb3cd533ea668f9bb20dbc299de">§ </a></span>first_timestamp</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">double Xdf::Stream::first_timestamp</td> + </tr> + </table> +</div><div class="memdoc"> +<p>First time stamp of the stream. </p> + +</div> +</div> +<a id="a732d62cf3216a3bd4990625b0eb723cf"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a732d62cf3216a3bd4990625b0eb723cf">§ </a></span>info</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">struct { ... } Xdf::Stream::info</td> + </tr> + </table> +</div><div class="memdoc"> +<p>Meta-data from the stream header of the current stream. </p> + +</div> +</div> +<a id="a9e05df342a36187ae492c75f10fc7713"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a9e05df342a36187ae492c75f10fc7713">§ </a></span>last_timestamp <span class="overload">[1/2]</span></h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">double Xdf::Stream::last_timestamp</td> + </tr> + </table> +</div><div class="memdoc"> +<p>Last time stamp of the stream. </p> + +</div> +</div> +<a id="ab61b638cf490354db62fb7da999750cf"></a> +<h2 class="memtitle"><span class="permalink"><a href="#ab61b638cf490354db62fb7da999750cf">§ </a></span>last_timestamp <span class="overload">[2/2]</span></h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">float Xdf::Stream::last_timestamp { 0 }</td> + </tr> + </table> +</div><div class="memdoc"> +<p>For temporary use while loading the vector </p> + +</div> +</div> +<a id="a9c1fbac049f7c15225de9fe9713abc0a"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a9c1fbac049f7c15225de9fe9713abc0a">§ </a></span>measured_srate</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">double Xdf::Stream::measured_srate</td> + </tr> + </table> +</div><div class="memdoc"> +<p>Measured sample rate of the stream. </p> + +</div> +</div> +<a id="a112e1dcc0e4b7f9583755366da8c3c64"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a112e1dcc0e4b7f9583755366da8c3c64">§ </a></span>name</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">std::string Xdf::Stream::name</td> + </tr> + </table> +</div><div class="memdoc"> +<p>Name of the current stream. </p> + +</div> +</div> +<a id="a17696fc2ee37c1d79601fac1736deb35"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a17696fc2ee37c1d79601fac1736deb35">§ </a></span>nominal_srate</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">double Xdf::Stream::nominal_srate</td> + </tr> + </table> +</div><div class="memdoc"> +<p>The nominal sample rate of the current stream. </p> + +</div> +</div> +<a id="a329234a46df00cd51a67a7f4f637c08a"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a329234a46df00cd51a67a7f4f637c08a">§ </a></span>sample_count</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">int Xdf::Stream::sample_count</td> + </tr> + </table> +</div><div class="memdoc"> +<p>Sample count of the stream. </p> + +</div> +</div> +<a id="a49bbcb0c3130c3efef27ece47084b327"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a49bbcb0c3130c3efef27ece47084b327">§ </a></span>sampling_interval</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">float Xdf::Stream::sampling_interval</td> + </tr> + </table> +</div><div class="memdoc"> +<p>If srate > 0, sampling_interval = 1/srate; otherwise 0 </p> + +</div> +</div> +<a id="aecd1fdf80d421e2362eeee58b31d4e11"></a> +<h2 class="memtitle"><span class="permalink"><a href="#aecd1fdf80d421e2362eeee58b31d4e11">§ </a></span>streamFooter</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">std::string Xdf::Stream::streamFooter</td> + </tr> + </table> +</div><div class="memdoc"> +<p>Raw XDF of stream footer chunk. </p> + +</div> +</div> +<a id="a2dff1924d1f7de075df08c4001201d63"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a2dff1924d1f7de075df08c4001201d63">§ </a></span>streamHeader</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">std::string Xdf::Stream::streamHeader</td> + </tr> + </table> +</div><div class="memdoc"> +<p>Raw XDF of stream header chunk. </p> + +</div> +</div> +<a id="adfdeb5f6220da9fe671d3f37e27ed0bb"></a> +<h2 class="memtitle"><span class="permalink"><a href="#adfdeb5f6220da9fe671d3f37e27ed0bb">§ </a></span>time_series</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">std::vector<std::vector<float> > Xdf::Stream::time_series</td> + </tr> + </table> +</div><div class="memdoc"> + +<p>A 2D vector which stores the time series of a stream. Each row represents a channel. </p> + +</div> +</div> +<a id="a3f05ffb18a1feb56c248c391a69f104b"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a3f05ffb18a1feb56c248c391a69f104b">§ </a></span>time_stamps</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">std::vector<float> Xdf::Stream::time_stamps</td> + </tr> + </table> +</div><div class="memdoc"> +<p>A vector to store time stamps. </p> + +</div> +</div> +<a id="a7e5aa085e48de871ea6661651b28e097"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a7e5aa085e48de871ea6661651b28e097">§ </a></span>type</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">std::string Xdf::Stream::type</td> + </tr> + </table> +</div><div class="memdoc"> +<p>Type of the current stream. </p> + +</div> +</div> +<hr/>The documentation for this class was generated from the following file:<ul> +<li>C:/Users/Yida Lin/Documents/GitHub/libxdf/libxdf/<a class="el" href="xdf_8h_source.html">xdf.h</a></li> +</ul> +</div><!-- contents --> +</div><!-- doc-content --> +<!-- start footer part --> +<div id="nav-path" class="navpath"><!-- id is needed for treeview function! --> + <ul> + <li class="navelem"><a class="el" href="class_xdf.html">Xdf</a></li><li class="navelem"><a class="el" href="struct_xdf_1_1_stream.html">Stream</a></li> + <li class="footer">Generated by + <a href="http://www.doxygen.org/index.html"> + <img class="footer" src="doxygen.png" alt="doxygen"/></a> 1.8.12 </li> + </ul> +</div> +</body> +</html> diff --git a/C++/docs/html/struct_xdf_1_1_stream.js b/C++/docs/html/struct_xdf_1_1_stream.js new file mode 100644 index 0000000..330e96f --- /dev/null +++ b/C++/docs/html/struct_xdf_1_1_stream.js @@ -0,0 +1,24 @@ +var struct_xdf_1_1_stream = +[ + [ "channel_count", "struct_xdf_1_1_stream.html#ab8fb7c3d645305e84f90d919f698082c", null ], + [ "channel_format", "struct_xdf_1_1_stream.html#ad7b61b077e247ba57a18c182e285d0ad", null ], + [ "channels", "struct_xdf_1_1_stream.html#a71d987a538d0819cdbd58120d1a79ef5", null ], + [ "clock_offsets", "struct_xdf_1_1_stream.html#a6f6328f0746591a3a471048b6b9bd258", null ], + [ "clock_times", "struct_xdf_1_1_stream.html#a6bc91dcf23e551a9adbc415b562f3a79", null ], + [ "clock_values", "struct_xdf_1_1_stream.html#a988989603854812cb693e56ff352a753", null ], + [ "effective_sample_rate", "struct_xdf_1_1_stream.html#abeb1d2eb26a46eac34a478f04f5143d6", null ], + [ "first_timestamp", "struct_xdf_1_1_stream.html#a22a44cb3cd533ea668f9bb20dbc299de", null ], + [ "info", "struct_xdf_1_1_stream.html#a732d62cf3216a3bd4990625b0eb723cf", null ], + [ "last_timestamp", "struct_xdf_1_1_stream.html#a9e05df342a36187ae492c75f10fc7713", null ], + [ "last_timestamp", "struct_xdf_1_1_stream.html#ab61b638cf490354db62fb7da999750cf", null ], + [ "measured_srate", "struct_xdf_1_1_stream.html#a9c1fbac049f7c15225de9fe9713abc0a", null ], + [ "name", "struct_xdf_1_1_stream.html#a112e1dcc0e4b7f9583755366da8c3c64", null ], + [ "nominal_srate", "struct_xdf_1_1_stream.html#a17696fc2ee37c1d79601fac1736deb35", null ], + [ "sample_count", "struct_xdf_1_1_stream.html#a329234a46df00cd51a67a7f4f637c08a", null ], + [ "sampling_interval", "struct_xdf_1_1_stream.html#a49bbcb0c3130c3efef27ece47084b327", null ], + [ "streamFooter", "struct_xdf_1_1_stream.html#aecd1fdf80d421e2362eeee58b31d4e11", null ], + [ "streamHeader", "struct_xdf_1_1_stream.html#a2dff1924d1f7de075df08c4001201d63", null ], + [ "time_series", "struct_xdf_1_1_stream.html#adfdeb5f6220da9fe671d3f37e27ed0bb", null ], + [ "time_stamps", "struct_xdf_1_1_stream.html#a3f05ffb18a1feb56c248c391a69f104b", null ], + [ "type", "struct_xdf_1_1_stream.html#a7e5aa085e48de871ea6661651b28e097", null ] +]; \ No newline at end of file diff --git a/C++/docs/html/sync_off.png b/C++/docs/html/sync_off.png new file mode 100644 index 0000000000000000000000000000000000000000..3b443fc62892114406e3d399421b2a881b897acc GIT binary patch literal 853 zcmV-b1FHOqP)<h;3K|Lk000e1NJLTq000;O000;W1^@s6;CDUv0009VNkl<ZcmeI* zOK4PA7{KxW<S|JmGnqI|rb(KahDirA+8B+gVk8A)%pe9yF;+3L5iKZG7xuBS&@L(k z33MTXOIxMHjirbWgs8M;qhM?(_-v^nS(KzU#%Ih_`hB-^XYSm&39)2*I6vmhow@fr z=iKj{vvuv-e;!~uA+biR6pf-n<cdGVuox5<#BBg4c>oT|#XixUYy%lpuf3i8{fX!o zUyDD0jOrAiT^tq>fLSOOABs-#u{dV^F$b{L9&!2=9&RmV;;8s^x&UqB$PCj4FdKbh zoB1WTskPUPu05XzFbA}=KZ-GP1fPpAfSs>6AHb12UlR%-i&uOlTpFNS7{jm@mkU1V zh`nrXr~+^lsV-s1dkZOaI|kYyVj3WBpPCY{n~yd%u%e+d=f%`N0FItMPtdgBb@py; zq@v6NVArhyTC7)ULw-Jy8y42S1~4n(3LkrW8mW(F-4oXUP3E`e#g**YyqI7h-J2zK zK{m9##m4ri!7N>CqQqCcnI3hqo1I;Yh&QLNY4T`*ptiQGozK>FF$!$+84Z`xwmeMh zJ0WT+OH$WYFALEaGj2_l+#DC3t7_S`vHpSivNeFbP6+r50cO<q-Bsh$IuZaopT|9E z-75alp&U9s%(|8uI^NA(#AD;nc=%{ivdZX(QFJ7~-yf%_Adjk`W@NhjJTyZ8*;|!n z9=K#TJuZz+={YZ#>8iu)`7i%Z4BTPh@_m3Tk!nAm^)5Bqnr%Ov|Baunj#&RPtRuK& z4RGz|D5HNrW83-#ydk}tVKJrNmyYt-sT<tBHx6XfOFDx2(ijpMiR>xLGlJY5nc&Re zU4SgHNPx8~Yxwr$bsju?4q&%T1874xxzq+_%?h8_ofw~(bld=o3iC)LUNR*BY%c0y zWd_jX{Y8`l%z+ol1$@Qa?Cy!(0CVIEeYpKZ`(9{z>3$CIe;pJDQk$m3p}$>xBm4lb zKo{4S)`wdU9Ba9jJbVJ0C=SOefZe%d$8=2r={nu<_^a3~>c#t_U6dye5)JrR(_a^E f@}b6j1K9lwFJq@>o)+Ry00000NkvXXu0mjfWa5j* literal 0 HcmV?d00001 diff --git a/C++/docs/html/sync_on.png b/C++/docs/html/sync_on.png new file mode 100644 index 0000000000000000000000000000000000000000..e08320fb64e6fa33b573005ed6d8fe294e19db76 GIT binary patch literal 845 zcmV-T1G4;yP)<h;3K|Lk000e1NJLTq000;O000;W1^@s6;CDUv0009NNkl<ZcmeI* zUr1D09KiAKIOC-Ar)j4&EoU~y1|7@QCTmeCsMH~fFw#|0OWK8m>Y;xxyHF2B5Wzm| zOOGupOTn@c(JmBOl)e;XMNnZuiTJP>rM8<|Q`7I<ojWskx{8*sm){4kXJ+p2oO6HY zoL5W7@h*VL_(ZL!7GaSmtl}SWU-XD;q7T4~4ZuW>_))aP?*T)ow&n59{}X4$3Goat zgjs?*aasfbrokzG5cT4K=uG`E14xZl@z)F<o_Z}1zllSWC8!Z+rkFN>={P0Y^?$4t z>v!teRnNZym<6h{7sLyF1V0HsfEl+l6TrZpsfr1}luH~F7L}ktXu|*uVX^RG$L0`K zWs3j|0tIvVe(N%_?2{(iCPFGf#B6Hjy6o&}D$A%W%jfO8_W%ZO#-mh}EM$LMn7joJ z05dHr!5Y92g+31l<%i1(=L1a1pXX+OYnalY>31V4K}BjyRe3)9n#;-cCVRD_IG1fT zOKGeNY8q;TL@K{dj@D^scf&VCs*-Jb>8b>|`b*osv52-!A?BpbYtTQBns5EAU**$m zSnVSm(teh>tQi*S*A>#ySc=n;`BHz`DuG4&g4Kf8lLhca+zvZ7t7RflD6-i-mcK=M z!=^P$*u2)bkY5asG4gsss!Hn%u~>}kIW`vMs%lJLH+u*9<4PaV_c6U`KqWXQH%+Nu zTv41O(^ZVi@qhjQdG!fbZw&y+2o!iYymO^?ud3{P*HdoX83YV*Uu_HB=?U&W9%AU# z80}k1SS-CXTU7dcQlsm<^oYLxVSseqY6NO}dc`Nj?8vrhNuCdm@^{a3AQ_>6myOj+ z`1RsLUXF|dm|3k7s2jD(B{rzE>WI2scH8i1;=O5Cc9xB3^aJk%fQjqsu+kH#0=_5a z0nCE8@dbQa-|YIuUVvG0L_IwHMEhOj$M<u9&-IHqnYs=DL+lbi3lG2ysF!p!_2H=p zj-g89hmThki^;JHknVE4V`@zS$(ZbTd?1=dsrXLRiJbUBq7weAmVjEk@rP>j4Uq05 X8=0q~qBNan00000NkvXXu0mjfptF>5 literal 0 HcmV?d00001 diff --git a/C++/docs/html/tab_a.png b/C++/docs/html/tab_a.png new file mode 100644 index 0000000000000000000000000000000000000000..3b725c41c5a527a3a3e40097077d0e206a681247 GIT binary patch literal 142 zcmeAS@N?(olHy`uVBq!ia0vp^j6kfy!2~3aiye;!QlXwMjv*C{Z|8b*H5dputLHD# z=<0|*y7z(Vor?d;H&?EG&cXR}?!j-Lm&u1OOI7AIF5&c)RFE;&p0MYK>*Kl@eiymD r@|NpwKX@^z+;{u_Z~trSBfrMKa%3`zocFjEXaR$#tDnm{r-UW|TZ1%4 literal 0 HcmV?d00001 diff --git a/C++/docs/html/tab_b.png b/C++/docs/html/tab_b.png new file mode 100644 index 0000000000000000000000000000000000000000..e2b4a8638cb3496a016eaed9e16ffc12846dea18 GIT binary patch literal 169 zcmeAS@N?(olHy`uVBq!ia0vp^j6kfy!2~3aiye;!QU#tajv*C{Z}0l@H7kg?K0Lnr z!j&C6_(~HV9oQ0Pa6x{-v0AGV_E?vLn<f<Rf3mJ=+uzfrOMlc%s`x4TZtnrR|B~W{ zyZP0m7vvtXV80W5^J2vvp97)4WrPK1-P<H^B$Ll|TGvzm;+92|BpdT89$b1Qf7x5g UZ&RH}7SL`6Pgg&ebxsLQ0A}n&iU0rr literal 0 HcmV?d00001 diff --git a/C++/docs/html/tab_h.png b/C++/docs/html/tab_h.png new file mode 100644 index 0000000000000000000000000000000000000000..fd5cb705488e60fcf30f56fcc951dee74f3b095b GIT binary patch literal 177 zcmeAS@N?(olHy`uVBq!ia0vp^j6kfy!2~3aiye;!QWc&qjv*C{Z}0jF9dr<AdpNI7 zaOs_6=O($9b?lc?Qk=SJVv5%FA{O^TY1^*qJ@<p}E}!uH_1eoPJ&tpVl={bg{Skd2 zp1FO|;|R90%G3WYZM5AU=A4%H?3qaQhHt%H9G|xYJ)ff*|MmI*zD3`*Z|LP?7d&26 cn!ZiLK0QM$CeyB_80ZEDPgg&ebxsLQ0C?O;!~g&Q literal 0 HcmV?d00001 diff --git a/C++/docs/html/tab_s.png b/C++/docs/html/tab_s.png new file mode 100644 index 0000000000000000000000000000000000000000..ab478c95b67371d700a20869f7de1ddd73522d50 GIT binary patch literal 184 zcmeAS@N?(olHy`uVBq!ia0vp^j6kfy!2~3aiye;!QuUrLjv*C{Z|^p8HaRdjTwH7) zC?wLlL}}I{)n%R&r+1}IGmDnq;&J#%V6)9VsYhS`O^BVBQlxOUep0c$RENLq#g8A$ z)z7%K_bI&n@J+X_=x}fJoEKed-$<>=ZI-;YrdjIl`U`uzuDWSP?o#Dmo{%SgM#oan kX~E1%D-|#H#QbHoIja2U-MgvsK&LQxy85}Sb4q9e0Efg%P5=M^ literal 0 HcmV?d00001 diff --git a/C++/docs/html/tabs.css b/C++/docs/html/tabs.css new file mode 100644 index 0000000..a28614b --- /dev/null +++ b/C++/docs/html/tabs.css @@ -0,0 +1 @@ +.sm{position:relative;z-index:9999}.sm,.sm ul,.sm li{display:block;list-style:none;margin:0;padding:0;line-height:normal;direction:ltr;text-align:left;-webkit-tap-highlight-color:rgba(0,0,0,0)}.sm-rtl,.sm-rtl ul,.sm-rtl li{direction:rtl;text-align:right}.sm>li>h1,.sm>li>h2,.sm>li>h3,.sm>li>h4,.sm>li>h5,.sm>li>h6{margin:0;padding:0}.sm ul{display:none}.sm li,.sm a{position:relative}.sm a{display:block}.sm a.disabled{cursor:not-allowed}.sm:after{content:"\00a0";display:block;height:0;font:0/0 serif;clear:both;visibility:hidden;overflow:hidden}.sm,.sm *,.sm *:before,.sm *:after{-moz-box-sizing:border-box;-webkit-box-sizing:border-box;box-sizing:border-box}#doc-content{overflow:auto;display:block;padding:0;margin:0;-webkit-overflow-scrolling:touch}.sm-dox{background-image:url("tab_b.png")}.sm-dox a,.sm-dox a:focus,.sm-dox a:hover,.sm-dox a:active{padding:0 12px;padding-right:43px;font-family:"Lucida Grande","Geneva","Helvetica",Arial,sans-serif;font-size:13px;font-weight:bold;line-height:36px;text-decoration:none;text-shadow:0 1px 1px rgba(255,255,255,0.9);color:#283a5d;outline:0}.sm-dox a:hover{background-image:url("tab_a.png");background-repeat:repeat-x;color:white;text-shadow:0 1px 1px black}.sm-dox a.current{color:#d23600}.sm-dox a.disabled{color:#bbb}.sm-dox a span.sub-arrow{position:absolute;top:50%;margin-top:-14px;left:auto;right:3px;width:28px;height:28px;overflow:hidden;font:bold 12px/28px monospace!important;text-align:center;text-shadow:none;background:rgba(255,255,255,0.5);-moz-border-radius:5px;-webkit-border-radius:5px;border-radius:5px}.sm-dox a.highlighted span.sub-arrow:before{display:block;content:'-'}.sm-dox>li:first-child>a,.sm-dox>li:first-child>:not(ul) a{-moz-border-radius:5px 5px 0 0;-webkit-border-radius:5px;border-radius:5px 5px 0 0}.sm-dox>li:last-child>a,.sm-dox>li:last-child>*:not(ul) a,.sm-dox>li:last-child>ul,.sm-dox>li:last-child>ul>li:last-child>a,.sm-dox>li:last-child>ul>li:last-child>*:not(ul) a,.sm-dox>li:last-child>ul>li:last-child>ul,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul{-moz-border-radius:0 0 5px 5px;-webkit-border-radius:0;border-radius:0 0 5px 5px}.sm-dox>li:last-child>a.highlighted,.sm-dox>li:last-child>*:not(ul) a.highlighted,.sm-dox>li:last-child>ul>li:last-child>a.highlighted,.sm-dox>li:last-child>ul>li:last-child>*:not(ul) a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a.highlighted{-moz-border-radius:0;-webkit-border-radius:0;border-radius:0}.sm-dox ul{background:rgba(162,162,162,0.1)}.sm-dox ul a,.sm-dox ul a:focus,.sm-dox ul a:hover,.sm-dox ul a:active{font-size:12px;border-left:8px solid transparent;line-height:36px;text-shadow:none;background-color:white;background-image:none}.sm-dox ul a:hover{background-image:url("tab_a.png");background-repeat:repeat-x;color:white;text-shadow:0 1px 1px black}.sm-dox ul ul a,.sm-dox ul ul a:hover,.sm-dox ul ul a:focus,.sm-dox ul ul a:active{border-left:16px solid transparent}.sm-dox ul ul ul a,.sm-dox ul ul ul a:hover,.sm-dox ul ul ul a:focus,.sm-dox ul ul ul a:active{border-left:24px solid transparent}.sm-dox ul ul ul ul a,.sm-dox ul ul ul ul a:hover,.sm-dox ul ul ul ul a:focus,.sm-dox ul ul ul ul a:active{border-left:32px solid transparent}.sm-dox ul ul ul ul ul a,.sm-dox ul ul ul ul ul a:hover,.sm-dox ul ul ul ul ul a:focus,.sm-dox ul ul ul ul ul a:active{border-left:40px solid transparent}@media(min-width:768px){.sm-dox ul{position:absolute;width:12em}.sm-dox li{float:left}.sm-dox.sm-rtl li{float:right}.sm-dox ul li,.sm-dox.sm-rtl ul li,.sm-dox.sm-vertical li{float:none}.sm-dox a{white-space:nowrap}.sm-dox ul a,.sm-dox.sm-vertical a{white-space:normal}.sm-dox .sm-nowrap>li>a,.sm-dox .sm-nowrap>li>:not(ul) a{white-space:nowrap}.sm-dox{padding:0 10px;background-image:url("tab_b.png");line-height:36px}.sm-dox a span.sub-arrow{top:50%;margin-top:-2px;right:12px;width:0;height:0;border-width:4px;border-style:solid dashed dashed dashed;border-color:#283a5d transparent transparent transparent;background:transparent;-moz-border-radius:0;-webkit-border-radius:0;border-radius:0}.sm-dox a,.sm-dox a:focus,.sm-dox a:active,.sm-dox a:hover,.sm-dox a.highlighted{padding:0 12px;background-image:url("tab_s.png");background-repeat:no-repeat;background-position:right;-moz-border-radius:0!important;-webkit-border-radius:0;border-radius:0!important}.sm-dox a:hover{background-image:url("tab_a.png");background-repeat:repeat-x;color:white;text-shadow:0 1px 1px black}.sm-dox a:hover span.sub-arrow{border-color:white transparent transparent transparent}.sm-dox a.has-submenu{padding-right:24px}.sm-dox li{border-top:0}.sm-dox>li>ul:before,.sm-dox>li>ul:after{content:'';position:absolute;top:-18px;left:30px;width:0;height:0;overflow:hidden;border-width:9px;border-style:dashed dashed solid dashed;border-color:transparent transparent #bbb transparent}.sm-dox>li>ul:after{top:-16px;left:31px;border-width:8px;border-color:transparent transparent #fff transparent}.sm-dox ul{border:1px solid #bbb;padding:5px 0;background:#fff;-moz-border-radius:5px!important;-webkit-border-radius:5px;border-radius:5px!important;-moz-box-shadow:0 5px 9px rgba(0,0,0,0.2);-webkit-box-shadow:0 5px 9px rgba(0,0,0,0.2);box-shadow:0 5px 9px rgba(0,0,0,0.2)}.sm-dox ul a span.sub-arrow{right:8px;top:50%;margin-top:-5px;border-width:5px;border-color:transparent transparent transparent #555;border-style:dashed dashed dashed solid}.sm-dox ul a,.sm-dox ul a:hover,.sm-dox ul a:focus,.sm-dox ul a:active,.sm-dox ul a.highlighted{color:#555;background-image:none;border:0!important;color:#555;background-image:none}.sm-dox ul a:hover{background-image:url("tab_a.png");background-repeat:repeat-x;color:white;text-shadow:0 1px 1px black}.sm-dox ul a:hover span.sub-arrow{border-color:transparent transparent transparent white}.sm-dox span.scroll-up,.sm-dox span.scroll-down{position:absolute;display:none;visibility:hidden;overflow:hidden;background:#fff;height:36px}.sm-dox span.scroll-up:hover,.sm-dox span.scroll-down:hover{background:#eee}.sm-dox span.scroll-up:hover span.scroll-up-arrow,.sm-dox span.scroll-up:hover span.scroll-down-arrow{border-color:transparent transparent #d23600 transparent}.sm-dox span.scroll-down:hover span.scroll-down-arrow{border-color:#d23600 transparent transparent transparent}.sm-dox span.scroll-up-arrow,.sm-dox span.scroll-down-arrow{position:absolute;top:0;left:50%;margin-left:-6px;width:0;height:0;overflow:hidden;border-width:6px;border-style:dashed dashed solid dashed;border-color:transparent transparent #555 transparent}.sm-dox span.scroll-down-arrow{top:8px;border-style:solid dashed dashed dashed;border-color:#555 transparent transparent transparent}.sm-dox.sm-rtl a.has-submenu{padding-right:12px;padding-left:24px}.sm-dox.sm-rtl a span.sub-arrow{right:auto;left:12px}.sm-dox.sm-rtl.sm-vertical a.has-submenu{padding:10px 20px}.sm-dox.sm-rtl.sm-vertical a span.sub-arrow{right:auto;left:8px;border-style:dashed solid dashed dashed;border-color:transparent #555 transparent transparent}.sm-dox.sm-rtl>li>ul:before{left:auto;right:30px}.sm-dox.sm-rtl>li>ul:after{left:auto;right:31px}.sm-dox.sm-rtl ul a.has-submenu{padding:10px 20px!important}.sm-dox.sm-rtl ul a span.sub-arrow{right:auto;left:8px;border-style:dashed solid dashed dashed;border-color:transparent #555 transparent transparent}.sm-dox.sm-vertical{padding:10px 0;-moz-border-radius:5px;-webkit-border-radius:5px;border-radius:5px}.sm-dox.sm-vertical a{padding:10px 20px}.sm-dox.sm-vertical a:hover,.sm-dox.sm-vertical a:focus,.sm-dox.sm-vertical a:active,.sm-dox.sm-vertical a.highlighted{background:#fff}.sm-dox.sm-vertical a.disabled{background-image:url("tab_b.png")}.sm-dox.sm-vertical a span.sub-arrow{right:8px;top:50%;margin-top:-5px;border-width:5px;border-style:dashed dashed dashed solid;border-color:transparent transparent transparent #555}.sm-dox.sm-vertical>li>ul:before,.sm-dox.sm-vertical>li>ul:after{display:none}.sm-dox.sm-vertical ul a{padding:10px 20px}.sm-dox.sm-vertical ul a:hover,.sm-dox.sm-vertical ul a:focus,.sm-dox.sm-vertical ul a:active,.sm-dox.sm-vertical ul a.highlighted{background:#eee}.sm-dox.sm-vertical ul a.disabled{background:#fff}} \ No newline at end of file diff --git a/C++/docs/html/xdf_8cpp.html b/C++/docs/html/xdf_8cpp.html new file mode 100644 index 0000000..eb87216 --- /dev/null +++ b/C++/docs/html/xdf_8cpp.html @@ -0,0 +1,132 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>libxdf: C:/Users/Yida Lin/Documents/GitHub/libxdf/libxdf/xdf.cpp File Reference</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="navtree.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="resize.js"></script> +<script type="text/javascript" src="navtreedata.js"></script> +<script type="text/javascript" src="navtree.js"></script> +<script type="text/javascript"> + $(document).ready(initResizable); +</script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">libxdf +  <span id="projectnumber">0.92</span> + </div> + <div id="projectbrief">A static C++ library for loading XDF files</div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.12 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<div id="side-nav" class="ui-resizable side-nav-resizable"> + <div id="nav-tree"> + <div id="nav-tree-contents"> + <div id="nav-sync" class="sync"></div> + </div> + </div> + <div id="splitbar" style="-moz-user-select:none;" + class="ui-resizable-handle"> + </div> +</div> +<script type="text/javascript"> +$(document).ready(function(){initNavTree('xdf_8cpp.html','');}); +</script> +<div id="doc-content"> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="header"> + <div class="summary"> +<a href="#define-members">Macros</a> </div> + <div class="headertitle"> +<div class="title">xdf.cpp File Reference</div> </div> +</div><!--header--> +<div class="contents"> +<div class="textblock"><code>#include "<a class="el" href="xdf_8h_source.html">xdf.h</a>"</code><br /> +<code>#include <iostream></code><br /> +<code>#include <fstream></code><br /> +<code>#include "pugixml/pugixml.hpp"</code><br /> +<code>#include <sstream></code><br /> +<code>#include <algorithm></code><br /> +<code>#include "smarc/smarc.h"</code><br /> +<code>#include <time.h></code><br /> +<code>#include <numeric></code><br /> +</div><table class="memberdecls"> +<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="define-members"></a> +Macros</h2></td></tr> +<tr class="memitem:a6821bafc3c88dfb2e433a095df9940c6"><td class="memItemLeft" align="right" valign="top">#define </td><td class="memItemRight" valign="bottom"><a class="el" href="xdf_8cpp.html#a6821bafc3c88dfb2e433a095df9940c6">BUF_SIZE</a>   8192</td></tr> +<tr class="separator:a6821bafc3c88dfb2e433a095df9940c6"><td class="memSeparator" colspan="2"> </td></tr> +</table> +<h2 class="groupheader">Macro Definition Documentation</h2> +<a id="a6821bafc3c88dfb2e433a095df9940c6"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a6821bafc3c88dfb2e433a095df9940c6">§ </a></span>BUF_SIZE</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">#define BUF_SIZE   8192</td> + </tr> + </table> +</div><div class="memdoc"> + +</div> +</div> +</div><!-- contents --> +</div><!-- doc-content --> +<!-- start footer part --> +<div id="nav-path" class="navpath"><!-- id is needed for treeview function! --> + <ul> + <li class="navelem"><a class="el" href="dir_f396504afdc959660871b003fa10164d.html">Documents</a></li><li class="navelem"><a class="el" href="dir_7e17ac9cf8fba2cb04bc248c85b0ceb7.html">GitHub</a></li><li class="navelem"><a class="el" href="dir_72e8b74943c3b26541b5ac1c7338ef6f.html">libxdf</a></li><li class="navelem"><a class="el" href="dir_689ecbe789caf2e46799b15492db205c.html">libxdf</a></li><li class="navelem"><a class="el" href="xdf_8cpp.html">xdf.cpp</a></li> + <li class="footer">Generated by + <a href="http://www.doxygen.org/index.html"> + <img class="footer" src="doxygen.png" alt="doxygen"/></a> 1.8.12 </li> + </ul> +</div> +</body> +</html> diff --git a/C++/docs/html/xdf_8cpp.js b/C++/docs/html/xdf_8cpp.js new file mode 100644 index 0000000..4ccc2b4 --- /dev/null +++ b/C++/docs/html/xdf_8cpp.js @@ -0,0 +1,4 @@ +var xdf_8cpp = +[ + [ "BUF_SIZE", "xdf_8cpp.html#a6821bafc3c88dfb2e433a095df9940c6", null ] +]; \ No newline at end of file diff --git a/C++/docs/html/xdf_8h.html b/C++/docs/html/xdf_8h.html new file mode 100644 index 0000000..1773f04 --- /dev/null +++ b/C++/docs/html/xdf_8h.html @@ -0,0 +1,121 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>libxdf: C:/Users/Yida Lin/Documents/GitHub/libxdf/libxdf/xdf.h File Reference</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="navtree.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="resize.js"></script> +<script type="text/javascript" src="navtreedata.js"></script> +<script type="text/javascript" src="navtree.js"></script> +<script type="text/javascript"> + $(document).ready(initResizable); +</script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">libxdf +  <span id="projectnumber">0.92</span> + </div> + <div id="projectbrief">A static C++ library for loading XDF files</div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.12 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<div id="side-nav" class="ui-resizable side-nav-resizable"> + <div id="nav-tree"> + <div id="nav-tree-contents"> + <div id="nav-sync" class="sync"></div> + </div> + </div> + <div id="splitbar" style="-moz-user-select:none;" + class="ui-resizable-handle"> + </div> +</div> +<script type="text/javascript"> +$(document).ready(function(){initNavTree('xdf_8h.html','');}); +</script> +<div id="doc-content"> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="header"> + <div class="summary"> +<a href="#nested-classes">Classes</a> </div> + <div class="headertitle"> +<div class="title">xdf.h File Reference</div> </div> +</div><!--header--> +<div class="contents"> + +<p>The header file of <a class="el" href="class_xdf.html">Xdf</a> class. +<a href="#details">More...</a></p> +<div class="textblock"><code>#include <string></code><br /> +<code>#include <vector></code><br /> +<code>#include <map></code><br /> +<code>#include <set></code><br /> +</div> +<p><a href="xdf_8h_source.html">Go to the source code of this file.</a></p> +<table class="memberdecls"> +<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="nested-classes"></a> +Classes</h2></td></tr> +<tr class="memitem:"><td class="memItemLeft" align="right" valign="top">class  </td><td class="memItemRight" valign="bottom"><a class="el" href="class_xdf.html">Xdf</a></td></tr> +<tr class="separator:"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:"><td class="memItemLeft" align="right" valign="top">class  </td><td class="memItemRight" valign="bottom"><a class="el" href="struct_xdf_1_1_stream.html">Xdf::Stream</a></td></tr> +<tr class="separator:"><td class="memSeparator" colspan="2"> </td></tr> +</table> +<a name="details" id="details"></a><h2 class="groupheader">Detailed Description</h2> +<div class="textblock"><p>The header file of <a class="el" href="class_xdf.html">Xdf</a> class. </p> +</div></div><!-- contents --> +</div><!-- doc-content --> +<!-- start footer part --> +<div id="nav-path" class="navpath"><!-- id is needed for treeview function! --> + <ul> + <li class="navelem"><a class="el" href="dir_f396504afdc959660871b003fa10164d.html">Documents</a></li><li class="navelem"><a class="el" href="dir_7e17ac9cf8fba2cb04bc248c85b0ceb7.html">GitHub</a></li><li class="navelem"><a class="el" href="dir_72e8b74943c3b26541b5ac1c7338ef6f.html">libxdf</a></li><li class="navelem"><a class="el" href="dir_689ecbe789caf2e46799b15492db205c.html">libxdf</a></li><li class="navelem"><a class="el" href="xdf_8h.html">xdf.h</a></li> + <li class="footer">Generated by + <a href="http://www.doxygen.org/index.html"> + <img class="footer" src="doxygen.png" alt="doxygen"/></a> 1.8.12 </li> + </ul> +</div> +</body> +</html> diff --git a/C++/docs/html/xdf_8h_source.html b/C++/docs/html/xdf_8h_source.html new file mode 100644 index 0000000..9837577 --- /dev/null +++ b/C++/docs/html/xdf_8h_source.html @@ -0,0 +1,151 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.12"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>libxdf: C:/Users/Yida Lin/Documents/GitHub/libxdf/libxdf/xdf.h Source File</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="navtree.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="resize.js"></script> +<script type="text/javascript" src="navtreedata.js"></script> +<script type="text/javascript" src="navtree.js"></script> +<script type="text/javascript"> + $(document).ready(initResizable); +</script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">libxdf +  <span id="projectnumber">0.92</span> + </div> + <div id="projectbrief">A static C++ library for loading XDF files</div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.12 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<div id="side-nav" class="ui-resizable side-nav-resizable"> + <div id="nav-tree"> + <div id="nav-tree-contents"> + <div id="nav-sync" class="sync"></div> + </div> + </div> + <div id="splitbar" style="-moz-user-select:none;" + class="ui-resizable-handle"> + </div> +</div> +<script type="text/javascript"> +$(document).ready(function(){initNavTree('xdf_8h_source.html','');}); +</script> +<div id="doc-content"> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="header"> + <div class="headertitle"> +<div class="title">xdf.h</div> </div> +</div><!--header--> +<div class="contents"> +<a href="xdf_8h.html">Go to the documentation of this file.</a><div class="fragment"><div class="line"><a name="l00001"></a><span class="lineno"> 1</span> <span class="comment">//libxdf is a static C++ library to load XDF files</span></div><div class="line"><a name="l00002"></a><span class="lineno"> 2</span> <span class="comment">//Copyright (C) 2017 Yida Lin</span></div><div class="line"><a name="l00003"></a><span class="lineno"> 3</span> </div><div class="line"><a name="l00004"></a><span class="lineno"> 4</span> <span class="comment">//This program is free software: you can redistribute it and/or modify</span></div><div class="line"><a name="l00005"></a><span class="lineno"> 5</span> <span class="comment">//it under the terms of the GNU General Public License as published by</span></div><div class="line"><a name="l00006"></a><span class="lineno"> 6</span> <span class="comment">//the Free Software Foundation, either version 3 of the License, or</span></div><div class="line"><a name="l00007"></a><span class="lineno"> 7</span> <span class="comment">//(at your option) any later version.</span></div><div class="line"><a name="l00008"></a><span class="lineno"> 8</span> </div><div class="line"><a name="l00009"></a><span class="lineno"> 9</span> <span class="comment">//This program is distributed in the hope that it will be useful,</span></div><div class="line"><a name="l00010"></a><span class="lineno"> 10</span> <span class="comment">//but WITHOUT ANY WARRANTY; without even the implied warranty of</span></div><div class="line"><a name="l00011"></a><span class="lineno"> 11</span> <span class="comment">//MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the</span></div><div class="line"><a name="l00012"></a><span class="lineno"> 12</span> <span class="comment">//GNU General Public License for more details.</span></div><div class="line"><a name="l00013"></a><span class="lineno"> 13</span> </div><div class="line"><a name="l00014"></a><span class="lineno"> 14</span> <span class="comment">//You should have received a copy of the GNU General Public License</span></div><div class="line"><a name="l00015"></a><span class="lineno"> 15</span> <span class="comment">//along with this program. If not, see <http://www.gnu.org/licenses/>.</span></div><div class="line"><a name="l00016"></a><span class="lineno"> 16</span> <span class="comment">//If you have questions, contact author at ITAL_FAZIOLI@hotmail.com</span></div><div class="line"><a name="l00017"></a><span class="lineno"> 17</span> </div><div class="line"><a name="l00022"></a><span class="lineno"> 22</span> <span class="preprocessor">#ifndef XDF_H</span></div><div class="line"><a name="l00023"></a><span class="lineno"> 23</span> <span class="preprocessor">#define XDF_H</span></div><div class="line"><a name="l00024"></a><span class="lineno"> 24</span> </div><div class="line"><a name="l00025"></a><span class="lineno"> 25</span> <span class="preprocessor">#include <string></span></div><div class="line"><a name="l00026"></a><span class="lineno"> 26</span> <span class="preprocessor">#include <vector></span></div><div class="line"><a name="l00027"></a><span class="lineno"> 27</span> <span class="preprocessor">#include <map></span></div><div class="line"><a name="l00028"></a><span class="lineno"> 28</span> <span class="preprocessor">#include <set></span></div><div class="line"><a name="l00029"></a><span class="lineno"> 29</span> </div><div class="line"><a name="l00037"></a><span class="lineno"><a class="line" href="class_xdf.html"> 37</a></span> <span class="keyword">class </span><a class="code" href="class_xdf.html">Xdf</a></div><div class="line"><a name="l00038"></a><span class="lineno"> 38</span> { </div><div class="line"><a name="l00039"></a><span class="lineno"> 39</span> <span class="keyword">public</span>:</div><div class="line"><a name="l00041"></a><span class="lineno"> 41</span>  <a class="code" href="class_xdf.html#a7900b5a4f3792b9d59a5d43db821607e">Xdf</a>();</div><div class="line"><a name="l00042"></a><span class="lineno"> 42</span> </div><div class="line"><a name="l00043"></a><span class="lineno"> 43</span>  <span class="comment">//subclass for single streams</span></div><div class="line"><a name="l00053"></a><span class="lineno"><a class="line" href="struct_xdf_1_1_stream.html"> 53</a></span> <span class="comment"></span> <span class="keyword">struct </span><a class="code" href="struct_xdf_1_1_stream.html">Stream</a></div><div class="line"><a name="l00054"></a><span class="lineno"> 54</span>  {</div><div class="line"><a name="l00056"></a><span class="lineno"><a class="line" href="struct_xdf_1_1_stream.html#adfdeb5f6220da9fe671d3f37e27ed0bb"> 56</a></span>  std::vector<std::vector<float> > <a class="code" href="struct_xdf_1_1_stream.html#adfdeb5f6220da9fe671d3f37e27ed0bb">time_series</a>;</div><div class="line"><a name="l00057"></a><span class="lineno"><a class="line" href="struct_xdf_1_1_stream.html#a3f05ffb18a1feb56c248c391a69f104b"> 57</a></span>  std::vector<float> <a class="code" href="struct_xdf_1_1_stream.html#a3f05ffb18a1feb56c248c391a69f104b">time_stamps</a>; </div><div class="line"><a name="l00058"></a><span class="lineno"><a class="line" href="struct_xdf_1_1_stream.html#a2dff1924d1f7de075df08c4001201d63"> 58</a></span>  std::string <a class="code" href="struct_xdf_1_1_stream.html#a2dff1924d1f7de075df08c4001201d63">streamHeader</a>; </div><div class="line"><a name="l00059"></a><span class="lineno"><a class="line" href="struct_xdf_1_1_stream.html#aecd1fdf80d421e2362eeee58b31d4e11"> 59</a></span>  std::string <a class="code" href="struct_xdf_1_1_stream.html#aecd1fdf80d421e2362eeee58b31d4e11">streamFooter</a>; </div><div class="line"><a name="l00061"></a><span class="lineno"> 61</span>  <span class="keyword">struct</span></div><div class="line"><a name="l00062"></a><span class="lineno"> 62</span>  {</div><div class="line"><a name="l00063"></a><span class="lineno"><a class="line" href="struct_xdf_1_1_stream.html#ab8fb7c3d645305e84f90d919f698082c"> 63</a></span>  <span class="keywordtype">int</span> <a class="code" href="struct_xdf_1_1_stream.html#ab8fb7c3d645305e84f90d919f698082c">channel_count</a>; </div><div class="line"><a name="l00064"></a><span class="lineno"><a class="line" href="struct_xdf_1_1_stream.html#a17696fc2ee37c1d79601fac1736deb35"> 64</a></span>  <span class="keywordtype">double</span> <a class="code" href="struct_xdf_1_1_stream.html#a17696fc2ee37c1d79601fac1736deb35">nominal_srate</a>; </div><div class="line"><a name="l00065"></a><span class="lineno"><a class="line" href="struct_xdf_1_1_stream.html#a112e1dcc0e4b7f9583755366da8c3c64"> 65</a></span>  std::string <a class="code" href="struct_xdf_1_1_stream.html#a112e1dcc0e4b7f9583755366da8c3c64">name</a>; </div><div class="line"><a name="l00066"></a><span class="lineno"><a class="line" href="struct_xdf_1_1_stream.html#a7e5aa085e48de871ea6661651b28e097"> 66</a></span>  std::string <a class="code" href="struct_xdf_1_1_stream.html#a7e5aa085e48de871ea6661651b28e097">type</a>; </div><div class="line"><a name="l00067"></a><span class="lineno"><a class="line" href="struct_xdf_1_1_stream.html#ad7b61b077e247ba57a18c182e285d0ad"> 67</a></span>  std::string <a class="code" href="struct_xdf_1_1_stream.html#ad7b61b077e247ba57a18c182e285d0ad">channel_format</a>;</div><div class="line"><a name="l00069"></a><span class="lineno"><a class="line" href="struct_xdf_1_1_stream.html#a71d987a538d0819cdbd58120d1a79ef5"> 69</a></span>  std::vector<std::map<std::string, std::string> > <a class="code" href="struct_xdf_1_1_stream.html#a71d987a538d0819cdbd58120d1a79ef5">channels</a>;</div><div class="line"><a name="l00071"></a><span class="lineno"><a class="line" href="struct_xdf_1_1_stream.html#a6f6328f0746591a3a471048b6b9bd258"> 71</a></span>  std::vector<std::pair<double, double> > <a class="code" href="struct_xdf_1_1_stream.html#a6f6328f0746591a3a471048b6b9bd258">clock_offsets</a>; </div><div class="line"><a name="l00073"></a><span class="lineno"><a class="line" href="struct_xdf_1_1_stream.html#a22a44cb3cd533ea668f9bb20dbc299de"> 73</a></span>  <span class="keywordtype">double</span> <a class="code" href="struct_xdf_1_1_stream.html#a22a44cb3cd533ea668f9bb20dbc299de">first_timestamp</a>; </div><div class="line"><a name="l00074"></a><span class="lineno"><a class="line" href="struct_xdf_1_1_stream.html#a9e05df342a36187ae492c75f10fc7713"> 74</a></span>  <span class="keywordtype">double</span> <a class="code" href="struct_xdf_1_1_stream.html#a9e05df342a36187ae492c75f10fc7713">last_timestamp</a>; </div><div class="line"><a name="l00075"></a><span class="lineno"><a class="line" href="struct_xdf_1_1_stream.html#a329234a46df00cd51a67a7f4f637c08a"> 75</a></span>  <span class="keywordtype">int</span> <a class="code" href="struct_xdf_1_1_stream.html#a329234a46df00cd51a67a7f4f637c08a">sample_count</a>; </div><div class="line"><a name="l00076"></a><span class="lineno"><a class="line" href="struct_xdf_1_1_stream.html#a9c1fbac049f7c15225de9fe9713abc0a"> 76</a></span>  <span class="keywordtype">double</span> <a class="code" href="struct_xdf_1_1_stream.html#a9c1fbac049f7c15225de9fe9713abc0a">measured_srate</a>; </div><div class="line"><a name="l00077"></a><span class="lineno"><a class="line" href="struct_xdf_1_1_stream.html#abeb1d2eb26a46eac34a478f04f5143d6"> 77</a></span>  <span class="keywordtype">double</span> <a class="code" href="struct_xdf_1_1_stream.html#abeb1d2eb26a46eac34a478f04f5143d6">effective_sample_rate</a>;</div><div class="line"><a name="l00078"></a><span class="lineno"> 78</span>  } <a class="code" href="struct_xdf_1_1_stream.html#a732d62cf3216a3bd4990625b0eb723cf">info</a>; </div><div class="line"><a name="l00080"></a><span class="lineno"><a class="line" href="struct_xdf_1_1_stream.html#ab61b638cf490354db62fb7da999750cf"> 80</a></span>  <span class="keywordtype">float</span> <a class="code" href="struct_xdf_1_1_stream.html#a9e05df342a36187ae492c75f10fc7713">last_timestamp</a>{ 0 }; </div><div class="line"><a name="l00081"></a><span class="lineno"><a class="line" href="struct_xdf_1_1_stream.html#a49bbcb0c3130c3efef27ece47084b327"> 81</a></span>  <span class="keywordtype">float</span> <a class="code" href="struct_xdf_1_1_stream.html#a49bbcb0c3130c3efef27ece47084b327">sampling_interval</a>; </div><div class="line"><a name="l00082"></a><span class="lineno"><a class="line" href="struct_xdf_1_1_stream.html#a6bc91dcf23e551a9adbc415b562f3a79"> 82</a></span>  std::vector<double> <a class="code" href="struct_xdf_1_1_stream.html#a6bc91dcf23e551a9adbc415b562f3a79">clock_times</a>;</div><div class="line"><a name="l00083"></a><span class="lineno"><a class="line" href="struct_xdf_1_1_stream.html#a988989603854812cb693e56ff352a753"> 83</a></span>  std::vector<double> <a class="code" href="struct_xdf_1_1_stream.html#a988989603854812cb693e56ff352a753">clock_values</a>;</div><div class="line"><a name="l00084"></a><span class="lineno"> 84</span>  };</div><div class="line"><a name="l00085"></a><span class="lineno"> 85</span> </div><div class="line"><a name="l00086"></a><span class="lineno"> 86</span>  <span class="comment">//XDF properties=================================================================================</span></div><div class="line"><a name="l00087"></a><span class="lineno"> 87</span> </div><div class="line"><a name="l00088"></a><span class="lineno"><a class="line" href="class_xdf.html#acc12687ca26e8352afb960d459c5947a"> 88</a></span>  std::vector<Stream> <a class="code" href="class_xdf.html#acc12687ca26e8352afb960d459c5947a">streams</a>; </div><div class="line"><a name="l00089"></a><span class="lineno"><a class="line" href="class_xdf.html#a1d7401eb1557b2f34ac0ff4b9f79d04f"> 89</a></span>  <span class="keywordtype">float</span> <a class="code" href="class_xdf.html#a1d7401eb1557b2f34ac0ff4b9f79d04f">version</a>; </div><div class="line"><a name="l00091"></a><span class="lineno"><a class="line" href="class_xdf.html#ac0b5d7d53fb28832594718cc16f65184"> 91</a></span>  uint64_t <a class="code" href="class_xdf.html#ac0b5d7d53fb28832594718cc16f65184">totalLen</a> = 0; </div><div class="line"><a name="l00094"></a><span class="lineno"><a class="line" href="class_xdf.html#a44da046e191b2ae90b9bfe4de8d58ea3"> 94</a></span>  <span class="keywordtype">float</span> <a class="code" href="class_xdf.html#a44da046e191b2ae90b9bfe4de8d58ea3">minTS</a> = 0; </div><div class="line"><a name="l00095"></a><span class="lineno"><a class="line" href="class_xdf.html#a6874a847c980f296ebbcf703fa48096a"> 95</a></span>  <span class="keywordtype">float</span> <a class="code" href="class_xdf.html#a6874a847c980f296ebbcf703fa48096a">maxTS</a> = 0; </div><div class="line"><a name="l00096"></a><span class="lineno"><a class="line" href="class_xdf.html#a9b4fc485a140ba5020a48ca5fa2e45ea"> 96</a></span>  <span class="keywordtype">size_t</span> <a class="code" href="class_xdf.html#a9b4fc485a140ba5020a48ca5fa2e45ea">totalCh</a> = 0; </div><div class="line"><a name="l00097"></a><span class="lineno"><a class="line" href="class_xdf.html#ac65175994e0e2eeec4dd2f4688cd2040"> 97</a></span>  <span class="keywordtype">int</span> <a class="code" href="class_xdf.html#ac65175994e0e2eeec4dd2f4688cd2040">majSR</a> = 0; </div><div class="line"><a name="l00098"></a><span class="lineno"><a class="line" href="class_xdf.html#a3cb480731a20caa480e3e6744acb562c"> 98</a></span>  <span class="keywordtype">int</span> <a class="code" href="class_xdf.html#a3cb480731a20caa480e3e6744acb562c">maxSR</a> = 0; </div><div class="line"><a name="l00099"></a><span class="lineno"><a class="line" href="class_xdf.html#aa02e5a435186cdabbaf2487068c53dbc"> 99</a></span>  std::vector<int> <a class="code" href="class_xdf.html#aa02e5a435186cdabbaf2487068c53dbc">streamMap</a>;</div><div class="line"><a name="l00107"></a><span class="lineno"><a class="line" href="class_xdf.html#a4e3322abfe4d533d6b7a96cbbea7271a"> 107</a></span>  <span class="keyword">typedef</span> std::string <a class="code" href="class_xdf.html#a4e3322abfe4d533d6b7a96cbbea7271a">eventName</a>;</div><div class="line"><a name="l00113"></a><span class="lineno"><a class="line" href="class_xdf.html#a1fbf3d641262cc1daade33eca1789990"> 113</a></span>  <span class="keyword">typedef</span> <span class="keywordtype">float</span> <a class="code" href="class_xdf.html#a1fbf3d641262cc1daade33eca1789990">eventTimeStamp</a>;</div><div class="line"><a name="l00114"></a><span class="lineno"> 114</span> </div><div class="line"><a name="l00115"></a><span class="lineno"><a class="line" href="class_xdf.html#a45004fc495cad33768fae80b996a68db"> 115</a></span>  std::vector<std::pair<std::pair<eventName, eventTimeStamp>, <span class="keywordtype">int</span>> > <a class="code" href="class_xdf.html#a45004fc495cad33768fae80b996a68db">eventMap</a>;</div><div class="line"><a name="l00117"></a><span class="lineno"><a class="line" href="class_xdf.html#a26a2b517f020dc9f188c2277c76add85"> 117</a></span>  std::vector<std::string> <a class="code" href="class_xdf.html#a26a2b517f020dc9f188c2277c76add85">dictionary</a>;</div><div class="line"><a name="l00118"></a><span class="lineno"><a class="line" href="class_xdf.html#a4acb87e86380bf7266976cd6c4cb3826"> 118</a></span>  std::vector<uint16_t> <a class="code" href="class_xdf.html#a4acb87e86380bf7266976cd6c4cb3826">eventType</a>; </div><div class="line"><a name="l00119"></a><span class="lineno"><a class="line" href="class_xdf.html#a250d6f79d0333887393eab248fee3c93"> 119</a></span>  std::vector<std::string> <a class="code" href="class_xdf.html#a250d6f79d0333887393eab248fee3c93">labels</a>; </div><div class="line"><a name="l00120"></a><span class="lineno"><a class="line" href="class_xdf.html#add8aceaf68ad49b708f4df29f439778d"> 120</a></span>  std::set<double> <a class="code" href="class_xdf.html#add8aceaf68ad49b708f4df29f439778d">sampleRateMap</a>; </div><div class="line"><a name="l00121"></a><span class="lineno"><a class="line" href="class_xdf.html#a1a2b080f29080a5c521de907769d9419"> 121</a></span>  std::vector<float> <a class="code" href="class_xdf.html#a1a2b080f29080a5c521de907769d9419">offsets</a>; </div><div class="line"><a name="l00123"></a><span class="lineno"><a class="line" href="class_xdf.html#a1e46bbbf31121fb394aa8cf5c10d10b0"> 123</a></span>  std::string <a class="code" href="class_xdf.html#a1e46bbbf31121fb394aa8cf5c10d10b0">fileHeader</a>; </div><div class="line"><a name="l00124"></a><span class="lineno"><a class="line" href="class_xdf.html#a83d5309d854b1052fa575b539a69c58d"> 124</a></span>  <span class="keywordtype">int</span> <a class="code" href="class_xdf.html#a83d5309d854b1052fa575b539a69c58d">userAddedStream</a> { 0 }; </div><div class="line"><a name="l00127"></a><span class="lineno"><a class="line" href="class_xdf.html#a7b1496a8667d67b90836696a1e2da618"> 127</a></span>  std::vector<std::pair<std::string, double> > <a class="code" href="class_xdf.html#a7b1496a8667d67b90836696a1e2da618">userCreatedEvents</a>;</div><div class="line"><a name="l00129"></a><span class="lineno"> 129</span>  <span class="comment">//Public Functions==============================================================================================</span></div><div class="line"><a name="l00130"></a><span class="lineno"> 130</span> </div><div class="line"><a name="l00142"></a><span class="lineno"> 142</span>  <span class="keywordtype">void</span> <a class="code" href="class_xdf.html#aa7dc1ef8c04216d703604bf868146428">adjustTotalLength</a>();</div><div class="line"><a name="l00143"></a><span class="lineno"> 143</span> </div><div class="line"><a name="l00154"></a><span class="lineno"> 154</span>  <span class="keywordtype">void</span> <a class="code" href="class_xdf.html#a75ef15a72071fe0d36ef6311214518fe">calcTotalLength</a>(<span class="keywordtype">int</span> sampleRate);</div><div class="line"><a name="l00155"></a><span class="lineno"> 155</span> </div><div class="line"><a name="l00160"></a><span class="lineno"> 160</span>  <span class="keywordtype">void</span> <a class="code" href="class_xdf.html#ad98829202c9ae64505c9ecc7796c8ddc">createLabels</a>();</div><div class="line"><a name="l00161"></a><span class="lineno"> 161</span> </div><div class="line"><a name="l00174"></a><span class="lineno"> 174</span>  <span class="keywordtype">void</span> <a class="code" href="class_xdf.html#a4d2c5859af84542a15a80c906465f4e3">detrend</a>();</div><div class="line"><a name="l00175"></a><span class="lineno"> 175</span> </div><div class="line"><a name="l00186"></a><span class="lineno"> 186</span>  <span class="keywordtype">void</span> <a class="code" href="class_xdf.html#a12332c25006e2c6d71883c368c3c1f61">freeUpTimeStamps</a>();</div><div class="line"><a name="l00187"></a><span class="lineno"> 187</span> </div><div class="line"><a name="l00193"></a><span class="lineno"> 193</span>  <span class="keywordtype">int</span> <a class="code" href="class_xdf.html#a993e94535d6d9e544a64ffbbb2bb4e8c">load_xdf</a>(std::string filename);</div><div class="line"><a name="l00194"></a><span class="lineno"> 194</span> </div><div class="line"><a name="l00200"></a><span class="lineno"> 200</span>  <span class="keywordtype">void</span> <a class="code" href="class_xdf.html#a67c5890ac84f257e91bdb93dcbe958ae">resample</a>(<span class="keywordtype">int</span> userSrate);</div><div class="line"><a name="l00201"></a><span class="lineno"> 201</span> </div><div class="line"><a name="l00208"></a><span class="lineno"> 208</span>  <span class="keywordtype">int</span> <a class="code" href="class_xdf.html#a072e657d7620d61080a15a215c691210">writeEventsToXDF</a>(std::string file_path);</div><div class="line"><a name="l00209"></a><span class="lineno"> 209</span> </div><div class="line"><a name="l00210"></a><span class="lineno"> 210</span>  <span class="comment">//Private Functions: Not intended to be used by external programs======================================</span></div><div class="line"><a name="l00211"></a><span class="lineno"> 211</span> </div><div class="line"><a name="l00212"></a><span class="lineno"> 212</span> <span class="keyword">private</span>:</div><div class="line"><a name="l00213"></a><span class="lineno"> 213</span> </div><div class="line"><a name="l00217"></a><span class="lineno"> 217</span>  <span class="keywordtype">void</span> calcEffectiveSrate();</div><div class="line"><a name="l00218"></a><span class="lineno"> 218</span> </div><div class="line"><a name="l00229"></a><span class="lineno"> 229</span>  <span class="keywordtype">void</span> calcTotalChannel();</div><div class="line"><a name="l00230"></a><span class="lineno"> 230</span> </div><div class="line"><a name="l00251"></a><span class="lineno"> 251</span>  <span class="keywordtype">void</span> findMajSR();</div><div class="line"><a name="l00252"></a><span class="lineno"> 252</span> </div><div class="line"><a name="l00259"></a><span class="lineno"> 259</span>  <span class="keywordtype">void</span> findMinMax();</div><div class="line"><a name="l00260"></a><span class="lineno"> 260</span> </div><div class="line"><a name="l00267"></a><span class="lineno"> 267</span>  <span class="keywordtype">void</span> getHighestSampleRate();</div><div class="line"><a name="l00268"></a><span class="lineno"> 268</span> </div><div class="line"><a name="l00274"></a><span class="lineno"> 274</span>  <span class="keywordtype">void</span> loadDictionary();</div><div class="line"><a name="l00275"></a><span class="lineno"> 275</span> </div><div class="line"><a name="l00281"></a><span class="lineno"> 281</span>  <span class="keywordtype">void</span> loadSampleRateMap();</div><div class="line"><a name="l00282"></a><span class="lineno"> 282</span> </div><div class="line"><a name="l00292"></a><span class="lineno"> 292</span>  uint64_t readLength(std::ifstream &file);</div><div class="line"><a name="l00293"></a><span class="lineno"> 293</span> };</div><div class="line"><a name="l00294"></a><span class="lineno"> 294</span> </div><div class="line"><a name="l00295"></a><span class="lineno"> 295</span> <span class="preprocessor">#endif // XDF_H</span></div><div class="ttc" id="class_xdf_html_a4e3322abfe4d533d6b7a96cbbea7271a"><div class="ttname"><a href="class_xdf.html#a4e3322abfe4d533d6b7a96cbbea7271a">Xdf::eventName</a></div><div class="ttdeci">std::string eventName</div><div class="ttdoc">Used as std::vector<std::pair<std::pair<eventName, eventTimeStamp>, int> > in eventMap. </div><div class="ttdef"><b>Definition:</b> xdf.h:107</div></div> +<div class="ttc" id="struct_xdf_1_1_stream_html_a9c1fbac049f7c15225de9fe9713abc0a"><div class="ttname"><a href="struct_xdf_1_1_stream.html#a9c1fbac049f7c15225de9fe9713abc0a">Xdf::Stream::measured_srate</a></div><div class="ttdeci">double measured_srate</div><div class="ttdef"><b>Definition:</b> xdf.h:76</div></div> +<div class="ttc" id="class_xdf_html_a26a2b517f020dc9f188c2277c76add85"><div class="ttname"><a href="class_xdf.html#a26a2b517f020dc9f188c2277c76add85">Xdf::dictionary</a></div><div class="ttdeci">std::vector< std::string > dictionary</div><div class="ttdef"><b>Definition:</b> xdf.h:117</div></div> +<div class="ttc" id="struct_xdf_1_1_stream_html_a9e05df342a36187ae492c75f10fc7713"><div class="ttname"><a href="struct_xdf_1_1_stream.html#a9e05df342a36187ae492c75f10fc7713">Xdf::Stream::last_timestamp</a></div><div class="ttdeci">double last_timestamp</div><div class="ttdef"><b>Definition:</b> xdf.h:74</div></div> +<div class="ttc" id="struct_xdf_1_1_stream_html_a988989603854812cb693e56ff352a753"><div class="ttname"><a href="struct_xdf_1_1_stream.html#a988989603854812cb693e56ff352a753">Xdf::Stream::clock_values</a></div><div class="ttdeci">std::vector< double > clock_values</div><div class="ttdef"><b>Definition:</b> xdf.h:83</div></div> +<div class="ttc" id="class_xdf_html_a12332c25006e2c6d71883c368c3c1f61"><div class="ttname"><a href="class_xdf.html#a12332c25006e2c6d71883c368c3c1f61">Xdf::freeUpTimeStamps</a></div><div class="ttdeci">void freeUpTimeStamps()</div><div class="ttdoc">Delete the time stamps vectors when no longer needed to release some memory. </div><div class="ttdef"><b>Definition:</b> xdf.cpp:760</div></div> +<div class="ttc" id="class_xdf_html_a7b1496a8667d67b90836696a1e2da618"><div class="ttname"><a href="class_xdf.html#a7b1496a8667d67b90836696a1e2da618">Xdf::userCreatedEvents</a></div><div class="ttdeci">std::vector< std::pair< std::string, double > > userCreatedEvents</div><div class="ttdef"><b>Definition:</b> xdf.h:127</div></div> +<div class="ttc" id="class_xdf_html_a83d5309d854b1052fa575b539a69c58d"><div class="ttname"><a href="class_xdf.html#a83d5309d854b1052fa575b539a69c58d">Xdf::userAddedStream</a></div><div class="ttdeci">int userAddedStream</div><div class="ttdef"><b>Definition:</b> xdf.h:124</div></div> +<div class="ttc" id="class_xdf_html_ac65175994e0e2eeec4dd2f4688cd2040"><div class="ttname"><a href="class_xdf.html#ac65175994e0e2eeec4dd2f4688cd2040">Xdf::majSR</a></div><div class="ttdeci">int majSR</div><div class="ttdef"><b>Definition:</b> xdf.h:97</div></div> +<div class="ttc" id="class_xdf_html_a9b4fc485a140ba5020a48ca5fa2e45ea"><div class="ttname"><a href="class_xdf.html#a9b4fc485a140ba5020a48ca5fa2e45ea">Xdf::totalCh</a></div><div class="ttdeci">size_t totalCh</div><div class="ttdef"><b>Definition:</b> xdf.h:96</div></div> +<div class="ttc" id="class_xdf_html_a44da046e191b2ae90b9bfe4de8d58ea3"><div class="ttname"><a href="class_xdf.html#a44da046e191b2ae90b9bfe4de8d58ea3">Xdf::minTS</a></div><div class="ttdeci">float minTS</div><div class="ttdef"><b>Definition:</b> xdf.h:94</div></div> +<div class="ttc" id="struct_xdf_1_1_stream_html_aecd1fdf80d421e2362eeee58b31d4e11"><div class="ttname"><a href="struct_xdf_1_1_stream.html#aecd1fdf80d421e2362eeee58b31d4e11">Xdf::Stream::streamFooter</a></div><div class="ttdeci">std::string streamFooter</div><div class="ttdef"><b>Definition:</b> xdf.h:59</div></div> +<div class="ttc" id="class_xdf_html_a4acb87e86380bf7266976cd6c4cb3826"><div class="ttname"><a href="class_xdf.html#a4acb87e86380bf7266976cd6c4cb3826">Xdf::eventType</a></div><div class="ttdeci">std::vector< uint16_t > eventType</div><div class="ttdef"><b>Definition:</b> xdf.h:118</div></div> +<div class="ttc" id="struct_xdf_1_1_stream_html_a6bc91dcf23e551a9adbc415b562f3a79"><div class="ttname"><a href="struct_xdf_1_1_stream.html#a6bc91dcf23e551a9adbc415b562f3a79">Xdf::Stream::clock_times</a></div><div class="ttdeci">std::vector< double > clock_times</div><div class="ttdef"><b>Definition:</b> xdf.h:82</div></div> +<div class="ttc" id="struct_xdf_1_1_stream_html"><div class="ttname"><a href="struct_xdf_1_1_stream.html">Xdf::Stream</a></div><div class="ttdef"><b>Definition:</b> xdf.h:53</div></div> +<div class="ttc" id="class_xdf_html_a6874a847c980f296ebbcf703fa48096a"><div class="ttname"><a href="class_xdf.html#a6874a847c980f296ebbcf703fa48096a">Xdf::maxTS</a></div><div class="ttdeci">float maxTS</div><div class="ttdef"><b>Definition:</b> xdf.h:95</div></div> +<div class="ttc" id="class_xdf_html_a4d2c5859af84542a15a80c906465f4e3"><div class="ttname"><a href="class_xdf.html#a4d2c5859af84542a15a80c906465f4e3">Xdf::detrend</a></div><div class="ttdeci">void detrend()</div><div class="ttdoc">Subtract the entire channel by its mean. </div><div class="ttdef"><b>Definition:</b> xdf.cpp:803</div></div> +<div class="ttc" id="struct_xdf_1_1_stream_html_adfdeb5f6220da9fe671d3f37e27ed0bb"><div class="ttname"><a href="struct_xdf_1_1_stream.html#adfdeb5f6220da9fe671d3f37e27ed0bb">Xdf::Stream::time_series</a></div><div class="ttdeci">std::vector< std::vector< float > > time_series</div><div class="ttdoc">A 2D vector which stores the time series of a stream. Each row represents a channel. </div><div class="ttdef"><b>Definition:</b> xdf.h:56</div></div> +<div class="ttc" id="struct_xdf_1_1_stream_html_a7e5aa085e48de871ea6661651b28e097"><div class="ttname"><a href="struct_xdf_1_1_stream.html#a7e5aa085e48de871ea6661651b28e097">Xdf::Stream::type</a></div><div class="ttdeci">std::string type</div><div class="ttdef"><b>Definition:</b> xdf.h:66</div></div> +<div class="ttc" id="class_xdf_html_acc12687ca26e8352afb960d459c5947a"><div class="ttname"><a href="class_xdf.html#acc12687ca26e8352afb960d459c5947a">Xdf::streams</a></div><div class="ttdeci">std::vector< Stream > streams</div><div class="ttdef"><b>Definition:</b> xdf.h:88</div></div> +<div class="ttc" id="class_xdf_html_aa7dc1ef8c04216d703604bf868146428"><div class="ttname"><a href="class_xdf.html#aa7dc1ef8c04216d703604bf868146428">Xdf::adjustTotalLength</a></div><div class="ttdeci">void adjustTotalLength()</div><div class="ttdoc">Adjust totalLen to avoid possible deviation. </div><div class="ttdef"><b>Definition:</b> xdf.cpp:776</div></div> +<div class="ttc" id="struct_xdf_1_1_stream_html_a112e1dcc0e4b7f9583755366da8c3c64"><div class="ttname"><a href="struct_xdf_1_1_stream.html#a112e1dcc0e4b7f9583755366da8c3c64">Xdf::Stream::name</a></div><div class="ttdeci">std::string name</div><div class="ttdef"><b>Definition:</b> xdf.h:65</div></div> +<div class="ttc" id="class_xdf_html_a072e657d7620d61080a15a215c691210"><div class="ttname"><a href="class_xdf.html#a072e657d7620d61080a15a215c691210">Xdf::writeEventsToXDF</a></div><div class="ttdeci">int writeEventsToXDF(std::string file_path)</div><div class="ttdoc">writeEventsToXDF </div><div class="ttdef"><b>Definition:</b> xdf.cpp:851</div></div> +<div class="ttc" id="class_xdf_html_a45004fc495cad33768fae80b996a68db"><div class="ttname"><a href="class_xdf.html#a45004fc495cad33768fae80b996a68db">Xdf::eventMap</a></div><div class="ttdeci">std::vector< std::pair< std::pair< eventName, eventTimeStamp >, int > > eventMap</div><div class="ttdef"><b>Definition:</b> xdf.h:115</div></div> +<div class="ttc" id="class_xdf_html_a1fbf3d641262cc1daade33eca1789990"><div class="ttname"><a href="class_xdf.html#a1fbf3d641262cc1daade33eca1789990">Xdf::eventTimeStamp</a></div><div class="ttdeci">float eventTimeStamp</div><div class="ttdoc">Used as std::vector<std::pair<std::pair<eventName, eventTimeStamp>, int> > in eventMap. </div><div class="ttdef"><b>Definition:</b> xdf.h:113</div></div> +<div class="ttc" id="class_xdf_html"><div class="ttname"><a href="class_xdf.html">Xdf</a></div><div class="ttdef"><b>Definition:</b> xdf.h:37</div></div> +<div class="ttc" id="class_xdf_html_ad98829202c9ae64505c9ecc7796c8ddc"><div class="ttname"><a href="class_xdf.html#ad98829202c9ae64505c9ecc7796c8ddc">Xdf::createLabels</a></div><div class="ttdeci">void createLabels()</div><div class="ttdoc">Create labels for each channel and store them in labels vector. </div><div class="ttdef"><b>Definition:</b> xdf.cpp:940</div></div> +<div class="ttc" id="class_xdf_html_a67c5890ac84f257e91bdb93dcbe958ae"><div class="ttname"><a href="class_xdf.html#a67c5890ac84f257e91bdb93dcbe958ae">Xdf::resample</a></div><div class="ttdeci">void resample(int userSrate)</div><div class="ttdoc">Resample all streams and channel to a chosen sample rate. </div><div class="ttdef"><b>Definition:</b> xdf.cpp:537</div></div> +<div class="ttc" id="struct_xdf_1_1_stream_html_ab8fb7c3d645305e84f90d919f698082c"><div class="ttname"><a href="struct_xdf_1_1_stream.html#ab8fb7c3d645305e84f90d919f698082c">Xdf::Stream::channel_count</a></div><div class="ttdeci">int channel_count</div><div class="ttdef"><b>Definition:</b> xdf.h:63</div></div> +<div class="ttc" id="class_xdf_html_a7900b5a4f3792b9d59a5d43db821607e"><div class="ttname"><a href="class_xdf.html#a7900b5a4f3792b9d59a5d43db821607e">Xdf::Xdf</a></div><div class="ttdeci">Xdf()</div><div class="ttdoc">Default constructor with no parameter. </div><div class="ttdef"><b>Definition:</b> xdf.cpp:30</div></div> +<div class="ttc" id="class_xdf_html_a250d6f79d0333887393eab248fee3c93"><div class="ttname"><a href="class_xdf.html#a250d6f79d0333887393eab248fee3c93">Xdf::labels</a></div><div class="ttdeci">std::vector< std::string > labels</div><div class="ttdef"><b>Definition:</b> xdf.h:119</div></div> +<div class="ttc" id="class_xdf_html_a3cb480731a20caa480e3e6744acb562c"><div class="ttname"><a href="class_xdf.html#a3cb480731a20caa480e3e6744acb562c">Xdf::maxSR</a></div><div class="ttdeci">int maxSR</div><div class="ttdef"><b>Definition:</b> xdf.h:98</div></div> +<div class="ttc" id="struct_xdf_1_1_stream_html_ad7b61b077e247ba57a18c182e285d0ad"><div class="ttname"><a href="struct_xdf_1_1_stream.html#ad7b61b077e247ba57a18c182e285d0ad">Xdf::Stream::channel_format</a></div><div class="ttdeci">std::string channel_format</div><div class="ttdef"><b>Definition:</b> xdf.h:67</div></div> +<div class="ttc" id="struct_xdf_1_1_stream_html_a22a44cb3cd533ea668f9bb20dbc299de"><div class="ttname"><a href="struct_xdf_1_1_stream.html#a22a44cb3cd533ea668f9bb20dbc299de">Xdf::Stream::first_timestamp</a></div><div class="ttdeci">double first_timestamp</div><div class="ttdef"><b>Definition:</b> xdf.h:73</div></div> +<div class="ttc" id="struct_xdf_1_1_stream_html_a732d62cf3216a3bd4990625b0eb723cf"><div class="ttname"><a href="struct_xdf_1_1_stream.html#a732d62cf3216a3bd4990625b0eb723cf">Xdf::Stream::info</a></div><div class="ttdeci">struct Xdf::Stream::@0 info</div></div> +<div class="ttc" id="class_xdf_html_add8aceaf68ad49b708f4df29f439778d"><div class="ttname"><a href="class_xdf.html#add8aceaf68ad49b708f4df29f439778d">Xdf::sampleRateMap</a></div><div class="ttdeci">std::set< double > sampleRateMap</div><div class="ttdef"><b>Definition:</b> xdf.h:120</div></div> +<div class="ttc" id="class_xdf_html_aa02e5a435186cdabbaf2487068c53dbc"><div class="ttname"><a href="class_xdf.html#aa02e5a435186cdabbaf2487068c53dbc">Xdf::streamMap</a></div><div class="ttdeci">std::vector< int > streamMap</div><div class="ttdef"><b>Definition:</b> xdf.h:99</div></div> +<div class="ttc" id="struct_xdf_1_1_stream_html_a49bbcb0c3130c3efef27ece47084b327"><div class="ttname"><a href="struct_xdf_1_1_stream.html#a49bbcb0c3130c3efef27ece47084b327">Xdf::Stream::sampling_interval</a></div><div class="ttdeci">float sampling_interval</div><div class="ttdef"><b>Definition:</b> xdf.h:81</div></div> +<div class="ttc" id="class_xdf_html_a1d7401eb1557b2f34ac0ff4b9f79d04f"><div class="ttname"><a href="class_xdf.html#a1d7401eb1557b2f34ac0ff4b9f79d04f">Xdf::version</a></div><div class="ttdeci">float version</div><div class="ttdef"><b>Definition:</b> xdf.h:89</div></div> +<div class="ttc" id="class_xdf_html_a1a2b080f29080a5c521de907769d9419"><div class="ttname"><a href="class_xdf.html#a1a2b080f29080a5c521de907769d9419">Xdf::offsets</a></div><div class="ttdeci">std::vector< float > offsets</div><div class="ttdef"><b>Definition:</b> xdf.h:121</div></div> +<div class="ttc" id="struct_xdf_1_1_stream_html_abeb1d2eb26a46eac34a478f04f5143d6"><div class="ttname"><a href="struct_xdf_1_1_stream.html#abeb1d2eb26a46eac34a478f04f5143d6">Xdf::Stream::effective_sample_rate</a></div><div class="ttdeci">double effective_sample_rate</div><div class="ttdef"><b>Definition:</b> xdf.h:77</div></div> +<div class="ttc" id="class_xdf_html_ac0b5d7d53fb28832594718cc16f65184"><div class="ttname"><a href="class_xdf.html#ac0b5d7d53fb28832594718cc16f65184">Xdf::totalLen</a></div><div class="ttdeci">uint64_t totalLen</div><div class="ttdef"><b>Definition:</b> xdf.h:91</div></div> +<div class="ttc" id="class_xdf_html_a75ef15a72071fe0d36ef6311214518fe"><div class="ttname"><a href="class_xdf.html#a75ef15a72071fe0d36ef6311214518fe">Xdf::calcTotalLength</a></div><div class="ttdeci">void calcTotalLength(int sampleRate)</div><div class="ttdoc">Calculate the globle length (in samples). </div><div class="ttdef"><b>Definition:</b> xdf.cpp:755</div></div> +<div class="ttc" id="class_xdf_html_a993e94535d6d9e544a64ffbbb2bb4e8c"><div class="ttname"><a href="class_xdf.html#a993e94535d6d9e544a64ffbbb2bb4e8c">Xdf::load_xdf</a></div><div class="ttdeci">int load_xdf(std::string filename)</div><div class="ttdoc">The main function of loading an XDF file. </div><div class="ttdef"><b>Definition:</b> xdf.cpp:34</div></div> +<div class="ttc" id="struct_xdf_1_1_stream_html_a329234a46df00cd51a67a7f4f637c08a"><div class="ttname"><a href="struct_xdf_1_1_stream.html#a329234a46df00cd51a67a7f4f637c08a">Xdf::Stream::sample_count</a></div><div class="ttdeci">int sample_count</div><div class="ttdef"><b>Definition:</b> xdf.h:75</div></div> +<div class="ttc" id="class_xdf_html_a1e46bbbf31121fb394aa8cf5c10d10b0"><div class="ttname"><a href="class_xdf.html#a1e46bbbf31121fb394aa8cf5c10d10b0">Xdf::fileHeader</a></div><div class="ttdeci">std::string fileHeader</div><div class="ttdef"><b>Definition:</b> xdf.h:123</div></div> +<div class="ttc" id="struct_xdf_1_1_stream_html_a6f6328f0746591a3a471048b6b9bd258"><div class="ttname"><a href="struct_xdf_1_1_stream.html#a6f6328f0746591a3a471048b6b9bd258">Xdf::Stream::clock_offsets</a></div><div class="ttdeci">std::vector< std::pair< double, double > > clock_offsets</div><div class="ttdef"><b>Definition:</b> xdf.h:71</div></div> +<div class="ttc" id="struct_xdf_1_1_stream_html_a2dff1924d1f7de075df08c4001201d63"><div class="ttname"><a href="struct_xdf_1_1_stream.html#a2dff1924d1f7de075df08c4001201d63">Xdf::Stream::streamHeader</a></div><div class="ttdeci">std::string streamHeader</div><div class="ttdef"><b>Definition:</b> xdf.h:58</div></div> +<div class="ttc" id="struct_xdf_1_1_stream_html_a71d987a538d0819cdbd58120d1a79ef5"><div class="ttname"><a href="struct_xdf_1_1_stream.html#a71d987a538d0819cdbd58120d1a79ef5">Xdf::Stream::channels</a></div><div class="ttdeci">std::vector< std::map< std::string, std::string > > channels</div><div class="ttdef"><b>Definition:</b> xdf.h:69</div></div> +<div class="ttc" id="struct_xdf_1_1_stream_html_a3f05ffb18a1feb56c248c391a69f104b"><div class="ttname"><a href="struct_xdf_1_1_stream.html#a3f05ffb18a1feb56c248c391a69f104b">Xdf::Stream::time_stamps</a></div><div class="ttdeci">std::vector< float > time_stamps</div><div class="ttdef"><b>Definition:</b> xdf.h:57</div></div> +<div class="ttc" id="struct_xdf_1_1_stream_html_a17696fc2ee37c1d79601fac1736deb35"><div class="ttname"><a href="struct_xdf_1_1_stream.html#a17696fc2ee37c1d79601fac1736deb35">Xdf::Stream::nominal_srate</a></div><div class="ttdeci">double nominal_srate</div><div class="ttdef"><b>Definition:</b> xdf.h:64</div></div> +</div><!-- fragment --></div><!-- contents --> +</div><!-- doc-content --> +<!-- start footer part --> +<div id="nav-path" class="navpath"><!-- id is needed for treeview function! --> + <ul> + <li class="navelem"><a class="el" href="dir_f396504afdc959660871b003fa10164d.html">Documents</a></li><li class="navelem"><a class="el" href="dir_7e17ac9cf8fba2cb04bc248c85b0ceb7.html">GitHub</a></li><li class="navelem"><a class="el" href="dir_72e8b74943c3b26541b5ac1c7338ef6f.html">libxdf</a></li><li class="navelem"><a class="el" href="dir_689ecbe789caf2e46799b15492db205c.html">libxdf</a></li><li class="navelem"><a class="el" href="xdf_8h.html">xdf.h</a></li> + <li class="footer">Generated by + <a href="http://www.doxygen.org/index.html"> + <img class="footer" src="doxygen.png" alt="doxygen"/></a> 1.8.12 </li> + </ul> +</div> +</body> +</html> diff --git a/C++/pugixml/pugiconfig.hpp b/C++/pugixml/pugiconfig.hpp new file mode 100644 index 0000000..2d1e6aa --- /dev/null +++ b/C++/pugixml/pugiconfig.hpp @@ -0,0 +1,74 @@ +/** + * pugixml parser - version 1.8 + * -------------------------------------------------------- + * Copyright (C) 2006-2016, by Arseny Kapoulkine (arseny.kapoulkine@gmail.com) + * Report bugs and download new versions at http://pugixml.org/ + * + * This library is distributed under the MIT License. See notice at the end + * of this file. + * + * This work is based on the pugxml parser, which is: + * Copyright (C) 2003, by Kristen Wegner (kristen@tima.net) + */ + +#ifndef HEADER_PUGICONFIG_HPP +#define HEADER_PUGICONFIG_HPP + +// Uncomment this to enable wchar_t mode +// #define PUGIXML_WCHAR_MODE + +// Uncomment this to enable compact mode +// #define PUGIXML_COMPACT + +// Uncomment this to disable XPath +// #define PUGIXML_NO_XPATH + +// Uncomment this to disable STL +// #define PUGIXML_NO_STL + +// Uncomment this to disable exceptions +// #define PUGIXML_NO_EXCEPTIONS + +// Set this to control attributes for public classes/functions, i.e.: +// #define PUGIXML_API __declspec(dllexport) // to export all public symbols from DLL +// #define PUGIXML_CLASS __declspec(dllimport) // to import all classes from DLL +// #define PUGIXML_FUNCTION __fastcall // to set calling conventions to all public functions to fastcall +// In absence of PUGIXML_CLASS/PUGIXML_FUNCTION definitions PUGIXML_API is used instead + +// Tune these constants to adjust memory-related behavior +// #define PUGIXML_MEMORY_PAGE_SIZE 32768 +// #define PUGIXML_MEMORY_OUTPUT_STACK 10240 +// #define PUGIXML_MEMORY_XPATH_PAGE_SIZE 4096 + +// Uncomment this to switch to header-only version +// #define PUGIXML_HEADER_ONLY + +// Uncomment this to enable long long support +// #define PUGIXML_HAS_LONG_LONG + +#endif + +/** + * Copyright (c) 2006-2016 Arseny Kapoulkine + * + * Permission is hereby granted, free of charge, to any person + * obtaining a copy of this software and associated documentation + * files (the "Software"), to deal in the Software without + * restriction, including without limitation the rights to use, + * copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the + * Software is furnished to do so, subject to the following + * conditions: + * + * The above copyright notice and this permission notice shall be + * included in all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, + * EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES + * OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND + * NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT + * HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, + * WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING + * FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR + * OTHER DEALINGS IN THE SOFTWARE. + */ diff --git a/C++/pugixml/pugixml.cpp b/C++/pugixml/pugixml.cpp new file mode 100644 index 0000000..cac51a5 --- /dev/null +++ b/C++/pugixml/pugixml.cpp @@ -0,0 +1,12622 @@ +/** + * pugixml parser - version 1.8 + * -------------------------------------------------------- + * Copyright (C) 2006-2016, by Arseny Kapoulkine (arseny.kapoulkine@gmail.com) + * Report bugs and download new versions at http://pugixml.org/ + * + * This library is distributed under the MIT License. See notice at the end + * of this file. + * + * This work is based on the pugxml parser, which is: + * Copyright (C) 2003, by Kristen Wegner (kristen@tima.net) + */ + +#ifndef SOURCE_PUGIXML_CPP +#define SOURCE_PUGIXML_CPP + +#include "pugixml.hpp" + +#include <stdlib.h> +#include <stdio.h> +#include <string.h> +#include <assert.h> +#include <limits.h> + +#ifdef PUGIXML_WCHAR_MODE +# include <wchar.h> +#endif + +#ifndef PUGIXML_NO_XPATH +# include <math.h> +# include <float.h> +# ifdef PUGIXML_NO_EXCEPTIONS +# include <setjmp.h> +# endif +#endif + +#ifndef PUGIXML_NO_STL +# include <istream> +# include <ostream> +# include <string> +#endif + +// For placement new +#include <new> + +#ifdef _MSC_VER +# pragma warning(push) +# pragma warning(disable: 4127) // conditional expression is constant +# pragma warning(disable: 4324) // structure was padded due to __declspec(align()) +# pragma warning(disable: 4611) // interaction between '_setjmp' and C++ object destruction is non-portable +# pragma warning(disable: 4702) // unreachable code +# pragma warning(disable: 4996) // this function or variable may be unsafe +# pragma warning(disable: 4793) // function compiled as native: presence of '_setjmp' makes a function unmanaged +#endif + +#ifdef __INTEL_COMPILER +# pragma warning(disable: 177) // function was declared but never referenced +# pragma warning(disable: 279) // controlling expression is constant +# pragma warning(disable: 1478 1786) // function was declared "deprecated" +# pragma warning(disable: 1684) // conversion from pointer to same-sized integral type +#endif + +#if defined(__BORLANDC__) && defined(PUGIXML_HEADER_ONLY) +# pragma warn -8080 // symbol is declared but never used; disabling this inside push/pop bracket does not make the warning go away +#endif + +#ifdef __BORLANDC__ +# pragma option push +# pragma warn -8008 // condition is always false +# pragma warn -8066 // unreachable code +#endif + +#ifdef __SNC__ +// Using diag_push/diag_pop does not disable the warnings inside templates due to a compiler bug +# pragma diag_suppress=178 // function was declared but never referenced +# pragma diag_suppress=237 // controlling expression is constant +#endif + +// Inlining controls +#if defined(_MSC_VER) && _MSC_VER >= 1300 +# define PUGI__NO_INLINE __declspec(noinline) +#elif defined(__GNUC__) +# define PUGI__NO_INLINE __attribute__((noinline)) +#else +# define PUGI__NO_INLINE +#endif + +// Branch weight controls +#if defined(__GNUC__) +# define PUGI__UNLIKELY(cond) __builtin_expect(cond, 0) +#else +# define PUGI__UNLIKELY(cond) (cond) +#endif + +// Simple static assertion +#define PUGI__STATIC_ASSERT(cond) { static const char condition_failed[(cond) ? 1 : -1] = {0}; (void)condition_failed[0]; } + +// Digital Mars C++ bug workaround for passing char loaded from memory via stack +#ifdef __DMC__ +# define PUGI__DMC_VOLATILE volatile +#else +# define PUGI__DMC_VOLATILE +#endif + +// Borland C++ bug workaround for not defining ::memcpy depending on header include order (can't always use std::memcpy because some compilers don't have it at all) +#if defined(__BORLANDC__) && !defined(__MEM_H_USING_LIST) +using std::memcpy; +using std::memmove; +using std::memset; +#endif + +// Some MinGW versions have headers that erroneously omit LLONG_MIN/LLONG_MAX/ULLONG_MAX definitions in strict ANSI mode +#if defined(PUGIXML_HAS_LONG_LONG) && defined(__MINGW32__) && defined(__STRICT_ANSI__) && !defined(LLONG_MAX) && !defined(LLONG_MIN) && !defined(ULLONG_MAX) +# define LLONG_MAX 9223372036854775807LL +# define LLONG_MIN (-LLONG_MAX-1) +# define ULLONG_MAX (2ULL*LLONG_MAX+1) +#endif + +// In some environments MSVC is a compiler but the CRT lacks certain MSVC-specific features +#if defined(_MSC_VER) && !defined(__S3E__) +# define PUGI__MSVC_CRT_VERSION _MSC_VER +#endif + +#ifdef PUGIXML_HEADER_ONLY +# define PUGI__NS_BEGIN namespace pugi { namespace impl { +# define PUGI__NS_END } } +# define PUGI__FN inline +# define PUGI__FN_NO_INLINE inline +#else +# if defined(_MSC_VER) && _MSC_VER < 1300 // MSVC6 seems to have an amusing bug with anonymous namespaces inside namespaces +# define PUGI__NS_BEGIN namespace pugi { namespace impl { +# define PUGI__NS_END } } +# else +# define PUGI__NS_BEGIN namespace pugi { namespace impl { namespace { +# define PUGI__NS_END } } } +# endif +# define PUGI__FN +# define PUGI__FN_NO_INLINE PUGI__NO_INLINE +#endif + +// uintptr_t +#if (defined(_MSC_VER) && _MSC_VER < 1600) || (defined(__BORLANDC__) && __BORLANDC__ < 0x561) +namespace pugi +{ +# ifndef _UINTPTR_T_DEFINED + typedef size_t uintptr_t; +# endif + + typedef unsigned __int8 uint8_t; + typedef unsigned __int16 uint16_t; + typedef unsigned __int32 uint32_t; +} +#else +# include <stdint.h> +#endif + +// Memory allocation +PUGI__NS_BEGIN + PUGI__FN void* default_allocate(size_t size) + { + return malloc(size); + } + + PUGI__FN void default_deallocate(void* ptr) + { + free(ptr); + } + + template <typename T> + struct xml_memory_management_function_storage + { + static allocation_function allocate; + static deallocation_function deallocate; + }; + + // Global allocation functions are stored in class statics so that in header mode linker deduplicates them + // Without a template<> we'll get multiple definitions of the same static + template <typename T> allocation_function xml_memory_management_function_storage<T>::allocate = default_allocate; + template <typename T> deallocation_function xml_memory_management_function_storage<T>::deallocate = default_deallocate; + + typedef xml_memory_management_function_storage<int> xml_memory; +PUGI__NS_END + +// String utilities +PUGI__NS_BEGIN + // Get string length + PUGI__FN size_t strlength(const char_t* s) + { + assert(s); + + #ifdef PUGIXML_WCHAR_MODE + return wcslen(s); + #else + return strlen(s); + #endif + } + + // Compare two strings + PUGI__FN bool strequal(const char_t* src, const char_t* dst) + { + assert(src && dst); + + #ifdef PUGIXML_WCHAR_MODE + return wcscmp(src, dst) == 0; + #else + return strcmp(src, dst) == 0; + #endif + } + + // Compare lhs with [rhs_begin, rhs_end) + PUGI__FN bool strequalrange(const char_t* lhs, const char_t* rhs, size_t count) + { + for (size_t i = 0; i < count; ++i) + if (lhs[i] != rhs[i]) + return false; + + return lhs[count] == 0; + } + + // Get length of wide string, even if CRT lacks wide character support + PUGI__FN size_t strlength_wide(const wchar_t* s) + { + assert(s); + + #ifdef PUGIXML_WCHAR_MODE + return wcslen(s); + #else + const wchar_t* end = s; + while (*end) end++; + return static_cast<size_t>(end - s); + #endif + } +PUGI__NS_END + +// auto_ptr-like object for exception recovery +PUGI__NS_BEGIN + template <typename T> struct auto_deleter + { + typedef void (*D)(T*); + + T* data; + D deleter; + + auto_deleter(T* data_, D deleter_): data(data_), deleter(deleter_) + { + } + + ~auto_deleter() + { + if (data) deleter(data); + } + + T* release() + { + T* result = data; + data = 0; + return result; + } + }; +PUGI__NS_END + +#ifdef PUGIXML_COMPACT +PUGI__NS_BEGIN + class compact_hash_table + { + public: + compact_hash_table(): _items(0), _capacity(0), _count(0) + { + } + + void clear() + { + if (_items) + { + xml_memory::deallocate(_items); + _items = 0; + _capacity = 0; + _count = 0; + } + } + + void** find(const void* key) + { + assert(key); + + if (_capacity == 0) return 0; + + size_t hashmod = _capacity - 1; + size_t bucket = hash(key) & hashmod; + + for (size_t probe = 0; probe <= hashmod; ++probe) + { + item_t& probe_item = _items[bucket]; + + if (probe_item.key == key) + return &probe_item.value; + + if (probe_item.key == 0) + return 0; + + // hash collision, quadratic probing + bucket = (bucket + probe + 1) & hashmod; + } + + assert(false && "Hash table is full"); + return 0; + } + + void** insert(const void* key) + { + assert(key); + assert(_capacity != 0 && _count < _capacity - _capacity / 4); + + size_t hashmod = _capacity - 1; + size_t bucket = hash(key) & hashmod; + + for (size_t probe = 0; probe <= hashmod; ++probe) + { + item_t& probe_item = _items[bucket]; + + if (probe_item.key == 0) + { + probe_item.key = key; + _count++; + return &probe_item.value; + } + + if (probe_item.key == key) + return &probe_item.value; + + // hash collision, quadratic probing + bucket = (bucket + probe + 1) & hashmod; + } + + assert(false && "Hash table is full"); + return 0; + } + + bool reserve() + { + if (_count + 16 >= _capacity - _capacity / 4) + return rehash(); + + return true; + } + + private: + struct item_t + { + const void* key; + void* value; + }; + + item_t* _items; + size_t _capacity; + + size_t _count; + + bool rehash(); + + static unsigned int hash(const void* key) + { + unsigned int h = static_cast<unsigned int>(reinterpret_cast<uintptr_t>(key)); + + // MurmurHash3 32-bit finalizer + h ^= h >> 16; + h *= 0x85ebca6bu; + h ^= h >> 13; + h *= 0xc2b2ae35u; + h ^= h >> 16; + + return h; + } + }; + + PUGI__FN_NO_INLINE bool compact_hash_table::rehash() + { + compact_hash_table rt; + rt._capacity = (_capacity == 0) ? 32 : _capacity * 2; + rt._items = static_cast<item_t*>(xml_memory::allocate(sizeof(item_t) * rt._capacity)); + + if (!rt._items) + return false; + + memset(rt._items, 0, sizeof(item_t) * rt._capacity); + + for (size_t i = 0; i < _capacity; ++i) + if (_items[i].key) + *rt.insert(_items[i].key) = _items[i].value; + + if (_items) + xml_memory::deallocate(_items); + + _capacity = rt._capacity; + _items = rt._items; + + assert(_count == rt._count); + + return true; + } + +PUGI__NS_END +#endif + +PUGI__NS_BEGIN +#ifdef PUGIXML_COMPACT + static const uintptr_t xml_memory_block_alignment = 4; +#else + static const uintptr_t xml_memory_block_alignment = sizeof(void*); +#endif + + // extra metadata bits + static const uintptr_t xml_memory_page_contents_shared_mask = 64; + static const uintptr_t xml_memory_page_name_allocated_mask = 32; + static const uintptr_t xml_memory_page_value_allocated_mask = 16; + static const uintptr_t xml_memory_page_type_mask = 15; + + // combined masks for string uniqueness + static const uintptr_t xml_memory_page_name_allocated_or_shared_mask = xml_memory_page_name_allocated_mask | xml_memory_page_contents_shared_mask; + static const uintptr_t xml_memory_page_value_allocated_or_shared_mask = xml_memory_page_value_allocated_mask | xml_memory_page_contents_shared_mask; + +#ifdef PUGIXML_COMPACT + #define PUGI__GETHEADER_IMPL(object, page, flags) // unused + #define PUGI__GETPAGE_IMPL(header) (header).get_page() +#else + #define PUGI__GETHEADER_IMPL(object, page, flags) (((reinterpret_cast<char*>(object) - reinterpret_cast<char*>(page)) << 8) | (flags)) + // this macro casts pointers through void* to avoid 'cast increases required alignment of target type' warnings + #define PUGI__GETPAGE_IMPL(header) static_cast<impl::xml_memory_page*>(const_cast<void*>(static_cast<const void*>(reinterpret_cast<const char*>(&header) - (header >> 8)))) +#endif + + #define PUGI__GETPAGE(n) PUGI__GETPAGE_IMPL((n)->header) + #define PUGI__NODETYPE(n) static_cast<xml_node_type>((n)->header & impl::xml_memory_page_type_mask) + + struct xml_allocator; + + struct xml_memory_page + { + static xml_memory_page* construct(void* memory) + { + xml_memory_page* result = static_cast<xml_memory_page*>(memory); + + result->allocator = 0; + result->prev = 0; + result->next = 0; + result->busy_size = 0; + result->freed_size = 0; + + #ifdef PUGIXML_COMPACT + result->compact_string_base = 0; + result->compact_shared_parent = 0; + result->compact_page_marker = 0; + #endif + + return result; + } + + xml_allocator* allocator; + + xml_memory_page* prev; + xml_memory_page* next; + + size_t busy_size; + size_t freed_size; + + #ifdef PUGIXML_COMPACT + char_t* compact_string_base; + void* compact_shared_parent; + uint32_t* compact_page_marker; + #endif + }; + + static const size_t xml_memory_page_size = + #ifdef PUGIXML_MEMORY_PAGE_SIZE + (PUGIXML_MEMORY_PAGE_SIZE) + #else + 32768 + #endif + - sizeof(xml_memory_page); + + struct xml_memory_string_header + { + uint16_t page_offset; // offset from page->data + uint16_t full_size; // 0 if string occupies whole page + }; + + struct xml_allocator + { + xml_allocator(xml_memory_page* root): _root(root), _busy_size(root->busy_size) + { + #ifdef PUGIXML_COMPACT + _hash = 0; + #endif + } + + xml_memory_page* allocate_page(size_t data_size) + { + size_t size = sizeof(xml_memory_page) + data_size; + + // allocate block with some alignment, leaving memory for worst-case padding + void* memory = xml_memory::allocate(size); + if (!memory) return 0; + + // prepare page structure + xml_memory_page* page = xml_memory_page::construct(memory); + assert(page); + + page->allocator = _root->allocator; + + return page; + } + + static void deallocate_page(xml_memory_page* page) + { + xml_memory::deallocate(page); + } + + void* allocate_memory_oob(size_t size, xml_memory_page*& out_page); + + void* allocate_memory(size_t size, xml_memory_page*& out_page) + { + if (PUGI__UNLIKELY(_busy_size + size > xml_memory_page_size)) + return allocate_memory_oob(size, out_page); + + void* buf = reinterpret_cast<char*>(_root) + sizeof(xml_memory_page) + _busy_size; + + _busy_size += size; + + out_page = _root; + + return buf; + } + + #ifdef PUGIXML_COMPACT + void* allocate_object(size_t size, xml_memory_page*& out_page) + { + void* result = allocate_memory(size + sizeof(uint32_t), out_page); + if (!result) return 0; + + // adjust for marker + ptrdiff_t offset = static_cast<char*>(result) - reinterpret_cast<char*>(out_page->compact_page_marker); + + if (PUGI__UNLIKELY(static_cast<uintptr_t>(offset) >= 256 * xml_memory_block_alignment)) + { + // insert new marker + uint32_t* marker = static_cast<uint32_t*>(result); + + *marker = static_cast<uint32_t>(reinterpret_cast<char*>(marker) - reinterpret_cast<char*>(out_page)); + out_page->compact_page_marker = marker; + + // since we don't reuse the page space until we reallocate it, we can just pretend that we freed the marker block + // this will make sure deallocate_memory correctly tracks the size + out_page->freed_size += sizeof(uint32_t); + + return marker + 1; + } + else + { + // roll back uint32_t part + _busy_size -= sizeof(uint32_t); + + return result; + } + } + #else + void* allocate_object(size_t size, xml_memory_page*& out_page) + { + return allocate_memory(size, out_page); + } + #endif + + void deallocate_memory(void* ptr, size_t size, xml_memory_page* page) + { + if (page == _root) page->busy_size = _busy_size; + + assert(ptr >= reinterpret_cast<char*>(page) + sizeof(xml_memory_page) && ptr < reinterpret_cast<char*>(page) + sizeof(xml_memory_page) + page->busy_size); + (void)!ptr; + + page->freed_size += size; + assert(page->freed_size <= page->busy_size); + + if (page->freed_size == page->busy_size) + { + if (page->next == 0) + { + assert(_root == page); + + // top page freed, just reset sizes + page->busy_size = 0; + page->freed_size = 0; + + #ifdef PUGIXML_COMPACT + // reset compact state to maximize efficiency + page->compact_string_base = 0; + page->compact_shared_parent = 0; + page->compact_page_marker = 0; + #endif + + _busy_size = 0; + } + else + { + assert(_root != page); + assert(page->prev); + + // remove from the list + page->prev->next = page->next; + page->next->prev = page->prev; + + // deallocate + deallocate_page(page); + } + } + } + + char_t* allocate_string(size_t length) + { + static const size_t max_encoded_offset = (1 << 16) * xml_memory_block_alignment; + + PUGI__STATIC_ASSERT(xml_memory_page_size <= max_encoded_offset); + + // allocate memory for string and header block + size_t size = sizeof(xml_memory_string_header) + length * sizeof(char_t); + + // round size up to block alignment boundary + size_t full_size = (size + (xml_memory_block_alignment - 1)) & ~(xml_memory_block_alignment - 1); + + xml_memory_page* page; + xml_memory_string_header* header = static_cast<xml_memory_string_header*>(allocate_memory(full_size, page)); + + if (!header) return 0; + + // setup header + ptrdiff_t page_offset = reinterpret_cast<char*>(header) - reinterpret_cast<char*>(page) - sizeof(xml_memory_page); + + assert(page_offset % xml_memory_block_alignment == 0); + assert(page_offset >= 0 && static_cast<size_t>(page_offset) < max_encoded_offset); + header->page_offset = static_cast<uint16_t>(static_cast<size_t>(page_offset) / xml_memory_block_alignment); + + // full_size == 0 for large strings that occupy the whole page + assert(full_size % xml_memory_block_alignment == 0); + assert(full_size < max_encoded_offset || (page->busy_size == full_size && page_offset == 0)); + header->full_size = static_cast<uint16_t>(full_size < max_encoded_offset ? full_size / xml_memory_block_alignment : 0); + + // round-trip through void* to avoid 'cast increases required alignment of target type' warning + // header is guaranteed a pointer-sized alignment, which should be enough for char_t + return static_cast<char_t*>(static_cast<void*>(header + 1)); + } + + void deallocate_string(char_t* string) + { + // this function casts pointers through void* to avoid 'cast increases required alignment of target type' warnings + // we're guaranteed the proper (pointer-sized) alignment on the input string if it was allocated via allocate_string + + // get header + xml_memory_string_header* header = static_cast<xml_memory_string_header*>(static_cast<void*>(string)) - 1; + assert(header); + + // deallocate + size_t page_offset = sizeof(xml_memory_page) + header->page_offset * xml_memory_block_alignment; + xml_memory_page* page = reinterpret_cast<xml_memory_page*>(static_cast<void*>(reinterpret_cast<char*>(header) - page_offset)); + + // if full_size == 0 then this string occupies the whole page + size_t full_size = header->full_size == 0 ? page->busy_size : header->full_size * xml_memory_block_alignment; + + deallocate_memory(header, full_size, page); + } + + bool reserve() + { + #ifdef PUGIXML_COMPACT + return _hash->reserve(); + #else + return true; + #endif + } + + xml_memory_page* _root; + size_t _busy_size; + + #ifdef PUGIXML_COMPACT + compact_hash_table* _hash; + #endif + }; + + PUGI__FN_NO_INLINE void* xml_allocator::allocate_memory_oob(size_t size, xml_memory_page*& out_page) + { + const size_t large_allocation_threshold = xml_memory_page_size / 4; + + xml_memory_page* page = allocate_page(size <= large_allocation_threshold ? xml_memory_page_size : size); + out_page = page; + + if (!page) return 0; + + if (size <= large_allocation_threshold) + { + _root->busy_size = _busy_size; + + // insert page at the end of linked list + page->prev = _root; + _root->next = page; + _root = page; + + _busy_size = size; + } + else + { + // insert page before the end of linked list, so that it is deleted as soon as possible + // the last page is not deleted even if it's empty (see deallocate_memory) + assert(_root->prev); + + page->prev = _root->prev; + page->next = _root; + + _root->prev->next = page; + _root->prev = page; + + page->busy_size = size; + } + + return reinterpret_cast<char*>(page) + sizeof(xml_memory_page); + } +PUGI__NS_END + +#ifdef PUGIXML_COMPACT +PUGI__NS_BEGIN + static const uintptr_t compact_alignment_log2 = 2; + static const uintptr_t compact_alignment = 1 << compact_alignment_log2; + + class compact_header + { + public: + compact_header(xml_memory_page* page, unsigned int flags) + { + PUGI__STATIC_ASSERT(xml_memory_block_alignment == compact_alignment); + + ptrdiff_t offset = (reinterpret_cast<char*>(this) - reinterpret_cast<char*>(page->compact_page_marker)); + assert(offset % compact_alignment == 0 && static_cast<uintptr_t>(offset) < 256 * compact_alignment); + + _page = static_cast<unsigned char>(offset >> compact_alignment_log2); + _flags = static_cast<unsigned char>(flags); + } + + void operator&=(uintptr_t mod) + { + _flags &= static_cast<unsigned char>(mod); + } + + void operator|=(uintptr_t mod) + { + _flags |= static_cast<unsigned char>(mod); + } + + uintptr_t operator&(uintptr_t mod) const + { + return _flags & mod; + } + + xml_memory_page* get_page() const + { + // round-trip through void* to silence 'cast increases required alignment of target type' warnings + const char* page_marker = reinterpret_cast<const char*>(this) - (_page << compact_alignment_log2); + const char* page = page_marker - *reinterpret_cast<const uint32_t*>(static_cast<const void*>(page_marker)); + + return const_cast<xml_memory_page*>(reinterpret_cast<const xml_memory_page*>(static_cast<const void*>(page))); + } + + private: + unsigned char _page; + unsigned char _flags; + }; + + PUGI__FN xml_memory_page* compact_get_page(const void* object, int header_offset) + { + const compact_header* header = reinterpret_cast<const compact_header*>(static_cast<const char*>(object) - header_offset); + + return header->get_page(); + } + + template <int header_offset, typename T> PUGI__FN_NO_INLINE T* compact_get_value(const void* object) + { + return static_cast<T*>(*compact_get_page(object, header_offset)->allocator->_hash->find(object)); + } + + template <int header_offset, typename T> PUGI__FN_NO_INLINE void compact_set_value(const void* object, T* value) + { + *compact_get_page(object, header_offset)->allocator->_hash->insert(object) = value; + } + + template <typename T, int header_offset, int start = -126> class compact_pointer + { + public: + compact_pointer(): _data(0) + { + } + + void operator=(const compact_pointer& rhs) + { + *this = rhs + 0; + } + + void operator=(T* value) + { + if (value) + { + // value is guaranteed to be compact-aligned; 'this' is not + // our decoding is based on 'this' aligned to compact alignment downwards (see operator T*) + // so for negative offsets (e.g. -3) we need to adjust the diff by compact_alignment - 1 to + // compensate for arithmetic shift rounding for negative values + ptrdiff_t diff = reinterpret_cast<char*>(value) - reinterpret_cast<char*>(this); + ptrdiff_t offset = ((diff + int(compact_alignment - 1)) >> compact_alignment_log2) - start; + + if (static_cast<uintptr_t>(offset) <= 253) + _data = static_cast<unsigned char>(offset + 1); + else + { + compact_set_value<header_offset>(this, value); + + _data = 255; + } + } + else + _data = 0; + } + + operator T*() const + { + if (_data) + { + if (_data < 255) + { + uintptr_t base = reinterpret_cast<uintptr_t>(this) & ~(compact_alignment - 1); + + return reinterpret_cast<T*>(base + ((_data - 1 + start) << compact_alignment_log2)); + } + else + return compact_get_value<header_offset, T>(this); + } + else + return 0; + } + + T* operator->() const + { + return *this; + } + + private: + unsigned char _data; + }; + + template <typename T, int header_offset> class compact_pointer_parent + { + public: + compact_pointer_parent(): _data(0) + { + } + + void operator=(const compact_pointer_parent& rhs) + { + *this = rhs + 0; + } + + void operator=(T* value) + { + if (value) + { + // value is guaranteed to be compact-aligned; 'this' is not + // our decoding is based on 'this' aligned to compact alignment downwards (see operator T*) + // so for negative offsets (e.g. -3) we need to adjust the diff by compact_alignment - 1 to + // compensate for arithmetic shift behavior for negative values + ptrdiff_t diff = reinterpret_cast<char*>(value) - reinterpret_cast<char*>(this); + ptrdiff_t offset = ((diff + int(compact_alignment - 1)) >> compact_alignment_log2) + 65533; + + if (static_cast<uintptr_t>(offset) <= 65533) + { + _data = static_cast<unsigned short>(offset + 1); + } + else + { + xml_memory_page* page = compact_get_page(this, header_offset); + + if (PUGI__UNLIKELY(page->compact_shared_parent == 0)) + page->compact_shared_parent = value; + + if (page->compact_shared_parent == value) + { + _data = 65534; + } + else + { + compact_set_value<header_offset>(this, value); + + _data = 65535; + } + } + } + else + { + _data = 0; + } + } + + operator T*() const + { + if (_data) + { + if (_data < 65534) + { + uintptr_t base = reinterpret_cast<uintptr_t>(this) & ~(compact_alignment - 1); + + return reinterpret_cast<T*>(base + ((_data - 1 - 65533) << compact_alignment_log2)); + } + else if (_data == 65534) + return static_cast<T*>(compact_get_page(this, header_offset)->compact_shared_parent); + else + return compact_get_value<header_offset, T>(this); + } + else + return 0; + } + + T* operator->() const + { + return *this; + } + + private: + uint16_t _data; + }; + + template <int header_offset, int base_offset> class compact_string + { + public: + compact_string(): _data(0) + { + } + + void operator=(const compact_string& rhs) + { + *this = rhs + 0; + } + + void operator=(char_t* value) + { + if (value) + { + xml_memory_page* page = compact_get_page(this, header_offset); + + if (PUGI__UNLIKELY(page->compact_string_base == 0)) + page->compact_string_base = value; + + ptrdiff_t offset = value - page->compact_string_base; + + if (static_cast<uintptr_t>(offset) < (65535 << 7)) + { + // round-trip through void* to silence 'cast increases required alignment of target type' warnings + uint16_t* base = reinterpret_cast<uint16_t*>(static_cast<void*>(reinterpret_cast<char*>(this) - base_offset)); + + if (*base == 0) + { + *base = static_cast<uint16_t>((offset >> 7) + 1); + _data = static_cast<unsigned char>((offset & 127) + 1); + } + else + { + ptrdiff_t remainder = offset - ((*base - 1) << 7); + + if (static_cast<uintptr_t>(remainder) <= 253) + { + _data = static_cast<unsigned char>(remainder + 1); + } + else + { + compact_set_value<header_offset>(this, value); + + _data = 255; + } + } + } + else + { + compact_set_value<header_offset>(this, value); + + _data = 255; + } + } + else + { + _data = 0; + } + } + + operator char_t*() const + { + if (_data) + { + if (_data < 255) + { + xml_memory_page* page = compact_get_page(this, header_offset); + + // round-trip through void* to silence 'cast increases required alignment of target type' warnings + const uint16_t* base = reinterpret_cast<const uint16_t*>(static_cast<const void*>(reinterpret_cast<const char*>(this) - base_offset)); + assert(*base); + + ptrdiff_t offset = ((*base - 1) << 7) + (_data - 1); + + return page->compact_string_base + offset; + } + else + { + return compact_get_value<header_offset, char_t>(this); + } + } + else + return 0; + } + + private: + unsigned char _data; + }; +PUGI__NS_END +#endif + +#ifdef PUGIXML_COMPACT +namespace pugi +{ + struct xml_attribute_struct + { + xml_attribute_struct(impl::xml_memory_page* page): header(page, 0), namevalue_base(0) + { + PUGI__STATIC_ASSERT(sizeof(xml_attribute_struct) == 8); + } + + impl::compact_header header; + + uint16_t namevalue_base; + + impl::compact_string<4, 2> name; + impl::compact_string<5, 3> value; + + impl::compact_pointer<xml_attribute_struct, 6> prev_attribute_c; + impl::compact_pointer<xml_attribute_struct, 7, 0> next_attribute; + }; + + struct xml_node_struct + { + xml_node_struct(impl::xml_memory_page* page, xml_node_type type): header(page, type), namevalue_base(0) + { + PUGI__STATIC_ASSERT(sizeof(xml_node_struct) == 12); + } + + impl::compact_header header; + + uint16_t namevalue_base; + + impl::compact_string<4, 2> name; + impl::compact_string<5, 3> value; + + impl::compact_pointer_parent<xml_node_struct, 6> parent; + + impl::compact_pointer<xml_node_struct, 8, 0> first_child; + + impl::compact_pointer<xml_node_struct, 9> prev_sibling_c; + impl::compact_pointer<xml_node_struct, 10, 0> next_sibling; + + impl::compact_pointer<xml_attribute_struct, 11, 0> first_attribute; + }; +} +#else +namespace pugi +{ + struct xml_attribute_struct + { + xml_attribute_struct(impl::xml_memory_page* page): name(0), value(0), prev_attribute_c(0), next_attribute(0) + { + header = PUGI__GETHEADER_IMPL(this, page, 0); + } + + uintptr_t header; + + char_t* name; + char_t* value; + + xml_attribute_struct* prev_attribute_c; + xml_attribute_struct* next_attribute; + }; + + struct xml_node_struct + { + xml_node_struct(impl::xml_memory_page* page, xml_node_type type): name(0), value(0), parent(0), first_child(0), prev_sibling_c(0), next_sibling(0), first_attribute(0) + { + header = PUGI__GETHEADER_IMPL(this, page, type); + } + + uintptr_t header; + + char_t* name; + char_t* value; + + xml_node_struct* parent; + + xml_node_struct* first_child; + + xml_node_struct* prev_sibling_c; + xml_node_struct* next_sibling; + + xml_attribute_struct* first_attribute; + }; +} +#endif + +PUGI__NS_BEGIN + struct xml_extra_buffer + { + char_t* buffer; + xml_extra_buffer* next; + }; + + struct xml_document_struct: public xml_node_struct, public xml_allocator + { + xml_document_struct(xml_memory_page* page): xml_node_struct(page, node_document), xml_allocator(page), buffer(0), extra_buffers(0) + { + } + + const char_t* buffer; + + xml_extra_buffer* extra_buffers; + + #ifdef PUGIXML_COMPACT + compact_hash_table hash; + #endif + }; + + template <typename Object> inline xml_allocator& get_allocator(const Object* object) + { + assert(object); + + return *PUGI__GETPAGE(object)->allocator; + } + + template <typename Object> inline xml_document_struct& get_document(const Object* object) + { + assert(object); + + return *static_cast<xml_document_struct*>(PUGI__GETPAGE(object)->allocator); + } +PUGI__NS_END + +// Low-level DOM operations +PUGI__NS_BEGIN + inline xml_attribute_struct* allocate_attribute(xml_allocator& alloc) + { + xml_memory_page* page; + void* memory = alloc.allocate_object(sizeof(xml_attribute_struct), page); + if (!memory) return 0; + + return new (memory) xml_attribute_struct(page); + } + + inline xml_node_struct* allocate_node(xml_allocator& alloc, xml_node_type type) + { + xml_memory_page* page; + void* memory = alloc.allocate_object(sizeof(xml_node_struct), page); + if (!memory) return 0; + + return new (memory) xml_node_struct(page, type); + } + + inline void destroy_attribute(xml_attribute_struct* a, xml_allocator& alloc) + { + if (a->header & impl::xml_memory_page_name_allocated_mask) + alloc.deallocate_string(a->name); + + if (a->header & impl::xml_memory_page_value_allocated_mask) + alloc.deallocate_string(a->value); + + alloc.deallocate_memory(a, sizeof(xml_attribute_struct), PUGI__GETPAGE(a)); + } + + inline void destroy_node(xml_node_struct* n, xml_allocator& alloc) + { + if (n->header & impl::xml_memory_page_name_allocated_mask) + alloc.deallocate_string(n->name); + + if (n->header & impl::xml_memory_page_value_allocated_mask) + alloc.deallocate_string(n->value); + + for (xml_attribute_struct* attr = n->first_attribute; attr; ) + { + xml_attribute_struct* next = attr->next_attribute; + + destroy_attribute(attr, alloc); + + attr = next; + } + + for (xml_node_struct* child = n->first_child; child; ) + { + xml_node_struct* next = child->next_sibling; + + destroy_node(child, alloc); + + child = next; + } + + alloc.deallocate_memory(n, sizeof(xml_node_struct), PUGI__GETPAGE(n)); + } + + inline void append_node(xml_node_struct* child, xml_node_struct* node) + { + child->parent = node; + + xml_node_struct* head = node->first_child; + + if (head) + { + xml_node_struct* tail = head->prev_sibling_c; + + tail->next_sibling = child; + child->prev_sibling_c = tail; + head->prev_sibling_c = child; + } + else + { + node->first_child = child; + child->prev_sibling_c = child; + } + } + + inline void prepend_node(xml_node_struct* child, xml_node_struct* node) + { + child->parent = node; + + xml_node_struct* head = node->first_child; + + if (head) + { + child->prev_sibling_c = head->prev_sibling_c; + head->prev_sibling_c = child; + } + else + child->prev_sibling_c = child; + + child->next_sibling = head; + node->first_child = child; + } + + inline void insert_node_after(xml_node_struct* child, xml_node_struct* node) + { + xml_node_struct* parent = node->parent; + + child->parent = parent; + + if (node->next_sibling) + node->next_sibling->prev_sibling_c = child; + else + parent->first_child->prev_sibling_c = child; + + child->next_sibling = node->next_sibling; + child->prev_sibling_c = node; + + node->next_sibling = child; + } + + inline void insert_node_before(xml_node_struct* child, xml_node_struct* node) + { + xml_node_struct* parent = node->parent; + + child->parent = parent; + + if (node->prev_sibling_c->next_sibling) + node->prev_sibling_c->next_sibling = child; + else + parent->first_child = child; + + child->prev_sibling_c = node->prev_sibling_c; + child->next_sibling = node; + + node->prev_sibling_c = child; + } + + inline void remove_node(xml_node_struct* node) + { + xml_node_struct* parent = node->parent; + + if (node->next_sibling) + node->next_sibling->prev_sibling_c = node->prev_sibling_c; + else + parent->first_child->prev_sibling_c = node->prev_sibling_c; + + if (node->prev_sibling_c->next_sibling) + node->prev_sibling_c->next_sibling = node->next_sibling; + else + parent->first_child = node->next_sibling; + + node->parent = 0; + node->prev_sibling_c = 0; + node->next_sibling = 0; + } + + inline void append_attribute(xml_attribute_struct* attr, xml_node_struct* node) + { + xml_attribute_struct* head = node->first_attribute; + + if (head) + { + xml_attribute_struct* tail = head->prev_attribute_c; + + tail->next_attribute = attr; + attr->prev_attribute_c = tail; + head->prev_attribute_c = attr; + } + else + { + node->first_attribute = attr; + attr->prev_attribute_c = attr; + } + } + + inline void prepend_attribute(xml_attribute_struct* attr, xml_node_struct* node) + { + xml_attribute_struct* head = node->first_attribute; + + if (head) + { + attr->prev_attribute_c = head->prev_attribute_c; + head->prev_attribute_c = attr; + } + else + attr->prev_attribute_c = attr; + + attr->next_attribute = head; + node->first_attribute = attr; + } + + inline void insert_attribute_after(xml_attribute_struct* attr, xml_attribute_struct* place, xml_node_struct* node) + { + if (place->next_attribute) + place->next_attribute->prev_attribute_c = attr; + else + node->first_attribute->prev_attribute_c = attr; + + attr->next_attribute = place->next_attribute; + attr->prev_attribute_c = place; + place->next_attribute = attr; + } + + inline void insert_attribute_before(xml_attribute_struct* attr, xml_attribute_struct* place, xml_node_struct* node) + { + if (place->prev_attribute_c->next_attribute) + place->prev_attribute_c->next_attribute = attr; + else + node->first_attribute = attr; + + attr->prev_attribute_c = place->prev_attribute_c; + attr->next_attribute = place; + place->prev_attribute_c = attr; + } + + inline void remove_attribute(xml_attribute_struct* attr, xml_node_struct* node) + { + if (attr->next_attribute) + attr->next_attribute->prev_attribute_c = attr->prev_attribute_c; + else + node->first_attribute->prev_attribute_c = attr->prev_attribute_c; + + if (attr->prev_attribute_c->next_attribute) + attr->prev_attribute_c->next_attribute = attr->next_attribute; + else + node->first_attribute = attr->next_attribute; + + attr->prev_attribute_c = 0; + attr->next_attribute = 0; + } + + PUGI__FN_NO_INLINE xml_node_struct* append_new_node(xml_node_struct* node, xml_allocator& alloc, xml_node_type type = node_element) + { + if (!alloc.reserve()) return 0; + + xml_node_struct* child = allocate_node(alloc, type); + if (!child) return 0; + + append_node(child, node); + + return child; + } + + PUGI__FN_NO_INLINE xml_attribute_struct* append_new_attribute(xml_node_struct* node, xml_allocator& alloc) + { + if (!alloc.reserve()) return 0; + + xml_attribute_struct* attr = allocate_attribute(alloc); + if (!attr) return 0; + + append_attribute(attr, node); + + return attr; + } +PUGI__NS_END + +// Helper classes for code generation +PUGI__NS_BEGIN + struct opt_false + { + enum { value = 0 }; + }; + + struct opt_true + { + enum { value = 1 }; + }; +PUGI__NS_END + +// Unicode utilities +PUGI__NS_BEGIN + inline uint16_t endian_swap(uint16_t value) + { + return static_cast<uint16_t>(((value & 0xff) << 8) | (value >> 8)); + } + + inline uint32_t endian_swap(uint32_t value) + { + return ((value & 0xff) << 24) | ((value & 0xff00) << 8) | ((value & 0xff0000) >> 8) | (value >> 24); + } + + struct utf8_counter + { + typedef size_t value_type; + + static value_type low(value_type result, uint32_t ch) + { + // U+0000..U+007F + if (ch < 0x80) return result + 1; + // U+0080..U+07FF + else if (ch < 0x800) return result + 2; + // U+0800..U+FFFF + else return result + 3; + } + + static value_type high(value_type result, uint32_t) + { + // U+10000..U+10FFFF + return result + 4; + } + }; + + struct utf8_writer + { + typedef uint8_t* value_type; + + static value_type low(value_type result, uint32_t ch) + { + // U+0000..U+007F + if (ch < 0x80) + { + *result = static_cast<uint8_t>(ch); + return result + 1; + } + // U+0080..U+07FF + else if (ch < 0x800) + { + result[0] = static_cast<uint8_t>(0xC0 | (ch >> 6)); + result[1] = static_cast<uint8_t>(0x80 | (ch & 0x3F)); + return result + 2; + } + // U+0800..U+FFFF + else + { + result[0] = static_cast<uint8_t>(0xE0 | (ch >> 12)); + result[1] = static_cast<uint8_t>(0x80 | ((ch >> 6) & 0x3F)); + result[2] = static_cast<uint8_t>(0x80 | (ch & 0x3F)); + return result + 3; + } + } + + static value_type high(value_type result, uint32_t ch) + { + // U+10000..U+10FFFF + result[0] = static_cast<uint8_t>(0xF0 | (ch >> 18)); + result[1] = static_cast<uint8_t>(0x80 | ((ch >> 12) & 0x3F)); + result[2] = static_cast<uint8_t>(0x80 | ((ch >> 6) & 0x3F)); + result[3] = static_cast<uint8_t>(0x80 | (ch & 0x3F)); + return result + 4; + } + + static value_type any(value_type result, uint32_t ch) + { + return (ch < 0x10000) ? low(result, ch) : high(result, ch); + } + }; + + struct utf16_counter + { + typedef size_t value_type; + + static value_type low(value_type result, uint32_t) + { + return result + 1; + } + + static value_type high(value_type result, uint32_t) + { + return result + 2; + } + }; + + struct utf16_writer + { + typedef uint16_t* value_type; + + static value_type low(value_type result, uint32_t ch) + { + *result = static_cast<uint16_t>(ch); + + return result + 1; + } + + static value_type high(value_type result, uint32_t ch) + { + uint32_t msh = static_cast<uint32_t>(ch - 0x10000) >> 10; + uint32_t lsh = static_cast<uint32_t>(ch - 0x10000) & 0x3ff; + + result[0] = static_cast<uint16_t>(0xD800 + msh); + result[1] = static_cast<uint16_t>(0xDC00 + lsh); + + return result + 2; + } + + static value_type any(value_type result, uint32_t ch) + { + return (ch < 0x10000) ? low(result, ch) : high(result, ch); + } + }; + + struct utf32_counter + { + typedef size_t value_type; + + static value_type low(value_type result, uint32_t) + { + return result + 1; + } + + static value_type high(value_type result, uint32_t) + { + return result + 1; + } + }; + + struct utf32_writer + { + typedef uint32_t* value_type; + + static value_type low(value_type result, uint32_t ch) + { + *result = ch; + + return result + 1; + } + + static value_type high(value_type result, uint32_t ch) + { + *result = ch; + + return result + 1; + } + + static value_type any(value_type result, uint32_t ch) + { + *result = ch; + + return result + 1; + } + }; + + struct latin1_writer + { + typedef uint8_t* value_type; + + static value_type low(value_type result, uint32_t ch) + { + *result = static_cast<uint8_t>(ch > 255 ? '?' : ch); + + return result + 1; + } + + static value_type high(value_type result, uint32_t ch) + { + (void)ch; + + *result = '?'; + + return result + 1; + } + }; + + struct utf8_decoder + { + typedef uint8_t type; + + template <typename Traits> static inline typename Traits::value_type process(const uint8_t* data, size_t size, typename Traits::value_type result, Traits) + { + const uint8_t utf8_byte_mask = 0x3f; + + while (size) + { + uint8_t lead = *data; + + // 0xxxxxxx -> U+0000..U+007F + if (lead < 0x80) + { + result = Traits::low(result, lead); + data += 1; + size -= 1; + + // process aligned single-byte (ascii) blocks + if ((reinterpret_cast<uintptr_t>(data) & 3) == 0) + { + // round-trip through void* to silence 'cast increases required alignment of target type' warnings + while (size >= 4 && (*static_cast<const uint32_t*>(static_cast<const void*>(data)) & 0x80808080) == 0) + { + result = Traits::low(result, data[0]); + result = Traits::low(result, data[1]); + result = Traits::low(result, data[2]); + result = Traits::low(result, data[3]); + data += 4; + size -= 4; + } + } + } + // 110xxxxx -> U+0080..U+07FF + else if (static_cast<unsigned int>(lead - 0xC0) < 0x20 && size >= 2 && (data[1] & 0xc0) == 0x80) + { + result = Traits::low(result, ((lead & ~0xC0) << 6) | (data[1] & utf8_byte_mask)); + data += 2; + size -= 2; + } + // 1110xxxx -> U+0800-U+FFFF + else if (static_cast<unsigned int>(lead - 0xE0) < 0x10 && size >= 3 && (data[1] & 0xc0) == 0x80 && (data[2] & 0xc0) == 0x80) + { + result = Traits::low(result, ((lead & ~0xE0) << 12) | ((data[1] & utf8_byte_mask) << 6) | (data[2] & utf8_byte_mask)); + data += 3; + size -= 3; + } + // 11110xxx -> U+10000..U+10FFFF + else if (static_cast<unsigned int>(lead - 0xF0) < 0x08 && size >= 4 && (data[1] & 0xc0) == 0x80 && (data[2] & 0xc0) == 0x80 && (data[3] & 0xc0) == 0x80) + { + result = Traits::high(result, ((lead & ~0xF0) << 18) | ((data[1] & utf8_byte_mask) << 12) | ((data[2] & utf8_byte_mask) << 6) | (data[3] & utf8_byte_mask)); + data += 4; + size -= 4; + } + // 10xxxxxx or 11111xxx -> invalid + else + { + data += 1; + size -= 1; + } + } + + return result; + } + }; + + template <typename opt_swap> struct utf16_decoder + { + typedef uint16_t type; + + template <typename Traits> static inline typename Traits::value_type process(const uint16_t* data, size_t size, typename Traits::value_type result, Traits) + { + while (size) + { + uint16_t lead = opt_swap::value ? endian_swap(*data) : *data; + + // U+0000..U+D7FF + if (lead < 0xD800) + { + result = Traits::low(result, lead); + data += 1; + size -= 1; + } + // U+E000..U+FFFF + else if (static_cast<unsigned int>(lead - 0xE000) < 0x2000) + { + result = Traits::low(result, lead); + data += 1; + size -= 1; + } + // surrogate pair lead + else if (static_cast<unsigned int>(lead - 0xD800) < 0x400 && size >= 2) + { + uint16_t next = opt_swap::value ? endian_swap(data[1]) : data[1]; + + if (static_cast<unsigned int>(next - 0xDC00) < 0x400) + { + result = Traits::high(result, 0x10000 + ((lead & 0x3ff) << 10) + (next & 0x3ff)); + data += 2; + size -= 2; + } + else + { + data += 1; + size -= 1; + } + } + else + { + data += 1; + size -= 1; + } + } + + return result; + } + }; + + template <typename opt_swap> struct utf32_decoder + { + typedef uint32_t type; + + template <typename Traits> static inline typename Traits::value_type process(const uint32_t* data, size_t size, typename Traits::value_type result, Traits) + { + while (size) + { + uint32_t lead = opt_swap::value ? endian_swap(*data) : *data; + + // U+0000..U+FFFF + if (lead < 0x10000) + { + result = Traits::low(result, lead); + data += 1; + size -= 1; + } + // U+10000..U+10FFFF + else + { + result = Traits::high(result, lead); + data += 1; + size -= 1; + } + } + + return result; + } + }; + + struct latin1_decoder + { + typedef uint8_t type; + + template <typename Traits> static inline typename Traits::value_type process(const uint8_t* data, size_t size, typename Traits::value_type result, Traits) + { + while (size) + { + result = Traits::low(result, *data); + data += 1; + size -= 1; + } + + return result; + } + }; + + template <size_t size> struct wchar_selector; + + template <> struct wchar_selector<2> + { + typedef uint16_t type; + typedef utf16_counter counter; + typedef utf16_writer writer; + typedef utf16_decoder<opt_false> decoder; + }; + + template <> struct wchar_selector<4> + { + typedef uint32_t type; + typedef utf32_counter counter; + typedef utf32_writer writer; + typedef utf32_decoder<opt_false> decoder; + }; + + typedef wchar_selector<sizeof(wchar_t)>::counter wchar_counter; + typedef wchar_selector<sizeof(wchar_t)>::writer wchar_writer; + + struct wchar_decoder + { + typedef wchar_t type; + + template <typename Traits> static inline typename Traits::value_type process(const wchar_t* data, size_t size, typename Traits::value_type result, Traits traits) + { + typedef wchar_selector<sizeof(wchar_t)>::decoder decoder; + + return decoder::process(reinterpret_cast<const typename decoder::type*>(data), size, result, traits); + } + }; + +#ifdef PUGIXML_WCHAR_MODE + PUGI__FN void convert_wchar_endian_swap(wchar_t* result, const wchar_t* data, size_t length) + { + for (size_t i = 0; i < length; ++i) + result[i] = static_cast<wchar_t>(endian_swap(static_cast<wchar_selector<sizeof(wchar_t)>::type>(data[i]))); + } +#endif +PUGI__NS_END + +PUGI__NS_BEGIN + enum chartype_t + { + ct_parse_pcdata = 1, // \0, &, \r, < + ct_parse_attr = 2, // \0, &, \r, ', " + ct_parse_attr_ws = 4, // \0, &, \r, ', ", \n, tab + ct_space = 8, // \r, \n, space, tab + ct_parse_cdata = 16, // \0, ], >, \r + ct_parse_comment = 32, // \0, -, >, \r + ct_symbol = 64, // Any symbol > 127, a-z, A-Z, 0-9, _, :, -, . + ct_start_symbol = 128 // Any symbol > 127, a-z, A-Z, _, : + }; + + static const unsigned char chartype_table[256] = + { + 55, 0, 0, 0, 0, 0, 0, 0, 0, 12, 12, 0, 0, 63, 0, 0, // 0-15 + 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, // 16-31 + 8, 0, 6, 0, 0, 0, 7, 6, 0, 0, 0, 0, 0, 96, 64, 0, // 32-47 + 64, 64, 64, 64, 64, 64, 64, 64, 64, 64, 192, 0, 1, 0, 48, 0, // 48-63 + 0, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, // 64-79 + 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 0, 0, 16, 0, 192, // 80-95 + 0, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, // 96-111 + 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 0, 0, 0, 0, 0, // 112-127 + + 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, // 128+ + 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, + 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, + 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, + 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, + 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, + 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, + 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192, 192 + }; + + enum chartypex_t + { + ctx_special_pcdata = 1, // Any symbol >= 0 and < 32 (except \t, \r, \n), &, <, > + ctx_special_attr = 2, // Any symbol >= 0 and < 32 (except \t), &, <, >, " + ctx_start_symbol = 4, // Any symbol > 127, a-z, A-Z, _ + ctx_digit = 8, // 0-9 + ctx_symbol = 16 // Any symbol > 127, a-z, A-Z, 0-9, _, -, . + }; + + static const unsigned char chartypex_table[256] = + { + 3, 3, 3, 3, 3, 3, 3, 3, 3, 0, 2, 3, 3, 2, 3, 3, // 0-15 + 3, 3, 3, 3, 3, 3, 3, 3, 3, 3, 3, 3, 3, 3, 3, 3, // 16-31 + 0, 0, 2, 0, 0, 0, 3, 0, 0, 0, 0, 0, 0, 16, 16, 0, // 32-47 + 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 0, 0, 3, 0, 3, 0, // 48-63 + + 0, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, // 64-79 + 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 0, 0, 0, 0, 20, // 80-95 + 0, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, // 96-111 + 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 0, 0, 0, 0, 0, // 112-127 + + 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, // 128+ + 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, + 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, + 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, + 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, + 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, + 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, + 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20 + }; + +#ifdef PUGIXML_WCHAR_MODE + #define PUGI__IS_CHARTYPE_IMPL(c, ct, table) ((static_cast<unsigned int>(c) < 128 ? table[static_cast<unsigned int>(c)] : table[128]) & (ct)) +#else + #define PUGI__IS_CHARTYPE_IMPL(c, ct, table) (table[static_cast<unsigned char>(c)] & (ct)) +#endif + + #define PUGI__IS_CHARTYPE(c, ct) PUGI__IS_CHARTYPE_IMPL(c, ct, chartype_table) + #define PUGI__IS_CHARTYPEX(c, ct) PUGI__IS_CHARTYPE_IMPL(c, ct, chartypex_table) + + PUGI__FN bool is_little_endian() + { + unsigned int ui = 1; + + return *reinterpret_cast<unsigned char*>(&ui) == 1; + } + + PUGI__FN xml_encoding get_wchar_encoding() + { + PUGI__STATIC_ASSERT(sizeof(wchar_t) == 2 || sizeof(wchar_t) == 4); + + if (sizeof(wchar_t) == 2) + return is_little_endian() ? encoding_utf16_le : encoding_utf16_be; + else + return is_little_endian() ? encoding_utf32_le : encoding_utf32_be; + } + + PUGI__FN bool parse_declaration_encoding(const uint8_t* data, size_t size, const uint8_t*& out_encoding, size_t& out_length) + { + #define PUGI__SCANCHAR(ch) { if (offset >= size || data[offset] != ch) return false; offset++; } + #define PUGI__SCANCHARTYPE(ct) { while (offset < size && PUGI__IS_CHARTYPE(data[offset], ct)) offset++; } + + // check if we have a non-empty XML declaration + if (size < 6 || !((data[0] == '<') & (data[1] == '?') & (data[2] == 'x') & (data[3] == 'm') & (data[4] == 'l') && PUGI__IS_CHARTYPE(data[5], ct_space))) + return false; + + // scan XML declaration until the encoding field + for (size_t i = 6; i + 1 < size; ++i) + { + // declaration can not contain ? in quoted values + if (data[i] == '?') + return false; + + if (data[i] == 'e' && data[i + 1] == 'n') + { + size_t offset = i; + + // encoding follows the version field which can't contain 'en' so this has to be the encoding if XML is well formed + PUGI__SCANCHAR('e'); PUGI__SCANCHAR('n'); PUGI__SCANCHAR('c'); PUGI__SCANCHAR('o'); + PUGI__SCANCHAR('d'); PUGI__SCANCHAR('i'); PUGI__SCANCHAR('n'); PUGI__SCANCHAR('g'); + + // S? = S? + PUGI__SCANCHARTYPE(ct_space); + PUGI__SCANCHAR('='); + PUGI__SCANCHARTYPE(ct_space); + + // the only two valid delimiters are ' and " + uint8_t delimiter = (offset < size && data[offset] == '"') ? '"' : '\''; + + PUGI__SCANCHAR(delimiter); + + size_t start = offset; + + out_encoding = data + offset; + + PUGI__SCANCHARTYPE(ct_symbol); + + out_length = offset - start; + + PUGI__SCANCHAR(delimiter); + + return true; + } + } + + return false; + + #undef PUGI__SCANCHAR + #undef PUGI__SCANCHARTYPE + } + + PUGI__FN xml_encoding guess_buffer_encoding(const uint8_t* data, size_t size) + { + // skip encoding autodetection if input buffer is too small + if (size < 4) return encoding_utf8; + + uint8_t d0 = data[0], d1 = data[1], d2 = data[2], d3 = data[3]; + + // look for BOM in first few bytes + if (d0 == 0 && d1 == 0 && d2 == 0xfe && d3 == 0xff) return encoding_utf32_be; + if (d0 == 0xff && d1 == 0xfe && d2 == 0 && d3 == 0) return encoding_utf32_le; + if (d0 == 0xfe && d1 == 0xff) return encoding_utf16_be; + if (d0 == 0xff && d1 == 0xfe) return encoding_utf16_le; + if (d0 == 0xef && d1 == 0xbb && d2 == 0xbf) return encoding_utf8; + + // look for <, <? or <?xm in various encodings + if (d0 == 0 && d1 == 0 && d2 == 0 && d3 == 0x3c) return encoding_utf32_be; + if (d0 == 0x3c && d1 == 0 && d2 == 0 && d3 == 0) return encoding_utf32_le; + if (d0 == 0 && d1 == 0x3c && d2 == 0 && d3 == 0x3f) return encoding_utf16_be; + if (d0 == 0x3c && d1 == 0 && d2 == 0x3f && d3 == 0) return encoding_utf16_le; + + // look for utf16 < followed by node name (this may fail, but is better than utf8 since it's zero terminated so early) + if (d0 == 0 && d1 == 0x3c) return encoding_utf16_be; + if (d0 == 0x3c && d1 == 0) return encoding_utf16_le; + + // no known BOM detected; parse declaration + const uint8_t* enc = 0; + size_t enc_length = 0; + + if (d0 == 0x3c && d1 == 0x3f && d2 == 0x78 && d3 == 0x6d && parse_declaration_encoding(data, size, enc, enc_length)) + { + // iso-8859-1 (case-insensitive) + if (enc_length == 10 + && (enc[0] | ' ') == 'i' && (enc[1] | ' ') == 's' && (enc[2] | ' ') == 'o' + && enc[3] == '-' && enc[4] == '8' && enc[5] == '8' && enc[6] == '5' && enc[7] == '9' + && enc[8] == '-' && enc[9] == '1') + return encoding_latin1; + + // latin1 (case-insensitive) + if (enc_length == 6 + && (enc[0] | ' ') == 'l' && (enc[1] | ' ') == 'a' && (enc[2] | ' ') == 't' + && (enc[3] | ' ') == 'i' && (enc[4] | ' ') == 'n' + && enc[5] == '1') + return encoding_latin1; + } + + return encoding_utf8; + } + + PUGI__FN xml_encoding get_buffer_encoding(xml_encoding encoding, const void* contents, size_t size) + { + // replace wchar encoding with utf implementation + if (encoding == encoding_wchar) return get_wchar_encoding(); + + // replace utf16 encoding with utf16 with specific endianness + if (encoding == encoding_utf16) return is_little_endian() ? encoding_utf16_le : encoding_utf16_be; + + // replace utf32 encoding with utf32 with specific endianness + if (encoding == encoding_utf32) return is_little_endian() ? encoding_utf32_le : encoding_utf32_be; + + // only do autodetection if no explicit encoding is requested + if (encoding != encoding_auto) return encoding; + + // try to guess encoding (based on XML specification, Appendix F.1) + const uint8_t* data = static_cast<const uint8_t*>(contents); + + return guess_buffer_encoding(data, size); + } + + PUGI__FN bool get_mutable_buffer(char_t*& out_buffer, size_t& out_length, const void* contents, size_t size, bool is_mutable) + { + size_t length = size / sizeof(char_t); + + if (is_mutable) + { + out_buffer = static_cast<char_t*>(const_cast<void*>(contents)); + out_length = length; + } + else + { + char_t* buffer = static_cast<char_t*>(xml_memory::allocate((length + 1) * sizeof(char_t))); + if (!buffer) return false; + + if (contents) + memcpy(buffer, contents, length * sizeof(char_t)); + else + assert(length == 0); + + buffer[length] = 0; + + out_buffer = buffer; + out_length = length + 1; + } + + return true; + } + +#ifdef PUGIXML_WCHAR_MODE + PUGI__FN bool need_endian_swap_utf(xml_encoding le, xml_encoding re) + { + return (le == encoding_utf16_be && re == encoding_utf16_le) || (le == encoding_utf16_le && re == encoding_utf16_be) || + (le == encoding_utf32_be && re == encoding_utf32_le) || (le == encoding_utf32_le && re == encoding_utf32_be); + } + + PUGI__FN bool convert_buffer_endian_swap(char_t*& out_buffer, size_t& out_length, const void* contents, size_t size, bool is_mutable) + { + const char_t* data = static_cast<const char_t*>(contents); + size_t length = size / sizeof(char_t); + + if (is_mutable) + { + char_t* buffer = const_cast<char_t*>(data); + + convert_wchar_endian_swap(buffer, data, length); + + out_buffer = buffer; + out_length = length; + } + else + { + char_t* buffer = static_cast<char_t*>(xml_memory::allocate((length + 1) * sizeof(char_t))); + if (!buffer) return false; + + convert_wchar_endian_swap(buffer, data, length); + buffer[length] = 0; + + out_buffer = buffer; + out_length = length + 1; + } + + return true; + } + + template <typename D> PUGI__FN bool convert_buffer_generic(char_t*& out_buffer, size_t& out_length, const void* contents, size_t size, D) + { + const typename D::type* data = static_cast<const typename D::type*>(contents); + size_t data_length = size / sizeof(typename D::type); + + // first pass: get length in wchar_t units + size_t length = D::process(data, data_length, 0, wchar_counter()); + + // allocate buffer of suitable length + char_t* buffer = static_cast<char_t*>(xml_memory::allocate((length + 1) * sizeof(char_t))); + if (!buffer) return false; + + // second pass: convert utf16 input to wchar_t + wchar_writer::value_type obegin = reinterpret_cast<wchar_writer::value_type>(buffer); + wchar_writer::value_type oend = D::process(data, data_length, obegin, wchar_writer()); + + assert(oend == obegin + length); + *oend = 0; + + out_buffer = buffer; + out_length = length + 1; + + return true; + } + + PUGI__FN bool convert_buffer(char_t*& out_buffer, size_t& out_length, xml_encoding encoding, const void* contents, size_t size, bool is_mutable) + { + // get native encoding + xml_encoding wchar_encoding = get_wchar_encoding(); + + // fast path: no conversion required + if (encoding == wchar_encoding) + return get_mutable_buffer(out_buffer, out_length, contents, size, is_mutable); + + // only endian-swapping is required + if (need_endian_swap_utf(encoding, wchar_encoding)) + return convert_buffer_endian_swap(out_buffer, out_length, contents, size, is_mutable); + + // source encoding is utf8 + if (encoding == encoding_utf8) + return convert_buffer_generic(out_buffer, out_length, contents, size, utf8_decoder()); + + // source encoding is utf16 + if (encoding == encoding_utf16_be || encoding == encoding_utf16_le) + { + xml_encoding native_encoding = is_little_endian() ? encoding_utf16_le : encoding_utf16_be; + + return (native_encoding == encoding) ? + convert_buffer_generic(out_buffer, out_length, contents, size, utf16_decoder<opt_false>()) : + convert_buffer_generic(out_buffer, out_length, contents, size, utf16_decoder<opt_true>()); + } + + // source encoding is utf32 + if (encoding == encoding_utf32_be || encoding == encoding_utf32_le) + { + xml_encoding native_encoding = is_little_endian() ? encoding_utf32_le : encoding_utf32_be; + + return (native_encoding == encoding) ? + convert_buffer_generic(out_buffer, out_length, contents, size, utf32_decoder<opt_false>()) : + convert_buffer_generic(out_buffer, out_length, contents, size, utf32_decoder<opt_true>()); + } + + // source encoding is latin1 + if (encoding == encoding_latin1) + return convert_buffer_generic(out_buffer, out_length, contents, size, latin1_decoder()); + + assert(false && "Invalid encoding"); + return false; + } +#else + template <typename D> PUGI__FN bool convert_buffer_generic(char_t*& out_buffer, size_t& out_length, const void* contents, size_t size, D) + { + const typename D::type* data = static_cast<const typename D::type*>(contents); + size_t data_length = size / sizeof(typename D::type); + + // first pass: get length in utf8 units + size_t length = D::process(data, data_length, 0, utf8_counter()); + + // allocate buffer of suitable length + char_t* buffer = static_cast<char_t*>(xml_memory::allocate((length + 1) * sizeof(char_t))); + if (!buffer) return false; + + // second pass: convert utf16 input to utf8 + uint8_t* obegin = reinterpret_cast<uint8_t*>(buffer); + uint8_t* oend = D::process(data, data_length, obegin, utf8_writer()); + + assert(oend == obegin + length); + *oend = 0; + + out_buffer = buffer; + out_length = length + 1; + + return true; + } + + PUGI__FN size_t get_latin1_7bit_prefix_length(const uint8_t* data, size_t size) + { + for (size_t i = 0; i < size; ++i) + if (data[i] > 127) + return i; + + return size; + } + + PUGI__FN bool convert_buffer_latin1(char_t*& out_buffer, size_t& out_length, const void* contents, size_t size, bool is_mutable) + { + const uint8_t* data = static_cast<const uint8_t*>(contents); + size_t data_length = size; + + // get size of prefix that does not need utf8 conversion + size_t prefix_length = get_latin1_7bit_prefix_length(data, data_length); + assert(prefix_length <= data_length); + + const uint8_t* postfix = data + prefix_length; + size_t postfix_length = data_length - prefix_length; + + // if no conversion is needed, just return the original buffer + if (postfix_length == 0) return get_mutable_buffer(out_buffer, out_length, contents, size, is_mutable); + + // first pass: get length in utf8 units + size_t length = prefix_length + latin1_decoder::process(postfix, postfix_length, 0, utf8_counter()); + + // allocate buffer of suitable length + char_t* buffer = static_cast<char_t*>(xml_memory::allocate((length + 1) * sizeof(char_t))); + if (!buffer) return false; + + // second pass: convert latin1 input to utf8 + memcpy(buffer, data, prefix_length); + + uint8_t* obegin = reinterpret_cast<uint8_t*>(buffer); + uint8_t* oend = latin1_decoder::process(postfix, postfix_length, obegin + prefix_length, utf8_writer()); + + assert(oend == obegin + length); + *oend = 0; + + out_buffer = buffer; + out_length = length + 1; + + return true; + } + + PUGI__FN bool convert_buffer(char_t*& out_buffer, size_t& out_length, xml_encoding encoding, const void* contents, size_t size, bool is_mutable) + { + // fast path: no conversion required + if (encoding == encoding_utf8) + return get_mutable_buffer(out_buffer, out_length, contents, size, is_mutable); + + // source encoding is utf16 + if (encoding == encoding_utf16_be || encoding == encoding_utf16_le) + { + xml_encoding native_encoding = is_little_endian() ? encoding_utf16_le : encoding_utf16_be; + + return (native_encoding == encoding) ? + convert_buffer_generic(out_buffer, out_length, contents, size, utf16_decoder<opt_false>()) : + convert_buffer_generic(out_buffer, out_length, contents, size, utf16_decoder<opt_true>()); + } + + // source encoding is utf32 + if (encoding == encoding_utf32_be || encoding == encoding_utf32_le) + { + xml_encoding native_encoding = is_little_endian() ? encoding_utf32_le : encoding_utf32_be; + + return (native_encoding == encoding) ? + convert_buffer_generic(out_buffer, out_length, contents, size, utf32_decoder<opt_false>()) : + convert_buffer_generic(out_buffer, out_length, contents, size, utf32_decoder<opt_true>()); + } + + // source encoding is latin1 + if (encoding == encoding_latin1) + return convert_buffer_latin1(out_buffer, out_length, contents, size, is_mutable); + + assert(false && "Invalid encoding"); + return false; + } +#endif + + PUGI__FN size_t as_utf8_begin(const wchar_t* str, size_t length) + { + // get length in utf8 characters + return wchar_decoder::process(str, length, 0, utf8_counter()); + } + + PUGI__FN void as_utf8_end(char* buffer, size_t size, const wchar_t* str, size_t length) + { + // convert to utf8 + uint8_t* begin = reinterpret_cast<uint8_t*>(buffer); + uint8_t* end = wchar_decoder::process(str, length, begin, utf8_writer()); + + assert(begin + size == end); + (void)!end; + (void)!size; + } + +#ifndef PUGIXML_NO_STL + PUGI__FN std::string as_utf8_impl(const wchar_t* str, size_t length) + { + // first pass: get length in utf8 characters + size_t size = as_utf8_begin(str, length); + + // allocate resulting string + std::string result; + result.resize(size); + + // second pass: convert to utf8 + if (size > 0) as_utf8_end(&result[0], size, str, length); + + return result; + } + + PUGI__FN std::basic_string<wchar_t> as_wide_impl(const char* str, size_t size) + { + const uint8_t* data = reinterpret_cast<const uint8_t*>(str); + + // first pass: get length in wchar_t units + size_t length = utf8_decoder::process(data, size, 0, wchar_counter()); + + // allocate resulting string + std::basic_string<wchar_t> result; + result.resize(length); + + // second pass: convert to wchar_t + if (length > 0) + { + wchar_writer::value_type begin = reinterpret_cast<wchar_writer::value_type>(&result[0]); + wchar_writer::value_type end = utf8_decoder::process(data, size, begin, wchar_writer()); + + assert(begin + length == end); + (void)!end; + } + + return result; + } +#endif + + template <typename Header> + inline bool strcpy_insitu_allow(size_t length, const Header& header, uintptr_t header_mask, char_t* target) + { + // never reuse shared memory + if (header & xml_memory_page_contents_shared_mask) return false; + + size_t target_length = strlength(target); + + // always reuse document buffer memory if possible + if ((header & header_mask) == 0) return target_length >= length; + + // reuse heap memory if waste is not too great + const size_t reuse_threshold = 32; + + return target_length >= length && (target_length < reuse_threshold || target_length - length < target_length / 2); + } + + template <typename String, typename Header> + PUGI__FN bool strcpy_insitu(String& dest, Header& header, uintptr_t header_mask, const char_t* source, size_t source_length) + { + if (source_length == 0) + { + // empty string and null pointer are equivalent, so just deallocate old memory + xml_allocator* alloc = PUGI__GETPAGE_IMPL(header)->allocator; + + if (header & header_mask) alloc->deallocate_string(dest); + + // mark the string as not allocated + dest = 0; + header &= ~header_mask; + + return true; + } + else if (dest && strcpy_insitu_allow(source_length, header, header_mask, dest)) + { + // we can reuse old buffer, so just copy the new data (including zero terminator) + memcpy(dest, source, source_length * sizeof(char_t)); + dest[source_length] = 0; + + return true; + } + else + { + xml_allocator* alloc = PUGI__GETPAGE_IMPL(header)->allocator; + + if (!alloc->reserve()) return false; + + // allocate new buffer + char_t* buf = alloc->allocate_string(source_length + 1); + if (!buf) return false; + + // copy the string (including zero terminator) + memcpy(buf, source, source_length * sizeof(char_t)); + buf[source_length] = 0; + + // deallocate old buffer (*after* the above to protect against overlapping memory and/or allocation failures) + if (header & header_mask) alloc->deallocate_string(dest); + + // the string is now allocated, so set the flag + dest = buf; + header |= header_mask; + + return true; + } + } + + struct gap + { + char_t* end; + size_t size; + + gap(): end(0), size(0) + { + } + + // Push new gap, move s count bytes further (skipping the gap). + // Collapse previous gap. + void push(char_t*& s, size_t count) + { + if (end) // there was a gap already; collapse it + { + // Move [old_gap_end, new_gap_start) to [old_gap_start, ...) + assert(s >= end); + memmove(end - size, end, reinterpret_cast<char*>(s) - reinterpret_cast<char*>(end)); + } + + s += count; // end of current gap + + // "merge" two gaps + end = s; + size += count; + } + + // Collapse all gaps, return past-the-end pointer + char_t* flush(char_t* s) + { + if (end) + { + // Move [old_gap_end, current_pos) to [old_gap_start, ...) + assert(s >= end); + memmove(end - size, end, reinterpret_cast<char*>(s) - reinterpret_cast<char*>(end)); + + return s - size; + } + else return s; + } + }; + + PUGI__FN char_t* strconv_escape(char_t* s, gap& g) + { + char_t* stre = s + 1; + + switch (*stre) + { + case '#': // &#... + { + unsigned int ucsc = 0; + + if (stre[1] == 'x') // &#x... (hex code) + { + stre += 2; + + char_t ch = *stre; + + if (ch == ';') return stre; + + for (;;) + { + if (static_cast<unsigned int>(ch - '0') <= 9) + ucsc = 16 * ucsc + (ch - '0'); + else if (static_cast<unsigned int>((ch | ' ') - 'a') <= 5) + ucsc = 16 * ucsc + ((ch | ' ') - 'a' + 10); + else if (ch == ';') + break; + else // cancel + return stre; + + ch = *++stre; + } + + ++stre; + } + else // &#... (dec code) + { + char_t ch = *++stre; + + if (ch == ';') return stre; + + for (;;) + { + if (static_cast<unsigned int>(static_cast<unsigned int>(ch) - '0') <= 9) + ucsc = 10 * ucsc + (ch - '0'); + else if (ch == ';') + break; + else // cancel + return stre; + + ch = *++stre; + } + + ++stre; + } + + #ifdef PUGIXML_WCHAR_MODE + s = reinterpret_cast<char_t*>(wchar_writer::any(reinterpret_cast<wchar_writer::value_type>(s), ucsc)); + #else + s = reinterpret_cast<char_t*>(utf8_writer::any(reinterpret_cast<uint8_t*>(s), ucsc)); + #endif + + g.push(s, stre - s); + return stre; + } + + case 'a': // &a + { + ++stre; + + if (*stre == 'm') // &am + { + if (*++stre == 'p' && *++stre == ';') // & + { + *s++ = '&'; + ++stre; + + g.push(s, stre - s); + return stre; + } + } + else if (*stre == 'p') // &ap + { + if (*++stre == 'o' && *++stre == 's' && *++stre == ';') // ' + { + *s++ = '\''; + ++stre; + + g.push(s, stre - s); + return stre; + } + } + break; + } + + case 'g': // &g + { + if (*++stre == 't' && *++stre == ';') // > + { + *s++ = '>'; + ++stre; + + g.push(s, stre - s); + return stre; + } + break; + } + + case 'l': // &l + { + if (*++stre == 't' && *++stre == ';') // < + { + *s++ = '<'; + ++stre; + + g.push(s, stre - s); + return stre; + } + break; + } + + case 'q': // &q + { + if (*++stre == 'u' && *++stre == 'o' && *++stre == 't' && *++stre == ';') // " + { + *s++ = '"'; + ++stre; + + g.push(s, stre - s); + return stre; + } + break; + } + + default: + break; + } + + return stre; + } + + // Parser utilities + #define PUGI__ENDSWITH(c, e) ((c) == (e) || ((c) == 0 && endch == (e))) + #define PUGI__SKIPWS() { while (PUGI__IS_CHARTYPE(*s, ct_space)) ++s; } + #define PUGI__OPTSET(OPT) ( optmsk & (OPT) ) + #define PUGI__PUSHNODE(TYPE) { cursor = append_new_node(cursor, *alloc, TYPE); if (!cursor) PUGI__THROW_ERROR(status_out_of_memory, s); } + #define PUGI__POPNODE() { cursor = cursor->parent; } + #define PUGI__SCANFOR(X) { while (*s != 0 && !(X)) ++s; } + #define PUGI__SCANWHILE(X) { while (X) ++s; } + #define PUGI__SCANWHILE_UNROLL(X) { for (;;) { char_t ss = s[0]; if (PUGI__UNLIKELY(!(X))) { break; } ss = s[1]; if (PUGI__UNLIKELY(!(X))) { s += 1; break; } ss = s[2]; if (PUGI__UNLIKELY(!(X))) { s += 2; break; } ss = s[3]; if (PUGI__UNLIKELY(!(X))) { s += 3; break; } s += 4; } } + #define PUGI__ENDSEG() { ch = *s; *s = 0; ++s; } + #define PUGI__THROW_ERROR(err, m) return error_offset = m, error_status = err, static_cast<char_t*>(0) + #define PUGI__CHECK_ERROR(err, m) { if (*s == 0) PUGI__THROW_ERROR(err, m); } + + PUGI__FN char_t* strconv_comment(char_t* s, char_t endch) + { + gap g; + + while (true) + { + PUGI__SCANWHILE_UNROLL(!PUGI__IS_CHARTYPE(ss, ct_parse_comment)); + + if (*s == '\r') // Either a single 0x0d or 0x0d 0x0a pair + { + *s++ = '\n'; // replace first one with 0x0a + + if (*s == '\n') g.push(s, 1); + } + else if (s[0] == '-' && s[1] == '-' && PUGI__ENDSWITH(s[2], '>')) // comment ends here + { + *g.flush(s) = 0; + + return s + (s[2] == '>' ? 3 : 2); + } + else if (*s == 0) + { + return 0; + } + else ++s; + } + } + + PUGI__FN char_t* strconv_cdata(char_t* s, char_t endch) + { + gap g; + + while (true) + { + PUGI__SCANWHILE_UNROLL(!PUGI__IS_CHARTYPE(ss, ct_parse_cdata)); + + if (*s == '\r') // Either a single 0x0d or 0x0d 0x0a pair + { + *s++ = '\n'; // replace first one with 0x0a + + if (*s == '\n') g.push(s, 1); + } + else if (s[0] == ']' && s[1] == ']' && PUGI__ENDSWITH(s[2], '>')) // CDATA ends here + { + *g.flush(s) = 0; + + return s + 1; + } + else if (*s == 0) + { + return 0; + } + else ++s; + } + } + + typedef char_t* (*strconv_pcdata_t)(char_t*); + + template <typename opt_trim, typename opt_eol, typename opt_escape> struct strconv_pcdata_impl + { + static char_t* parse(char_t* s) + { + gap g; + + char_t* begin = s; + + while (true) + { + PUGI__SCANWHILE_UNROLL(!PUGI__IS_CHARTYPE(ss, ct_parse_pcdata)); + + if (*s == '<') // PCDATA ends here + { + char_t* end = g.flush(s); + + if (opt_trim::value) + while (end > begin && PUGI__IS_CHARTYPE(end[-1], ct_space)) + --end; + + *end = 0; + + return s + 1; + } + else if (opt_eol::value && *s == '\r') // Either a single 0x0d or 0x0d 0x0a pair + { + *s++ = '\n'; // replace first one with 0x0a + + if (*s == '\n') g.push(s, 1); + } + else if (opt_escape::value && *s == '&') + { + s = strconv_escape(s, g); + } + else if (*s == 0) + { + char_t* end = g.flush(s); + + if (opt_trim::value) + while (end > begin && PUGI__IS_CHARTYPE(end[-1], ct_space)) + --end; + + *end = 0; + + return s; + } + else ++s; + } + } + }; + + PUGI__FN strconv_pcdata_t get_strconv_pcdata(unsigned int optmask) + { + PUGI__STATIC_ASSERT(parse_escapes == 0x10 && parse_eol == 0x20 && parse_trim_pcdata == 0x0800); + + switch (((optmask >> 4) & 3) | ((optmask >> 9) & 4)) // get bitmask for flags (eol escapes trim) + { + case 0: return strconv_pcdata_impl<opt_false, opt_false, opt_false>::parse; + case 1: return strconv_pcdata_impl<opt_false, opt_false, opt_true>::parse; + case 2: return strconv_pcdata_impl<opt_false, opt_true, opt_false>::parse; + case 3: return strconv_pcdata_impl<opt_false, opt_true, opt_true>::parse; + case 4: return strconv_pcdata_impl<opt_true, opt_false, opt_false>::parse; + case 5: return strconv_pcdata_impl<opt_true, opt_false, opt_true>::parse; + case 6: return strconv_pcdata_impl<opt_true, opt_true, opt_false>::parse; + case 7: return strconv_pcdata_impl<opt_true, opt_true, opt_true>::parse; + default: assert(false); return 0; // should not get here + } + } + + typedef char_t* (*strconv_attribute_t)(char_t*, char_t); + + template <typename opt_escape> struct strconv_attribute_impl + { + static char_t* parse_wnorm(char_t* s, char_t end_quote) + { + gap g; + + // trim leading whitespaces + if (PUGI__IS_CHARTYPE(*s, ct_space)) + { + char_t* str = s; + + do ++str; + while (PUGI__IS_CHARTYPE(*str, ct_space)); + + g.push(s, str - s); + } + + while (true) + { + PUGI__SCANWHILE_UNROLL(!PUGI__IS_CHARTYPE(ss, ct_parse_attr_ws | ct_space)); + + if (*s == end_quote) + { + char_t* str = g.flush(s); + + do *str-- = 0; + while (PUGI__IS_CHARTYPE(*str, ct_space)); + + return s + 1; + } + else if (PUGI__IS_CHARTYPE(*s, ct_space)) + { + *s++ = ' '; + + if (PUGI__IS_CHARTYPE(*s, ct_space)) + { + char_t* str = s + 1; + while (PUGI__IS_CHARTYPE(*str, ct_space)) ++str; + + g.push(s, str - s); + } + } + else if (opt_escape::value && *s == '&') + { + s = strconv_escape(s, g); + } + else if (!*s) + { + return 0; + } + else ++s; + } + } + + static char_t* parse_wconv(char_t* s, char_t end_quote) + { + gap g; + + while (true) + { + PUGI__SCANWHILE_UNROLL(!PUGI__IS_CHARTYPE(ss, ct_parse_attr_ws)); + + if (*s == end_quote) + { + *g.flush(s) = 0; + + return s + 1; + } + else if (PUGI__IS_CHARTYPE(*s, ct_space)) + { + if (*s == '\r') + { + *s++ = ' '; + + if (*s == '\n') g.push(s, 1); + } + else *s++ = ' '; + } + else if (opt_escape::value && *s == '&') + { + s = strconv_escape(s, g); + } + else if (!*s) + { + return 0; + } + else ++s; + } + } + + static char_t* parse_eol(char_t* s, char_t end_quote) + { + gap g; + + while (true) + { + PUGI__SCANWHILE_UNROLL(!PUGI__IS_CHARTYPE(ss, ct_parse_attr)); + + if (*s == end_quote) + { + *g.flush(s) = 0; + + return s + 1; + } + else if (*s == '\r') + { + *s++ = '\n'; + + if (*s == '\n') g.push(s, 1); + } + else if (opt_escape::value && *s == '&') + { + s = strconv_escape(s, g); + } + else if (!*s) + { + return 0; + } + else ++s; + } + } + + static char_t* parse_simple(char_t* s, char_t end_quote) + { + gap g; + + while (true) + { + PUGI__SCANWHILE_UNROLL(!PUGI__IS_CHARTYPE(ss, ct_parse_attr)); + + if (*s == end_quote) + { + *g.flush(s) = 0; + + return s + 1; + } + else if (opt_escape::value && *s == '&') + { + s = strconv_escape(s, g); + } + else if (!*s) + { + return 0; + } + else ++s; + } + } + }; + + PUGI__FN strconv_attribute_t get_strconv_attribute(unsigned int optmask) + { + PUGI__STATIC_ASSERT(parse_escapes == 0x10 && parse_eol == 0x20 && parse_wconv_attribute == 0x40 && parse_wnorm_attribute == 0x80); + + switch ((optmask >> 4) & 15) // get bitmask for flags (wconv wnorm eol escapes) + { + case 0: return strconv_attribute_impl<opt_false>::parse_simple; + case 1: return strconv_attribute_impl<opt_true>::parse_simple; + case 2: return strconv_attribute_impl<opt_false>::parse_eol; + case 3: return strconv_attribute_impl<opt_true>::parse_eol; + case 4: return strconv_attribute_impl<opt_false>::parse_wconv; + case 5: return strconv_attribute_impl<opt_true>::parse_wconv; + case 6: return strconv_attribute_impl<opt_false>::parse_wconv; + case 7: return strconv_attribute_impl<opt_true>::parse_wconv; + case 8: return strconv_attribute_impl<opt_false>::parse_wnorm; + case 9: return strconv_attribute_impl<opt_true>::parse_wnorm; + case 10: return strconv_attribute_impl<opt_false>::parse_wnorm; + case 11: return strconv_attribute_impl<opt_true>::parse_wnorm; + case 12: return strconv_attribute_impl<opt_false>::parse_wnorm; + case 13: return strconv_attribute_impl<opt_true>::parse_wnorm; + case 14: return strconv_attribute_impl<opt_false>::parse_wnorm; + case 15: return strconv_attribute_impl<opt_true>::parse_wnorm; + default: assert(false); return 0; // should not get here + } + } + + inline xml_parse_result make_parse_result(xml_parse_status status, ptrdiff_t offset = 0) + { + xml_parse_result result; + result.status = status; + result.offset = offset; + + return result; + } + + struct xml_parser + { + xml_allocator* alloc; + char_t* error_offset; + xml_parse_status error_status; + + xml_parser(xml_allocator* alloc_): alloc(alloc_), error_offset(0), error_status(status_ok) + { + } + + // DOCTYPE consists of nested sections of the following possible types: + // <!-- ... -->, <? ... ?>, "...", '...' + // <![...]]> + // <!...> + // First group can not contain nested groups + // Second group can contain nested groups of the same type + // Third group can contain all other groups + char_t* parse_doctype_primitive(char_t* s) + { + if (*s == '"' || *s == '\'') + { + // quoted string + char_t ch = *s++; + PUGI__SCANFOR(*s == ch); + if (!*s) PUGI__THROW_ERROR(status_bad_doctype, s); + + s++; + } + else if (s[0] == '<' && s[1] == '?') + { + // <? ... ?> + s += 2; + PUGI__SCANFOR(s[0] == '?' && s[1] == '>'); // no need for ENDSWITH because ?> can't terminate proper doctype + if (!*s) PUGI__THROW_ERROR(status_bad_doctype, s); + + s += 2; + } + else if (s[0] == '<' && s[1] == '!' && s[2] == '-' && s[3] == '-') + { + s += 4; + PUGI__SCANFOR(s[0] == '-' && s[1] == '-' && s[2] == '>'); // no need for ENDSWITH because --> can't terminate proper doctype + if (!*s) PUGI__THROW_ERROR(status_bad_doctype, s); + + s += 3; + } + else PUGI__THROW_ERROR(status_bad_doctype, s); + + return s; + } + + char_t* parse_doctype_ignore(char_t* s) + { + size_t depth = 0; + + assert(s[0] == '<' && s[1] == '!' && s[2] == '['); + s += 3; + + while (*s) + { + if (s[0] == '<' && s[1] == '!' && s[2] == '[') + { + // nested ignore section + s += 3; + depth++; + } + else if (s[0] == ']' && s[1] == ']' && s[2] == '>') + { + // ignore section end + s += 3; + + if (depth == 0) + return s; + + depth--; + } + else s++; + } + + PUGI__THROW_ERROR(status_bad_doctype, s); + } + + char_t* parse_doctype_group(char_t* s, char_t endch) + { + size_t depth = 0; + + assert((s[0] == '<' || s[0] == 0) && s[1] == '!'); + s += 2; + + while (*s) + { + if (s[0] == '<' && s[1] == '!' && s[2] != '-') + { + if (s[2] == '[') + { + // ignore + s = parse_doctype_ignore(s); + if (!s) return s; + } + else + { + // some control group + s += 2; + depth++; + } + } + else if (s[0] == '<' || s[0] == '"' || s[0] == '\'') + { + // unknown tag (forbidden), or some primitive group + s = parse_doctype_primitive(s); + if (!s) return s; + } + else if (*s == '>') + { + if (depth == 0) + return s; + + depth--; + s++; + } + else s++; + } + + if (depth != 0 || endch != '>') PUGI__THROW_ERROR(status_bad_doctype, s); + + return s; + } + + char_t* parse_exclamation(char_t* s, xml_node_struct* cursor, unsigned int optmsk, char_t endch) + { + // parse node contents, starting with exclamation mark + ++s; + + if (*s == '-') // '<!-...' + { + ++s; + + if (*s == '-') // '<!--...' + { + ++s; + + if (PUGI__OPTSET(parse_comments)) + { + PUGI__PUSHNODE(node_comment); // Append a new node on the tree. + cursor->value = s; // Save the offset. + } + + if (PUGI__OPTSET(parse_eol) && PUGI__OPTSET(parse_comments)) + { + s = strconv_comment(s, endch); + + if (!s) PUGI__THROW_ERROR(status_bad_comment, cursor->value); + } + else + { + // Scan for terminating '-->'. + PUGI__SCANFOR(s[0] == '-' && s[1] == '-' && PUGI__ENDSWITH(s[2], '>')); + PUGI__CHECK_ERROR(status_bad_comment, s); + + if (PUGI__OPTSET(parse_comments)) + *s = 0; // Zero-terminate this segment at the first terminating '-'. + + s += (s[2] == '>' ? 3 : 2); // Step over the '\0->'. + } + } + else PUGI__THROW_ERROR(status_bad_comment, s); + } + else if (*s == '[') + { + // '<![CDATA[...' + if (*++s=='C' && *++s=='D' && *++s=='A' && *++s=='T' && *++s=='A' && *++s == '[') + { + ++s; + + if (PUGI__OPTSET(parse_cdata)) + { + PUGI__PUSHNODE(node_cdata); // Append a new node on the tree. + cursor->value = s; // Save the offset. + + if (PUGI__OPTSET(parse_eol)) + { + s = strconv_cdata(s, endch); + + if (!s) PUGI__THROW_ERROR(status_bad_cdata, cursor->value); + } + else + { + // Scan for terminating ']]>'. + PUGI__SCANFOR(s[0] == ']' && s[1] == ']' && PUGI__ENDSWITH(s[2], '>')); + PUGI__CHECK_ERROR(status_bad_cdata, s); + + *s++ = 0; // Zero-terminate this segment. + } + } + else // Flagged for discard, but we still have to scan for the terminator. + { + // Scan for terminating ']]>'. + PUGI__SCANFOR(s[0] == ']' && s[1] == ']' && PUGI__ENDSWITH(s[2], '>')); + PUGI__CHECK_ERROR(status_bad_cdata, s); + + ++s; + } + + s += (s[1] == '>' ? 2 : 1); // Step over the last ']>'. + } + else PUGI__THROW_ERROR(status_bad_cdata, s); + } + else if (s[0] == 'D' && s[1] == 'O' && s[2] == 'C' && s[3] == 'T' && s[4] == 'Y' && s[5] == 'P' && PUGI__ENDSWITH(s[6], 'E')) + { + s -= 2; + + if (cursor->parent) PUGI__THROW_ERROR(status_bad_doctype, s); + + char_t* mark = s + 9; + + s = parse_doctype_group(s, endch); + if (!s) return s; + + assert((*s == 0 && endch == '>') || *s == '>'); + if (*s) *s++ = 0; + + if (PUGI__OPTSET(parse_doctype)) + { + while (PUGI__IS_CHARTYPE(*mark, ct_space)) ++mark; + + PUGI__PUSHNODE(node_doctype); + + cursor->value = mark; + } + } + else if (*s == 0 && endch == '-') PUGI__THROW_ERROR(status_bad_comment, s); + else if (*s == 0 && endch == '[') PUGI__THROW_ERROR(status_bad_cdata, s); + else PUGI__THROW_ERROR(status_unrecognized_tag, s); + + return s; + } + + char_t* parse_question(char_t* s, xml_node_struct*& ref_cursor, unsigned int optmsk, char_t endch) + { + // load into registers + xml_node_struct* cursor = ref_cursor; + char_t ch = 0; + + // parse node contents, starting with question mark + ++s; + + // read PI target + char_t* target = s; + + if (!PUGI__IS_CHARTYPE(*s, ct_start_symbol)) PUGI__THROW_ERROR(status_bad_pi, s); + + PUGI__SCANWHILE(PUGI__IS_CHARTYPE(*s, ct_symbol)); + PUGI__CHECK_ERROR(status_bad_pi, s); + + // determine node type; stricmp / strcasecmp is not portable + bool declaration = (target[0] | ' ') == 'x' && (target[1] | ' ') == 'm' && (target[2] | ' ') == 'l' && target + 3 == s; + + if (declaration ? PUGI__OPTSET(parse_declaration) : PUGI__OPTSET(parse_pi)) + { + if (declaration) + { + // disallow non top-level declarations + if (cursor->parent) PUGI__THROW_ERROR(status_bad_pi, s); + + PUGI__PUSHNODE(node_declaration); + } + else + { + PUGI__PUSHNODE(node_pi); + } + + cursor->name = target; + + PUGI__ENDSEG(); + + // parse value/attributes + if (ch == '?') + { + // empty node + if (!PUGI__ENDSWITH(*s, '>')) PUGI__THROW_ERROR(status_bad_pi, s); + s += (*s == '>'); + + PUGI__POPNODE(); + } + else if (PUGI__IS_CHARTYPE(ch, ct_space)) + { + PUGI__SKIPWS(); + + // scan for tag end + char_t* value = s; + + PUGI__SCANFOR(s[0] == '?' && PUGI__ENDSWITH(s[1], '>')); + PUGI__CHECK_ERROR(status_bad_pi, s); + + if (declaration) + { + // replace ending ? with / so that 'element' terminates properly + *s = '/'; + + // we exit from this function with cursor at node_declaration, which is a signal to parse() to go to LOC_ATTRIBUTES + s = value; + } + else + { + // store value and step over > + cursor->value = value; + + PUGI__POPNODE(); + + PUGI__ENDSEG(); + + s += (*s == '>'); + } + } + else PUGI__THROW_ERROR(status_bad_pi, s); + } + else + { + // scan for tag end + PUGI__SCANFOR(s[0] == '?' && PUGI__ENDSWITH(s[1], '>')); + PUGI__CHECK_ERROR(status_bad_pi, s); + + s += (s[1] == '>' ? 2 : 1); + } + + // store from registers + ref_cursor = cursor; + + return s; + } + + char_t* parse_tree(char_t* s, xml_node_struct* root, unsigned int optmsk, char_t endch) + { + strconv_attribute_t strconv_attribute = get_strconv_attribute(optmsk); + strconv_pcdata_t strconv_pcdata = get_strconv_pcdata(optmsk); + + char_t ch = 0; + xml_node_struct* cursor = root; + char_t* mark = s; + + while (*s != 0) + { + if (*s == '<') + { + ++s; + + LOC_TAG: + if (PUGI__IS_CHARTYPE(*s, ct_start_symbol)) // '<#...' + { + PUGI__PUSHNODE(node_element); // Append a new node to the tree. + + cursor->name = s; + + PUGI__SCANWHILE_UNROLL(PUGI__IS_CHARTYPE(ss, ct_symbol)); // Scan for a terminator. + PUGI__ENDSEG(); // Save char in 'ch', terminate & step over. + + if (ch == '>') + { + // end of tag + } + else if (PUGI__IS_CHARTYPE(ch, ct_space)) + { + LOC_ATTRIBUTES: + while (true) + { + PUGI__SKIPWS(); // Eat any whitespace. + + if (PUGI__IS_CHARTYPE(*s, ct_start_symbol)) // <... #... + { + xml_attribute_struct* a = append_new_attribute(cursor, *alloc); // Make space for this attribute. + if (!a) PUGI__THROW_ERROR(status_out_of_memory, s); + + a->name = s; // Save the offset. + + PUGI__SCANWHILE_UNROLL(PUGI__IS_CHARTYPE(ss, ct_symbol)); // Scan for a terminator. + PUGI__ENDSEG(); // Save char in 'ch', terminate & step over. + + if (PUGI__IS_CHARTYPE(ch, ct_space)) + { + PUGI__SKIPWS(); // Eat any whitespace. + + ch = *s; + ++s; + } + + if (ch == '=') // '<... #=...' + { + PUGI__SKIPWS(); // Eat any whitespace. + + if (*s == '"' || *s == '\'') // '<... #="...' + { + ch = *s; // Save quote char to avoid breaking on "''" -or- '""'. + ++s; // Step over the quote. + a->value = s; // Save the offset. + + s = strconv_attribute(s, ch); + + if (!s) PUGI__THROW_ERROR(status_bad_attribute, a->value); + + // After this line the loop continues from the start; + // Whitespaces, / and > are ok, symbols and EOF are wrong, + // everything else will be detected + if (PUGI__IS_CHARTYPE(*s, ct_start_symbol)) PUGI__THROW_ERROR(status_bad_attribute, s); + } + else PUGI__THROW_ERROR(status_bad_attribute, s); + } + else PUGI__THROW_ERROR(status_bad_attribute, s); + } + else if (*s == '/') + { + ++s; + + if (*s == '>') + { + PUGI__POPNODE(); + s++; + break; + } + else if (*s == 0 && endch == '>') + { + PUGI__POPNODE(); + break; + } + else PUGI__THROW_ERROR(status_bad_start_element, s); + } + else if (*s == '>') + { + ++s; + + break; + } + else if (*s == 0 && endch == '>') + { + break; + } + else PUGI__THROW_ERROR(status_bad_start_element, s); + } + + // !!! + } + else if (ch == '/') // '<#.../' + { + if (!PUGI__ENDSWITH(*s, '>')) PUGI__THROW_ERROR(status_bad_start_element, s); + + PUGI__POPNODE(); // Pop. + + s += (*s == '>'); + } + else if (ch == 0) + { + // we stepped over null terminator, backtrack & handle closing tag + --s; + + if (endch != '>') PUGI__THROW_ERROR(status_bad_start_element, s); + } + else PUGI__THROW_ERROR(status_bad_start_element, s); + } + else if (*s == '/') + { + ++s; + + mark = s; + + char_t* name = cursor->name; + if (!name) PUGI__THROW_ERROR(status_end_element_mismatch, mark); + + while (PUGI__IS_CHARTYPE(*s, ct_symbol)) + { + if (*s++ != *name++) PUGI__THROW_ERROR(status_end_element_mismatch, mark); + } + + if (*name) + { + if (*s == 0 && name[0] == endch && name[1] == 0) PUGI__THROW_ERROR(status_bad_end_element, s); + else PUGI__THROW_ERROR(status_end_element_mismatch, mark); + } + + PUGI__POPNODE(); // Pop. + + PUGI__SKIPWS(); + + if (*s == 0) + { + if (endch != '>') PUGI__THROW_ERROR(status_bad_end_element, s); + } + else + { + if (*s != '>') PUGI__THROW_ERROR(status_bad_end_element, s); + ++s; + } + } + else if (*s == '?') // '<?...' + { + s = parse_question(s, cursor, optmsk, endch); + if (!s) return s; + + assert(cursor); + if (PUGI__NODETYPE(cursor) == node_declaration) goto LOC_ATTRIBUTES; + } + else if (*s == '!') // '<!...' + { + s = parse_exclamation(s, cursor, optmsk, endch); + if (!s) return s; + } + else if (*s == 0 && endch == '?') PUGI__THROW_ERROR(status_bad_pi, s); + else PUGI__THROW_ERROR(status_unrecognized_tag, s); + } + else + { + mark = s; // Save this offset while searching for a terminator. + + PUGI__SKIPWS(); // Eat whitespace if no genuine PCDATA here. + + if (*s == '<' || !*s) + { + // We skipped some whitespace characters because otherwise we would take the tag branch instead of PCDATA one + assert(mark != s); + + if (!PUGI__OPTSET(parse_ws_pcdata | parse_ws_pcdata_single) || PUGI__OPTSET(parse_trim_pcdata)) + { + continue; + } + else if (PUGI__OPTSET(parse_ws_pcdata_single)) + { + if (s[0] != '<' || s[1] != '/' || cursor->first_child) continue; + } + } + + if (!PUGI__OPTSET(parse_trim_pcdata)) + s = mark; + + if (cursor->parent || PUGI__OPTSET(parse_fragment)) + { + if (PUGI__OPTSET(parse_embed_pcdata) && cursor->parent && !cursor->first_child && !cursor->value) + { + cursor->value = s; // Save the offset. + } + else + { + PUGI__PUSHNODE(node_pcdata); // Append a new node on the tree. + + cursor->value = s; // Save the offset. + + PUGI__POPNODE(); // Pop since this is a standalone. + } + + s = strconv_pcdata(s); + + if (!*s) break; + } + else + { + PUGI__SCANFOR(*s == '<'); // '...<' + if (!*s) break; + + ++s; + } + + // We're after '<' + goto LOC_TAG; + } + } + + // check that last tag is closed + if (cursor != root) PUGI__THROW_ERROR(status_end_element_mismatch, s); + + return s; + } + + #ifdef PUGIXML_WCHAR_MODE + static char_t* parse_skip_bom(char_t* s) + { + unsigned int bom = 0xfeff; + return (s[0] == static_cast<wchar_t>(bom)) ? s + 1 : s; + } + #else + static char_t* parse_skip_bom(char_t* s) + { + return (s[0] == '\xef' && s[1] == '\xbb' && s[2] == '\xbf') ? s + 3 : s; + } + #endif + + static bool has_element_node_siblings(xml_node_struct* node) + { + while (node) + { + if (PUGI__NODETYPE(node) == node_element) return true; + + node = node->next_sibling; + } + + return false; + } + + static xml_parse_result parse(char_t* buffer, size_t length, xml_document_struct* xmldoc, xml_node_struct* root, unsigned int optmsk) + { + // early-out for empty documents + if (length == 0) + return make_parse_result(PUGI__OPTSET(parse_fragment) ? status_ok : status_no_document_element); + + // get last child of the root before parsing + xml_node_struct* last_root_child = root->first_child ? root->first_child->prev_sibling_c + 0 : 0; + + // create parser on stack + xml_parser parser(static_cast<xml_allocator*>(xmldoc)); + + // save last character and make buffer zero-terminated (speeds up parsing) + char_t endch = buffer[length - 1]; + buffer[length - 1] = 0; + + // skip BOM to make sure it does not end up as part of parse output + char_t* buffer_data = parse_skip_bom(buffer); + + // perform actual parsing + parser.parse_tree(buffer_data, root, optmsk, endch); + + xml_parse_result result = make_parse_result(parser.error_status, parser.error_offset ? parser.error_offset - buffer : 0); + assert(result.offset >= 0 && static_cast<size_t>(result.offset) <= length); + + if (result) + { + // since we removed last character, we have to handle the only possible false positive (stray <) + if (endch == '<') + return make_parse_result(status_unrecognized_tag, length - 1); + + // check if there are any element nodes parsed + xml_node_struct* first_root_child_parsed = last_root_child ? last_root_child->next_sibling + 0 : root->first_child+ 0; + + if (!PUGI__OPTSET(parse_fragment) && !has_element_node_siblings(first_root_child_parsed)) + return make_parse_result(status_no_document_element, length - 1); + } + else + { + // roll back offset if it occurs on a null terminator in the source buffer + if (result.offset > 0 && static_cast<size_t>(result.offset) == length - 1 && endch == 0) + result.offset--; + } + + return result; + } + }; + + // Output facilities + PUGI__FN xml_encoding get_write_native_encoding() + { + #ifdef PUGIXML_WCHAR_MODE + return get_wchar_encoding(); + #else + return encoding_utf8; + #endif + } + + PUGI__FN xml_encoding get_write_encoding(xml_encoding encoding) + { + // replace wchar encoding with utf implementation + if (encoding == encoding_wchar) return get_wchar_encoding(); + + // replace utf16 encoding with utf16 with specific endianness + if (encoding == encoding_utf16) return is_little_endian() ? encoding_utf16_le : encoding_utf16_be; + + // replace utf32 encoding with utf32 with specific endianness + if (encoding == encoding_utf32) return is_little_endian() ? encoding_utf32_le : encoding_utf32_be; + + // only do autodetection if no explicit encoding is requested + if (encoding != encoding_auto) return encoding; + + // assume utf8 encoding + return encoding_utf8; + } + + template <typename D, typename T> PUGI__FN size_t convert_buffer_output_generic(typename T::value_type dest, const char_t* data, size_t length, D, T) + { + PUGI__STATIC_ASSERT(sizeof(char_t) == sizeof(typename D::type)); + + typename T::value_type end = D::process(reinterpret_cast<const typename D::type*>(data), length, dest, T()); + + return static_cast<size_t>(end - dest) * sizeof(*dest); + } + + template <typename D, typename T> PUGI__FN size_t convert_buffer_output_generic(typename T::value_type dest, const char_t* data, size_t length, D, T, bool opt_swap) + { + PUGI__STATIC_ASSERT(sizeof(char_t) == sizeof(typename D::type)); + + typename T::value_type end = D::process(reinterpret_cast<const typename D::type*>(data), length, dest, T()); + + if (opt_swap) + { + for (typename T::value_type i = dest; i != end; ++i) + *i = endian_swap(*i); + } + + return static_cast<size_t>(end - dest) * sizeof(*dest); + } + +#ifdef PUGIXML_WCHAR_MODE + PUGI__FN size_t get_valid_length(const char_t* data, size_t length) + { + if (length < 1) return 0; + + // discard last character if it's the lead of a surrogate pair + return (sizeof(wchar_t) == 2 && static_cast<unsigned int>(static_cast<uint16_t>(data[length - 1]) - 0xD800) < 0x400) ? length - 1 : length; + } + + PUGI__FN size_t convert_buffer_output(char_t* r_char, uint8_t* r_u8, uint16_t* r_u16, uint32_t* r_u32, const char_t* data, size_t length, xml_encoding encoding) + { + // only endian-swapping is required + if (need_endian_swap_utf(encoding, get_wchar_encoding())) + { + convert_wchar_endian_swap(r_char, data, length); + + return length * sizeof(char_t); + } + + // convert to utf8 + if (encoding == encoding_utf8) + return convert_buffer_output_generic(r_u8, data, length, wchar_decoder(), utf8_writer()); + + // convert to utf16 + if (encoding == encoding_utf16_be || encoding == encoding_utf16_le) + { + xml_encoding native_encoding = is_little_endian() ? encoding_utf16_le : encoding_utf16_be; + + return convert_buffer_output_generic(r_u16, data, length, wchar_decoder(), utf16_writer(), native_encoding != encoding); + } + + // convert to utf32 + if (encoding == encoding_utf32_be || encoding == encoding_utf32_le) + { + xml_encoding native_encoding = is_little_endian() ? encoding_utf32_le : encoding_utf32_be; + + return convert_buffer_output_generic(r_u32, data, length, wchar_decoder(), utf32_writer(), native_encoding != encoding); + } + + // convert to latin1 + if (encoding == encoding_latin1) + return convert_buffer_output_generic(r_u8, data, length, wchar_decoder(), latin1_writer()); + + assert(false && "Invalid encoding"); + return 0; + } +#else + PUGI__FN size_t get_valid_length(const char_t* data, size_t length) + { + if (length < 5) return 0; + + for (size_t i = 1; i <= 4; ++i) + { + uint8_t ch = static_cast<uint8_t>(data[length - i]); + + // either a standalone character or a leading one + if ((ch & 0xc0) != 0x80) return length - i; + } + + // there are four non-leading characters at the end, sequence tail is broken so might as well process the whole chunk + return length; + } + + PUGI__FN size_t convert_buffer_output(char_t* /* r_char */, uint8_t* r_u8, uint16_t* r_u16, uint32_t* r_u32, const char_t* data, size_t length, xml_encoding encoding) + { + if (encoding == encoding_utf16_be || encoding == encoding_utf16_le) + { + xml_encoding native_encoding = is_little_endian() ? encoding_utf16_le : encoding_utf16_be; + + return convert_buffer_output_generic(r_u16, data, length, utf8_decoder(), utf16_writer(), native_encoding != encoding); + } + + if (encoding == encoding_utf32_be || encoding == encoding_utf32_le) + { + xml_encoding native_encoding = is_little_endian() ? encoding_utf32_le : encoding_utf32_be; + + return convert_buffer_output_generic(r_u32, data, length, utf8_decoder(), utf32_writer(), native_encoding != encoding); + } + + if (encoding == encoding_latin1) + return convert_buffer_output_generic(r_u8, data, length, utf8_decoder(), latin1_writer()); + + assert(false && "Invalid encoding"); + return 0; + } +#endif + + class xml_buffered_writer + { + xml_buffered_writer(const xml_buffered_writer&); + xml_buffered_writer& operator=(const xml_buffered_writer&); + + public: + xml_buffered_writer(xml_writer& writer_, xml_encoding user_encoding): writer(writer_), bufsize(0), encoding(get_write_encoding(user_encoding)) + { + PUGI__STATIC_ASSERT(bufcapacity >= 8); + } + + size_t flush() + { + flush(buffer, bufsize); + bufsize = 0; + return 0; + } + + void flush(const char_t* data, size_t size) + { + if (size == 0) return; + + // fast path, just write data + if (encoding == get_write_native_encoding()) + writer.write(data, size * sizeof(char_t)); + else + { + // convert chunk + size_t result = convert_buffer_output(scratch.data_char, scratch.data_u8, scratch.data_u16, scratch.data_u32, data, size, encoding); + assert(result <= sizeof(scratch)); + + // write data + writer.write(scratch.data_u8, result); + } + } + + void write_direct(const char_t* data, size_t length) + { + // flush the remaining buffer contents + flush(); + + // handle large chunks + if (length > bufcapacity) + { + if (encoding == get_write_native_encoding()) + { + // fast path, can just write data chunk + writer.write(data, length * sizeof(char_t)); + return; + } + + // need to convert in suitable chunks + while (length > bufcapacity) + { + // get chunk size by selecting such number of characters that are guaranteed to fit into scratch buffer + // and form a complete codepoint sequence (i.e. discard start of last codepoint if necessary) + size_t chunk_size = get_valid_length(data, bufcapacity); + assert(chunk_size); + + // convert chunk and write + flush(data, chunk_size); + + // iterate + data += chunk_size; + length -= chunk_size; + } + + // small tail is copied below + bufsize = 0; + } + + memcpy(buffer + bufsize, data, length * sizeof(char_t)); + bufsize += length; + } + + void write_buffer(const char_t* data, size_t length) + { + size_t offset = bufsize; + + if (offset + length <= bufcapacity) + { + memcpy(buffer + offset, data, length * sizeof(char_t)); + bufsize = offset + length; + } + else + { + write_direct(data, length); + } + } + + void write_string(const char_t* data) + { + // write the part of the string that fits in the buffer + size_t offset = bufsize; + + while (*data && offset < bufcapacity) + buffer[offset++] = *data++; + + // write the rest + if (offset < bufcapacity) + { + bufsize = offset; + } + else + { + // backtrack a bit if we have split the codepoint + size_t length = offset - bufsize; + size_t extra = length - get_valid_length(data - length, length); + + bufsize = offset - extra; + + write_direct(data - extra, strlength(data) + extra); + } + } + + void write(char_t d0) + { + size_t offset = bufsize; + if (offset > bufcapacity - 1) offset = flush(); + + buffer[offset + 0] = d0; + bufsize = offset + 1; + } + + void write(char_t d0, char_t d1) + { + size_t offset = bufsize; + if (offset > bufcapacity - 2) offset = flush(); + + buffer[offset + 0] = d0; + buffer[offset + 1] = d1; + bufsize = offset + 2; + } + + void write(char_t d0, char_t d1, char_t d2) + { + size_t offset = bufsize; + if (offset > bufcapacity - 3) offset = flush(); + + buffer[offset + 0] = d0; + buffer[offset + 1] = d1; + buffer[offset + 2] = d2; + bufsize = offset + 3; + } + + void write(char_t d0, char_t d1, char_t d2, char_t d3) + { + size_t offset = bufsize; + if (offset > bufcapacity - 4) offset = flush(); + + buffer[offset + 0] = d0; + buffer[offset + 1] = d1; + buffer[offset + 2] = d2; + buffer[offset + 3] = d3; + bufsize = offset + 4; + } + + void write(char_t d0, char_t d1, char_t d2, char_t d3, char_t d4) + { + size_t offset = bufsize; + if (offset > bufcapacity - 5) offset = flush(); + + buffer[offset + 0] = d0; + buffer[offset + 1] = d1; + buffer[offset + 2] = d2; + buffer[offset + 3] = d3; + buffer[offset + 4] = d4; + bufsize = offset + 5; + } + + void write(char_t d0, char_t d1, char_t d2, char_t d3, char_t d4, char_t d5) + { + size_t offset = bufsize; + if (offset > bufcapacity - 6) offset = flush(); + + buffer[offset + 0] = d0; + buffer[offset + 1] = d1; + buffer[offset + 2] = d2; + buffer[offset + 3] = d3; + buffer[offset + 4] = d4; + buffer[offset + 5] = d5; + bufsize = offset + 6; + } + + // utf8 maximum expansion: x4 (-> utf32) + // utf16 maximum expansion: x2 (-> utf32) + // utf32 maximum expansion: x1 + enum + { + bufcapacitybytes = + #ifdef PUGIXML_MEMORY_OUTPUT_STACK + PUGIXML_MEMORY_OUTPUT_STACK + #else + 10240 + #endif + , + bufcapacity = bufcapacitybytes / (sizeof(char_t) + 4) + }; + + char_t buffer[bufcapacity]; + + union + { + uint8_t data_u8[4 * bufcapacity]; + uint16_t data_u16[2 * bufcapacity]; + uint32_t data_u32[bufcapacity]; + char_t data_char[bufcapacity]; + } scratch; + + xml_writer& writer; + size_t bufsize; + xml_encoding encoding; + }; + + PUGI__FN void text_output_escaped(xml_buffered_writer& writer, const char_t* s, chartypex_t type) + { + while (*s) + { + const char_t* prev = s; + + // While *s is a usual symbol + PUGI__SCANWHILE_UNROLL(!PUGI__IS_CHARTYPEX(ss, type)); + + writer.write_buffer(prev, static_cast<size_t>(s - prev)); + + switch (*s) + { + case 0: break; + case '&': + writer.write('&', 'a', 'm', 'p', ';'); + ++s; + break; + case '<': + writer.write('&', 'l', 't', ';'); + ++s; + break; + case '>': + writer.write('&', 'g', 't', ';'); + ++s; + break; + case '"': + writer.write('&', 'q', 'u', 'o', 't', ';'); + ++s; + break; + default: // s is not a usual symbol + { + unsigned int ch = static_cast<unsigned int>(*s++); + assert(ch < 32); + + writer.write('&', '#', static_cast<char_t>((ch / 10) + '0'), static_cast<char_t>((ch % 10) + '0'), ';'); + } + } + } + } + + PUGI__FN void text_output(xml_buffered_writer& writer, const char_t* s, chartypex_t type, unsigned int flags) + { + if (flags & format_no_escapes) + writer.write_string(s); + else + text_output_escaped(writer, s, type); + } + + PUGI__FN void text_output_cdata(xml_buffered_writer& writer, const char_t* s) + { + do + { + writer.write('<', '!', '[', 'C', 'D'); + writer.write('A', 'T', 'A', '['); + + const char_t* prev = s; + + // look for ]]> sequence - we can't output it as is since it terminates CDATA + while (*s && !(s[0] == ']' && s[1] == ']' && s[2] == '>')) ++s; + + // skip ]] if we stopped at ]]>, > will go to the next CDATA section + if (*s) s += 2; + + writer.write_buffer(prev, static_cast<size_t>(s - prev)); + + writer.write(']', ']', '>'); + } + while (*s); + } + + PUGI__FN void text_output_indent(xml_buffered_writer& writer, const char_t* indent, size_t indent_length, unsigned int depth) + { + switch (indent_length) + { + case 1: + { + for (unsigned int i = 0; i < depth; ++i) + writer.write(indent[0]); + break; + } + + case 2: + { + for (unsigned int i = 0; i < depth; ++i) + writer.write(indent[0], indent[1]); + break; + } + + case 3: + { + for (unsigned int i = 0; i < depth; ++i) + writer.write(indent[0], indent[1], indent[2]); + break; + } + + case 4: + { + for (unsigned int i = 0; i < depth; ++i) + writer.write(indent[0], indent[1], indent[2], indent[3]); + break; + } + + default: + { + for (unsigned int i = 0; i < depth; ++i) + writer.write_buffer(indent, indent_length); + } + } + } + + PUGI__FN void node_output_comment(xml_buffered_writer& writer, const char_t* s) + { + writer.write('<', '!', '-', '-'); + + while (*s) + { + const char_t* prev = s; + + // look for -\0 or -- sequence - we can't output it since -- is illegal in comment body + while (*s && !(s[0] == '-' && (s[1] == '-' || s[1] == 0))) ++s; + + writer.write_buffer(prev, static_cast<size_t>(s - prev)); + + if (*s) + { + assert(*s == '-'); + + writer.write('-', ' '); + ++s; + } + } + + writer.write('-', '-', '>'); + } + + PUGI__FN void node_output_pi_value(xml_buffered_writer& writer, const char_t* s) + { + while (*s) + { + const char_t* prev = s; + + // look for ?> sequence - we can't output it since ?> terminates PI + while (*s && !(s[0] == '?' && s[1] == '>')) ++s; + + writer.write_buffer(prev, static_cast<size_t>(s - prev)); + + if (*s) + { + assert(s[0] == '?' && s[1] == '>'); + + writer.write('?', ' ', '>'); + s += 2; + } + } + } + + PUGI__FN void node_output_attributes(xml_buffered_writer& writer, xml_node_struct* node, const char_t* indent, size_t indent_length, unsigned int flags, unsigned int depth) + { + const char_t* default_name = PUGIXML_TEXT(":anonymous"); + + for (xml_attribute_struct* a = node->first_attribute; a; a = a->next_attribute) + { + if ((flags & (format_indent_attributes | format_raw)) == format_indent_attributes) + { + writer.write('\n'); + + text_output_indent(writer, indent, indent_length, depth + 1); + } + else + { + writer.write(' '); + } + + writer.write_string(a->name ? a->name + 0 : default_name); + writer.write('=', '"'); + + if (a->value) + text_output(writer, a->value, ctx_special_attr, flags); + + writer.write('"'); + } + } + + PUGI__FN bool node_output_start(xml_buffered_writer& writer, xml_node_struct* node, const char_t* indent, size_t indent_length, unsigned int flags, unsigned int depth) + { + const char_t* default_name = PUGIXML_TEXT(":anonymous"); + const char_t* name = node->name ? node->name + 0 : default_name; + + writer.write('<'); + writer.write_string(name); + + if (node->first_attribute) + node_output_attributes(writer, node, indent, indent_length, flags, depth); + + // element nodes can have value if parse_embed_pcdata was used + if (!node->value) + { + if (!node->first_child) + { + if (flags & format_no_empty_element_tags) + { + writer.write('>', '<', '/'); + writer.write_string(name); + writer.write('>'); + + return false; + } + else + { + if ((flags & format_raw) == 0) + writer.write(' '); + + writer.write('/', '>'); + + return false; + } + } + else + { + writer.write('>'); + + return true; + } + } + else + { + writer.write('>'); + + text_output(writer, node->value, ctx_special_pcdata, flags); + + if (!node->first_child) + { + writer.write('<', '/'); + writer.write_string(name); + writer.write('>'); + + return false; + } + else + { + return true; + } + } + } + + PUGI__FN void node_output_end(xml_buffered_writer& writer, xml_node_struct* node) + { + const char_t* default_name = PUGIXML_TEXT(":anonymous"); + const char_t* name = node->name ? node->name + 0 : default_name; + + writer.write('<', '/'); + writer.write_string(name); + writer.write('>'); + } + + PUGI__FN void node_output_simple(xml_buffered_writer& writer, xml_node_struct* node, unsigned int flags) + { + const char_t* default_name = PUGIXML_TEXT(":anonymous"); + + switch (PUGI__NODETYPE(node)) + { + case node_pcdata: + text_output(writer, node->value ? node->value + 0 : PUGIXML_TEXT(""), ctx_special_pcdata, flags); + break; + + case node_cdata: + text_output_cdata(writer, node->value ? node->value + 0 : PUGIXML_TEXT("")); + break; + + case node_comment: + node_output_comment(writer, node->value ? node->value + 0 : PUGIXML_TEXT("")); + break; + + case node_pi: + writer.write('<', '?'); + writer.write_string(node->name ? node->name + 0 : default_name); + + if (node->value) + { + writer.write(' '); + node_output_pi_value(writer, node->value); + } + + writer.write('?', '>'); + break; + + case node_declaration: + writer.write('<', '?'); + writer.write_string(node->name ? node->name + 0 : default_name); + node_output_attributes(writer, node, PUGIXML_TEXT(""), 0, flags | format_raw, 0); + writer.write('?', '>'); + break; + + case node_doctype: + writer.write('<', '!', 'D', 'O', 'C'); + writer.write('T', 'Y', 'P', 'E'); + + if (node->value) + { + writer.write(' '); + writer.write_string(node->value); + } + + writer.write('>'); + break; + + default: + assert(false && "Invalid node type"); + } + } + + enum indent_flags_t + { + indent_newline = 1, + indent_indent = 2 + }; + + PUGI__FN void node_output(xml_buffered_writer& writer, xml_node_struct* root, const char_t* indent, unsigned int flags, unsigned int depth) + { + size_t indent_length = ((flags & (format_indent | format_indent_attributes)) && (flags & format_raw) == 0) ? strlength(indent) : 0; + unsigned int indent_flags = indent_indent; + + xml_node_struct* node = root; + + do + { + assert(node); + + // begin writing current node + if (PUGI__NODETYPE(node) == node_pcdata || PUGI__NODETYPE(node) == node_cdata) + { + node_output_simple(writer, node, flags); + + indent_flags = 0; + } + else + { + if ((indent_flags & indent_newline) && (flags & format_raw) == 0) + writer.write('\n'); + + if ((indent_flags & indent_indent) && indent_length) + text_output_indent(writer, indent, indent_length, depth); + + if (PUGI__NODETYPE(node) == node_element) + { + indent_flags = indent_newline | indent_indent; + + if (node_output_start(writer, node, indent, indent_length, flags, depth)) + { + // element nodes can have value if parse_embed_pcdata was used + if (node->value) + indent_flags = 0; + + node = node->first_child; + depth++; + continue; + } + } + else if (PUGI__NODETYPE(node) == node_document) + { + indent_flags = indent_indent; + + if (node->first_child) + { + node = node->first_child; + continue; + } + } + else + { + node_output_simple(writer, node, flags); + + indent_flags = indent_newline | indent_indent; + } + } + + // continue to the next node + while (node != root) + { + if (node->next_sibling) + { + node = node->next_sibling; + break; + } + + node = node->parent; + + // write closing node + if (PUGI__NODETYPE(node) == node_element) + { + depth--; + + if ((indent_flags & indent_newline) && (flags & format_raw) == 0) + writer.write('\n'); + + if ((indent_flags & indent_indent) && indent_length) + text_output_indent(writer, indent, indent_length, depth); + + node_output_end(writer, node); + + indent_flags = indent_newline | indent_indent; + } + } + } + while (node != root); + + if ((indent_flags & indent_newline) && (flags & format_raw) == 0) + writer.write('\n'); + } + + PUGI__FN bool has_declaration(xml_node_struct* node) + { + for (xml_node_struct* child = node->first_child; child; child = child->next_sibling) + { + xml_node_type type = PUGI__NODETYPE(child); + + if (type == node_declaration) return true; + if (type == node_element) return false; + } + + return false; + } + + PUGI__FN bool is_attribute_of(xml_attribute_struct* attr, xml_node_struct* node) + { + for (xml_attribute_struct* a = node->first_attribute; a; a = a->next_attribute) + if (a == attr) + return true; + + return false; + } + + PUGI__FN bool allow_insert_attribute(xml_node_type parent) + { + return parent == node_element || parent == node_declaration; + } + + PUGI__FN bool allow_insert_child(xml_node_type parent, xml_node_type child) + { + if (parent != node_document && parent != node_element) return false; + if (child == node_document || child == node_null) return false; + if (parent != node_document && (child == node_declaration || child == node_doctype)) return false; + + return true; + } + + PUGI__FN bool allow_move(xml_node parent, xml_node child) + { + // check that child can be a child of parent + if (!allow_insert_child(parent.type(), child.type())) + return false; + + // check that node is not moved between documents + if (parent.root() != child.root()) + return false; + + // check that new parent is not in the child subtree + xml_node cur = parent; + + while (cur) + { + if (cur == child) + return false; + + cur = cur.parent(); + } + + return true; + } + + template <typename String, typename Header> + PUGI__FN void node_copy_string(String& dest, Header& header, uintptr_t header_mask, char_t* source, Header& source_header, xml_allocator* alloc) + { + assert(!dest && (header & header_mask) == 0); + + if (source) + { + if (alloc && (source_header & header_mask) == 0) + { + dest = source; + + // since strcpy_insitu can reuse document buffer memory we need to mark both source and dest as shared + header |= xml_memory_page_contents_shared_mask; + source_header |= xml_memory_page_contents_shared_mask; + } + else + strcpy_insitu(dest, header, header_mask, source, strlength(source)); + } + } + + PUGI__FN void node_copy_contents(xml_node_struct* dn, xml_node_struct* sn, xml_allocator* shared_alloc) + { + node_copy_string(dn->name, dn->header, xml_memory_page_name_allocated_mask, sn->name, sn->header, shared_alloc); + node_copy_string(dn->value, dn->header, xml_memory_page_value_allocated_mask, sn->value, sn->header, shared_alloc); + + for (xml_attribute_struct* sa = sn->first_attribute; sa; sa = sa->next_attribute) + { + xml_attribute_struct* da = append_new_attribute(dn, get_allocator(dn)); + + if (da) + { + node_copy_string(da->name, da->header, xml_memory_page_name_allocated_mask, sa->name, sa->header, shared_alloc); + node_copy_string(da->value, da->header, xml_memory_page_value_allocated_mask, sa->value, sa->header, shared_alloc); + } + } + } + + PUGI__FN void node_copy_tree(xml_node_struct* dn, xml_node_struct* sn) + { + xml_allocator& alloc = get_allocator(dn); + xml_allocator* shared_alloc = (&alloc == &get_allocator(sn)) ? &alloc : 0; + + node_copy_contents(dn, sn, shared_alloc); + + xml_node_struct* dit = dn; + xml_node_struct* sit = sn->first_child; + + while (sit && sit != sn) + { + if (sit != dn) + { + xml_node_struct* copy = append_new_node(dit, alloc, PUGI__NODETYPE(sit)); + + if (copy) + { + node_copy_contents(copy, sit, shared_alloc); + + if (sit->first_child) + { + dit = copy; + sit = sit->first_child; + continue; + } + } + } + + // continue to the next node + do + { + if (sit->next_sibling) + { + sit = sit->next_sibling; + break; + } + + sit = sit->parent; + dit = dit->parent; + } + while (sit != sn); + } + } + + PUGI__FN void node_copy_attribute(xml_attribute_struct* da, xml_attribute_struct* sa) + { + xml_allocator& alloc = get_allocator(da); + xml_allocator* shared_alloc = (&alloc == &get_allocator(sa)) ? &alloc : 0; + + node_copy_string(da->name, da->header, xml_memory_page_name_allocated_mask, sa->name, sa->header, shared_alloc); + node_copy_string(da->value, da->header, xml_memory_page_value_allocated_mask, sa->value, sa->header, shared_alloc); + } + + inline bool is_text_node(xml_node_struct* node) + { + xml_node_type type = PUGI__NODETYPE(node); + + return type == node_pcdata || type == node_cdata; + } + + // get value with conversion functions + template <typename U> U string_to_integer(const char_t* value, U minneg, U maxpos) + { + U result = 0; + const char_t* s = value; + + while (PUGI__IS_CHARTYPE(*s, ct_space)) + s++; + + bool negative = (*s == '-'); + + s += (*s == '+' || *s == '-'); + + bool overflow = false; + + if (s[0] == '0' && (s[1] | ' ') == 'x') + { + s += 2; + + // since overflow detection relies on length of the sequence skip leading zeros + while (*s == '0') + s++; + + const char_t* start = s; + + for (;;) + { + if (static_cast<unsigned>(*s - '0') < 10) + result = result * 16 + (*s - '0'); + else if (static_cast<unsigned>((*s | ' ') - 'a') < 6) + result = result * 16 + ((*s | ' ') - 'a' + 10); + else + break; + + s++; + } + + size_t digits = static_cast<size_t>(s - start); + + overflow = digits > sizeof(U) * 2; + } + else + { + // since overflow detection relies on length of the sequence skip leading zeros + while (*s == '0') + s++; + + const char_t* start = s; + + for (;;) + { + if (static_cast<unsigned>(*s - '0') < 10) + result = result * 10 + (*s - '0'); + else + break; + + s++; + } + + size_t digits = static_cast<size_t>(s - start); + + PUGI__STATIC_ASSERT(sizeof(U) == 8 || sizeof(U) == 4 || sizeof(U) == 2); + + const size_t max_digits10 = sizeof(U) == 8 ? 20 : sizeof(U) == 4 ? 10 : 5; + const char_t max_lead = sizeof(U) == 8 ? '1' : sizeof(U) == 4 ? '4' : '6'; + const size_t high_bit = sizeof(U) * 8 - 1; + + overflow = digits >= max_digits10 && !(digits == max_digits10 && (*start < max_lead || (*start == max_lead && result >> high_bit))); + } + + if (negative) + return (overflow || result > minneg) ? 0 - minneg : 0 - result; + else + return (overflow || result > maxpos) ? maxpos : result; + } + + PUGI__FN int get_value_int(const char_t* value) + { + return string_to_integer<unsigned int>(value, 0 - static_cast<unsigned int>(INT_MIN), INT_MAX); + } + + PUGI__FN unsigned int get_value_uint(const char_t* value) + { + return string_to_integer<unsigned int>(value, 0, UINT_MAX); + } + + PUGI__FN double get_value_double(const char_t* value) + { + #ifdef PUGIXML_WCHAR_MODE + return wcstod(value, 0); + #else + return strtod(value, 0); + #endif + } + + PUGI__FN float get_value_float(const char_t* value) + { + #ifdef PUGIXML_WCHAR_MODE + return static_cast<float>(wcstod(value, 0)); + #else + return static_cast<float>(strtod(value, 0)); + #endif + } + + PUGI__FN bool get_value_bool(const char_t* value) + { + // only look at first char + char_t first = *value; + + // 1*, t* (true), T* (True), y* (yes), Y* (YES) + return (first == '1' || first == 't' || first == 'T' || first == 'y' || first == 'Y'); + } + +#ifdef PUGIXML_HAS_LONG_LONG + PUGI__FN long long get_value_llong(const char_t* value) + { + return string_to_integer<unsigned long long>(value, 0 - static_cast<unsigned long long>(LLONG_MIN), LLONG_MAX); + } + + PUGI__FN unsigned long long get_value_ullong(const char_t* value) + { + return string_to_integer<unsigned long long>(value, 0, ULLONG_MAX); + } +#endif + + template <typename U> PUGI__FN char_t* integer_to_string(char_t* begin, char_t* end, U value, bool negative) + { + char_t* result = end - 1; + U rest = negative ? 0 - value : value; + + do + { + *result-- = static_cast<char_t>('0' + (rest % 10)); + rest /= 10; + } + while (rest); + + assert(result >= begin); + (void)begin; + + *result = '-'; + + return result + !negative; + } + + // set value with conversion functions + template <typename String, typename Header> + PUGI__FN bool set_value_ascii(String& dest, Header& header, uintptr_t header_mask, char* buf) + { + #ifdef PUGIXML_WCHAR_MODE + char_t wbuf[128]; + assert(strlen(buf) < sizeof(wbuf) / sizeof(wbuf[0])); + + size_t offset = 0; + for (; buf[offset]; ++offset) wbuf[offset] = buf[offset]; + + return strcpy_insitu(dest, header, header_mask, wbuf, offset); + #else + return strcpy_insitu(dest, header, header_mask, buf, strlen(buf)); + #endif + } + + template <typename U, typename String, typename Header> + PUGI__FN bool set_value_integer(String& dest, Header& header, uintptr_t header_mask, U value, bool negative) + { + char_t buf[64]; + char_t* end = buf + sizeof(buf) / sizeof(buf[0]); + char_t* begin = integer_to_string(buf, end, value, negative); + + return strcpy_insitu(dest, header, header_mask, begin, end - begin); + } + + template <typename String, typename Header> + PUGI__FN bool set_value_convert(String& dest, Header& header, uintptr_t header_mask, float value) + { + char buf[128]; + sprintf(buf, "%.9g", value); + + return set_value_ascii(dest, header, header_mask, buf); + } + + template <typename String, typename Header> + PUGI__FN bool set_value_convert(String& dest, Header& header, uintptr_t header_mask, double value) + { + char buf[128]; + sprintf(buf, "%.17g", value); + + return set_value_ascii(dest, header, header_mask, buf); + } + + template <typename String, typename Header> + PUGI__FN bool set_value_bool(String& dest, Header& header, uintptr_t header_mask, bool value) + { + return strcpy_insitu(dest, header, header_mask, value ? PUGIXML_TEXT("true") : PUGIXML_TEXT("false"), value ? 4 : 5); + } + + PUGI__FN xml_parse_result load_buffer_impl(xml_document_struct* doc, xml_node_struct* root, void* contents, size_t size, unsigned int options, xml_encoding encoding, bool is_mutable, bool own, char_t** out_buffer) + { + // check input buffer + if (!contents && size) return make_parse_result(status_io_error); + + // get actual encoding + xml_encoding buffer_encoding = impl::get_buffer_encoding(encoding, contents, size); + + // get private buffer + char_t* buffer = 0; + size_t length = 0; + + if (!impl::convert_buffer(buffer, length, buffer_encoding, contents, size, is_mutable)) return impl::make_parse_result(status_out_of_memory); + + // delete original buffer if we performed a conversion + if (own && buffer != contents && contents) impl::xml_memory::deallocate(contents); + + // grab onto buffer if it's our buffer, user is responsible for deallocating contents himself + if (own || buffer != contents) *out_buffer = buffer; + + // store buffer for offset_debug + doc->buffer = buffer; + + // parse + xml_parse_result res = impl::xml_parser::parse(buffer, length, doc, root, options); + + // remember encoding + res.encoding = buffer_encoding; + + return res; + } + + // we need to get length of entire file to load it in memory; the only (relatively) sane way to do it is via seek/tell trick + PUGI__FN xml_parse_status get_file_size(FILE* file, size_t& out_result) + { + #if defined(PUGI__MSVC_CRT_VERSION) && PUGI__MSVC_CRT_VERSION >= 1400 && !defined(_WIN32_WCE) + // there are 64-bit versions of fseek/ftell, let's use them + typedef __int64 length_type; + + _fseeki64(file, 0, SEEK_END); + length_type length = _ftelli64(file); + _fseeki64(file, 0, SEEK_SET); + #elif defined(__MINGW32__) && !defined(__NO_MINGW_LFS) && (!defined(__STRICT_ANSI__) || defined(__MINGW64_VERSION_MAJOR)) + // there are 64-bit versions of fseek/ftell, let's use them + typedef off64_t length_type; + + fseeko64(file, 0, SEEK_END); + length_type length = ftello64(file); + fseeko64(file, 0, SEEK_SET); + #else + // if this is a 32-bit OS, long is enough; if this is a unix system, long is 64-bit, which is enough; otherwise we can't do anything anyway. + typedef long length_type; + + fseek(file, 0, SEEK_END); + length_type length = ftell(file); + fseek(file, 0, SEEK_SET); + #endif + + // check for I/O errors + if (length < 0) return status_io_error; + + // check for overflow + size_t result = static_cast<size_t>(length); + + if (static_cast<length_type>(result) != length) return status_out_of_memory; + + // finalize + out_result = result; + + return status_ok; + } + + // This function assumes that buffer has extra sizeof(char_t) writable bytes after size + PUGI__FN size_t zero_terminate_buffer(void* buffer, size_t size, xml_encoding encoding) + { + // We only need to zero-terminate if encoding conversion does not do it for us + #ifdef PUGIXML_WCHAR_MODE + xml_encoding wchar_encoding = get_wchar_encoding(); + + if (encoding == wchar_encoding || need_endian_swap_utf(encoding, wchar_encoding)) + { + size_t length = size / sizeof(char_t); + + static_cast<char_t*>(buffer)[length] = 0; + return (length + 1) * sizeof(char_t); + } + #else + if (encoding == encoding_utf8) + { + static_cast<char*>(buffer)[size] = 0; + return size + 1; + } + #endif + + return size; + } + + PUGI__FN xml_parse_result load_file_impl(xml_document_struct* doc, FILE* file, unsigned int options, xml_encoding encoding, char_t** out_buffer) + { + if (!file) return make_parse_result(status_file_not_found); + + // get file size (can result in I/O errors) + size_t size = 0; + xml_parse_status size_status = get_file_size(file, size); + if (size_status != status_ok) return make_parse_result(size_status); + + size_t max_suffix_size = sizeof(char_t); + + // allocate buffer for the whole file + char* contents = static_cast<char*>(xml_memory::allocate(size + max_suffix_size)); + if (!contents) return make_parse_result(status_out_of_memory); + + // read file in memory + size_t read_size = fread(contents, 1, size, file); + + if (read_size != size) + { + xml_memory::deallocate(contents); + return make_parse_result(status_io_error); + } + + xml_encoding real_encoding = get_buffer_encoding(encoding, contents, size); + + return load_buffer_impl(doc, doc, contents, zero_terminate_buffer(contents, size, real_encoding), options, real_encoding, true, true, out_buffer); + } + + PUGI__FN void close_file(FILE* file) + { + fclose(file); + } + +#ifndef PUGIXML_NO_STL + template <typename T> struct xml_stream_chunk + { + static xml_stream_chunk* create() + { + void* memory = xml_memory::allocate(sizeof(xml_stream_chunk)); + if (!memory) return 0; + + return new (memory) xml_stream_chunk(); + } + + static void destroy(xml_stream_chunk* chunk) + { + // free chunk chain + while (chunk) + { + xml_stream_chunk* next_ = chunk->next; + + xml_memory::deallocate(chunk); + + chunk = next_; + } + } + + xml_stream_chunk(): next(0), size(0) + { + } + + xml_stream_chunk* next; + size_t size; + + T data[xml_memory_page_size / sizeof(T)]; + }; + + template <typename T> PUGI__FN xml_parse_status load_stream_data_noseek(std::basic_istream<T>& stream, void** out_buffer, size_t* out_size) + { + auto_deleter<xml_stream_chunk<T> > chunks(0, xml_stream_chunk<T>::destroy); + + // read file to a chunk list + size_t total = 0; + xml_stream_chunk<T>* last = 0; + + while (!stream.eof()) + { + // allocate new chunk + xml_stream_chunk<T>* chunk = xml_stream_chunk<T>::create(); + if (!chunk) return status_out_of_memory; + + // append chunk to list + if (last) last = last->next = chunk; + else chunks.data = last = chunk; + + // read data to chunk + stream.read(chunk->data, static_cast<std::streamsize>(sizeof(chunk->data) / sizeof(T))); + chunk->size = static_cast<size_t>(stream.gcount()) * sizeof(T); + + // read may set failbit | eofbit in case gcount() is less than read length, so check for other I/O errors + if (stream.bad() || (!stream.eof() && stream.fail())) return status_io_error; + + // guard against huge files (chunk size is small enough to make this overflow check work) + if (total + chunk->size < total) return status_out_of_memory; + total += chunk->size; + } + + size_t max_suffix_size = sizeof(char_t); + + // copy chunk list to a contiguous buffer + char* buffer = static_cast<char*>(xml_memory::allocate(total + max_suffix_size)); + if (!buffer) return status_out_of_memory; + + char* write = buffer; + + for (xml_stream_chunk<T>* chunk = chunks.data; chunk; chunk = chunk->next) + { + assert(write + chunk->size <= buffer + total); + memcpy(write, chunk->data, chunk->size); + write += chunk->size; + } + + assert(write == buffer + total); + + // return buffer + *out_buffer = buffer; + *out_size = total; + + return status_ok; + } + + template <typename T> PUGI__FN xml_parse_status load_stream_data_seek(std::basic_istream<T>& stream, void** out_buffer, size_t* out_size) + { + // get length of remaining data in stream + typename std::basic_istream<T>::pos_type pos = stream.tellg(); + stream.seekg(0, std::ios::end); + std::streamoff length = stream.tellg() - pos; + stream.seekg(pos); + + if (stream.fail() || pos < 0) return status_io_error; + + // guard against huge files + size_t read_length = static_cast<size_t>(length); + + if (static_cast<std::streamsize>(read_length) != length || length < 0) return status_out_of_memory; + + size_t max_suffix_size = sizeof(char_t); + + // read stream data into memory (guard against stream exceptions with buffer holder) + auto_deleter<void> buffer(xml_memory::allocate(read_length * sizeof(T) + max_suffix_size), xml_memory::deallocate); + if (!buffer.data) return status_out_of_memory; + + stream.read(static_cast<T*>(buffer.data), static_cast<std::streamsize>(read_length)); + + // read may set failbit | eofbit in case gcount() is less than read_length (i.e. line ending conversion), so check for other I/O errors + if (stream.bad() || (!stream.eof() && stream.fail())) return status_io_error; + + // return buffer + size_t actual_length = static_cast<size_t>(stream.gcount()); + assert(actual_length <= read_length); + + *out_buffer = buffer.release(); + *out_size = actual_length * sizeof(T); + + return status_ok; + } + + template <typename T> PUGI__FN xml_parse_result load_stream_impl(xml_document_struct* doc, std::basic_istream<T>& stream, unsigned int options, xml_encoding encoding, char_t** out_buffer) + { + void* buffer = 0; + size_t size = 0; + xml_parse_status status = status_ok; + + // if stream has an error bit set, bail out (otherwise tellg() can fail and we'll clear error bits) + if (stream.fail()) return make_parse_result(status_io_error); + + // load stream to memory (using seek-based implementation if possible, since it's faster and takes less memory) + if (stream.tellg() < 0) + { + stream.clear(); // clear error flags that could be set by a failing tellg + status = load_stream_data_noseek(stream, &buffer, &size); + } + else + status = load_stream_data_seek(stream, &buffer, &size); + + if (status != status_ok) return make_parse_result(status); + + xml_encoding real_encoding = get_buffer_encoding(encoding, buffer, size); + + return load_buffer_impl(doc, doc, buffer, zero_terminate_buffer(buffer, size, real_encoding), options, real_encoding, true, true, out_buffer); + } +#endif + +#if defined(PUGI__MSVC_CRT_VERSION) || defined(__BORLANDC__) || (defined(__MINGW32__) && (!defined(__STRICT_ANSI__) || defined(__MINGW64_VERSION_MAJOR))) + PUGI__FN FILE* open_file_wide(const wchar_t* path, const wchar_t* mode) + { + return _wfopen(path, mode); + } +#else + PUGI__FN char* convert_path_heap(const wchar_t* str) + { + assert(str); + + // first pass: get length in utf8 characters + size_t length = strlength_wide(str); + size_t size = as_utf8_begin(str, length); + + // allocate resulting string + char* result = static_cast<char*>(xml_memory::allocate(size + 1)); + if (!result) return 0; + + // second pass: convert to utf8 + as_utf8_end(result, size, str, length); + + // zero-terminate + result[size] = 0; + + return result; + } + + PUGI__FN FILE* open_file_wide(const wchar_t* path, const wchar_t* mode) + { + // there is no standard function to open wide paths, so our best bet is to try utf8 path + char* path_utf8 = convert_path_heap(path); + if (!path_utf8) return 0; + + // convert mode to ASCII (we mirror _wfopen interface) + char mode_ascii[4] = {0}; + for (size_t i = 0; mode[i]; ++i) mode_ascii[i] = static_cast<char>(mode[i]); + + // try to open the utf8 path + FILE* result = fopen(path_utf8, mode_ascii); + + // free dummy buffer + xml_memory::deallocate(path_utf8); + + return result; + } +#endif + + PUGI__FN bool save_file_impl(const xml_document& doc, FILE* file, const char_t* indent, unsigned int flags, xml_encoding encoding) + { + if (!file) return false; + + xml_writer_file writer(file); + doc.save(writer, indent, flags, encoding); + + return ferror(file) == 0; + } + + struct name_null_sentry + { + xml_node_struct* node; + char_t* name; + + name_null_sentry(xml_node_struct* node_): node(node_), name(node_->name) + { + node->name = 0; + } + + ~name_null_sentry() + { + node->name = name; + } + }; +PUGI__NS_END + +namespace pugi +{ + PUGI__FN xml_writer_file::xml_writer_file(void* file_): file(file_) + { + } + + PUGI__FN void xml_writer_file::write(const void* data, size_t size) + { + size_t result = fwrite(data, 1, size, static_cast<FILE*>(file)); + (void)!result; // unfortunately we can't do proper error handling here + } + +#ifndef PUGIXML_NO_STL + PUGI__FN xml_writer_stream::xml_writer_stream(std::basic_ostream<char, std::char_traits<char> >& stream): narrow_stream(&stream), wide_stream(0) + { + } + + PUGI__FN xml_writer_stream::xml_writer_stream(std::basic_ostream<wchar_t, std::char_traits<wchar_t> >& stream): narrow_stream(0), wide_stream(&stream) + { + } + + PUGI__FN void xml_writer_stream::write(const void* data, size_t size) + { + if (narrow_stream) + { + assert(!wide_stream); + narrow_stream->write(reinterpret_cast<const char*>(data), static_cast<std::streamsize>(size)); + } + else + { + assert(wide_stream); + assert(size % sizeof(wchar_t) == 0); + + wide_stream->write(reinterpret_cast<const wchar_t*>(data), static_cast<std::streamsize>(size / sizeof(wchar_t))); + } + } +#endif + + PUGI__FN xml_tree_walker::xml_tree_walker(): _depth(0) + { + } + + PUGI__FN xml_tree_walker::~xml_tree_walker() + { + } + + PUGI__FN int xml_tree_walker::depth() const + { + return _depth; + } + + PUGI__FN bool xml_tree_walker::begin(xml_node&) + { + return true; + } + + PUGI__FN bool xml_tree_walker::end(xml_node&) + { + return true; + } + + PUGI__FN xml_attribute::xml_attribute(): _attr(0) + { + } + + PUGI__FN xml_attribute::xml_attribute(xml_attribute_struct* attr): _attr(attr) + { + } + + PUGI__FN static void unspecified_bool_xml_attribute(xml_attribute***) + { + } + + PUGI__FN xml_attribute::operator xml_attribute::unspecified_bool_type() const + { + return _attr ? unspecified_bool_xml_attribute : 0; + } + + PUGI__FN bool xml_attribute::operator!() const + { + return !_attr; + } + + PUGI__FN bool xml_attribute::operator==(const xml_attribute& r) const + { + return (_attr == r._attr); + } + + PUGI__FN bool xml_attribute::operator!=(const xml_attribute& r) const + { + return (_attr != r._attr); + } + + PUGI__FN bool xml_attribute::operator<(const xml_attribute& r) const + { + return (_attr < r._attr); + } + + PUGI__FN bool xml_attribute::operator>(const xml_attribute& r) const + { + return (_attr > r._attr); + } + + PUGI__FN bool xml_attribute::operator<=(const xml_attribute& r) const + { + return (_attr <= r._attr); + } + + PUGI__FN bool xml_attribute::operator>=(const xml_attribute& r) const + { + return (_attr >= r._attr); + } + + PUGI__FN xml_attribute xml_attribute::next_attribute() const + { + return _attr ? xml_attribute(_attr->next_attribute) : xml_attribute(); + } + + PUGI__FN xml_attribute xml_attribute::previous_attribute() const + { + return _attr && _attr->prev_attribute_c->next_attribute ? xml_attribute(_attr->prev_attribute_c) : xml_attribute(); + } + + PUGI__FN const char_t* xml_attribute::as_string(const char_t* def) const + { + return (_attr && _attr->value) ? _attr->value + 0 : def; + } + + PUGI__FN int xml_attribute::as_int(int def) const + { + return (_attr && _attr->value) ? impl::get_value_int(_attr->value) : def; + } + + PUGI__FN unsigned int xml_attribute::as_uint(unsigned int def) const + { + return (_attr && _attr->value) ? impl::get_value_uint(_attr->value) : def; + } + + PUGI__FN double xml_attribute::as_double(double def) const + { + return (_attr && _attr->value) ? impl::get_value_double(_attr->value) : def; + } + + PUGI__FN float xml_attribute::as_float(float def) const + { + return (_attr && _attr->value) ? impl::get_value_float(_attr->value) : def; + } + + PUGI__FN bool xml_attribute::as_bool(bool def) const + { + return (_attr && _attr->value) ? impl::get_value_bool(_attr->value) : def; + } + +#ifdef PUGIXML_HAS_LONG_LONG + PUGI__FN long long xml_attribute::as_llong(long long def) const + { + return (_attr && _attr->value) ? impl::get_value_llong(_attr->value) : def; + } + + PUGI__FN unsigned long long xml_attribute::as_ullong(unsigned long long def) const + { + return (_attr && _attr->value) ? impl::get_value_ullong(_attr->value) : def; + } +#endif + + PUGI__FN bool xml_attribute::empty() const + { + return !_attr; + } + + PUGI__FN const char_t* xml_attribute::name() const + { + return (_attr && _attr->name) ? _attr->name + 0 : PUGIXML_TEXT(""); + } + + PUGI__FN const char_t* xml_attribute::value() const + { + return (_attr && _attr->value) ? _attr->value + 0 : PUGIXML_TEXT(""); + } + + PUGI__FN size_t xml_attribute::hash_value() const + { + return static_cast<size_t>(reinterpret_cast<uintptr_t>(_attr) / sizeof(xml_attribute_struct)); + } + + PUGI__FN xml_attribute_struct* xml_attribute::internal_object() const + { + return _attr; + } + + PUGI__FN xml_attribute& xml_attribute::operator=(const char_t* rhs) + { + set_value(rhs); + return *this; + } + + PUGI__FN xml_attribute& xml_attribute::operator=(int rhs) + { + set_value(rhs); + return *this; + } + + PUGI__FN xml_attribute& xml_attribute::operator=(unsigned int rhs) + { + set_value(rhs); + return *this; + } + + PUGI__FN xml_attribute& xml_attribute::operator=(long rhs) + { + set_value(rhs); + return *this; + } + + PUGI__FN xml_attribute& xml_attribute::operator=(unsigned long rhs) + { + set_value(rhs); + return *this; + } + + PUGI__FN xml_attribute& xml_attribute::operator=(double rhs) + { + set_value(rhs); + return *this; + } + + PUGI__FN xml_attribute& xml_attribute::operator=(float rhs) + { + set_value(rhs); + return *this; + } + + PUGI__FN xml_attribute& xml_attribute::operator=(bool rhs) + { + set_value(rhs); + return *this; + } + +#ifdef PUGIXML_HAS_LONG_LONG + PUGI__FN xml_attribute& xml_attribute::operator=(long long rhs) + { + set_value(rhs); + return *this; + } + + PUGI__FN xml_attribute& xml_attribute::operator=(unsigned long long rhs) + { + set_value(rhs); + return *this; + } +#endif + + PUGI__FN bool xml_attribute::set_name(const char_t* rhs) + { + if (!_attr) return false; + + return impl::strcpy_insitu(_attr->name, _attr->header, impl::xml_memory_page_name_allocated_mask, rhs, impl::strlength(rhs)); + } + + PUGI__FN bool xml_attribute::set_value(const char_t* rhs) + { + if (!_attr) return false; + + return impl::strcpy_insitu(_attr->value, _attr->header, impl::xml_memory_page_value_allocated_mask, rhs, impl::strlength(rhs)); + } + + PUGI__FN bool xml_attribute::set_value(int rhs) + { + if (!_attr) return false; + + return impl::set_value_integer<unsigned int>(_attr->value, _attr->header, impl::xml_memory_page_value_allocated_mask, rhs, rhs < 0); + } + + PUGI__FN bool xml_attribute::set_value(unsigned int rhs) + { + if (!_attr) return false; + + return impl::set_value_integer<unsigned int>(_attr->value, _attr->header, impl::xml_memory_page_value_allocated_mask, rhs, false); + } + + PUGI__FN bool xml_attribute::set_value(long rhs) + { + if (!_attr) return false; + + return impl::set_value_integer<unsigned long>(_attr->value, _attr->header, impl::xml_memory_page_value_allocated_mask, rhs, rhs < 0); + } + + PUGI__FN bool xml_attribute::set_value(unsigned long rhs) + { + if (!_attr) return false; + + return impl::set_value_integer<unsigned long>(_attr->value, _attr->header, impl::xml_memory_page_value_allocated_mask, rhs, false); + } + + PUGI__FN bool xml_attribute::set_value(double rhs) + { + if (!_attr) return false; + + return impl::set_value_convert(_attr->value, _attr->header, impl::xml_memory_page_value_allocated_mask, rhs); + } + + PUGI__FN bool xml_attribute::set_value(float rhs) + { + if (!_attr) return false; + + return impl::set_value_convert(_attr->value, _attr->header, impl::xml_memory_page_value_allocated_mask, rhs); + } + + PUGI__FN bool xml_attribute::set_value(bool rhs) + { + if (!_attr) return false; + + return impl::set_value_bool(_attr->value, _attr->header, impl::xml_memory_page_value_allocated_mask, rhs); + } + +#ifdef PUGIXML_HAS_LONG_LONG + PUGI__FN bool xml_attribute::set_value(long long rhs) + { + if (!_attr) return false; + + return impl::set_value_integer<unsigned long long>(_attr->value, _attr->header, impl::xml_memory_page_value_allocated_mask, rhs, rhs < 0); + } + + PUGI__FN bool xml_attribute::set_value(unsigned long long rhs) + { + if (!_attr) return false; + + return impl::set_value_integer<unsigned long long>(_attr->value, _attr->header, impl::xml_memory_page_value_allocated_mask, rhs, false); + } +#endif + +#ifdef __BORLANDC__ + PUGI__FN bool operator&&(const xml_attribute& lhs, bool rhs) + { + return (bool)lhs && rhs; + } + + PUGI__FN bool operator||(const xml_attribute& lhs, bool rhs) + { + return (bool)lhs || rhs; + } +#endif + + PUGI__FN xml_node::xml_node(): _root(0) + { + } + + PUGI__FN xml_node::xml_node(xml_node_struct* p): _root(p) + { + } + + PUGI__FN static void unspecified_bool_xml_node(xml_node***) + { + } + + PUGI__FN xml_node::operator xml_node::unspecified_bool_type() const + { + return _root ? unspecified_bool_xml_node : 0; + } + + PUGI__FN bool xml_node::operator!() const + { + return !_root; + } + + PUGI__FN xml_node::iterator xml_node::begin() const + { + return iterator(_root ? _root->first_child + 0 : 0, _root); + } + + PUGI__FN xml_node::iterator xml_node::end() const + { + return iterator(0, _root); + } + + PUGI__FN xml_node::attribute_iterator xml_node::attributes_begin() const + { + return attribute_iterator(_root ? _root->first_attribute + 0 : 0, _root); + } + + PUGI__FN xml_node::attribute_iterator xml_node::attributes_end() const + { + return attribute_iterator(0, _root); + } + + PUGI__FN xml_object_range<xml_node_iterator> xml_node::children() const + { + return xml_object_range<xml_node_iterator>(begin(), end()); + } + + PUGI__FN xml_object_range<xml_named_node_iterator> xml_node::children(const char_t* name_) const + { + return xml_object_range<xml_named_node_iterator>(xml_named_node_iterator(child(name_)._root, _root, name_), xml_named_node_iterator(0, _root, name_)); + } + + PUGI__FN xml_object_range<xml_attribute_iterator> xml_node::attributes() const + { + return xml_object_range<xml_attribute_iterator>(attributes_begin(), attributes_end()); + } + + PUGI__FN bool xml_node::operator==(const xml_node& r) const + { + return (_root == r._root); + } + + PUGI__FN bool xml_node::operator!=(const xml_node& r) const + { + return (_root != r._root); + } + + PUGI__FN bool xml_node::operator<(const xml_node& r) const + { + return (_root < r._root); + } + + PUGI__FN bool xml_node::operator>(const xml_node& r) const + { + return (_root > r._root); + } + + PUGI__FN bool xml_node::operator<=(const xml_node& r) const + { + return (_root <= r._root); + } + + PUGI__FN bool xml_node::operator>=(const xml_node& r) const + { + return (_root >= r._root); + } + + PUGI__FN bool xml_node::empty() const + { + return !_root; + } + + PUGI__FN const char_t* xml_node::name() const + { + return (_root && _root->name) ? _root->name + 0 : PUGIXML_TEXT(""); + } + + PUGI__FN xml_node_type xml_node::type() const + { + return _root ? PUGI__NODETYPE(_root) : node_null; + } + + PUGI__FN const char_t* xml_node::value() const + { + return (_root && _root->value) ? _root->value + 0 : PUGIXML_TEXT(""); + } + + PUGI__FN xml_node xml_node::child(const char_t* name_) const + { + if (!_root) return xml_node(); + + for (xml_node_struct* i = _root->first_child; i; i = i->next_sibling) + if (i->name && impl::strequal(name_, i->name)) return xml_node(i); + + return xml_node(); + } + + PUGI__FN xml_attribute xml_node::attribute(const char_t* name_) const + { + if (!_root) return xml_attribute(); + + for (xml_attribute_struct* i = _root->first_attribute; i; i = i->next_attribute) + if (i->name && impl::strequal(name_, i->name)) + return xml_attribute(i); + + return xml_attribute(); + } + + PUGI__FN xml_node xml_node::next_sibling(const char_t* name_) const + { + if (!_root) return xml_node(); + + for (xml_node_struct* i = _root->next_sibling; i; i = i->next_sibling) + if (i->name && impl::strequal(name_, i->name)) return xml_node(i); + + return xml_node(); + } + + PUGI__FN xml_node xml_node::next_sibling() const + { + return _root ? xml_node(_root->next_sibling) : xml_node(); + } + + PUGI__FN xml_node xml_node::previous_sibling(const char_t* name_) const + { + if (!_root) return xml_node(); + + for (xml_node_struct* i = _root->prev_sibling_c; i->next_sibling; i = i->prev_sibling_c) + if (i->name && impl::strequal(name_, i->name)) return xml_node(i); + + return xml_node(); + } + + PUGI__FN xml_attribute xml_node::attribute(const char_t* name_, xml_attribute& hint_) const + { + xml_attribute_struct* hint = hint_._attr; + + // if hint is not an attribute of node, behavior is not defined + assert(!hint || (_root && impl::is_attribute_of(hint, _root))); + + if (!_root) return xml_attribute(); + + // optimistically search from hint up until the end + for (xml_attribute_struct* i = hint; i; i = i->next_attribute) + if (i->name && impl::strequal(name_, i->name)) + { + // update hint to maximize efficiency of searching for consecutive attributes + hint_._attr = i->next_attribute; + + return xml_attribute(i); + } + + // wrap around and search from the first attribute until the hint + // 'j' null pointer check is technically redundant, but it prevents a crash in case the assertion above fails + for (xml_attribute_struct* j = _root->first_attribute; j && j != hint; j = j->next_attribute) + if (j->name && impl::strequal(name_, j->name)) + { + // update hint to maximize efficiency of searching for consecutive attributes + hint_._attr = j->next_attribute; + + return xml_attribute(j); + } + + return xml_attribute(); + } + + PUGI__FN xml_node xml_node::previous_sibling() const + { + if (!_root) return xml_node(); + + if (_root->prev_sibling_c->next_sibling) return xml_node(_root->prev_sibling_c); + else return xml_node(); + } + + PUGI__FN xml_node xml_node::parent() const + { + return _root ? xml_node(_root->parent) : xml_node(); + } + + PUGI__FN xml_node xml_node::root() const + { + return _root ? xml_node(&impl::get_document(_root)) : xml_node(); + } + + PUGI__FN xml_text xml_node::text() const + { + return xml_text(_root); + } + + PUGI__FN const char_t* xml_node::child_value() const + { + if (!_root) return PUGIXML_TEXT(""); + + // element nodes can have value if parse_embed_pcdata was used + if (PUGI__NODETYPE(_root) == node_element && _root->value) + return _root->value; + + for (xml_node_struct* i = _root->first_child; i; i = i->next_sibling) + if (impl::is_text_node(i) && i->value) + return i->value; + + return PUGIXML_TEXT(""); + } + + PUGI__FN const char_t* xml_node::child_value(const char_t* name_) const + { + return child(name_).child_value(); + } + + PUGI__FN xml_attribute xml_node::first_attribute() const + { + return _root ? xml_attribute(_root->first_attribute) : xml_attribute(); + } + + PUGI__FN xml_attribute xml_node::last_attribute() const + { + return _root && _root->first_attribute ? xml_attribute(_root->first_attribute->prev_attribute_c) : xml_attribute(); + } + + PUGI__FN xml_node xml_node::first_child() const + { + return _root ? xml_node(_root->first_child) : xml_node(); + } + + PUGI__FN xml_node xml_node::last_child() const + { + return _root && _root->first_child ? xml_node(_root->first_child->prev_sibling_c) : xml_node(); + } + + PUGI__FN bool xml_node::set_name(const char_t* rhs) + { + xml_node_type type_ = _root ? PUGI__NODETYPE(_root) : node_null; + + if (type_ != node_element && type_ != node_pi && type_ != node_declaration) + return false; + + return impl::strcpy_insitu(_root->name, _root->header, impl::xml_memory_page_name_allocated_mask, rhs, impl::strlength(rhs)); + } + + PUGI__FN bool xml_node::set_value(const char_t* rhs) + { + xml_node_type type_ = _root ? PUGI__NODETYPE(_root) : node_null; + + if (type_ != node_pcdata && type_ != node_cdata && type_ != node_comment && type_ != node_pi && type_ != node_doctype) + return false; + + return impl::strcpy_insitu(_root->value, _root->header, impl::xml_memory_page_value_allocated_mask, rhs, impl::strlength(rhs)); + } + + PUGI__FN xml_attribute xml_node::append_attribute(const char_t* name_) + { + if (!impl::allow_insert_attribute(type())) return xml_attribute(); + + impl::xml_allocator& alloc = impl::get_allocator(_root); + if (!alloc.reserve()) return xml_attribute(); + + xml_attribute a(impl::allocate_attribute(alloc)); + if (!a) return xml_attribute(); + + impl::append_attribute(a._attr, _root); + + a.set_name(name_); + + return a; + } + + PUGI__FN xml_attribute xml_node::prepend_attribute(const char_t* name_) + { + if (!impl::allow_insert_attribute(type())) return xml_attribute(); + + impl::xml_allocator& alloc = impl::get_allocator(_root); + if (!alloc.reserve()) return xml_attribute(); + + xml_attribute a(impl::allocate_attribute(alloc)); + if (!a) return xml_attribute(); + + impl::prepend_attribute(a._attr, _root); + + a.set_name(name_); + + return a; + } + + PUGI__FN xml_attribute xml_node::insert_attribute_after(const char_t* name_, const xml_attribute& attr) + { + if (!impl::allow_insert_attribute(type())) return xml_attribute(); + if (!attr || !impl::is_attribute_of(attr._attr, _root)) return xml_attribute(); + + impl::xml_allocator& alloc = impl::get_allocator(_root); + if (!alloc.reserve()) return xml_attribute(); + + xml_attribute a(impl::allocate_attribute(alloc)); + if (!a) return xml_attribute(); + + impl::insert_attribute_after(a._attr, attr._attr, _root); + + a.set_name(name_); + + return a; + } + + PUGI__FN xml_attribute xml_node::insert_attribute_before(const char_t* name_, const xml_attribute& attr) + { + if (!impl::allow_insert_attribute(type())) return xml_attribute(); + if (!attr || !impl::is_attribute_of(attr._attr, _root)) return xml_attribute(); + + impl::xml_allocator& alloc = impl::get_allocator(_root); + if (!alloc.reserve()) return xml_attribute(); + + xml_attribute a(impl::allocate_attribute(alloc)); + if (!a) return xml_attribute(); + + impl::insert_attribute_before(a._attr, attr._attr, _root); + + a.set_name(name_); + + return a; + } + + PUGI__FN xml_attribute xml_node::append_copy(const xml_attribute& proto) + { + if (!proto) return xml_attribute(); + if (!impl::allow_insert_attribute(type())) return xml_attribute(); + + impl::xml_allocator& alloc = impl::get_allocator(_root); + if (!alloc.reserve()) return xml_attribute(); + + xml_attribute a(impl::allocate_attribute(alloc)); + if (!a) return xml_attribute(); + + impl::append_attribute(a._attr, _root); + impl::node_copy_attribute(a._attr, proto._attr); + + return a; + } + + PUGI__FN xml_attribute xml_node::prepend_copy(const xml_attribute& proto) + { + if (!proto) return xml_attribute(); + if (!impl::allow_insert_attribute(type())) return xml_attribute(); + + impl::xml_allocator& alloc = impl::get_allocator(_root); + if (!alloc.reserve()) return xml_attribute(); + + xml_attribute a(impl::allocate_attribute(alloc)); + if (!a) return xml_attribute(); + + impl::prepend_attribute(a._attr, _root); + impl::node_copy_attribute(a._attr, proto._attr); + + return a; + } + + PUGI__FN xml_attribute xml_node::insert_copy_after(const xml_attribute& proto, const xml_attribute& attr) + { + if (!proto) return xml_attribute(); + if (!impl::allow_insert_attribute(type())) return xml_attribute(); + if (!attr || !impl::is_attribute_of(attr._attr, _root)) return xml_attribute(); + + impl::xml_allocator& alloc = impl::get_allocator(_root); + if (!alloc.reserve()) return xml_attribute(); + + xml_attribute a(impl::allocate_attribute(alloc)); + if (!a) return xml_attribute(); + + impl::insert_attribute_after(a._attr, attr._attr, _root); + impl::node_copy_attribute(a._attr, proto._attr); + + return a; + } + + PUGI__FN xml_attribute xml_node::insert_copy_before(const xml_attribute& proto, const xml_attribute& attr) + { + if (!proto) return xml_attribute(); + if (!impl::allow_insert_attribute(type())) return xml_attribute(); + if (!attr || !impl::is_attribute_of(attr._attr, _root)) return xml_attribute(); + + impl::xml_allocator& alloc = impl::get_allocator(_root); + if (!alloc.reserve()) return xml_attribute(); + + xml_attribute a(impl::allocate_attribute(alloc)); + if (!a) return xml_attribute(); + + impl::insert_attribute_before(a._attr, attr._attr, _root); + impl::node_copy_attribute(a._attr, proto._attr); + + return a; + } + + PUGI__FN xml_node xml_node::append_child(xml_node_type type_) + { + if (!impl::allow_insert_child(type(), type_)) return xml_node(); + + impl::xml_allocator& alloc = impl::get_allocator(_root); + if (!alloc.reserve()) return xml_node(); + + xml_node n(impl::allocate_node(alloc, type_)); + if (!n) return xml_node(); + + impl::append_node(n._root, _root); + + if (type_ == node_declaration) n.set_name(PUGIXML_TEXT("xml")); + + return n; + } + + PUGI__FN xml_node xml_node::prepend_child(xml_node_type type_) + { + if (!impl::allow_insert_child(type(), type_)) return xml_node(); + + impl::xml_allocator& alloc = impl::get_allocator(_root); + if (!alloc.reserve()) return xml_node(); + + xml_node n(impl::allocate_node(alloc, type_)); + if (!n) return xml_node(); + + impl::prepend_node(n._root, _root); + + if (type_ == node_declaration) n.set_name(PUGIXML_TEXT("xml")); + + return n; + } + + PUGI__FN xml_node xml_node::insert_child_before(xml_node_type type_, const xml_node& node) + { + if (!impl::allow_insert_child(type(), type_)) return xml_node(); + if (!node._root || node._root->parent != _root) return xml_node(); + + impl::xml_allocator& alloc = impl::get_allocator(_root); + if (!alloc.reserve()) return xml_node(); + + xml_node n(impl::allocate_node(alloc, type_)); + if (!n) return xml_node(); + + impl::insert_node_before(n._root, node._root); + + if (type_ == node_declaration) n.set_name(PUGIXML_TEXT("xml")); + + return n; + } + + PUGI__FN xml_node xml_node::insert_child_after(xml_node_type type_, const xml_node& node) + { + if (!impl::allow_insert_child(type(), type_)) return xml_node(); + if (!node._root || node._root->parent != _root) return xml_node(); + + impl::xml_allocator& alloc = impl::get_allocator(_root); + if (!alloc.reserve()) return xml_node(); + + xml_node n(impl::allocate_node(alloc, type_)); + if (!n) return xml_node(); + + impl::insert_node_after(n._root, node._root); + + if (type_ == node_declaration) n.set_name(PUGIXML_TEXT("xml")); + + return n; + } + + PUGI__FN xml_node xml_node::append_child(const char_t* name_) + { + xml_node result = append_child(node_element); + + result.set_name(name_); + + return result; + } + + PUGI__FN xml_node xml_node::prepend_child(const char_t* name_) + { + xml_node result = prepend_child(node_element); + + result.set_name(name_); + + return result; + } + + PUGI__FN xml_node xml_node::insert_child_after(const char_t* name_, const xml_node& node) + { + xml_node result = insert_child_after(node_element, node); + + result.set_name(name_); + + return result; + } + + PUGI__FN xml_node xml_node::insert_child_before(const char_t* name_, const xml_node& node) + { + xml_node result = insert_child_before(node_element, node); + + result.set_name(name_); + + return result; + } + + PUGI__FN xml_node xml_node::append_copy(const xml_node& proto) + { + xml_node_type type_ = proto.type(); + if (!impl::allow_insert_child(type(), type_)) return xml_node(); + + impl::xml_allocator& alloc = impl::get_allocator(_root); + if (!alloc.reserve()) return xml_node(); + + xml_node n(impl::allocate_node(alloc, type_)); + if (!n) return xml_node(); + + impl::append_node(n._root, _root); + impl::node_copy_tree(n._root, proto._root); + + return n; + } + + PUGI__FN xml_node xml_node::prepend_copy(const xml_node& proto) + { + xml_node_type type_ = proto.type(); + if (!impl::allow_insert_child(type(), type_)) return xml_node(); + + impl::xml_allocator& alloc = impl::get_allocator(_root); + if (!alloc.reserve()) return xml_node(); + + xml_node n(impl::allocate_node(alloc, type_)); + if (!n) return xml_node(); + + impl::prepend_node(n._root, _root); + impl::node_copy_tree(n._root, proto._root); + + return n; + } + + PUGI__FN xml_node xml_node::insert_copy_after(const xml_node& proto, const xml_node& node) + { + xml_node_type type_ = proto.type(); + if (!impl::allow_insert_child(type(), type_)) return xml_node(); + if (!node._root || node._root->parent != _root) return xml_node(); + + impl::xml_allocator& alloc = impl::get_allocator(_root); + if (!alloc.reserve()) return xml_node(); + + xml_node n(impl::allocate_node(alloc, type_)); + if (!n) return xml_node(); + + impl::insert_node_after(n._root, node._root); + impl::node_copy_tree(n._root, proto._root); + + return n; + } + + PUGI__FN xml_node xml_node::insert_copy_before(const xml_node& proto, const xml_node& node) + { + xml_node_type type_ = proto.type(); + if (!impl::allow_insert_child(type(), type_)) return xml_node(); + if (!node._root || node._root->parent != _root) return xml_node(); + + impl::xml_allocator& alloc = impl::get_allocator(_root); + if (!alloc.reserve()) return xml_node(); + + xml_node n(impl::allocate_node(alloc, type_)); + if (!n) return xml_node(); + + impl::insert_node_before(n._root, node._root); + impl::node_copy_tree(n._root, proto._root); + + return n; + } + + PUGI__FN xml_node xml_node::append_move(const xml_node& moved) + { + if (!impl::allow_move(*this, moved)) return xml_node(); + + impl::xml_allocator& alloc = impl::get_allocator(_root); + if (!alloc.reserve()) return xml_node(); + + // disable document_buffer_order optimization since moving nodes around changes document order without changing buffer pointers + impl::get_document(_root).header |= impl::xml_memory_page_contents_shared_mask; + + impl::remove_node(moved._root); + impl::append_node(moved._root, _root); + + return moved; + } + + PUGI__FN xml_node xml_node::prepend_move(const xml_node& moved) + { + if (!impl::allow_move(*this, moved)) return xml_node(); + + impl::xml_allocator& alloc = impl::get_allocator(_root); + if (!alloc.reserve()) return xml_node(); + + // disable document_buffer_order optimization since moving nodes around changes document order without changing buffer pointers + impl::get_document(_root).header |= impl::xml_memory_page_contents_shared_mask; + + impl::remove_node(moved._root); + impl::prepend_node(moved._root, _root); + + return moved; + } + + PUGI__FN xml_node xml_node::insert_move_after(const xml_node& moved, const xml_node& node) + { + if (!impl::allow_move(*this, moved)) return xml_node(); + if (!node._root || node._root->parent != _root) return xml_node(); + if (moved._root == node._root) return xml_node(); + + impl::xml_allocator& alloc = impl::get_allocator(_root); + if (!alloc.reserve()) return xml_node(); + + // disable document_buffer_order optimization since moving nodes around changes document order without changing buffer pointers + impl::get_document(_root).header |= impl::xml_memory_page_contents_shared_mask; + + impl::remove_node(moved._root); + impl::insert_node_after(moved._root, node._root); + + return moved; + } + + PUGI__FN xml_node xml_node::insert_move_before(const xml_node& moved, const xml_node& node) + { + if (!impl::allow_move(*this, moved)) return xml_node(); + if (!node._root || node._root->parent != _root) return xml_node(); + if (moved._root == node._root) return xml_node(); + + impl::xml_allocator& alloc = impl::get_allocator(_root); + if (!alloc.reserve()) return xml_node(); + + // disable document_buffer_order optimization since moving nodes around changes document order without changing buffer pointers + impl::get_document(_root).header |= impl::xml_memory_page_contents_shared_mask; + + impl::remove_node(moved._root); + impl::insert_node_before(moved._root, node._root); + + return moved; + } + + PUGI__FN bool xml_node::remove_attribute(const char_t* name_) + { + return remove_attribute(attribute(name_)); + } + + PUGI__FN bool xml_node::remove_attribute(const xml_attribute& a) + { + if (!_root || !a._attr) return false; + if (!impl::is_attribute_of(a._attr, _root)) return false; + + impl::xml_allocator& alloc = impl::get_allocator(_root); + if (!alloc.reserve()) return false; + + impl::remove_attribute(a._attr, _root); + impl::destroy_attribute(a._attr, alloc); + + return true; + } + + PUGI__FN bool xml_node::remove_child(const char_t* name_) + { + return remove_child(child(name_)); + } + + PUGI__FN bool xml_node::remove_child(const xml_node& n) + { + if (!_root || !n._root || n._root->parent != _root) return false; + + impl::xml_allocator& alloc = impl::get_allocator(_root); + if (!alloc.reserve()) return false; + + impl::remove_node(n._root); + impl::destroy_node(n._root, alloc); + + return true; + } + + PUGI__FN xml_parse_result xml_node::append_buffer(const void* contents, size_t size, unsigned int options, xml_encoding encoding) + { + // append_buffer is only valid for elements/documents + if (!impl::allow_insert_child(type(), node_element)) return impl::make_parse_result(status_append_invalid_root); + + // get document node + impl::xml_document_struct* doc = &impl::get_document(_root); + + // disable document_buffer_order optimization since in a document with multiple buffers comparing buffer pointers does not make sense + doc->header |= impl::xml_memory_page_contents_shared_mask; + + // get extra buffer element (we'll store the document fragment buffer there so that we can deallocate it later) + impl::xml_memory_page* page = 0; + impl::xml_extra_buffer* extra = static_cast<impl::xml_extra_buffer*>(doc->allocate_memory(sizeof(impl::xml_extra_buffer), page)); + (void)page; + + if (!extra) return impl::make_parse_result(status_out_of_memory); + + // add extra buffer to the list + extra->buffer = 0; + extra->next = doc->extra_buffers; + doc->extra_buffers = extra; + + // name of the root has to be NULL before parsing - otherwise closing node mismatches will not be detected at the top level + impl::name_null_sentry sentry(_root); + + return impl::load_buffer_impl(doc, _root, const_cast<void*>(contents), size, options, encoding, false, false, &extra->buffer); + } + + PUGI__FN xml_node xml_node::find_child_by_attribute(const char_t* name_, const char_t* attr_name, const char_t* attr_value) const + { + if (!_root) return xml_node(); + + for (xml_node_struct* i = _root->first_child; i; i = i->next_sibling) + if (i->name && impl::strequal(name_, i->name)) + { + for (xml_attribute_struct* a = i->first_attribute; a; a = a->next_attribute) + if (a->name && impl::strequal(attr_name, a->name) && impl::strequal(attr_value, a->value ? a->value + 0 : PUGIXML_TEXT(""))) + return xml_node(i); + } + + return xml_node(); + } + + PUGI__FN xml_node xml_node::find_child_by_attribute(const char_t* attr_name, const char_t* attr_value) const + { + if (!_root) return xml_node(); + + for (xml_node_struct* i = _root->first_child; i; i = i->next_sibling) + for (xml_attribute_struct* a = i->first_attribute; a; a = a->next_attribute) + if (a->name && impl::strequal(attr_name, a->name) && impl::strequal(attr_value, a->value ? a->value + 0 : PUGIXML_TEXT(""))) + return xml_node(i); + + return xml_node(); + } + +#ifndef PUGIXML_NO_STL + PUGI__FN string_t xml_node::path(char_t delimiter) const + { + if (!_root) return string_t(); + + size_t offset = 0; + + for (xml_node_struct* i = _root; i; i = i->parent) + { + offset += (i != _root); + offset += i->name ? impl::strlength(i->name) : 0; + } + + string_t result; + result.resize(offset); + + for (xml_node_struct* j = _root; j; j = j->parent) + { + if (j != _root) + result[--offset] = delimiter; + + if (j->name && *j->name) + { + size_t length = impl::strlength(j->name); + + offset -= length; + memcpy(&result[offset], j->name, length * sizeof(char_t)); + } + } + + assert(offset == 0); + + return result; + } +#endif + + PUGI__FN xml_node xml_node::first_element_by_path(const char_t* path_, char_t delimiter) const + { + xml_node found = *this; // Current search context. + + if (!_root || !path_ || !path_[0]) return found; + + if (path_[0] == delimiter) + { + // Absolute path; e.g. '/foo/bar' + found = found.root(); + ++path_; + } + + const char_t* path_segment = path_; + + while (*path_segment == delimiter) ++path_segment; + + const char_t* path_segment_end = path_segment; + + while (*path_segment_end && *path_segment_end != delimiter) ++path_segment_end; + + if (path_segment == path_segment_end) return found; + + const char_t* next_segment = path_segment_end; + + while (*next_segment == delimiter) ++next_segment; + + if (*path_segment == '.' && path_segment + 1 == path_segment_end) + return found.first_element_by_path(next_segment, delimiter); + else if (*path_segment == '.' && *(path_segment+1) == '.' && path_segment + 2 == path_segment_end) + return found.parent().first_element_by_path(next_segment, delimiter); + else + { + for (xml_node_struct* j = found._root->first_child; j; j = j->next_sibling) + { + if (j->name && impl::strequalrange(j->name, path_segment, static_cast<size_t>(path_segment_end - path_segment))) + { + xml_node subsearch = xml_node(j).first_element_by_path(next_segment, delimiter); + + if (subsearch) return subsearch; + } + } + + return xml_node(); + } + } + + PUGI__FN bool xml_node::traverse(xml_tree_walker& walker) + { + walker._depth = -1; + + xml_node arg_begin = *this; + if (!walker.begin(arg_begin)) return false; + + xml_node cur = first_child(); + + if (cur) + { + ++walker._depth; + + do + { + xml_node arg_for_each = cur; + if (!walker.for_each(arg_for_each)) + return false; + + if (cur.first_child()) + { + ++walker._depth; + cur = cur.first_child(); + } + else if (cur.next_sibling()) + cur = cur.next_sibling(); + else + { + // Borland C++ workaround + while (!cur.next_sibling() && cur != *this && !cur.parent().empty()) + { + --walker._depth; + cur = cur.parent(); + } + + if (cur != *this) + cur = cur.next_sibling(); + } + } + while (cur && cur != *this); + } + + assert(walker._depth == -1); + + xml_node arg_end = *this; + return walker.end(arg_end); + } + + PUGI__FN size_t xml_node::hash_value() const + { + return static_cast<size_t>(reinterpret_cast<uintptr_t>(_root) / sizeof(xml_node_struct)); + } + + PUGI__FN xml_node_struct* xml_node::internal_object() const + { + return _root; + } + + PUGI__FN void xml_node::print(xml_writer& writer, const char_t* indent, unsigned int flags, xml_encoding encoding, unsigned int depth) const + { + if (!_root) return; + + impl::xml_buffered_writer buffered_writer(writer, encoding); + + impl::node_output(buffered_writer, _root, indent, flags, depth); + + buffered_writer.flush(); + } + +#ifndef PUGIXML_NO_STL + PUGI__FN void xml_node::print(std::basic_ostream<char, std::char_traits<char> >& stream, const char_t* indent, unsigned int flags, xml_encoding encoding, unsigned int depth) const + { + xml_writer_stream writer(stream); + + print(writer, indent, flags, encoding, depth); + } + + PUGI__FN void xml_node::print(std::basic_ostream<wchar_t, std::char_traits<wchar_t> >& stream, const char_t* indent, unsigned int flags, unsigned int depth) const + { + xml_writer_stream writer(stream); + + print(writer, indent, flags, encoding_wchar, depth); + } +#endif + + PUGI__FN ptrdiff_t xml_node::offset_debug() const + { + if (!_root) return -1; + + impl::xml_document_struct& doc = impl::get_document(_root); + + // we can determine the offset reliably only if there is exactly once parse buffer + if (!doc.buffer || doc.extra_buffers) return -1; + + switch (type()) + { + case node_document: + return 0; + + case node_element: + case node_declaration: + case node_pi: + return _root->name && (_root->header & impl::xml_memory_page_name_allocated_or_shared_mask) == 0 ? _root->name - doc.buffer : -1; + + case node_pcdata: + case node_cdata: + case node_comment: + case node_doctype: + return _root->value && (_root->header & impl::xml_memory_page_value_allocated_or_shared_mask) == 0 ? _root->value - doc.buffer : -1; + + default: + return -1; + } + } + +#ifdef __BORLANDC__ + PUGI__FN bool operator&&(const xml_node& lhs, bool rhs) + { + return (bool)lhs && rhs; + } + + PUGI__FN bool operator||(const xml_node& lhs, bool rhs) + { + return (bool)lhs || rhs; + } +#endif + + PUGI__FN xml_text::xml_text(xml_node_struct* root): _root(root) + { + } + + PUGI__FN xml_node_struct* xml_text::_data() const + { + if (!_root || impl::is_text_node(_root)) return _root; + + // element nodes can have value if parse_embed_pcdata was used + if (PUGI__NODETYPE(_root) == node_element && _root->value) + return _root; + + for (xml_node_struct* node = _root->first_child; node; node = node->next_sibling) + if (impl::is_text_node(node)) + return node; + + return 0; + } + + PUGI__FN xml_node_struct* xml_text::_data_new() + { + xml_node_struct* d = _data(); + if (d) return d; + + return xml_node(_root).append_child(node_pcdata).internal_object(); + } + + PUGI__FN xml_text::xml_text(): _root(0) + { + } + + PUGI__FN static void unspecified_bool_xml_text(xml_text***) + { + } + + PUGI__FN xml_text::operator xml_text::unspecified_bool_type() const + { + return _data() ? unspecified_bool_xml_text : 0; + } + + PUGI__FN bool xml_text::operator!() const + { + return !_data(); + } + + PUGI__FN bool xml_text::empty() const + { + return _data() == 0; + } + + PUGI__FN const char_t* xml_text::get() const + { + xml_node_struct* d = _data(); + + return (d && d->value) ? d->value + 0 : PUGIXML_TEXT(""); + } + + PUGI__FN const char_t* xml_text::as_string(const char_t* def) const + { + xml_node_struct* d = _data(); + + return (d && d->value) ? d->value + 0 : def; + } + + PUGI__FN int xml_text::as_int(int def) const + { + xml_node_struct* d = _data(); + + return (d && d->value) ? impl::get_value_int(d->value) : def; + } + + PUGI__FN unsigned int xml_text::as_uint(unsigned int def) const + { + xml_node_struct* d = _data(); + + return (d && d->value) ? impl::get_value_uint(d->value) : def; + } + + PUGI__FN double xml_text::as_double(double def) const + { + xml_node_struct* d = _data(); + + return (d && d->value) ? impl::get_value_double(d->value) : def; + } + + PUGI__FN float xml_text::as_float(float def) const + { + xml_node_struct* d = _data(); + + return (d && d->value) ? impl::get_value_float(d->value) : def; + } + + PUGI__FN bool xml_text::as_bool(bool def) const + { + xml_node_struct* d = _data(); + + return (d && d->value) ? impl::get_value_bool(d->value) : def; + } + +#ifdef PUGIXML_HAS_LONG_LONG + PUGI__FN long long xml_text::as_llong(long long def) const + { + xml_node_struct* d = _data(); + + return (d && d->value) ? impl::get_value_llong(d->value) : def; + } + + PUGI__FN unsigned long long xml_text::as_ullong(unsigned long long def) const + { + xml_node_struct* d = _data(); + + return (d && d->value) ? impl::get_value_ullong(d->value) : def; + } +#endif + + PUGI__FN bool xml_text::set(const char_t* rhs) + { + xml_node_struct* dn = _data_new(); + + return dn ? impl::strcpy_insitu(dn->value, dn->header, impl::xml_memory_page_value_allocated_mask, rhs, impl::strlength(rhs)) : false; + } + + PUGI__FN bool xml_text::set(int rhs) + { + xml_node_struct* dn = _data_new(); + + return dn ? impl::set_value_integer<unsigned int>(dn->value, dn->header, impl::xml_memory_page_value_allocated_mask, rhs, rhs < 0) : false; + } + + PUGI__FN bool xml_text::set(unsigned int rhs) + { + xml_node_struct* dn = _data_new(); + + return dn ? impl::set_value_integer<unsigned int>(dn->value, dn->header, impl::xml_memory_page_value_allocated_mask, rhs, false) : false; + } + + PUGI__FN bool xml_text::set(long rhs) + { + xml_node_struct* dn = _data_new(); + + return dn ? impl::set_value_integer<unsigned long>(dn->value, dn->header, impl::xml_memory_page_value_allocated_mask, rhs, rhs < 0) : false; + } + + PUGI__FN bool xml_text::set(unsigned long rhs) + { + xml_node_struct* dn = _data_new(); + + return dn ? impl::set_value_integer<unsigned long>(dn->value, dn->header, impl::xml_memory_page_value_allocated_mask, rhs, false) : false; + } + + PUGI__FN bool xml_text::set(float rhs) + { + xml_node_struct* dn = _data_new(); + + return dn ? impl::set_value_convert(dn->value, dn->header, impl::xml_memory_page_value_allocated_mask, rhs) : false; + } + + PUGI__FN bool xml_text::set(double rhs) + { + xml_node_struct* dn = _data_new(); + + return dn ? impl::set_value_convert(dn->value, dn->header, impl::xml_memory_page_value_allocated_mask, rhs) : false; + } + + PUGI__FN bool xml_text::set(bool rhs) + { + xml_node_struct* dn = _data_new(); + + return dn ? impl::set_value_bool(dn->value, dn->header, impl::xml_memory_page_value_allocated_mask, rhs) : false; + } + +#ifdef PUGIXML_HAS_LONG_LONG + PUGI__FN bool xml_text::set(long long rhs) + { + xml_node_struct* dn = _data_new(); + + return dn ? impl::set_value_integer<unsigned long long>(dn->value, dn->header, impl::xml_memory_page_value_allocated_mask, rhs, rhs < 0) : false; + } + + PUGI__FN bool xml_text::set(unsigned long long rhs) + { + xml_node_struct* dn = _data_new(); + + return dn ? impl::set_value_integer<unsigned long long>(dn->value, dn->header, impl::xml_memory_page_value_allocated_mask, rhs, false) : false; + } +#endif + + PUGI__FN xml_text& xml_text::operator=(const char_t* rhs) + { + set(rhs); + return *this; + } + + PUGI__FN xml_text& xml_text::operator=(int rhs) + { + set(rhs); + return *this; + } + + PUGI__FN xml_text& xml_text::operator=(unsigned int rhs) + { + set(rhs); + return *this; + } + + PUGI__FN xml_text& xml_text::operator=(long rhs) + { + set(rhs); + return *this; + } + + PUGI__FN xml_text& xml_text::operator=(unsigned long rhs) + { + set(rhs); + return *this; + } + + PUGI__FN xml_text& xml_text::operator=(double rhs) + { + set(rhs); + return *this; + } + + PUGI__FN xml_text& xml_text::operator=(float rhs) + { + set(rhs); + return *this; + } + + PUGI__FN xml_text& xml_text::operator=(bool rhs) + { + set(rhs); + return *this; + } + +#ifdef PUGIXML_HAS_LONG_LONG + PUGI__FN xml_text& xml_text::operator=(long long rhs) + { + set(rhs); + return *this; + } + + PUGI__FN xml_text& xml_text::operator=(unsigned long long rhs) + { + set(rhs); + return *this; + } +#endif + + PUGI__FN xml_node xml_text::data() const + { + return xml_node(_data()); + } + +#ifdef __BORLANDC__ + PUGI__FN bool operator&&(const xml_text& lhs, bool rhs) + { + return (bool)lhs && rhs; + } + + PUGI__FN bool operator||(const xml_text& lhs, bool rhs) + { + return (bool)lhs || rhs; + } +#endif + + PUGI__FN xml_node_iterator::xml_node_iterator() + { + } + + PUGI__FN xml_node_iterator::xml_node_iterator(const xml_node& node): _wrap(node), _parent(node.parent()) + { + } + + PUGI__FN xml_node_iterator::xml_node_iterator(xml_node_struct* ref, xml_node_struct* parent): _wrap(ref), _parent(parent) + { + } + + PUGI__FN bool xml_node_iterator::operator==(const xml_node_iterator& rhs) const + { + return _wrap._root == rhs._wrap._root && _parent._root == rhs._parent._root; + } + + PUGI__FN bool xml_node_iterator::operator!=(const xml_node_iterator& rhs) const + { + return _wrap._root != rhs._wrap._root || _parent._root != rhs._parent._root; + } + + PUGI__FN xml_node& xml_node_iterator::operator*() const + { + assert(_wrap._root); + return _wrap; + } + + PUGI__FN xml_node* xml_node_iterator::operator->() const + { + assert(_wrap._root); + return const_cast<xml_node*>(&_wrap); // BCC5 workaround + } + + PUGI__FN const xml_node_iterator& xml_node_iterator::operator++() + { + assert(_wrap._root); + _wrap._root = _wrap._root->next_sibling; + return *this; + } + + PUGI__FN xml_node_iterator xml_node_iterator::operator++(int) + { + xml_node_iterator temp = *this; + ++*this; + return temp; + } + + PUGI__FN const xml_node_iterator& xml_node_iterator::operator--() + { + _wrap = _wrap._root ? _wrap.previous_sibling() : _parent.last_child(); + return *this; + } + + PUGI__FN xml_node_iterator xml_node_iterator::operator--(int) + { + xml_node_iterator temp = *this; + --*this; + return temp; + } + + PUGI__FN xml_attribute_iterator::xml_attribute_iterator() + { + } + + PUGI__FN xml_attribute_iterator::xml_attribute_iterator(const xml_attribute& attr, const xml_node& parent): _wrap(attr), _parent(parent) + { + } + + PUGI__FN xml_attribute_iterator::xml_attribute_iterator(xml_attribute_struct* ref, xml_node_struct* parent): _wrap(ref), _parent(parent) + { + } + + PUGI__FN bool xml_attribute_iterator::operator==(const xml_attribute_iterator& rhs) const + { + return _wrap._attr == rhs._wrap._attr && _parent._root == rhs._parent._root; + } + + PUGI__FN bool xml_attribute_iterator::operator!=(const xml_attribute_iterator& rhs) const + { + return _wrap._attr != rhs._wrap._attr || _parent._root != rhs._parent._root; + } + + PUGI__FN xml_attribute& xml_attribute_iterator::operator*() const + { + assert(_wrap._attr); + return _wrap; + } + + PUGI__FN xml_attribute* xml_attribute_iterator::operator->() const + { + assert(_wrap._attr); + return const_cast<xml_attribute*>(&_wrap); // BCC5 workaround + } + + PUGI__FN const xml_attribute_iterator& xml_attribute_iterator::operator++() + { + assert(_wrap._attr); + _wrap._attr = _wrap._attr->next_attribute; + return *this; + } + + PUGI__FN xml_attribute_iterator xml_attribute_iterator::operator++(int) + { + xml_attribute_iterator temp = *this; + ++*this; + return temp; + } + + PUGI__FN const xml_attribute_iterator& xml_attribute_iterator::operator--() + { + _wrap = _wrap._attr ? _wrap.previous_attribute() : _parent.last_attribute(); + return *this; + } + + PUGI__FN xml_attribute_iterator xml_attribute_iterator::operator--(int) + { + xml_attribute_iterator temp = *this; + --*this; + return temp; + } + + PUGI__FN xml_named_node_iterator::xml_named_node_iterator(): _name(0) + { + } + + PUGI__FN xml_named_node_iterator::xml_named_node_iterator(const xml_node& node, const char_t* name): _wrap(node), _parent(node.parent()), _name(name) + { + } + + PUGI__FN xml_named_node_iterator::xml_named_node_iterator(xml_node_struct* ref, xml_node_struct* parent, const char_t* name): _wrap(ref), _parent(parent), _name(name) + { + } + + PUGI__FN bool xml_named_node_iterator::operator==(const xml_named_node_iterator& rhs) const + { + return _wrap._root == rhs._wrap._root && _parent._root == rhs._parent._root; + } + + PUGI__FN bool xml_named_node_iterator::operator!=(const xml_named_node_iterator& rhs) const + { + return _wrap._root != rhs._wrap._root || _parent._root != rhs._parent._root; + } + + PUGI__FN xml_node& xml_named_node_iterator::operator*() const + { + assert(_wrap._root); + return _wrap; + } + + PUGI__FN xml_node* xml_named_node_iterator::operator->() const + { + assert(_wrap._root); + return const_cast<xml_node*>(&_wrap); // BCC5 workaround + } + + PUGI__FN const xml_named_node_iterator& xml_named_node_iterator::operator++() + { + assert(_wrap._root); + _wrap = _wrap.next_sibling(_name); + return *this; + } + + PUGI__FN xml_named_node_iterator xml_named_node_iterator::operator++(int) + { + xml_named_node_iterator temp = *this; + ++*this; + return temp; + } + + PUGI__FN const xml_named_node_iterator& xml_named_node_iterator::operator--() + { + if (_wrap._root) + _wrap = _wrap.previous_sibling(_name); + else + { + _wrap = _parent.last_child(); + + if (!impl::strequal(_wrap.name(), _name)) + _wrap = _wrap.previous_sibling(_name); + } + + return *this; + } + + PUGI__FN xml_named_node_iterator xml_named_node_iterator::operator--(int) + { + xml_named_node_iterator temp = *this; + --*this; + return temp; + } + + PUGI__FN xml_parse_result::xml_parse_result(): status(status_internal_error), offset(0), encoding(encoding_auto) + { + } + + PUGI__FN xml_parse_result::operator bool() const + { + return status == status_ok; + } + + PUGI__FN const char* xml_parse_result::description() const + { + switch (status) + { + case status_ok: return "No error"; + + case status_file_not_found: return "File was not found"; + case status_io_error: return "Error reading from file/stream"; + case status_out_of_memory: return "Could not allocate memory"; + case status_internal_error: return "Internal error occurred"; + + case status_unrecognized_tag: return "Could not determine tag type"; + + case status_bad_pi: return "Error parsing document declaration/processing instruction"; + case status_bad_comment: return "Error parsing comment"; + case status_bad_cdata: return "Error parsing CDATA section"; + case status_bad_doctype: return "Error parsing document type declaration"; + case status_bad_pcdata: return "Error parsing PCDATA section"; + case status_bad_start_element: return "Error parsing start element tag"; + case status_bad_attribute: return "Error parsing element attribute"; + case status_bad_end_element: return "Error parsing end element tag"; + case status_end_element_mismatch: return "Start-end tags mismatch"; + + case status_append_invalid_root: return "Unable to append nodes: root is not an element or document"; + + case status_no_document_element: return "No document element found"; + + default: return "Unknown error"; + } + } + + PUGI__FN xml_document::xml_document(): _buffer(0) + { + _create(); + } + + PUGI__FN xml_document::~xml_document() + { + _destroy(); + } + + PUGI__FN void xml_document::reset() + { + _destroy(); + _create(); + } + + PUGI__FN void xml_document::reset(const xml_document& proto) + { + reset(); + + for (xml_node cur = proto.first_child(); cur; cur = cur.next_sibling()) + append_copy(cur); + } + + PUGI__FN void xml_document::_create() + { + assert(!_root); + + #ifdef PUGIXML_COMPACT + const size_t page_offset = sizeof(uint32_t); + #else + const size_t page_offset = 0; + #endif + + // initialize sentinel page + PUGI__STATIC_ASSERT(sizeof(impl::xml_memory_page) + sizeof(impl::xml_document_struct) + page_offset <= sizeof(_memory)); + + // prepare page structure + impl::xml_memory_page* page = impl::xml_memory_page::construct(_memory); + assert(page); + + page->busy_size = impl::xml_memory_page_size; + + // setup first page marker + #ifdef PUGIXML_COMPACT + // round-trip through void* to avoid 'cast increases required alignment of target type' warning + page->compact_page_marker = reinterpret_cast<uint32_t*>(static_cast<void*>(reinterpret_cast<char*>(page) + sizeof(impl::xml_memory_page))); + *page->compact_page_marker = sizeof(impl::xml_memory_page); + #endif + + // allocate new root + _root = new (reinterpret_cast<char*>(page) + sizeof(impl::xml_memory_page) + page_offset) impl::xml_document_struct(page); + _root->prev_sibling_c = _root; + + // setup sentinel page + page->allocator = static_cast<impl::xml_document_struct*>(_root); + + // setup hash table pointer in allocator + #ifdef PUGIXML_COMPACT + page->allocator->_hash = &static_cast<impl::xml_document_struct*>(_root)->hash; + #endif + + // verify the document allocation + assert(reinterpret_cast<char*>(_root) + sizeof(impl::xml_document_struct) <= _memory + sizeof(_memory)); + } + + PUGI__FN void xml_document::_destroy() + { + assert(_root); + + // destroy static storage + if (_buffer) + { + impl::xml_memory::deallocate(_buffer); + _buffer = 0; + } + + // destroy extra buffers (note: no need to destroy linked list nodes, they're allocated using document allocator) + for (impl::xml_extra_buffer* extra = static_cast<impl::xml_document_struct*>(_root)->extra_buffers; extra; extra = extra->next) + { + if (extra->buffer) impl::xml_memory::deallocate(extra->buffer); + } + + // destroy dynamic storage, leave sentinel page (it's in static memory) + impl::xml_memory_page* root_page = PUGI__GETPAGE(_root); + assert(root_page && !root_page->prev); + assert(reinterpret_cast<char*>(root_page) >= _memory && reinterpret_cast<char*>(root_page) < _memory + sizeof(_memory)); + + for (impl::xml_memory_page* page = root_page->next; page; ) + { + impl::xml_memory_page* next = page->next; + + impl::xml_allocator::deallocate_page(page); + + page = next; + } + + #ifdef PUGIXML_COMPACT + // destroy hash table + static_cast<impl::xml_document_struct*>(_root)->hash.clear(); + #endif + + _root = 0; + } + +#ifndef PUGIXML_NO_STL + PUGI__FN xml_parse_result xml_document::load(std::basic_istream<char, std::char_traits<char> >& stream, unsigned int options, xml_encoding encoding) + { + reset(); + + return impl::load_stream_impl(static_cast<impl::xml_document_struct*>(_root), stream, options, encoding, &_buffer); + } + + PUGI__FN xml_parse_result xml_document::load(std::basic_istream<wchar_t, std::char_traits<wchar_t> >& stream, unsigned int options) + { + reset(); + + return impl::load_stream_impl(static_cast<impl::xml_document_struct*>(_root), stream, options, encoding_wchar, &_buffer); + } +#endif + + PUGI__FN xml_parse_result xml_document::load_string(const char_t* contents, unsigned int options) + { + // Force native encoding (skip autodetection) + #ifdef PUGIXML_WCHAR_MODE + xml_encoding encoding = encoding_wchar; + #else + xml_encoding encoding = encoding_utf8; + #endif + + return load_buffer(contents, impl::strlength(contents) * sizeof(char_t), options, encoding); + } + + PUGI__FN xml_parse_result xml_document::load(const char_t* contents, unsigned int options) + { + return load_string(contents, options); + } + + PUGI__FN xml_parse_result xml_document::load_file(const char* path_, unsigned int options, xml_encoding encoding) + { + reset(); + + using impl::auto_deleter; // MSVC7 workaround + auto_deleter<FILE> file(fopen(path_, "rb"), impl::close_file); + + return impl::load_file_impl(static_cast<impl::xml_document_struct*>(_root), file.data, options, encoding, &_buffer); + } + + PUGI__FN xml_parse_result xml_document::load_file(const wchar_t* path_, unsigned int options, xml_encoding encoding) + { + reset(); + + using impl::auto_deleter; // MSVC7 workaround + auto_deleter<FILE> file(impl::open_file_wide(path_, L"rb"), impl::close_file); + + return impl::load_file_impl(static_cast<impl::xml_document_struct*>(_root), file.data, options, encoding, &_buffer); + } + + PUGI__FN xml_parse_result xml_document::load_buffer(const void* contents, size_t size, unsigned int options, xml_encoding encoding) + { + reset(); + + return impl::load_buffer_impl(static_cast<impl::xml_document_struct*>(_root), _root, const_cast<void*>(contents), size, options, encoding, false, false, &_buffer); + } + + PUGI__FN xml_parse_result xml_document::load_buffer_inplace(void* contents, size_t size, unsigned int options, xml_encoding encoding) + { + reset(); + + return impl::load_buffer_impl(static_cast<impl::xml_document_struct*>(_root), _root, contents, size, options, encoding, true, false, &_buffer); + } + + PUGI__FN xml_parse_result xml_document::load_buffer_inplace_own(void* contents, size_t size, unsigned int options, xml_encoding encoding) + { + reset(); + + return impl::load_buffer_impl(static_cast<impl::xml_document_struct*>(_root), _root, contents, size, options, encoding, true, true, &_buffer); + } + + PUGI__FN void xml_document::save(xml_writer& writer, const char_t* indent, unsigned int flags, xml_encoding encoding) const + { + impl::xml_buffered_writer buffered_writer(writer, encoding); + + if ((flags & format_write_bom) && encoding != encoding_latin1) + { + // BOM always represents the codepoint U+FEFF, so just write it in native encoding + #ifdef PUGIXML_WCHAR_MODE + unsigned int bom = 0xfeff; + buffered_writer.write(static_cast<wchar_t>(bom)); + #else + buffered_writer.write('\xef', '\xbb', '\xbf'); + #endif + } + + if (!(flags & format_no_declaration) && !impl::has_declaration(_root)) + { + buffered_writer.write_string(PUGIXML_TEXT("<?xml version=\"1.0\"")); + if (encoding == encoding_latin1) buffered_writer.write_string(PUGIXML_TEXT(" encoding=\"ISO-8859-1\"")); + buffered_writer.write('?', '>'); + if (!(flags & format_raw)) buffered_writer.write('\n'); + } + + impl::node_output(buffered_writer, _root, indent, flags, 0); + + buffered_writer.flush(); + } + +#ifndef PUGIXML_NO_STL + PUGI__FN void xml_document::save(std::basic_ostream<char, std::char_traits<char> >& stream, const char_t* indent, unsigned int flags, xml_encoding encoding) const + { + xml_writer_stream writer(stream); + + save(writer, indent, flags, encoding); + } + + PUGI__FN void xml_document::save(std::basic_ostream<wchar_t, std::char_traits<wchar_t> >& stream, const char_t* indent, unsigned int flags) const + { + xml_writer_stream writer(stream); + + save(writer, indent, flags, encoding_wchar); + } +#endif + + PUGI__FN bool xml_document::save_file(const char* path_, const char_t* indent, unsigned int flags, xml_encoding encoding) const + { + using impl::auto_deleter; // MSVC7 workaround + auto_deleter<FILE> file(fopen(path_, (flags & format_save_file_text) ? "w" : "wb"), impl::close_file); + + return impl::save_file_impl(*this, file.data, indent, flags, encoding); + } + + PUGI__FN bool xml_document::save_file(const wchar_t* path_, const char_t* indent, unsigned int flags, xml_encoding encoding) const + { + using impl::auto_deleter; // MSVC7 workaround + auto_deleter<FILE> file(impl::open_file_wide(path_, (flags & format_save_file_text) ? L"w" : L"wb"), impl::close_file); + + return impl::save_file_impl(*this, file.data, indent, flags, encoding); + } + + PUGI__FN xml_node xml_document::document_element() const + { + assert(_root); + + for (xml_node_struct* i = _root->first_child; i; i = i->next_sibling) + if (PUGI__NODETYPE(i) == node_element) + return xml_node(i); + + return xml_node(); + } + +#ifndef PUGIXML_NO_STL + PUGI__FN std::string PUGIXML_FUNCTION as_utf8(const wchar_t* str) + { + assert(str); + + return impl::as_utf8_impl(str, impl::strlength_wide(str)); + } + + PUGI__FN std::string PUGIXML_FUNCTION as_utf8(const std::basic_string<wchar_t>& str) + { + return impl::as_utf8_impl(str.c_str(), str.size()); + } + + PUGI__FN std::basic_string<wchar_t> PUGIXML_FUNCTION as_wide(const char* str) + { + assert(str); + + return impl::as_wide_impl(str, strlen(str)); + } + + PUGI__FN std::basic_string<wchar_t> PUGIXML_FUNCTION as_wide(const std::string& str) + { + return impl::as_wide_impl(str.c_str(), str.size()); + } +#endif + + PUGI__FN void PUGIXML_FUNCTION set_memory_management_functions(allocation_function allocate, deallocation_function deallocate) + { + impl::xml_memory::allocate = allocate; + impl::xml_memory::deallocate = deallocate; + } + + PUGI__FN allocation_function PUGIXML_FUNCTION get_memory_allocation_function() + { + return impl::xml_memory::allocate; + } + + PUGI__FN deallocation_function PUGIXML_FUNCTION get_memory_deallocation_function() + { + return impl::xml_memory::deallocate; + } +} + +#if !defined(PUGIXML_NO_STL) && (defined(_MSC_VER) || defined(__ICC)) +namespace std +{ + // Workarounds for (non-standard) iterator category detection for older versions (MSVC7/IC8 and earlier) + PUGI__FN std::bidirectional_iterator_tag _Iter_cat(const pugi::xml_node_iterator&) + { + return std::bidirectional_iterator_tag(); + } + + PUGI__FN std::bidirectional_iterator_tag _Iter_cat(const pugi::xml_attribute_iterator&) + { + return std::bidirectional_iterator_tag(); + } + + PUGI__FN std::bidirectional_iterator_tag _Iter_cat(const pugi::xml_named_node_iterator&) + { + return std::bidirectional_iterator_tag(); + } +} +#endif + +#if !defined(PUGIXML_NO_STL) && defined(__SUNPRO_CC) +namespace std +{ + // Workarounds for (non-standard) iterator category detection + PUGI__FN std::bidirectional_iterator_tag __iterator_category(const pugi::xml_node_iterator&) + { + return std::bidirectional_iterator_tag(); + } + + PUGI__FN std::bidirectional_iterator_tag __iterator_category(const pugi::xml_attribute_iterator&) + { + return std::bidirectional_iterator_tag(); + } + + PUGI__FN std::bidirectional_iterator_tag __iterator_category(const pugi::xml_named_node_iterator&) + { + return std::bidirectional_iterator_tag(); + } +} +#endif + +#ifndef PUGIXML_NO_XPATH +// STL replacements +PUGI__NS_BEGIN + struct equal_to + { + template <typename T> bool operator()(const T& lhs, const T& rhs) const + { + return lhs == rhs; + } + }; + + struct not_equal_to + { + template <typename T> bool operator()(const T& lhs, const T& rhs) const + { + return lhs != rhs; + } + }; + + struct less + { + template <typename T> bool operator()(const T& lhs, const T& rhs) const + { + return lhs < rhs; + } + }; + + struct less_equal + { + template <typename T> bool operator()(const T& lhs, const T& rhs) const + { + return lhs <= rhs; + } + }; + + template <typename T> void swap(T& lhs, T& rhs) + { + T temp = lhs; + lhs = rhs; + rhs = temp; + } + + template <typename I, typename Pred> I min_element(I begin, I end, const Pred& pred) + { + I result = begin; + + for (I it = begin + 1; it != end; ++it) + if (pred(*it, *result)) + result = it; + + return result; + } + + template <typename I> void reverse(I begin, I end) + { + while (end - begin > 1) swap(*begin++, *--end); + } + + template <typename I> I unique(I begin, I end) + { + // fast skip head + while (end - begin > 1 && *begin != *(begin + 1)) begin++; + + if (begin == end) return begin; + + // last written element + I write = begin++; + + // merge unique elements + while (begin != end) + { + if (*begin != *write) + *++write = *begin++; + else + begin++; + } + + // past-the-end (write points to live element) + return write + 1; + } + + template <typename I> void copy_backwards(I begin, I end, I target) + { + while (begin != end) *--target = *--end; + } + + template <typename I, typename Pred, typename T> void insertion_sort(I begin, I end, const Pred& pred, T*) + { + assert(begin != end); + + for (I it = begin + 1; it != end; ++it) + { + T val = *it; + + if (pred(val, *begin)) + { + // move to front + copy_backwards(begin, it, it + 1); + *begin = val; + } + else + { + I hole = it; + + // move hole backwards + while (pred(val, *(hole - 1))) + { + *hole = *(hole - 1); + hole--; + } + + // fill hole with element + *hole = val; + } + } + } + + // std variant for elements with == + template <typename I, typename Pred> void partition(I begin, I middle, I end, const Pred& pred, I* out_eqbeg, I* out_eqend) + { + I eqbeg = middle, eqend = middle + 1; + + // expand equal range + while (eqbeg != begin && *(eqbeg - 1) == *eqbeg) --eqbeg; + while (eqend != end && *eqend == *eqbeg) ++eqend; + + // process outer elements + I ltend = eqbeg, gtbeg = eqend; + + for (;;) + { + // find the element from the right side that belongs to the left one + for (; gtbeg != end; ++gtbeg) + if (!pred(*eqbeg, *gtbeg)) + { + if (*gtbeg == *eqbeg) swap(*gtbeg, *eqend++); + else break; + } + + // find the element from the left side that belongs to the right one + for (; ltend != begin; --ltend) + if (!pred(*(ltend - 1), *eqbeg)) + { + if (*eqbeg == *(ltend - 1)) swap(*(ltend - 1), *--eqbeg); + else break; + } + + // scanned all elements + if (gtbeg == end && ltend == begin) + { + *out_eqbeg = eqbeg; + *out_eqend = eqend; + return; + } + + // make room for elements by moving equal area + if (gtbeg == end) + { + if (--ltend != --eqbeg) swap(*ltend, *eqbeg); + swap(*eqbeg, *--eqend); + } + else if (ltend == begin) + { + if (eqend != gtbeg) swap(*eqbeg, *eqend); + ++eqend; + swap(*gtbeg++, *eqbeg++); + } + else swap(*gtbeg++, *--ltend); + } + } + + template <typename I, typename Pred> void median3(I first, I middle, I last, const Pred& pred) + { + if (pred(*middle, *first)) swap(*middle, *first); + if (pred(*last, *middle)) swap(*last, *middle); + if (pred(*middle, *first)) swap(*middle, *first); + } + + template <typename I, typename Pred> void median(I first, I middle, I last, const Pred& pred) + { + if (last - first <= 40) + { + // median of three for small chunks + median3(first, middle, last, pred); + } + else + { + // median of nine + size_t step = (last - first + 1) / 8; + + median3(first, first + step, first + 2 * step, pred); + median3(middle - step, middle, middle + step, pred); + median3(last - 2 * step, last - step, last, pred); + median3(first + step, middle, last - step, pred); + } + } + + template <typename I, typename Pred> void sort(I begin, I end, const Pred& pred) + { + // sort large chunks + while (end - begin > 32) + { + // find median element + I middle = begin + (end - begin) / 2; + median(begin, middle, end - 1, pred); + + // partition in three chunks (< = >) + I eqbeg, eqend; + partition(begin, middle, end, pred, &eqbeg, &eqend); + + // loop on larger half + if (eqbeg - begin > end - eqend) + { + sort(eqend, end, pred); + end = eqbeg; + } + else + { + sort(begin, eqbeg, pred); + begin = eqend; + } + } + + // insertion sort small chunk + if (begin != end) insertion_sort(begin, end, pred, &*begin); + } +PUGI__NS_END + +// Allocator used for AST and evaluation stacks +PUGI__NS_BEGIN + static const size_t xpath_memory_page_size = + #ifdef PUGIXML_MEMORY_XPATH_PAGE_SIZE + PUGIXML_MEMORY_XPATH_PAGE_SIZE + #else + 4096 + #endif + ; + + static const uintptr_t xpath_memory_block_alignment = sizeof(double) > sizeof(void*) ? sizeof(double) : sizeof(void*); + + struct xpath_memory_block + { + xpath_memory_block* next; + size_t capacity; + + union + { + char data[xpath_memory_page_size]; + double alignment; + }; + }; + + class xpath_allocator + { + xpath_memory_block* _root; + size_t _root_size; + + public: + #ifdef PUGIXML_NO_EXCEPTIONS + jmp_buf* error_handler; + #endif + + xpath_allocator(xpath_memory_block* root, size_t root_size = 0): _root(root), _root_size(root_size) + { + #ifdef PUGIXML_NO_EXCEPTIONS + error_handler = 0; + #endif + } + + void* allocate_nothrow(size_t size) + { + // round size up to block alignment boundary + size = (size + xpath_memory_block_alignment - 1) & ~(xpath_memory_block_alignment - 1); + + if (_root_size + size <= _root->capacity) + { + void* buf = &_root->data[0] + _root_size; + _root_size += size; + return buf; + } + else + { + // make sure we have at least 1/4th of the page free after allocation to satisfy subsequent allocation requests + size_t block_capacity_base = sizeof(_root->data); + size_t block_capacity_req = size + block_capacity_base / 4; + size_t block_capacity = (block_capacity_base > block_capacity_req) ? block_capacity_base : block_capacity_req; + + size_t block_size = block_capacity + offsetof(xpath_memory_block, data); + + xpath_memory_block* block = static_cast<xpath_memory_block*>(xml_memory::allocate(block_size)); + if (!block) return 0; + + block->next = _root; + block->capacity = block_capacity; + + _root = block; + _root_size = size; + + return block->data; + } + } + + void* allocate(size_t size) + { + void* result = allocate_nothrow(size); + + if (!result) + { + #ifdef PUGIXML_NO_EXCEPTIONS + assert(error_handler); + longjmp(*error_handler, 1); + #else + throw std::bad_alloc(); + #endif + } + + return result; + } + + void* reallocate(void* ptr, size_t old_size, size_t new_size) + { + // round size up to block alignment boundary + old_size = (old_size + xpath_memory_block_alignment - 1) & ~(xpath_memory_block_alignment - 1); + new_size = (new_size + xpath_memory_block_alignment - 1) & ~(xpath_memory_block_alignment - 1); + + // we can only reallocate the last object + assert(ptr == 0 || static_cast<char*>(ptr) + old_size == &_root->data[0] + _root_size); + + // adjust root size so that we have not allocated the object at all + bool only_object = (_root_size == old_size); + + if (ptr) _root_size -= old_size; + + // allocate a new version (this will obviously reuse the memory if possible) + void* result = allocate(new_size); + assert(result); + + // we have a new block + if (result != ptr && ptr) + { + // copy old data + assert(new_size >= old_size); + memcpy(result, ptr, old_size); + + // free the previous page if it had no other objects + if (only_object) + { + assert(_root->data == result); + assert(_root->next); + + xpath_memory_block* next = _root->next->next; + + if (next) + { + // deallocate the whole page, unless it was the first one + xml_memory::deallocate(_root->next); + _root->next = next; + } + } + } + + return result; + } + + void revert(const xpath_allocator& state) + { + // free all new pages + xpath_memory_block* cur = _root; + + while (cur != state._root) + { + xpath_memory_block* next = cur->next; + + xml_memory::deallocate(cur); + + cur = next; + } + + // restore state + _root = state._root; + _root_size = state._root_size; + } + + void release() + { + xpath_memory_block* cur = _root; + assert(cur); + + while (cur->next) + { + xpath_memory_block* next = cur->next; + + xml_memory::deallocate(cur); + + cur = next; + } + } + }; + + struct xpath_allocator_capture + { + xpath_allocator_capture(xpath_allocator* alloc): _target(alloc), _state(*alloc) + { + } + + ~xpath_allocator_capture() + { + _target->revert(_state); + } + + xpath_allocator* _target; + xpath_allocator _state; + }; + + struct xpath_stack + { + xpath_allocator* result; + xpath_allocator* temp; + }; + + struct xpath_stack_data + { + xpath_memory_block blocks[2]; + xpath_allocator result; + xpath_allocator temp; + xpath_stack stack; + + #ifdef PUGIXML_NO_EXCEPTIONS + jmp_buf error_handler; + #endif + + xpath_stack_data(): result(blocks + 0), temp(blocks + 1) + { + blocks[0].next = blocks[1].next = 0; + blocks[0].capacity = blocks[1].capacity = sizeof(blocks[0].data); + + stack.result = &result; + stack.temp = &temp; + + #ifdef PUGIXML_NO_EXCEPTIONS + result.error_handler = temp.error_handler = &error_handler; + #endif + } + + ~xpath_stack_data() + { + result.release(); + temp.release(); + } + }; +PUGI__NS_END + +// String class +PUGI__NS_BEGIN + class xpath_string + { + const char_t* _buffer; + bool _uses_heap; + size_t _length_heap; + + static char_t* duplicate_string(const char_t* string, size_t length, xpath_allocator* alloc) + { + char_t* result = static_cast<char_t*>(alloc->allocate((length + 1) * sizeof(char_t))); + assert(result); + + memcpy(result, string, length * sizeof(char_t)); + result[length] = 0; + + return result; + } + + xpath_string(const char_t* buffer, bool uses_heap_, size_t length_heap): _buffer(buffer), _uses_heap(uses_heap_), _length_heap(length_heap) + { + } + + public: + static xpath_string from_const(const char_t* str) + { + return xpath_string(str, false, 0); + } + + static xpath_string from_heap_preallocated(const char_t* begin, const char_t* end) + { + assert(begin <= end && *end == 0); + + return xpath_string(begin, true, static_cast<size_t>(end - begin)); + } + + static xpath_string from_heap(const char_t* begin, const char_t* end, xpath_allocator* alloc) + { + assert(begin <= end); + + size_t length = static_cast<size_t>(end - begin); + + return length == 0 ? xpath_string() : xpath_string(duplicate_string(begin, length, alloc), true, length); + } + + xpath_string(): _buffer(PUGIXML_TEXT("")), _uses_heap(false), _length_heap(0) + { + } + + void append(const xpath_string& o, xpath_allocator* alloc) + { + // skip empty sources + if (!*o._buffer) return; + + // fast append for constant empty target and constant source + if (!*_buffer && !_uses_heap && !o._uses_heap) + { + _buffer = o._buffer; + } + else + { + // need to make heap copy + size_t target_length = length(); + size_t source_length = o.length(); + size_t result_length = target_length + source_length; + + // allocate new buffer + char_t* result = static_cast<char_t*>(alloc->reallocate(_uses_heap ? const_cast<char_t*>(_buffer) : 0, (target_length + 1) * sizeof(char_t), (result_length + 1) * sizeof(char_t))); + assert(result); + + // append first string to the new buffer in case there was no reallocation + if (!_uses_heap) memcpy(result, _buffer, target_length * sizeof(char_t)); + + // append second string to the new buffer + memcpy(result + target_length, o._buffer, source_length * sizeof(char_t)); + result[result_length] = 0; + + // finalize + _buffer = result; + _uses_heap = true; + _length_heap = result_length; + } + } + + const char_t* c_str() const + { + return _buffer; + } + + size_t length() const + { + return _uses_heap ? _length_heap : strlength(_buffer); + } + + char_t* data(xpath_allocator* alloc) + { + // make private heap copy + if (!_uses_heap) + { + size_t length_ = strlength(_buffer); + + _buffer = duplicate_string(_buffer, length_, alloc); + _uses_heap = true; + _length_heap = length_; + } + + return const_cast<char_t*>(_buffer); + } + + bool empty() const + { + return *_buffer == 0; + } + + bool operator==(const xpath_string& o) const + { + return strequal(_buffer, o._buffer); + } + + bool operator!=(const xpath_string& o) const + { + return !strequal(_buffer, o._buffer); + } + + bool uses_heap() const + { + return _uses_heap; + } + }; +PUGI__NS_END + +PUGI__NS_BEGIN + PUGI__FN bool starts_with(const char_t* string, const char_t* pattern) + { + while (*pattern && *string == *pattern) + { + string++; + pattern++; + } + + return *pattern == 0; + } + + PUGI__FN const char_t* find_char(const char_t* s, char_t c) + { + #ifdef PUGIXML_WCHAR_MODE + return wcschr(s, c); + #else + return strchr(s, c); + #endif + } + + PUGI__FN const char_t* find_substring(const char_t* s, const char_t* p) + { + #ifdef PUGIXML_WCHAR_MODE + // MSVC6 wcsstr bug workaround (if s is empty it always returns 0) + return (*p == 0) ? s : wcsstr(s, p); + #else + return strstr(s, p); + #endif + } + + // Converts symbol to lower case, if it is an ASCII one + PUGI__FN char_t tolower_ascii(char_t ch) + { + return static_cast<unsigned int>(ch - 'A') < 26 ? static_cast<char_t>(ch | ' ') : ch; + } + + PUGI__FN xpath_string string_value(const xpath_node& na, xpath_allocator* alloc) + { + if (na.attribute()) + return xpath_string::from_const(na.attribute().value()); + else + { + xml_node n = na.node(); + + switch (n.type()) + { + case node_pcdata: + case node_cdata: + case node_comment: + case node_pi: + return xpath_string::from_const(n.value()); + + case node_document: + case node_element: + { + xpath_string result; + + // element nodes can have value if parse_embed_pcdata was used + if (n.value()[0]) + result.append(xpath_string::from_const(n.value()), alloc); + + xml_node cur = n.first_child(); + + while (cur && cur != n) + { + if (cur.type() == node_pcdata || cur.type() == node_cdata) + result.append(xpath_string::from_const(cur.value()), alloc); + + if (cur.first_child()) + cur = cur.first_child(); + else if (cur.next_sibling()) + cur = cur.next_sibling(); + else + { + while (!cur.next_sibling() && cur != n) + cur = cur.parent(); + + if (cur != n) cur = cur.next_sibling(); + } + } + + return result; + } + + default: + return xpath_string(); + } + } + } + + PUGI__FN bool node_is_before_sibling(xml_node_struct* ln, xml_node_struct* rn) + { + assert(ln->parent == rn->parent); + + // there is no common ancestor (the shared parent is null), nodes are from different documents + if (!ln->parent) return ln < rn; + + // determine sibling order + xml_node_struct* ls = ln; + xml_node_struct* rs = rn; + + while (ls && rs) + { + if (ls == rn) return true; + if (rs == ln) return false; + + ls = ls->next_sibling; + rs = rs->next_sibling; + } + + // if rn sibling chain ended ln must be before rn + return !rs; + } + + PUGI__FN bool node_is_before(xml_node_struct* ln, xml_node_struct* rn) + { + // find common ancestor at the same depth, if any + xml_node_struct* lp = ln; + xml_node_struct* rp = rn; + + while (lp && rp && lp->parent != rp->parent) + { + lp = lp->parent; + rp = rp->parent; + } + + // parents are the same! + if (lp && rp) return node_is_before_sibling(lp, rp); + + // nodes are at different depths, need to normalize heights + bool left_higher = !lp; + + while (lp) + { + lp = lp->parent; + ln = ln->parent; + } + + while (rp) + { + rp = rp->parent; + rn = rn->parent; + } + + // one node is the ancestor of the other + if (ln == rn) return left_higher; + + // find common ancestor... again + while (ln->parent != rn->parent) + { + ln = ln->parent; + rn = rn->parent; + } + + return node_is_before_sibling(ln, rn); + } + + PUGI__FN bool node_is_ancestor(xml_node_struct* parent, xml_node_struct* node) + { + while (node && node != parent) node = node->parent; + + return parent && node == parent; + } + + PUGI__FN const void* document_buffer_order(const xpath_node& xnode) + { + xml_node_struct* node = xnode.node().internal_object(); + + if (node) + { + if ((get_document(node).header & xml_memory_page_contents_shared_mask) == 0) + { + if (node->name && (node->header & impl::xml_memory_page_name_allocated_or_shared_mask) == 0) return node->name; + if (node->value && (node->header & impl::xml_memory_page_value_allocated_or_shared_mask) == 0) return node->value; + } + + return 0; + } + + xml_attribute_struct* attr = xnode.attribute().internal_object(); + + if (attr) + { + if ((get_document(attr).header & xml_memory_page_contents_shared_mask) == 0) + { + if ((attr->header & impl::xml_memory_page_name_allocated_or_shared_mask) == 0) return attr->name; + if ((attr->header & impl::xml_memory_page_value_allocated_or_shared_mask) == 0) return attr->value; + } + + return 0; + } + + return 0; + } + + struct document_order_comparator + { + bool operator()(const xpath_node& lhs, const xpath_node& rhs) const + { + // optimized document order based check + const void* lo = document_buffer_order(lhs); + const void* ro = document_buffer_order(rhs); + + if (lo && ro) return lo < ro; + + // slow comparison + xml_node ln = lhs.node(), rn = rhs.node(); + + // compare attributes + if (lhs.attribute() && rhs.attribute()) + { + // shared parent + if (lhs.parent() == rhs.parent()) + { + // determine sibling order + for (xml_attribute a = lhs.attribute(); a; a = a.next_attribute()) + if (a == rhs.attribute()) + return true; + + return false; + } + + // compare attribute parents + ln = lhs.parent(); + rn = rhs.parent(); + } + else if (lhs.attribute()) + { + // attributes go after the parent element + if (lhs.parent() == rhs.node()) return false; + + ln = lhs.parent(); + } + else if (rhs.attribute()) + { + // attributes go after the parent element + if (rhs.parent() == lhs.node()) return true; + + rn = rhs.parent(); + } + + if (ln == rn) return false; + + if (!ln || !rn) return ln < rn; + + return node_is_before(ln.internal_object(), rn.internal_object()); + } + }; + + struct duplicate_comparator + { + bool operator()(const xpath_node& lhs, const xpath_node& rhs) const + { + if (lhs.attribute()) return rhs.attribute() ? lhs.attribute() < rhs.attribute() : true; + else return rhs.attribute() ? false : lhs.node() < rhs.node(); + } + }; + + PUGI__FN double gen_nan() + { + #if defined(__STDC_IEC_559__) || ((FLT_RADIX - 0 == 2) && (FLT_MAX_EXP - 0 == 128) && (FLT_MANT_DIG - 0 == 24)) + PUGI__STATIC_ASSERT(sizeof(float) == sizeof(uint32_t)); + typedef uint32_t UI; // BCC5 workaround + union { float f; UI i; } u; + u.i = 0x7fc00000; + return u.f; + #else + // fallback + const volatile double zero = 0.0; + return zero / zero; + #endif + } + + PUGI__FN bool is_nan(double value) + { + #if defined(PUGI__MSVC_CRT_VERSION) || defined(__BORLANDC__) + return !!_isnan(value); + #elif defined(fpclassify) && defined(FP_NAN) + return fpclassify(value) == FP_NAN; + #else + // fallback + const volatile double v = value; + return v != v; + #endif + } + + PUGI__FN const char_t* convert_number_to_string_special(double value) + { + #if defined(PUGI__MSVC_CRT_VERSION) || defined(__BORLANDC__) + if (_finite(value)) return (value == 0) ? PUGIXML_TEXT("0") : 0; + if (_isnan(value)) return PUGIXML_TEXT("NaN"); + return value > 0 ? PUGIXML_TEXT("Infinity") : PUGIXML_TEXT("-Infinity"); + #elif defined(fpclassify) && defined(FP_NAN) && defined(FP_INFINITE) && defined(FP_ZERO) + switch (fpclassify(value)) + { + case FP_NAN: + return PUGIXML_TEXT("NaN"); + + case FP_INFINITE: + return value > 0 ? PUGIXML_TEXT("Infinity") : PUGIXML_TEXT("-Infinity"); + + case FP_ZERO: + return PUGIXML_TEXT("0"); + + default: + return 0; + } + #else + // fallback + const volatile double v = value; + + if (v == 0) return PUGIXML_TEXT("0"); + if (v != v) return PUGIXML_TEXT("NaN"); + if (v * 2 == v) return value > 0 ? PUGIXML_TEXT("Infinity") : PUGIXML_TEXT("-Infinity"); + return 0; + #endif + } + + PUGI__FN bool convert_number_to_boolean(double value) + { + return (value != 0 && !is_nan(value)); + } + + PUGI__FN void truncate_zeros(char* begin, char* end) + { + while (begin != end && end[-1] == '0') end--; + + *end = 0; + } + + // gets mantissa digits in the form of 0.xxxxx with 0. implied and the exponent +#if defined(PUGI__MSVC_CRT_VERSION) && PUGI__MSVC_CRT_VERSION >= 1400 && !defined(_WIN32_WCE) + PUGI__FN void convert_number_to_mantissa_exponent(double value, char* buffer, size_t buffer_size, char** out_mantissa, int* out_exponent) + { + // get base values + int sign, exponent; + _ecvt_s(buffer, buffer_size, value, DBL_DIG + 1, &exponent, &sign); + + // truncate redundant zeros + truncate_zeros(buffer, buffer + strlen(buffer)); + + // fill results + *out_mantissa = buffer; + *out_exponent = exponent; + } +#else + PUGI__FN void convert_number_to_mantissa_exponent(double value, char* buffer, size_t buffer_size, char** out_mantissa, int* out_exponent) + { + // get a scientific notation value with IEEE DBL_DIG decimals + sprintf(buffer, "%.*e", DBL_DIG, value); + assert(strlen(buffer) < buffer_size); + (void)!buffer_size; + + // get the exponent (possibly negative) + char* exponent_string = strchr(buffer, 'e'); + assert(exponent_string); + + int exponent = atoi(exponent_string + 1); + + // extract mantissa string: skip sign + char* mantissa = buffer[0] == '-' ? buffer + 1 : buffer; + assert(mantissa[0] != '0' && mantissa[1] == '.'); + + // divide mantissa by 10 to eliminate integer part + mantissa[1] = mantissa[0]; + mantissa++; + exponent++; + + // remove extra mantissa digits and zero-terminate mantissa + truncate_zeros(mantissa, exponent_string); + + // fill results + *out_mantissa = mantissa; + *out_exponent = exponent; + } +#endif + + PUGI__FN xpath_string convert_number_to_string(double value, xpath_allocator* alloc) + { + // try special number conversion + const char_t* special = convert_number_to_string_special(value); + if (special) return xpath_string::from_const(special); + + // get mantissa + exponent form + char mantissa_buffer[32]; + + char* mantissa; + int exponent; + convert_number_to_mantissa_exponent(value, mantissa_buffer, sizeof(mantissa_buffer), &mantissa, &exponent); + + // allocate a buffer of suitable length for the number + size_t result_size = strlen(mantissa_buffer) + (exponent > 0 ? exponent : -exponent) + 4; + char_t* result = static_cast<char_t*>(alloc->allocate(sizeof(char_t) * result_size)); + assert(result); + + // make the number! + char_t* s = result; + + // sign + if (value < 0) *s++ = '-'; + + // integer part + if (exponent <= 0) + { + *s++ = '0'; + } + else + { + while (exponent > 0) + { + assert(*mantissa == 0 || static_cast<unsigned int>(static_cast<unsigned int>(*mantissa) - '0') <= 9); + *s++ = *mantissa ? *mantissa++ : '0'; + exponent--; + } + } + + // fractional part + if (*mantissa) + { + // decimal point + *s++ = '.'; + + // extra zeroes from negative exponent + while (exponent < 0) + { + *s++ = '0'; + exponent++; + } + + // extra mantissa digits + while (*mantissa) + { + assert(static_cast<unsigned int>(*mantissa - '0') <= 9); + *s++ = *mantissa++; + } + } + + // zero-terminate + assert(s < result + result_size); + *s = 0; + + return xpath_string::from_heap_preallocated(result, s); + } + + PUGI__FN bool check_string_to_number_format(const char_t* string) + { + // parse leading whitespace + while (PUGI__IS_CHARTYPE(*string, ct_space)) ++string; + + // parse sign + if (*string == '-') ++string; + + if (!*string) return false; + + // if there is no integer part, there should be a decimal part with at least one digit + if (!PUGI__IS_CHARTYPEX(string[0], ctx_digit) && (string[0] != '.' || !PUGI__IS_CHARTYPEX(string[1], ctx_digit))) return false; + + // parse integer part + while (PUGI__IS_CHARTYPEX(*string, ctx_digit)) ++string; + + // parse decimal part + if (*string == '.') + { + ++string; + + while (PUGI__IS_CHARTYPEX(*string, ctx_digit)) ++string; + } + + // parse trailing whitespace + while (PUGI__IS_CHARTYPE(*string, ct_space)) ++string; + + return *string == 0; + } + + PUGI__FN double convert_string_to_number(const char_t* string) + { + // check string format + if (!check_string_to_number_format(string)) return gen_nan(); + + // parse string + #ifdef PUGIXML_WCHAR_MODE + return wcstod(string, 0); + #else + return strtod(string, 0); + #endif + } + + PUGI__FN bool convert_string_to_number_scratch(char_t (&buffer)[32], const char_t* begin, const char_t* end, double* out_result) + { + size_t length = static_cast<size_t>(end - begin); + char_t* scratch = buffer; + + if (length >= sizeof(buffer) / sizeof(buffer[0])) + { + // need to make dummy on-heap copy + scratch = static_cast<char_t*>(xml_memory::allocate((length + 1) * sizeof(char_t))); + if (!scratch) return false; + } + + // copy string to zero-terminated buffer and perform conversion + memcpy(scratch, begin, length * sizeof(char_t)); + scratch[length] = 0; + + *out_result = convert_string_to_number(scratch); + + // free dummy buffer + if (scratch != buffer) xml_memory::deallocate(scratch); + + return true; + } + + PUGI__FN double round_nearest(double value) + { + return floor(value + 0.5); + } + + PUGI__FN double round_nearest_nzero(double value) + { + // same as round_nearest, but returns -0 for [-0.5, -0] + // ceil is used to differentiate between +0 and -0 (we return -0 for [-0.5, -0] and +0 for +0) + return (value >= -0.5 && value <= 0) ? ceil(value) : floor(value + 0.5); + } + + PUGI__FN const char_t* qualified_name(const xpath_node& node) + { + return node.attribute() ? node.attribute().name() : node.node().name(); + } + + PUGI__FN const char_t* local_name(const xpath_node& node) + { + const char_t* name = qualified_name(node); + const char_t* p = find_char(name, ':'); + + return p ? p + 1 : name; + } + + struct namespace_uri_predicate + { + const char_t* prefix; + size_t prefix_length; + + namespace_uri_predicate(const char_t* name) + { + const char_t* pos = find_char(name, ':'); + + prefix = pos ? name : 0; + prefix_length = pos ? static_cast<size_t>(pos - name) : 0; + } + + bool operator()(xml_attribute a) const + { + const char_t* name = a.name(); + + if (!starts_with(name, PUGIXML_TEXT("xmlns"))) return false; + + return prefix ? name[5] == ':' && strequalrange(name + 6, prefix, prefix_length) : name[5] == 0; + } + }; + + PUGI__FN const char_t* namespace_uri(xml_node node) + { + namespace_uri_predicate pred = node.name(); + + xml_node p = node; + + while (p) + { + xml_attribute a = p.find_attribute(pred); + + if (a) return a.value(); + + p = p.parent(); + } + + return PUGIXML_TEXT(""); + } + + PUGI__FN const char_t* namespace_uri(xml_attribute attr, xml_node parent) + { + namespace_uri_predicate pred = attr.name(); + + // Default namespace does not apply to attributes + if (!pred.prefix) return PUGIXML_TEXT(""); + + xml_node p = parent; + + while (p) + { + xml_attribute a = p.find_attribute(pred); + + if (a) return a.value(); + + p = p.parent(); + } + + return PUGIXML_TEXT(""); + } + + PUGI__FN const char_t* namespace_uri(const xpath_node& node) + { + return node.attribute() ? namespace_uri(node.attribute(), node.parent()) : namespace_uri(node.node()); + } + + PUGI__FN char_t* normalize_space(char_t* buffer) + { + char_t* write = buffer; + + for (char_t* it = buffer; *it; ) + { + char_t ch = *it++; + + if (PUGI__IS_CHARTYPE(ch, ct_space)) + { + // replace whitespace sequence with single space + while (PUGI__IS_CHARTYPE(*it, ct_space)) it++; + + // avoid leading spaces + if (write != buffer) *write++ = ' '; + } + else *write++ = ch; + } + + // remove trailing space + if (write != buffer && PUGI__IS_CHARTYPE(write[-1], ct_space)) write--; + + // zero-terminate + *write = 0; + + return write; + } + + PUGI__FN char_t* translate(char_t* buffer, const char_t* from, const char_t* to, size_t to_length) + { + char_t* write = buffer; + + while (*buffer) + { + PUGI__DMC_VOLATILE char_t ch = *buffer++; + + const char_t* pos = find_char(from, ch); + + if (!pos) + *write++ = ch; // do not process + else if (static_cast<size_t>(pos - from) < to_length) + *write++ = to[pos - from]; // replace + } + + // zero-terminate + *write = 0; + + return write; + } + + PUGI__FN unsigned char* translate_table_generate(xpath_allocator* alloc, const char_t* from, const char_t* to) + { + unsigned char table[128] = {0}; + + while (*from) + { + unsigned int fc = static_cast<unsigned int>(*from); + unsigned int tc = static_cast<unsigned int>(*to); + + if (fc >= 128 || tc >= 128) + return 0; + + // code=128 means "skip character" + if (!table[fc]) + table[fc] = static_cast<unsigned char>(tc ? tc : 128); + + from++; + if (tc) to++; + } + + for (int i = 0; i < 128; ++i) + if (!table[i]) + table[i] = static_cast<unsigned char>(i); + + void* result = alloc->allocate_nothrow(sizeof(table)); + + if (result) + { + memcpy(result, table, sizeof(table)); + } + + return static_cast<unsigned char*>(result); + } + + PUGI__FN char_t* translate_table(char_t* buffer, const unsigned char* table) + { + char_t* write = buffer; + + while (*buffer) + { + char_t ch = *buffer++; + unsigned int index = static_cast<unsigned int>(ch); + + if (index < 128) + { + unsigned char code = table[index]; + + // code=128 means "skip character" (table size is 128 so 128 can be a special value) + // this code skips these characters without extra branches + *write = static_cast<char_t>(code); + write += 1 - (code >> 7); + } + else + { + *write++ = ch; + } + } + + // zero-terminate + *write = 0; + + return write; + } + + inline bool is_xpath_attribute(const char_t* name) + { + return !(starts_with(name, PUGIXML_TEXT("xmlns")) && (name[5] == 0 || name[5] == ':')); + } + + struct xpath_variable_boolean: xpath_variable + { + xpath_variable_boolean(): xpath_variable(xpath_type_boolean), value(false) + { + } + + bool value; + char_t name[1]; + }; + + struct xpath_variable_number: xpath_variable + { + xpath_variable_number(): xpath_variable(xpath_type_number), value(0) + { + } + + double value; + char_t name[1]; + }; + + struct xpath_variable_string: xpath_variable + { + xpath_variable_string(): xpath_variable(xpath_type_string), value(0) + { + } + + ~xpath_variable_string() + { + if (value) xml_memory::deallocate(value); + } + + char_t* value; + char_t name[1]; + }; + + struct xpath_variable_node_set: xpath_variable + { + xpath_variable_node_set(): xpath_variable(xpath_type_node_set) + { + } + + xpath_node_set value; + char_t name[1]; + }; + + static const xpath_node_set dummy_node_set; + + PUGI__FN unsigned int hash_string(const char_t* str) + { + // Jenkins one-at-a-time hash (http://en.wikipedia.org/wiki/Jenkins_hash_function#one-at-a-time) + unsigned int result = 0; + + while (*str) + { + result += static_cast<unsigned int>(*str++); + result += result << 10; + result ^= result >> 6; + } + + result += result << 3; + result ^= result >> 11; + result += result << 15; + + return result; + } + + template <typename T> PUGI__FN T* new_xpath_variable(const char_t* name) + { + size_t length = strlength(name); + if (length == 0) return 0; // empty variable names are invalid + + // $$ we can't use offsetof(T, name) because T is non-POD, so we just allocate additional length characters + void* memory = xml_memory::allocate(sizeof(T) + length * sizeof(char_t)); + if (!memory) return 0; + + T* result = new (memory) T(); + + memcpy(result->name, name, (length + 1) * sizeof(char_t)); + + return result; + } + + PUGI__FN xpath_variable* new_xpath_variable(xpath_value_type type, const char_t* name) + { + switch (type) + { + case xpath_type_node_set: + return new_xpath_variable<xpath_variable_node_set>(name); + + case xpath_type_number: + return new_xpath_variable<xpath_variable_number>(name); + + case xpath_type_string: + return new_xpath_variable<xpath_variable_string>(name); + + case xpath_type_boolean: + return new_xpath_variable<xpath_variable_boolean>(name); + + default: + return 0; + } + } + + template <typename T> PUGI__FN void delete_xpath_variable(T* var) + { + var->~T(); + xml_memory::deallocate(var); + } + + PUGI__FN void delete_xpath_variable(xpath_value_type type, xpath_variable* var) + { + switch (type) + { + case xpath_type_node_set: + delete_xpath_variable(static_cast<xpath_variable_node_set*>(var)); + break; + + case xpath_type_number: + delete_xpath_variable(static_cast<xpath_variable_number*>(var)); + break; + + case xpath_type_string: + delete_xpath_variable(static_cast<xpath_variable_string*>(var)); + break; + + case xpath_type_boolean: + delete_xpath_variable(static_cast<xpath_variable_boolean*>(var)); + break; + + default: + assert(false && "Invalid variable type"); + } + } + + PUGI__FN bool copy_xpath_variable(xpath_variable* lhs, const xpath_variable* rhs) + { + switch (rhs->type()) + { + case xpath_type_node_set: + return lhs->set(static_cast<const xpath_variable_node_set*>(rhs)->value); + + case xpath_type_number: + return lhs->set(static_cast<const xpath_variable_number*>(rhs)->value); + + case xpath_type_string: + return lhs->set(static_cast<const xpath_variable_string*>(rhs)->value); + + case xpath_type_boolean: + return lhs->set(static_cast<const xpath_variable_boolean*>(rhs)->value); + + default: + assert(false && "Invalid variable type"); + return false; + } + } + + PUGI__FN bool get_variable_scratch(char_t (&buffer)[32], xpath_variable_set* set, const char_t* begin, const char_t* end, xpath_variable** out_result) + { + size_t length = static_cast<size_t>(end - begin); + char_t* scratch = buffer; + + if (length >= sizeof(buffer) / sizeof(buffer[0])) + { + // need to make dummy on-heap copy + scratch = static_cast<char_t*>(xml_memory::allocate((length + 1) * sizeof(char_t))); + if (!scratch) return false; + } + + // copy string to zero-terminated buffer and perform lookup + memcpy(scratch, begin, length * sizeof(char_t)); + scratch[length] = 0; + + *out_result = set->get(scratch); + + // free dummy buffer + if (scratch != buffer) xml_memory::deallocate(scratch); + + return true; + } +PUGI__NS_END + +// Internal node set class +PUGI__NS_BEGIN + PUGI__FN xpath_node_set::type_t xpath_get_order(const xpath_node* begin, const xpath_node* end) + { + if (end - begin < 2) + return xpath_node_set::type_sorted; + + document_order_comparator cmp; + + bool first = cmp(begin[0], begin[1]); + + for (const xpath_node* it = begin + 1; it + 1 < end; ++it) + if (cmp(it[0], it[1]) != first) + return xpath_node_set::type_unsorted; + + return first ? xpath_node_set::type_sorted : xpath_node_set::type_sorted_reverse; + } + + PUGI__FN xpath_node_set::type_t xpath_sort(xpath_node* begin, xpath_node* end, xpath_node_set::type_t type, bool rev) + { + xpath_node_set::type_t order = rev ? xpath_node_set::type_sorted_reverse : xpath_node_set::type_sorted; + + if (type == xpath_node_set::type_unsorted) + { + xpath_node_set::type_t sorted = xpath_get_order(begin, end); + + if (sorted == xpath_node_set::type_unsorted) + { + sort(begin, end, document_order_comparator()); + + type = xpath_node_set::type_sorted; + } + else + type = sorted; + } + + if (type != order) reverse(begin, end); + + return order; + } + + PUGI__FN xpath_node xpath_first(const xpath_node* begin, const xpath_node* end, xpath_node_set::type_t type) + { + if (begin == end) return xpath_node(); + + switch (type) + { + case xpath_node_set::type_sorted: + return *begin; + + case xpath_node_set::type_sorted_reverse: + return *(end - 1); + + case xpath_node_set::type_unsorted: + return *min_element(begin, end, document_order_comparator()); + + default: + assert(false && "Invalid node set type"); + return xpath_node(); + } + } + + class xpath_node_set_raw + { + xpath_node_set::type_t _type; + + xpath_node* _begin; + xpath_node* _end; + xpath_node* _eos; + + public: + xpath_node_set_raw(): _type(xpath_node_set::type_unsorted), _begin(0), _end(0), _eos(0) + { + } + + xpath_node* begin() const + { + return _begin; + } + + xpath_node* end() const + { + return _end; + } + + bool empty() const + { + return _begin == _end; + } + + size_t size() const + { + return static_cast<size_t>(_end - _begin); + } + + xpath_node first() const + { + return xpath_first(_begin, _end, _type); + } + + void push_back_grow(const xpath_node& node, xpath_allocator* alloc); + + void push_back(const xpath_node& node, xpath_allocator* alloc) + { + if (_end != _eos) + *_end++ = node; + else + push_back_grow(node, alloc); + } + + void append(const xpath_node* begin_, const xpath_node* end_, xpath_allocator* alloc) + { + if (begin_ == end_) return; + + size_t size_ = static_cast<size_t>(_end - _begin); + size_t capacity = static_cast<size_t>(_eos - _begin); + size_t count = static_cast<size_t>(end_ - begin_); + + if (size_ + count > capacity) + { + // reallocate the old array or allocate a new one + xpath_node* data = static_cast<xpath_node*>(alloc->reallocate(_begin, capacity * sizeof(xpath_node), (size_ + count) * sizeof(xpath_node))); + assert(data); + + // finalize + _begin = data; + _end = data + size_; + _eos = data + size_ + count; + } + + memcpy(_end, begin_, count * sizeof(xpath_node)); + _end += count; + } + + void sort_do() + { + _type = xpath_sort(_begin, _end, _type, false); + } + + void truncate(xpath_node* pos) + { + assert(_begin <= pos && pos <= _end); + + _end = pos; + } + + void remove_duplicates() + { + if (_type == xpath_node_set::type_unsorted) + sort(_begin, _end, duplicate_comparator()); + + _end = unique(_begin, _end); + } + + xpath_node_set::type_t type() const + { + return _type; + } + + void set_type(xpath_node_set::type_t value) + { + _type = value; + } + }; + + PUGI__FN_NO_INLINE void xpath_node_set_raw::push_back_grow(const xpath_node& node, xpath_allocator* alloc) + { + size_t capacity = static_cast<size_t>(_eos - _begin); + + // get new capacity (1.5x rule) + size_t new_capacity = capacity + capacity / 2 + 1; + + // reallocate the old array or allocate a new one + xpath_node* data = static_cast<xpath_node*>(alloc->reallocate(_begin, capacity * sizeof(xpath_node), new_capacity * sizeof(xpath_node))); + assert(data); + + // finalize + _begin = data; + _end = data + capacity; + _eos = data + new_capacity; + + // push + *_end++ = node; + } +PUGI__NS_END + +PUGI__NS_BEGIN + struct xpath_context + { + xpath_node n; + size_t position, size; + + xpath_context(const xpath_node& n_, size_t position_, size_t size_): n(n_), position(position_), size(size_) + { + } + }; + + enum lexeme_t + { + lex_none = 0, + lex_equal, + lex_not_equal, + lex_less, + lex_greater, + lex_less_or_equal, + lex_greater_or_equal, + lex_plus, + lex_minus, + lex_multiply, + lex_union, + lex_var_ref, + lex_open_brace, + lex_close_brace, + lex_quoted_string, + lex_number, + lex_slash, + lex_double_slash, + lex_open_square_brace, + lex_close_square_brace, + lex_string, + lex_comma, + lex_axis_attribute, + lex_dot, + lex_double_dot, + lex_double_colon, + lex_eof + }; + + struct xpath_lexer_string + { + const char_t* begin; + const char_t* end; + + xpath_lexer_string(): begin(0), end(0) + { + } + + bool operator==(const char_t* other) const + { + size_t length = static_cast<size_t>(end - begin); + + return strequalrange(other, begin, length); + } + }; + + class xpath_lexer + { + const char_t* _cur; + const char_t* _cur_lexeme_pos; + xpath_lexer_string _cur_lexeme_contents; + + lexeme_t _cur_lexeme; + + public: + explicit xpath_lexer(const char_t* query): _cur(query) + { + next(); + } + + const char_t* state() const + { + return _cur; + } + + void next() + { + const char_t* cur = _cur; + + while (PUGI__IS_CHARTYPE(*cur, ct_space)) ++cur; + + // save lexeme position for error reporting + _cur_lexeme_pos = cur; + + switch (*cur) + { + case 0: + _cur_lexeme = lex_eof; + break; + + case '>': + if (*(cur+1) == '=') + { + cur += 2; + _cur_lexeme = lex_greater_or_equal; + } + else + { + cur += 1; + _cur_lexeme = lex_greater; + } + break; + + case '<': + if (*(cur+1) == '=') + { + cur += 2; + _cur_lexeme = lex_less_or_equal; + } + else + { + cur += 1; + _cur_lexeme = lex_less; + } + break; + + case '!': + if (*(cur+1) == '=') + { + cur += 2; + _cur_lexeme = lex_not_equal; + } + else + { + _cur_lexeme = lex_none; + } + break; + + case '=': + cur += 1; + _cur_lexeme = lex_equal; + + break; + + case '+': + cur += 1; + _cur_lexeme = lex_plus; + + break; + + case '-': + cur += 1; + _cur_lexeme = lex_minus; + + break; + + case '*': + cur += 1; + _cur_lexeme = lex_multiply; + + break; + + case '|': + cur += 1; + _cur_lexeme = lex_union; + + break; + + case '$': + cur += 1; + + if (PUGI__IS_CHARTYPEX(*cur, ctx_start_symbol)) + { + _cur_lexeme_contents.begin = cur; + + while (PUGI__IS_CHARTYPEX(*cur, ctx_symbol)) cur++; + + if (cur[0] == ':' && PUGI__IS_CHARTYPEX(cur[1], ctx_symbol)) // qname + { + cur++; // : + + while (PUGI__IS_CHARTYPEX(*cur, ctx_symbol)) cur++; + } + + _cur_lexeme_contents.end = cur; + + _cur_lexeme = lex_var_ref; + } + else + { + _cur_lexeme = lex_none; + } + + break; + + case '(': + cur += 1; + _cur_lexeme = lex_open_brace; + + break; + + case ')': + cur += 1; + _cur_lexeme = lex_close_brace; + + break; + + case '[': + cur += 1; + _cur_lexeme = lex_open_square_brace; + + break; + + case ']': + cur += 1; + _cur_lexeme = lex_close_square_brace; + + break; + + case ',': + cur += 1; + _cur_lexeme = lex_comma; + + break; + + case '/': + if (*(cur+1) == '/') + { + cur += 2; + _cur_lexeme = lex_double_slash; + } + else + { + cur += 1; + _cur_lexeme = lex_slash; + } + break; + + case '.': + if (*(cur+1) == '.') + { + cur += 2; + _cur_lexeme = lex_double_dot; + } + else if (PUGI__IS_CHARTYPEX(*(cur+1), ctx_digit)) + { + _cur_lexeme_contents.begin = cur; // . + + ++cur; + + while (PUGI__IS_CHARTYPEX(*cur, ctx_digit)) cur++; + + _cur_lexeme_contents.end = cur; + + _cur_lexeme = lex_number; + } + else + { + cur += 1; + _cur_lexeme = lex_dot; + } + break; + + case '@': + cur += 1; + _cur_lexeme = lex_axis_attribute; + + break; + + case '"': + case '\'': + { + char_t terminator = *cur; + + ++cur; + + _cur_lexeme_contents.begin = cur; + while (*cur && *cur != terminator) cur++; + _cur_lexeme_contents.end = cur; + + if (!*cur) + _cur_lexeme = lex_none; + else + { + cur += 1; + _cur_lexeme = lex_quoted_string; + } + + break; + } + + case ':': + if (*(cur+1) == ':') + { + cur += 2; + _cur_lexeme = lex_double_colon; + } + else + { + _cur_lexeme = lex_none; + } + break; + + default: + if (PUGI__IS_CHARTYPEX(*cur, ctx_digit)) + { + _cur_lexeme_contents.begin = cur; + + while (PUGI__IS_CHARTYPEX(*cur, ctx_digit)) cur++; + + if (*cur == '.') + { + cur++; + + while (PUGI__IS_CHARTYPEX(*cur, ctx_digit)) cur++; + } + + _cur_lexeme_contents.end = cur; + + _cur_lexeme = lex_number; + } + else if (PUGI__IS_CHARTYPEX(*cur, ctx_start_symbol)) + { + _cur_lexeme_contents.begin = cur; + + while (PUGI__IS_CHARTYPEX(*cur, ctx_symbol)) cur++; + + if (cur[0] == ':') + { + if (cur[1] == '*') // namespace test ncname:* + { + cur += 2; // :* + } + else if (PUGI__IS_CHARTYPEX(cur[1], ctx_symbol)) // namespace test qname + { + cur++; // : + + while (PUGI__IS_CHARTYPEX(*cur, ctx_symbol)) cur++; + } + } + + _cur_lexeme_contents.end = cur; + + _cur_lexeme = lex_string; + } + else + { + _cur_lexeme = lex_none; + } + } + + _cur = cur; + } + + lexeme_t current() const + { + return _cur_lexeme; + } + + const char_t* current_pos() const + { + return _cur_lexeme_pos; + } + + const xpath_lexer_string& contents() const + { + assert(_cur_lexeme == lex_var_ref || _cur_lexeme == lex_number || _cur_lexeme == lex_string || _cur_lexeme == lex_quoted_string); + + return _cur_lexeme_contents; + } + }; + + enum ast_type_t + { + ast_unknown, + ast_op_or, // left or right + ast_op_and, // left and right + ast_op_equal, // left = right + ast_op_not_equal, // left != right + ast_op_less, // left < right + ast_op_greater, // left > right + ast_op_less_or_equal, // left <= right + ast_op_greater_or_equal, // left >= right + ast_op_add, // left + right + ast_op_subtract, // left - right + ast_op_multiply, // left * right + ast_op_divide, // left / right + ast_op_mod, // left % right + ast_op_negate, // left - right + ast_op_union, // left | right + ast_predicate, // apply predicate to set; next points to next predicate + ast_filter, // select * from left where right + ast_string_constant, // string constant + ast_number_constant, // number constant + ast_variable, // variable + ast_func_last, // last() + ast_func_position, // position() + ast_func_count, // count(left) + ast_func_id, // id(left) + ast_func_local_name_0, // local-name() + ast_func_local_name_1, // local-name(left) + ast_func_namespace_uri_0, // namespace-uri() + ast_func_namespace_uri_1, // namespace-uri(left) + ast_func_name_0, // name() + ast_func_name_1, // name(left) + ast_func_string_0, // string() + ast_func_string_1, // string(left) + ast_func_concat, // concat(left, right, siblings) + ast_func_starts_with, // starts_with(left, right) + ast_func_contains, // contains(left, right) + ast_func_substring_before, // substring-before(left, right) + ast_func_substring_after, // substring-after(left, right) + ast_func_substring_2, // substring(left, right) + ast_func_substring_3, // substring(left, right, third) + ast_func_string_length_0, // string-length() + ast_func_string_length_1, // string-length(left) + ast_func_normalize_space_0, // normalize-space() + ast_func_normalize_space_1, // normalize-space(left) + ast_func_translate, // translate(left, right, third) + ast_func_boolean, // boolean(left) + ast_func_not, // not(left) + ast_func_true, // true() + ast_func_false, // false() + ast_func_lang, // lang(left) + ast_func_number_0, // number() + ast_func_number_1, // number(left) + ast_func_sum, // sum(left) + ast_func_floor, // floor(left) + ast_func_ceiling, // ceiling(left) + ast_func_round, // round(left) + ast_step, // process set left with step + ast_step_root, // select root node + + ast_opt_translate_table, // translate(left, right, third) where right/third are constants + ast_opt_compare_attribute // @name = 'string' + }; + + enum axis_t + { + axis_ancestor, + axis_ancestor_or_self, + axis_attribute, + axis_child, + axis_descendant, + axis_descendant_or_self, + axis_following, + axis_following_sibling, + axis_namespace, + axis_parent, + axis_preceding, + axis_preceding_sibling, + axis_self + }; + + enum nodetest_t + { + nodetest_none, + nodetest_name, + nodetest_type_node, + nodetest_type_comment, + nodetest_type_pi, + nodetest_type_text, + nodetest_pi, + nodetest_all, + nodetest_all_in_namespace + }; + + enum predicate_t + { + predicate_default, + predicate_posinv, + predicate_constant, + predicate_constant_one + }; + + enum nodeset_eval_t + { + nodeset_eval_all, + nodeset_eval_any, + nodeset_eval_first + }; + + template <axis_t N> struct axis_to_type + { + static const axis_t axis; + }; + + template <axis_t N> const axis_t axis_to_type<N>::axis = N; + + class xpath_ast_node + { + private: + // node type + char _type; + char _rettype; + + // for ast_step + char _axis; + + // for ast_step/ast_predicate/ast_filter + char _test; + + // tree node structure + xpath_ast_node* _left; + xpath_ast_node* _right; + xpath_ast_node* _next; + + union + { + // value for ast_string_constant + const char_t* string; + // value for ast_number_constant + double number; + // variable for ast_variable + xpath_variable* variable; + // node test for ast_step (node name/namespace/node type/pi target) + const char_t* nodetest; + // table for ast_opt_translate_table + const unsigned char* table; + } _data; + + xpath_ast_node(const xpath_ast_node&); + xpath_ast_node& operator=(const xpath_ast_node&); + + template <class Comp> static bool compare_eq(xpath_ast_node* lhs, xpath_ast_node* rhs, const xpath_context& c, const xpath_stack& stack, const Comp& comp) + { + xpath_value_type lt = lhs->rettype(), rt = rhs->rettype(); + + if (lt != xpath_type_node_set && rt != xpath_type_node_set) + { + if (lt == xpath_type_boolean || rt == xpath_type_boolean) + return comp(lhs->eval_boolean(c, stack), rhs->eval_boolean(c, stack)); + else if (lt == xpath_type_number || rt == xpath_type_number) + return comp(lhs->eval_number(c, stack), rhs->eval_number(c, stack)); + else if (lt == xpath_type_string || rt == xpath_type_string) + { + xpath_allocator_capture cr(stack.result); + + xpath_string ls = lhs->eval_string(c, stack); + xpath_string rs = rhs->eval_string(c, stack); + + return comp(ls, rs); + } + } + else if (lt == xpath_type_node_set && rt == xpath_type_node_set) + { + xpath_allocator_capture cr(stack.result); + + xpath_node_set_raw ls = lhs->eval_node_set(c, stack, nodeset_eval_all); + xpath_node_set_raw rs = rhs->eval_node_set(c, stack, nodeset_eval_all); + + for (const xpath_node* li = ls.begin(); li != ls.end(); ++li) + for (const xpath_node* ri = rs.begin(); ri != rs.end(); ++ri) + { + xpath_allocator_capture cri(stack.result); + + if (comp(string_value(*li, stack.result), string_value(*ri, stack.result))) + return true; + } + + return false; + } + else + { + if (lt == xpath_type_node_set) + { + swap(lhs, rhs); + swap(lt, rt); + } + + if (lt == xpath_type_boolean) + return comp(lhs->eval_boolean(c, stack), rhs->eval_boolean(c, stack)); + else if (lt == xpath_type_number) + { + xpath_allocator_capture cr(stack.result); + + double l = lhs->eval_number(c, stack); + xpath_node_set_raw rs = rhs->eval_node_set(c, stack, nodeset_eval_all); + + for (const xpath_node* ri = rs.begin(); ri != rs.end(); ++ri) + { + xpath_allocator_capture cri(stack.result); + + if (comp(l, convert_string_to_number(string_value(*ri, stack.result).c_str()))) + return true; + } + + return false; + } + else if (lt == xpath_type_string) + { + xpath_allocator_capture cr(stack.result); + + xpath_string l = lhs->eval_string(c, stack); + xpath_node_set_raw rs = rhs->eval_node_set(c, stack, nodeset_eval_all); + + for (const xpath_node* ri = rs.begin(); ri != rs.end(); ++ri) + { + xpath_allocator_capture cri(stack.result); + + if (comp(l, string_value(*ri, stack.result))) + return true; + } + + return false; + } + } + + assert(false && "Wrong types"); + return false; + } + + static bool eval_once(xpath_node_set::type_t type, nodeset_eval_t eval) + { + return type == xpath_node_set::type_sorted ? eval != nodeset_eval_all : eval == nodeset_eval_any; + } + + template <class Comp> static bool compare_rel(xpath_ast_node* lhs, xpath_ast_node* rhs, const xpath_context& c, const xpath_stack& stack, const Comp& comp) + { + xpath_value_type lt = lhs->rettype(), rt = rhs->rettype(); + + if (lt != xpath_type_node_set && rt != xpath_type_node_set) + return comp(lhs->eval_number(c, stack), rhs->eval_number(c, stack)); + else if (lt == xpath_type_node_set && rt == xpath_type_node_set) + { + xpath_allocator_capture cr(stack.result); + + xpath_node_set_raw ls = lhs->eval_node_set(c, stack, nodeset_eval_all); + xpath_node_set_raw rs = rhs->eval_node_set(c, stack, nodeset_eval_all); + + for (const xpath_node* li = ls.begin(); li != ls.end(); ++li) + { + xpath_allocator_capture cri(stack.result); + + double l = convert_string_to_number(string_value(*li, stack.result).c_str()); + + for (const xpath_node* ri = rs.begin(); ri != rs.end(); ++ri) + { + xpath_allocator_capture crii(stack.result); + + if (comp(l, convert_string_to_number(string_value(*ri, stack.result).c_str()))) + return true; + } + } + + return false; + } + else if (lt != xpath_type_node_set && rt == xpath_type_node_set) + { + xpath_allocator_capture cr(stack.result); + + double l = lhs->eval_number(c, stack); + xpath_node_set_raw rs = rhs->eval_node_set(c, stack, nodeset_eval_all); + + for (const xpath_node* ri = rs.begin(); ri != rs.end(); ++ri) + { + xpath_allocator_capture cri(stack.result); + + if (comp(l, convert_string_to_number(string_value(*ri, stack.result).c_str()))) + return true; + } + + return false; + } + else if (lt == xpath_type_node_set && rt != xpath_type_node_set) + { + xpath_allocator_capture cr(stack.result); + + xpath_node_set_raw ls = lhs->eval_node_set(c, stack, nodeset_eval_all); + double r = rhs->eval_number(c, stack); + + for (const xpath_node* li = ls.begin(); li != ls.end(); ++li) + { + xpath_allocator_capture cri(stack.result); + + if (comp(convert_string_to_number(string_value(*li, stack.result).c_str()), r)) + return true; + } + + return false; + } + else + { + assert(false && "Wrong types"); + return false; + } + } + + static void apply_predicate_boolean(xpath_node_set_raw& ns, size_t first, xpath_ast_node* expr, const xpath_stack& stack, bool once) + { + assert(ns.size() >= first); + assert(expr->rettype() != xpath_type_number); + + size_t i = 1; + size_t size = ns.size() - first; + + xpath_node* last = ns.begin() + first; + + // remove_if... or well, sort of + for (xpath_node* it = last; it != ns.end(); ++it, ++i) + { + xpath_context c(*it, i, size); + + if (expr->eval_boolean(c, stack)) + { + *last++ = *it; + + if (once) break; + } + } + + ns.truncate(last); + } + + static void apply_predicate_number(xpath_node_set_raw& ns, size_t first, xpath_ast_node* expr, const xpath_stack& stack, bool once) + { + assert(ns.size() >= first); + assert(expr->rettype() == xpath_type_number); + + size_t i = 1; + size_t size = ns.size() - first; + + xpath_node* last = ns.begin() + first; + + // remove_if... or well, sort of + for (xpath_node* it = last; it != ns.end(); ++it, ++i) + { + xpath_context c(*it, i, size); + + if (expr->eval_number(c, stack) == i) + { + *last++ = *it; + + if (once) break; + } + } + + ns.truncate(last); + } + + static void apply_predicate_number_const(xpath_node_set_raw& ns, size_t first, xpath_ast_node* expr, const xpath_stack& stack) + { + assert(ns.size() >= first); + assert(expr->rettype() == xpath_type_number); + + size_t size = ns.size() - first; + + xpath_node* last = ns.begin() + first; + + xpath_context c(xpath_node(), 1, size); + + double er = expr->eval_number(c, stack); + + if (er >= 1.0 && er <= size) + { + size_t eri = static_cast<size_t>(er); + + if (er == eri) + { + xpath_node r = last[eri - 1]; + + *last++ = r; + } + } + + ns.truncate(last); + } + + void apply_predicate(xpath_node_set_raw& ns, size_t first, const xpath_stack& stack, bool once) + { + if (ns.size() == first) return; + + assert(_type == ast_filter || _type == ast_predicate); + + if (_test == predicate_constant || _test == predicate_constant_one) + apply_predicate_number_const(ns, first, _right, stack); + else if (_right->rettype() == xpath_type_number) + apply_predicate_number(ns, first, _right, stack, once); + else + apply_predicate_boolean(ns, first, _right, stack, once); + } + + void apply_predicates(xpath_node_set_raw& ns, size_t first, const xpath_stack& stack, nodeset_eval_t eval) + { + if (ns.size() == first) return; + + bool last_once = eval_once(ns.type(), eval); + + for (xpath_ast_node* pred = _right; pred; pred = pred->_next) + pred->apply_predicate(ns, first, stack, !pred->_next && last_once); + } + + bool step_push(xpath_node_set_raw& ns, xml_attribute_struct* a, xml_node_struct* parent, xpath_allocator* alloc) + { + assert(a); + + const char_t* name = a->name ? a->name + 0 : PUGIXML_TEXT(""); + + switch (_test) + { + case nodetest_name: + if (strequal(name, _data.nodetest) && is_xpath_attribute(name)) + { + ns.push_back(xpath_node(xml_attribute(a), xml_node(parent)), alloc); + return true; + } + break; + + case nodetest_type_node: + case nodetest_all: + if (is_xpath_attribute(name)) + { + ns.push_back(xpath_node(xml_attribute(a), xml_node(parent)), alloc); + return true; + } + break; + + case nodetest_all_in_namespace: + if (starts_with(name, _data.nodetest) && is_xpath_attribute(name)) + { + ns.push_back(xpath_node(xml_attribute(a), xml_node(parent)), alloc); + return true; + } + break; + + default: + ; + } + + return false; + } + + bool step_push(xpath_node_set_raw& ns, xml_node_struct* n, xpath_allocator* alloc) + { + assert(n); + + xml_node_type type = PUGI__NODETYPE(n); + + switch (_test) + { + case nodetest_name: + if (type == node_element && n->name && strequal(n->name, _data.nodetest)) + { + ns.push_back(xml_node(n), alloc); + return true; + } + break; + + case nodetest_type_node: + ns.push_back(xml_node(n), alloc); + return true; + + case nodetest_type_comment: + if (type == node_comment) + { + ns.push_back(xml_node(n), alloc); + return true; + } + break; + + case nodetest_type_text: + if (type == node_pcdata || type == node_cdata) + { + ns.push_back(xml_node(n), alloc); + return true; + } + break; + + case nodetest_type_pi: + if (type == node_pi) + { + ns.push_back(xml_node(n), alloc); + return true; + } + break; + + case nodetest_pi: + if (type == node_pi && n->name && strequal(n->name, _data.nodetest)) + { + ns.push_back(xml_node(n), alloc); + return true; + } + break; + + case nodetest_all: + if (type == node_element) + { + ns.push_back(xml_node(n), alloc); + return true; + } + break; + + case nodetest_all_in_namespace: + if (type == node_element && n->name && starts_with(n->name, _data.nodetest)) + { + ns.push_back(xml_node(n), alloc); + return true; + } + break; + + default: + assert(false && "Unknown axis"); + } + + return false; + } + + template <class T> void step_fill(xpath_node_set_raw& ns, xml_node_struct* n, xpath_allocator* alloc, bool once, T) + { + const axis_t axis = T::axis; + + switch (axis) + { + case axis_attribute: + { + for (xml_attribute_struct* a = n->first_attribute; a; a = a->next_attribute) + if (step_push(ns, a, n, alloc) & once) + return; + + break; + } + + case axis_child: + { + for (xml_node_struct* c = n->first_child; c; c = c->next_sibling) + if (step_push(ns, c, alloc) & once) + return; + + break; + } + + case axis_descendant: + case axis_descendant_or_self: + { + if (axis == axis_descendant_or_self) + if (step_push(ns, n, alloc) & once) + return; + + xml_node_struct* cur = n->first_child; + + while (cur) + { + if (step_push(ns, cur, alloc) & once) + return; + + if (cur->first_child) + cur = cur->first_child; + else + { + while (!cur->next_sibling) + { + cur = cur->parent; + + if (cur == n) return; + } + + cur = cur->next_sibling; + } + } + + break; + } + + case axis_following_sibling: + { + for (xml_node_struct* c = n->next_sibling; c; c = c->next_sibling) + if (step_push(ns, c, alloc) & once) + return; + + break; + } + + case axis_preceding_sibling: + { + for (xml_node_struct* c = n->prev_sibling_c; c->next_sibling; c = c->prev_sibling_c) + if (step_push(ns, c, alloc) & once) + return; + + break; + } + + case axis_following: + { + xml_node_struct* cur = n; + + // exit from this node so that we don't include descendants + while (!cur->next_sibling) + { + cur = cur->parent; + + if (!cur) return; + } + + cur = cur->next_sibling; + + while (cur) + { + if (step_push(ns, cur, alloc) & once) + return; + + if (cur->first_child) + cur = cur->first_child; + else + { + while (!cur->next_sibling) + { + cur = cur->parent; + + if (!cur) return; + } + + cur = cur->next_sibling; + } + } + + break; + } + + case axis_preceding: + { + xml_node_struct* cur = n; + + // exit from this node so that we don't include descendants + while (!cur->prev_sibling_c->next_sibling) + { + cur = cur->parent; + + if (!cur) return; + } + + cur = cur->prev_sibling_c; + + while (cur) + { + if (cur->first_child) + cur = cur->first_child->prev_sibling_c; + else + { + // leaf node, can't be ancestor + if (step_push(ns, cur, alloc) & once) + return; + + while (!cur->prev_sibling_c->next_sibling) + { + cur = cur->parent; + + if (!cur) return; + + if (!node_is_ancestor(cur, n)) + if (step_push(ns, cur, alloc) & once) + return; + } + + cur = cur->prev_sibling_c; + } + } + + break; + } + + case axis_ancestor: + case axis_ancestor_or_self: + { + if (axis == axis_ancestor_or_self) + if (step_push(ns, n, alloc) & once) + return; + + xml_node_struct* cur = n->parent; + + while (cur) + { + if (step_push(ns, cur, alloc) & once) + return; + + cur = cur->parent; + } + + break; + } + + case axis_self: + { + step_push(ns, n, alloc); + + break; + } + + case axis_parent: + { + if (n->parent) + step_push(ns, n->parent, alloc); + + break; + } + + default: + assert(false && "Unimplemented axis"); + } + } + + template <class T> void step_fill(xpath_node_set_raw& ns, xml_attribute_struct* a, xml_node_struct* p, xpath_allocator* alloc, bool once, T v) + { + const axis_t axis = T::axis; + + switch (axis) + { + case axis_ancestor: + case axis_ancestor_or_self: + { + if (axis == axis_ancestor_or_self && _test == nodetest_type_node) // reject attributes based on principal node type test + if (step_push(ns, a, p, alloc) & once) + return; + + xml_node_struct* cur = p; + + while (cur) + { + if (step_push(ns, cur, alloc) & once) + return; + + cur = cur->parent; + } + + break; + } + + case axis_descendant_or_self: + case axis_self: + { + if (_test == nodetest_type_node) // reject attributes based on principal node type test + step_push(ns, a, p, alloc); + + break; + } + + case axis_following: + { + xml_node_struct* cur = p; + + while (cur) + { + if (cur->first_child) + cur = cur->first_child; + else + { + while (!cur->next_sibling) + { + cur = cur->parent; + + if (!cur) return; + } + + cur = cur->next_sibling; + } + + if (step_push(ns, cur, alloc) & once) + return; + } + + break; + } + + case axis_parent: + { + step_push(ns, p, alloc); + + break; + } + + case axis_preceding: + { + // preceding:: axis does not include attribute nodes and attribute ancestors (they are the same as parent's ancestors), so we can reuse node preceding + step_fill(ns, p, alloc, once, v); + break; + } + + default: + assert(false && "Unimplemented axis"); + } + } + + template <class T> void step_fill(xpath_node_set_raw& ns, const xpath_node& xn, xpath_allocator* alloc, bool once, T v) + { + const axis_t axis = T::axis; + const bool axis_has_attributes = (axis == axis_ancestor || axis == axis_ancestor_or_self || axis == axis_descendant_or_self || axis == axis_following || axis == axis_parent || axis == axis_preceding || axis == axis_self); + + if (xn.node()) + step_fill(ns, xn.node().internal_object(), alloc, once, v); + else if (axis_has_attributes && xn.attribute() && xn.parent()) + step_fill(ns, xn.attribute().internal_object(), xn.parent().internal_object(), alloc, once, v); + } + + template <class T> xpath_node_set_raw step_do(const xpath_context& c, const xpath_stack& stack, nodeset_eval_t eval, T v) + { + const axis_t axis = T::axis; + const bool axis_reverse = (axis == axis_ancestor || axis == axis_ancestor_or_self || axis == axis_preceding || axis == axis_preceding_sibling); + const xpath_node_set::type_t axis_type = axis_reverse ? xpath_node_set::type_sorted_reverse : xpath_node_set::type_sorted; + + bool once = + (axis == axis_attribute && _test == nodetest_name) || + (!_right && eval_once(axis_type, eval)) || + (_right && !_right->_next && _right->_test == predicate_constant_one); + + xpath_node_set_raw ns; + ns.set_type(axis_type); + + if (_left) + { + xpath_node_set_raw s = _left->eval_node_set(c, stack, nodeset_eval_all); + + // self axis preserves the original order + if (axis == axis_self) ns.set_type(s.type()); + + for (const xpath_node* it = s.begin(); it != s.end(); ++it) + { + size_t size = ns.size(); + + // in general, all axes generate elements in a particular order, but there is no order guarantee if axis is applied to two nodes + if (axis != axis_self && size != 0) ns.set_type(xpath_node_set::type_unsorted); + + step_fill(ns, *it, stack.result, once, v); + if (_right) apply_predicates(ns, size, stack, eval); + } + } + else + { + step_fill(ns, c.n, stack.result, once, v); + if (_right) apply_predicates(ns, 0, stack, eval); + } + + // child, attribute and self axes always generate unique set of nodes + // for other axis, if the set stayed sorted, it stayed unique because the traversal algorithms do not visit the same node twice + if (axis != axis_child && axis != axis_attribute && axis != axis_self && ns.type() == xpath_node_set::type_unsorted) + ns.remove_duplicates(); + + return ns; + } + + public: + xpath_ast_node(ast_type_t type, xpath_value_type rettype_, const char_t* value): + _type(static_cast<char>(type)), _rettype(static_cast<char>(rettype_)), _axis(0), _test(0), _left(0), _right(0), _next(0) + { + assert(type == ast_string_constant); + _data.string = value; + } + + xpath_ast_node(ast_type_t type, xpath_value_type rettype_, double value): + _type(static_cast<char>(type)), _rettype(static_cast<char>(rettype_)), _axis(0), _test(0), _left(0), _right(0), _next(0) + { + assert(type == ast_number_constant); + _data.number = value; + } + + xpath_ast_node(ast_type_t type, xpath_value_type rettype_, xpath_variable* value): + _type(static_cast<char>(type)), _rettype(static_cast<char>(rettype_)), _axis(0), _test(0), _left(0), _right(0), _next(0) + { + assert(type == ast_variable); + _data.variable = value; + } + + xpath_ast_node(ast_type_t type, xpath_value_type rettype_, xpath_ast_node* left = 0, xpath_ast_node* right = 0): + _type(static_cast<char>(type)), _rettype(static_cast<char>(rettype_)), _axis(0), _test(0), _left(left), _right(right), _next(0) + { + } + + xpath_ast_node(ast_type_t type, xpath_ast_node* left, axis_t axis, nodetest_t test, const char_t* contents): + _type(static_cast<char>(type)), _rettype(xpath_type_node_set), _axis(static_cast<char>(axis)), _test(static_cast<char>(test)), _left(left), _right(0), _next(0) + { + assert(type == ast_step); + _data.nodetest = contents; + } + + xpath_ast_node(ast_type_t type, xpath_ast_node* left, xpath_ast_node* right, predicate_t test): + _type(static_cast<char>(type)), _rettype(xpath_type_node_set), _axis(0), _test(static_cast<char>(test)), _left(left), _right(right), _next(0) + { + assert(type == ast_filter || type == ast_predicate); + } + + void set_next(xpath_ast_node* value) + { + _next = value; + } + + void set_right(xpath_ast_node* value) + { + _right = value; + } + + bool eval_boolean(const xpath_context& c, const xpath_stack& stack) + { + switch (_type) + { + case ast_op_or: + return _left->eval_boolean(c, stack) || _right->eval_boolean(c, stack); + + case ast_op_and: + return _left->eval_boolean(c, stack) && _right->eval_boolean(c, stack); + + case ast_op_equal: + return compare_eq(_left, _right, c, stack, equal_to()); + + case ast_op_not_equal: + return compare_eq(_left, _right, c, stack, not_equal_to()); + + case ast_op_less: + return compare_rel(_left, _right, c, stack, less()); + + case ast_op_greater: + return compare_rel(_right, _left, c, stack, less()); + + case ast_op_less_or_equal: + return compare_rel(_left, _right, c, stack, less_equal()); + + case ast_op_greater_or_equal: + return compare_rel(_right, _left, c, stack, less_equal()); + + case ast_func_starts_with: + { + xpath_allocator_capture cr(stack.result); + + xpath_string lr = _left->eval_string(c, stack); + xpath_string rr = _right->eval_string(c, stack); + + return starts_with(lr.c_str(), rr.c_str()); + } + + case ast_func_contains: + { + xpath_allocator_capture cr(stack.result); + + xpath_string lr = _left->eval_string(c, stack); + xpath_string rr = _right->eval_string(c, stack); + + return find_substring(lr.c_str(), rr.c_str()) != 0; + } + + case ast_func_boolean: + return _left->eval_boolean(c, stack); + + case ast_func_not: + return !_left->eval_boolean(c, stack); + + case ast_func_true: + return true; + + case ast_func_false: + return false; + + case ast_func_lang: + { + if (c.n.attribute()) return false; + + xpath_allocator_capture cr(stack.result); + + xpath_string lang = _left->eval_string(c, stack); + + for (xml_node n = c.n.node(); n; n = n.parent()) + { + xml_attribute a = n.attribute(PUGIXML_TEXT("xml:lang")); + + if (a) + { + const char_t* value = a.value(); + + // strnicmp / strncasecmp is not portable + for (const char_t* lit = lang.c_str(); *lit; ++lit) + { + if (tolower_ascii(*lit) != tolower_ascii(*value)) return false; + ++value; + } + + return *value == 0 || *value == '-'; + } + } + + return false; + } + + case ast_opt_compare_attribute: + { + const char_t* value = (_right->_type == ast_string_constant) ? _right->_data.string : _right->_data.variable->get_string(); + + xml_attribute attr = c.n.node().attribute(_left->_data.nodetest); + + return attr && strequal(attr.value(), value) && is_xpath_attribute(attr.name()); + } + + case ast_variable: + { + assert(_rettype == _data.variable->type()); + + if (_rettype == xpath_type_boolean) + return _data.variable->get_boolean(); + + // fallthrough to type conversion + } + + default: + { + switch (_rettype) + { + case xpath_type_number: + return convert_number_to_boolean(eval_number(c, stack)); + + case xpath_type_string: + { + xpath_allocator_capture cr(stack.result); + + return !eval_string(c, stack).empty(); + } + + case xpath_type_node_set: + { + xpath_allocator_capture cr(stack.result); + + return !eval_node_set(c, stack, nodeset_eval_any).empty(); + } + + default: + assert(false && "Wrong expression for return type boolean"); + return false; + } + } + } + } + + double eval_number(const xpath_context& c, const xpath_stack& stack) + { + switch (_type) + { + case ast_op_add: + return _left->eval_number(c, stack) + _right->eval_number(c, stack); + + case ast_op_subtract: + return _left->eval_number(c, stack) - _right->eval_number(c, stack); + + case ast_op_multiply: + return _left->eval_number(c, stack) * _right->eval_number(c, stack); + + case ast_op_divide: + return _left->eval_number(c, stack) / _right->eval_number(c, stack); + + case ast_op_mod: + return fmod(_left->eval_number(c, stack), _right->eval_number(c, stack)); + + case ast_op_negate: + return -_left->eval_number(c, stack); + + case ast_number_constant: + return _data.number; + + case ast_func_last: + return static_cast<double>(c.size); + + case ast_func_position: + return static_cast<double>(c.position); + + case ast_func_count: + { + xpath_allocator_capture cr(stack.result); + + return static_cast<double>(_left->eval_node_set(c, stack, nodeset_eval_all).size()); + } + + case ast_func_string_length_0: + { + xpath_allocator_capture cr(stack.result); + + return static_cast<double>(string_value(c.n, stack.result).length()); + } + + case ast_func_string_length_1: + { + xpath_allocator_capture cr(stack.result); + + return static_cast<double>(_left->eval_string(c, stack).length()); + } + + case ast_func_number_0: + { + xpath_allocator_capture cr(stack.result); + + return convert_string_to_number(string_value(c.n, stack.result).c_str()); + } + + case ast_func_number_1: + return _left->eval_number(c, stack); + + case ast_func_sum: + { + xpath_allocator_capture cr(stack.result); + + double r = 0; + + xpath_node_set_raw ns = _left->eval_node_set(c, stack, nodeset_eval_all); + + for (const xpath_node* it = ns.begin(); it != ns.end(); ++it) + { + xpath_allocator_capture cri(stack.result); + + r += convert_string_to_number(string_value(*it, stack.result).c_str()); + } + + return r; + } + + case ast_func_floor: + { + double r = _left->eval_number(c, stack); + + return r == r ? floor(r) : r; + } + + case ast_func_ceiling: + { + double r = _left->eval_number(c, stack); + + return r == r ? ceil(r) : r; + } + + case ast_func_round: + return round_nearest_nzero(_left->eval_number(c, stack)); + + case ast_variable: + { + assert(_rettype == _data.variable->type()); + + if (_rettype == xpath_type_number) + return _data.variable->get_number(); + + // fallthrough to type conversion + } + + default: + { + switch (_rettype) + { + case xpath_type_boolean: + return eval_boolean(c, stack) ? 1 : 0; + + case xpath_type_string: + { + xpath_allocator_capture cr(stack.result); + + return convert_string_to_number(eval_string(c, stack).c_str()); + } + + case xpath_type_node_set: + { + xpath_allocator_capture cr(stack.result); + + return convert_string_to_number(eval_string(c, stack).c_str()); + } + + default: + assert(false && "Wrong expression for return type number"); + return 0; + } + + } + } + } + + xpath_string eval_string_concat(const xpath_context& c, const xpath_stack& stack) + { + assert(_type == ast_func_concat); + + xpath_allocator_capture ct(stack.temp); + + // count the string number + size_t count = 1; + for (xpath_ast_node* nc = _right; nc; nc = nc->_next) count++; + + // gather all strings + xpath_string static_buffer[4]; + xpath_string* buffer = static_buffer; + + // allocate on-heap for large concats + if (count > sizeof(static_buffer) / sizeof(static_buffer[0])) + { + buffer = static_cast<xpath_string*>(stack.temp->allocate(count * sizeof(xpath_string))); + assert(buffer); + } + + // evaluate all strings to temporary stack + xpath_stack swapped_stack = {stack.temp, stack.result}; + + buffer[0] = _left->eval_string(c, swapped_stack); + + size_t pos = 1; + for (xpath_ast_node* n = _right; n; n = n->_next, ++pos) buffer[pos] = n->eval_string(c, swapped_stack); + assert(pos == count); + + // get total length + size_t length = 0; + for (size_t i = 0; i < count; ++i) length += buffer[i].length(); + + // create final string + char_t* result = static_cast<char_t*>(stack.result->allocate((length + 1) * sizeof(char_t))); + assert(result); + + char_t* ri = result; + + for (size_t j = 0; j < count; ++j) + for (const char_t* bi = buffer[j].c_str(); *bi; ++bi) + *ri++ = *bi; + + *ri = 0; + + return xpath_string::from_heap_preallocated(result, ri); + } + + xpath_string eval_string(const xpath_context& c, const xpath_stack& stack) + { + switch (_type) + { + case ast_string_constant: + return xpath_string::from_const(_data.string); + + case ast_func_local_name_0: + { + xpath_node na = c.n; + + return xpath_string::from_const(local_name(na)); + } + + case ast_func_local_name_1: + { + xpath_allocator_capture cr(stack.result); + + xpath_node_set_raw ns = _left->eval_node_set(c, stack, nodeset_eval_first); + xpath_node na = ns.first(); + + return xpath_string::from_const(local_name(na)); + } + + case ast_func_name_0: + { + xpath_node na = c.n; + + return xpath_string::from_const(qualified_name(na)); + } + + case ast_func_name_1: + { + xpath_allocator_capture cr(stack.result); + + xpath_node_set_raw ns = _left->eval_node_set(c, stack, nodeset_eval_first); + xpath_node na = ns.first(); + + return xpath_string::from_const(qualified_name(na)); + } + + case ast_func_namespace_uri_0: + { + xpath_node na = c.n; + + return xpath_string::from_const(namespace_uri(na)); + } + + case ast_func_namespace_uri_1: + { + xpath_allocator_capture cr(stack.result); + + xpath_node_set_raw ns = _left->eval_node_set(c, stack, nodeset_eval_first); + xpath_node na = ns.first(); + + return xpath_string::from_const(namespace_uri(na)); + } + + case ast_func_string_0: + return string_value(c.n, stack.result); + + case ast_func_string_1: + return _left->eval_string(c, stack); + + case ast_func_concat: + return eval_string_concat(c, stack); + + case ast_func_substring_before: + { + xpath_allocator_capture cr(stack.temp); + + xpath_stack swapped_stack = {stack.temp, stack.result}; + + xpath_string s = _left->eval_string(c, swapped_stack); + xpath_string p = _right->eval_string(c, swapped_stack); + + const char_t* pos = find_substring(s.c_str(), p.c_str()); + + return pos ? xpath_string::from_heap(s.c_str(), pos, stack.result) : xpath_string(); + } + + case ast_func_substring_after: + { + xpath_allocator_capture cr(stack.temp); + + xpath_stack swapped_stack = {stack.temp, stack.result}; + + xpath_string s = _left->eval_string(c, swapped_stack); + xpath_string p = _right->eval_string(c, swapped_stack); + + const char_t* pos = find_substring(s.c_str(), p.c_str()); + if (!pos) return xpath_string(); + + const char_t* rbegin = pos + p.length(); + const char_t* rend = s.c_str() + s.length(); + + return s.uses_heap() ? xpath_string::from_heap(rbegin, rend, stack.result) : xpath_string::from_const(rbegin); + } + + case ast_func_substring_2: + { + xpath_allocator_capture cr(stack.temp); + + xpath_stack swapped_stack = {stack.temp, stack.result}; + + xpath_string s = _left->eval_string(c, swapped_stack); + size_t s_length = s.length(); + + double first = round_nearest(_right->eval_number(c, stack)); + + if (is_nan(first)) return xpath_string(); // NaN + else if (first >= s_length + 1) return xpath_string(); + + size_t pos = first < 1 ? 1 : static_cast<size_t>(first); + assert(1 <= pos && pos <= s_length + 1); + + const char_t* rbegin = s.c_str() + (pos - 1); + const char_t* rend = s.c_str() + s.length(); + + return s.uses_heap() ? xpath_string::from_heap(rbegin, rend, stack.result) : xpath_string::from_const(rbegin); + } + + case ast_func_substring_3: + { + xpath_allocator_capture cr(stack.temp); + + xpath_stack swapped_stack = {stack.temp, stack.result}; + + xpath_string s = _left->eval_string(c, swapped_stack); + size_t s_length = s.length(); + + double first = round_nearest(_right->eval_number(c, stack)); + double last = first + round_nearest(_right->_next->eval_number(c, stack)); + + if (is_nan(first) || is_nan(last)) return xpath_string(); + else if (first >= s_length + 1) return xpath_string(); + else if (first >= last) return xpath_string(); + else if (last < 1) return xpath_string(); + + size_t pos = first < 1 ? 1 : static_cast<size_t>(first); + size_t end = last >= s_length + 1 ? s_length + 1 : static_cast<size_t>(last); + + assert(1 <= pos && pos <= end && end <= s_length + 1); + const char_t* rbegin = s.c_str() + (pos - 1); + const char_t* rend = s.c_str() + (end - 1); + + return (end == s_length + 1 && !s.uses_heap()) ? xpath_string::from_const(rbegin) : xpath_string::from_heap(rbegin, rend, stack.result); + } + + case ast_func_normalize_space_0: + { + xpath_string s = string_value(c.n, stack.result); + + char_t* begin = s.data(stack.result); + char_t* end = normalize_space(begin); + + return xpath_string::from_heap_preallocated(begin, end); + } + + case ast_func_normalize_space_1: + { + xpath_string s = _left->eval_string(c, stack); + + char_t* begin = s.data(stack.result); + char_t* end = normalize_space(begin); + + return xpath_string::from_heap_preallocated(begin, end); + } + + case ast_func_translate: + { + xpath_allocator_capture cr(stack.temp); + + xpath_stack swapped_stack = {stack.temp, stack.result}; + + xpath_string s = _left->eval_string(c, stack); + xpath_string from = _right->eval_string(c, swapped_stack); + xpath_string to = _right->_next->eval_string(c, swapped_stack); + + char_t* begin = s.data(stack.result); + char_t* end = translate(begin, from.c_str(), to.c_str(), to.length()); + + return xpath_string::from_heap_preallocated(begin, end); + } + + case ast_opt_translate_table: + { + xpath_string s = _left->eval_string(c, stack); + + char_t* begin = s.data(stack.result); + char_t* end = translate_table(begin, _data.table); + + return xpath_string::from_heap_preallocated(begin, end); + } + + case ast_variable: + { + assert(_rettype == _data.variable->type()); + + if (_rettype == xpath_type_string) + return xpath_string::from_const(_data.variable->get_string()); + + // fallthrough to type conversion + } + + default: + { + switch (_rettype) + { + case xpath_type_boolean: + return xpath_string::from_const(eval_boolean(c, stack) ? PUGIXML_TEXT("true") : PUGIXML_TEXT("false")); + + case xpath_type_number: + return convert_number_to_string(eval_number(c, stack), stack.result); + + case xpath_type_node_set: + { + xpath_allocator_capture cr(stack.temp); + + xpath_stack swapped_stack = {stack.temp, stack.result}; + + xpath_node_set_raw ns = eval_node_set(c, swapped_stack, nodeset_eval_first); + return ns.empty() ? xpath_string() : string_value(ns.first(), stack.result); + } + + default: + assert(false && "Wrong expression for return type string"); + return xpath_string(); + } + } + } + } + + xpath_node_set_raw eval_node_set(const xpath_context& c, const xpath_stack& stack, nodeset_eval_t eval) + { + switch (_type) + { + case ast_op_union: + { + xpath_allocator_capture cr(stack.temp); + + xpath_stack swapped_stack = {stack.temp, stack.result}; + + xpath_node_set_raw ls = _left->eval_node_set(c, swapped_stack, eval); + xpath_node_set_raw rs = _right->eval_node_set(c, stack, eval); + + // we can optimize merging two sorted sets, but this is a very rare operation, so don't bother + rs.set_type(xpath_node_set::type_unsorted); + + rs.append(ls.begin(), ls.end(), stack.result); + rs.remove_duplicates(); + + return rs; + } + + case ast_filter: + { + xpath_node_set_raw set = _left->eval_node_set(c, stack, _test == predicate_constant_one ? nodeset_eval_first : nodeset_eval_all); + + // either expression is a number or it contains position() call; sort by document order + if (_test != predicate_posinv) set.sort_do(); + + bool once = eval_once(set.type(), eval); + + apply_predicate(set, 0, stack, once); + + return set; + } + + case ast_func_id: + return xpath_node_set_raw(); + + case ast_step: + { + switch (_axis) + { + case axis_ancestor: + return step_do(c, stack, eval, axis_to_type<axis_ancestor>()); + + case axis_ancestor_or_self: + return step_do(c, stack, eval, axis_to_type<axis_ancestor_or_self>()); + + case axis_attribute: + return step_do(c, stack, eval, axis_to_type<axis_attribute>()); + + case axis_child: + return step_do(c, stack, eval, axis_to_type<axis_child>()); + + case axis_descendant: + return step_do(c, stack, eval, axis_to_type<axis_descendant>()); + + case axis_descendant_or_self: + return step_do(c, stack, eval, axis_to_type<axis_descendant_or_self>()); + + case axis_following: + return step_do(c, stack, eval, axis_to_type<axis_following>()); + + case axis_following_sibling: + return step_do(c, stack, eval, axis_to_type<axis_following_sibling>()); + + case axis_namespace: + // namespaced axis is not supported + return xpath_node_set_raw(); + + case axis_parent: + return step_do(c, stack, eval, axis_to_type<axis_parent>()); + + case axis_preceding: + return step_do(c, stack, eval, axis_to_type<axis_preceding>()); + + case axis_preceding_sibling: + return step_do(c, stack, eval, axis_to_type<axis_preceding_sibling>()); + + case axis_self: + return step_do(c, stack, eval, axis_to_type<axis_self>()); + + default: + assert(false && "Unknown axis"); + return xpath_node_set_raw(); + } + } + + case ast_step_root: + { + assert(!_right); // root step can't have any predicates + + xpath_node_set_raw ns; + + ns.set_type(xpath_node_set::type_sorted); + + if (c.n.node()) ns.push_back(c.n.node().root(), stack.result); + else if (c.n.attribute()) ns.push_back(c.n.parent().root(), stack.result); + + return ns; + } + + case ast_variable: + { + assert(_rettype == _data.variable->type()); + + if (_rettype == xpath_type_node_set) + { + const xpath_node_set& s = _data.variable->get_node_set(); + + xpath_node_set_raw ns; + + ns.set_type(s.type()); + ns.append(s.begin(), s.end(), stack.result); + + return ns; + } + + // fallthrough to type conversion + } + + default: + assert(false && "Wrong expression for return type node set"); + return xpath_node_set_raw(); + } + } + + void optimize(xpath_allocator* alloc) + { + if (_left) + _left->optimize(alloc); + + if (_right) + _right->optimize(alloc); + + if (_next) + _next->optimize(alloc); + + optimize_self(alloc); + } + + void optimize_self(xpath_allocator* alloc) + { + // Rewrite [position()=expr] with [expr] + // Note that this step has to go before classification to recognize [position()=1] + if ((_type == ast_filter || _type == ast_predicate) && + _right->_type == ast_op_equal && _right->_left->_type == ast_func_position && _right->_right->_rettype == xpath_type_number) + { + _right = _right->_right; + } + + // Classify filter/predicate ops to perform various optimizations during evaluation + if (_type == ast_filter || _type == ast_predicate) + { + assert(_test == predicate_default); + + if (_right->_type == ast_number_constant && _right->_data.number == 1.0) + _test = predicate_constant_one; + else if (_right->_rettype == xpath_type_number && (_right->_type == ast_number_constant || _right->_type == ast_variable || _right->_type == ast_func_last)) + _test = predicate_constant; + else if (_right->_rettype != xpath_type_number && _right->is_posinv_expr()) + _test = predicate_posinv; + } + + // Rewrite descendant-or-self::node()/child::foo with descendant::foo + // The former is a full form of //foo, the latter is much faster since it executes the node test immediately + // Do a similar kind of rewrite for self/descendant/descendant-or-self axes + // Note that we only rewrite positionally invariant steps (//foo[1] != /descendant::foo[1]) + if (_type == ast_step && (_axis == axis_child || _axis == axis_self || _axis == axis_descendant || _axis == axis_descendant_or_self) && _left && + _left->_type == ast_step && _left->_axis == axis_descendant_or_self && _left->_test == nodetest_type_node && !_left->_right && + is_posinv_step()) + { + if (_axis == axis_child || _axis == axis_descendant) + _axis = axis_descendant; + else + _axis = axis_descendant_or_self; + + _left = _left->_left; + } + + // Use optimized lookup table implementation for translate() with constant arguments + if (_type == ast_func_translate && _right->_type == ast_string_constant && _right->_next->_type == ast_string_constant) + { + unsigned char* table = translate_table_generate(alloc, _right->_data.string, _right->_next->_data.string); + + if (table) + { + _type = ast_opt_translate_table; + _data.table = table; + } + } + + // Use optimized path for @attr = 'value' or @attr = $value + if (_type == ast_op_equal && + _left->_type == ast_step && _left->_axis == axis_attribute && _left->_test == nodetest_name && !_left->_left && !_left->_right && + (_right->_type == ast_string_constant || (_right->_type == ast_variable && _right->_rettype == xpath_type_string))) + { + _type = ast_opt_compare_attribute; + } + } + + bool is_posinv_expr() const + { + switch (_type) + { + case ast_func_position: + case ast_func_last: + return false; + + case ast_string_constant: + case ast_number_constant: + case ast_variable: + return true; + + case ast_step: + case ast_step_root: + return true; + + case ast_predicate: + case ast_filter: + return true; + + default: + if (_left && !_left->is_posinv_expr()) return false; + + for (xpath_ast_node* n = _right; n; n = n->_next) + if (!n->is_posinv_expr()) return false; + + return true; + } + } + + bool is_posinv_step() const + { + assert(_type == ast_step); + + for (xpath_ast_node* n = _right; n; n = n->_next) + { + assert(n->_type == ast_predicate); + + if (n->_test != predicate_posinv) + return false; + } + + return true; + } + + xpath_value_type rettype() const + { + return static_cast<xpath_value_type>(_rettype); + } + }; + + struct xpath_parser + { + xpath_allocator* _alloc; + xpath_lexer _lexer; + + const char_t* _query; + xpath_variable_set* _variables; + + xpath_parse_result* _result; + + char_t _scratch[32]; + + #ifdef PUGIXML_NO_EXCEPTIONS + jmp_buf _error_handler; + #endif + + void throw_error(const char* message) + { + _result->error = message; + _result->offset = _lexer.current_pos() - _query; + + #ifdef PUGIXML_NO_EXCEPTIONS + longjmp(_error_handler, 1); + #else + throw xpath_exception(*_result); + #endif + } + + void throw_error_oom() + { + #ifdef PUGIXML_NO_EXCEPTIONS + throw_error("Out of memory"); + #else + throw std::bad_alloc(); + #endif + } + + void* alloc_node() + { + void* result = _alloc->allocate_nothrow(sizeof(xpath_ast_node)); + + if (!result) throw_error_oom(); + + return result; + } + + const char_t* alloc_string(const xpath_lexer_string& value) + { + if (value.begin) + { + size_t length = static_cast<size_t>(value.end - value.begin); + + char_t* c = static_cast<char_t*>(_alloc->allocate_nothrow((length + 1) * sizeof(char_t))); + if (!c) throw_error_oom(); + assert(c); // workaround for clang static analysis + + memcpy(c, value.begin, length * sizeof(char_t)); + c[length] = 0; + + return c; + } + else return 0; + } + + xpath_ast_node* parse_function_helper(ast_type_t type0, ast_type_t type1, size_t argc, xpath_ast_node* args[2]) + { + assert(argc <= 1); + + if (argc == 1 && args[0]->rettype() != xpath_type_node_set) + throw_error("Function has to be applied to node set"); + + return new (alloc_node()) xpath_ast_node(argc == 0 ? type0 : type1, xpath_type_string, args[0]); + } + + xpath_ast_node* parse_function(const xpath_lexer_string& name, size_t argc, xpath_ast_node* args[2]) + { + switch (name.begin[0]) + { + case 'b': + if (name == PUGIXML_TEXT("boolean") && argc == 1) + return new (alloc_node()) xpath_ast_node(ast_func_boolean, xpath_type_boolean, args[0]); + + break; + + case 'c': + if (name == PUGIXML_TEXT("count") && argc == 1) + { + if (args[0]->rettype() != xpath_type_node_set) + throw_error("Function has to be applied to node set"); + + return new (alloc_node()) xpath_ast_node(ast_func_count, xpath_type_number, args[0]); + } + else if (name == PUGIXML_TEXT("contains") && argc == 2) + return new (alloc_node()) xpath_ast_node(ast_func_contains, xpath_type_boolean, args[0], args[1]); + else if (name == PUGIXML_TEXT("concat") && argc >= 2) + return new (alloc_node()) xpath_ast_node(ast_func_concat, xpath_type_string, args[0], args[1]); + else if (name == PUGIXML_TEXT("ceiling") && argc == 1) + return new (alloc_node()) xpath_ast_node(ast_func_ceiling, xpath_type_number, args[0]); + + break; + + case 'f': + if (name == PUGIXML_TEXT("false") && argc == 0) + return new (alloc_node()) xpath_ast_node(ast_func_false, xpath_type_boolean); + else if (name == PUGIXML_TEXT("floor") && argc == 1) + return new (alloc_node()) xpath_ast_node(ast_func_floor, xpath_type_number, args[0]); + + break; + + case 'i': + if (name == PUGIXML_TEXT("id") && argc == 1) + return new (alloc_node()) xpath_ast_node(ast_func_id, xpath_type_node_set, args[0]); + + break; + + case 'l': + if (name == PUGIXML_TEXT("last") && argc == 0) + return new (alloc_node()) xpath_ast_node(ast_func_last, xpath_type_number); + else if (name == PUGIXML_TEXT("lang") && argc == 1) + return new (alloc_node()) xpath_ast_node(ast_func_lang, xpath_type_boolean, args[0]); + else if (name == PUGIXML_TEXT("local-name") && argc <= 1) + return parse_function_helper(ast_func_local_name_0, ast_func_local_name_1, argc, args); + + break; + + case 'n': + if (name == PUGIXML_TEXT("name") && argc <= 1) + return parse_function_helper(ast_func_name_0, ast_func_name_1, argc, args); + else if (name == PUGIXML_TEXT("namespace-uri") && argc <= 1) + return parse_function_helper(ast_func_namespace_uri_0, ast_func_namespace_uri_1, argc, args); + else if (name == PUGIXML_TEXT("normalize-space") && argc <= 1) + return new (alloc_node()) xpath_ast_node(argc == 0 ? ast_func_normalize_space_0 : ast_func_normalize_space_1, xpath_type_string, args[0], args[1]); + else if (name == PUGIXML_TEXT("not") && argc == 1) + return new (alloc_node()) xpath_ast_node(ast_func_not, xpath_type_boolean, args[0]); + else if (name == PUGIXML_TEXT("number") && argc <= 1) + return new (alloc_node()) xpath_ast_node(argc == 0 ? ast_func_number_0 : ast_func_number_1, xpath_type_number, args[0]); + + break; + + case 'p': + if (name == PUGIXML_TEXT("position") && argc == 0) + return new (alloc_node()) xpath_ast_node(ast_func_position, xpath_type_number); + + break; + + case 'r': + if (name == PUGIXML_TEXT("round") && argc == 1) + return new (alloc_node()) xpath_ast_node(ast_func_round, xpath_type_number, args[0]); + + break; + + case 's': + if (name == PUGIXML_TEXT("string") && argc <= 1) + return new (alloc_node()) xpath_ast_node(argc == 0 ? ast_func_string_0 : ast_func_string_1, xpath_type_string, args[0]); + else if (name == PUGIXML_TEXT("string-length") && argc <= 1) + return new (alloc_node()) xpath_ast_node(argc == 0 ? ast_func_string_length_0 : ast_func_string_length_1, xpath_type_number, args[0]); + else if (name == PUGIXML_TEXT("starts-with") && argc == 2) + return new (alloc_node()) xpath_ast_node(ast_func_starts_with, xpath_type_boolean, args[0], args[1]); + else if (name == PUGIXML_TEXT("substring-before") && argc == 2) + return new (alloc_node()) xpath_ast_node(ast_func_substring_before, xpath_type_string, args[0], args[1]); + else if (name == PUGIXML_TEXT("substring-after") && argc == 2) + return new (alloc_node()) xpath_ast_node(ast_func_substring_after, xpath_type_string, args[0], args[1]); + else if (name == PUGIXML_TEXT("substring") && (argc == 2 || argc == 3)) + return new (alloc_node()) xpath_ast_node(argc == 2 ? ast_func_substring_2 : ast_func_substring_3, xpath_type_string, args[0], args[1]); + else if (name == PUGIXML_TEXT("sum") && argc == 1) + { + if (args[0]->rettype() != xpath_type_node_set) throw_error("Function has to be applied to node set"); + return new (alloc_node()) xpath_ast_node(ast_func_sum, xpath_type_number, args[0]); + } + + break; + + case 't': + if (name == PUGIXML_TEXT("translate") && argc == 3) + return new (alloc_node()) xpath_ast_node(ast_func_translate, xpath_type_string, args[0], args[1]); + else if (name == PUGIXML_TEXT("true") && argc == 0) + return new (alloc_node()) xpath_ast_node(ast_func_true, xpath_type_boolean); + + break; + + default: + break; + } + + throw_error("Unrecognized function or wrong parameter count"); + + return 0; + } + + axis_t parse_axis_name(const xpath_lexer_string& name, bool& specified) + { + specified = true; + + switch (name.begin[0]) + { + case 'a': + if (name == PUGIXML_TEXT("ancestor")) + return axis_ancestor; + else if (name == PUGIXML_TEXT("ancestor-or-self")) + return axis_ancestor_or_self; + else if (name == PUGIXML_TEXT("attribute")) + return axis_attribute; + + break; + + case 'c': + if (name == PUGIXML_TEXT("child")) + return axis_child; + + break; + + case 'd': + if (name == PUGIXML_TEXT("descendant")) + return axis_descendant; + else if (name == PUGIXML_TEXT("descendant-or-self")) + return axis_descendant_or_self; + + break; + + case 'f': + if (name == PUGIXML_TEXT("following")) + return axis_following; + else if (name == PUGIXML_TEXT("following-sibling")) + return axis_following_sibling; + + break; + + case 'n': + if (name == PUGIXML_TEXT("namespace")) + return axis_namespace; + + break; + + case 'p': + if (name == PUGIXML_TEXT("parent")) + return axis_parent; + else if (name == PUGIXML_TEXT("preceding")) + return axis_preceding; + else if (name == PUGIXML_TEXT("preceding-sibling")) + return axis_preceding_sibling; + + break; + + case 's': + if (name == PUGIXML_TEXT("self")) + return axis_self; + + break; + + default: + break; + } + + specified = false; + return axis_child; + } + + nodetest_t parse_node_test_type(const xpath_lexer_string& name) + { + switch (name.begin[0]) + { + case 'c': + if (name == PUGIXML_TEXT("comment")) + return nodetest_type_comment; + + break; + + case 'n': + if (name == PUGIXML_TEXT("node")) + return nodetest_type_node; + + break; + + case 'p': + if (name == PUGIXML_TEXT("processing-instruction")) + return nodetest_type_pi; + + break; + + case 't': + if (name == PUGIXML_TEXT("text")) + return nodetest_type_text; + + break; + + default: + break; + } + + return nodetest_none; + } + + // PrimaryExpr ::= VariableReference | '(' Expr ')' | Literal | Number | FunctionCall + xpath_ast_node* parse_primary_expression() + { + switch (_lexer.current()) + { + case lex_var_ref: + { + xpath_lexer_string name = _lexer.contents(); + + if (!_variables) + throw_error("Unknown variable: variable set is not provided"); + + xpath_variable* var = 0; + if (!get_variable_scratch(_scratch, _variables, name.begin, name.end, &var)) + throw_error_oom(); + + if (!var) + throw_error("Unknown variable: variable set does not contain the given name"); + + _lexer.next(); + + return new (alloc_node()) xpath_ast_node(ast_variable, var->type(), var); + } + + case lex_open_brace: + { + _lexer.next(); + + xpath_ast_node* n = parse_expression(); + + if (_lexer.current() != lex_close_brace) + throw_error("Unmatched braces"); + + _lexer.next(); + + return n; + } + + case lex_quoted_string: + { + const char_t* value = alloc_string(_lexer.contents()); + + xpath_ast_node* n = new (alloc_node()) xpath_ast_node(ast_string_constant, xpath_type_string, value); + _lexer.next(); + + return n; + } + + case lex_number: + { + double value = 0; + + if (!convert_string_to_number_scratch(_scratch, _lexer.contents().begin, _lexer.contents().end, &value)) + throw_error_oom(); + + xpath_ast_node* n = new (alloc_node()) xpath_ast_node(ast_number_constant, xpath_type_number, value); + _lexer.next(); + + return n; + } + + case lex_string: + { + xpath_ast_node* args[2] = {0}; + size_t argc = 0; + + xpath_lexer_string function = _lexer.contents(); + _lexer.next(); + + xpath_ast_node* last_arg = 0; + + if (_lexer.current() != lex_open_brace) + throw_error("Unrecognized function call"); + _lexer.next(); + + if (_lexer.current() != lex_close_brace) + args[argc++] = parse_expression(); + + while (_lexer.current() != lex_close_brace) + { + if (_lexer.current() != lex_comma) + throw_error("No comma between function arguments"); + _lexer.next(); + + xpath_ast_node* n = parse_expression(); + + if (argc < 2) args[argc] = n; + else last_arg->set_next(n); + + argc++; + last_arg = n; + } + + _lexer.next(); + + return parse_function(function, argc, args); + } + + default: + throw_error("Unrecognizable primary expression"); + + return 0; + } + } + + // FilterExpr ::= PrimaryExpr | FilterExpr Predicate + // Predicate ::= '[' PredicateExpr ']' + // PredicateExpr ::= Expr + xpath_ast_node* parse_filter_expression() + { + xpath_ast_node* n = parse_primary_expression(); + + while (_lexer.current() == lex_open_square_brace) + { + _lexer.next(); + + xpath_ast_node* expr = parse_expression(); + + if (n->rettype() != xpath_type_node_set) + throw_error("Predicate has to be applied to node set"); + + n = new (alloc_node()) xpath_ast_node(ast_filter, n, expr, predicate_default); + + if (_lexer.current() != lex_close_square_brace) + throw_error("Unmatched square brace"); + + _lexer.next(); + } + + return n; + } + + // Step ::= AxisSpecifier NodeTest Predicate* | AbbreviatedStep + // AxisSpecifier ::= AxisName '::' | '@'? + // NodeTest ::= NameTest | NodeType '(' ')' | 'processing-instruction' '(' Literal ')' + // NameTest ::= '*' | NCName ':' '*' | QName + // AbbreviatedStep ::= '.' | '..' + xpath_ast_node* parse_step(xpath_ast_node* set) + { + if (set && set->rettype() != xpath_type_node_set) + throw_error("Step has to be applied to node set"); + + bool axis_specified = false; + axis_t axis = axis_child; // implied child axis + + if (_lexer.current() == lex_axis_attribute) + { + axis = axis_attribute; + axis_specified = true; + + _lexer.next(); + } + else if (_lexer.current() == lex_dot) + { + _lexer.next(); + + return new (alloc_node()) xpath_ast_node(ast_step, set, axis_self, nodetest_type_node, 0); + } + else if (_lexer.current() == lex_double_dot) + { + _lexer.next(); + + return new (alloc_node()) xpath_ast_node(ast_step, set, axis_parent, nodetest_type_node, 0); + } + + nodetest_t nt_type = nodetest_none; + xpath_lexer_string nt_name; + + if (_lexer.current() == lex_string) + { + // node name test + nt_name = _lexer.contents(); + _lexer.next(); + + // was it an axis name? + if (_lexer.current() == lex_double_colon) + { + // parse axis name + if (axis_specified) + throw_error("Two axis specifiers in one step"); + + axis = parse_axis_name(nt_name, axis_specified); + + if (!axis_specified) + throw_error("Unknown axis"); + + // read actual node test + _lexer.next(); + + if (_lexer.current() == lex_multiply) + { + nt_type = nodetest_all; + nt_name = xpath_lexer_string(); + _lexer.next(); + } + else if (_lexer.current() == lex_string) + { + nt_name = _lexer.contents(); + _lexer.next(); + } + else throw_error("Unrecognized node test"); + } + + if (nt_type == nodetest_none) + { + // node type test or processing-instruction + if (_lexer.current() == lex_open_brace) + { + _lexer.next(); + + if (_lexer.current() == lex_close_brace) + { + _lexer.next(); + + nt_type = parse_node_test_type(nt_name); + + if (nt_type == nodetest_none) + throw_error("Unrecognized node type"); + + nt_name = xpath_lexer_string(); + } + else if (nt_name == PUGIXML_TEXT("processing-instruction")) + { + if (_lexer.current() != lex_quoted_string) + throw_error("Only literals are allowed as arguments to processing-instruction()"); + + nt_type = nodetest_pi; + nt_name = _lexer.contents(); + _lexer.next(); + + if (_lexer.current() != lex_close_brace) + throw_error("Unmatched brace near processing-instruction()"); + _lexer.next(); + } + else + { + throw_error("Unmatched brace near node type test"); + } + } + // QName or NCName:* + else + { + if (nt_name.end - nt_name.begin > 2 && nt_name.end[-2] == ':' && nt_name.end[-1] == '*') // NCName:* + { + nt_name.end--; // erase * + + nt_type = nodetest_all_in_namespace; + } + else + { + nt_type = nodetest_name; + } + } + } + } + else if (_lexer.current() == lex_multiply) + { + nt_type = nodetest_all; + _lexer.next(); + } + else + { + throw_error("Unrecognized node test"); + } + + const char_t* nt_name_copy = alloc_string(nt_name); + xpath_ast_node* n = new (alloc_node()) xpath_ast_node(ast_step, set, axis, nt_type, nt_name_copy); + + xpath_ast_node* last = 0; + + while (_lexer.current() == lex_open_square_brace) + { + _lexer.next(); + + xpath_ast_node* expr = parse_expression(); + + xpath_ast_node* pred = new (alloc_node()) xpath_ast_node(ast_predicate, 0, expr, predicate_default); + + if (_lexer.current() != lex_close_square_brace) + throw_error("Unmatched square brace"); + _lexer.next(); + + if (last) last->set_next(pred); + else n->set_right(pred); + + last = pred; + } + + return n; + } + + // RelativeLocationPath ::= Step | RelativeLocationPath '/' Step | RelativeLocationPath '//' Step + xpath_ast_node* parse_relative_location_path(xpath_ast_node* set) + { + xpath_ast_node* n = parse_step(set); + + while (_lexer.current() == lex_slash || _lexer.current() == lex_double_slash) + { + lexeme_t l = _lexer.current(); + _lexer.next(); + + if (l == lex_double_slash) + n = new (alloc_node()) xpath_ast_node(ast_step, n, axis_descendant_or_self, nodetest_type_node, 0); + + n = parse_step(n); + } + + return n; + } + + // LocationPath ::= RelativeLocationPath | AbsoluteLocationPath + // AbsoluteLocationPath ::= '/' RelativeLocationPath? | '//' RelativeLocationPath + xpath_ast_node* parse_location_path() + { + if (_lexer.current() == lex_slash) + { + _lexer.next(); + + xpath_ast_node* n = new (alloc_node()) xpath_ast_node(ast_step_root, xpath_type_node_set); + + // relative location path can start from axis_attribute, dot, double_dot, multiply and string lexemes; any other lexeme means standalone root path + lexeme_t l = _lexer.current(); + + if (l == lex_string || l == lex_axis_attribute || l == lex_dot || l == lex_double_dot || l == lex_multiply) + return parse_relative_location_path(n); + else + return n; + } + else if (_lexer.current() == lex_double_slash) + { + _lexer.next(); + + xpath_ast_node* n = new (alloc_node()) xpath_ast_node(ast_step_root, xpath_type_node_set); + n = new (alloc_node()) xpath_ast_node(ast_step, n, axis_descendant_or_self, nodetest_type_node, 0); + + return parse_relative_location_path(n); + } + + // else clause moved outside of if because of bogus warning 'control may reach end of non-void function being inlined' in gcc 4.0.1 + return parse_relative_location_path(0); + } + + // PathExpr ::= LocationPath + // | FilterExpr + // | FilterExpr '/' RelativeLocationPath + // | FilterExpr '//' RelativeLocationPath + // UnionExpr ::= PathExpr | UnionExpr '|' PathExpr + // UnaryExpr ::= UnionExpr | '-' UnaryExpr + xpath_ast_node* parse_path_or_unary_expression() + { + // Clarification. + // PathExpr begins with either LocationPath or FilterExpr. + // FilterExpr begins with PrimaryExpr + // PrimaryExpr begins with '$' in case of it being a variable reference, + // '(' in case of it being an expression, string literal, number constant or + // function call. + + if (_lexer.current() == lex_var_ref || _lexer.current() == lex_open_brace || + _lexer.current() == lex_quoted_string || _lexer.current() == lex_number || + _lexer.current() == lex_string) + { + if (_lexer.current() == lex_string) + { + // This is either a function call, or not - if not, we shall proceed with location path + const char_t* state = _lexer.state(); + + while (PUGI__IS_CHARTYPE(*state, ct_space)) ++state; + + if (*state != '(') return parse_location_path(); + + // This looks like a function call; however this still can be a node-test. Check it. + if (parse_node_test_type(_lexer.contents()) != nodetest_none) + return parse_location_path(); + } + + xpath_ast_node* n = parse_filter_expression(); + + if (_lexer.current() == lex_slash || _lexer.current() == lex_double_slash) + { + lexeme_t l = _lexer.current(); + _lexer.next(); + + if (l == lex_double_slash) + { + if (n->rettype() != xpath_type_node_set) + throw_error("Step has to be applied to node set"); + + n = new (alloc_node()) xpath_ast_node(ast_step, n, axis_descendant_or_self, nodetest_type_node, 0); + } + + // select from location path + return parse_relative_location_path(n); + } + + return n; + } + else if (_lexer.current() == lex_minus) + { + _lexer.next(); + + // precedence 7+ - only parses union expressions + xpath_ast_node* expr = parse_expression_rec(parse_path_or_unary_expression(), 7); + + return new (alloc_node()) xpath_ast_node(ast_op_negate, xpath_type_number, expr); + } + else + { + return parse_location_path(); + } + } + + struct binary_op_t + { + ast_type_t asttype; + xpath_value_type rettype; + int precedence; + + binary_op_t(): asttype(ast_unknown), rettype(xpath_type_none), precedence(0) + { + } + + binary_op_t(ast_type_t asttype_, xpath_value_type rettype_, int precedence_): asttype(asttype_), rettype(rettype_), precedence(precedence_) + { + } + + static binary_op_t parse(xpath_lexer& lexer) + { + switch (lexer.current()) + { + case lex_string: + if (lexer.contents() == PUGIXML_TEXT("or")) + return binary_op_t(ast_op_or, xpath_type_boolean, 1); + else if (lexer.contents() == PUGIXML_TEXT("and")) + return binary_op_t(ast_op_and, xpath_type_boolean, 2); + else if (lexer.contents() == PUGIXML_TEXT("div")) + return binary_op_t(ast_op_divide, xpath_type_number, 6); + else if (lexer.contents() == PUGIXML_TEXT("mod")) + return binary_op_t(ast_op_mod, xpath_type_number, 6); + else + return binary_op_t(); + + case lex_equal: + return binary_op_t(ast_op_equal, xpath_type_boolean, 3); + + case lex_not_equal: + return binary_op_t(ast_op_not_equal, xpath_type_boolean, 3); + + case lex_less: + return binary_op_t(ast_op_less, xpath_type_boolean, 4); + + case lex_greater: + return binary_op_t(ast_op_greater, xpath_type_boolean, 4); + + case lex_less_or_equal: + return binary_op_t(ast_op_less_or_equal, xpath_type_boolean, 4); + + case lex_greater_or_equal: + return binary_op_t(ast_op_greater_or_equal, xpath_type_boolean, 4); + + case lex_plus: + return binary_op_t(ast_op_add, xpath_type_number, 5); + + case lex_minus: + return binary_op_t(ast_op_subtract, xpath_type_number, 5); + + case lex_multiply: + return binary_op_t(ast_op_multiply, xpath_type_number, 6); + + case lex_union: + return binary_op_t(ast_op_union, xpath_type_node_set, 7); + + default: + return binary_op_t(); + } + } + }; + + xpath_ast_node* parse_expression_rec(xpath_ast_node* lhs, int limit) + { + binary_op_t op = binary_op_t::parse(_lexer); + + while (op.asttype != ast_unknown && op.precedence >= limit) + { + _lexer.next(); + + xpath_ast_node* rhs = parse_path_or_unary_expression(); + + binary_op_t nextop = binary_op_t::parse(_lexer); + + while (nextop.asttype != ast_unknown && nextop.precedence > op.precedence) + { + rhs = parse_expression_rec(rhs, nextop.precedence); + + nextop = binary_op_t::parse(_lexer); + } + + if (op.asttype == ast_op_union && (lhs->rettype() != xpath_type_node_set || rhs->rettype() != xpath_type_node_set)) + throw_error("Union operator has to be applied to node sets"); + + lhs = new (alloc_node()) xpath_ast_node(op.asttype, op.rettype, lhs, rhs); + + op = binary_op_t::parse(_lexer); + } + + return lhs; + } + + // Expr ::= OrExpr + // OrExpr ::= AndExpr | OrExpr 'or' AndExpr + // AndExpr ::= EqualityExpr | AndExpr 'and' EqualityExpr + // EqualityExpr ::= RelationalExpr + // | EqualityExpr '=' RelationalExpr + // | EqualityExpr '!=' RelationalExpr + // RelationalExpr ::= AdditiveExpr + // | RelationalExpr '<' AdditiveExpr + // | RelationalExpr '>' AdditiveExpr + // | RelationalExpr '<=' AdditiveExpr + // | RelationalExpr '>=' AdditiveExpr + // AdditiveExpr ::= MultiplicativeExpr + // | AdditiveExpr '+' MultiplicativeExpr + // | AdditiveExpr '-' MultiplicativeExpr + // MultiplicativeExpr ::= UnaryExpr + // | MultiplicativeExpr '*' UnaryExpr + // | MultiplicativeExpr 'div' UnaryExpr + // | MultiplicativeExpr 'mod' UnaryExpr + xpath_ast_node* parse_expression() + { + return parse_expression_rec(parse_path_or_unary_expression(), 0); + } + + xpath_parser(const char_t* query, xpath_variable_set* variables, xpath_allocator* alloc, xpath_parse_result* result): _alloc(alloc), _lexer(query), _query(query), _variables(variables), _result(result) + { + } + + xpath_ast_node* parse() + { + xpath_ast_node* result = parse_expression(); + + // check if there are unparsed tokens left + if (_lexer.current() != lex_eof) + throw_error("Incorrect query"); + + return result; + } + + static xpath_ast_node* parse(const char_t* query, xpath_variable_set* variables, xpath_allocator* alloc, xpath_parse_result* result) + { + xpath_parser parser(query, variables, alloc, result); + + #ifdef PUGIXML_NO_EXCEPTIONS + int error = setjmp(parser._error_handler); + + return (error == 0) ? parser.parse() : 0; + #else + return parser.parse(); + #endif + } + }; + + struct xpath_query_impl + { + static xpath_query_impl* create() + { + void* memory = xml_memory::allocate(sizeof(xpath_query_impl)); + if (!memory) return 0; + + return new (memory) xpath_query_impl(); + } + + static void destroy(xpath_query_impl* impl) + { + // free all allocated pages + impl->alloc.release(); + + // free allocator memory (with the first page) + xml_memory::deallocate(impl); + } + + xpath_query_impl(): root(0), alloc(&block) + { + block.next = 0; + block.capacity = sizeof(block.data); + } + + xpath_ast_node* root; + xpath_allocator alloc; + xpath_memory_block block; + }; + + PUGI__FN xpath_string evaluate_string_impl(xpath_query_impl* impl, const xpath_node& n, xpath_stack_data& sd) + { + if (!impl) return xpath_string(); + + #ifdef PUGIXML_NO_EXCEPTIONS + if (setjmp(sd.error_handler)) return xpath_string(); + #endif + + xpath_context c(n, 1, 1); + + return impl->root->eval_string(c, sd.stack); + } + + PUGI__FN impl::xpath_ast_node* evaluate_node_set_prepare(xpath_query_impl* impl) + { + if (!impl) return 0; + + if (impl->root->rettype() != xpath_type_node_set) + { + #ifdef PUGIXML_NO_EXCEPTIONS + return 0; + #else + xpath_parse_result res; + res.error = "Expression does not evaluate to node set"; + + throw xpath_exception(res); + #endif + } + + return impl->root; + } +PUGI__NS_END + +namespace pugi +{ +#ifndef PUGIXML_NO_EXCEPTIONS + PUGI__FN xpath_exception::xpath_exception(const xpath_parse_result& result_): _result(result_) + { + assert(_result.error); + } + + PUGI__FN const char* xpath_exception::what() const throw() + { + return _result.error; + } + + PUGI__FN const xpath_parse_result& xpath_exception::result() const + { + return _result; + } +#endif + + PUGI__FN xpath_node::xpath_node() + { + } + + PUGI__FN xpath_node::xpath_node(const xml_node& node_): _node(node_) + { + } + + PUGI__FN xpath_node::xpath_node(const xml_attribute& attribute_, const xml_node& parent_): _node(attribute_ ? parent_ : xml_node()), _attribute(attribute_) + { + } + + PUGI__FN xml_node xpath_node::node() const + { + return _attribute ? xml_node() : _node; + } + + PUGI__FN xml_attribute xpath_node::attribute() const + { + return _attribute; + } + + PUGI__FN xml_node xpath_node::parent() const + { + return _attribute ? _node : _node.parent(); + } + + PUGI__FN static void unspecified_bool_xpath_node(xpath_node***) + { + } + + PUGI__FN xpath_node::operator xpath_node::unspecified_bool_type() const + { + return (_node || _attribute) ? unspecified_bool_xpath_node : 0; + } + + PUGI__FN bool xpath_node::operator!() const + { + return !(_node || _attribute); + } + + PUGI__FN bool xpath_node::operator==(const xpath_node& n) const + { + return _node == n._node && _attribute == n._attribute; + } + + PUGI__FN bool xpath_node::operator!=(const xpath_node& n) const + { + return _node != n._node || _attribute != n._attribute; + } + +#ifdef __BORLANDC__ + PUGI__FN bool operator&&(const xpath_node& lhs, bool rhs) + { + return (bool)lhs && rhs; + } + + PUGI__FN bool operator||(const xpath_node& lhs, bool rhs) + { + return (bool)lhs || rhs; + } +#endif + + PUGI__FN void xpath_node_set::_assign(const_iterator begin_, const_iterator end_, type_t type_) + { + assert(begin_ <= end_); + + size_t size_ = static_cast<size_t>(end_ - begin_); + + if (size_ <= 1) + { + // deallocate old buffer + if (_begin != &_storage) impl::xml_memory::deallocate(_begin); + + // use internal buffer + if (begin_ != end_) _storage = *begin_; + + _begin = &_storage; + _end = &_storage + size_; + _type = type_; + } + else + { + // make heap copy + xpath_node* storage = static_cast<xpath_node*>(impl::xml_memory::allocate(size_ * sizeof(xpath_node))); + + if (!storage) + { + #ifdef PUGIXML_NO_EXCEPTIONS + return; + #else + throw std::bad_alloc(); + #endif + } + + memcpy(storage, begin_, size_ * sizeof(xpath_node)); + + // deallocate old buffer + if (_begin != &_storage) impl::xml_memory::deallocate(_begin); + + // finalize + _begin = storage; + _end = storage + size_; + _type = type_; + } + } + +#ifdef PUGIXML_HAS_MOVE + PUGI__FN void xpath_node_set::_move(xpath_node_set& rhs) + { + _type = rhs._type; + _storage = rhs._storage; + _begin = (rhs._begin == &rhs._storage) ? &_storage : rhs._begin; + _end = _begin + (rhs._end - rhs._begin); + + rhs._type = type_unsorted; + rhs._begin = &rhs._storage; + rhs._end = rhs._begin; + } +#endif + + PUGI__FN xpath_node_set::xpath_node_set(): _type(type_unsorted), _begin(&_storage), _end(&_storage) + { + } + + PUGI__FN xpath_node_set::xpath_node_set(const_iterator begin_, const_iterator end_, type_t type_): _type(type_unsorted), _begin(&_storage), _end(&_storage) + { + _assign(begin_, end_, type_); + } + + PUGI__FN xpath_node_set::~xpath_node_set() + { + if (_begin != &_storage) + impl::xml_memory::deallocate(_begin); + } + + PUGI__FN xpath_node_set::xpath_node_set(const xpath_node_set& ns): _type(type_unsorted), _begin(&_storage), _end(&_storage) + { + _assign(ns._begin, ns._end, ns._type); + } + + PUGI__FN xpath_node_set& xpath_node_set::operator=(const xpath_node_set& ns) + { + if (this == &ns) return *this; + + _assign(ns._begin, ns._end, ns._type); + + return *this; + } + +#ifdef PUGIXML_HAS_MOVE + PUGI__FN xpath_node_set::xpath_node_set(xpath_node_set&& rhs): _type(type_unsorted), _begin(&_storage), _end(&_storage) + { + _move(rhs); + } + + PUGI__FN xpath_node_set& xpath_node_set::operator=(xpath_node_set&& rhs) + { + if (this == &rhs) return *this; + + if (_begin != &_storage) + impl::xml_memory::deallocate(_begin); + + _move(rhs); + + return *this; + } +#endif + + PUGI__FN xpath_node_set::type_t xpath_node_set::type() const + { + return _type; + } + + PUGI__FN size_t xpath_node_set::size() const + { + return _end - _begin; + } + + PUGI__FN bool xpath_node_set::empty() const + { + return _begin == _end; + } + + PUGI__FN const xpath_node& xpath_node_set::operator[](size_t index) const + { + assert(index < size()); + return _begin[index]; + } + + PUGI__FN xpath_node_set::const_iterator xpath_node_set::begin() const + { + return _begin; + } + + PUGI__FN xpath_node_set::const_iterator xpath_node_set::end() const + { + return _end; + } + + PUGI__FN void xpath_node_set::sort(bool reverse) + { + _type = impl::xpath_sort(_begin, _end, _type, reverse); + } + + PUGI__FN xpath_node xpath_node_set::first() const + { + return impl::xpath_first(_begin, _end, _type); + } + + PUGI__FN xpath_parse_result::xpath_parse_result(): error("Internal error"), offset(0) + { + } + + PUGI__FN xpath_parse_result::operator bool() const + { + return error == 0; + } + + PUGI__FN const char* xpath_parse_result::description() const + { + return error ? error : "No error"; + } + + PUGI__FN xpath_variable::xpath_variable(xpath_value_type type_): _type(type_), _next(0) + { + } + + PUGI__FN const char_t* xpath_variable::name() const + { + switch (_type) + { + case xpath_type_node_set: + return static_cast<const impl::xpath_variable_node_set*>(this)->name; + + case xpath_type_number: + return static_cast<const impl::xpath_variable_number*>(this)->name; + + case xpath_type_string: + return static_cast<const impl::xpath_variable_string*>(this)->name; + + case xpath_type_boolean: + return static_cast<const impl::xpath_variable_boolean*>(this)->name; + + default: + assert(false && "Invalid variable type"); + return 0; + } + } + + PUGI__FN xpath_value_type xpath_variable::type() const + { + return _type; + } + + PUGI__FN bool xpath_variable::get_boolean() const + { + return (_type == xpath_type_boolean) ? static_cast<const impl::xpath_variable_boolean*>(this)->value : false; + } + + PUGI__FN double xpath_variable::get_number() const + { + return (_type == xpath_type_number) ? static_cast<const impl::xpath_variable_number*>(this)->value : impl::gen_nan(); + } + + PUGI__FN const char_t* xpath_variable::get_string() const + { + const char_t* value = (_type == xpath_type_string) ? static_cast<const impl::xpath_variable_string*>(this)->value : 0; + return value ? value : PUGIXML_TEXT(""); + } + + PUGI__FN const xpath_node_set& xpath_variable::get_node_set() const + { + return (_type == xpath_type_node_set) ? static_cast<const impl::xpath_variable_node_set*>(this)->value : impl::dummy_node_set; + } + + PUGI__FN bool xpath_variable::set(bool value) + { + if (_type != xpath_type_boolean) return false; + + static_cast<impl::xpath_variable_boolean*>(this)->value = value; + return true; + } + + PUGI__FN bool xpath_variable::set(double value) + { + if (_type != xpath_type_number) return false; + + static_cast<impl::xpath_variable_number*>(this)->value = value; + return true; + } + + PUGI__FN bool xpath_variable::set(const char_t* value) + { + if (_type != xpath_type_string) return false; + + impl::xpath_variable_string* var = static_cast<impl::xpath_variable_string*>(this); + + // duplicate string + size_t size = (impl::strlength(value) + 1) * sizeof(char_t); + + char_t* copy = static_cast<char_t*>(impl::xml_memory::allocate(size)); + if (!copy) return false; + + memcpy(copy, value, size); + + // replace old string + if (var->value) impl::xml_memory::deallocate(var->value); + var->value = copy; + + return true; + } + + PUGI__FN bool xpath_variable::set(const xpath_node_set& value) + { + if (_type != xpath_type_node_set) return false; + + static_cast<impl::xpath_variable_node_set*>(this)->value = value; + return true; + } + + PUGI__FN xpath_variable_set::xpath_variable_set() + { + for (size_t i = 0; i < sizeof(_data) / sizeof(_data[0]); ++i) + _data[i] = 0; + } + + PUGI__FN xpath_variable_set::~xpath_variable_set() + { + for (size_t i = 0; i < sizeof(_data) / sizeof(_data[0]); ++i) + _destroy(_data[i]); + } + + PUGI__FN xpath_variable_set::xpath_variable_set(const xpath_variable_set& rhs) + { + for (size_t i = 0; i < sizeof(_data) / sizeof(_data[0]); ++i) + _data[i] = 0; + + _assign(rhs); + } + + PUGI__FN xpath_variable_set& xpath_variable_set::operator=(const xpath_variable_set& rhs) + { + if (this == &rhs) return *this; + + _assign(rhs); + + return *this; + } + +#ifdef PUGIXML_HAS_MOVE + PUGI__FN xpath_variable_set::xpath_variable_set(xpath_variable_set&& rhs) + { + for (size_t i = 0; i < sizeof(_data) / sizeof(_data[0]); ++i) + { + _data[i] = rhs._data[i]; + rhs._data[i] = 0; + } + } + + PUGI__FN xpath_variable_set& xpath_variable_set::operator=(xpath_variable_set&& rhs) + { + for (size_t i = 0; i < sizeof(_data) / sizeof(_data[0]); ++i) + { + _destroy(_data[i]); + + _data[i] = rhs._data[i]; + rhs._data[i] = 0; + } + + return *this; + } +#endif + + PUGI__FN void xpath_variable_set::_assign(const xpath_variable_set& rhs) + { + xpath_variable_set temp; + + for (size_t i = 0; i < sizeof(_data) / sizeof(_data[0]); ++i) + if (rhs._data[i] && !_clone(rhs._data[i], &temp._data[i])) + return; + + _swap(temp); + } + + PUGI__FN void xpath_variable_set::_swap(xpath_variable_set& rhs) + { + for (size_t i = 0; i < sizeof(_data) / sizeof(_data[0]); ++i) + { + xpath_variable* chain = _data[i]; + + _data[i] = rhs._data[i]; + rhs._data[i] = chain; + } + } + + PUGI__FN xpath_variable* xpath_variable_set::_find(const char_t* name) const + { + const size_t hash_size = sizeof(_data) / sizeof(_data[0]); + size_t hash = impl::hash_string(name) % hash_size; + + // look for existing variable + for (xpath_variable* var = _data[hash]; var; var = var->_next) + if (impl::strequal(var->name(), name)) + return var; + + return 0; + } + + PUGI__FN bool xpath_variable_set::_clone(xpath_variable* var, xpath_variable** out_result) + { + xpath_variable* last = 0; + + while (var) + { + // allocate storage for new variable + xpath_variable* nvar = impl::new_xpath_variable(var->_type, var->name()); + if (!nvar) return false; + + // link the variable to the result immediately to handle failures gracefully + if (last) + last->_next = nvar; + else + *out_result = nvar; + + last = nvar; + + // copy the value; this can fail due to out-of-memory conditions + if (!impl::copy_xpath_variable(nvar, var)) return false; + + var = var->_next; + } + + return true; + } + + PUGI__FN void xpath_variable_set::_destroy(xpath_variable* var) + { + while (var) + { + xpath_variable* next = var->_next; + + impl::delete_xpath_variable(var->_type, var); + + var = next; + } + } + + PUGI__FN xpath_variable* xpath_variable_set::add(const char_t* name, xpath_value_type type) + { + const size_t hash_size = sizeof(_data) / sizeof(_data[0]); + size_t hash = impl::hash_string(name) % hash_size; + + // look for existing variable + for (xpath_variable* var = _data[hash]; var; var = var->_next) + if (impl::strequal(var->name(), name)) + return var->type() == type ? var : 0; + + // add new variable + xpath_variable* result = impl::new_xpath_variable(type, name); + + if (result) + { + result->_next = _data[hash]; + + _data[hash] = result; + } + + return result; + } + + PUGI__FN bool xpath_variable_set::set(const char_t* name, bool value) + { + xpath_variable* var = add(name, xpath_type_boolean); + return var ? var->set(value) : false; + } + + PUGI__FN bool xpath_variable_set::set(const char_t* name, double value) + { + xpath_variable* var = add(name, xpath_type_number); + return var ? var->set(value) : false; + } + + PUGI__FN bool xpath_variable_set::set(const char_t* name, const char_t* value) + { + xpath_variable* var = add(name, xpath_type_string); + return var ? var->set(value) : false; + } + + PUGI__FN bool xpath_variable_set::set(const char_t* name, const xpath_node_set& value) + { + xpath_variable* var = add(name, xpath_type_node_set); + return var ? var->set(value) : false; + } + + PUGI__FN xpath_variable* xpath_variable_set::get(const char_t* name) + { + return _find(name); + } + + PUGI__FN const xpath_variable* xpath_variable_set::get(const char_t* name) const + { + return _find(name); + } + + PUGI__FN xpath_query::xpath_query(const char_t* query, xpath_variable_set* variables): _impl(0) + { + impl::xpath_query_impl* qimpl = impl::xpath_query_impl::create(); + + if (!qimpl) + { + #ifdef PUGIXML_NO_EXCEPTIONS + _result.error = "Out of memory"; + #else + throw std::bad_alloc(); + #endif + } + else + { + using impl::auto_deleter; // MSVC7 workaround + auto_deleter<impl::xpath_query_impl> impl(qimpl, impl::xpath_query_impl::destroy); + + qimpl->root = impl::xpath_parser::parse(query, variables, &qimpl->alloc, &_result); + + if (qimpl->root) + { + qimpl->root->optimize(&qimpl->alloc); + + _impl = impl.release(); + _result.error = 0; + } + } + } + + PUGI__FN xpath_query::xpath_query(): _impl(0) + { + } + + PUGI__FN xpath_query::~xpath_query() + { + if (_impl) + impl::xpath_query_impl::destroy(static_cast<impl::xpath_query_impl*>(_impl)); + } + +#ifdef PUGIXML_HAS_MOVE + PUGI__FN xpath_query::xpath_query(xpath_query&& rhs) + { + _impl = rhs._impl; + _result = rhs._result; + rhs._impl = 0; + rhs._result = xpath_parse_result(); + } + + PUGI__FN xpath_query& xpath_query::operator=(xpath_query&& rhs) + { + if (this == &rhs) return *this; + + if (_impl) + impl::xpath_query_impl::destroy(static_cast<impl::xpath_query_impl*>(_impl)); + + _impl = rhs._impl; + _result = rhs._result; + rhs._impl = 0; + rhs._result = xpath_parse_result(); + + return *this; + } +#endif + + PUGI__FN xpath_value_type xpath_query::return_type() const + { + if (!_impl) return xpath_type_none; + + return static_cast<impl::xpath_query_impl*>(_impl)->root->rettype(); + } + + PUGI__FN bool xpath_query::evaluate_boolean(const xpath_node& n) const + { + if (!_impl) return false; + + impl::xpath_context c(n, 1, 1); + impl::xpath_stack_data sd; + + #ifdef PUGIXML_NO_EXCEPTIONS + if (setjmp(sd.error_handler)) return false; + #endif + + return static_cast<impl::xpath_query_impl*>(_impl)->root->eval_boolean(c, sd.stack); + } + + PUGI__FN double xpath_query::evaluate_number(const xpath_node& n) const + { + if (!_impl) return impl::gen_nan(); + + impl::xpath_context c(n, 1, 1); + impl::xpath_stack_data sd; + + #ifdef PUGIXML_NO_EXCEPTIONS + if (setjmp(sd.error_handler)) return impl::gen_nan(); + #endif + + return static_cast<impl::xpath_query_impl*>(_impl)->root->eval_number(c, sd.stack); + } + +#ifndef PUGIXML_NO_STL + PUGI__FN string_t xpath_query::evaluate_string(const xpath_node& n) const + { + impl::xpath_stack_data sd; + + impl::xpath_string r = impl::evaluate_string_impl(static_cast<impl::xpath_query_impl*>(_impl), n, sd); + + return string_t(r.c_str(), r.length()); + } +#endif + + PUGI__FN size_t xpath_query::evaluate_string(char_t* buffer, size_t capacity, const xpath_node& n) const + { + impl::xpath_stack_data sd; + + impl::xpath_string r = impl::evaluate_string_impl(static_cast<impl::xpath_query_impl*>(_impl), n, sd); + + size_t full_size = r.length() + 1; + + if (capacity > 0) + { + size_t size = (full_size < capacity) ? full_size : capacity; + assert(size > 0); + + memcpy(buffer, r.c_str(), (size - 1) * sizeof(char_t)); + buffer[size - 1] = 0; + } + + return full_size; + } + + PUGI__FN xpath_node_set xpath_query::evaluate_node_set(const xpath_node& n) const + { + impl::xpath_ast_node* root = impl::evaluate_node_set_prepare(static_cast<impl::xpath_query_impl*>(_impl)); + if (!root) return xpath_node_set(); + + impl::xpath_context c(n, 1, 1); + impl::xpath_stack_data sd; + + #ifdef PUGIXML_NO_EXCEPTIONS + if (setjmp(sd.error_handler)) return xpath_node_set(); + #endif + + impl::xpath_node_set_raw r = root->eval_node_set(c, sd.stack, impl::nodeset_eval_all); + + return xpath_node_set(r.begin(), r.end(), r.type()); + } + + PUGI__FN xpath_node xpath_query::evaluate_node(const xpath_node& n) const + { + impl::xpath_ast_node* root = impl::evaluate_node_set_prepare(static_cast<impl::xpath_query_impl*>(_impl)); + if (!root) return xpath_node(); + + impl::xpath_context c(n, 1, 1); + impl::xpath_stack_data sd; + + #ifdef PUGIXML_NO_EXCEPTIONS + if (setjmp(sd.error_handler)) return xpath_node(); + #endif + + impl::xpath_node_set_raw r = root->eval_node_set(c, sd.stack, impl::nodeset_eval_first); + + return r.first(); + } + + PUGI__FN const xpath_parse_result& xpath_query::result() const + { + return _result; + } + + PUGI__FN static void unspecified_bool_xpath_query(xpath_query***) + { + } + + PUGI__FN xpath_query::operator xpath_query::unspecified_bool_type() const + { + return _impl ? unspecified_bool_xpath_query : 0; + } + + PUGI__FN bool xpath_query::operator!() const + { + return !_impl; + } + + PUGI__FN xpath_node xml_node::select_node(const char_t* query, xpath_variable_set* variables) const + { + xpath_query q(query, variables); + return select_node(q); + } + + PUGI__FN xpath_node xml_node::select_node(const xpath_query& query) const + { + return query.evaluate_node(*this); + } + + PUGI__FN xpath_node_set xml_node::select_nodes(const char_t* query, xpath_variable_set* variables) const + { + xpath_query q(query, variables); + return select_nodes(q); + } + + PUGI__FN xpath_node_set xml_node::select_nodes(const xpath_query& query) const + { + return query.evaluate_node_set(*this); + } + + PUGI__FN xpath_node xml_node::select_single_node(const char_t* query, xpath_variable_set* variables) const + { + xpath_query q(query, variables); + return select_single_node(q); + } + + PUGI__FN xpath_node xml_node::select_single_node(const xpath_query& query) const + { + return query.evaluate_node(*this); + } +} + +#endif + +#ifdef __BORLANDC__ +# pragma option pop +#endif + +// Intel C++ does not properly keep warning state for function templates, +// so popping warning state at the end of translation unit leads to warnings in the middle. +#if defined(_MSC_VER) && !defined(__INTEL_COMPILER) +# pragma warning(pop) +#endif + +// Undefine all local macros (makes sure we're not leaking macros in header-only mode) +#undef PUGI__NO_INLINE +#undef PUGI__UNLIKELY +#undef PUGI__STATIC_ASSERT +#undef PUGI__DMC_VOLATILE +#undef PUGI__MSVC_CRT_VERSION +#undef PUGI__NS_BEGIN +#undef PUGI__NS_END +#undef PUGI__FN +#undef PUGI__FN_NO_INLINE +#undef PUGI__GETHEADER_IMPL +#undef PUGI__GETPAGE_IMPL +#undef PUGI__GETPAGE +#undef PUGI__NODETYPE +#undef PUGI__IS_CHARTYPE_IMPL +#undef PUGI__IS_CHARTYPE +#undef PUGI__IS_CHARTYPEX +#undef PUGI__ENDSWITH +#undef PUGI__SKIPWS +#undef PUGI__OPTSET +#undef PUGI__PUSHNODE +#undef PUGI__POPNODE +#undef PUGI__SCANFOR +#undef PUGI__SCANWHILE +#undef PUGI__SCANWHILE_UNROLL +#undef PUGI__ENDSEG +#undef PUGI__THROW_ERROR +#undef PUGI__CHECK_ERROR + +#endif + +/** + * Copyright (c) 2006-2016 Arseny Kapoulkine + * + * Permission is hereby granted, free of charge, to any person + * obtaining a copy of this software and associated documentation + * files (the "Software"), to deal in the Software without + * restriction, including without limitation the rights to use, + * copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the + * Software is furnished to do so, subject to the following + * conditions: + * + * The above copyright notice and this permission notice shall be + * included in all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, + * EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES + * OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND + * NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT + * HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, + * WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING + * FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR + * OTHER DEALINGS IN THE SOFTWARE. + */ diff --git a/C++/pugixml/pugixml.hpp b/C++/pugixml/pugixml.hpp new file mode 100644 index 0000000..6288d4b --- /dev/null +++ b/C++/pugixml/pugixml.hpp @@ -0,0 +1,1434 @@ +/** + * pugixml parser - version 1.8 + * -------------------------------------------------------- + * Copyright (C) 2006-2016, by Arseny Kapoulkine (arseny.kapoulkine@gmail.com) + * Report bugs and download new versions at http://pugixml.org/ + * + * This library is distributed under the MIT License. See notice at the end + * of this file. + * + * This work is based on the pugxml parser, which is: + * Copyright (C) 2003, by Kristen Wegner (kristen@tima.net) + */ + +#ifndef PUGIXML_VERSION +// Define version macro; evaluates to major * 100 + minor so that it's safe to use in less-than comparisons +# define PUGIXML_VERSION 180 +#endif + +// Include user configuration file (this can define various configuration macros) +#include "pugiconfig.hpp" + +#ifndef HEADER_PUGIXML_HPP +#define HEADER_PUGIXML_HPP + +// Include stddef.h for size_t and ptrdiff_t +#include <stddef.h> + +// Include exception header for XPath +#if !defined(PUGIXML_NO_XPATH) && !defined(PUGIXML_NO_EXCEPTIONS) +# include <exception> +#endif + +// Include STL headers +#ifndef PUGIXML_NO_STL +# include <iterator> +# include <iosfwd> +# include <string> +#endif + +// Macro for deprecated features +#ifndef PUGIXML_DEPRECATED +# if defined(__GNUC__) +# define PUGIXML_DEPRECATED __attribute__((deprecated)) +# elif defined(_MSC_VER) && _MSC_VER >= 1300 +# define PUGIXML_DEPRECATED __declspec(deprecated) +# else +# define PUGIXML_DEPRECATED +# endif +#endif + +// If no API is defined, assume default +#ifndef PUGIXML_API +# define PUGIXML_API +#endif + +// If no API for classes is defined, assume default +#ifndef PUGIXML_CLASS +# define PUGIXML_CLASS PUGIXML_API +#endif + +// If no API for functions is defined, assume default +#ifndef PUGIXML_FUNCTION +# define PUGIXML_FUNCTION PUGIXML_API +#endif + +// If the platform is known to have long long support, enable long long functions +#ifndef PUGIXML_HAS_LONG_LONG +# if __cplusplus >= 201103 +# define PUGIXML_HAS_LONG_LONG +# elif defined(_MSC_VER) && _MSC_VER >= 1400 +# define PUGIXML_HAS_LONG_LONG +# endif +#endif + +// If the platform is known to have move semantics support, compile move ctor/operator implementation +#ifndef PUGIXML_HAS_MOVE +# if __cplusplus >= 201103 +# define PUGIXML_HAS_MOVE +# elif defined(_MSC_VER) && _MSC_VER >= 1600 +# define PUGIXML_HAS_MOVE +# endif +#endif + +// If C++ is 2011 or higher, add 'override' qualifiers +#ifndef PUGIXML_OVERRIDE +# if __cplusplus >= 201103 +# define PUGIXML_OVERRIDE override +# else +# define PUGIXML_OVERRIDE +# endif +#endif + +// Character interface macros +#ifdef PUGIXML_WCHAR_MODE +# define PUGIXML_TEXT(t) L ## t +# define PUGIXML_CHAR wchar_t +#else +# define PUGIXML_TEXT(t) t +# define PUGIXML_CHAR char +#endif + +namespace pugi +{ + // Character type used for all internal storage and operations; depends on PUGIXML_WCHAR_MODE + typedef PUGIXML_CHAR char_t; + +#ifndef PUGIXML_NO_STL + // String type used for operations that work with STL string; depends on PUGIXML_WCHAR_MODE + typedef std::basic_string<PUGIXML_CHAR, std::char_traits<PUGIXML_CHAR>, std::allocator<PUGIXML_CHAR> > string_t; +#endif +} + +// The PugiXML namespace +namespace pugi +{ + // Tree node types + enum xml_node_type + { + node_null, // Empty (null) node handle + node_document, // A document tree's absolute root + node_element, // Element tag, i.e. '<node/>' + node_pcdata, // Plain character data, i.e. 'text' + node_cdata, // Character data, i.e. '<![CDATA[text]]>' + node_comment, // Comment tag, i.e. '<!-- text -->' + node_pi, // Processing instruction, i.e. '<?name?>' + node_declaration, // Document declaration, i.e. '<?xml version="1.0"?>' + node_doctype // Document type declaration, i.e. '<!DOCTYPE doc>' + }; + + // Parsing options + + // Minimal parsing mode (equivalent to turning all other flags off). + // Only elements and PCDATA sections are added to the DOM tree, no text conversions are performed. + const unsigned int parse_minimal = 0x0000; + + // This flag determines if processing instructions (node_pi) are added to the DOM tree. This flag is off by default. + const unsigned int parse_pi = 0x0001; + + // This flag determines if comments (node_comment) are added to the DOM tree. This flag is off by default. + const unsigned int parse_comments = 0x0002; + + // This flag determines if CDATA sections (node_cdata) are added to the DOM tree. This flag is on by default. + const unsigned int parse_cdata = 0x0004; + + // This flag determines if plain character data (node_pcdata) that consist only of whitespace are added to the DOM tree. + // This flag is off by default; turning it on usually results in slower parsing and more memory consumption. + const unsigned int parse_ws_pcdata = 0x0008; + + // This flag determines if character and entity references are expanded during parsing. This flag is on by default. + const unsigned int parse_escapes = 0x0010; + + // This flag determines if EOL characters are normalized (converted to #xA) during parsing. This flag is on by default. + const unsigned int parse_eol = 0x0020; + + // This flag determines if attribute values are normalized using CDATA normalization rules during parsing. This flag is on by default. + const unsigned int parse_wconv_attribute = 0x0040; + + // This flag determines if attribute values are normalized using NMTOKENS normalization rules during parsing. This flag is off by default. + const unsigned int parse_wnorm_attribute = 0x0080; + + // This flag determines if document declaration (node_declaration) is added to the DOM tree. This flag is off by default. + const unsigned int parse_declaration = 0x0100; + + // This flag determines if document type declaration (node_doctype) is added to the DOM tree. This flag is off by default. + const unsigned int parse_doctype = 0x0200; + + // This flag determines if plain character data (node_pcdata) that is the only child of the parent node and that consists only + // of whitespace is added to the DOM tree. + // This flag is off by default; turning it on may result in slower parsing and more memory consumption. + const unsigned int parse_ws_pcdata_single = 0x0400; + + // This flag determines if leading and trailing whitespace is to be removed from plain character data. This flag is off by default. + const unsigned int parse_trim_pcdata = 0x0800; + + // This flag determines if plain character data that does not have a parent node is added to the DOM tree, and if an empty document + // is a valid document. This flag is off by default. + const unsigned int parse_fragment = 0x1000; + + // This flag determines if plain character data is be stored in the parent element's value. This significantly changes the structure of + // the document; this flag is only recommended for parsing documents with many PCDATA nodes in memory-constrained environments. + // This flag is off by default. + const unsigned int parse_embed_pcdata = 0x2000; + + // The default parsing mode. + // Elements, PCDATA and CDATA sections are added to the DOM tree, character/reference entities are expanded, + // End-of-Line characters are normalized, attribute values are normalized using CDATA normalization rules. + const unsigned int parse_default = parse_cdata | parse_escapes | parse_wconv_attribute | parse_eol; + + // The full parsing mode. + // Nodes of all types are added to the DOM tree, character/reference entities are expanded, + // End-of-Line characters are normalized, attribute values are normalized using CDATA normalization rules. + const unsigned int parse_full = parse_default | parse_pi | parse_comments | parse_declaration | parse_doctype; + + // These flags determine the encoding of input data for XML document + enum xml_encoding + { + encoding_auto, // Auto-detect input encoding using BOM or < / <? detection; use UTF8 if BOM is not found + encoding_utf8, // UTF8 encoding + encoding_utf16_le, // Little-endian UTF16 + encoding_utf16_be, // Big-endian UTF16 + encoding_utf16, // UTF16 with native endianness + encoding_utf32_le, // Little-endian UTF32 + encoding_utf32_be, // Big-endian UTF32 + encoding_utf32, // UTF32 with native endianness + encoding_wchar, // The same encoding wchar_t has (either UTF16 or UTF32) + encoding_latin1 + }; + + // Formatting flags + + // Indent the nodes that are written to output stream with as many indentation strings as deep the node is in DOM tree. This flag is on by default. + const unsigned int format_indent = 0x01; + + // Write encoding-specific BOM to the output stream. This flag is off by default. + const unsigned int format_write_bom = 0x02; + + // Use raw output mode (no indentation and no line breaks are written). This flag is off by default. + const unsigned int format_raw = 0x04; + + // Omit default XML declaration even if there is no declaration in the document. This flag is off by default. + const unsigned int format_no_declaration = 0x08; + + // Don't escape attribute values and PCDATA contents. This flag is off by default. + const unsigned int format_no_escapes = 0x10; + + // Open file using text mode in xml_document::save_file. This enables special character (i.e. new-line) conversions on some systems. This flag is off by default. + const unsigned int format_save_file_text = 0x20; + + // Write every attribute on a new line with appropriate indentation. This flag is off by default. + const unsigned int format_indent_attributes = 0x40; + + // Don't output empty element tags, instead writing an explicit start and end tag even if there are no children. This flag is off by default. + const unsigned int format_no_empty_element_tags = 0x80; + + // The default set of formatting flags. + // Nodes are indented depending on their depth in DOM tree, a default declaration is output if document has none. + const unsigned int format_default = format_indent; + + // Forward declarations + struct xml_attribute_struct; + struct xml_node_struct; + + class xml_node_iterator; + class xml_attribute_iterator; + class xml_named_node_iterator; + + class xml_tree_walker; + + struct xml_parse_result; + + class xml_node; + + class xml_text; + + #ifndef PUGIXML_NO_XPATH + class xpath_node; + class xpath_node_set; + class xpath_query; + class xpath_variable_set; + #endif + + // Range-based for loop support + template <typename It> class xml_object_range + { + public: + typedef It const_iterator; + typedef It iterator; + + xml_object_range(It b, It e): _begin(b), _end(e) + { + } + + It begin() const { return _begin; } + It end() const { return _end; } + + private: + It _begin, _end; + }; + + // Writer interface for node printing (see xml_node::print) + class PUGIXML_CLASS xml_writer + { + public: + virtual ~xml_writer() {} + + // Write memory chunk into stream/file/whatever + virtual void write(const void* data, size_t size) = 0; + }; + + // xml_writer implementation for FILE* + class PUGIXML_CLASS xml_writer_file: public xml_writer + { + public: + // Construct writer from a FILE* object; void* is used to avoid header dependencies on stdio + xml_writer_file(void* file); + + virtual void write(const void* data, size_t size) PUGIXML_OVERRIDE; + + private: + void* file; + }; + + #ifndef PUGIXML_NO_STL + // xml_writer implementation for streams + class PUGIXML_CLASS xml_writer_stream: public xml_writer + { + public: + // Construct writer from an output stream object + xml_writer_stream(std::basic_ostream<char, std::char_traits<char> >& stream); + xml_writer_stream(std::basic_ostream<wchar_t, std::char_traits<wchar_t> >& stream); + + virtual void write(const void* data, size_t size) PUGIXML_OVERRIDE; + + private: + std::basic_ostream<char, std::char_traits<char> >* narrow_stream; + std::basic_ostream<wchar_t, std::char_traits<wchar_t> >* wide_stream; + }; + #endif + + // A light-weight handle for manipulating attributes in DOM tree + class PUGIXML_CLASS xml_attribute + { + friend class xml_attribute_iterator; + friend class xml_node; + + private: + xml_attribute_struct* _attr; + + typedef void (*unspecified_bool_type)(xml_attribute***); + + public: + // Default constructor. Constructs an empty attribute. + xml_attribute(); + + // Constructs attribute from internal pointer + explicit xml_attribute(xml_attribute_struct* attr); + + // Safe bool conversion operator + operator unspecified_bool_type() const; + + // Borland C++ workaround + bool operator!() const; + + // Comparison operators (compares wrapped attribute pointers) + bool operator==(const xml_attribute& r) const; + bool operator!=(const xml_attribute& r) const; + bool operator<(const xml_attribute& r) const; + bool operator>(const xml_attribute& r) const; + bool operator<=(const xml_attribute& r) const; + bool operator>=(const xml_attribute& r) const; + + // Check if attribute is empty + bool empty() const; + + // Get attribute name/value, or "" if attribute is empty + const char_t* name() const; + const char_t* value() const; + + // Get attribute value, or the default value if attribute is empty + const char_t* as_string(const char_t* def = PUGIXML_TEXT("")) const; + + // Get attribute value as a number, or the default value if conversion did not succeed or attribute is empty + int as_int(int def = 0) const; + unsigned int as_uint(unsigned int def = 0) const; + double as_double(double def = 0) const; + float as_float(float def = 0) const; + + #ifdef PUGIXML_HAS_LONG_LONG + long long as_llong(long long def = 0) const; + unsigned long long as_ullong(unsigned long long def = 0) const; + #endif + + // Get attribute value as bool (returns true if first character is in '1tTyY' set), or the default value if attribute is empty + bool as_bool(bool def = false) const; + + // Set attribute name/value (returns false if attribute is empty or there is not enough memory) + bool set_name(const char_t* rhs); + bool set_value(const char_t* rhs); + + // Set attribute value with type conversion (numbers are converted to strings, boolean is converted to "true"/"false") + bool set_value(int rhs); + bool set_value(unsigned int rhs); + bool set_value(long rhs); + bool set_value(unsigned long rhs); + bool set_value(double rhs); + bool set_value(float rhs); + bool set_value(bool rhs); + + #ifdef PUGIXML_HAS_LONG_LONG + bool set_value(long long rhs); + bool set_value(unsigned long long rhs); + #endif + + // Set attribute value (equivalent to set_value without error checking) + xml_attribute& operator=(const char_t* rhs); + xml_attribute& operator=(int rhs); + xml_attribute& operator=(unsigned int rhs); + xml_attribute& operator=(long rhs); + xml_attribute& operator=(unsigned long rhs); + xml_attribute& operator=(double rhs); + xml_attribute& operator=(float rhs); + xml_attribute& operator=(bool rhs); + + #ifdef PUGIXML_HAS_LONG_LONG + xml_attribute& operator=(long long rhs); + xml_attribute& operator=(unsigned long long rhs); + #endif + + // Get next/previous attribute in the attribute list of the parent node + xml_attribute next_attribute() const; + xml_attribute previous_attribute() const; + + // Get hash value (unique for handles to the same object) + size_t hash_value() const; + + // Get internal pointer + xml_attribute_struct* internal_object() const; + }; + +#ifdef __BORLANDC__ + // Borland C++ workaround + bool PUGIXML_FUNCTION operator&&(const xml_attribute& lhs, bool rhs); + bool PUGIXML_FUNCTION operator||(const xml_attribute& lhs, bool rhs); +#endif + + // A light-weight handle for manipulating nodes in DOM tree + class PUGIXML_CLASS xml_node + { + friend class xml_attribute_iterator; + friend class xml_node_iterator; + friend class xml_named_node_iterator; + + protected: + xml_node_struct* _root; + + typedef void (*unspecified_bool_type)(xml_node***); + + public: + // Default constructor. Constructs an empty node. + xml_node(); + + // Constructs node from internal pointer + explicit xml_node(xml_node_struct* p); + + // Safe bool conversion operator + operator unspecified_bool_type() const; + + // Borland C++ workaround + bool operator!() const; + + // Comparison operators (compares wrapped node pointers) + bool operator==(const xml_node& r) const; + bool operator!=(const xml_node& r) const; + bool operator<(const xml_node& r) const; + bool operator>(const xml_node& r) const; + bool operator<=(const xml_node& r) const; + bool operator>=(const xml_node& r) const; + + // Check if node is empty. + bool empty() const; + + // Get node type + xml_node_type type() const; + + // Get node name, or "" if node is empty or it has no name + const char_t* name() const; + + // Get node value, or "" if node is empty or it has no value + // Note: For <node>text</node> node.value() does not return "text"! Use child_value() or text() methods to access text inside nodes. + const char_t* value() const; + + // Get attribute list + xml_attribute first_attribute() const; + xml_attribute last_attribute() const; + + // Get children list + xml_node first_child() const; + xml_node last_child() const; + + // Get next/previous sibling in the children list of the parent node + xml_node next_sibling() const; + xml_node previous_sibling() const; + + // Get parent node + xml_node parent() const; + + // Get root of DOM tree this node belongs to + xml_node root() const; + + // Get text object for the current node + xml_text text() const; + + // Get child, attribute or next/previous sibling with the specified name + xml_node child(const char_t* name) const; + xml_attribute attribute(const char_t* name) const; + xml_node next_sibling(const char_t* name) const; + xml_node previous_sibling(const char_t* name) const; + + // Get attribute, starting the search from a hint (and updating hint so that searching for a sequence of attributes is fast) + xml_attribute attribute(const char_t* name, xml_attribute& hint) const; + + // Get child value of current node; that is, value of the first child node of type PCDATA/CDATA + const char_t* child_value() const; + + // Get child value of child with specified name. Equivalent to child(name).child_value(). + const char_t* child_value(const char_t* name) const; + + // Set node name/value (returns false if node is empty, there is not enough memory, or node can not have name/value) + bool set_name(const char_t* rhs); + bool set_value(const char_t* rhs); + + // Add attribute with specified name. Returns added attribute, or empty attribute on errors. + xml_attribute append_attribute(const char_t* name); + xml_attribute prepend_attribute(const char_t* name); + xml_attribute insert_attribute_after(const char_t* name, const xml_attribute& attr); + xml_attribute insert_attribute_before(const char_t* name, const xml_attribute& attr); + + // Add a copy of the specified attribute. Returns added attribute, or empty attribute on errors. + xml_attribute append_copy(const xml_attribute& proto); + xml_attribute prepend_copy(const xml_attribute& proto); + xml_attribute insert_copy_after(const xml_attribute& proto, const xml_attribute& attr); + xml_attribute insert_copy_before(const xml_attribute& proto, const xml_attribute& attr); + + // Add child node with specified type. Returns added node, or empty node on errors. + xml_node append_child(xml_node_type type = node_element); + xml_node prepend_child(xml_node_type type = node_element); + xml_node insert_child_after(xml_node_type type, const xml_node& node); + xml_node insert_child_before(xml_node_type type, const xml_node& node); + + // Add child element with specified name. Returns added node, or empty node on errors. + xml_node append_child(const char_t* name); + xml_node prepend_child(const char_t* name); + xml_node insert_child_after(const char_t* name, const xml_node& node); + xml_node insert_child_before(const char_t* name, const xml_node& node); + + // Add a copy of the specified node as a child. Returns added node, or empty node on errors. + xml_node append_copy(const xml_node& proto); + xml_node prepend_copy(const xml_node& proto); + xml_node insert_copy_after(const xml_node& proto, const xml_node& node); + xml_node insert_copy_before(const xml_node& proto, const xml_node& node); + + // Move the specified node to become a child of this node. Returns moved node, or empty node on errors. + xml_node append_move(const xml_node& moved); + xml_node prepend_move(const xml_node& moved); + xml_node insert_move_after(const xml_node& moved, const xml_node& node); + xml_node insert_move_before(const xml_node& moved, const xml_node& node); + + // Remove specified attribute + bool remove_attribute(const xml_attribute& a); + bool remove_attribute(const char_t* name); + + // Remove specified child + bool remove_child(const xml_node& n); + bool remove_child(const char_t* name); + + // Parses buffer as an XML document fragment and appends all nodes as children of the current node. + // Copies/converts the buffer, so it may be deleted or changed after the function returns. + // Note: append_buffer allocates memory that has the lifetime of the owning document; removing the appended nodes does not immediately reclaim that memory. + xml_parse_result append_buffer(const void* contents, size_t size, unsigned int options = parse_default, xml_encoding encoding = encoding_auto); + + // Find attribute using predicate. Returns first attribute for which predicate returned true. + template <typename Predicate> xml_attribute find_attribute(Predicate pred) const + { + if (!_root) return xml_attribute(); + + for (xml_attribute attrib = first_attribute(); attrib; attrib = attrib.next_attribute()) + if (pred(attrib)) + return attrib; + + return xml_attribute(); + } + + // Find child node using predicate. Returns first child for which predicate returned true. + template <typename Predicate> xml_node find_child(Predicate pred) const + { + if (!_root) return xml_node(); + + for (xml_node node = first_child(); node; node = node.next_sibling()) + if (pred(node)) + return node; + + return xml_node(); + } + + // Find node from subtree using predicate. Returns first node from subtree (depth-first), for which predicate returned true. + template <typename Predicate> xml_node find_node(Predicate pred) const + { + if (!_root) return xml_node(); + + xml_node cur = first_child(); + + while (cur._root && cur._root != _root) + { + if (pred(cur)) return cur; + + if (cur.first_child()) cur = cur.first_child(); + else if (cur.next_sibling()) cur = cur.next_sibling(); + else + { + while (!cur.next_sibling() && cur._root != _root) cur = cur.parent(); + + if (cur._root != _root) cur = cur.next_sibling(); + } + } + + return xml_node(); + } + + // Find child node by attribute name/value + xml_node find_child_by_attribute(const char_t* name, const char_t* attr_name, const char_t* attr_value) const; + xml_node find_child_by_attribute(const char_t* attr_name, const char_t* attr_value) const; + + #ifndef PUGIXML_NO_STL + // Get the absolute node path from root as a text string. + string_t path(char_t delimiter = '/') const; + #endif + + // Search for a node by path consisting of node names and . or .. elements. + xml_node first_element_by_path(const char_t* path, char_t delimiter = '/') const; + + // Recursively traverse subtree with xml_tree_walker + bool traverse(xml_tree_walker& walker); + + #ifndef PUGIXML_NO_XPATH + // Select single node by evaluating XPath query. Returns first node from the resulting node set. + xpath_node select_node(const char_t* query, xpath_variable_set* variables = 0) const; + xpath_node select_node(const xpath_query& query) const; + + // Select node set by evaluating XPath query + xpath_node_set select_nodes(const char_t* query, xpath_variable_set* variables = 0) const; + xpath_node_set select_nodes(const xpath_query& query) const; + + // (deprecated: use select_node instead) Select single node by evaluating XPath query. + xpath_node select_single_node(const char_t* query, xpath_variable_set* variables = 0) const; + xpath_node select_single_node(const xpath_query& query) const; + + #endif + + // Print subtree using a writer object + void print(xml_writer& writer, const char_t* indent = PUGIXML_TEXT("\t"), unsigned int flags = format_default, xml_encoding encoding = encoding_auto, unsigned int depth = 0) const; + + #ifndef PUGIXML_NO_STL + // Print subtree to stream + void print(std::basic_ostream<char, std::char_traits<char> >& os, const char_t* indent = PUGIXML_TEXT("\t"), unsigned int flags = format_default, xml_encoding encoding = encoding_auto, unsigned int depth = 0) const; + void print(std::basic_ostream<wchar_t, std::char_traits<wchar_t> >& os, const char_t* indent = PUGIXML_TEXT("\t"), unsigned int flags = format_default, unsigned int depth = 0) const; + #endif + + // Child nodes iterators + typedef xml_node_iterator iterator; + + iterator begin() const; + iterator end() const; + + // Attribute iterators + typedef xml_attribute_iterator attribute_iterator; + + attribute_iterator attributes_begin() const; + attribute_iterator attributes_end() const; + + // Range-based for support + xml_object_range<xml_node_iterator> children() const; + xml_object_range<xml_named_node_iterator> children(const char_t* name) const; + xml_object_range<xml_attribute_iterator> attributes() const; + + // Get node offset in parsed file/string (in char_t units) for debugging purposes + ptrdiff_t offset_debug() const; + + // Get hash value (unique for handles to the same object) + size_t hash_value() const; + + // Get internal pointer + xml_node_struct* internal_object() const; + }; + +#ifdef __BORLANDC__ + // Borland C++ workaround + bool PUGIXML_FUNCTION operator&&(const xml_node& lhs, bool rhs); + bool PUGIXML_FUNCTION operator||(const xml_node& lhs, bool rhs); +#endif + + // A helper for working with text inside PCDATA nodes + class PUGIXML_CLASS xml_text + { + friend class xml_node; + + xml_node_struct* _root; + + typedef void (*unspecified_bool_type)(xml_text***); + + explicit xml_text(xml_node_struct* root); + + xml_node_struct* _data_new(); + xml_node_struct* _data() const; + + public: + // Default constructor. Constructs an empty object. + xml_text(); + + // Safe bool conversion operator + operator unspecified_bool_type() const; + + // Borland C++ workaround + bool operator!() const; + + // Check if text object is empty + bool empty() const; + + // Get text, or "" if object is empty + const char_t* get() const; + + // Get text, or the default value if object is empty + const char_t* as_string(const char_t* def = PUGIXML_TEXT("")) const; + + // Get text as a number, or the default value if conversion did not succeed or object is empty + int as_int(int def = 0) const; + unsigned int as_uint(unsigned int def = 0) const; + double as_double(double def = 0) const; + float as_float(float def = 0) const; + + #ifdef PUGIXML_HAS_LONG_LONG + long long as_llong(long long def = 0) const; + unsigned long long as_ullong(unsigned long long def = 0) const; + #endif + + // Get text as bool (returns true if first character is in '1tTyY' set), or the default value if object is empty + bool as_bool(bool def = false) const; + + // Set text (returns false if object is empty or there is not enough memory) + bool set(const char_t* rhs); + + // Set text with type conversion (numbers are converted to strings, boolean is converted to "true"/"false") + bool set(int rhs); + bool set(unsigned int rhs); + bool set(long rhs); + bool set(unsigned long rhs); + bool set(double rhs); + bool set(float rhs); + bool set(bool rhs); + + #ifdef PUGIXML_HAS_LONG_LONG + bool set(long long rhs); + bool set(unsigned long long rhs); + #endif + + // Set text (equivalent to set without error checking) + xml_text& operator=(const char_t* rhs); + xml_text& operator=(int rhs); + xml_text& operator=(unsigned int rhs); + xml_text& operator=(long rhs); + xml_text& operator=(unsigned long rhs); + xml_text& operator=(double rhs); + xml_text& operator=(float rhs); + xml_text& operator=(bool rhs); + + #ifdef PUGIXML_HAS_LONG_LONG + xml_text& operator=(long long rhs); + xml_text& operator=(unsigned long long rhs); + #endif + + // Get the data node (node_pcdata or node_cdata) for this object + xml_node data() const; + }; + +#ifdef __BORLANDC__ + // Borland C++ workaround + bool PUGIXML_FUNCTION operator&&(const xml_text& lhs, bool rhs); + bool PUGIXML_FUNCTION operator||(const xml_text& lhs, bool rhs); +#endif + + // Child node iterator (a bidirectional iterator over a collection of xml_node) + class PUGIXML_CLASS xml_node_iterator + { + friend class xml_node; + + private: + mutable xml_node _wrap; + xml_node _parent; + + xml_node_iterator(xml_node_struct* ref, xml_node_struct* parent); + + public: + // Iterator traits + typedef ptrdiff_t difference_type; + typedef xml_node value_type; + typedef xml_node* pointer; + typedef xml_node& reference; + + #ifndef PUGIXML_NO_STL + typedef std::bidirectional_iterator_tag iterator_category; + #endif + + // Default constructor + xml_node_iterator(); + + // Construct an iterator which points to the specified node + xml_node_iterator(const xml_node& node); + + // Iterator operators + bool operator==(const xml_node_iterator& rhs) const; + bool operator!=(const xml_node_iterator& rhs) const; + + xml_node& operator*() const; + xml_node* operator->() const; + + const xml_node_iterator& operator++(); + xml_node_iterator operator++(int); + + const xml_node_iterator& operator--(); + xml_node_iterator operator--(int); + }; + + // Attribute iterator (a bidirectional iterator over a collection of xml_attribute) + class PUGIXML_CLASS xml_attribute_iterator + { + friend class xml_node; + + private: + mutable xml_attribute _wrap; + xml_node _parent; + + xml_attribute_iterator(xml_attribute_struct* ref, xml_node_struct* parent); + + public: + // Iterator traits + typedef ptrdiff_t difference_type; + typedef xml_attribute value_type; + typedef xml_attribute* pointer; + typedef xml_attribute& reference; + + #ifndef PUGIXML_NO_STL + typedef std::bidirectional_iterator_tag iterator_category; + #endif + + // Default constructor + xml_attribute_iterator(); + + // Construct an iterator which points to the specified attribute + xml_attribute_iterator(const xml_attribute& attr, const xml_node& parent); + + // Iterator operators + bool operator==(const xml_attribute_iterator& rhs) const; + bool operator!=(const xml_attribute_iterator& rhs) const; + + xml_attribute& operator*() const; + xml_attribute* operator->() const; + + const xml_attribute_iterator& operator++(); + xml_attribute_iterator operator++(int); + + const xml_attribute_iterator& operator--(); + xml_attribute_iterator operator--(int); + }; + + // Named node range helper + class PUGIXML_CLASS xml_named_node_iterator + { + friend class xml_node; + + public: + // Iterator traits + typedef ptrdiff_t difference_type; + typedef xml_node value_type; + typedef xml_node* pointer; + typedef xml_node& reference; + + #ifndef PUGIXML_NO_STL + typedef std::bidirectional_iterator_tag iterator_category; + #endif + + // Default constructor + xml_named_node_iterator(); + + // Construct an iterator which points to the specified node + xml_named_node_iterator(const xml_node& node, const char_t* name); + + // Iterator operators + bool operator==(const xml_named_node_iterator& rhs) const; + bool operator!=(const xml_named_node_iterator& rhs) const; + + xml_node& operator*() const; + xml_node* operator->() const; + + const xml_named_node_iterator& operator++(); + xml_named_node_iterator operator++(int); + + const xml_named_node_iterator& operator--(); + xml_named_node_iterator operator--(int); + + private: + mutable xml_node _wrap; + xml_node _parent; + const char_t* _name; + + xml_named_node_iterator(xml_node_struct* ref, xml_node_struct* parent, const char_t* name); + }; + + // Abstract tree walker class (see xml_node::traverse) + class PUGIXML_CLASS xml_tree_walker + { + friend class xml_node; + + private: + int _depth; + + protected: + // Get current traversal depth + int depth() const; + + public: + xml_tree_walker(); + virtual ~xml_tree_walker(); + + // Callback that is called when traversal begins + virtual bool begin(xml_node& node); + + // Callback that is called for each node traversed + virtual bool for_each(xml_node& node) = 0; + + // Callback that is called when traversal ends + virtual bool end(xml_node& node); + }; + + // Parsing status, returned as part of xml_parse_result object + enum xml_parse_status + { + status_ok = 0, // No error + + status_file_not_found, // File was not found during load_file() + status_io_error, // Error reading from file/stream + status_out_of_memory, // Could not allocate memory + status_internal_error, // Internal error occurred + + status_unrecognized_tag, // Parser could not determine tag type + + status_bad_pi, // Parsing error occurred while parsing document declaration/processing instruction + status_bad_comment, // Parsing error occurred while parsing comment + status_bad_cdata, // Parsing error occurred while parsing CDATA section + status_bad_doctype, // Parsing error occurred while parsing document type declaration + status_bad_pcdata, // Parsing error occurred while parsing PCDATA section + status_bad_start_element, // Parsing error occurred while parsing start element tag + status_bad_attribute, // Parsing error occurred while parsing element attribute + status_bad_end_element, // Parsing error occurred while parsing end element tag + status_end_element_mismatch,// There was a mismatch of start-end tags (closing tag had incorrect name, some tag was not closed or there was an excessive closing tag) + + status_append_invalid_root, // Unable to append nodes since root type is not node_element or node_document (exclusive to xml_node::append_buffer) + + status_no_document_element // Parsing resulted in a document without element nodes + }; + + // Parsing result + struct PUGIXML_CLASS xml_parse_result + { + // Parsing status (see xml_parse_status) + xml_parse_status status; + + // Last parsed offset (in char_t units from start of input data) + ptrdiff_t offset; + + // Source document encoding + xml_encoding encoding; + + // Default constructor, initializes object to failed state + xml_parse_result(); + + // Cast to bool operator + operator bool() const; + + // Get error description + const char* description() const; + }; + + // Document class (DOM tree root) + class PUGIXML_CLASS xml_document: public xml_node + { + private: + char_t* _buffer; + + char _memory[192]; + + // Non-copyable semantics + xml_document(const xml_document&); + xml_document& operator=(const xml_document&); + + void _create(); + void _destroy(); + + public: + // Default constructor, makes empty document + xml_document(); + + // Destructor, invalidates all node/attribute handles to this document + ~xml_document(); + + // Removes all nodes, leaving the empty document + void reset(); + + // Removes all nodes, then copies the entire contents of the specified document + void reset(const xml_document& proto); + + #ifndef PUGIXML_NO_STL + // Load document from stream. + xml_parse_result load(std::basic_istream<char, std::char_traits<char> >& stream, unsigned int options = parse_default, xml_encoding encoding = encoding_auto); + xml_parse_result load(std::basic_istream<wchar_t, std::char_traits<wchar_t> >& stream, unsigned int options = parse_default); + #endif + + // (deprecated: use load_string instead) Load document from zero-terminated string. No encoding conversions are applied. + xml_parse_result load(const char_t* contents, unsigned int options = parse_default); + + // Load document from zero-terminated string. No encoding conversions are applied. + xml_parse_result load_string(const char_t* contents, unsigned int options = parse_default); + + // Load document from file + xml_parse_result load_file(const char* path, unsigned int options = parse_default, xml_encoding encoding = encoding_auto); + xml_parse_result load_file(const wchar_t* path, unsigned int options = parse_default, xml_encoding encoding = encoding_auto); + + // Load document from buffer. Copies/converts the buffer, so it may be deleted or changed after the function returns. + xml_parse_result load_buffer(const void* contents, size_t size, unsigned int options = parse_default, xml_encoding encoding = encoding_auto); + + // Load document from buffer, using the buffer for in-place parsing (the buffer is modified and used for storage of document data). + // You should ensure that buffer data will persist throughout the document's lifetime, and free the buffer memory manually once document is destroyed. + xml_parse_result load_buffer_inplace(void* contents, size_t size, unsigned int options = parse_default, xml_encoding encoding = encoding_auto); + + // Load document from buffer, using the buffer for in-place parsing (the buffer is modified and used for storage of document data). + // You should allocate the buffer with pugixml allocation function; document will free the buffer when it is no longer needed (you can't use it anymore). + xml_parse_result load_buffer_inplace_own(void* contents, size_t size, unsigned int options = parse_default, xml_encoding encoding = encoding_auto); + + // Save XML document to writer (semantics is slightly different from xml_node::print, see documentation for details). + void save(xml_writer& writer, const char_t* indent = PUGIXML_TEXT("\t"), unsigned int flags = format_default, xml_encoding encoding = encoding_auto) const; + + #ifndef PUGIXML_NO_STL + // Save XML document to stream (semantics is slightly different from xml_node::print, see documentation for details). + void save(std::basic_ostream<char, std::char_traits<char> >& stream, const char_t* indent = PUGIXML_TEXT("\t"), unsigned int flags = format_default, xml_encoding encoding = encoding_auto) const; + void save(std::basic_ostream<wchar_t, std::char_traits<wchar_t> >& stream, const char_t* indent = PUGIXML_TEXT("\t"), unsigned int flags = format_default) const; + #endif + + // Save XML to file + bool save_file(const char* path, const char_t* indent = PUGIXML_TEXT("\t"), unsigned int flags = format_default, xml_encoding encoding = encoding_auto) const; + bool save_file(const wchar_t* path, const char_t* indent = PUGIXML_TEXT("\t"), unsigned int flags = format_default, xml_encoding encoding = encoding_auto) const; + + // Get document element + xml_node document_element() const; + }; + +#ifndef PUGIXML_NO_XPATH + // XPath query return type + enum xpath_value_type + { + xpath_type_none, // Unknown type (query failed to compile) + xpath_type_node_set, // Node set (xpath_node_set) + xpath_type_number, // Number + xpath_type_string, // String + xpath_type_boolean // Boolean + }; + + // XPath parsing result + struct PUGIXML_CLASS xpath_parse_result + { + // Error message (0 if no error) + const char* error; + + // Last parsed offset (in char_t units from string start) + ptrdiff_t offset; + + // Default constructor, initializes object to failed state + xpath_parse_result(); + + // Cast to bool operator + operator bool() const; + + // Get error description + const char* description() const; + }; + + // A single XPath variable + class PUGIXML_CLASS xpath_variable + { + friend class xpath_variable_set; + + protected: + xpath_value_type _type; + xpath_variable* _next; + + xpath_variable(xpath_value_type type); + + // Non-copyable semantics + xpath_variable(const xpath_variable&); + xpath_variable& operator=(const xpath_variable&); + + public: + // Get variable name + const char_t* name() const; + + // Get variable type + xpath_value_type type() const; + + // Get variable value; no type conversion is performed, default value (false, NaN, empty string, empty node set) is returned on type mismatch error + bool get_boolean() const; + double get_number() const; + const char_t* get_string() const; + const xpath_node_set& get_node_set() const; + + // Set variable value; no type conversion is performed, false is returned on type mismatch error + bool set(bool value); + bool set(double value); + bool set(const char_t* value); + bool set(const xpath_node_set& value); + }; + + // A set of XPath variables + class PUGIXML_CLASS xpath_variable_set + { + private: + xpath_variable* _data[64]; + + void _assign(const xpath_variable_set& rhs); + void _swap(xpath_variable_set& rhs); + + xpath_variable* _find(const char_t* name) const; + + static bool _clone(xpath_variable* var, xpath_variable** out_result); + static void _destroy(xpath_variable* var); + + public: + // Default constructor/destructor + xpath_variable_set(); + ~xpath_variable_set(); + + // Copy constructor/assignment operator + xpath_variable_set(const xpath_variable_set& rhs); + xpath_variable_set& operator=(const xpath_variable_set& rhs); + + #ifdef PUGIXML_HAS_MOVE + // Move semantics support + xpath_variable_set(xpath_variable_set&& rhs); + xpath_variable_set& operator=(xpath_variable_set&& rhs); + #endif + + // Add a new variable or get the existing one, if the types match + xpath_variable* add(const char_t* name, xpath_value_type type); + + // Set value of an existing variable; no type conversion is performed, false is returned if there is no such variable or if types mismatch + bool set(const char_t* name, bool value); + bool set(const char_t* name, double value); + bool set(const char_t* name, const char_t* value); + bool set(const char_t* name, const xpath_node_set& value); + + // Get existing variable by name + xpath_variable* get(const char_t* name); + const xpath_variable* get(const char_t* name) const; + }; + + // A compiled XPath query object + class PUGIXML_CLASS xpath_query + { + private: + void* _impl; + xpath_parse_result _result; + + typedef void (*unspecified_bool_type)(xpath_query***); + + // Non-copyable semantics + xpath_query(const xpath_query&); + xpath_query& operator=(const xpath_query&); + + public: + // Construct a compiled object from XPath expression. + // If PUGIXML_NO_EXCEPTIONS is not defined, throws xpath_exception on compilation errors. + explicit xpath_query(const char_t* query, xpath_variable_set* variables = 0); + + // Constructor + xpath_query(); + + // Destructor + ~xpath_query(); + + #ifdef PUGIXML_HAS_MOVE + // Move semantics support + xpath_query(xpath_query&& rhs); + xpath_query& operator=(xpath_query&& rhs); + #endif + + // Get query expression return type + xpath_value_type return_type() const; + + // Evaluate expression as boolean value in the specified context; performs type conversion if necessary. + // If PUGIXML_NO_EXCEPTIONS is not defined, throws std::bad_alloc on out of memory errors. + bool evaluate_boolean(const xpath_node& n) const; + + // Evaluate expression as double value in the specified context; performs type conversion if necessary. + // If PUGIXML_NO_EXCEPTIONS is not defined, throws std::bad_alloc on out of memory errors. + double evaluate_number(const xpath_node& n) const; + + #ifndef PUGIXML_NO_STL + // Evaluate expression as string value in the specified context; performs type conversion if necessary. + // If PUGIXML_NO_EXCEPTIONS is not defined, throws std::bad_alloc on out of memory errors. + string_t evaluate_string(const xpath_node& n) const; + #endif + + // Evaluate expression as string value in the specified context; performs type conversion if necessary. + // At most capacity characters are written to the destination buffer, full result size is returned (includes terminating zero). + // If PUGIXML_NO_EXCEPTIONS is not defined, throws std::bad_alloc on out of memory errors. + // If PUGIXML_NO_EXCEPTIONS is defined, returns empty set instead. + size_t evaluate_string(char_t* buffer, size_t capacity, const xpath_node& n) const; + + // Evaluate expression as node set in the specified context. + // If PUGIXML_NO_EXCEPTIONS is not defined, throws xpath_exception on type mismatch and std::bad_alloc on out of memory errors. + // If PUGIXML_NO_EXCEPTIONS is defined, returns empty node set instead. + xpath_node_set evaluate_node_set(const xpath_node& n) const; + + // Evaluate expression as node set in the specified context. + // Return first node in document order, or empty node if node set is empty. + // If PUGIXML_NO_EXCEPTIONS is not defined, throws xpath_exception on type mismatch and std::bad_alloc on out of memory errors. + // If PUGIXML_NO_EXCEPTIONS is defined, returns empty node instead. + xpath_node evaluate_node(const xpath_node& n) const; + + // Get parsing result (used to get compilation errors in PUGIXML_NO_EXCEPTIONS mode) + const xpath_parse_result& result() const; + + // Safe bool conversion operator + operator unspecified_bool_type() const; + + // Borland C++ workaround + bool operator!() const; + }; + + #ifndef PUGIXML_NO_EXCEPTIONS + // XPath exception class + class PUGIXML_CLASS xpath_exception: public std::exception + { + private: + xpath_parse_result _result; + + public: + // Construct exception from parse result + explicit xpath_exception(const xpath_parse_result& result); + + // Get error message + virtual const char* what() const throw() PUGIXML_OVERRIDE; + + // Get parse result + const xpath_parse_result& result() const; + }; + #endif + + // XPath node class (either xml_node or xml_attribute) + class PUGIXML_CLASS xpath_node + { + private: + xml_node _node; + xml_attribute _attribute; + + typedef void (*unspecified_bool_type)(xpath_node***); + + public: + // Default constructor; constructs empty XPath node + xpath_node(); + + // Construct XPath node from XML node/attribute + xpath_node(const xml_node& node); + xpath_node(const xml_attribute& attribute, const xml_node& parent); + + // Get node/attribute, if any + xml_node node() const; + xml_attribute attribute() const; + + // Get parent of contained node/attribute + xml_node parent() const; + + // Safe bool conversion operator + operator unspecified_bool_type() const; + + // Borland C++ workaround + bool operator!() const; + + // Comparison operators + bool operator==(const xpath_node& n) const; + bool operator!=(const xpath_node& n) const; + }; + +#ifdef __BORLANDC__ + // Borland C++ workaround + bool PUGIXML_FUNCTION operator&&(const xpath_node& lhs, bool rhs); + bool PUGIXML_FUNCTION operator||(const xpath_node& lhs, bool rhs); +#endif + + // A fixed-size collection of XPath nodes + class PUGIXML_CLASS xpath_node_set + { + public: + // Collection type + enum type_t + { + type_unsorted, // Not ordered + type_sorted, // Sorted by document order (ascending) + type_sorted_reverse // Sorted by document order (descending) + }; + + // Constant iterator type + typedef const xpath_node* const_iterator; + + // We define non-constant iterator to be the same as constant iterator so that various generic algorithms (i.e. boost foreach) work + typedef const xpath_node* iterator; + + // Default constructor. Constructs empty set. + xpath_node_set(); + + // Constructs a set from iterator range; data is not checked for duplicates and is not sorted according to provided type, so be careful + xpath_node_set(const_iterator begin, const_iterator end, type_t type = type_unsorted); + + // Destructor + ~xpath_node_set(); + + // Copy constructor/assignment operator + xpath_node_set(const xpath_node_set& ns); + xpath_node_set& operator=(const xpath_node_set& ns); + + #ifdef PUGIXML_HAS_MOVE + // Move semantics support + xpath_node_set(xpath_node_set&& rhs); + xpath_node_set& operator=(xpath_node_set&& rhs); + #endif + + // Get collection type + type_t type() const; + + // Get collection size + size_t size() const; + + // Indexing operator + const xpath_node& operator[](size_t index) const; + + // Collection iterators + const_iterator begin() const; + const_iterator end() const; + + // Sort the collection in ascending/descending order by document order + void sort(bool reverse = false); + + // Get first node in the collection by document order + xpath_node first() const; + + // Check if collection is empty + bool empty() const; + + private: + type_t _type; + + xpath_node _storage; + + xpath_node* _begin; + xpath_node* _end; + + void _assign(const_iterator begin, const_iterator end, type_t type); + void _move(xpath_node_set& rhs); + }; +#endif + +#ifndef PUGIXML_NO_STL + // Convert wide string to UTF8 + std::basic_string<char, std::char_traits<char>, std::allocator<char> > PUGIXML_FUNCTION as_utf8(const wchar_t* str); + std::basic_string<char, std::char_traits<char>, std::allocator<char> > PUGIXML_FUNCTION as_utf8(const std::basic_string<wchar_t, std::char_traits<wchar_t>, std::allocator<wchar_t> >& str); + + // Convert UTF8 to wide string + std::basic_string<wchar_t, std::char_traits<wchar_t>, std::allocator<wchar_t> > PUGIXML_FUNCTION as_wide(const char* str); + std::basic_string<wchar_t, std::char_traits<wchar_t>, std::allocator<wchar_t> > PUGIXML_FUNCTION as_wide(const std::basic_string<char, std::char_traits<char>, std::allocator<char> >& str); +#endif + + // Memory allocation function interface; returns pointer to allocated memory or NULL on failure + typedef void* (*allocation_function)(size_t size); + + // Memory deallocation function interface + typedef void (*deallocation_function)(void* ptr); + + // Override default memory management functions. All subsequent allocations/deallocations will be performed via supplied functions. + void PUGIXML_FUNCTION set_memory_management_functions(allocation_function allocate, deallocation_function deallocate); + + // Get current memory management functions + allocation_function PUGIXML_FUNCTION get_memory_allocation_function(); + deallocation_function PUGIXML_FUNCTION get_memory_deallocation_function(); +} + +#if !defined(PUGIXML_NO_STL) && (defined(_MSC_VER) || defined(__ICC)) +namespace std +{ + // Workarounds for (non-standard) iterator category detection for older versions (MSVC7/IC8 and earlier) + std::bidirectional_iterator_tag PUGIXML_FUNCTION _Iter_cat(const pugi::xml_node_iterator&); + std::bidirectional_iterator_tag PUGIXML_FUNCTION _Iter_cat(const pugi::xml_attribute_iterator&); + std::bidirectional_iterator_tag PUGIXML_FUNCTION _Iter_cat(const pugi::xml_named_node_iterator&); +} +#endif + +#if !defined(PUGIXML_NO_STL) && defined(__SUNPRO_CC) +namespace std +{ + // Workarounds for (non-standard) iterator category detection + std::bidirectional_iterator_tag PUGIXML_FUNCTION __iterator_category(const pugi::xml_node_iterator&); + std::bidirectional_iterator_tag PUGIXML_FUNCTION __iterator_category(const pugi::xml_attribute_iterator&); + std::bidirectional_iterator_tag PUGIXML_FUNCTION __iterator_category(const pugi::xml_named_node_iterator&); +} +#endif + +#endif + +// Make sure implementation is included in header-only mode +// Use macro expansion in #include to work around QMake (QTBUG-11923) +#if defined(PUGIXML_HEADER_ONLY) && !defined(PUGIXML_SOURCE) +# define PUGIXML_SOURCE "pugixml.cpp" +# include PUGIXML_SOURCE +#endif + +/** + * Copyright (c) 2006-2016 Arseny Kapoulkine + * + * Permission is hereby granted, free of charge, to any person + * obtaining a copy of this software and associated documentation + * files (the "Software"), to deal in the Software without + * restriction, including without limitation the rights to use, + * copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the + * Software is furnished to do so, subject to the following + * conditions: + * + * The above copyright notice and this permission notice shall be + * included in all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, + * EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES + * OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND + * NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT + * HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, + * WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING + * FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR + * OTHER DEALINGS IN THE SOFTWARE. + */ diff --git a/C++/smarc/filtering.c b/C++/smarc/filtering.c new file mode 100644 index 0000000..956efce --- /dev/null +++ b/C++/smarc/filtering.c @@ -0,0 +1,111 @@ +/** + * Smarc + * + * Copyright (c) 2009-2011 Institut T�l�com - T�l�com Paristech + * T�l�com ParisTech / dept. TSI + * + * Authors : Benoit Mathieu, Jacques Prado + * + * This file is part of Smarc. + * + * Smarc is free software: you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation, either version 3 of the License, or + * (at your option) any later version. + * + * Smarc is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program. If not, see <http://www.gnu.org/licenses/>. + */ + +#include "filtering.h" + +#ifndef __SSE2__ + +double filter(const double* restrict filt, const double* restrict signal, const int K) +{ + register double v = 0.0; + for (int k=0;k<K;++k) + v+=filt[k]*signal[k]; + return v; +} + +#else + +#include <emmintrin.h> + +double basic_filter(const double* restrict filt, const double* restrict signal, const int K) +{ +// printf("basic filter for K=%i\n",K); + register double v = 0.0; + for (int k=0;k<K;++k) + v+=filt[k]*signal[k]; + return v; +} + +double sse_filtering_aligned(const double* restrict filt, const double* restrict signal, const int K) { +// printf("sse_filtering filt=%p signal=%p K=%i\n",filt,signal,K); + // filt and signal are 16 byte aligned, K % 2 = 0 + __m128d v = _mm_setzero_pd(); + int k=0; + for (;k<K-1;k+=2) { + __m128d f = _mm_load_pd(filt + k); + __m128d s = _mm_load_pd(signal + k); + v = _mm_add_pd(v,_mm_mul_pd(f,s)); + } + double tmp[2]; + _mm_storeu_pd(tmp,v); + if (k==K) + return tmp[0] + tmp[1]; + // else + return tmp[0] + tmp[1] + filt[k]*signal[k]; +} + +double sse_filtering_misaligned(const double* restrict filt, const double* restrict signal, const int K) { +// printf("sse_filtering_misaligned filt=%p signal=%p K=%i\n",filt,signal,K); + __m128d v = _mm_setzero_pd(); + __m128d s = _mm_load1_pd(signal); + int k=0; + for (;k<K-4;k+=4) { + __m128d f = _mm_load_pd(filt + k); + __m128d s2 = _mm_load_pd(signal + k + 1); + s = _mm_shuffle_pd(s,s2,_MM_SHUFFLE2(0,1)); + v = _mm_add_pd(v,_mm_mul_pd(f,s)); + f = _mm_load_pd(filt + k + 2); + s = _mm_load_pd(signal + k + 3); + s2 = _mm_shuffle_pd(s2,s,_MM_SHUFFLE2(0,1)); + v = _mm_add_pd(v,_mm_mul_pd(f,s2)); + } + double tmp[2]; + _mm_storeu_pd(tmp,v); + for (;k<K;++k) + tmp[0]+=filt[k]*signal[k]; + return tmp[0] + tmp[1]; +} + +double filter(const double* restrict filt, const double* restrict signal, int K) +{ + if (K<8) + return basic_filter(filt,signal,K); + double v = 0; + if ((((unsigned long)filt) & 15) != 0) { // if filt is not 16-bytes aligned + v += filt[0]*signal[0]; + ++filt; + ++signal; + --K; + } + if ((((unsigned long)signal) & 15) == 0) { // if signal is 16-bytes aligned + return v + sse_filtering_aligned(filt,signal,K); + } + // else + return v + sse_filtering_misaligned(filt,signal,K); +} + + +#endif + + diff --git a/C++/smarc/filtering.h b/C++/smarc/filtering.h new file mode 100644 index 0000000..4172b54 --- /dev/null +++ b/C++/smarc/filtering.h @@ -0,0 +1,30 @@ +/** + * Smarc + * + * Copyright (c) 2009-2011 Institut T�l�com - T�l�com Paristech + * T�l�com ParisTech / dept. TSI + * + * Authors : Benoit Mathieu, Jacques Prado + * + * This file is part of Smarc. + * + * Smarc is free software: you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation, either version 3 of the License, or + * (at your option) any later version. + * + * Smarc is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program. If not, see <http://www.gnu.org/licenses/>. + */ + +#ifndef FILTER_H_ +#define FILTER_H_ + +double filter(const double* restrict filt, const double* restrict signal, const int K); + +#endif /* FILTER_H_ */ diff --git a/C++/smarc/multi_stage.c b/C++/smarc/multi_stage.c new file mode 100644 index 0000000..d6f6216 --- /dev/null +++ b/C++/smarc/multi_stage.c @@ -0,0 +1,580 @@ +/** + * Smarc + * + * Copyright (c) 2009-2011 Institut Télécom - Télécom Paristech + * Télécom ParisTech / dept. TSI + * + * Authors : Benoit Mathieu, Jacques Prado + * + * This file is part of Smarc. + * + * Smarc is free software: you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation, either version 3 of the License, or + * (at your option) any later version. + * + * Smarc is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program. If not, see <http://www.gnu.org/licenses/>. + */ + + +#include "multi_stage.h" +#include "string.h" +#include "stdlib.h" +#include "stdio.h" +#include "math.h" +#include "remez_lp.h" + +int find_pgcd(int a, int b) { + int r; + if (b > a) { + r = a; + a = b; + b = r; + } + r = a % b; + while (r != 0) { + a = b; + b = r; + r = a % b; + } + return b; +} + +struct PPredef { + int Q; + int P; + char* def; +}; + +static const int s_predefs_size = 40; +// less operations +static const struct PPredef s_predefs[] = { + { 1, 4, "2/1 2/1"}, + { 1, 6, "2/1 3/1"}, + { 1, 8, "2/1 2/1 2/1"}, + { 1, 12, "2/1 2/1 3/1"}, + { 1, 16, "2/1 2/1 2/1 2/1"}, + { 1, 24, "2/1 2/1 2/1 3/1"}, + { 3, 4, "2/1 2/3"}, + { 3, 8, "2/1 4/3"}, + { 4, 1, "1/2 1/2"}, + { 6, 1, "1/2 1/3"}, + { 8, 1, "1/2 1/2 1/2"}, + { 4, 3, "3/2 1/2"}, + { 8, 3, "1/2 3/4"}, + { 12, 1, "1/2 1/2 1/3"}, + { 16, 1, "1/2 1/2 1/2 1/2"}, + { 24, 1, "1/2 1/2 1/2 1/3"}, + { 40, 147, "1/2 3/2 7/2 7/5"}, + { 80, 147, "7/5 7/4 3/2 1/2"}, + { 80, 441, "3/2 3/2 7/4 7/5"}, + { 147, 40, "2/1 2/3 2/7 5/7"}, + { 147, 80, "5/7 4/7 2/3 2/1"}, + { 147, 160, "4/7 2/1 4/3 5/7"}, + { 147, 320, "4/7 4/1 4/3 5/7"}, + { 147, 640, "2/1 4/1 4/7 4/3 5/7"}, + { 147, 1280, "4/1 4/1 4/7 4/3 5/7"}, + { 147, 2560, "2/1 4/1 4/1 4/7 4/3 5/7"}, + { 160, 147, "7/5 3/4 1/2 7/4"}, + { 160, 441, "7/5 7/4 3/2 3/2 1/2"}, + { 320, 147, "7/4 1/4 3/4 7/5"}, + { 320, 441, "3/4 3/4 7/4 7/5"}, + { 441, 80, "2/3 2/3 4/7 5/7"}, + { 441, 160, "5/7 4/7 2/3 2/3 2/1"}, + { 441, 320, "4/7 4/3 4/3 5/7"}, + { 441, 640, "2/1 4/7 4/3 4/3 5/7"}, + { 441, 1280, "4/1 4/7 4/3 4/3 5/7"}, + { 640, 147, "1/2 1/4 7/4 3/4 7/5"}, + { 640, 441, "1/2 7/4 3/4 3/4 7/5"}, + { 1280, 147, "1/4 1/4 7/4 3/4 7/5"}, + { 1280, 441, "1/4 7/4 3/4 3/4 7/5"}, + { 2560, 147, "1/2 1/4 1/4 7/4 3/4 7/5"} +}; + +void destroy_multistagedef(struct PMultiStageDef* pdef) { + if (pdef) { + if (pdef->nb_stages > 0) { + free(pdef->L); + } + free(pdef); + } +} + +int compare_ratios(const void* e1, const void* e2) { + const int* p1 = (const int*) e1; + const int* p2 = (const int*) e2; + if ((p1[0] > p1[1]) && (p2[0] < p2[1])) + return -1; + if ((p2[0] > p2[1]) && (p1[0] < p1[1])) + return 1; + return (p1[0] * p2[1] - p1[1] * p2[0]); +// return 0; // keep original order +} + +void reorder_stages(struct PMultiStageDef* pdef) { + int* ratios = malloc(2 * pdef->nb_stages * sizeof(int)); + for (int s = 0; s < pdef->nb_stages; s++) { + ratios[2 * s] = pdef->L[s]; + ratios[2 * s + 1] = pdef->M[s]; + } + qsort(ratios, pdef->nb_stages, 2 * sizeof(int), compare_ratios); + for (int s = 0; s < pdef->nb_stages; s++) { + pdef->L[s] = ratios[2 * s]; + pdef->M[s] = ratios[2 * s + 1]; + } + free(ratios); +} + +void check_stages(struct PMultiStageDef* pdef) { + // sort ratios + int* at_end = malloc(2* pdef->nb_stages * sizeof(int)); + int end_index = 0; + int pos_index = 0; + int Mprod = 1; + int Lprod = 1; + for (int s=0;s<pdef->nb_stages;s++) { + Mprod *= pdef->M[s]; + Lprod *= pdef->L[s]; + } + int minPQ = (Mprod < Lprod) ? Mprod : Lprod; + int fin = Mprod; + Mprod = 1; + Lprod = 1; + for (int s=0;s<pdef->nb_stages;s++) { + if (fin*Lprod*pdef->L[s] < minPQ*Mprod*pdef->M[s]) { + // invalid step, put it at the end + at_end[2*end_index] = pdef->L[s]; + at_end[2*end_index+1] = pdef->M[s]; + end_index++; + } else { + // keep it + if (pos_index!=s) { + pdef->L[pos_index] = pdef->L[s]; + pdef->M[pos_index] = pdef->M[s]; + } + pos_index++; + Lprod *= pdef->L[s]; + Mprod *= pdef->M[s]; + } + } + // report at_end + for (int e=0;e<end_index;e++) { + pdef->L[pos_index] = at_end[2*e]; + pdef->M[pos_index] = at_end[2*e+1]; + pos_index++; + } + free(at_end); +} + +int factors(int value, int* res, int* resSize) { + int i = 0; + int p = 2; + while (value > 1 && i < *resSize && p <= value) { + if (value % p == 0) { + res[i++] = p; + value /= p; + } else { + // find next prime + int notprime = 1; + while (notprime) { + p++; + notprime = 0; + for (int f = 2; f <= (p / 2); f++) { + if (p % f == 0) { + notprime = 1; + break; + } + } + } + } + } + *resSize = i; + return value; +} + +struct PMultiStageDef* get_predef_ratios(int fsin, int fsout) { + int pgcd = find_pgcd(fsin,fsout); + int P = fsout / pgcd; + int Q = fsin / pgcd; + for (int i = 0; i < s_predefs_size; i++) { + if ((s_predefs[i].P == P) && (s_predefs[i].Q == Q)) { + struct PMultiStageDef* pdef = malloc(sizeof(struct PMultiStageDef)); + char* def = s_predefs[i].def; + pdef->nb_stages = 0; + for (int c=0;c<strlen(def);c++) + if (def[c]=='/') pdef->nb_stages++; + pdef->L = malloc(2 * pdef->nb_stages * sizeof(int)); + pdef->M = &pdef->L[pdef->nb_stages]; + char* pos = def; + for (int s = 0; s < pdef->nb_stages; s++) { + pdef->L[s] = atoi(pos); + while (*pos!='/') pos++; + pos++; + pdef->M[s] = atoi(pos); + if (s==pdef->nb_stages-1) + break; + while (*pos!=' ') pos++; + pos++; + } + reorder_stages(pdef); + return pdef; + } + } + return NULL; +} + +struct PMultiStageDef* get_user_ratios(int fsin, int fsout, const char* userdef) { + struct PMultiStageDef* pdef = malloc(sizeof(struct PMultiStageDef)); + + // compute nb stages + pdef->nb_stages = 0; + const char* pch = strchr(userdef, '/'); + while (pch != NULL) { + pdef->nb_stages++; + pch = strchr(pch + 1, '/'); + } + + // parse L M + pdef->L = malloc(2 * pdef->nb_stages * sizeof(int)); + pdef->M = &pdef->L[pdef->nb_stages]; + pch = userdef; + for (int s = 0; s < pdef->nb_stages; s++) { + pdef->L[s] = atoi(pch); + if (pdef->L[s] <= 0) + goto error; + pch = strchr(pch, '/'); + if (pch == NULL) + goto error; + pch++; + pdef->M[s] = atoi(pch); + if (pdef->M[s] <= 0) + goto error; + if (s < (pdef->nb_stages - 1)) { + pch = strchr(pch, ' '); + if (pch == NULL) + goto error; + pch++; + } + } + reorder_stages(pdef); + return pdef; + + error: printf("ERROR: cannot parse multistage user definition '%s'\n", + userdef); + free(pdef); + return NULL; +} + +void find_ratio(double rat, double tol, int* L, int* M) { + double r = rat; + int p2 = 0, q2 = 1; + int p1 = 1, q1 = 0; + int p, q; + while (1) { + int a = (int) floor(r); + + p = a * p1 + p2; + q = a * q1 + q2; + double c = (double) p / q; + if (fabs(rat - c) < tol) + break; + r = 1.0 / (r - a); + p2 = p1; + q2 = q1; + p1 = p; + q1 = q; + } + *L = p; + *M = q; +} + +#define MAX_FACTORS 10 + +struct PMultiStageDef* build_auto_ratios(int fsin, int fsout, double tol) { + int L = 0; + int M = 0; + double rat = (double) fsin / fsout; + find_ratio(rat, tol * rat, &M, &L); + + int nbL = MAX_FACTORS; + int* LL = malloc(nbL * sizeof(int)); + if (factors(L, LL, &nbL) != 1) { + free(LL); + printf("WARNING: too many factors for %i !\n", L); + return NULL; + } + + int nbM = MAX_FACTORS; + int* MM = malloc(nbM * sizeof(int)); + if (factors(M, MM, &nbM) != 1) { + free(MM); + printf("ERROR: too many factors for %i !\n", M); + return NULL; + } + + if (nbL < nbM) { + memmove(&LL[nbM - nbL], LL, nbL * sizeof(int)); + for (int i = 0; i < (nbM - nbL); i++) + LL[i] = 1; + nbL = nbM; + } + if (nbM < nbL) { + for (int i = nbM; i < nbL; i++) + MM[i] = 1; + nbM = nbL; + } + + struct PMultiStageDef* pdef = malloc(sizeof(struct PMultiStageDef)); + pdef->nb_stages = nbL; + pdef->L = malloc(2 * nbL * sizeof(int)); + pdef->M = &pdef->L[nbL]; + for (int s = 0; s < nbL; s++) { + pdef->L[s] = LL[s]; + pdef->M[s] = MM[s]; + } + free(LL); + free(MM); + + reorder_stages(pdef); + return pdef; +} + +#define MAX_INT_NUMBER (1<<30) +#define MAX_NB_STAGES 5 +#define FACTOR_MAX 21 +#define MAX_FREQ_FACTOR 4 +#define MAX_FILTER_LENGTH 4000 + +void next_factor(int* current, int* remains, int factormax) { + int N = *current * *remains; + for (int i= 1 + *current;(i<=factormax) && (i*2<=N);i++) { + if (N%i==0) { + *current = i; + *remains = N / i; + return; + } + } + if (*current!=N && N<=factormax) { + *current = N; + *remains = 1; + return; + } + *remains = N; + *current = 1; + return; +} + +void print_stage_def(char* msg, struct PMultiStageDef* def) { + printf("%s ",msg); + for (int i=0;i<def->nb_stages;i++) + printf(" %i/%i",def->L[i],def->M[i]); + printf("\n"); +} + +int find_next_stages(int L, int M, struct PMultiStageDef* def, int factormax) { +// print_stage_def("find next stage of",def); + int minLM = (L<M) ? L : M; + int maxFreq = (L<M) ? M*MAX_FREQ_FACTOR : L*MAX_FREQ_FACTOR; + // pop last stage + int stage = def->nb_stages - 1; + int rL = def->L[stage]; + int rM = def->M[stage]; + stage--; + // iterate to find next valid stage with + while (stage>=0) { +// printf("stage %i: %i/%i rL=%i rM=%i\n",stage,def->L[stage],def->M[stage],rL,rM); + // if no more L nor M factors we are done + if (rL==1 && rM==1) { + def->nb_stages = stage; + return 1; + } + // if maximum number of stage has been reach we are done + if (stage==MAX_NB_STAGES-1) { + if (rL>factormax || rM>factormax) { + // invalid stage, pop + stage--; + continue; + } + def->nb_stages = MAX_NB_STAGES; + def->L[stage] = rL; + def->M[stage] = rM; + return 1; + } + // try to increase M +// printf("try to increment M: %i %i\n",def->M[stage],rM); + next_factor(&def->M[stage],&rM,factormax); + if (def->M[stage] == 1) { + // try to increase L +// printf("try to increment L: %i %i\n",def->L[stage],rL); + next_factor(&def->L[stage],&rL,factormax); + if (def->L[stage]==1) { + // pop current stage +// printf("no more possibilities, pop stage\n"); + stage--; + continue; + } + } + // check stage is valid + { + int currentFS = L * rM / rL; + if (currentFS>maxFreq) + continue; + if (currentFS<minLM) { + // do not need to examine next M values + def->M[stage] *= rM; + rM = 1; + continue; + } + } + // push stage +// printf("choose %i/%i\n",def->L[stage],def->M[stage]); + stage++; + def->L[stage] = 1; + def->M[stage] = 1; + } + // no more stages found + return 0; +} + +int get_max_prime_factor(int N) { + int maxp=1; + while (N>maxp) { + int p=1; + for (int i=2;i*i<=N;i++) { + if (N%i==0) { + p = i; + break; + } + } + if (p==1) + p=N; + if (p>maxp) + maxp = p; + N /= p; + } + return maxp; +} + +struct PMultiStageDef* build_fast_ratios(int fsin, int fsout, double tol, double bandwidth, double rp, double rs) +{ + int L = 0; + int M = 0; + double rat = (double) fsin / fsout; + find_ratio(rat, tol * rat, &M, &L); + +// printf("build fast ratios for %i/%i\n",L,M); + + // allocate all memory contiguously + struct PMultiStageDef* best = malloc(2*sizeof(struct PMultiStageDef) + 4*MAX_NB_STAGES*sizeof(int)); + best->L = (int*) (best + 1); + best->M = best->L + MAX_NB_STAGES; + struct PMultiStageDef* current = (struct PMultiStageDef*) (best->M + MAX_NB_STAGES); + current->L = (int*) (current + 1); + current->M = (int*) (current->L + MAX_NB_STAGES); + + // check factor_max + int factor_max = FACTOR_MAX; + { + int max_prime = get_max_prime_factor(L); + if (factor_max<max_prime) + factor_max=max_prime; + max_prime = get_max_prime_factor(M); + if (factor_max<max_prime) + factor_max=max_prime; + } + + // initialize vars for computing filter orders + double *bands, *mag, *dev, *weight; + bands = malloc(10 * sizeof(double)); + mag = &bands[4]; + dev = &mag[2]; + weight = &dev[2]; + + bands[0] = 0; + bands[1] = 0; // fpass + bands[2] = 0.5; // fstop + bands[3] = 0.5; + + mag[0] = 1; + mag[1] = 0; + + double fstop = (fsin<fsout) ? (double)fsin/2 : (double)fsout/2; + double fpass = fstop * bandwidth; + + // iterate over all stages + double best_ops = MAX_INT_NUMBER; + current->nb_stages = 2; + current->L[0] = 1; + current->M[0] = 1; + current->L[1] = L; + current->M[1] = M; + int nbTest = 0; + while (find_next_stages(L,M,current,factor_max)) { +// print_stage_def("got stage ",current); + nbTest++; + // compute ops + dev[0] = (pow(10, rp / 20.0) - 1) / (current->nb_stages *(pow(10, rp / 20.0) + 1)); + dev[1] = pow(10, -rs / 20.0); + double fs = (double) fsin; + double ops = 0.0; + for (int s=0;s<current->nb_stages;s++) { + const int cL = current->L[s]; + const int cM = current->M[s]; + double fmax = fs * cL; + bands[1] = fpass / fmax; + bands[2] = (cL>cM) ? (fs-fstop) / fmax : (fs*cL/cM - fstop) / fmax; + int flen = remez_lp_order(bands, mag, dev, weight); + { + int k=(flen-1)/(2*cM); + while (2*k*cM+1 < flen) + k++; + flen = 2*k*cM+1; + } + if (flen>MAX_FILTER_LENGTH) + { +// printf("- %i/%i filter too long !\n",cL,cM); + ops = MAX_INT_NUMBER; + break; + } + double stage_ops = flen*fs / cM; +// printf("- %i/%i : flen=%i ops=%0.2f\n",cL,cM,flen,stage_ops); + ops += stage_ops; + fs = (fs * cL) / cM; + } +// printf("total ops = %0.2f\n",ops); + if (ops<best_ops) { +// printf("best one !\n"); + best_ops = ops; + best->nb_stages = current->nb_stages; + for (int i=0;i<current->nb_stages;i++) { + best->L[i] = current->L[i]; + best->M[i] = current->M[i]; + } + } + } +// printf("have test %i combinaison\n",nbTest); +// print_stage_def("best one is",best); +// printf("width %0.2f operations\n",best_ops); + + // prepare output + struct PMultiStageDef* pdef = malloc(sizeof(struct PMultiStageDef)); + pdef->nb_stages = best->nb_stages; + pdef->L = malloc(2 * best->nb_stages * sizeof(int)); + pdef->M = &pdef->L[best->nb_stages]; + for (int s = 0; s < pdef->nb_stages; s++) { + pdef->L[s] = best->L[s]; + pdef->M[s] = best->M[s]; + } + + // free working memory + free(best); + free(bands); + + return pdef; +} diff --git a/C++/smarc/multi_stage.h b/C++/smarc/multi_stage.h new file mode 100644 index 0000000..0451ec6 --- /dev/null +++ b/C++/smarc/multi_stage.h @@ -0,0 +1,46 @@ +/** + * Smarc + * + * Copyright (c) 2009-2011 Institut T�l�com - T�l�com Paristech + * T�l�com ParisTech / dept. TSI + * + * Authors : Benoit Mathieu, Jacques Prado + * + * This file is part of Smarc. + * + * Smarc is free software: you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation, either version 3 of the License, or + * (at your option) any later version. + * + * Smarc is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program. If not, see <http://www.gnu.org/licenses/>. + */ + +#ifndef MULTI_STAGE_H_ +#define MULTI_STAGE_H_ + +/** + * Definition of a multistage filter plan. + * - nb_stages: number of stages + * - L: array of nb_stages interpolation factors + * - M: array of nb_stages decimation factors + */ +struct PMultiStageDef { + int nb_stages; + int* L; + int* M; +}; + +struct PMultiStageDef* get_predef_ratios(int fsin, int fsout); +struct PMultiStageDef* get_user_ratios(int fsin, int fsout, const char* userdef); +struct PMultiStageDef* build_auto_ratios(int fsin, int fsout, double tol); +struct PMultiStageDef* build_fast_ratios(int fsin, int fsout, double tol, double bandwidth,double rp,double rs); +void destroy_multistagedef(struct PMultiStageDef*); + +#endif /* MULTI_STAGE_H_ */ diff --git a/C++/smarc/polyfilt.c b/C++/smarc/polyfilt.c new file mode 100644 index 0000000..78d170c --- /dev/null +++ b/C++/smarc/polyfilt.c @@ -0,0 +1,150 @@ +/** + * Smarc + * + * Copyright (c) 2009-2011 Institut Télécom - Télécom Paristech + * Télécom ParisTech / dept. TSI + * + * Authors : Benoit Mathieu, Jacques Prado + * + * This file is part of Smarc. + * + * Smarc is free software: you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation, either version 3 of the License, or + * (at your option) any later version. + * + * Smarc is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program. If not, see <http://www.gnu.org/licenses/>. + */ + +#include "polyfilt.h" + +#include <stdlib.h> +#include <stdio.h> +#include <string.h> + +void polyfiltLM(struct PSFilter* pfilt, struct PSState* pstate, + const double* signal, int signalLen, int* nbRead, double* output, + int outputLen, int* nbWritten) { + const int M = pfilt->M; + const int L = pfilt->L; + const int K = pfilt->K; + + int signalPos = 0; + int outPos = 0; + int phase = pstate->phase; + + // skip first sample for delays + if (pstate->skip>0) + { + const int maxAdvance = (M + L - 1) / L; + while (pstate->skip>0 && ((signalPos+maxAdvance)<signalLen)) { + pstate->skip--; + phase += M; + signalPos += phase / L; + phase = phase % L; + } + } + + // process filtering + while ((signalPos+K<=signalLen) && (outPos<outputLen)) + { + // compute value + output[outPos++] = filter(pfilt->filters + phase*K,signal + signalPos, K); + + // consume samples + phase += M; + signalPos += phase / L; + phase = phase % L; + } + + // report state values + pstate->phase = phase; + *nbRead = signalPos; + *nbWritten = outPos; +} + + +void polyfiltM(struct PSFilter* pfilt, struct PSState* pstate, + const double* restrict signal, const int signalLen, int* restrict nbConsume, + double* restrict output, const int outputLen, int* restrict nbWritten) { + const int M = pfilt->M; + const int K = pfilt->K; + const double* filt = pfilt->filters; + + int signalPos = 0; + int outPos = 0; + + // skip first sample for delays + while (pstate->skip>0 && ((signalPos+M)<signalLen)) { + pstate->skip--; + signalPos += M; + } + + // process filtering + while (((signalPos+K)<=signalLen) && (outPos<outputLen)) + { + // compute value +// double v = 0.0; +// const double* inPtr = signal + signalPos; +// for (int k=0;k<K;k++) +// v += inPtr[k] * filt[k]; +// output[outPos++] = v; + output[outPos++] = filter(filt,signal+signalPos,K); + + // consume samples + signalPos += M; + } + + // report state values + *nbWritten = outPos; + *nbConsume = signalPos; +} + +void polyfiltL(struct PSFilter* pfilt, struct PSState* pstate, + const double* signal, int signalLen, int* nbRead, double* output, + int outputLen, int* nbWritten) { + const int L = pfilt->L; + const int K = pfilt->K; + + int signalPos = 0; + int outPos = 0; + int phase = pstate->phase; + + // skip first sample for delays + while (pstate->skip>0 && signalPos<signalLen) { + pstate->skip--; + phase++; + if (phase==L) { + signalPos++; + phase = 0; + } + } + + // compute first output to reach phase 0 + while (signalPos+K<=signalLen && outPos<outputLen) + { +// double v=0; +// const double* inPtr = signal + signalPos; +// const double* filtPtr = pfilt->filters + phase*K; +// for (int k=0;k<K;++k) +// v += inPtr[k] * filtPtr[k]; +// output[outPos++] = v; + output[outPos++] = filter(pfilt->filters + phase*K, signal+signalPos, K); + phase++; + if (phase==L) { + signalPos++; + phase=0; + } + } + + // report state values + pstate->phase = phase; + *nbRead = signalPos; + *nbWritten = outPos; +} diff --git a/C++/smarc/polyfilt.h b/C++/smarc/polyfilt.h new file mode 100644 index 0000000..d2dca6a --- /dev/null +++ b/C++/smarc/polyfilt.h @@ -0,0 +1,79 @@ +/** + * Smarc + * + * Copyright (c) 2009-2011 Institut T�l�com - T�l�com Paristech + * T�l�com ParisTech / dept. TSI + * + * Authors : Benoit Mathieu, Jacques Prado + * + * This file is part of Smarc. + * + * Smarc is free software: you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation, either version 3 of the License, or + * (at your option) any later version. + * + * Smarc is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program. If not, see <http://www.gnu.org/licenses/>. + */ + +#ifndef POLYFILTLM_H_ +#define POLYFILTLM_H_ + +#include "smarc.h" +#include "stage_impl.h" + +/** + * Filter signal with a L/M filter (interpolation factor and decimation factor are not 1) + * - pfilt [IN]: filter to use + * - pstate [IN/OUT]: filter state + * - signal [IN]: input signal + * - signalLen [IN]: input signal length + * - nbRead [OUT]: number of samples read from input signal + * - output [OUT]: output array + * - outputLen [IN]: length of output array. Maximum number of samples to write + * - nbWritten [OUT]: number of samples effectively written + * - w [IN]: workspace to use for temporary results. + */ +void polyfiltLM(struct PSFilter* pfilt, struct PSState* pstate, + const double* restrict signal, const int signalLen, int* nbConsume, + double* restrict output, const int outputLen, int* nbWritten); + +/** + * Filter signal with a decimation filter (interpolation factor L is 1) + * - pfilt [IN]: filter to use + * - pstate [IN/OUT]: filter state + * - signal [IN]: input signal + * - signalLen [IN]: input signal length + * - nbRead [OUT]: number of samples read from input signal + * - output [OUT]: output array + * - outputLen [IN]: length of output array. Maximum number of samples to write + * - nbWritten [OUT]: number of samples effectively written + * - w [IN]: workspace to use for temporary results. + */ +void polyfiltM(struct PSFilter* pfilt, struct PSState* pstate, + const double* restrict signal, const int signalLen, int* restrict nbConsume, + double* restrict output, const int outputLen, int* restrict nbWritten); + +/** + * Filter signal with a interpolation filter (decimation factor M is 1) + * - pfilt [IN]: filter to use + * - pstate [IN/OUT]: filter state + * - signal [IN]: input signal + * - signalLen [IN]: input signal length + * - nbRead [OUT]: number of samples read from input signal + * - output [OUT]: output array + * - outputLen [IN]: length of output array. Maximum number of samples to write + * - nbWritten [OUT]: number of samples effectively written + * - w [IN]: workspace to use for temporary results. + */ +void polyfiltL(struct PSFilter* pfilt, struct PSState* pstate, + const double* restrict signal, const int signalLen, int* restrict nbConsume, + double* restrict output, const int outputLen, int* restrict nbWritten); + +#endif /* POLYFILTLM_H_ */ diff --git a/C++/smarc/remez_lp.c b/C++/smarc/remez_lp.c new file mode 100644 index 0000000..6302af1 --- /dev/null +++ b/C++/smarc/remez_lp.c @@ -0,0 +1,601 @@ +/** + * Smarc + * + * Copyright (c) 2009-2011 Institut Télécom - Télécom Paristech + * Télécom ParisTech / dept. TSI + * + * Authors : Benoit Mathieu, Jacques Prado + * + * This file is part of Smarc. + * + * Smarc is free software: you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation, either version 3 of the License, or + * (at your option) any later version. + * + * Smarc is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program. If not, see <http://www.gnu.org/licenses/>. + */ + + +/******************************************************************************** + * Adaptation de l'algorithme Parks-McClellan pour les FIR de type 1 et 2 + * d'apres le livre "Theory and applications of digital signal processing" de + * L.R. Rabiner et B. Gold et le programme fortran "A computer program for + * designing optimum linear phase digital filters" de J.H. McClellan, T.W. Parks + * et L.R. Rabiner. + ********************************************************************************/ + + +#include "remez_lp.h" +#include <math.h> +#include <stdlib.h> +#include <stdio.h> + +#define GRIDDENSITY 16 +#define MAXITERATIONS 250 + +#define min(a,b) ((a)<(b)?(a):(b)) +#define max(a,b) ((a)>(b)?(a):(b)) + +double remlpord(double f1, double f2, double d1, double d2) { + static double A1A3[3] = {5.309e-03, 7.114e-02, -4.761e-01}; + static double A4A6[3] = {-2.660e-03, -5.941e-01, -4.278e-01}; + + d1 = log10(d1); + d2 = log10(d2); + + double lh[3] = { d1 * d1, d1, 1}; + double DD1[3] = {0,0,0}; + for (int i=0;i<3;i++) + DD1[i] = d2*A1A3[i] + A4A6[i]; + double D = 0.0; + for (int i = 0; i < 3; i++) + D += DD1[i]*lh[i]; + double fK = 11.01217 + (d1 - d2) * 0.51244; + double df = f2 - f1; + return D / df - fK * df + 1; +} + +int remez_lp_order(const double* fcuts, const double* mag, const double* dev, + double* weight) { + int N = ceil(remlpord(fcuts[1], fcuts[2], dev[0], dev[1])); + double maxdev = (dev[0] > dev[1] ? dev[0] : dev[1]); + weight[0] = maxdev / dev[0]; + weight[1] = maxdev / dev[1]; + return N; +} + + +void build_grid(int lgfiltre, int nfcns, const double* bands, int nbands, int lgrid, int nodd, const double* dev, const double* weight, + double** FreqGrille, int* taillegrilledense, double** des, double** wt) +{ + int np = floor(0.5+(nfcns*bands[1]) / (0.5+(bands[1]-bands[2]))); + if (np==0) + np++; + int ns = nfcns+1-np; + if (ns<=1) + ns = 2; + while ((np+ns-1)*lgrid+2 <= lgfiltre) + lgrid *= 2; + + *taillegrilledense = (np+ns-1)*lgrid+2; + *FreqGrille = malloc(*taillegrilledense * sizeof(double)); + *des = malloc(*taillegrilledense * sizeof(double)); + *wt = malloc(*taillegrilledense * sizeof(double)); + + double delf = 1.0 / (lgrid * np); + for (int k=0;k<np*lgrid+1;k++) + { + (*FreqGrille)[k] = k*bands[1]*delf; + (*des)[k] = dev[0]; + (*wt)[k] = weight[0]; + } + delf = 1.0 /((ns-1)*lgrid); + for (int k=0;k<(ns-1)*lgrid+1;k++) + { + (*FreqGrille)[(np*lgrid)+1+k] = bands[2] + k*(bands[3]-bands[2])*delf; + (*des)[(np*lgrid)+1+k] = dev[1]; + (*wt)[(np*lgrid)+1+k] = weight[1]; + } + // Dans les cas pair on supprime le point en 0.5 ou en 0.5-eps + if (nodd==0 && (*FreqGrille)[*taillegrilledense-1]>(0.5-delf)) + (*taillegrilledense)--; +} + +/** + * Coefficients pour l'interpolation de Lagrange + * fonction D du Fortran + */ +double dd(int k,int n, int m, const double* x) +{ + double d=1; + double q=x[k]; + for (int l=0;l<m;l++) + { + for (int ll=l;ll<n;ll+=m) + { + double xx = 2*(q -x[ll]); + if (xx!=0) + d *= xx; + } + } + return 1.0 / d; +} + +/** + * fonction gee issu du Fortran + */ +double gee(const double* FreqGrille, const double* ad, const double* x, const double* y, const double* des, const double* wt, + double comp,int nut,int l, int nz, double* E) +{ + double sum = 0; + double dot = 0; + for (int i=0;i<nz;i++) + { + double v = ad[i]/(cos(PI2*FreqGrille[l])-x[i]); + sum += v; + dot += v*y[i]; + } + dot /= sum; + *E = (dot - des[l])*wt[l]; + return nut*(*E) - comp; +} + +/** + * Algorithme d'echange + * Les drapeaux flag et semaphore permmettent de remplacer les goto + * du programme original. Il y a donc plusieurs copies des memes portions + * de code pour des conditions differentes. + */ +int echange(int nfcns,int taillegrilledense,int* iExt,double* FreqGrille,double* des,double* wt, + double* x, double* y, double* ad) +{ + double comp = 0.0; + double deltal = -1; + double delta = 0.0; + int nz = nfcns + 1; + int nzz = nz+1; + int iter = 0; + int luck = 0; + int jchnge = 1; + int jet = floor((nfcns-1)/15) + 1; + double y1 = 0.0; + double E = 0.0; + double dtemp = 0.0; + int k1 = 0; + int knz = 0; + int klow = 0; + int kup = 0; + int nu = 0; + int nut = 0; + int nut1 = 0; + int j=1; + int flag = 0; + int l=0; + while (jchnge>0) + { + iter++; + if (iter>MAXITERATIONS) + break; + for (int i=0;i<nz;i++) + x[i] = cos(PI2*FreqGrille[iExt[i]]); + // coefficients ak de l'article + for (int nn=0;nn<nz;nn++) + ad[nn] = dd(nn,nz,jet,x); + // Calcul de delta (dev dans le Fortran) + { + double dnum = 0.0; + double dden = 0.0; + int add = 1; + for (int i=0;i<nz;i++) + { + dnum += ad[i]*des[iExt[i]]; + dden += add*ad[i]/wt[iExt[i]]; + add = -add; + } + delta = dnum / dden; + } + nu=(delta>0? -1 : 1); + delta *= -nu; + { + int add = 1; + for (int i=0;i<nz;i++) + { + y[i] = des[iExt[i]] + nu*delta*add/wt[iExt[i]]; + add = -add; + } + } + if (delta <= deltal) // OUCH + { + printf("ERROR: remez exchange algorithm do not converge\n"); + printf("ERROR: Filter designed will probably be incorrect\n"); + return -1; + } + deltal = delta; // etiquette 150 + jchnge = 0; // on se prepare a sortir si les extrema n'ont pas change + k1 = iExt[0]; + knz = iExt[nz-1]; + klow = -1; + nut = -nu; + j=1; + while (j<nzz) // etiquette 200 + { + kup = iExt[j]; + l = iExt[j-1] + 1; + nut = -nut; + if (j==2) + y1 = comp; + comp = delta; + flag = 1; // test de bascule pour gerer les gotos + if (l<kup) // on inverse le test goto 220 + { + dtemp = gee(FreqGrille,ad,x,y,des,wt,comp,nut,l,nz,&E); + if (dtemp>0) // on inverse le test goto 220 + { + comp = nut*E; + l++; // etiquette 210 + while (l<kup) // on inverse le test goto 215 + { + dtemp = gee(FreqGrille,ad,x,y,des,wt,comp,nut,l,nz,&E); + if (dtemp<=0) // test goto 215 + break; + comp = nut*E; + l++; + } + iExt[j-1] = l - 1; // etiquette 215 + j++; + klow = l - 1; + jchnge++; // extrema ont change + flag = 0; // test de bascule pour le goto 200 + } + } + if (flag) + { + l -= 2; // etiquette 220 et 225 + while (l>klow) // on inverse le test goto 250 + { + dtemp = gee(FreqGrille,ad,x,y,des,wt,comp,nut,l,nz,&E); + if (dtemp>0 || jchnge>0) // groupe les tests goto 230 et goto 225 + break; + l--; // etiquette 235 + } + if (l<=klow) // test goto 240 + { + l = iExt[j-1] + 1; // etiquette 250 + if (jchnge>0) // test goto 215 + { + iExt[j-1] = l-1; // on refait 215 + j++; + klow = l-1; + jchnge++; // extrema ont change + } else { // sinon on a fait l-2 au lieu de l-1 (220 et 225) + l++; + while (l<kup) // test goto 260 + { + dtemp = gee(FreqGrille,ad,x,y,des,wt,comp,nut,l,nz,&E); + if (dtemp>0) + break; + l++; // sinon on a fait l-2 au lieu de l-1 (220 et 225) + } + if (l<kup && dtemp>0) // on n'est pas passe dans le while precedent + { + comp = nut*E; + l++; + while (l<kup) + { + dtemp = gee(FreqGrille,ad,x,y,des,wt,comp,nut,l,nz,&E); + if (dtemp<=0) + break; + comp = nut*E; + l++; + } + iExt[j-1] = l-1; // on est revenu a l >= kup + j++; + klow = l-1; + jchnge++; + } else { // if l < kup && dtemp > 0 n'est pas verifie + klow = iExt[j-1]; + j++; + } + } + } else if (dtemp>0) { // ici l > klow + comp = nut*E; + l--; + while (l>klow) // tant que l > klow on fait la couble entre 200 et goto 200 + { + dtemp = gee(FreqGrille,ad,x,y,des,wt,comp,nut,l,nz,&E); + if (dtemp<=0) + break; + comp = nut*E; + l--; + } + klow = iExt[j-1]; + iExt[j-1] = l+1; + j++; + jchnge++; + } else { + klow = iExt[j-1]; + j++; + } + } + } + while (j==nzz) // etiquette 300 + { + k1 = min(k1,iExt[0]); // if k1.GT.iExt(1) + knz = max(knz,iExt[nz-1]); // if knz.LT.iExt(nz) + nut1 = nut; + nut = -nu; + l = 0; + kup = k1; + comp = comp*1.00001; + luck = 1; + flag = 1; // test de bascule pour le goto 310 + while (l<kup) // on inverse le test goto 315 + { + dtemp = gee(FreqGrille,ad,x,y,des,wt,comp,nut,l,nz,&E); + if (dtemp>0) + { + comp = nut*E; + j = nzz; + l++; + while (l<kup) + { + dtemp = gee(FreqGrille,ad,x,y,des,wt,comp,nut,l,nz,&E); + if (dtemp<=0) + break; + comp = nut*E; + l++; + } + iExt[j-1] = l-1; + j++; + klow = l-1; + jchnge++; // extrema ont change + flag=0; // gestion bascule + break; + } + l++; + } + if (flag) // on fait 315 si bascule == 1 + { + luck = 6; + l = taillegrilledense; // etiquette 325 + klow = knz; + nut = -nut1; + comp = y1*1.00001; + l--; + while (l>klow) + { + dtemp = gee(FreqGrille,ad,x,y,des,wt,comp,nut,l,nz,&E); + if (dtemp>0) // on inverse le test pour le break dans le if suivant + { + j = nzz; + comp = nut*E; + luck += 10; + l--; // etiquette 330 + while (l>klow) // on inverse le test goto 340 + { + dtemp = gee(FreqGrille,ad,x,y,des,wt,comp,nut,l,nz,&E); + if (dtemp<=0) + break; + comp = nut*E; + l--; + } + klow = iExt[j-1]; + iExt[j-1] = l+1; + j++; + jchnge++; // extrema ont change + flag = 0; // on est passe, bascule = 0 + break; + } + l--; + } + if (flag) + { + if (luck != 6) // on inverse le test en 340 + { + for (int i=nfcns-1;i>0;i--) + iExt[i] = iExt[i-1]; + iExt[0] = k1; + jchnge ++; + } + break; + } + } + } + if (j>nzz) // arrive-t-on en 320 ? + { + if (luck>9) // oui, et luck>9 alors goto 350 + { + for (int i=0;i<nfcns;i++) + iExt[i] = iExt[i+1]; + iExt[nfcns] = iExt[nz]; + jchnge++; // extrema ont change + } else { // oui, et luck<9 + y1 = max(y1,comp); + k1 = iExt[nzz-1]; + l = taillegrilledense; + klow = knz; + nut = -nut1; + comp = y1*1.00001; + l--; + while (l>klow) // tant que l > klow, on fait ce qui est sous 330 + { + dtemp = gee(FreqGrille,ad,x,y,des,wt,comp,nut,l,nz,&E); + if (dtemp>0) + { + j = nzz; + comp = nut*E; + luck += 10; + l--; + while (l > klow) + { + dtemp = gee(FreqGrille,ad,x,y,des,wt,comp,nut,l,nz,&E); + if (dtemp<=0) + break; + comp = nut*E; + l--; + } + klow = iExt[j-1]; + iExt[j-1] = l+1; + j++; + jchnge++; + for (int i=0;i<nfcns;i++) + iExt[i] = iExt[i+1]; + iExt[nfcns] = iExt[nz]; + break; + } + l--; + } + if (luck!=6) // on arrive en 340 avec semaphore = 1 + { + for (int i=nfcns;i>0;i--) + iExt[i] = iExt[i-1]; + iExt[0] = k1; + jchnge ++; + } + } + } + } + return 0; +} + +void build_rep_imp(int nfcns, const double* ad, double* x, const double* y, int nodd, double* h) +{ + // Transformee de Fourier inverse + double* a = malloc((nfcns+1)*sizeof(double)); + double* alpha = malloc((nfcns+2)*sizeof(double)); + int nz = nfcns+1; + int nzz = nz+1; + int nm1 = nfcns-1; + double fsh = 1.0e-6; + x[nzz-1] = -2; + double cn = 2*nfcns-1; + double delf = 1.0 / cn; + int l=0; + for (int j=0;j<nfcns;j++) + { + double ft = j*delf; + double xt = cos(PI2*ft); + double xe = x[l]; + // Test apres 410 + // tant que xt<=xe && (xe-xt) >= fsh + // on boucle sur l=l+1 et xe = x(l) + while ((xt <= xe) && ((xe-xt) >= fsh)) + xe = x[++l]; + if ((xt-xe) < fsh) + a[j] = y[l]; + else { + double sum = 0; + double dot = 0; + for (int i=0;i<nz;i++) + { + double v = ad[i] / (xt-x[i]); + sum += v; + dot += v*y[i]; + } + a[j] = dot / sum; + } + if (l > 1) // etiquette 430 + l--; + } + double dden = PI2 / cn; + for (int j=0;j<nfcns;j++) + { + double dnum = j*dden; + if (nm1 < 1) + alpha[j] = a[0]; + else { + double t = a[0]; + for (int i=1;i<nfcns;i++) + t += 2*a[i]*cos(dnum*i); + alpha[j] = t; + } + } + alpha[0] /= cn; + for (int i=1;i<nfcns;i++) + alpha[i] *= 2.0 / cn; + if (nfcns <= 3) + alpha[nfcns+1] = alpha[nfcns] = 0; + + // On convertit les alpha en reponse impulsionnelle + // La reponse est symetrique + if (nodd != 0) + { + for (int i=0;i<nfcns-1;i++) + h[i] = 0.5*alpha[nfcns-1-i]; + h[nfcns-1] = alpha[0]; + for (int i=0;i<nfcns-1;i++) + h[nfcns+i] = h[nfcns-2-i]; + } else { + h[0] = 0.25*alpha[nfcns-1]; + for (int i=1;i<nfcns-1;i++) + h[i] = 0.25 * (alpha[nfcns-1-i] + alpha[nfcns-i]); + h[nfcns-1] = 0.5*alpha[0]+0.25*alpha[1]; + for (int i=0;i<nfcns;i++) + h[nfcns+i] = h[nfcns-1-i]; + } + + free(a); + free(alpha); +} + +int remez_lp(double h[], int filterLen, + double bands[], double dev[], double weight[]) +{ + int lgrid = GRIDDENSITY; + int nbands = 2; // design lowpass filter + int nodd = filterLen%2; + int nfcns = filterLen/2; + if (nodd) + nfcns++; + double* FreqGrille = NULL; + int taillegrilledense = 0; + double* des = NULL; + double* wt = NULL; + // remplissage de la grille, des et wt + build_grid(filterLen, nfcns,bands,nbands,lgrid,nodd,dev,weight,&FreqGrille,&taillegrilledense,&des,&wt); + // ponderation par q(w)=cos(w/2) si longueur paire + if (nodd==0) + { + for (int i=0;i<taillegrilledense;i++) + { + double coeff = cos(PI * FreqGrille[i]); + des[i] /= coeff; + wt[i] *= coeff; + } + } + // Extrema initiaux + int* iExt = malloc((nfcns+2)*sizeof(int)); + { + double temp = (double)(taillegrilledense-1)/nfcns; + for (int i=0;i<nfcns;i++) + iExt[i] = floor(i*temp); + iExt[nfcns] = taillegrilledense-1; + iExt[nfcns+1] = taillegrilledense; + } + // Algorithme d'echange + double* x = malloc((nfcns+2)*sizeof(double)); + double* y = malloc((nfcns+1)*sizeof(double)); + double* ad = malloc((nfcns+1)*sizeof(double)); + int iRc = echange(nfcns,taillegrilledense,iExt,FreqGrille,des,wt,x,y,ad); + + if (iRc == 0) + build_rep_imp(nfcns,ad,x,y,nodd,h); + + // release memory + free(FreqGrille); + free(des); + free(wt); + free(iExt); + free(x); + free(y); + free(ad); + + return iRc; +} diff --git a/C++/smarc/remez_lp.h b/C++/smarc/remez_lp.h new file mode 100644 index 0000000..5566d85 --- /dev/null +++ b/C++/smarc/remez_lp.h @@ -0,0 +1,55 @@ +/** + * Smarc + * + * Copyright (c) 2009-2011 Institut T�l�com - T�l�com Paristech + * T�l�com ParisTech / dept. TSI + * + * Authors : Benoit Mathieu, Jacques Prado + * + * This file is part of Smarc. + * + * Smarc is free software: you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation, either version 3 of the License, or + * (at your option) any later version. + * + * Smarc is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program. If not, see <http://www.gnu.org/licenses/>. + */ + +#ifndef __REMEZ_LP_H__ +#define __REMEZ_LP_H__ + +#define PI 3.1415926535897932 +#define PI2 6.2831853071795865 + +/** + * Compute minimal length of lowpass filter for given parameters (Remez's method) + * - fcuts [IN]: frequency bands (normalized form). Should be [0 fpass fcut 0.5] + * - mag [IN]: amplitudes in given bands. should be [1 0] for a lowpass filter + * - dev [IN]: accepted ripple factor in given bands. + * - weight [OUT]: weights to use in remez_lp + * return filter length. + */ +int remez_lp_order(const double* fcuts, const double* mag, const double* dev, + double* weight); + +/** + * Applying Remez method to build a lowpass filter matching the given parameters. + * - h [OUT]: array where to write result filter (already allocated) + * - filterLen [IN]: filter length (computed by remez_lp_order) + * - bands [IN]: frequency bands (normalized form). Should be [0 fpass fcut 0.5] + * - dev [IN]: accepted ripple factor in given bands + * - weight [IN]: weight computed by remez_lp_order + * return 0 if success -1 if failed + */ +int remez_lp(double h[], int filterLen, + double bands[], double dev[], double weight[]); + +#endif /* __REMEZ_H__ */ + diff --git a/C++/smarc/smarc.c b/C++/smarc/smarc.c new file mode 100644 index 0000000..4b60148 --- /dev/null +++ b/C++/smarc/smarc.c @@ -0,0 +1,391 @@ +/** + * Smarc + * + * Copyright (c) 2009-2011 Institut Télécom - Télécom Paristech + * Télécom ParisTech / dept. TSI + * + * Authors : Benoit Mathieu, Jacques Prado + * + * This file is part of Smarc. + * + * Smarc is free software: you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation, either version 3 of the License, or + * (at your option) any later version. + * + * Smarc is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program. If not, see <http://www.gnu.org/licenses/>. + */ + +#include "smarc.h" +#include "stage_impl.h" +#include "multi_stage.h" +#include "polyfilt.h" +#include <stdlib.h> +#include <stdio.h> +#include <string.h> +#include <math.h> + +#define FIRST_BUFFER_SIZE 512 + +struct PFilter +{ + int fsin; + int fsout; + double fpass; + double fstop; + double rp; + double rs; + int nb_stages; + struct PSFilter** filter; +}; + +int smarc_get_fs_in(struct PFilter* pfilt) +{ + return pfilt->fsin; +} + +int smarc_get_fs_out(struct PFilter* pfilt) +{ + return pfilt->fsout; +} + +int smarc_get_output_buffer_size(struct PFilter* pfilt,int inSize) +{ + int outSize = 1 + (int) ceil((double)inSize * (double) pfilt->fsout / (double) pfilt->fsin); + double stage_fsout = pfilt->fsin; + for (int i=0;i<pfilt->nb_stages;i++) + { + stage_fsout *= (double)pfilt->filter[i]->L / (double)pfilt->filter[i]->M; + outSize += ceil( pfilt->fsout * pfilt->filter[i]->filter_delay / stage_fsout); + } + return outSize; +} + + +struct PFilter* smarc_init_pfilter(int fsin, const int fsout, double bandwidth, double rp, double rs, double tol, const char* userratios, int searchfastconversion) +{ + if (fsout==fsin) + { + printf("ERROR: in and out samplerates are equals ! (%i Hz)\n",fsin); + return NULL; + } + + struct PMultiStageDef* pdef; + if (userratios!=NULL && strlen(userratios)>0) + { + pdef = get_user_ratios(fsin,fsout,userratios); + if (!pdef) + return NULL; + } else if (searchfastconversion) { + pdef = build_fast_ratios(fsin,fsout,tol,bandwidth,rp,rs); + } else { + pdef = get_predef_ratios(fsin,fsout); + if (!pdef) + { + pdef = build_auto_ratios(fsin,fsout, tol); + } + } + + if (!pdef) + { + printf("ERROR: cannot design multistage samplerate converter ! try to increase tolerance or define it yourself.\n"); + return NULL; + } + + struct PFilter* pfilt = malloc(sizeof(struct PFilter)); + pfilt->fsin = fsin; + pfilt->fsout = fsout; + pfilt->rp = rp; + pfilt->rs = rs; + + pfilt->nb_stages = pdef->nb_stages; + pfilt->filter = malloc(pfilt->nb_stages*sizeof(struct PSFilter*)); + + pfilt->fstop = (fsin>fsout ? fsout/2 : fsin/2); + double fpass = bandwidth*pfilt->fstop; + pfilt->fpass = fpass; + double stage_fsin = fsin; + for (int i=0;i<pdef->nb_stages;i++) + { + double fstop = 0; + double fmax = pdef->L[i]*stage_fsin; + if (pdef->L[i] > pdef->M[i]) + { + // interpolation + fstop = stage_fsin - pfilt->fstop; + } else { + // decimation + fstop = ((stage_fsin * pdef->L[i]) / pdef->M[i]) - (pfilt->fstop); + } + pfilt->filter[i] = init_psfilter(pdef->L[i],pdef->M[i], + fpass / fmax,fstop / fmax,rp,rs,pdef->nb_stages); + if (pfilt->filter[i]==NULL) + return NULL; + stage_fsin = (stage_fsin * pdef->L[i]) / pdef->M[i]; + } + if (fabs(stage_fsin - fsout) > tol*fsin) + { + printf("ERROR: multistage filter output %f != %i ! (there should be an error in multistage definition)\n", stage_fsin,fsout); + return NULL; + } else if (stage_fsin!=fsout) + { + printf("WARNING: output samplerate is %f\n",stage_fsin); + } + + destroy_multistagedef(pdef); + + return pfilt; +} + +void smarc_destroy_pfilter(struct PFilter* pfilt) +{ + for (int i=0;i<pfilt->nb_stages;i++) + destroy_psfilter(pfilt->filter[i]); + free(pfilt->filter); + free(pfilt); +} + +void smarc_print_pfilter(struct PFilter* pfilt) +{ + printf("multi-stage polyphase resample from %iHz to %iHz\n",pfilt->fsin,pfilt->fsout); + printf(" passband to %0.2fHz, passband ripple factor %0.2fdB\n",pfilt->fpass,pfilt->rp); + printf(" stopband from %0.2fHz, stopband ripple factor %0.2fdB\n", pfilt->fstop,pfilt->rs); + printf("successive resample stages are :\n"); + for (int s=0;s<pfilt->nb_stages;s++) + printf(" %i / %i : filter length = %i, delay = %i\n",pfilt->filter[s]->L,pfilt->filter[s]->M,pfilt->filter[s]->flen,pfilt->filter[s]->filter_delay); +} + +struct PStageBuffer +{ + double* data; + int size; + int pos; +}; + +struct PState +{ + int nb_stages; + struct PSState** state; + struct PStageBuffer** buffer; + // flush vars + double* flush_buf; + int flush_size; + int flush_pos; + int flush_stage; +}; + +struct PState* smarc_init_pstate(struct PFilter* pfilt) +{ + struct PState* pstate = malloc(sizeof(struct PState)); + pstate->nb_stages = pfilt->nb_stages; + pstate->flush_buf = NULL; + + // init states + pstate->state = malloc(pstate->nb_stages*sizeof(struct PSState*)); + for (int i=0;i<pstate->nb_stages;i++) + pstate->state[i] = init_psstate(pfilt->filter[i]); + + // init buffers + pstate->buffer = malloc((pstate->nb_stages+1)*sizeof(struct PStageBuffer*)); + int total_size = 0; + int current_buffer_size = 0; + for (int i=0;i<pstate->nb_stages+1;i++) + { + struct PStageBuffer* cbuf = malloc(sizeof(struct PStageBuffer)); + pstate->buffer[i] = cbuf; + if (i==0) { + current_buffer_size = FIRST_BUFFER_SIZE; + } + else { + current_buffer_size = current_buffer_size * pfilt->filter[i-1]->L / pfilt->filter[i-1]->M + 1; + } + int filter_len = 0; + if (i<pstate->nb_stages) + filter_len = pfilt->filter[i]->K - 1; + cbuf->size = current_buffer_size + filter_len; + cbuf->pos = 0; +// printf("buffer %i has buffer size %i + %i = %i \n",i,current_buffer_size,filter_len,cbuf->size); + total_size += cbuf->size; + } + + // allocate all buffer contiguously + pstate->buffer[0]->data = (double*) malloc(total_size*sizeof(double)); + for (int i=1;i<pstate->nb_stages+1;i++) + pstate->buffer[i]->data = pstate->buffer[i-1]->data + pstate->buffer[i-1]->size; + + // reset pstate before returning it + smarc_reset_pstate(pstate,pfilt); + return pstate; +} + +void smarc_destroy_pstate(struct PState* pstate) +{ + for (int i=0;i<pstate->nb_stages;i++) + destroy_psstate(pstate->state[i]); + free(pstate->buffer[0]->data); + for (int i=0;i<pstate->nb_stages+1;i++) + free(pstate->buffer[i]); + if (pstate->flush_buf) + free(pstate->flush_buf); + free(pstate->buffer); + free(pstate); +} + +void smarc_reset_pstate(struct PState* pstate, struct PFilter* pfilt) +{ + for (int i=0;i<pstate->nb_stages;i++) + reset_psstate(pstate->state[i],pfilt->filter[i]); + for (int i=0;i<pstate->nb_stages;i++) { + struct PStageBuffer* buf = pstate->buffer[i]; + buf->pos = pfilt->filter[i]->K - 1; + for (int k=0;k<buf->pos;k++) + buf->data[k] = 0; + } + pstate->buffer[pstate->nb_stages]->pos = 0; + if (pstate->flush_buf) { + free(pstate->flush_buf); + pstate->flush_buf = NULL; + } + pstate->flush_stage = 0; + pstate->flush_pos = 0; + pstate->flush_size = 0; +} + +int smarc_resample(struct PFilter* pfilt, struct PState* pstate, + const double* signal, + int signalLength, + double* output, + int outputLength) +{ + int nbRead = 0; + int nbWritten = 0; + unsigned char inputRemains = 1; // use it as a flag + while (inputRemains && nbWritten<outputLength) { + inputRemains = 0; +// printf("process signal %i/%i, written %i/%i\n",*nbRead,signalLength,*nbWritten,outputLength); + // fill first buffer + { + struct PStageBuffer* fbuf = pstate->buffer[0]; + int toRead = fbuf->size - fbuf->pos; + if (toRead>signalLength-nbRead) + toRead = signalLength - nbRead; + else + inputRemains = 1; +// printf("Push %i sample in first buffer %i/%i\n",toRead,fbuf->pos,fbuf->size); + if (toRead>0) { + memcpy(fbuf->data + fbuf->pos, signal + nbRead, toRead*sizeof(double)); + fbuf->pos += toRead; + nbRead += toRead; + } + } + // process all stages + for (int i=0;i<pfilt->nb_stages;i++) + { + struct PSFilter* filt = pfilt->filter[i]; + struct PSState* state = pstate->state[i]; + struct PStageBuffer* inbuf = pstate->buffer[i]; + struct PStageBuffer* outbuf = pstate->buffer[i+1]; + int nbStageRead; + int nbStageWritten; + polyfiltLM(filt,state,inbuf->data,inbuf->pos,&nbStageRead,outbuf->data + outbuf->pos,outbuf->size - outbuf->pos,&nbStageWritten); + +// printf("stage %i: read %i [%i/%i] write %i [%i/%i] K=%i\n",i,nbStageRead,inbuf->pos,inbuf->size,nbStageWritten,outbuf->pos,outbuf->size,filt->K); + + // keep non processed input + if (nbStageRead<inbuf->pos) { + memmove(inbuf->data, inbuf->data + nbStageRead, (inbuf->pos - nbStageRead)*sizeof(double)); + } + inbuf->pos -= nbStageRead; + if (inbuf->pos>filt->K-1) + inputRemains = 1; + + // update output pos + outbuf->pos += nbStageWritten; + } + // report last buffer to output + { + struct PStageBuffer* lbuf = pstate->buffer[pstate->nb_stages]; + int toWrite = lbuf->pos; + if (nbWritten + toWrite >= outputLength) { + printf("WARNING: cannot write all output samples, please provide larger output buffer !"); + toWrite = outputLength - nbWritten; + } +// printf("write %i samples from last buf %i/%i into output buffer %i/%i\n",toWrite,lbuf->pos,lbuf->size,*nbWritten,outputLength); + if (toWrite>0) + memcpy(output + nbWritten,lbuf->data,toWrite*sizeof(double)); + if (toWrite<lbuf->pos) + memmove(lbuf->data,lbuf->data+toWrite,(lbuf->pos-toWrite)*sizeof(double)); + nbWritten += toWrite; + lbuf->pos -= toWrite; + } + } + return nbWritten; +} + +int smarc_resample_flush(struct PFilter* pfilt, struct PState* pstate, + double* output, + int outputLength) +{ + int nbWritten = 0; + // flush all stages + while (pstate->flush_stage<pfilt->nb_stages && nbWritten<outputLength) + { +// printf("flushing stage %i [%i/%i]\n",pstate->flush_stage,pstate->flush_pos,pstate->flush_size); + struct PSFilter* filt = pfilt->filter[pstate->flush_stage]; + struct PStageBuffer* inbuf = pstate->buffer[pstate->flush_stage]; + if (pstate->flush_buf==NULL) { + int toFlush = filt->K - 1 - inbuf->pos + (filt->filter_delay * filt->M) / filt->L; + if (toFlush<(inbuf->size-inbuf->pos)) { +// printf("flushing straight %i samples\n",toFlush); + // just write flush samples into buffer + for (int k=0;k<toFlush;k++) + inbuf->data[inbuf->pos+k] = inbuf->data[inbuf->pos - 2 - k]; + inbuf->pos += toFlush; + } else { + // remember samples to flush + pstate->flush_buf = (double*) malloc(toFlush*sizeof(double)); + pstate->flush_size = toFlush; + for (int k=0;k<toFlush;k++) + pstate->flush_buf[k] = inbuf->data[inbuf->pos - 2 - k]; + // fill inbuf + for (int k=0;k<inbuf->size-inbuf->pos;k++) + inbuf->data[inbuf->pos+k] = pstate->flush_buf[k]; +// printf("flushing %i/%i samples\n", inbuf->size-inbuf->pos, toFlush); + pstate->flush_pos = inbuf->size-inbuf->pos; + inbuf->pos = inbuf->size; + } + } else { + // continue flushing + int toWrite = inbuf->size - inbuf->pos; + if (toWrite> (pstate->flush_size-pstate->flush_pos)) + toWrite = pstate->flush_size-pstate->flush_pos; + for (int k=0;k<toWrite;k++) + inbuf->data[inbuf->pos+k] = pstate->flush_buf[pstate->flush_pos+k]; +// printf("flushing next %i samples starting at %i/%i\n",toWrite,pstate->flush_pos,pstate->flush_size); + pstate->flush_pos += toWrite; + inbuf->pos += toWrite; + } + + // process filtering + nbWritten += smarc_resample(pfilt,pstate,NULL,0,output + nbWritten, outputLength - nbWritten); + + // check if all have been read + if ((inbuf->pos<filt->K) && (pstate->flush_pos==pstate->flush_size)) { + // end flushing this stage + if (pstate->flush_buf) { + free(pstate->flush_buf); + pstate->flush_buf = NULL; + pstate->flush_pos = 0; + pstate->flush_size = 0; + } + pstate->flush_stage++; + } + } + return nbWritten; +} diff --git a/C++/smarc/smarc.h b/C++/smarc/smarc.h new file mode 100644 index 0000000..6dae2c8 --- /dev/null +++ b/C++/smarc/smarc.h @@ -0,0 +1,138 @@ +/** + * Smarc + * + * Copyright (c) 2009-2011 Institut T�l�com - T�l�com Paristech + * T�l�com ParisTech / dept. TSI + * + * Authors : Benoit Mathieu, Jacques Prado + * + * This file is part of Smarc. + * + * Smarc is free software: you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation, either version 3 of the License, or + * (at your option) any later version. + * + * Smarc is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program. If not, see <http://www.gnu.org/licenses/>. + */ + +#ifndef SMARC_H_ +#define SMARC_H_ + +#ifdef __cplusplus +extern "C" { +#endif + +/** + * PFilter represent a multi-stage polyphase filter + */ +struct PFilter; + +/** + * Build a PFilter with given parameter. Given pointer must be free by calling destroy_pfilter function + * - fsin (IN) : frequency samplerate of input signal + * - fsout (IN) : desired frequency samplerate for output signal + * - bandwidth (IN) : bandwidth to keep, real in 0..1. For example, 0.95 means that 95% of maximum + * possible bandwidth is kept. Too high value may results in impossible filter to design. + * - rp (IN) : Passband ripple factor, in dB. + * - rs (IN) : Stopband ripple factor, in dB. + * - tol (IN) : samplerate conversion error tolerance. Usual value for tol is 0.000001. Usual frequencies conversion + * has exact samplerate conversion, but for unusual frequencies, in particular when fsin or fsout + * are large prime numbers, the user should accept a tolerance otherwise the filter may + * be impossible to design. + * - userratios (IN) : ratios to use to build multistage samplerate converter, in following format : + * 'L1/M2 L2/M2 ...'. This parameter is optional. + * - searchfastconversion (IN) : if 1 try to search fastest conversion stages. This may fail. + * if 0 use safe default conversion stages. + */ +struct PFilter* smarc_init_pfilter(int fsin, const int fsout, + double bandwidth, double rp, double rs, + double tol, const char* userratios, int searchfastconversion); + +/** + * release PFilter + */ +void smarc_destroy_pfilter(struct PFilter*); + +/** + * returns input frequency samplerate for PFilter + */ +int smarc_get_fs_in(struct PFilter*); + +/** + * return output frequency samplerate for PFilter + */ +int smarc_get_fs_out(struct PFilter*); + +/** + * return a recommended output buffer size to safely resample + * input signal chunks of length inSize with filter pfilt + */ +int smarc_get_output_buffer_size(struct PFilter* pfilt,int inSize); + +/** + * print PFilter informations to standard output + */ +void smarc_print_pfilter(struct PFilter*); + +/** + * PState represent a filter state. A PFilter may be used to filter several channels, each channels having its own PState. + */ +struct PState; + +/** + * Create a PState for a given PFilter. Returned pointer must be freed by destroy_pstate() + */ +struct PState* smarc_init_pstate(struct PFilter*); + +/** + * Free PState + */ +void smarc_destroy_pstate(struct PState*); + +/** + * Reset PState so that it can be used to process another signal. + */ +void smarc_reset_pstate(struct PState*, struct PFilter*); + +/** + * Resample a chunk of signal. + * - pfilter [IN]: PFilter used to resample + * - pstate [IN/OUT]: current state of resampler + * - signal [IN]: array holding signal to resample + * - signalLength [IN]: length of signal to resample + * - output [OUT]: buffer where to write resampled signal + * - outputLength [IN]: size of output buffer. + * Returns the number of output samples written. + */ +int smarc_resample(struct PFilter* pfilter, struct PState* pstate, + const double* signal, + int signalLength, + double* output, + int outputLength); + +/** + * Flush all sample in state considering there will be no more input signal. + * This function must be called only once. + * - pfilter [IN]: PFilter used to resample + * - pstate [IN/OUT]: current state of resampler + * - output [OUT]: buffer where to write resampled signal + * - outputLength [IN]: size of output buffer. + * Returns the number of output samples written. + */ +int smarc_resample_flush(struct PFilter*, struct PState*, + double* output, + int outputLength); + +#ifdef __cplusplus +} +#endif + + +#endif /* SMARC_H_ */ diff --git a/C++/smarc/stage_impl.c b/C++/smarc/stage_impl.c new file mode 100644 index 0000000..700cda3 --- /dev/null +++ b/C++/smarc/stage_impl.c @@ -0,0 +1,170 @@ +/** + * Smarc + * + * Copyright (c) 2009-2011 Institut Télécom - Télécom Paristech + * Télécom ParisTech / dept. TSI + * + * Authors : Benoit Mathieu, Jacques Prado + * + * This file is part of Smarc. + * + * Smarc is free software: you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation, either version 3 of the License, or + * (at your option) any later version. + * + * Smarc is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program. If not, see <http://www.gnu.org/licenses/>. + */ + +#include "stage_impl.h" +#include "filtering.h" +#include "polyfilt.h" + +#include <stdlib.h> +#include <stdio.h> +#include <math.h> +#include <string.h> + +#include "remez_lp.h" + +#define MAX_FILTER_LENGTH 8192 + +void build_filter(double fpass, double fstop, + double rp, double rs, int rpFactor, double** h, int* len, int lenStep) { + int i; + double *bands, *mag, *dev, *weight; + +// printf("build filter %f %f %f, %f/%i %f (lenstep=%i)\n",fpass,fstop,fmax,rp,rpFactor, rs,lenStep); + + bands = malloc(10 * sizeof(double)); + mag = &bands[4]; + dev = &mag[2]; + weight = &dev[2]; + + bands[0] = 0; + bands[1] = fpass; + bands[2] = fstop; + bands[3] = 0.5; + + mag[0] = 1; + mag[1] = 0; + + dev[0] = (pow(10, rp / 20.0) - 1) / (rpFactor *(pow(10, rp / 20.0) + 1)); + dev[1] = pow(10, -rs / 20.0); + + int n = remez_lp_order(bands, mag, dev, weight); + + // filter length must be 2*K*lenStep+1 so that delay is integer + { + int k = 1; + while (2*k*lenStep + 1 < n) + k++; + *len = 2*k*lenStep + 1; + } + + if (n>MAX_FILTER_LENGTH) + { + free(bands); + *len = 0; + printf("ERROR: cannot build remez filter, it's too long ! (%i) try with other parameters\n",n); + return; + } + + *h = malloc((*len) * sizeof(double)); + for (i = 0; i < *len; i++) + (*h)[i] = 0; + int iRc = remez_lp(*h, *len, bands, mag, weight); + if (iRc) + { + free(*h); + *h = NULL; + *len = 0; + } + + free(bands); +} + +struct PSFilter* init_psfilter(int L, int M, + double fpass, double fstop, + double rp, double rs, int rpFactor) { + + double* h = 0; + int Lenh; + + build_filter(fpass,fstop,rp, rs, rpFactor, &h, &Lenh,M); + if (Lenh==0) + { + printf("ERROR: cannot build filter %i/%i (within a %i stage filter) with parameters fpass=%0.2f fstop=%0.2f rp=%0.2f rs=%0.2f\n",L,M,rpFactor, fpass,fstop,rp,rs); + return NULL; + } + // ensure Lenh > M+L-1 + // (this is generally already true, but must check it for polyfiltLM) + while (Lenh<(L+M-1)) + Lenh += 2 * M; + + struct PSFilter* pfilt = malloc(sizeof(struct PSFilter)); + + // adjust filter gain + if (L>1) + for (int i = 0; i < Lenh; i++) + h[i] *= L; + + // filters + int K = Lenh / L; + if (Lenh > K*L) + K++; + pfilt->filters = malloc(L*K*sizeof(double)); + + if (L==1) + { + // decimation filter (only one filter) + for (int k=0;k<K;k++) + pfilt->filters[K-1-k] = h[k]; + } else { + // filter with interpolation (one filter per interpolation tap) + for (int i=0;i<L;i++) + pfilt->filters[i*K] = 0.0; + for (int i=0;i<Lenh;i++) + { + pfilt->filters[(i%L)*K+K-1-i/L] = h[i]; + } + } + + free(h); + + pfilt->flen = Lenh; + pfilt->M = M; + pfilt->L = L; + pfilt->K = K; + pfilt->filter_delay = (Lenh - 1) / (2*M); + + return pfilt; +} + +void destroy_psfilter(struct PSFilter* pfilt) { + free(pfilt->filters); + free(pfilt); +} + +struct PSState* init_psstate(struct PSFilter* pfilt) { + struct PSState* pstate = (struct PSState*) malloc(sizeof(struct PSState)); + pstate->skip = 0; + pstate->phase = 0; + reset_psstate(pstate,pfilt); + return pstate; +} + +void destroy_psstate(struct PSState* pstate) { + free(pstate); +} + +void reset_psstate(struct PSState* pstate, const struct PSFilter* pfilt) { + pstate->skip=pfilt->filter_delay; + pstate->phase = 0; +} diff --git a/C++/smarc/stage_impl.h b/C++/smarc/stage_impl.h new file mode 100644 index 0000000..8d24b1a --- /dev/null +++ b/C++/smarc/stage_impl.h @@ -0,0 +1,100 @@ +/** + * Smarc + * + * Copyright (c) 2009-2011 Institut T�l�com - T�l�com Paristech + * T�l�com ParisTech / dept. TSI + * + * Authors : Benoit Mathieu, Jacques Prado + * + * This file is part of Smarc. + * + * Smarc is free software: you can redistribute it and/or modify + * it under the terms of the GNU Lesser General Public License as published by + * the Free Software Foundation, either version 3 of the License, or + * (at your option) any later version. + * + * Smarc is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public License + * along with this program. If not, see <http://www.gnu.org/licenses/>. + */ + +#ifndef POLYPHASE_DECL_H_ +#define POLYPHASE_DECL_H_ + +#include "filtering.h" + +#define FILT(pfilt,m,l) &pfilt->filters[(m*L+l)*K] +#define FILT_STATE(pstate,m) &pstate->yi[m*(K-1)] + +/** + * Defines a filter stage. + * - flen: length of remez filter. (L*M*K) + * - L: interpolation factor + * - M: decimation factor + * - K: sub-filter length + * - filters: array of L*M sub filters of length K. (total size is flen) + */ +struct PSFilter { + int flen; + int L; + int M; + int K; + + double* filters; + int filter_delay; +}; + +/** + * Initialize PSFilter struct with given parameters + * - L [IN]: interpolation factor + * - M [IN]: decimation factor + * - fpass [IN]: start of lowpass filter transition band, in normalized form (0<fpass<0.5) + * - fstop [IN]: end of lowpass filter transition band, in normalized form (fpass<fstop<0.5) + * - rp [IN]: accepted ripple factor in pass band (in dB) within global structure. + * - rs [IN]: accepted ripple factor in stop band (in dB) + * - rpFactor [IN]: number of stage in global structure. + * + * Return pointer to PSFilter struct. This pointer must be deleted using destroy_psfilter function. + */ +struct PSFilter* init_psfilter(int L, int M, + double fpass, double fstop, + double rp, double rs, int rpFactor); + +/** + * Destroy PSFilter, release memory + */ +void destroy_psfilter(struct PSFilter*); + +/** + * Defines a filter stage state. + * - inbuf: input buffer + * - inbuf_size: input buffer allocated size + * - available: available samples in inbuf + * - skip: number of samples to skip (used to handle filter delay) + */ +struct PSState { + int skip; + int phase; +}; + +/** + * Initialize a filter stage state for the given filter stage + * The returned pointer must be freed by calling destroy_psstate + */ +struct PSState* init_psstate(struct PSFilter*); + +/** + * Destroy a filter stage state + */ +void destroy_psstate(struct PSState*); + +/** + * Reset a filter stage state so that an other signal can be filtered. + */ +void reset_psstate(struct PSState*, const struct PSFilter*); + +#endif /* POLYPHASE_DECL_H_ */ diff --git a/C++/xdf.cpp b/C++/xdf.cpp new file mode 100644 index 0000000..de694e9 --- /dev/null +++ b/C++/xdf.cpp @@ -0,0 +1,1033 @@ +//libxdf is a static C++ library to load XDF files +//Copyright (C) 2017 Yida Lin + +//This program is free software: you can redistribute it and/or modify +//it under the terms of the GNU General Public License as published by +//the Free Software Foundation, either version 3 of the License, or +//(at your option) any later version. + +//This program is distributed in the hope that it will be useful, +//but WITHOUT ANY WARRANTY; without even the implied warranty of +//MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +//GNU General Public License for more details. + +//You should have received a copy of the GNU General Public License +//along with this program. If not, see <http://www.gnu.org/licenses/>. +//If you have questions, contact author at ITAL_FAZIOLI@hotmail.com + + +#include "xdf.h" + +#include <iostream> +#include <fstream> +#include "pugixml/pugixml.hpp" //pugi XML parser +#include <sstream> +#include <algorithm> +#include "smarc/smarc.h" //resampling library +#include <time.h> /* clock_t, clock, CLOCKS_PER_SEC */ +#include <numeric> //std::accumulate + +Xdf::Xdf() +{ +} + +int Xdf::load_xdf(std::string filename) +{ + clock_t time; + time = clock(); + + + /* //uncompress if necessary + char ext[_MAX_EXT]; //for file extension + + _splitpath_s ( argv[1], NULL, NULL, NULL, NULL, NULL, NULL, ext, NULL ); + if (strcmp(ext, ".xdfz") == 0) + { + //uncompress + } + */ + + std::vector<int> idmap; //remaps stream id's onto indices in streams + + + //=================================================================== + //========================= parse the file ========================== + //=================================================================== + + + std::ifstream file(filename, std::ios::in | std::ios::binary); + + if (file.is_open()) + { + //read [MagicCode] + std::string magicNumber; + for (char c; file >> c;) + { + magicNumber.push_back(c); + if (magicNumber.size() == 4) + break; + } + + if (magicNumber.compare("XDF:")) + { + std::cout << "This is not a valid XDF file.('" << filename << "')\n"; + return -1; + } + + //for each chunk + while (1) + { + uint64_t ChLen = readLength(file);//chunk length + + if (ChLen == 0) + break; + + uint16_t tag; //read tag of the chunk, 6 possibilities + file.read(reinterpret_cast<char *>(&tag), 2); + + switch (tag) + { + case 1: //[FileHeader] + { + char* buffer = new char[ChLen - 2]; + file.read(buffer, ChLen - 2); + fileHeader = buffer; + + pugi::xml_document doc; + + doc.load_buffer_inplace(buffer, ChLen - 2); + + pugi::xml_node info = doc.child("info"); + + version = info.child("version").text().as_float(); + + delete[] buffer; + } + break; + case 2: //read [StreamHeader] chunk + { + //read [StreamID] + int streamID; + int index; + file.read((char*)&streamID, 4); + std::vector<int>::iterator it {std::find(idmap.begin(),idmap.end(),streamID)}; + if (it == idmap.end()) + { + index = idmap.size(); + idmap.emplace_back(streamID); + streams.emplace_back(); + } + else + index = std::distance(idmap.begin(), it); + + + pugi::xml_document doc; + + //read [Content] + char* buffer = new char[ChLen - 6]; + file.read(buffer, ChLen - 6); + streams[index].streamHeader = buffer; + + doc.load_buffer_inplace(buffer, ChLen - 6); + + pugi::xml_node info = doc.child("info"); + pugi::xml_node desc = info.child("desc"); + + streams[index].info.channel_count = info.child("channel_count").text().as_int(); + streams[index].info.nominal_srate = info.child("nominal_srate").text().as_double(); + streams[index].info.name = info.child("name").text().get(); + streams[index].info.type = info.child("type").text().get(); + streams[index].info.channel_format = info.child("channel_format").text().get(); + + for (auto channel = desc.child("channels").child("channel"); channel; channel = channel.next_sibling("channel")) + { + streams[index].info.channels.emplace_back(); + + for (auto const &entry : channel.children()) + streams[index].info.channels.back().emplace(entry.name(), entry.child_value()); + } + + if (streams[index].info.nominal_srate > 0) + streams[index].sampling_interval = 1 / streams[index].info.nominal_srate; + else + streams[index].sampling_interval = 0; + + delete[] buffer; + } + break; + case 3: //read [Samples] chunk + { + //read [StreamID] + int streamID; + int index; + file.read((char*)&streamID, 4); + std::vector<int>::iterator it {std::find(idmap.begin(),idmap.end(),streamID)}; + if (it == idmap.end()) + { + index = idmap.size(); + idmap.emplace_back(streamID); + streams.emplace_back(); + } + else + index = std::distance(idmap.begin(), it); + + + //read [NumSampleBytes], [NumSamples] + uint64_t numSamp = readLength(file); + + //check the data type + if (streams[index].info.channel_format.compare("float32") == 0) + { + //if the time series is empty + if (streams[index].time_series.empty()) + streams[index].time_series.resize(streams[index].info.channel_count); + + //for each sample + for (size_t i = 0; i < numSamp; i++) + { + //read or deduce time stamp + uint8_t tsBytes; + file.read(reinterpret_cast<char *>(&tsBytes), 1); + + double ts; //temporary time stamp + + if (tsBytes == 8) + { + file.read((char*)&ts, 8); + streams[index].time_stamps.emplace_back(ts); + } + else + { + ts = streams[index].last_timestamp + streams[index].sampling_interval; + streams[index].time_stamps.emplace_back(ts); + } + + streams[index].last_timestamp = ts; + + //read the data + for (int v = 0; v < streams[index].info.channel_count; ++v) + { + float data; + file.read((char*)&data, 4); + streams[index].time_series[v].emplace_back(data); + } + } + } + else if (streams[index].info.channel_format.compare("double64") == 0) + { + //if the time series is empty + if (streams[index].time_series.empty()) + streams[index].time_series.resize(streams[index].info.channel_count); + + //for each sample + for (size_t i = 0; i < numSamp; i++) + { + //read or deduce time stamp + uint8_t tsBytes; + file.read(reinterpret_cast<char *>(&tsBytes), 1); + + double ts; //temporary time stamp + + if (tsBytes == 8) + { + file.read((char*)&ts, 8); + streams[index].time_stamps.emplace_back(ts); + } + else + { + ts = streams[index].last_timestamp + streams[index].sampling_interval; + streams[index].time_stamps.emplace_back(ts); + } + + streams[index].last_timestamp = ts; + + //read the data + for (int v = 0; v < streams[index].info.channel_count; ++v) + { + double data; + file.read((char*)&data, 8); + streams[index].time_series[v].emplace_back(data); + } + } + } + else if (streams[index].info.channel_format.compare("int8") == 0) + { + //if the time series is empty + if (streams[index].time_series.empty()) + streams[index].time_series.resize(streams[index].info.channel_count); + + //for each sample + for (size_t i = 0; i < numSamp; i++) + { + //read or deduce time stamp + uint8_t tsBytes; + file.read(reinterpret_cast<char *>(&tsBytes), 1); + + double ts; //temporary time stamp + + if (tsBytes == 8) + { + file.read((char*)&ts, 8); + streams[index].time_stamps.emplace_back(ts); + } + else + { + ts = streams[index].last_timestamp + streams[index].sampling_interval; + streams[index].time_stamps.emplace_back(ts); + } + + streams[index].last_timestamp = ts; + + //read the data + for (int v = 0; v < streams[index].info.channel_count; ++v) + { + int8_t data; + file.read((char*)&data, 1); + streams[index].time_series[v].emplace_back(data); + } + } + } + else if (streams[index].info.channel_format.compare("int16") == 0) + { + //if the time series is empty + if (streams[index].time_series.empty()) + streams[index].time_series.resize(streams[index].info.channel_count); + + //for each sample + for (size_t i = 0; i < numSamp; i++) + { + //read or deduce time stamp + uint8_t tsBytes; + file.read(reinterpret_cast<char *>(&tsBytes), 1); + + double ts; //temporary time stamp + + if (tsBytes == 8) + { + file.read((char*)&ts, 8); + streams[index].time_stamps.emplace_back(ts); + } + else + { + ts = streams[index].last_timestamp + streams[index].sampling_interval; + streams[index].time_stamps.emplace_back(ts); + } + + streams[index].last_timestamp = ts; + + //read the data + for (int v = 0; v < streams[index].info.channel_count; ++v) + { + int16_t data; + file.read((char*)&data, 2); + streams[index].time_series[v].emplace_back(data); + } + } + } + else if (streams[index].info.channel_format.compare("int32") == 0) + { + //if the time series is empty + if (streams[index].time_series.empty()) + streams[index].time_series.resize(streams[index].info.channel_count); + + //for each sample + for (size_t i = 0; i < numSamp; i++) + { + //read or deduce time stamp + uint8_t tsBytes; + file.read(reinterpret_cast<char *>(&tsBytes), 1); + + double ts; //temporary time stamp + + if (tsBytes == 8) + { + file.read((char*)&ts, 8); + streams[index].time_stamps.emplace_back(ts); + } + else + { + ts = streams[index].last_timestamp + streams[index].sampling_interval; + streams[index].time_stamps.emplace_back(ts); + } + + streams[index].last_timestamp = ts; + + //read the data + for (int v = 0; v < streams[index].info.channel_count; ++v) + { + int32_t data; + file.read((char*)&data, 4); + streams[index].time_series[v].emplace_back(data); + } + } + } + else if (streams[index].info.channel_format.compare("int64") == 0) + { + //if the time series is empty + if (streams[index].time_series.empty()) + streams[index].time_series.resize(streams[index].info.channel_count); + + //for each sample + for (size_t i = 0; i < numSamp; i++) + { + //read or deduce time stamp + uint8_t tsBytes; + file.read(reinterpret_cast<char *>(&tsBytes), 1); + + double ts; //temporary time stamp + + if (tsBytes == 8) + { + file.read((char*)&ts, 8); + streams[index].time_stamps.emplace_back(ts); + } + else + { + ts = streams[index].last_timestamp + streams[index].sampling_interval; + streams[index].time_stamps.emplace_back(ts); + } + + streams[index].last_timestamp = ts; + + //read the data + for (int v = 0; v < streams[index].info.channel_count; ++v) + { + int64_t data; + file.read((char*)&data, 8); + streams[index].time_series[v].emplace_back(data); + } + } + } + else if (streams[index].info.channel_format.compare("string") == 0) + { + //for each event + for (size_t i = 0; i < numSamp; i++) + { + //read or deduce time stamp + uint8_t tsBytes; + file.read(reinterpret_cast<char *>(&tsBytes), 1); + + double ts; //temporary time stamp + + if (tsBytes == 8) + file.read((char*)&ts, 8); + else + ts = streams[index].last_timestamp + streams[index].sampling_interval; + + //read the event + int8_t bytes; + file.read((char*)&bytes, 1); + if (bytes == 1) + { + uint8_t length; + file.read((char*)&length, 1); + char* buffer = new char[length + 1]; + file.read(buffer, length); + buffer[length] = '\0'; + eventMap.emplace_back(std::make_pair(buffer, ts), index); + delete[] buffer; + } + else if (bytes == 4) + { + uint32_t length; + file.read((char*)&length, 4); + char* buffer = new char[length + 1]; + file.read(buffer, length); + buffer[length] = '\0'; + eventMap.emplace_back(std::make_pair(buffer, ts), index); + delete[] buffer; + } + else if (bytes == 8) + { + uint64_t length; + file.read((char*)&length, 8); + char* buffer = new char[length + 1]; + file.read(buffer, length); + buffer[length] = '\0'; + eventMap.emplace_back(std::make_pair(buffer, ts), index); + delete[] buffer; + } + + streams[index].last_timestamp = ts; + } + } + } + break; + case 4: //read [ClockOffset] chunk + { + int streamID; + int index; + file.read((char*)&streamID, 4); + std::vector<int>::iterator it {std::find(idmap.begin(),idmap.end(),streamID)}; + if (it == idmap.end()) + { + index = idmap.size(); + idmap.emplace_back(streamID); + streams.emplace_back(); + } + else + index = std::distance(idmap.begin(), it); + + + double collectionTime; + double offsetValue; + + file.read((char*)&collectionTime, 8); + file.read((char*)&offsetValue, 8); + + streams[index].clock_times.emplace_back(collectionTime); + streams[index].clock_values.emplace_back(offsetValue); + } + break; + case 6: //read [StreamFooter] chunk + { + pugi::xml_document doc; + + //read [StreamID] + int streamID; + int index; + file.read((char*)&streamID, 4); + std::vector<int>::iterator it {std::find(idmap.begin(),idmap.end(),streamID)}; + if (it == idmap.end()) + { + index = idmap.size(); + idmap.emplace_back(streamID); + streams.emplace_back(); + } + else + index = std::distance(idmap.begin(), it); + + + char* buffer = new char[ChLen - 6]; + file.read(buffer, ChLen - 6); + streams[index].streamFooter = buffer; + + doc.load_buffer_inplace(buffer, ChLen - 6); + + pugi::xml_node info = doc.child("info"); + + streams[index].info.first_timestamp = info.child("first_timestamp").text().as_double(); + streams[index].info.last_timestamp = info.child("last_timestamp").text().as_double(); + streams[index].info.measured_srate = info.child("measured_srate").text().as_double(); + streams[index].info.sample_count = info.child("sample_count").text().as_int(); + delete[] buffer; + } + break; + case 5: //skip other chunk types (Boundary, ...) + file.seekg(ChLen - 2, file.cur); + break; + default: + std::cout << "Unknown chunk encountered.\n"; + break; + } + } + + + //calculate how much time it takes to read the data + clock_t halfWay = clock() - time; + + std::cout << "it took " << halfWay << " clicks (" << ((float)halfWay) / CLOCKS_PER_SEC << " seconds)" + << " reading XDF data" << std::endl; + + + //========================================================== + //=============find the min and max time stamps============= + //========================================================== + + findMinMax(); + + findMajSR(); + + getHighestSampleRate(); + + loadSampleRateMap(); + + calcTotalChannel(); + + loadDictionary(); + + calcEffectiveSrate(); + + //loading finishes, close file + file.close(); + } + else + { + std::cout << "Unable to open file" << std::endl; + return 1; + } + + return 0; +} + +void Xdf::resample(int userSrate) +{ + //if user entered a preferred sample rate, we resample all the channels to that sample rate + //Otherwise, we resample all channels to the sample rate that has the most channels + + clock_t time = clock(); + +#define BUF_SIZE 8192 + for (auto &stream : streams) + { + if (!stream.time_series.empty() && + stream.info.nominal_srate != userSrate && + stream.info.nominal_srate != 0) + { + int fsin = stream.info.nominal_srate; // input samplerate + int fsout = userSrate; // output samplerate + double bandwidth = 0.95; // bandwidth + double rp = 0.1; // passband ripple factor + double rs = 140; // stopband attenuation + double tol = 0.000001; // tolerance + + // initialize smarc filter + struct PFilter* pfilt = smarc_init_pfilter(fsin, fsout, bandwidth, rp, + rs, tol, NULL, 0); + if (pfilt == NULL) + continue; + + // initialize smarc filter state + struct PState* pstate = smarc_init_pstate(pfilt); + + for (auto &row : stream.time_series) + { + // initialize buffers + int read = 0; + int written = 0; + const int OUT_BUF_SIZE = (int) smarc_get_output_buffer_size(pfilt, row.size()); + double* inbuf = new double[row.size()]; + double* outbuf = new double[OUT_BUF_SIZE]; + + + std::copy(row.begin(), row.end(), inbuf); + + read = row.size(); + + // resample signal block + written = smarc_resample(pfilt, pstate, inbuf, read, outbuf, OUT_BUF_SIZE); + + // do what you want with your output + row.resize(written); + std::copy ( outbuf, outbuf+written, row.begin() ); + + // flushing last values + written = smarc_resample_flush(pfilt, pstate, outbuf, OUT_BUF_SIZE); + + // do what you want with your output + row.resize(row.size() + written); + std::copy ( outbuf, outbuf+written, row.begin() + row.size() - written ); + + // you are done with converting your signal. + // If you want to reuse the same converter to process another signal + // just reset the state: + smarc_reset_pstate(pstate,pfilt); + + delete[] inbuf; + delete[] outbuf; + } + // release smarc filter state + smarc_destroy_pstate(pstate); + + // release smarc filter + smarc_destroy_pfilter(pfilt); + } + } + //resampling finishes here + + + //====================================================================== + //===========Calculating total length & total channel count============= + //====================================================================== + + + calcTotalLength(userSrate); + + adjustTotalLength(); + + time = clock() - time; + + std::cout << "it took " << time << " clicks (" << ((float)time) / CLOCKS_PER_SEC << " seconds)" + << " resampling" << std::endl; +} + +//function of reading the length of each chunk +uint64_t Xdf::readLength(std::ifstream &file) +{ + uint8_t bytes; + file.read((char*)&bytes, 1); + uint64_t length = 0; + + switch (bytes) + { + case 1: + { + uint8_t buffer = 0; + file.read(reinterpret_cast<char *>(&buffer), 1); + length = buffer; + return length; + } + case 4: + { + uint32_t buffer = 0; + file.read(reinterpret_cast<char *>(&buffer), 4); + length = buffer; + return length; + } + case 8: + { + file.read(reinterpret_cast<char *>(&length), 8); + return length; + } + default: + std::cout << "Invalid variable-length integer encountered.\n"; + return 0; + } +} + +void Xdf::findMinMax() +{ + //find the smallest timestamp of all streams + for (auto const &stream : streams) + { + if (stream.info.first_timestamp != -1) + { + minTS = stream.info.first_timestamp; + break; + } + } + for (auto const &stream : streams) + { + if (stream.info.first_timestamp != -1 && stream.info.first_timestamp < minTS) + minTS = stream.info.first_timestamp; + } + + //find the max timestamp of all streams + for (auto const &stream : streams) + { + if (stream.info.last_timestamp != 0 && stream.info.last_timestamp > maxTS) + maxTS = stream.info.last_timestamp; + } +} + +void Xdf::findMajSR() +{ + // find out which sample rate has the most channels + typedef int sampRate; + typedef int numChannel; + + std::vector<std::pair<sampRate, numChannel> > srateMap; //<srate, numChannels> pairs of all the streams + + //find out whether a sample rate already exists in srateMap + for (auto const &stream : streams) + { + if (stream.info.nominal_srate != 0) + { + std::vector<std::pair<sampRate, numChannel> >::iterator it {std::find_if(srateMap.begin(), srateMap.end(), + [&](const std::pair<sampRate, numChannel> &element) + {return element.first == stream.info.nominal_srate; })} ; + //if it doesn't, add it here + if (it == srateMap.end()) + srateMap.emplace_back(stream.info.nominal_srate, stream.info.channel_count); + //if it already exists, add additional channel numbers to that sample rate + else + { + int index (std::distance(srateMap.begin(),it)) ; + srateMap[index].second += stream.info.channel_count; + } + } + } + + //search the srateMap to see which sample rate has the most channels + int index (std::distance(srateMap.begin(), + std::max_element(srateMap.begin(),srateMap.end(), + [] (const std::pair<sampRate, numChannel> &largest, + const std::pair<sampRate, numChannel> &first) + { return largest.second < first.second; }))); + + majSR = srateMap[index].first; //the sample rate that has the most channels +} + +void Xdf::calcTotalChannel() +{ + //calculating total channel count, and indexing them onto streamMap + for (size_t c = 0; c < streams.size(); c++) + { + if(!streams[c].time_series.empty()) + { + totalCh += streams[c].info.channel_count; + + for (int i = 0; i < streams[c].info.channel_count; i++) + streamMap.emplace_back(c); + } + } +} + +void Xdf::calcTotalLength(int sampleRate) +{ + totalLen = (maxTS - minTS) * sampleRate; +} + +void Xdf::freeUpTimeStamps() +{ + //free up as much memory as possible + for (auto &stream : streams) + { + //we don't need to keep all the time stamps unless it's a stream with irregular samples + //filter irregular streams and string streams + if (stream.info.nominal_srate != 0 && !stream.time_stamps.empty() && stream.info.channel_format.compare("string")) + { + std::vector<double> nothing; + //however we still need to keep the first time stamp of each stream to decide at which position the signal should start + nothing.emplace_back(stream.time_stamps.front()); + stream.time_stamps.swap(nothing); + } + } +} + +void Xdf::adjustTotalLength() +{ + for (auto const &stream : streams) + { + if(!stream.time_series.empty()) + { + if (totalLen < stream.time_series.front().size()) + totalLen = stream.time_series.front().size(); + } + } +} + +void Xdf::getHighestSampleRate() +{ + for (auto const &stream : streams) + { + if (stream.info.nominal_srate > maxSR) + maxSR = stream.info.nominal_srate; + } +} + +void Xdf::loadSampleRateMap() +{ + for (auto const &stream : streams) + sampleRateMap.emplace(stream.info.nominal_srate); +} + +void Xdf::detrend() +{ + for (auto &stream : streams) + { + for (auto &row : stream.time_series) + { + long double init = 0.0; + long double mean = std::accumulate(row.begin(), row.end(), init) / row.size(); + std::transform(row.begin(), row.end(), row.begin(), bind2nd(std::minus<double>(), mean)); + offsets.emplace_back(mean); + } + } +} + +void Xdf::calcEffectiveSrate() +{ + for (auto &stream : streams) + { + if (stream.info.nominal_srate) + { + try + { + stream.info.effective_sample_rate + = stream.info.sample_count / + (stream.info.last_timestamp - stream.info.first_timestamp); + + if (stream.info.effective_sample_rate) + effectiveSampleRateVector.emplace_back(stream.info.effective_sample_rate); + + pugi::xml_document doc; + doc.load_string(stream.streamFooter.c_str()); + pugi::xml_node sampleCount = doc.child("info").child("sample_count"); + pugi::xml_node effectiveSampleRate + = doc.child("info").insert_child_after("effective_sample_rate", sampleCount); + effectiveSampleRate.append_child(pugi::node_pcdata) + .set_value(std::to_string(stream.info.effective_sample_rate).c_str()); + + std::stringstream buffer; + doc.save(buffer); + + stream.streamFooter = buffer.str(); + } + catch (std::exception &e) + { + std::cerr << "Error calculating effective sample rate. " + << e.what() << std::endl; + } + } + } +} + +int Xdf::writeEventsToXDF(std::string file_path) +{ + if (userAddedStream) + { + std::fstream file; + file.open(file_path, std::ios::app | std::ios::binary); + + if (file.is_open()) + { + //start to append to new XDF file + //first write a stream header chunk + //Num Length Bytes + file.put(4); + //length + int length = streams[userAddedStream].streamHeader.size() + 6; //+6 because of the length int itself and short int tag + file.write((char*)&length, 4); + + //tag + short tag = 2; + file.write((char*)&tag, 2); + //streamNumber + int streamNumber = userAddedStream + 1; //+1 because the stream IDs in XDF are 1 based instead of 0 based + file.write((char*)&streamNumber, 4); + //content + file.write(streams[userAddedStream].streamHeader.c_str(), length - 6);//length - 6 is the string length + + //write samples chunk + //Num Length Bytes + file.put(8); + //length + //add the bytes of all following actions together + int64_t stringTotalLength = 0; + for (auto const &event : userCreatedEvents) + stringTotalLength += event.first.size(); + + int64_t sampleChunkLength = 2 + 4 + 1 + 4 + + userCreatedEvents.size() * + (1 + 8 + 1 + 4) + stringTotalLength; + file.write((char*)&sampleChunkLength, 8); + + + //tag + tag = 3; + file.write((char*)&tag, 2); + //streamNumber + file.write((char*)&streamNumber, 4); + //content + //NumSamplesBytes + file.put(4); + + //Num Samples + int numSamples = userCreatedEvents.size(); + file.write((char*)&numSamples, 4); + + //samples + for (auto const &event : userCreatedEvents) + { + //TimeStampBytes + file.put(8); + + //Optional Time Stamp + double timeStamp = event.second; + file.write((char*)&timeStamp, 8); + + //Num Length Bytes + file.put(4); + + //Length + int stringLength = event.first.length(); + file.write((char*)&stringLength, 4); + + //String Content + file.write(event.first.c_str(), stringLength); + } + + file.close(); + } + else + { + std::cerr << "Unable to open file." << std::endl; + return -1; //Error + } + } + + std::cout << "Succesfully wrote to XDF file." << std::endl; + + return 0; //Success +} + +void Xdf::createLabels() +{ + size_t channelCount = 0; + + for (size_t st = 0; st < streams.size(); st++) + { + if (streams[st].info.channels.size()) + { + for (size_t ch = 0; ch < streams[st].info.channels.size(); ch++) + { + // +1 for 1 based numbers; for user convenience only. The internal computation is still 0 based + std::string label = "Stream " + std::to_string(st + 1) + " - Channel " + std::to_string(ch + 1) + + " - " + std::to_string((int)streams[st].info.nominal_srate) + " Hz\n"; + + label += streams[st].info.name + '\n'; + + for (auto const &entry : streams[st].info.channels[ch]) + { + if (entry.second != "") + label += entry.first + " : " + entry.second + '\n'; + } + if (offsets.size()) + { + if (offsets[channelCount] >= 0) + label.append("baseline +").append(std::to_string(offsets[channelCount])); + else + label.append("baseline ").append(std::to_string(offsets[channelCount])); + } + labels.emplace_back(label); + + channelCount++; + } + } + else + { + for (size_t ch = 0; ch < streams[st].time_series.size(); ch++) + { + // +1 for 1 based numbers; for user convenience only. The internal computation is still 0 based + std::string label = "Stream " + std::to_string(st + 1) + + " - Channel " + std::to_string(ch + 1) + " - " + + std::to_string((int)streams[st].info.nominal_srate) + + " Hz\n" + streams[st].info.name + '\n' + streams[st].info.type + '\n'; + + label += streams[st].info.name + '\n'; + + if (offsets.size()) + { + if (offsets[channelCount] >= 0) + label.append("baseline +").append(std::to_string(offsets[channelCount])); + else + label.append("baseline ").append(std::to_string(offsets[channelCount])); + } + + labels.emplace_back(label); + + channelCount++; + } + } + } +} + +void Xdf::loadDictionary() +{ + //loop through the eventMap + for (auto const &entry : eventMap) + { + //search the dictionary to see whether an event is already in it + auto it = std::find(dictionary.begin(),dictionary.end(),entry.first.first); + //if it isn't yet + if (it == dictionary.end()) + { //add it to the dictionary, also store its index into eventType vector for future use + eventType.emplace_back(dictionary.size()); + dictionary.emplace_back(entry.first.first); + } + //if it's already in there + else //store its index into eventType vector + eventType.emplace_back(std::distance(dictionary.begin(), it)); + } +} diff --git a/C++/xdf.h b/C++/xdf.h new file mode 100644 index 0000000..540e592 --- /dev/null +++ b/C++/xdf.h @@ -0,0 +1,297 @@ +//libxdf is a static C++ library to load XDF files +//Copyright (C) 2017 Yida Lin + +//This program is free software: you can redistribute it and/or modify +//it under the terms of the GNU General Public License as published by +//the Free Software Foundation, either version 3 of the License, or +//(at your option) any later version. + +//This program is distributed in the hope that it will be useful, +//but WITHOUT ANY WARRANTY; without even the implied warranty of +//MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +//GNU General Public License for more details. + +//You should have received a copy of the GNU General Public License +//along with this program. If not, see <http://www.gnu.org/licenses/>. +//If you have questions, contact author at ITAL_FAZIOLI@hotmail.com + +/*! \file xdf.h + * \brief The header file of Xdf class + */ + +#ifndef XDF_H +#define XDF_H + +#include <string> +#include <vector> +#include <map> +#include <set> + +/*! \class Xdf + * + * Xdf class is designed to store the data of an entire XDF file. + * It comes with methods to read XDF files and containers to store + * the data, as well as some additional methods e.g. resampling etc. + */ + +class Xdf +{ +public: + //! Default constructor with no parameter. + Xdf(); + + //subclass for single streams + /*! \class Stream + * + * XDF files uses stream as the unit to store data. An XDF file usually + * contains multiple streams, while each of them may contain one or more + * channels. + * The Stream class provides a handy way to store all the meta-data, + * time-series, time-stamps and all other information of a single stream + * from an XDF file. + */ + struct Stream + { + //! A 2D vector which stores the time series of a stream. Each row represents a channel. + std::vector<std::vector<float> > time_series; + std::vector<double> time_stamps; /*!< A vector to store time stamps. */ + std::string streamHeader; /*!< Raw XDF of stream header chunk. */ + std::string streamFooter; /*!< Raw XDF of stream footer chunk. */ + + struct + { + int channel_count; /*!< Number of channels of the current stream */ + double nominal_srate; /*!< The nominal sample rate of the current stream. */ + std::string name; /*!< Name of the current stream. */ + std::string type; /*!< Type of the current stream. */ + std::string channel_format;/*!< Channel format of the current stream. */ + + std::vector<std::map<std::string, std::string> > channels;/*!< A vector to store the meta-data of the channels of the current stream. */ + + std::vector<std::pair<double, double> > clock_offsets; /*!< A vector to store clock offsets from the ClockOffset chunk. */ + + double first_timestamp; /*!< First time stamp of the stream. */ + double last_timestamp; /*!< Last time stamp of the stream. */ + int sample_count; /*!< Sample count of the stream. */ + double measured_srate; /*!< Measured sample rate of the stream. */ + double effective_sample_rate = 0;/*!< Effective sample rate. */ + } info; /*!< Meta-data from the stream header of the current stream. */ + + double last_timestamp{ 0 }; /*!< For temporary use while loading the vector */ + double sampling_interval; /*!< If srate > 0, sampling_interval = 1/srate; otherwise 0 */ + std::vector<double> clock_times;/*!< Vector of clock times from clock offset chunk (Tag 4). */ + std::vector<double> clock_values;/*!< Vector of clock values from clock offset chunk (Tag 4). */ + }; + + //XDF properties================================================================================= + + std::vector<Stream> streams; /*!< A vector to store all the streams of the current XDF file. */ + float version; /*!< The version of XDF file */ + + uint64_t totalLen = 0; /*!< The total length is the product of the range between the smallest + *time stamp and the largest multiplied by the major sample rate. */ + + double minTS = 0; /*!< The smallest time stamp across all streams. */ + double maxTS = 0; /*!< The largest time stamp across all streams. */ + size_t totalCh = 0; /*!< The total number of channel count. */ + int majSR = 0; /*!< The sample rate that has the most channels across all streams. */ + int maxSR = 0; /*!< Highest sample rate across all streams. */ + std::vector<double> effectiveSampleRateVector; /*!< Effective Sample Rate of each stream. */ + double fileEffectiveSampleRate = 0; /*!< If effective sample rates in all the streams are the same, this is the value. */ + std::vector<int> streamMap;/*!< A vector indexes which channels belong to which stream. + * The index is the same as channel number; the actual content is the stream Number */ + + /*! + * \brief Used as `std::vector<std::pair<std::pair<eventName, eventTimeStamp>, int> >` + * in eventMap. + * \sa eventMap + */ + typedef std::string eventName; + /*! + * \brief Used as `std::vector<std::pair<std::pair<eventName, eventTimeStamp>, int> >` + * in eventMap. + * \sa eventMap + */ + typedef double eventTimeStamp; + + std::vector<std::pair<std::pair<eventName, eventTimeStamp>, int> > eventMap;/*!< The vector to store all the events across all streams. + * The format is <<events, timestamps>, streamNum>. */ + std::vector<std::string> dictionary;/*!< The vector to store unique event types with no repetitions. \sa eventMap */ + std::vector<uint16_t> eventType; /*!< The vector to store events by their index in the dictionary.\sa dictionary, eventMap */ + std::vector<std::string> labels; /*!< The vector to store descriptive labels of each channel. */ + std::set<double> sampleRateMap; /*!< The vector to store all sample rates across all the streams. */ + std::vector<float> offsets; /*!< Offsets of each channel after using subtractMean() function */ + + std::string fileHeader; /*!< Raw XML of the file header. */ + int userAddedStream { 0 }; /*!< For Sigviewer only: if user manually added events in Sigviewer, + * the events will be stored in a new stream after all current streams. + * The index will be userAddedStream. */ + std::vector<std::pair<std::string, double> > userCreatedEvents;/*!< User created events in Sigviewer. */ + + //Public Functions============================================================================================== + + /*! + * \brief Adjust `totalLen` to avoid possible deviation + * + * `totalLen` is calculated by multiplying the difference between max time + * stamp and minimal time stamp by the `majSR` (major sample rate). + * However, this can be inaccurate. In case any channel is longer than + * `totalLen`, this function will make `totalLen` match the length of + * that channel. + * + * \sa totalLen, majSR, calcTotalLength() + */ + void adjustTotalLength(); + + /*! + * \brief Calculate the globle length (in samples). + * + * This is calculated by multiplying the rage from the earliest + * time stamp to the last time stamp across all channels by the + * parameter sampleRate. + * + * \param sampleRate is the sample rate you wish to use to calculate the + * total length. + */ + void calcTotalLength(int sampleRate); + + /*! + * \brief Create labels for each channel and store them in _labels_ vector. + * \sa labels, offsets + */ + void createLabels(); + + /*! + * \brief Subtract the entire channel by its mean. + * + * Sigviewer displays both the channel signals as well as the zero baseline. + * Thus when the mean of a channel is too high or too low it would be very + * hard to see the fluctuation. Subtract the entire channel by its mean + * will make the signal fluctuate around the zero baseline, and has better + * visual effect. The mean of each channel times `-1` will be stored in + * member vector `offsets` + * + * \sa offsets + */ + void detrend(); + + /*! + * \brief Delete the time stamps vectors when no longer needed to + * release some memory. + * + * Sigviewer doesn't demand time stamps to display signals except + * irregular sample rate channels, events, and the first time stamp + * of each channel (used to decide where does a channel start when + * putting all streams together). In this case we can delete the time + * stamps when no longer needed to free up some memory. + */ + void freeUpTimeStamps(); + + /*! + * \brief The main function of loading an XDF file. + * \param filename is the path to the file being loaded including the + * file name. + */ + int load_xdf(std::string filename); + + /*! + * \brief Resample all streams and channel to a chosen sample rate + * \param userSrate is recommended to be between integer 1 and + * the highest sample rate of the current file. + */ + void resample(int userSrate); + + /*! + * \brief writeEventsToXDF + * + * If user added some markups and events in Sigviewer, this function can + * store those user created events back to the XDF file in a new stream + */ + int writeEventsToXDF(std::string file_path); + + //Private Functions: Not intended to be used by external programs====================================== + +private: + + /*! + * \brief calcEffectiveSrate + */ + void calcEffectiveSrate(); + + /*! + * \brief Calculate the total channel count and store the result + * in `totalCh`. + * + * Channels of both regular and irregular sample rates are included. + * The streams with the channel format `string` are excluded, and are + * stored in `eventMap` instead. + * + * \sa totalCh, eventMap + */ + void calcTotalChannel(); + + /*! + * \brief Find the sample rate that has the most channels. + * + * XDF format supports different sample rates across streams, but + * Sigviewer needs to display all channels in a unified sample rate. + * Thus if there are more than one sample rate in the file, some channels + * need to be resampled in order to be displayed. + * + * Libxdf uses third party _smarc_ library to do the resampling task. + * While _smarc_ library is powerful in the sense that it can resample + * signals to almost any sample rate, it's fairly slow, and for performance + * reason it's better to minimize the resampling process. + * + * findMajSR() will find which sample rate currently has the most channels + * in the file. If only those channels with a different sample rate are to + * be resampled, the resampling process will be finished in the shortest + * possible period. + * + * \sa majSR, resample(int userSrate) + */ + void findMajSR(); + + /*! + * \brief Find the minimal and maximal time stamps across all streams. + * + * The results will be stored in member variables `minTS` and `maxTS` respectively. + * \sa minTS, maxTS, calcTotalLength(int sampleRate); + */ + void findMinMax(); + + /*! + * \brief Get the highest sample rate of all streams and store + * it in `maxSR`. + * + * \sa maxSR + */ + void getHighestSampleRate(); + + /*! + * \brief Copy all unique types of events from _eventMap_ to + * _dictionary_ with no repeats. + * \sa dictionary, eventMap + */ + void loadDictionary(); + + /*! + * \brief Load every sample rate appeared in the current file into + * member variable `sampleRateMap`. + * \sa sampleRateMap + */ + void loadSampleRateMap(); + + /*! + * \brief This function will get the length of the upcoming chunk, or the number of samples. + * + * While loading XDF file there are 2 cases where this function will be + * needed. One is to get the length of each chunk, one is to get the + * number of samples when loading the time series (Chunk tag 3). + * \param file is the XDF file that is being loaded in the type of `std::ifstream`. + * \return The length of the upcoming chunk (in bytes). + */ + uint64_t readLength(std::ifstream &file); +}; + +#endif // XDF_H diff --git a/C++/xdf.pro b/C++/xdf.pro new file mode 100644 index 0000000..40df18e --- /dev/null +++ b/C++/xdf.pro @@ -0,0 +1,35 @@ +QT -= gui + +TARGET = xdf +TEMPLATE = lib +CONFIG += c++11 shared_and_static build_all + +QMAKE_CFLAGS += -std=c99 + +SOURCES += xdf.cpp \ + smarc/filtering.c \ + smarc/multi_stage.c \ + smarc/polyfilt.c \ + smarc/remez_lp.c \ + smarc/smarc.c \ + smarc/stage_impl.c \ + pugixml/pugixml.cpp + +HEADERS += xdf.h \ + smarc/filtering.h \ + smarc/multi_stage.h \ + smarc/polyfilt.h \ + smarc/remez_lp.h \ + smarc/smarc.h \ + smarc/stage_impl.h \ + pugixml/pugiconfig.hpp \ + pugixml/pugixml.hpp + +unix { + target.path = /usr/lib + INSTALLS += target +} + +macx { + QMAKE_MACOSX_DEPLOYMENT_TARGET = 10.9 +}