diff --git a/content/dynamic/examples/advanced_graphics/level.lua b/content/dynamic/examples/advanced_graphics/level.lua new file mode 100644 index 0000000..27143aa --- /dev/null +++ b/content/dynamic/examples/advanced_graphics/level.lua @@ -0,0 +1,10 @@ +pewpew.set_level_size(500fx, 500fx) + +local background1 = pewpew.new_customizable_entity(0fx, 0fx) +pewpew.customizable_entity_set_mesh(background1, "/dynamic/examples/advanced_graphics/polar_graphic.lua", 0) + +local background2 = pewpew.new_customizable_entity(200fx, 200fx) +pewpew.customizable_entity_set_mesh(background2, "/dynamic/examples/advanced_graphics/polar_graphic.lua", 1) + + +pewpew.new_player_ship(100fx, 100fx, 0) \ No newline at end of file diff --git a/content/dynamic/examples/advanced_graphics/polar_graphic.lua b/content/dynamic/examples/advanced_graphics/polar_graphic.lua new file mode 100755 index 0000000..ec5c9cd --- /dev/null +++ b/content/dynamic/examples/advanced_graphics/polar_graphic.lua @@ -0,0 +1,40 @@ + + +function f1(angle) + return 100 * (1.0 - math.cos(angle) * math.sin(3 * angle)) +end + +function f2(angle) + return 200 * (math.cos(angle) + math.sin(4 * angle)) +end + +function mesh_from_polar_function(f) + computed_vertexes = {} + + local index = 0 + local line = {} + for angle = 0, math.pi * 2, 0.05 do + local radius = f(angle) + local x = math.cos(angle) * radius + local y = math.sin(angle) * radius + table.insert(computed_vertexes, {x, y}) + table.insert(line, index) + index = index + 1 + end + + -- Close the loop + table.insert(line, 0) + + return { + vertexes = computed_vertexes, + segments = {line}, + } +end + + + +meshes = { + mesh_from_polar_function(f1), + mesh_from_polar_function(f2), +} + diff --git a/content/dynamic/examples/complex_level/level.lua b/content/dynamic/examples/advanced_level/level.lua similarity index 97% rename from content/dynamic/examples/complex_level/level.lua rename to content/dynamic/examples/advanced_level/level.lua index 66b7a2a..f593e34 100755 --- a/content/dynamic/examples/complex_level/level.lua +++ b/content/dynamic/examples/advanced_level/level.lua @@ -5,7 +5,7 @@ pewpew.set_level_size(width, height) -- Create an entity at position (0,0) that will hold the background mesh. local background = pewpew.new_customizable_entity(0fx, 0fx) -pewpew.customizable_entity_set_mesh(background, "/dynamic/examples/complex_level/rectangles_graphic.lua", 0) +pewpew.customizable_entity_set_mesh(background, "/dynamic/examples/advanced_level/rectangles_graphic.lua", 0) -- Configure the player, with 2 shields. pewpew.configure_player(0, {shield = 2}) diff --git a/content/dynamic/examples/complex_level/rectangles_graphic.lua b/content/dynamic/examples/advanced_level/rectangles_graphic.lua similarity index 100% rename from content/dynamic/examples/complex_level/rectangles_graphic.lua rename to content/dynamic/examples/advanced_level/rectangles_graphic.lua diff --git a/content/dynamic/examples/complex_graphics/level.lua b/content/dynamic/examples/complex_graphics/level.lua deleted file mode 100644 index 902eaf3..0000000 --- a/content/dynamic/examples/complex_graphics/level.lua +++ /dev/null @@ -1,6 +0,0 @@ -pewpew.set_level_size(500fx, 500fx) - -local polar_function_background = pewpew.new_customizable_entity(0fx, 0fx) -pewpew.customizable_entity_set_mesh(polar_function_background, "/dynamic/examples/complex_graphics/polar_graphic.lua", 0) - -pewpew.new_player_ship(100fx, 100fx, 0) \ No newline at end of file diff --git a/content/dynamic/examples/complex_graphics/polar_graphic.lua b/content/dynamic/examples/complex_graphics/polar_graphic.lua deleted file mode 100755 index 9a41bd3..0000000 --- a/content/dynamic/examples/complex_graphics/polar_graphic.lua +++ /dev/null @@ -1,31 +0,0 @@ -computed_vertexes = {} -computed_segments = {} - -function polar_func(angle) - return 100 * (1.0 - math.cos(angle) * math.sin(3 * angle)) -end - -function polar_to_cartesian(angle, radius) - return math.cos(angle) * radius, math.sin(angle) * radius -end - -local index = 0 -local line = {} -for angle = 0, math.pi * 2, 0.1 do - local radius = polar_func(angle) - local x,y = polar_to_cartesian(angle, radius) - table.insert(computed_vertexes, {x, y}) - table.insert(line, index) - index = index + 1 -end - --- Close the loop -table.insert(line, 0) - -meshes = { - { - vertexes = computed_vertexes, - segments = {line}, - } -} - diff --git a/content/dynamic/examples/simple_level/square500x500_graphic.lua b/content/dynamic/examples/simple_level/square500x500_graphic.lua index 0d04465..25c5689 100755 --- a/content/dynamic/examples/simple_level/square500x500_graphic.lua +++ b/content/dynamic/examples/simple_level/square500x500_graphic.lua @@ -1,6 +1,7 @@ meshes = { { vertexes = {{0,0}, {500,0}, {500,500}, {0,500}}, + colors = {0xffffffff, 0xffff00ff, 0xff00ffff, 0x00ff0000}, segments = {{0,1,2,3,0}} } } diff --git a/content/dynamic/examples/sounds/level.lua b/content/dynamic/examples/sounds/level.lua new file mode 100755 index 0000000..57e8cbf --- /dev/null +++ b/content/dynamic/examples/sounds/level.lua @@ -0,0 +1,29 @@ +local width = 500fx +local height = 500fx +pewpew.set_level_size(width, height) + +local time = 0 + +local background = pewpew.new_customizable_entity(0fx, 0fx) +pewpew.customizable_entity_set_mesh(background, "/dynamic/examples/sounds/square500x500_graphic.lua", 0) + +pewpew.new_player_ship(250fx, 250fx, 0) + +function level_tick() + if time % 30 == 0 then + local x = 100fx + local y = 100fx + pewpew.play_sound("/dynamic/examples/sounds/sounds.lua", 0, x, y) + pewpew.create_explosion(x, y, 0xff0000ff, 1fx, 50) + end + if time % 30 == 15 then + local x = 400fx + local y = 400fx + pewpew.play_sound("/dynamic/examples/sounds/sounds.lua", 1, x, y) + pewpew.create_explosion(x, y, 0x00ffffff, 1fx, 50) + end + time = time + 1 +end + +-- Register the `level_tick` function to be called at every game tick. +pewpew.add_update_callback(level_tick) \ No newline at end of file diff --git a/content/dynamic/examples/sounds/sounds.lua b/content/dynamic/examples/sounds/sounds.lua new file mode 100755 index 0000000..4d9c091 --- /dev/null +++ b/content/dynamic/examples/sounds/sounds.lua @@ -0,0 +1,12 @@ +sounds = { + { + frequency = 1000, + decay = 0.5, + waveform = "tangent", + }, + { + frequency = 500, + decay = 0.5, + waveform = "triangle", + } +} diff --git a/content/dynamic/examples/sounds/square500x500_graphic.lua b/content/dynamic/examples/sounds/square500x500_graphic.lua new file mode 100755 index 0000000..0d04465 --- /dev/null +++ b/content/dynamic/examples/sounds/square500x500_graphic.lua @@ -0,0 +1,6 @@ +meshes = { + { + vertexes = {{0,0}, {500,0}, {500,500}, {0,500}}, + segments = {{0,1,2,3,0}} + } +} diff --git a/content/dynamic/examples/tutorial/box_graphics.lua b/content/dynamic/examples/tutorial/box_graphics.lua index fc632cc..9fd73e6 100755 --- a/content/dynamic/examples/tutorial/box_graphics.lua +++ b/content/dynamic/examples/tutorial/box_graphics.lua @@ -1,4 +1,4 @@ -local gfx = require("dynamic/other/tutorial/graphics_helpers.lua") +local gfx = require("dynamic/examples/tutorial/graphics_helpers.lua") meshes = {gfx.new_mesh(), gfx.new_mesh()} diff --git a/content/dynamic/examples/tutorial/cage_graphics.lua b/content/dynamic/examples/tutorial/cage_graphics.lua index cb32d0f..e2080c9 100755 --- a/content/dynamic/examples/tutorial/cage_graphics.lua +++ b/content/dynamic/examples/tutorial/cage_graphics.lua @@ -1,13 +1,13 @@ -local gfx = require("dynamic/other/tutorial/graphics_helpers.lua") +local gfx = require("dynamic/examples/tutorial/graphics_helpers.lua") function make_cage_mesh() local mesh = gfx.new_mesh() local color = 0x40ffffff - for i = 200 - 20, 200 + 20, 5 do - gfx.add_line_to_mesh(mesh, {{i, 200 - 20, -50}, {i, 200 - 20, 50}}, {color, color}) - gfx.add_line_to_mesh(mesh, {{i, 200 + 20, -50}, {i, 200 + 20, 50}}, {color, color}) - gfx.add_line_to_mesh(mesh, {{200 - 20, i, -50}, {200 - 20, i, 50}}, {color, color}) - gfx.add_line_to_mesh(mesh, {{200 + 20, i, -50}, {200 + 20, i, 50}}, {color, color}) + for i = - 20, 20, 5 do + gfx.add_line_to_mesh(mesh, {{i, -20, -50}, {i, -20, 50}}, {color, color}) + gfx.add_line_to_mesh(mesh, {{i, 20, -50}, {i, 20, 50}}, {color, color}) + gfx.add_line_to_mesh(mesh, {{-20, i, -50}, {-20, i, 50}}, {color, color}) + gfx.add_line_to_mesh(mesh, {{20, i, -50}, {20, i, 50}}, {color, color}) end return mesh end diff --git a/content/dynamic/examples/tutorial/graphics_helpers.lua b/content/dynamic/examples/tutorial/graphics_helpers.lua index 531701f..30ca94b 100755 --- a/content/dynamic/examples/tutorial/graphics_helpers.lua +++ b/content/dynamic/examples/tutorial/graphics_helpers.lua @@ -69,4 +69,8 @@ function helper.make_color(r, g, b, a) return color end +function helper.print() + pewpew.print("it works!") +end + return helper \ No newline at end of file diff --git a/content/dynamic/examples/tutorial/level.lua b/content/dynamic/examples/tutorial/level.lua index 238779a..9dc0a6d 100755 --- a/content/dynamic/examples/tutorial/level.lua +++ b/content/dynamic/examples/tutorial/level.lua @@ -1,4 +1,4 @@ -local boxes = require("dynamic/other/tutorial/box_template.lua") +local boxes = require("dynamic/examples/tutorial/box_template.lua") function clamp(v, min, max) if v < min then @@ -9,16 +9,16 @@ function clamp(v, min, max) return v end -local box_outer_mesh_info = {"/dynamic/other/tutorial/box_graphics.lua", 0} -local box_inner_mesh_info = {"/dynamic/other/tutorial/box_graphics.lua", 1} +local box_outer_mesh_info = {"/dynamic/examples/tutorial/box_graphics.lua", 0} +local box_inner_mesh_info = {"/dynamic/examples/tutorial/box_graphics.lua", 1} local w = 400fx local h = 400fx local margin = 50fx pewpew.set_level_size(w, h) -local id = pewpew.new_customizable_entity(0, 0) -pewpew.customizable_entity_set_mesh(id, "/dynamic/other/tutorial/level_graphics.lua", 0) +local id = pewpew.new_customizable_entity(0fx, 0fx) +pewpew.customizable_entity_set_mesh(id, "/dynamic/examples/tutorial/level_graphics.lua", 0) ship = pewpew.new_player_ship(w / 2fx, h / 2fx, 0) local camera_distance = -15fx @@ -62,8 +62,8 @@ function level_tick() function() mode_shoot = true mode_shoot_time = 0 - local cage = pewpew.new_customizable_entity(0fx, 0fx) - pewpew.customizable_entity_set_mesh(cage, "/dynamic/other/tutorial/cage_graphics.lua", 0) + local cage = pewpew.new_customizable_entity(w / 2fx, h / 2fx) + pewpew.customizable_entity_set_mesh(cage, "/dynamic/examples/tutorial/cage_graphics.lua", 0) pewpew.configure_player_ship_weapon(ship, {frequency = 4, cannon = pewpew.CannonType.DOUBLE}) local up_angle = fmath.tau() * fmath.from_fraction(1, 4) local down_angle = fmath.tau() * fmath.from_fraction(3, 4) diff --git a/content/dynamic/examples/tutorial/level_graphics.lua b/content/dynamic/examples/tutorial/level_graphics.lua index 5577eab..7a04a31 100755 --- a/content/dynamic/examples/tutorial/level_graphics.lua +++ b/content/dynamic/examples/tutorial/level_graphics.lua @@ -1,4 +1,6 @@ -local gfx = require("dynamic/other/tutorial/graphics_helpers.lua") +local gfx = require("dynamic/examples/tutorial/graphics_helpers.lua") + +gfx.print() function make_level_mesh() local mesh = gfx.new_mesh() diff --git a/content/pewpewlive-wasm.js b/content/pewpewlive-wasm.js new file mode 100644 index 0000000..84e4029 --- /dev/null +++ b/content/pewpewlive-wasm.js @@ -0,0 +1,12298 @@ + + +// The Module object: Our interface to the outside world. We import +// and export values on it. There are various ways Module can be used: +// 1. Not defined. We create it here +// 2. A function parameter, function(Module) { ..generated code.. } +// 3. pre-run appended it, var Module = {}; ..generated code.. +// 4. External script tag defines var Module. +// We need to check if Module already exists (e.g. case 3 above). +// Substitution will be replaced with actual code on later stage of the build, +// this way Closure Compiler will not mangle it (e.g. case 4. above). +// Note that if you want to run closure, and also to use Module +// after the generated code, you will need to define var Module = {}; +// before the code. Then that object will be used in the code, and you +// can continue to use Module afterwards as well. +var Module = typeof Module !== 'undefined' ? Module : {}; + + + +// --pre-jses are emitted after the Module integration code, so that they can +// refer to Module (if they choose; they can also define Module) +// {{PRE_JSES}} + +// Sometimes an existing Module object exists with properties +// meant to overwrite the default module functionality. Here +// we collect those properties and reapply _after_ we configure +// the current environment's defaults to avoid having to be so +// defensive during initialization. +var moduleOverrides = {}; +var key; +for (key in Module) { + if (Module.hasOwnProperty(key)) { + moduleOverrides[key] = Module[key]; + } +} + +var arguments_ = []; +var thisProgram = './this.program'; +var quit_ = function(status, toThrow) { + throw toThrow; +}; + +// Determine the runtime environment we are in. You can customize this by +// setting the ENVIRONMENT setting at compile time (see settings.js). + +var ENVIRONMENT_IS_WEB = false; +var ENVIRONMENT_IS_WORKER = false; +var ENVIRONMENT_IS_NODE = false; +var ENVIRONMENT_IS_SHELL = false; +ENVIRONMENT_IS_WEB = typeof window === 'object'; +ENVIRONMENT_IS_WORKER = typeof importScripts === 'function'; +// N.b. Electron.js environment is simultaneously a NODE-environment, but +// also a web environment. +ENVIRONMENT_IS_NODE = typeof process === 'object' && typeof process.versions === 'object' && typeof process.versions.node === 'string'; +ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER; + +if (Module['ENVIRONMENT']) { + throw new Error('Module.ENVIRONMENT has been deprecated. To force the environment, use the ENVIRONMENT compile-time option (for example, -s ENVIRONMENT=web or -s ENVIRONMENT=node)'); +} + + + +// `/` should be present at the end if `scriptDirectory` is not empty +var scriptDirectory = ''; +function locateFile(path) { + if (Module['locateFile']) { + return Module['locateFile'](path, scriptDirectory); + } + return scriptDirectory + path; +} + +// Hooks that are implemented differently in different runtime environments. +var read_, + readAsync, + readBinary, + setWindowTitle; + +var nodeFS; +var nodePath; + +if (ENVIRONMENT_IS_NODE) { + if (ENVIRONMENT_IS_WORKER) { + scriptDirectory = require('path').dirname(scriptDirectory) + '/'; + } else { + scriptDirectory = __dirname + '/'; + } + + + + + read_ = function shell_read(filename, binary) { + if (!nodeFS) nodeFS = require('fs'); + if (!nodePath) nodePath = require('path'); + filename = nodePath['normalize'](filename); + return nodeFS['readFileSync'](filename, binary ? null : 'utf8'); + }; + + readBinary = function readBinary(filename) { + var ret = read_(filename, true); + if (!ret.buffer) { + ret = new Uint8Array(ret); + } + assert(ret.buffer); + return ret; + }; + + + + + if (process['argv'].length > 1) { + thisProgram = process['argv'][1].replace(/\\/g, '/'); + } + + arguments_ = process['argv'].slice(2); + + if (typeof module !== 'undefined') { + module['exports'] = Module; + } + + process['on']('uncaughtException', function(ex) { + // suppress ExitStatus exceptions from showing an error + if (!(ex instanceof ExitStatus)) { + throw ex; + } + }); + + process['on']('unhandledRejection', abort); + + quit_ = function(status) { + process['exit'](status); + }; + + Module['inspect'] = function () { return '[Emscripten Module object]'; }; + + + +} else +if (ENVIRONMENT_IS_SHELL) { + + + if (typeof read != 'undefined') { + read_ = function shell_read(f) { + return read(f); + }; + } + + readBinary = function readBinary(f) { + var data; + if (typeof readbuffer === 'function') { + return new Uint8Array(readbuffer(f)); + } + data = read(f, 'binary'); + assert(typeof data === 'object'); + return data; + }; + + if (typeof scriptArgs != 'undefined') { + arguments_ = scriptArgs; + } else if (typeof arguments != 'undefined') { + arguments_ = arguments; + } + + if (typeof quit === 'function') { + quit_ = function(status) { + quit(status); + }; + } + + if (typeof print !== 'undefined') { + // Prefer to use print/printErr where they exist, as they usually work better. + if (typeof console === 'undefined') console = /** @type{!Console} */({}); + console.log = /** @type{!function(this:Console, ...*): undefined} */ (print); + console.warn = console.error = /** @type{!function(this:Console, ...*): undefined} */ (typeof printErr !== 'undefined' ? printErr : print); + } + + +} else + +// Note that this includes Node.js workers when relevant (pthreads is enabled). +// Node.js workers are detected as a combination of ENVIRONMENT_IS_WORKER and +// ENVIRONMENT_IS_NODE. +if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) { + if (ENVIRONMENT_IS_WORKER) { // Check worker, not web, since window could be polyfilled + scriptDirectory = self.location.href; + } else if (document.currentScript) { // web + scriptDirectory = document.currentScript.src; + } + // blob urls look like blob:http://site.com/etc/etc and we cannot infer anything from them. + // otherwise, slice off the final part of the url to find the script directory. + // if scriptDirectory does not contain a slash, lastIndexOf will return -1, + // and scriptDirectory will correctly be replaced with an empty string. + if (scriptDirectory.indexOf('blob:') !== 0) { + scriptDirectory = scriptDirectory.substr(0, scriptDirectory.lastIndexOf('/')+1); + } else { + scriptDirectory = ''; + } + + + // Differentiate the Web Worker from the Node Worker case, as reading must + // be done differently. + { + + + + + read_ = function shell_read(url) { + var xhr = new XMLHttpRequest(); + xhr.open('GET', url, false); + xhr.send(null); + return xhr.responseText; + }; + + if (ENVIRONMENT_IS_WORKER) { + readBinary = function readBinary(url) { + var xhr = new XMLHttpRequest(); + xhr.open('GET', url, false); + xhr.responseType = 'arraybuffer'; + xhr.send(null); + return new Uint8Array(/** @type{!ArrayBuffer} */(xhr.response)); + }; + } + + readAsync = function readAsync(url, onload, onerror) { + var xhr = new XMLHttpRequest(); + xhr.open('GET', url, true); + xhr.responseType = 'arraybuffer'; + xhr.onload = function xhr_onload() { + if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0 + onload(xhr.response); + return; + } + onerror(); + }; + xhr.onerror = onerror; + xhr.send(null); + }; + + + + + } + + setWindowTitle = function(title) { document.title = title }; +} else +{ + throw new Error('environment detection error'); +} + + +// Set up the out() and err() hooks, which are how we can print to stdout or +// stderr, respectively. +var out = Module['print'] || console.log.bind(console); +var err = Module['printErr'] || console.warn.bind(console); + +// Merge back in the overrides +for (key in moduleOverrides) { + if (moduleOverrides.hasOwnProperty(key)) { + Module[key] = moduleOverrides[key]; + } +} +// Free the object hierarchy contained in the overrides, this lets the GC +// reclaim data used e.g. in memoryInitializerRequest, which is a large typed array. +moduleOverrides = null; + +// Emit code to handle expected values on the Module object. This applies Module.x +// to the proper local x. This has two benefits: first, we only emit it if it is +// expected to arrive, and second, by using a local everywhere else that can be +// minified. +if (Module['arguments']) arguments_ = Module['arguments'];if (!Object.getOwnPropertyDescriptor(Module, 'arguments')) Object.defineProperty(Module, 'arguments', { configurable: true, get: function() { abort('Module.arguments has been replaced with plain arguments_ (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)') } }); +if (Module['thisProgram']) thisProgram = Module['thisProgram'];if (!Object.getOwnPropertyDescriptor(Module, 'thisProgram')) Object.defineProperty(Module, 'thisProgram', { configurable: true, get: function() { abort('Module.thisProgram has been replaced with plain thisProgram (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)') } }); +if (Module['quit']) quit_ = Module['quit'];if (!Object.getOwnPropertyDescriptor(Module, 'quit')) Object.defineProperty(Module, 'quit', { configurable: true, get: function() { abort('Module.quit has been replaced with plain quit_ (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)') } }); + +// perform assertions in shell.js after we set up out() and err(), as otherwise if an assertion fails it cannot print the message +// Assertions on removed incoming Module JS APIs. +assert(typeof Module['memoryInitializerPrefixURL'] === 'undefined', 'Module.memoryInitializerPrefixURL option was removed, use Module.locateFile instead'); +assert(typeof Module['pthreadMainPrefixURL'] === 'undefined', 'Module.pthreadMainPrefixURL option was removed, use Module.locateFile instead'); +assert(typeof Module['cdInitializerPrefixURL'] === 'undefined', 'Module.cdInitializerPrefixURL option was removed, use Module.locateFile instead'); +assert(typeof Module['filePackagePrefixURL'] === 'undefined', 'Module.filePackagePrefixURL option was removed, use Module.locateFile instead'); +assert(typeof Module['read'] === 'undefined', 'Module.read option was removed (modify read_ in JS)'); +assert(typeof Module['readAsync'] === 'undefined', 'Module.readAsync option was removed (modify readAsync in JS)'); +assert(typeof Module['readBinary'] === 'undefined', 'Module.readBinary option was removed (modify readBinary in JS)'); +assert(typeof Module['setWindowTitle'] === 'undefined', 'Module.setWindowTitle option was removed (modify setWindowTitle in JS)'); +assert(typeof Module['TOTAL_MEMORY'] === 'undefined', 'Module.TOTAL_MEMORY has been renamed Module.INITIAL_MEMORY'); +if (!Object.getOwnPropertyDescriptor(Module, 'read')) Object.defineProperty(Module, 'read', { configurable: true, get: function() { abort('Module.read has been replaced with plain read_ (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)') } }); +if (!Object.getOwnPropertyDescriptor(Module, 'readAsync')) Object.defineProperty(Module, 'readAsync', { configurable: true, get: function() { abort('Module.readAsync has been replaced with plain readAsync (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)') } }); +if (!Object.getOwnPropertyDescriptor(Module, 'readBinary')) Object.defineProperty(Module, 'readBinary', { configurable: true, get: function() { abort('Module.readBinary has been replaced with plain readBinary (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)') } }); +if (!Object.getOwnPropertyDescriptor(Module, 'setWindowTitle')) Object.defineProperty(Module, 'setWindowTitle', { configurable: true, get: function() { abort('Module.setWindowTitle has been replaced with plain setWindowTitle (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)') } }); +var IDBFS = 'IDBFS is no longer included by default; build with -lidbfs.js'; +var PROXYFS = 'PROXYFS is no longer included by default; build with -lproxyfs.js'; +var WORKERFS = 'WORKERFS is no longer included by default; build with -lworkerfs.js'; +var NODEFS = 'NODEFS is no longer included by default; build with -lnodefs.js'; + + + + + + +// {{PREAMBLE_ADDITIONS}} + +var STACK_ALIGN = 16; + +function dynamicAlloc(size) { + assert(DYNAMICTOP_PTR); + var ret = HEAP32[DYNAMICTOP_PTR>>2]; + var end = (ret + size + 15) & -16; + assert(end <= HEAP8.length, 'failure to dynamicAlloc - memory growth etc. is not supported there, call malloc/sbrk directly'); + HEAP32[DYNAMICTOP_PTR>>2] = end; + return ret; +} + +function alignMemory(size, factor) { + if (!factor) factor = STACK_ALIGN; // stack alignment (16-byte) by default + return Math.ceil(size / factor) * factor; +} + +function getNativeTypeSize(type) { + switch (type) { + case 'i1': case 'i8': return 1; + case 'i16': return 2; + case 'i32': return 4; + case 'i64': return 8; + case 'float': return 4; + case 'double': return 8; + default: { + if (type[type.length-1] === '*') { + return 4; // A pointer + } else if (type[0] === 'i') { + var bits = Number(type.substr(1)); + assert(bits % 8 === 0, 'getNativeTypeSize invalid bits ' + bits + ', type ' + type); + return bits / 8; + } else { + return 0; + } + } + } +} + +function warnOnce(text) { + if (!warnOnce.shown) warnOnce.shown = {}; + if (!warnOnce.shown[text]) { + warnOnce.shown[text] = 1; + err(text); + } +} + + + + + + + + +// Wraps a JS function as a wasm function with a given signature. +function convertJsFunctionToWasm(func, sig) { + + // If the type reflection proposal is available, use the new + // "WebAssembly.Function" constructor. + // Otherwise, construct a minimal wasm module importing the JS function and + // re-exporting it. + if (typeof WebAssembly.Function === "function") { + var typeNames = { + 'i': 'i32', + 'j': 'i64', + 'f': 'f32', + 'd': 'f64' + }; + var type = { + parameters: [], + results: sig[0] == 'v' ? [] : [typeNames[sig[0]]] + }; + for (var i = 1; i < sig.length; ++i) { + type.parameters.push(typeNames[sig[i]]); + } + return new WebAssembly.Function(type, func); + } + + // The module is static, with the exception of the type section, which is + // generated based on the signature passed in. + var typeSection = [ + 0x01, // id: section, + 0x00, // length: 0 (placeholder) + 0x01, // count: 1 + 0x60, // form: func + ]; + var sigRet = sig.slice(0, 1); + var sigParam = sig.slice(1); + var typeCodes = { + 'i': 0x7f, // i32 + 'j': 0x7e, // i64 + 'f': 0x7d, // f32 + 'd': 0x7c, // f64 + }; + + // Parameters, length + signatures + typeSection.push(sigParam.length); + for (var i = 0; i < sigParam.length; ++i) { + typeSection.push(typeCodes[sigParam[i]]); + } + + // Return values, length + signatures + // With no multi-return in MVP, either 0 (void) or 1 (anything else) + if (sigRet == 'v') { + typeSection.push(0x00); + } else { + typeSection = typeSection.concat([0x01, typeCodes[sigRet]]); + } + + // Write the overall length of the type section back into the section header + // (excepting the 2 bytes for the section id and length) + typeSection[1] = typeSection.length - 2; + + // Rest of the module is static + var bytes = new Uint8Array([ + 0x00, 0x61, 0x73, 0x6d, // magic ("\0asm") + 0x01, 0x00, 0x00, 0x00, // version: 1 + ].concat(typeSection, [ + 0x02, 0x07, // import section + // (import "e" "f" (func 0 (type 0))) + 0x01, 0x01, 0x65, 0x01, 0x66, 0x00, 0x00, + 0x07, 0x05, // export section + // (export "f" (func 0 (type 0))) + 0x01, 0x01, 0x66, 0x00, 0x00, + ])); + + // We can compile this wasm module synchronously because it is very small. + // This accepts an import (at "e.f"), that it reroutes to an export (at "f") + var module = new WebAssembly.Module(bytes); + var instance = new WebAssembly.Instance(module, { + 'e': { + 'f': func + } + }); + var wrappedFunc = instance.exports['f']; + return wrappedFunc; +} + +var freeTableIndexes = []; + +// Weak map of functions in the table to their indexes, created on first use. +var functionsInTableMap; + +// Add a wasm function to the table. +function addFunctionWasm(func, sig) { + var table = wasmTable; + + // Check if the function is already in the table, to ensure each function + // gets a unique index. First, create the map if this is the first use. + if (!functionsInTableMap) { + functionsInTableMap = new WeakMap(); + for (var i = 0; i < table.length; i++) { + var item = table.get(i); + // Ignore null values. + if (item) { + functionsInTableMap.set(item, i); + } + } + } + if (functionsInTableMap.has(func)) { + return functionsInTableMap.get(func); + } + + // It's not in the table, add it now. + + // Make sure functionsInTableMap is actually up to date, that is, that this + // function is not actually in the wasm Table despite not being tracked in + // functionsInTableMap. + for (var i = 0; i < table.length; i++) { + assert(table.get(i) != func, 'function in Table but not functionsInTableMap'); + } + + var ret; + // Reuse a free index if there is one, otherwise grow. + if (freeTableIndexes.length) { + ret = freeTableIndexes.pop(); + } else { + ret = table.length; + // Grow the table + try { + table.grow(1); + } catch (err) { + if (!(err instanceof RangeError)) { + throw err; + } + throw 'Unable to grow wasm table. Set ALLOW_TABLE_GROWTH.'; + } + } + + // Set the new value. + try { + // Attempting to call this with JS function will cause of table.set() to fail + table.set(ret, func); + } catch (err) { + if (!(err instanceof TypeError)) { + throw err; + } + assert(typeof sig !== 'undefined', 'Missing signature argument to addFunction'); + var wrapped = convertJsFunctionToWasm(func, sig); + table.set(ret, wrapped); + } + + functionsInTableMap.set(func, ret); + + return ret; +} + +function removeFunctionWasm(index) { + functionsInTableMap.delete(wasmTable.get(index)); + freeTableIndexes.push(index); +} + +// 'sig' parameter is required for the llvm backend but only when func is not +// already a WebAssembly function. +function addFunction(func, sig) { + assert(typeof func !== 'undefined'); + if (typeof sig === 'undefined') { + err('warning: addFunction(): You should provide a wasm function signature string as a second argument. This is not necessary for asm.js and asm2wasm, but can be required for the LLVM wasm backend, so it is recommended for full portability.'); + } + + return addFunctionWasm(func, sig); +} + +function removeFunction(index) { + removeFunctionWasm(index); +} + + + +var funcWrappers = {}; + +function getFuncWrapper(func, sig) { + if (!func) return; // on null pointer, return undefined + assert(sig); + if (!funcWrappers[sig]) { + funcWrappers[sig] = {}; + } + var sigCache = funcWrappers[sig]; + if (!sigCache[func]) { + // optimize away arguments usage in common cases + if (sig.length === 1) { + sigCache[func] = function dynCall_wrapper() { + return dynCall(sig, func); + }; + } else if (sig.length === 2) { + sigCache[func] = function dynCall_wrapper(arg) { + return dynCall(sig, func, [arg]); + }; + } else { + // general case + sigCache[func] = function dynCall_wrapper() { + return dynCall(sig, func, Array.prototype.slice.call(arguments)); + }; + } + } + return sigCache[func]; +} + + + + + + + +function makeBigInt(low, high, unsigned) { + return unsigned ? ((+((low>>>0)))+((+((high>>>0)))*4294967296.0)) : ((+((low>>>0)))+((+((high|0)))*4294967296.0)); +} + +/** @param {Array=} args */ +function dynCall(sig, ptr, args) { + if (args && args.length) { + // j (64-bit integer) must be passed in as two numbers [low 32, high 32]. + assert(args.length === sig.substring(1).replace(/j/g, '--').length); + assert(('dynCall_' + sig) in Module, 'bad function pointer type - no table for sig \'' + sig + '\''); + return Module['dynCall_' + sig].apply(null, [ptr].concat(args)); + } else { + assert(sig.length == 1); + assert(('dynCall_' + sig) in Module, 'bad function pointer type - no table for sig \'' + sig + '\''); + return Module['dynCall_' + sig].call(null, ptr); + } +} + +var tempRet0 = 0; + +var setTempRet0 = function(value) { + tempRet0 = value; +}; + +var getTempRet0 = function() { + return tempRet0; +}; + +function getCompilerSetting(name) { + throw 'You must build with -s RETAIN_COMPILER_SETTINGS=1 for getCompilerSetting or emscripten_get_compiler_setting to work'; +} + +// The address globals begin at. Very low in memory, for code size and optimization opportunities. +// Above 0 is static memory, starting with globals. +// Then the stack. +// Then 'dynamic' memory for sbrk. +var GLOBAL_BASE = 1024; + + + + + +// === Preamble library stuff === + +// Documentation for the public APIs defined in this file must be updated in: +// site/source/docs/api_reference/preamble.js.rst +// A prebuilt local version of the documentation is available at: +// site/build/text/docs/api_reference/preamble.js.txt +// You can also build docs locally as HTML or other formats in site/ +// An online HTML version (which may be of a different version of Emscripten) +// is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html + + +var wasmBinary;if (Module['wasmBinary']) wasmBinary = Module['wasmBinary'];if (!Object.getOwnPropertyDescriptor(Module, 'wasmBinary')) Object.defineProperty(Module, 'wasmBinary', { configurable: true, get: function() { abort('Module.wasmBinary has been replaced with plain wasmBinary (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)') } }); +var noExitRuntime;if (Module['noExitRuntime']) noExitRuntime = Module['noExitRuntime'];if (!Object.getOwnPropertyDescriptor(Module, 'noExitRuntime')) Object.defineProperty(Module, 'noExitRuntime', { configurable: true, get: function() { abort('Module.noExitRuntime has been replaced with plain noExitRuntime (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)') } }); + + +if (typeof WebAssembly !== 'object') { + abort('no native wasm support detected'); +} + + + + +// In MINIMAL_RUNTIME, setValue() and getValue() are only available when building with safe heap enabled, for heap safety checking. +// In traditional runtime, setValue() and getValue() are always available (although their use is highly discouraged due to perf penalties) + +/** @param {number} ptr + @param {number} value + @param {string} type + @param {number|boolean=} noSafe */ +function setValue(ptr, value, type, noSafe) { + type = type || 'i8'; + if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit + switch(type) { + case 'i1': HEAP8[((ptr)>>0)]=value; break; + case 'i8': HEAP8[((ptr)>>0)]=value; break; + case 'i16': HEAP16[((ptr)>>1)]=value; break; + case 'i32': HEAP32[((ptr)>>2)]=value; break; + case 'i64': (tempI64 = [value>>>0,(tempDouble=value,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((ptr)>>2)]=tempI64[0],HEAP32[(((ptr)+(4))>>2)]=tempI64[1]); break; + case 'float': HEAPF32[((ptr)>>2)]=value; break; + case 'double': HEAPF64[((ptr)>>3)]=value; break; + default: abort('invalid type for setValue: ' + type); + } +} + +/** @param {number} ptr + @param {string} type + @param {number|boolean=} noSafe */ +function getValue(ptr, type, noSafe) { + type = type || 'i8'; + if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit + switch(type) { + case 'i1': return HEAP8[((ptr)>>0)]; + case 'i8': return HEAP8[((ptr)>>0)]; + case 'i16': return HEAP16[((ptr)>>1)]; + case 'i32': return HEAP32[((ptr)>>2)]; + case 'i64': return HEAP32[((ptr)>>2)]; + case 'float': return HEAPF32[((ptr)>>2)]; + case 'double': return HEAPF64[((ptr)>>3)]; + default: abort('invalid type for getValue: ' + type); + } + return null; +} + + + + + + +// Wasm globals + +var wasmMemory; + +// In fastcomp asm.js, we don't need a wasm Table at all. +// In the wasm backend, we polyfill the WebAssembly object, +// so this creates a (non-native-wasm) table for us. + +var wasmTable = new WebAssembly.Table({ + 'initial': 4141, + 'maximum': 4141 + 0, + 'element': 'anyfunc' +}); + + + + +//======================================== +// Runtime essentials +//======================================== + +// whether we are quitting the application. no code should run after this. +// set in exit() and abort() +var ABORT = false; + +// set by exit() and abort(). Passed to 'onExit' handler. +// NOTE: This is also used as the process return code code in shell environments +// but only when noExitRuntime is false. +var EXITSTATUS = 0; + +/** @type {function(*, string=)} */ +function assert(condition, text) { + if (!condition) { + abort('Assertion failed: ' + text); + } +} + +// Returns the C function with a specified identifier (for C++, you need to do manual name mangling) +function getCFunc(ident) { + var func = Module['_' + ident]; // closure exported function + assert(func, 'Cannot call unknown function ' + ident + ', make sure it is exported'); + return func; +} + +// C calling interface. +/** @param {string|null=} returnType + @param {Array=} argTypes + @param {Arguments|Array=} args + @param {Object=} opts */ +function ccall(ident, returnType, argTypes, args, opts) { + // For fast lookup of conversion functions + var toC = { + 'string': function(str) { + var ret = 0; + if (str !== null && str !== undefined && str !== 0) { // null string + // at most 4 bytes per UTF-8 code point, +1 for the trailing '\0' + var len = (str.length << 2) + 1; + ret = stackAlloc(len); + stringToUTF8(str, ret, len); + } + return ret; + }, + 'array': function(arr) { + var ret = stackAlloc(arr.length); + writeArrayToMemory(arr, ret); + return ret; + } + }; + + function convertReturnValue(ret) { + if (returnType === 'string') return UTF8ToString(ret); + if (returnType === 'boolean') return Boolean(ret); + return ret; + } + + var func = getCFunc(ident); + var cArgs = []; + var stack = 0; + assert(returnType !== 'array', 'Return type should not be "array".'); + if (args) { + for (var i = 0; i < args.length; i++) { + var converter = toC[argTypes[i]]; + if (converter) { + if (stack === 0) stack = stackSave(); + cArgs[i] = converter(args[i]); + } else { + cArgs[i] = args[i]; + } + } + } + var ret = func.apply(null, cArgs); + + ret = convertReturnValue(ret); + if (stack !== 0) stackRestore(stack); + return ret; +} + +/** @param {string=} returnType + @param {Array=} argTypes + @param {Object=} opts */ +function cwrap(ident, returnType, argTypes, opts) { + return function() { + return ccall(ident, returnType, argTypes, arguments, opts); + } +} + +var ALLOC_NORMAL = 0; // Tries to use _malloc() +var ALLOC_STACK = 1; // Lives for the duration of the current function call +var ALLOC_DYNAMIC = 2; // Cannot be freed except through sbrk +var ALLOC_NONE = 3; // Do not allocate + +// allocate(): This is for internal use. You can use it yourself as well, but the interface +// is a little tricky (see docs right below). The reason is that it is optimized +// for multiple syntaxes to save space in generated code. So you should +// normally not use allocate(), and instead allocate memory using _malloc(), +// initialize it with setValue(), and so forth. +// @slab: An array of data, or a number. If a number, then the size of the block to allocate, +// in *bytes* (note that this is sometimes confusing: the next parameter does not +// affect this!) +// @types: Either an array of types, one for each byte (or 0 if no type at that position), +// or a single type which is used for the entire block. This only matters if there +// is initial data - if @slab is a number, then this does not matter at all and is +// ignored. +// @allocator: How to allocate memory, see ALLOC_* +/** @type {function((TypedArray|Array<number>|number), string, number, number=)} */ +function allocate(slab, types, allocator, ptr) { + var zeroinit, size; + if (typeof slab === 'number') { + zeroinit = true; + size = slab; + } else { + zeroinit = false; + size = slab.length; + } + + var singleType = typeof types === 'string' ? types : null; + + var ret; + if (allocator == ALLOC_NONE) { + ret = ptr; + } else { + ret = [_malloc, + stackAlloc, + dynamicAlloc][allocator](Math.max(size, singleType ? 1 : types.length)); + } + + if (zeroinit) { + var stop; + ptr = ret; + assert((ret & 3) == 0); + stop = ret + (size & ~3); + for (; ptr < stop; ptr += 4) { + HEAP32[((ptr)>>2)]=0; + } + stop = ret + size; + while (ptr < stop) { + HEAP8[((ptr++)>>0)]=0; + } + return ret; + } + + if (singleType === 'i8') { + if (slab.subarray || slab.slice) { + HEAPU8.set(/** @type {!Uint8Array} */ (slab), ret); + } else { + HEAPU8.set(new Uint8Array(slab), ret); + } + return ret; + } + + var i = 0, type, typeSize, previousType; + while (i < size) { + var curr = slab[i]; + + type = singleType || types[i]; + if (type === 0) { + i++; + continue; + } + assert(type, 'Must know what type to store in allocate!'); + + if (type == 'i64') type = 'i32'; // special case: we have one i32 here, and one i32 later + + setValue(ret+i, curr, type); + + // no need to look up size unless type changes, so cache it + if (previousType !== type) { + typeSize = getNativeTypeSize(type); + previousType = type; + } + i += typeSize; + } + + return ret; +} + +// Allocate memory during any stage of startup - static memory early on, dynamic memory later, malloc when ready +function getMemory(size) { + if (!runtimeInitialized) return dynamicAlloc(size); + return _malloc(size); +} + + + + +// runtime_strings.js: Strings related runtime functions that are part of both MINIMAL_RUNTIME and regular runtime. + +// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the given array that contains uint8 values, returns +// a copy of that string as a Javascript String object. + +var UTF8Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf8') : undefined; + +/** + * @param {number} idx + * @param {number=} maxBytesToRead + * @return {string} + */ +function UTF8ArrayToString(heap, idx, maxBytesToRead) { + var endIdx = idx + maxBytesToRead; + var endPtr = idx; + // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself. + // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage. + // (As a tiny code save trick, compare endPtr against endIdx using a negation, so that undefined means Infinity) + while (heap[endPtr] && !(endPtr >= endIdx)) ++endPtr; + + if (endPtr - idx > 16 && heap.subarray && UTF8Decoder) { + return UTF8Decoder.decode(heap.subarray(idx, endPtr)); + } else { + var str = ''; + // If building with TextDecoder, we have already computed the string length above, so test loop end condition against that + while (idx < endPtr) { + // For UTF8 byte structure, see: + // http://en.wikipedia.org/wiki/UTF-8#Description + // https://www.ietf.org/rfc/rfc2279.txt + // https://tools.ietf.org/html/rfc3629 + var u0 = heap[idx++]; + if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; } + var u1 = heap[idx++] & 63; + if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; } + var u2 = heap[idx++] & 63; + if ((u0 & 0xF0) == 0xE0) { + u0 = ((u0 & 15) << 12) | (u1 << 6) | u2; + } else { + if ((u0 & 0xF8) != 0xF0) warnOnce('Invalid UTF-8 leading byte 0x' + u0.toString(16) + ' encountered when deserializing a UTF-8 string on the asm.js/wasm heap to a JS string!'); + u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | (heap[idx++] & 63); + } + + if (u0 < 0x10000) { + str += String.fromCharCode(u0); + } else { + var ch = u0 - 0x10000; + str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF)); + } + } + } + return str; +} + +// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the emscripten HEAP, returns a +// copy of that string as a Javascript String object. +// maxBytesToRead: an optional length that specifies the maximum number of bytes to read. You can omit +// this parameter to scan the string until the first \0 byte. If maxBytesToRead is +// passed, and the string at [ptr, ptr+maxBytesToReadr[ contains a null byte in the +// middle, then the string will cut short at that byte index (i.e. maxBytesToRead will +// not produce a string of exact length [ptr, ptr+maxBytesToRead[) +// N.B. mixing frequent uses of UTF8ToString() with and without maxBytesToRead may +// throw JS JIT optimizations off, so it is worth to consider consistently using one +// style or the other. +/** + * @param {number} ptr + * @param {number=} maxBytesToRead + * @return {string} + */ +function UTF8ToString(ptr, maxBytesToRead) { + return ptr ? UTF8ArrayToString(HEAPU8, ptr, maxBytesToRead) : ''; +} + +// Copies the given Javascript String object 'str' to the given byte array at address 'outIdx', +// encoded in UTF8 form and null-terminated. The copy will require at most str.length*4+1 bytes of space in the HEAP. +// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write. +// Parameters: +// str: the Javascript string to copy. +// heap: the array to copy to. Each index in this array is assumed to be one 8-byte element. +// outIdx: The starting offset in the array to begin the copying. +// maxBytesToWrite: The maximum number of bytes this function can write to the array. +// This count should include the null terminator, +// i.e. if maxBytesToWrite=1, only the null terminator will be written and nothing else. +// maxBytesToWrite=0 does not write any bytes to the output, not even the null terminator. +// Returns the number of bytes written, EXCLUDING the null terminator. + +function stringToUTF8Array(str, heap, outIdx, maxBytesToWrite) { + if (!(maxBytesToWrite > 0)) // Parameter maxBytesToWrite is not optional. Negative values, 0, null, undefined and false each don't write out any bytes. + return 0; + + var startIdx = outIdx; + var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator. + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629 + var u = str.charCodeAt(i); // possibly a lead surrogate + if (u >= 0xD800 && u <= 0xDFFF) { + var u1 = str.charCodeAt(++i); + u = 0x10000 + ((u & 0x3FF) << 10) | (u1 & 0x3FF); + } + if (u <= 0x7F) { + if (outIdx >= endIdx) break; + heap[outIdx++] = u; + } else if (u <= 0x7FF) { + if (outIdx + 1 >= endIdx) break; + heap[outIdx++] = 0xC0 | (u >> 6); + heap[outIdx++] = 0x80 | (u & 63); + } else if (u <= 0xFFFF) { + if (outIdx + 2 >= endIdx) break; + heap[outIdx++] = 0xE0 | (u >> 12); + heap[outIdx++] = 0x80 | ((u >> 6) & 63); + heap[outIdx++] = 0x80 | (u & 63); + } else { + if (outIdx + 3 >= endIdx) break; + if (u >= 0x200000) warnOnce('Invalid Unicode code point 0x' + u.toString(16) + ' encountered when serializing a JS string to an UTF-8 string on the asm.js/wasm heap! (Valid unicode code points should be in range 0-0x1FFFFF).'); + heap[outIdx++] = 0xF0 | (u >> 18); + heap[outIdx++] = 0x80 | ((u >> 12) & 63); + heap[outIdx++] = 0x80 | ((u >> 6) & 63); + heap[outIdx++] = 0x80 | (u & 63); + } + } + // Null-terminate the pointer to the buffer. + heap[outIdx] = 0; + return outIdx - startIdx; +} + +// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', +// null-terminated and encoded in UTF8 form. The copy will require at most str.length*4+1 bytes of space in the HEAP. +// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write. +// Returns the number of bytes written, EXCLUDING the null terminator. + +function stringToUTF8(str, outPtr, maxBytesToWrite) { + assert(typeof maxBytesToWrite == 'number', 'stringToUTF8(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!'); + return stringToUTF8Array(str, HEAPU8,outPtr, maxBytesToWrite); +} + +// Returns the number of bytes the given Javascript string takes if encoded as a UTF8 byte array, EXCLUDING the null terminator byte. +function lengthBytesUTF8(str) { + var len = 0; + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + var u = str.charCodeAt(i); // possibly a lead surrogate + if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF); + if (u <= 0x7F) ++len; + else if (u <= 0x7FF) len += 2; + else if (u <= 0xFFFF) len += 3; + else len += 4; + } + return len; +} + + + + + +// runtime_strings_extra.js: Strings related runtime functions that are available only in regular runtime. + +// Given a pointer 'ptr' to a null-terminated ASCII-encoded string in the emscripten HEAP, returns +// a copy of that string as a Javascript String object. + +function AsciiToString(ptr) { + var str = ''; + while (1) { + var ch = HEAPU8[((ptr++)>>0)]; + if (!ch) return str; + str += String.fromCharCode(ch); + } +} + +// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', +// null-terminated and encoded in ASCII form. The copy will require at most str.length+1 bytes of space in the HEAP. + +function stringToAscii(str, outPtr) { + return writeAsciiToMemory(str, outPtr, false); +} + +// Given a pointer 'ptr' to a null-terminated UTF16LE-encoded string in the emscripten HEAP, returns +// a copy of that string as a Javascript String object. + +var UTF16Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf-16le') : undefined; + +function UTF16ToString(ptr, maxBytesToRead) { + assert(ptr % 2 == 0, 'Pointer passed to UTF16ToString must be aligned to two bytes!'); + var endPtr = ptr; + // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself. + // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage. + var idx = endPtr >> 1; + var maxIdx = idx + maxBytesToRead / 2; + // If maxBytesToRead is not passed explicitly, it will be undefined, and this + // will always evaluate to true. This saves on code size. + while (!(idx >= maxIdx) && HEAPU16[idx]) ++idx; + endPtr = idx << 1; + + if (endPtr - ptr > 32 && UTF16Decoder) { + return UTF16Decoder.decode(HEAPU8.subarray(ptr, endPtr)); + } else { + var i = 0; + + var str = ''; + while (1) { + var codeUnit = HEAP16[(((ptr)+(i*2))>>1)]; + if (codeUnit == 0 || i == maxBytesToRead / 2) return str; + ++i; + // fromCharCode constructs a character from a UTF-16 code unit, so we can pass the UTF16 string right through. + str += String.fromCharCode(codeUnit); + } + } +} + +// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', +// null-terminated and encoded in UTF16 form. The copy will require at most str.length*4+2 bytes of space in the HEAP. +// Use the function lengthBytesUTF16() to compute the exact number of bytes (excluding null terminator) that this function will write. +// Parameters: +// str: the Javascript string to copy. +// outPtr: Byte address in Emscripten HEAP where to write the string to. +// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null +// terminator, i.e. if maxBytesToWrite=2, only the null terminator will be written and nothing else. +// maxBytesToWrite<2 does not write any bytes to the output, not even the null terminator. +// Returns the number of bytes written, EXCLUDING the null terminator. + +function stringToUTF16(str, outPtr, maxBytesToWrite) { + assert(outPtr % 2 == 0, 'Pointer passed to stringToUTF16 must be aligned to two bytes!'); + assert(typeof maxBytesToWrite == 'number', 'stringToUTF16(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!'); + // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed. + if (maxBytesToWrite === undefined) { + maxBytesToWrite = 0x7FFFFFFF; + } + if (maxBytesToWrite < 2) return 0; + maxBytesToWrite -= 2; // Null terminator. + var startPtr = outPtr; + var numCharsToWrite = (maxBytesToWrite < str.length*2) ? (maxBytesToWrite / 2) : str.length; + for (var i = 0; i < numCharsToWrite; ++i) { + // charCodeAt returns a UTF-16 encoded code unit, so it can be directly written to the HEAP. + var codeUnit = str.charCodeAt(i); // possibly a lead surrogate + HEAP16[((outPtr)>>1)]=codeUnit; + outPtr += 2; + } + // Null-terminate the pointer to the HEAP. + HEAP16[((outPtr)>>1)]=0; + return outPtr - startPtr; +} + +// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte. + +function lengthBytesUTF16(str) { + return str.length*2; +} + +function UTF32ToString(ptr, maxBytesToRead) { + assert(ptr % 4 == 0, 'Pointer passed to UTF32ToString must be aligned to four bytes!'); + var i = 0; + + var str = ''; + // If maxBytesToRead is not passed explicitly, it will be undefined, and this + // will always evaluate to true. This saves on code size. + while (!(i >= maxBytesToRead / 4)) { + var utf32 = HEAP32[(((ptr)+(i*4))>>2)]; + if (utf32 == 0) break; + ++i; + // Gotcha: fromCharCode constructs a character from a UTF-16 encoded code (pair), not from a Unicode code point! So encode the code point to UTF-16 for constructing. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + if (utf32 >= 0x10000) { + var ch = utf32 - 0x10000; + str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF)); + } else { + str += String.fromCharCode(utf32); + } + } + return str; +} + +// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', +// null-terminated and encoded in UTF32 form. The copy will require at most str.length*4+4 bytes of space in the HEAP. +// Use the function lengthBytesUTF32() to compute the exact number of bytes (excluding null terminator) that this function will write. +// Parameters: +// str: the Javascript string to copy. +// outPtr: Byte address in Emscripten HEAP where to write the string to. +// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null +// terminator, i.e. if maxBytesToWrite=4, only the null terminator will be written and nothing else. +// maxBytesToWrite<4 does not write any bytes to the output, not even the null terminator. +// Returns the number of bytes written, EXCLUDING the null terminator. + +function stringToUTF32(str, outPtr, maxBytesToWrite) { + assert(outPtr % 4 == 0, 'Pointer passed to stringToUTF32 must be aligned to four bytes!'); + assert(typeof maxBytesToWrite == 'number', 'stringToUTF32(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!'); + // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed. + if (maxBytesToWrite === undefined) { + maxBytesToWrite = 0x7FFFFFFF; + } + if (maxBytesToWrite < 4) return 0; + var startPtr = outPtr; + var endPtr = startPtr + maxBytesToWrite - 4; + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + var codeUnit = str.charCodeAt(i); // possibly a lead surrogate + if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) { + var trailSurrogate = str.charCodeAt(++i); + codeUnit = 0x10000 + ((codeUnit & 0x3FF) << 10) | (trailSurrogate & 0x3FF); + } + HEAP32[((outPtr)>>2)]=codeUnit; + outPtr += 4; + if (outPtr + 4 > endPtr) break; + } + // Null-terminate the pointer to the HEAP. + HEAP32[((outPtr)>>2)]=0; + return outPtr - startPtr; +} + +// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte. + +function lengthBytesUTF32(str) { + var len = 0; + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + var codeUnit = str.charCodeAt(i); + if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) ++i; // possibly a lead surrogate, so skip over the tail surrogate. + len += 4; + } + + return len; +} + +// Allocate heap space for a JS string, and write it there. +// It is the responsibility of the caller to free() that memory. +function allocateUTF8(str) { + var size = lengthBytesUTF8(str) + 1; + var ret = _malloc(size); + if (ret) stringToUTF8Array(str, HEAP8, ret, size); + return ret; +} + +// Allocate stack space for a JS string, and write it there. +function allocateUTF8OnStack(str) { + var size = lengthBytesUTF8(str) + 1; + var ret = stackAlloc(size); + stringToUTF8Array(str, HEAP8, ret, size); + return ret; +} + +// Deprecated: This function should not be called because it is unsafe and does not provide +// a maximum length limit of how many bytes it is allowed to write. Prefer calling the +// function stringToUTF8Array() instead, which takes in a maximum length that can be used +// to be secure from out of bounds writes. +/** @deprecated + @param {boolean=} dontAddNull */ +function writeStringToMemory(string, buffer, dontAddNull) { + warnOnce('writeStringToMemory is deprecated and should not be called! Use stringToUTF8() instead!'); + + var /** @type {number} */ lastChar, /** @type {number} */ end; + if (dontAddNull) { + // stringToUTF8Array always appends null. If we don't want to do that, remember the + // character that existed at the location where the null will be placed, and restore + // that after the write (below). + end = buffer + lengthBytesUTF8(string); + lastChar = HEAP8[end]; + } + stringToUTF8(string, buffer, Infinity); + if (dontAddNull) HEAP8[end] = lastChar; // Restore the value under the null character. +} + +function writeArrayToMemory(array, buffer) { + assert(array.length >= 0, 'writeArrayToMemory array must have a length (should be an array or typed array)') + HEAP8.set(array, buffer); +} + +/** @param {boolean=} dontAddNull */ +function writeAsciiToMemory(str, buffer, dontAddNull) { + for (var i = 0; i < str.length; ++i) { + assert(str.charCodeAt(i) === str.charCodeAt(i)&0xff); + HEAP8[((buffer++)>>0)]=str.charCodeAt(i); + } + // Null-terminate the pointer to the HEAP. + if (!dontAddNull) HEAP8[((buffer)>>0)]=0; +} + + + +// Memory management + +var PAGE_SIZE = 16384; +var WASM_PAGE_SIZE = 65536; +var ASMJS_PAGE_SIZE = 16777216; + +function alignUp(x, multiple) { + if (x % multiple > 0) { + x += multiple - (x % multiple); + } + return x; +} + +var HEAP, +/** @type {ArrayBuffer} */ + buffer, +/** @type {Int8Array} */ + HEAP8, +/** @type {Uint8Array} */ + HEAPU8, +/** @type {Int16Array} */ + HEAP16, +/** @type {Uint16Array} */ + HEAPU16, +/** @type {Int32Array} */ + HEAP32, +/** @type {Uint32Array} */ + HEAPU32, +/** @type {Float32Array} */ + HEAPF32, +/** @type {Float64Array} */ + HEAPF64; + +function updateGlobalBufferAndViews(buf) { + buffer = buf; + Module['HEAP8'] = HEAP8 = new Int8Array(buf); + Module['HEAP16'] = HEAP16 = new Int16Array(buf); + Module['HEAP32'] = HEAP32 = new Int32Array(buf); + Module['HEAPU8'] = HEAPU8 = new Uint8Array(buf); + Module['HEAPU16'] = HEAPU16 = new Uint16Array(buf); + Module['HEAPU32'] = HEAPU32 = new Uint32Array(buf); + Module['HEAPF32'] = HEAPF32 = new Float32Array(buf); + Module['HEAPF64'] = HEAPF64 = new Float64Array(buf); +} + +var STATIC_BASE = 1024, + STACK_BASE = 5945376, + STACKTOP = STACK_BASE, + STACK_MAX = 702496, + DYNAMIC_BASE = 5945376, + DYNAMICTOP_PTR = 702336; + +assert(STACK_BASE % 16 === 0, 'stack must start aligned'); +assert(DYNAMIC_BASE % 16 === 0, 'heap must start aligned'); + + +var TOTAL_STACK = 5242880; +if (Module['TOTAL_STACK']) assert(TOTAL_STACK === Module['TOTAL_STACK'], 'the stack size can no longer be determined at runtime') + +var INITIAL_INITIAL_MEMORY = Module['INITIAL_MEMORY'] || 134217728;if (!Object.getOwnPropertyDescriptor(Module, 'INITIAL_MEMORY')) Object.defineProperty(Module, 'INITIAL_MEMORY', { configurable: true, get: function() { abort('Module.INITIAL_MEMORY has been replaced with plain INITIAL_INITIAL_MEMORY (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)') } }); + +assert(INITIAL_INITIAL_MEMORY >= TOTAL_STACK, 'INITIAL_MEMORY should be larger than TOTAL_STACK, was ' + INITIAL_INITIAL_MEMORY + '! (TOTAL_STACK=' + TOTAL_STACK + ')'); + +// check for full engine support (use string 'subarray' to avoid closure compiler confusion) +assert(typeof Int32Array !== 'undefined' && typeof Float64Array !== 'undefined' && Int32Array.prototype.subarray !== undefined && Int32Array.prototype.set !== undefined, + 'JS engine does not provide full typed array support'); + + + + + + + + +// In non-standalone/normal mode, we create the memory here. + + + +// Create the main memory. (Note: this isn't used in STANDALONE_WASM mode since the wasm +// memory is created in the wasm, not in JS.) + + if (Module['wasmMemory']) { + wasmMemory = Module['wasmMemory']; + } else + { + wasmMemory = new WebAssembly.Memory({ + 'initial': INITIAL_INITIAL_MEMORY / WASM_PAGE_SIZE + , + 'maximum': INITIAL_INITIAL_MEMORY / WASM_PAGE_SIZE + }); + } + + +if (wasmMemory) { + buffer = wasmMemory.buffer; +} + +// If the user provides an incorrect length, just use that length instead rather than providing the user to +// specifically provide the memory length with Module['INITIAL_MEMORY']. +INITIAL_INITIAL_MEMORY = buffer.byteLength; +assert(INITIAL_INITIAL_MEMORY % WASM_PAGE_SIZE === 0); +updateGlobalBufferAndViews(buffer); + +HEAP32[DYNAMICTOP_PTR>>2] = DYNAMIC_BASE; + + + + + + +// Initializes the stack cookie. Called at the startup of main and at the startup of each thread in pthreads mode. +function writeStackCookie() { + assert((STACK_MAX & 3) == 0); + // The stack grows downwards + HEAPU32[(STACK_MAX >> 2)+1] = 0x2135467; + HEAPU32[(STACK_MAX >> 2)+2] = 0x89BACDFE; + // Also test the global address 0 for integrity. + // We don't do this with ASan because ASan does its own checks for this. + HEAP32[0] = 0x63736d65; /* 'emsc' */ +} + +function checkStackCookie() { + var cookie1 = HEAPU32[(STACK_MAX >> 2)+1]; + var cookie2 = HEAPU32[(STACK_MAX >> 2)+2]; + if (cookie1 != 0x2135467 || cookie2 != 0x89BACDFE) { + abort('Stack overflow! Stack cookie has been overwritten, expected hex dwords 0x89BACDFE and 0x2135467, but received 0x' + cookie2.toString(16) + ' ' + cookie1.toString(16)); + } + // Also test the global address 0 for integrity. + // We don't do this with ASan because ASan does its own checks for this. + if (HEAP32[0] !== 0x63736d65 /* 'emsc' */) abort('Runtime error: The application has corrupted its heap memory area (address zero)!'); +} + + + + + +// Endianness check (note: assumes compiler arch was little-endian) +(function() { + var h16 = new Int16Array(1); + var h8 = new Int8Array(h16.buffer); + h16[0] = 0x6373; + if (h8[0] !== 0x73 || h8[1] !== 0x63) throw 'Runtime error: expected the system to be little-endian!'; +})(); + +function abortFnPtrError(ptr, sig) { + var possibleSig = ''; + for(var x in debug_tables) { + var tbl = debug_tables[x]; + if (tbl[ptr]) { + possibleSig += 'as sig "' + x + '" pointing to function ' + tbl[ptr] + ', '; + } + } + abort("Invalid function pointer " + ptr + " called with signature '" + sig + "'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this). This pointer might make sense in another type signature: " + possibleSig); +} + + + +function callRuntimeCallbacks(callbacks) { + while(callbacks.length > 0) { + var callback = callbacks.shift(); + if (typeof callback == 'function') { + callback(Module); // Pass the module as the first argument. + continue; + } + var func = callback.func; + if (typeof func === 'number') { + if (callback.arg === undefined) { + Module['dynCall_v'](func); + } else { + Module['dynCall_vi'](func, callback.arg); + } + } else { + func(callback.arg === undefined ? null : callback.arg); + } + } +} + +var __ATPRERUN__ = []; // functions called before the runtime is initialized +var __ATINIT__ = []; // functions called during startup +var __ATMAIN__ = []; // functions called when main() is to be run +var __ATEXIT__ = []; // functions called during shutdown +var __ATPOSTRUN__ = []; // functions called after the main() is called + +var runtimeInitialized = false; +var runtimeExited = false; + + +function preRun() { + + if (Module['preRun']) { + if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']]; + while (Module['preRun'].length) { + addOnPreRun(Module['preRun'].shift()); + } + } + + callRuntimeCallbacks(__ATPRERUN__); +} + +function initRuntime() { + checkStackCookie(); + assert(!runtimeInitialized); + runtimeInitialized = true; + if (!Module["noFSInit"] && !FS.init.initialized) FS.init(); +TTY.init(); +SOCKFS.root = FS.mount(SOCKFS, {}, null); + callRuntimeCallbacks(__ATINIT__); +} + +function preMain() { + checkStackCookie(); + FS.ignorePermissions = false; + callRuntimeCallbacks(__ATMAIN__); +} + +function exitRuntime() { + checkStackCookie(); + callRuntimeCallbacks(__ATEXIT__); + FS.quit(); +TTY.shutdown(); + runtimeExited = true; +} + +function postRun() { + checkStackCookie(); + + if (Module['postRun']) { + if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']]; + while (Module['postRun'].length) { + addOnPostRun(Module['postRun'].shift()); + } + } + + callRuntimeCallbacks(__ATPOSTRUN__); +} + +function addOnPreRun(cb) { + __ATPRERUN__.unshift(cb); +} + +function addOnInit(cb) { + __ATINIT__.unshift(cb); +} + +function addOnPreMain(cb) { + __ATMAIN__.unshift(cb); +} + +function addOnExit(cb) { + __ATEXIT__.unshift(cb); +} + +function addOnPostRun(cb) { + __ATPOSTRUN__.unshift(cb); +} + +/** @param {number|boolean=} ignore */ +function unSign(value, bits, ignore) { + if (value >= 0) { + return value; + } + return bits <= 32 ? 2*Math.abs(1 << (bits-1)) + value // Need some trickery, since if bits == 32, we are right at the limit of the bits JS uses in bitshifts + : Math.pow(2, bits) + value; +} +/** @param {number|boolean=} ignore */ +function reSign(value, bits, ignore) { + if (value <= 0) { + return value; + } + var half = bits <= 32 ? Math.abs(1 << (bits-1)) // abs is needed if bits == 32 + : Math.pow(2, bits-1); + if (value >= half && (bits <= 32 || value > half)) { // for huge values, we can hit the precision limit and always get true here. so don't do that + // but, in general there is no perfect solution here. With 64-bit ints, we get rounding and errors + // TODO: In i64 mode 1, resign the two parts separately and safely + value = -2*half + value; // Cannot bitshift half, as it may be at the limit of the bits JS uses in bitshifts + } + return value; +} + + + + +// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/imul + +// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/fround + +// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/clz32 + +// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/trunc + +assert(Math.imul, 'This browser does not support Math.imul(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill'); +assert(Math.fround, 'This browser does not support Math.fround(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill'); +assert(Math.clz32, 'This browser does not support Math.clz32(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill'); +assert(Math.trunc, 'This browser does not support Math.trunc(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill'); + +var Math_abs = Math.abs; +var Math_cos = Math.cos; +var Math_sin = Math.sin; +var Math_tan = Math.tan; +var Math_acos = Math.acos; +var Math_asin = Math.asin; +var Math_atan = Math.atan; +var Math_atan2 = Math.atan2; +var Math_exp = Math.exp; +var Math_log = Math.log; +var Math_sqrt = Math.sqrt; +var Math_ceil = Math.ceil; +var Math_floor = Math.floor; +var Math_pow = Math.pow; +var Math_imul = Math.imul; +var Math_fround = Math.fround; +var Math_round = Math.round; +var Math_min = Math.min; +var Math_max = Math.max; +var Math_clz32 = Math.clz32; +var Math_trunc = Math.trunc; + + + +// A counter of dependencies for calling run(). If we need to +// do asynchronous work before running, increment this and +// decrement it. Incrementing must happen in a place like +// Module.preRun (used by emcc to add file preloading). +// Note that you can add dependencies in preRun, even though +// it happens right before run - run will be postponed until +// the dependencies are met. +var runDependencies = 0; +var runDependencyWatcher = null; +var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled +var runDependencyTracking = {}; + +function getUniqueRunDependency(id) { + var orig = id; + while (1) { + if (!runDependencyTracking[id]) return id; + id = orig + Math.random(); + } +} + +function addRunDependency(id) { + runDependencies++; + + if (Module['monitorRunDependencies']) { + Module['monitorRunDependencies'](runDependencies); + } + + if (id) { + assert(!runDependencyTracking[id]); + runDependencyTracking[id] = 1; + if (runDependencyWatcher === null && typeof setInterval !== 'undefined') { + // Check for missing dependencies every few seconds + runDependencyWatcher = setInterval(function() { + if (ABORT) { + clearInterval(runDependencyWatcher); + runDependencyWatcher = null; + return; + } + var shown = false; + for (var dep in runDependencyTracking) { + if (!shown) { + shown = true; + err('still waiting on run dependencies:'); + } + err('dependency: ' + dep); + } + if (shown) { + err('(end of list)'); + } + }, 10000); + } + } else { + err('warning: run dependency added without ID'); + } +} + +function removeRunDependency(id) { + runDependencies--; + + if (Module['monitorRunDependencies']) { + Module['monitorRunDependencies'](runDependencies); + } + + if (id) { + assert(runDependencyTracking[id]); + delete runDependencyTracking[id]; + } else { + err('warning: run dependency removed without ID'); + } + if (runDependencies == 0) { + if (runDependencyWatcher !== null) { + clearInterval(runDependencyWatcher); + runDependencyWatcher = null; + } + if (dependenciesFulfilled) { + var callback = dependenciesFulfilled; + dependenciesFulfilled = null; + callback(); // can add another dependenciesFulfilled + } + } +} + +Module["preloadedImages"] = {}; // maps url to image data +Module["preloadedAudios"] = {}; // maps url to audio data + +/** @param {string|number=} what */ +function abort(what) { + if (Module['onAbort']) { + Module['onAbort'](what); + } + + what += ''; + err(what); + + ABORT = true; + EXITSTATUS = 1; + + var output = 'abort(' + what + ') at ' + stackTrace(); + what = output; + + // Use a wasm runtime error, because a JS error might be seen as a foreign + // exception, which means we'd run destructors on it. We need the error to + // simply make the program stop. + var e = new WebAssembly.RuntimeError(what); + + // Throw the error whether or not MODULARIZE is set because abort is used + // in code paths apart from instantiation where an exception is expected + // to be thrown when abort is called. + throw e; +} + + +var memoryInitializer = null; + + + + + + + + + + + + +function hasPrefix(str, prefix) { + return String.prototype.startsWith ? + str.startsWith(prefix) : + str.indexOf(prefix) === 0; +} + +// Prefix of data URIs emitted by SINGLE_FILE and related options. +var dataURIPrefix = 'data:application/octet-stream;base64,'; + +// Indicates whether filename is a base64 data URI. +function isDataURI(filename) { + return hasPrefix(filename, dataURIPrefix); +} + +var fileURIPrefix = "file://"; + +// Indicates whether filename is delivered via file protocol (as opposed to http/https) +function isFileURI(filename) { + return hasPrefix(filename, fileURIPrefix); +} + + + +function createExportWrapper(name, fixedasm) { + return function() { + var displayName = name; + var asm = fixedasm; + if (!fixedasm) { + asm = Module['asm']; + } + assert(runtimeInitialized, 'native function `' + displayName + '` called before runtime initialization'); + assert(!runtimeExited, 'native function `' + displayName + '` called after runtime exit (use NO_EXIT_RUNTIME to keep it alive after main() exits)'); + if (!asm[name]) { + assert(asm[name], 'exported native function `' + displayName + '` not found'); + } + return asm[name].apply(null, arguments); + }; +} + +var wasmBinaryFile = 'pewpewlive-wasm.wasm'; +if (!isDataURI(wasmBinaryFile)) { + wasmBinaryFile = locateFile(wasmBinaryFile); +} + +function getBinary() { + try { + if (wasmBinary) { + return new Uint8Array(wasmBinary); + } + + if (readBinary) { + return readBinary(wasmBinaryFile); + } else { + throw "both async and sync fetching of the wasm failed"; + } + } + catch (err) { + abort(err); + } +} + +function getBinaryPromise() { + // If we don't have the binary yet, and have the Fetch api, use that; + // in some environments, like Electron's render process, Fetch api may be present, but have a different context than expected, let's only use it on the Web + if (!wasmBinary && (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && typeof fetch === 'function' + // Let's not use fetch to get objects over file:// as it's most likely Cordova which doesn't support fetch for file:// + && !isFileURI(wasmBinaryFile) + ) { + return fetch(wasmBinaryFile, { credentials: 'same-origin' }).then(function(response) { + if (!response['ok']) { + throw "failed to load wasm binary file at '" + wasmBinaryFile + "'"; + } + return response['arrayBuffer'](); + }).catch(function () { + return getBinary(); + }); + } + // Otherwise, getBinary should be able to get it synchronously + return new Promise(function(resolve, reject) { + resolve(getBinary()); + }); +} + + + +// Create the wasm instance. +// Receives the wasm imports, returns the exports. +function createWasm() { + // prepare imports + var info = { + 'env': asmLibraryArg, + 'wasi_snapshot_preview1': asmLibraryArg + }; + // Load the wasm module and create an instance of using native support in the JS engine. + // handle a generated wasm instance, receiving its exports and + // performing other necessary setup + /** @param {WebAssembly.Module=} module*/ + function receiveInstance(instance, module) { + var exports = instance.exports; + Module['asm'] = exports; + removeRunDependency('wasm-instantiate'); + } + // we can't run yet (except in a pthread, where we have a custom sync instantiator) + addRunDependency('wasm-instantiate'); + + + // Async compilation can be confusing when an error on the page overwrites Module + // (for example, if the order of elements is wrong, and the one defining Module is + // later), so we save Module and check it later. + var trueModule = Module; + function receiveInstantiatedSource(output) { + // 'output' is a WebAssemblyInstantiatedSource object which has both the module and instance. + // receiveInstance() will swap in the exports (to Module.asm) so they can be called + assert(Module === trueModule, 'the Module object should not be replaced during async compilation - perhaps the order of HTML elements is wrong?'); + trueModule = null; + // TODO: Due to Closure regression https://github.com/google/closure-compiler/issues/3193, the above line no longer optimizes out down to the following line. + // When the regression is fixed, can restore the above USE_PTHREADS-enabled path. + receiveInstance(output['instance']); + } + + + function instantiateArrayBuffer(receiver) { + return getBinaryPromise().then(function(binary) { + return WebAssembly.instantiate(binary, info); + }).then(receiver, function(reason) { + err('failed to asynchronously prepare wasm: ' + reason); + + + abort(reason); + }); + } + + // Prefer streaming instantiation if available. + function instantiateAsync() { + if (!wasmBinary && + typeof WebAssembly.instantiateStreaming === 'function' && + !isDataURI(wasmBinaryFile) && + // Don't use streaming for file:// delivered objects in a webview, fetch them synchronously. + !isFileURI(wasmBinaryFile) && + typeof fetch === 'function') { + fetch(wasmBinaryFile, { credentials: 'same-origin' }).then(function (response) { + var result = WebAssembly.instantiateStreaming(response, info); + return result.then(receiveInstantiatedSource, function(reason) { + // We expect the most common failure cause to be a bad MIME type for the binary, + // in which case falling back to ArrayBuffer instantiation should work. + err('wasm streaming compile failed: ' + reason); + err('falling back to ArrayBuffer instantiation'); + return instantiateArrayBuffer(receiveInstantiatedSource); + }); + }); + } else { + return instantiateArrayBuffer(receiveInstantiatedSource); + } + } + // User shell pages can write their own Module.instantiateWasm = function(imports, successCallback) callback + // to manually instantiate the Wasm module themselves. This allows pages to run the instantiation parallel + // to any other async startup actions they are performing. + if (Module['instantiateWasm']) { + try { + var exports = Module['instantiateWasm'](info, receiveInstance); + return exports; + } catch(e) { + err('Module.instantiateWasm callback failed with error: ' + e); + return false; + } + } + + instantiateAsync(); + return {}; // no exports yet; we'll fill them in later +} + + +// Globals used by JS i64 conversions +var tempDouble; +var tempI64; + +// === Body === + +var ASM_CONSTS = { + 584056: function($0) {var url = UTF8ToString($0); window.open(url, "_blank");}, + 584184: function() {Module.audioBuffers = {}; Module.audioContext = new (window.AudioContext || window.webkitAudioContext)();}, + 584291: function($0, $1, $2) {var sound_id = $0; var sample_ptr = $1; var sample_count = $2; audio_buffer = Module.audioContext.createBuffer( 1, sample_count, Module.audioContext.sampleRate); float_array = HEAPF32.subarray(sample_ptr / 4, (sample_ptr / 4) + sample_count); if (typeof audio_buffer.copyToChannel == 'function') { audio_buffer.copyToChannel(float_array, 0); } else { audio_buffer.getChannelData(0).set(float_array); } Module.audioBuffers[sound_id] = audio_buffer;}, + 584747: function($0, $1, $2) {var sound_id = $0; Module.audioContext.resume().then(function() { var source = Module.audioContext.createBufferSource(); var panner = Module.audioContext.createPanner(); source.buffer = Module.audioBuffers[sound_id]; if (panner.positionX) { panner.positionX.value = $1; panner.positionY.value = $2; } else { panner.setPosition($1, $2, 0); } panner.rolloffFactor = 0.1; source.connect(panner); panner.connect(Module.audioContext.destination); source.start(0); });}, + 585218: function($0) {var sound_id = $0; Module.audioContext.resume().then(function() { var source = Module.audioContext.createBufferSource(); source.buffer = Module.audioBuffers[sound_id]; source.connect(Module.audioContext.destination); source.start(0); });}, + 585462: function($0, $1) {var listener = Module.audioContext.listener; if (listener.positionX) { listener.positionX.value = $0; listener.positionY.value = $1; } else { listener.setPosition($0, $1, 0); }}, + 585646: function() {Module.audioBuffers = {}}, + 585671: function() {return Module.audioContext.sampleRate;}, + 586463: function($0, $1, $2, $3, $4, $5) {var url = UTF8ToString($0); var content_type = UTF8ToString($3); var post_string = new Uint8ClampedArray(Module.HEAPU8.buffer, $4, $5); var xhr = new XMLHttpRequest(); xhr.open("POST", url, true); xhr.responseType = 'arraybuffer'; xhr.setRequestHeader('Content-Type', content_type); xhr.timeout = 10000; var delegateId = $1; var xhrId = $2; xhr.onreadystatechange = function() { if (xhr.readyState == XMLHttpRequest.DONE) { if (xhr.status == 200) { Module.urlRequestOnSuccess(delegateId, xhrId, xhr.response); } else { Module.urlRequestOnError(delegateId, xhrId, xhr.status); } } }; xhr.send(post_string);}, + 623116: function($0, $1, $2) {var w = $0; var h = $1; var pixels = $2; if (!Module['SDL2']) Module['SDL2'] = {}; var SDL2 = Module['SDL2']; if (SDL2.ctxCanvas !== Module['canvas']) { SDL2.ctx = Module['createContext'](Module['canvas'], false, true); SDL2.ctxCanvas = Module['canvas']; } if (SDL2.w !== w || SDL2.h !== h || SDL2.imageCtx !== SDL2.ctx) { SDL2.image = SDL2.ctx.createImageData(w, h); SDL2.w = w; SDL2.h = h; SDL2.imageCtx = SDL2.ctx; } var data = SDL2.image.data; var src = pixels >> 2; var dst = 0; var num; if (typeof CanvasPixelArray !== 'undefined' && data instanceof CanvasPixelArray) { num = data.length; while (dst < num) { var val = HEAP32[src]; data[dst ] = val & 0xff; data[dst+1] = (val >> 8) & 0xff; data[dst+2] = (val >> 16) & 0xff; data[dst+3] = 0xff; src++; dst += 4; } } else { if (SDL2.data32Data !== data) { SDL2.data32 = new Int32Array(data.buffer); SDL2.data8 = new Uint8Array(data.buffer); } var data32 = SDL2.data32; num = data32.length; data32.set(HEAP32.subarray(src, src + num)); var data8 = SDL2.data8; var i = 3; var j = i + 4*num; if (num % 8 == 0) { while (i < j) { data8[i] = 0xff; i = i + 4 | 0; data8[i] = 0xff; i = i + 4 | 0; data8[i] = 0xff; i = i + 4 | 0; data8[i] = 0xff; i = i + 4 | 0; data8[i] = 0xff; i = i + 4 | 0; data8[i] = 0xff; i = i + 4 | 0; data8[i] = 0xff; i = i + 4 | 0; data8[i] = 0xff; i = i + 4 | 0; } } else { while (i < j) { data8[i] = 0xff; i = i + 4 | 0; } } } SDL2.ctx.putImageData(SDL2.image, 0, 0); return 0;}, + 624595: function($0, $1, $2, $3, $4) {var w = $0; var h = $1; var hot_x = $2; var hot_y = $3; var pixels = $4; var canvas = document.createElement("canvas"); canvas.width = w; canvas.height = h; var ctx = canvas.getContext("2d"); var image = ctx.createImageData(w, h); var data = image.data; var src = pixels >> 2; var dst = 0; var num; if (typeof CanvasPixelArray !== 'undefined' && data instanceof CanvasPixelArray) { num = data.length; while (dst < num) { var val = HEAP32[src]; data[dst ] = val & 0xff; data[dst+1] = (val >> 8) & 0xff; data[dst+2] = (val >> 16) & 0xff; data[dst+3] = (val >> 24) & 0xff; src++; dst += 4; } } else { var data32 = new Int32Array(data.buffer); num = data32.length; data32.set(HEAP32.subarray(src, src + num)); } ctx.putImageData(image, 0, 0); var url = hot_x === 0 && hot_y === 0 ? "url(" + canvas.toDataURL() + "), auto" : "url(" + canvas.toDataURL() + ") " + hot_x + " " + hot_y + ", auto"; var urlBuf = _malloc(url.length + 1); stringToUTF8(url, urlBuf, url.length + 1); return urlBuf;}, + 625584: function($0) {if (Module['canvas']) { Module['canvas'].style['cursor'] = UTF8ToString($0); } return 0;}, + 625677: function() {if (Module['canvas']) { Module['canvas'].style['cursor'] = 'none'; }}, + 626902: function() {return screen.width;}, + 626929: function() {return screen.height;}, + 626957: function() {return window.innerWidth;}, + 626989: function() {return window.innerHeight;}, + 627067: function($0) {if (typeof setWindowTitle !== 'undefined') { setWindowTitle(UTF8ToString($0)); } return 0;}, + 627201: function() {if (typeof(AudioContext) !== 'undefined') { return 1; } else if (typeof(webkitAudioContext) !== 'undefined') { return 1; } return 0;}, + 627367: function() {if ((typeof(navigator.mediaDevices) !== 'undefined') && (typeof(navigator.mediaDevices.getUserMedia) !== 'undefined')) { return 1; } else if (typeof(navigator.webkitGetUserMedia) !== 'undefined') { return 1; } return 0;}, + 627593: function($0) {if(typeof(Module['SDL2']) === 'undefined') { Module['SDL2'] = {}; } var SDL2 = Module['SDL2']; if (!$0) { SDL2.audio = {}; } else { SDL2.capture = {}; } if (!SDL2.audioContext) { if (typeof(AudioContext) !== 'undefined') { SDL2.audioContext = new AudioContext(); } else if (typeof(webkitAudioContext) !== 'undefined') { SDL2.audioContext = new webkitAudioContext(); } if (SDL2.audioContext) { autoResumeAudioContext(SDL2.audioContext); } } return SDL2.audioContext === undefined ? -1 : 0;}, + 628146: function() {var SDL2 = Module['SDL2']; return SDL2.audioContext.sampleRate;}, + 628216: function($0, $1, $2, $3) {var SDL2 = Module['SDL2']; var have_microphone = function(stream) { if (SDL2.capture.silenceTimer !== undefined) { clearTimeout(SDL2.capture.silenceTimer); SDL2.capture.silenceTimer = undefined; } SDL2.capture.mediaStreamNode = SDL2.audioContext.createMediaStreamSource(stream); SDL2.capture.scriptProcessorNode = SDL2.audioContext.createScriptProcessor($1, $0, 1); SDL2.capture.scriptProcessorNode.onaudioprocess = function(audioProcessingEvent) { if ((SDL2 === undefined) || (SDL2.capture === undefined)) { return; } audioProcessingEvent.outputBuffer.getChannelData(0).fill(0.0); SDL2.capture.currentCaptureBuffer = audioProcessingEvent.inputBuffer; dynCall('vi', $2, [$3]); }; SDL2.capture.mediaStreamNode.connect(SDL2.capture.scriptProcessorNode); SDL2.capture.scriptProcessorNode.connect(SDL2.audioContext.destination); SDL2.capture.stream = stream; }; var no_microphone = function(error) { }; SDL2.capture.silenceBuffer = SDL2.audioContext.createBuffer($0, $1, SDL2.audioContext.sampleRate); SDL2.capture.silenceBuffer.getChannelData(0).fill(0.0); var silence_callback = function() { SDL2.capture.currentCaptureBuffer = SDL2.capture.silenceBuffer; dynCall('vi', $2, [$3]); }; SDL2.capture.silenceTimer = setTimeout(silence_callback, ($1 / SDL2.audioContext.sampleRate) * 1000); if ((navigator.mediaDevices !== undefined) && (navigator.mediaDevices.getUserMedia !== undefined)) { navigator.mediaDevices.getUserMedia({ audio: true, video: false }).then(have_microphone).catch(no_microphone); } else if (navigator.webkitGetUserMedia !== undefined) { navigator.webkitGetUserMedia({ audio: true, video: false }, have_microphone, no_microphone); }}, + 629868: function($0, $1, $2, $3) {var SDL2 = Module['SDL2']; SDL2.audio.scriptProcessorNode = SDL2.audioContext['createScriptProcessor']($1, 0, $0); SDL2.audio.scriptProcessorNode['onaudioprocess'] = function (e) { if ((SDL2 === undefined) || (SDL2.audio === undefined)) { return; } SDL2.audio.currentOutputBuffer = e['outputBuffer']; dynCall('vi', $2, [$3]); }; SDL2.audio.scriptProcessorNode['connect'](SDL2.audioContext['destination']);}, + 630278: function($0, $1) {var SDL2 = Module['SDL2']; var numChannels = SDL2.capture.currentCaptureBuffer.numberOfChannels; for (var c = 0; c < numChannels; ++c) { var channelData = SDL2.capture.currentCaptureBuffer.getChannelData(c); if (channelData.length != $1) { throw 'Web Audio capture buffer length mismatch! Destination size: ' + channelData.length + ' samples vs expected ' + $1 + ' samples!'; } if (numChannels == 1) { for (var j = 0; j < $1; ++j) { setValue($0 + (j * 4), channelData[j], 'float'); } } else { for (var j = 0; j < $1; ++j) { setValue($0 + (((j * numChannels) + c) * 4), channelData[j], 'float'); } } }}, + 630883: function($0, $1) {var SDL2 = Module['SDL2']; var numChannels = SDL2.audio.currentOutputBuffer['numberOfChannels']; for (var c = 0; c < numChannels; ++c) { var channelData = SDL2.audio.currentOutputBuffer['getChannelData'](c); if (channelData.length != $1) { throw 'Web Audio output buffer length mismatch! Destination size: ' + channelData.length + ' samples vs expected ' + $1 + ' samples!'; } for (var j = 0; j < $1; ++j) { channelData[j] = HEAPF32[$0 + ((j*numChannels + c) << 2) >> 2]; } }}, + 631363: function($0) {var SDL2 = Module['SDL2']; if ($0) { if (SDL2.capture.silenceTimer !== undefined) { clearTimeout(SDL2.capture.silenceTimer); } if (SDL2.capture.stream !== undefined) { var tracks = SDL2.capture.stream.getAudioTracks(); for (var i = 0; i < tracks.length; i++) { SDL2.capture.stream.removeTrack(tracks[i]); } SDL2.capture.stream = undefined; } if (SDL2.capture.scriptProcessorNode !== undefined) { SDL2.capture.scriptProcessorNode.onaudioprocess = function(audioProcessingEvent) {}; SDL2.capture.scriptProcessorNode.disconnect(); SDL2.capture.scriptProcessorNode = undefined; } if (SDL2.capture.mediaStreamNode !== undefined) { SDL2.capture.mediaStreamNode.disconnect(); SDL2.capture.mediaStreamNode = undefined; } if (SDL2.capture.silenceBuffer !== undefined) { SDL2.capture.silenceBuffer = undefined } SDL2.capture = undefined; } else { if (SDL2.audio.scriptProcessorNode != undefined) { SDL2.audio.scriptProcessorNode.disconnect(); SDL2.audio.scriptProcessorNode = undefined; } SDL2.audio = undefined; } if ((SDL2.audioContext !== undefined) && (SDL2.audio === undefined) && (SDL2.capture === undefined)) { SDL2.audioContext.close(); SDL2.audioContext = undefined; }} +}; + +function _emscripten_asm_const_iii(code, sigPtr, argbuf) { + var args = readAsmConstArgs(sigPtr, argbuf); + + return ASM_CONSTS[code].apply(null, args); +} + + + +// STATICTOP = STATIC_BASE + 701472; +/* global initializers */ __ATINIT__.push({ func: function() { ___wasm_call_ctors() } }); + + + + +/* no memory initializer */ +// {{PRE_LIBRARY}} + + + function abortStackOverflow(allocSize) { + abort('Stack overflow! Attempted to allocate ' + allocSize + ' bytes on the stack, but stack has only ' + (STACK_MAX - stackSave() + allocSize) + ' bytes available!'); + } + + + function listenOnce(object, event, func) { + object.addEventListener(event, func, { 'once': true }); + }function autoResumeAudioContext(ctx, elements) { + if (!elements) { + elements = [document, document.getElementById('canvas')]; + } + ['keydown', 'mousedown', 'touchstart'].forEach(function(event) { + elements.forEach(function(element) { + if (element) { + listenOnce(element, event, function() { + if (ctx.state === 'suspended') ctx.resume(); + }); + } + }); + }); + } + + function demangle(func) { + // If demangle has failed before, stop demangling any further function names + // This avoids an infinite recursion with malloc()->abort()->stackTrace()->demangle()->malloc()->... + demangle.recursionGuard = (demangle.recursionGuard|0)+1; + if (demangle.recursionGuard > 1) return func; + var __cxa_demangle_func = Module['___cxa_demangle'] || Module['__cxa_demangle']; + assert(__cxa_demangle_func); + var stackTop = stackSave(); + try { + var s = func; + if (s.startsWith('__Z')) + s = s.substr(1); + var len = lengthBytesUTF8(s)+1; + var buf = stackAlloc(len); + stringToUTF8(s, buf, len); + var status = stackAlloc(4); + var ret = __cxa_demangle_func(buf, 0, 0, status); + if (HEAP32[((status)>>2)] === 0 && ret) { + return UTF8ToString(ret); + } + // otherwise, libcxxabi failed + } catch(e) { + } finally { + _free(ret); + stackRestore(stackTop); + if (demangle.recursionGuard < 2) --demangle.recursionGuard; + } + // failure when using libcxxabi, don't demangle + return func; + } + + function demangleAll(text) { + var regex = + /\b_Z[\w\d_]+/g; + return text.replace(regex, + function(x) { + var y = demangle(x); + return x === y ? x : (y + ' [' + x + ']'); + }); + } + + function jsStackTrace() { + var err = new Error(); + if (!err.stack) { + // IE10+ special cases: It does have callstack info, but it is only populated if an Error object is thrown, + // so try that as a special-case. + try { + throw new Error(); + } catch(e) { + err = e; + } + if (!err.stack) { + return '(no stack trace available)'; + } + } + return err.stack.toString(); + } + + function stackTrace() { + var js = jsStackTrace(); + if (Module['extraStackTrace']) js += '\n' + Module['extraStackTrace'](); + return demangleAll(js); + } + + function ___assert_fail(condition, filename, line, func) { + abort('Assertion failed: ' + UTF8ToString(condition) + ', at: ' + [filename ? UTF8ToString(filename) : 'unknown filename', line, func ? UTF8ToString(func) : 'unknown function']); + } + + + function _atexit(func, arg) { + + __ATEXIT__.unshift({ func: func, arg: arg }); + }function ___cxa_atexit(a0,a1 + ) { + return _atexit(a0,a1); + } + + function ___cxa_thread_atexit(a0,a1 + ) { + return _atexit(a0,a1); + } + + function ___handle_stack_overflow() { + abort('stack overflow') + } + + + function setErrNo(value) { + HEAP32[((___errno_location())>>2)]=value; + return value; + }function ___map_file(pathname, size) { + setErrNo(63); + return -1; + } + + + + var PATH={splitPath:function(filename) { + var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/; + return splitPathRe.exec(filename).slice(1); + },normalizeArray:function(parts, allowAboveRoot) { + // if the path tries to go above the root, `up` ends up > 0 + var up = 0; + for (var i = parts.length - 1; i >= 0; i--) { + var last = parts[i]; + if (last === '.') { + parts.splice(i, 1); + } else if (last === '..') { + parts.splice(i, 1); + up++; + } else if (up) { + parts.splice(i, 1); + up--; + } + } + // if the path is allowed to go above the root, restore leading ..s + if (allowAboveRoot) { + for (; up; up--) { + parts.unshift('..'); + } + } + return parts; + },normalize:function(path) { + var isAbsolute = path.charAt(0) === '/', + trailingSlash = path.substr(-1) === '/'; + // Normalize the path + path = PATH.normalizeArray(path.split('/').filter(function(p) { + return !!p; + }), !isAbsolute).join('/'); + if (!path && !isAbsolute) { + path = '.'; + } + if (path && trailingSlash) { + path += '/'; + } + return (isAbsolute ? '/' : '') + path; + },dirname:function(path) { + var result = PATH.splitPath(path), + root = result[0], + dir = result[1]; + if (!root && !dir) { + // No dirname whatsoever + return '.'; + } + if (dir) { + // It has a dirname, strip trailing slash + dir = dir.substr(0, dir.length - 1); + } + return root + dir; + },basename:function(path) { + // EMSCRIPTEN return '/'' for '/', not an empty string + if (path === '/') return '/'; + var lastSlash = path.lastIndexOf('/'); + if (lastSlash === -1) return path; + return path.substr(lastSlash+1); + },extname:function(path) { + return PATH.splitPath(path)[3]; + },join:function() { + var paths = Array.prototype.slice.call(arguments, 0); + return PATH.normalize(paths.join('/')); + },join2:function(l, r) { + return PATH.normalize(l + '/' + r); + }}; + + + var PATH_FS={resolve:function() { + var resolvedPath = '', + resolvedAbsolute = false; + for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) { + var path = (i >= 0) ? arguments[i] : FS.cwd(); + // Skip empty and invalid entries + if (typeof path !== 'string') { + throw new TypeError('Arguments to path.resolve must be strings'); + } else if (!path) { + return ''; // an invalid portion invalidates the whole thing + } + resolvedPath = path + '/' + resolvedPath; + resolvedAbsolute = path.charAt(0) === '/'; + } + // At this point the path should be resolved to a full absolute path, but + // handle relative paths to be safe (might happen when process.cwd() fails) + resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter(function(p) { + return !!p; + }), !resolvedAbsolute).join('/'); + return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.'; + },relative:function(from, to) { + from = PATH_FS.resolve(from).substr(1); + to = PATH_FS.resolve(to).substr(1); + function trim(arr) { + var start = 0; + for (; start < arr.length; start++) { + if (arr[start] !== '') break; + } + var end = arr.length - 1; + for (; end >= 0; end--) { + if (arr[end] !== '') break; + } + if (start > end) return []; + return arr.slice(start, end - start + 1); + } + var fromParts = trim(from.split('/')); + var toParts = trim(to.split('/')); + var length = Math.min(fromParts.length, toParts.length); + var samePartsLength = length; + for (var i = 0; i < length; i++) { + if (fromParts[i] !== toParts[i]) { + samePartsLength = i; + break; + } + } + var outputParts = []; + for (var i = samePartsLength; i < fromParts.length; i++) { + outputParts.push('..'); + } + outputParts = outputParts.concat(toParts.slice(samePartsLength)); + return outputParts.join('/'); + }}; + + var TTY={ttys:[],init:function () { + // https://github.com/emscripten-core/emscripten/pull/1555 + // if (ENVIRONMENT_IS_NODE) { + // // currently, FS.init does not distinguish if process.stdin is a file or TTY + // // device, it always assumes it's a TTY device. because of this, we're forcing + // // process.stdin to UTF8 encoding to at least make stdin reading compatible + // // with text files until FS.init can be refactored. + // process['stdin']['setEncoding']('utf8'); + // } + },shutdown:function() { + // https://github.com/emscripten-core/emscripten/pull/1555 + // if (ENVIRONMENT_IS_NODE) { + // // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)? + // // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation + // // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists? + // // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle + // // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call + // process['stdin']['pause'](); + // } + },register:function(dev, ops) { + TTY.ttys[dev] = { input: [], output: [], ops: ops }; + FS.registerDevice(dev, TTY.stream_ops); + },stream_ops:{open:function(stream) { + var tty = TTY.ttys[stream.node.rdev]; + if (!tty) { + throw new FS.ErrnoError(43); + } + stream.tty = tty; + stream.seekable = false; + },close:function(stream) { + // flush any pending line data + stream.tty.ops.flush(stream.tty); + },flush:function(stream) { + stream.tty.ops.flush(stream.tty); + },read:function(stream, buffer, offset, length, pos /* ignored */) { + if (!stream.tty || !stream.tty.ops.get_char) { + throw new FS.ErrnoError(60); + } + var bytesRead = 0; + for (var i = 0; i < length; i++) { + var result; + try { + result = stream.tty.ops.get_char(stream.tty); + } catch (e) { + throw new FS.ErrnoError(29); + } + if (result === undefined && bytesRead === 0) { + throw new FS.ErrnoError(6); + } + if (result === null || result === undefined) break; + bytesRead++; + buffer[offset+i] = result; + } + if (bytesRead) { + stream.node.timestamp = Date.now(); + } + return bytesRead; + },write:function(stream, buffer, offset, length, pos) { + if (!stream.tty || !stream.tty.ops.put_char) { + throw new FS.ErrnoError(60); + } + try { + for (var i = 0; i < length; i++) { + stream.tty.ops.put_char(stream.tty, buffer[offset+i]); + } + } catch (e) { + throw new FS.ErrnoError(29); + } + if (length) { + stream.node.timestamp = Date.now(); + } + return i; + }},default_tty_ops:{get_char:function(tty) { + if (!tty.input.length) { + var result = null; + if (ENVIRONMENT_IS_NODE) { + // we will read data by chunks of BUFSIZE + var BUFSIZE = 256; + var buf = Buffer.alloc ? Buffer.alloc(BUFSIZE) : new Buffer(BUFSIZE); + var bytesRead = 0; + + try { + bytesRead = nodeFS.readSync(process.stdin.fd, buf, 0, BUFSIZE, null); + } catch(e) { + // Cross-platform differences: on Windows, reading EOF throws an exception, but on other OSes, + // reading EOF returns 0. Uniformize behavior by treating the EOF exception to return 0. + if (e.toString().indexOf('EOF') != -1) bytesRead = 0; + else throw e; + } + + if (bytesRead > 0) { + result = buf.slice(0, bytesRead).toString('utf-8'); + } else { + result = null; + } + } else + if (typeof window != 'undefined' && + typeof window.prompt == 'function') { + // Browser. + result = window.prompt('Input: '); // returns null on cancel + if (result !== null) { + result += '\n'; + } + } else if (typeof readline == 'function') { + // Command line. + result = readline(); + if (result !== null) { + result += '\n'; + } + } + if (!result) { + return null; + } + tty.input = intArrayFromString(result, true); + } + return tty.input.shift(); + },put_char:function(tty, val) { + if (val === null || val === 10) { + out(UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } else { + if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle. + } + },flush:function(tty) { + if (tty.output && tty.output.length > 0) { + out(UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } + }},default_tty1_ops:{put_char:function(tty, val) { + if (val === null || val === 10) { + err(UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } else { + if (val != 0) tty.output.push(val); + } + },flush:function(tty) { + if (tty.output && tty.output.length > 0) { + err(UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } + }}}; + + var MEMFS={ops_table:null,mount:function(mount) { + return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0); + },createNode:function(parent, name, mode, dev) { + if (FS.isBlkdev(mode) || FS.isFIFO(mode)) { + // no supported + throw new FS.ErrnoError(63); + } + if (!MEMFS.ops_table) { + MEMFS.ops_table = { + dir: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr, + lookup: MEMFS.node_ops.lookup, + mknod: MEMFS.node_ops.mknod, + rename: MEMFS.node_ops.rename, + unlink: MEMFS.node_ops.unlink, + rmdir: MEMFS.node_ops.rmdir, + readdir: MEMFS.node_ops.readdir, + symlink: MEMFS.node_ops.symlink + }, + stream: { + llseek: MEMFS.stream_ops.llseek + } + }, + file: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr + }, + stream: { + llseek: MEMFS.stream_ops.llseek, + read: MEMFS.stream_ops.read, + write: MEMFS.stream_ops.write, + allocate: MEMFS.stream_ops.allocate, + mmap: MEMFS.stream_ops.mmap, + msync: MEMFS.stream_ops.msync + } + }, + link: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr, + readlink: MEMFS.node_ops.readlink + }, + stream: {} + }, + chrdev: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr + }, + stream: FS.chrdev_stream_ops + } + }; + } + var node = FS.createNode(parent, name, mode, dev); + if (FS.isDir(node.mode)) { + node.node_ops = MEMFS.ops_table.dir.node; + node.stream_ops = MEMFS.ops_table.dir.stream; + node.contents = {}; + } else if (FS.isFile(node.mode)) { + node.node_ops = MEMFS.ops_table.file.node; + node.stream_ops = MEMFS.ops_table.file.stream; + node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.length which gives the whole capacity. + // When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred + // for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size + // penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme. + node.contents = null; + } else if (FS.isLink(node.mode)) { + node.node_ops = MEMFS.ops_table.link.node; + node.stream_ops = MEMFS.ops_table.link.stream; + } else if (FS.isChrdev(node.mode)) { + node.node_ops = MEMFS.ops_table.chrdev.node; + node.stream_ops = MEMFS.ops_table.chrdev.stream; + } + node.timestamp = Date.now(); + // add the new node to the parent + if (parent) { + parent.contents[name] = node; + } + return node; + },getFileDataAsRegularArray:function(node) { + if (node.contents && node.contents.subarray) { + var arr = []; + for (var i = 0; i < node.usedBytes; ++i) arr.push(node.contents[i]); + return arr; // Returns a copy of the original data. + } + return node.contents; // No-op, the file contents are already in a JS array. Return as-is. + },getFileDataAsTypedArray:function(node) { + if (!node.contents) return new Uint8Array(0); + if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes. + return new Uint8Array(node.contents); + },expandFileStorage:function(node, newCapacity) { + var prevCapacity = node.contents ? node.contents.length : 0; + if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough. + // Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity. + // For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to + // avoid overshooting the allocation cap by a very large margin. + var CAPACITY_DOUBLING_MAX = 1024 * 1024; + newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) >>> 0); + if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding. + var oldContents = node.contents; + node.contents = new Uint8Array(newCapacity); // Allocate new storage. + if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage. + return; + },resizeFileStorage:function(node, newSize) { + if (node.usedBytes == newSize) return; + if (newSize == 0) { + node.contents = null; // Fully decommit when requesting a resize to zero. + node.usedBytes = 0; + return; + } + if (!node.contents || node.contents.subarray) { // Resize a typed array if that is being used as the backing store. + var oldContents = node.contents; + node.contents = new Uint8Array(newSize); // Allocate new storage. + if (oldContents) { + node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage. + } + node.usedBytes = newSize; + return; + } + // Backing with a JS array. + if (!node.contents) node.contents = []; + if (node.contents.length > newSize) node.contents.length = newSize; + else while (node.contents.length < newSize) node.contents.push(0); + node.usedBytes = newSize; + },node_ops:{getattr:function(node) { + var attr = {}; + // device numbers reuse inode numbers. + attr.dev = FS.isChrdev(node.mode) ? node.id : 1; + attr.ino = node.id; + attr.mode = node.mode; + attr.nlink = 1; + attr.uid = 0; + attr.gid = 0; + attr.rdev = node.rdev; + if (FS.isDir(node.mode)) { + attr.size = 4096; + } else if (FS.isFile(node.mode)) { + attr.size = node.usedBytes; + } else if (FS.isLink(node.mode)) { + attr.size = node.link.length; + } else { + attr.size = 0; + } + attr.atime = new Date(node.timestamp); + attr.mtime = new Date(node.timestamp); + attr.ctime = new Date(node.timestamp); + // NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize), + // but this is not required by the standard. + attr.blksize = 4096; + attr.blocks = Math.ceil(attr.size / attr.blksize); + return attr; + },setattr:function(node, attr) { + if (attr.mode !== undefined) { + node.mode = attr.mode; + } + if (attr.timestamp !== undefined) { + node.timestamp = attr.timestamp; + } + if (attr.size !== undefined) { + MEMFS.resizeFileStorage(node, attr.size); + } + },lookup:function(parent, name) { + throw FS.genericErrors[44]; + },mknod:function(parent, name, mode, dev) { + return MEMFS.createNode(parent, name, mode, dev); + },rename:function(old_node, new_dir, new_name) { + // if we're overwriting a directory at new_name, make sure it's empty. + if (FS.isDir(old_node.mode)) { + var new_node; + try { + new_node = FS.lookupNode(new_dir, new_name); + } catch (e) { + } + if (new_node) { + for (var i in new_node.contents) { + throw new FS.ErrnoError(55); + } + } + } + // do the internal rewiring + delete old_node.parent.contents[old_node.name]; + old_node.name = new_name; + new_dir.contents[new_name] = old_node; + old_node.parent = new_dir; + },unlink:function(parent, name) { + delete parent.contents[name]; + },rmdir:function(parent, name) { + var node = FS.lookupNode(parent, name); + for (var i in node.contents) { + throw new FS.ErrnoError(55); + } + delete parent.contents[name]; + },readdir:function(node) { + var entries = ['.', '..']; + for (var key in node.contents) { + if (!node.contents.hasOwnProperty(key)) { + continue; + } + entries.push(key); + } + return entries; + },symlink:function(parent, newname, oldpath) { + var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0); + node.link = oldpath; + return node; + },readlink:function(node) { + if (!FS.isLink(node.mode)) { + throw new FS.ErrnoError(28); + } + return node.link; + }},stream_ops:{read:function(stream, buffer, offset, length, position) { + var contents = stream.node.contents; + if (position >= stream.node.usedBytes) return 0; + var size = Math.min(stream.node.usedBytes - position, length); + assert(size >= 0); + if (size > 8 && contents.subarray) { // non-trivial, and typed array + buffer.set(contents.subarray(position, position + size), offset); + } else { + for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i]; + } + return size; + },write:function(stream, buffer, offset, length, position, canOwn) { + // The data buffer should be a typed array view + assert(!(buffer instanceof ArrayBuffer)); + + if (!length) return 0; + var node = stream.node; + node.timestamp = Date.now(); + + if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array? + if (canOwn) { + assert(position === 0, 'canOwn must imply no weird position inside the file'); + node.contents = buffer.subarray(offset, offset + length); + node.usedBytes = length; + return length; + } else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data. + node.contents = buffer.slice(offset, offset + length); + node.usedBytes = length; + return length; + } else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file? + node.contents.set(buffer.subarray(offset, offset + length), position); + return length; + } + } + + // Appending to an existing file and we need to reallocate, or source data did not come as a typed array. + MEMFS.expandFileStorage(node, position+length); + if (node.contents.subarray && buffer.subarray) { + // Use typed array write which is available. + node.contents.set(buffer.subarray(offset, offset + length), position); + } else { + for (var i = 0; i < length; i++) { + node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not. + } + } + node.usedBytes = Math.max(node.usedBytes, position + length); + return length; + },llseek:function(stream, offset, whence) { + var position = offset; + if (whence === 1) { + position += stream.position; + } else if (whence === 2) { + if (FS.isFile(stream.node.mode)) { + position += stream.node.usedBytes; + } + } + if (position < 0) { + throw new FS.ErrnoError(28); + } + return position; + },allocate:function(stream, offset, length) { + MEMFS.expandFileStorage(stream.node, offset + length); + stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length); + },mmap:function(stream, address, length, position, prot, flags) { + // We don't currently support location hints for the address of the mapping + assert(address === 0); + + if (!FS.isFile(stream.node.mode)) { + throw new FS.ErrnoError(43); + } + var ptr; + var allocated; + var contents = stream.node.contents; + // Only make a new copy when MAP_PRIVATE is specified. + if (!(flags & 2) && contents.buffer === buffer) { + // We can't emulate MAP_SHARED when the file is not backed by the buffer + // we're mapping to (e.g. the HEAP buffer). + allocated = false; + ptr = contents.byteOffset; + } else { + // Try to avoid unnecessary slices. + if (position > 0 || position + length < contents.length) { + if (contents.subarray) { + contents = contents.subarray(position, position + length); + } else { + contents = Array.prototype.slice.call(contents, position, position + length); + } + } + allocated = true; + ptr = FS.mmapAlloc(length); + if (!ptr) { + throw new FS.ErrnoError(48); + } + HEAP8.set(contents, ptr); + } + return { ptr: ptr, allocated: allocated }; + },msync:function(stream, buffer, offset, length, mmapFlags) { + if (!FS.isFile(stream.node.mode)) { + throw new FS.ErrnoError(43); + } + if (mmapFlags & 2) { + // MAP_PRIVATE calls need not to be synced back to underlying fs + return 0; + } + + var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false); + // should we check if bytesWritten and length are the same? + return 0; + }}}; + + var ERRNO_MESSAGES={0:"Success",1:"Arg list too long",2:"Permission denied",3:"Address already in use",4:"Address not available",5:"Address family not supported by protocol family",6:"No more processes",7:"Socket already connected",8:"Bad file number",9:"Trying to read unreadable message",10:"Mount device busy",11:"Operation canceled",12:"No children",13:"Connection aborted",14:"Connection refused",15:"Connection reset by peer",16:"File locking deadlock error",17:"Destination address required",18:"Math arg out of domain of func",19:"Quota exceeded",20:"File exists",21:"Bad address",22:"File too large",23:"Host is unreachable",24:"Identifier removed",25:"Illegal byte sequence",26:"Connection already in progress",27:"Interrupted system call",28:"Invalid argument",29:"I/O error",30:"Socket is already connected",31:"Is a directory",32:"Too many symbolic links",33:"Too many open files",34:"Too many links",35:"Message too long",36:"Multihop attempted",37:"File or path name too long",38:"Network interface is not configured",39:"Connection reset by network",40:"Network is unreachable",41:"Too many open files in system",42:"No buffer space available",43:"No such device",44:"No such file or directory",45:"Exec format error",46:"No record locks available",47:"The link has been severed",48:"Not enough core",49:"No message of desired type",50:"Protocol not available",51:"No space left on device",52:"Function not implemented",53:"Socket is not connected",54:"Not a directory",55:"Directory not empty",56:"State not recoverable",57:"Socket operation on non-socket",59:"Not a typewriter",60:"No such device or address",61:"Value too large for defined data type",62:"Previous owner died",63:"Not super-user",64:"Broken pipe",65:"Protocol error",66:"Unknown protocol",67:"Protocol wrong type for socket",68:"Math result not representable",69:"Read only file system",70:"Illegal seek",71:"No such process",72:"Stale file handle",73:"Connection timed out",74:"Text file busy",75:"Cross-device link",100:"Device not a stream",101:"Bad font file fmt",102:"Invalid slot",103:"Invalid request code",104:"No anode",105:"Block device required",106:"Channel number out of range",107:"Level 3 halted",108:"Level 3 reset",109:"Link number out of range",110:"Protocol driver not attached",111:"No CSI structure available",112:"Level 2 halted",113:"Invalid exchange",114:"Invalid request descriptor",115:"Exchange full",116:"No data (for no delay io)",117:"Timer expired",118:"Out of streams resources",119:"Machine is not on the network",120:"Package not installed",121:"The object is remote",122:"Advertise error",123:"Srmount error",124:"Communication error on send",125:"Cross mount point (not really error)",126:"Given log. name not unique",127:"f.d. invalid for this operation",128:"Remote address changed",129:"Can access a needed shared lib",130:"Accessing a corrupted shared lib",131:".lib section in a.out corrupted",132:"Attempting to link in too many libs",133:"Attempting to exec a shared library",135:"Streams pipe error",136:"Too many users",137:"Socket type not supported",138:"Not supported",139:"Protocol family not supported",140:"Can't send after socket shutdown",141:"Too many references",142:"Host is down",148:"No medium (in tape drive)",156:"Level 2 not synchronized"}; + + var ERRNO_CODES={EPERM:63,ENOENT:44,ESRCH:71,EINTR:27,EIO:29,ENXIO:60,E2BIG:1,ENOEXEC:45,EBADF:8,ECHILD:12,EAGAIN:6,EWOULDBLOCK:6,ENOMEM:48,EACCES:2,EFAULT:21,ENOTBLK:105,EBUSY:10,EEXIST:20,EXDEV:75,ENODEV:43,ENOTDIR:54,EISDIR:31,EINVAL:28,ENFILE:41,EMFILE:33,ENOTTY:59,ETXTBSY:74,EFBIG:22,ENOSPC:51,ESPIPE:70,EROFS:69,EMLINK:34,EPIPE:64,EDOM:18,ERANGE:68,ENOMSG:49,EIDRM:24,ECHRNG:106,EL2NSYNC:156,EL3HLT:107,EL3RST:108,ELNRNG:109,EUNATCH:110,ENOCSI:111,EL2HLT:112,EDEADLK:16,ENOLCK:46,EBADE:113,EBADR:114,EXFULL:115,ENOANO:104,EBADRQC:103,EBADSLT:102,EDEADLOCK:16,EBFONT:101,ENOSTR:100,ENODATA:116,ETIME:117,ENOSR:118,ENONET:119,ENOPKG:120,EREMOTE:121,ENOLINK:47,EADV:122,ESRMNT:123,ECOMM:124,EPROTO:65,EMULTIHOP:36,EDOTDOT:125,EBADMSG:9,ENOTUNIQ:126,EBADFD:127,EREMCHG:128,ELIBACC:129,ELIBBAD:130,ELIBSCN:131,ELIBMAX:132,ELIBEXEC:133,ENOSYS:52,ENOTEMPTY:55,ENAMETOOLONG:37,ELOOP:32,EOPNOTSUPP:138,EPFNOSUPPORT:139,ECONNRESET:15,ENOBUFS:42,EAFNOSUPPORT:5,EPROTOTYPE:67,ENOTSOCK:57,ENOPROTOOPT:50,ESHUTDOWN:140,ECONNREFUSED:14,EADDRINUSE:3,ECONNABORTED:13,ENETUNREACH:40,ENETDOWN:38,ETIMEDOUT:73,EHOSTDOWN:142,EHOSTUNREACH:23,EINPROGRESS:26,EALREADY:7,EDESTADDRREQ:17,EMSGSIZE:35,EPROTONOSUPPORT:66,ESOCKTNOSUPPORT:137,EADDRNOTAVAIL:4,ENETRESET:39,EISCONN:30,ENOTCONN:53,ETOOMANYREFS:141,EUSERS:136,EDQUOT:19,ESTALE:72,ENOTSUP:138,ENOMEDIUM:148,EILSEQ:25,EOVERFLOW:61,ECANCELED:11,ENOTRECOVERABLE:56,EOWNERDEAD:62,ESTRPIPE:135};var FS={root:null,mounts:[],devices:{},streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,trackingDelegate:{},tracking:{openFlags:{READ:1,WRITE:2}},ErrnoError:null,genericErrors:{},filesystems:null,syncFSRequests:0,handleFSError:function(e) { + if (!(e instanceof FS.ErrnoError)) throw e + ' : ' + stackTrace(); + return setErrNo(e.errno); + },lookupPath:function(path, opts) { + path = PATH_FS.resolve(FS.cwd(), path); + opts = opts || {}; + + if (!path) return { path: '', node: null }; + + var defaults = { + follow_mount: true, + recurse_count: 0 + }; + for (var key in defaults) { + if (opts[key] === undefined) { + opts[key] = defaults[key]; + } + } + + if (opts.recurse_count > 8) { // max recursive lookup of 8 + throw new FS.ErrnoError(32); + } + + // split the path + var parts = PATH.normalizeArray(path.split('/').filter(function(p) { + return !!p; + }), false); + + // start at the root + var current = FS.root; + var current_path = '/'; + + for (var i = 0; i < parts.length; i++) { + var islast = (i === parts.length-1); + if (islast && opts.parent) { + // stop resolving + break; + } + + current = FS.lookupNode(current, parts[i]); + current_path = PATH.join2(current_path, parts[i]); + + // jump to the mount's root node if this is a mountpoint + if (FS.isMountpoint(current)) { + if (!islast || (islast && opts.follow_mount)) { + current = current.mounted.root; + } + } + + // by default, lookupPath will not follow a symlink if it is the final path component. + // setting opts.follow = true will override this behavior. + if (!islast || opts.follow) { + var count = 0; + while (FS.isLink(current.mode)) { + var link = FS.readlink(current_path); + current_path = PATH_FS.resolve(PATH.dirname(current_path), link); + + var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count }); + current = lookup.node; + + if (count++ > 40) { // limit max consecutive symlinks to 40 (SYMLOOP_MAX). + throw new FS.ErrnoError(32); + } + } + } + } + + return { path: current_path, node: current }; + },getPath:function(node) { + var path; + while (true) { + if (FS.isRoot(node)) { + var mount = node.mount.mountpoint; + if (!path) return mount; + return mount[mount.length-1] !== '/' ? mount + '/' + path : mount + path; + } + path = path ? node.name + '/' + path : node.name; + node = node.parent; + } + },hashName:function(parentid, name) { + var hash = 0; + + + for (var i = 0; i < name.length; i++) { + hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0; + } + return ((parentid + hash) >>> 0) % FS.nameTable.length; + },hashAddNode:function(node) { + var hash = FS.hashName(node.parent.id, node.name); + node.name_next = FS.nameTable[hash]; + FS.nameTable[hash] = node; + },hashRemoveNode:function(node) { + var hash = FS.hashName(node.parent.id, node.name); + if (FS.nameTable[hash] === node) { + FS.nameTable[hash] = node.name_next; + } else { + var current = FS.nameTable[hash]; + while (current) { + if (current.name_next === node) { + current.name_next = node.name_next; + break; + } + current = current.name_next; + } + } + },lookupNode:function(parent, name) { + var errCode = FS.mayLookup(parent); + if (errCode) { + throw new FS.ErrnoError(errCode, parent); + } + var hash = FS.hashName(parent.id, name); + for (var node = FS.nameTable[hash]; node; node = node.name_next) { + var nodeName = node.name; + if (node.parent.id === parent.id && nodeName === name) { + return node; + } + } + // if we failed to find it in the cache, call into the VFS + return FS.lookup(parent, name); + },createNode:function(parent, name, mode, rdev) { + var node = new FS.FSNode(parent, name, mode, rdev); + + FS.hashAddNode(node); + + return node; + },destroyNode:function(node) { + FS.hashRemoveNode(node); + },isRoot:function(node) { + return node === node.parent; + },isMountpoint:function(node) { + return !!node.mounted; + },isFile:function(mode) { + return (mode & 61440) === 32768; + },isDir:function(mode) { + return (mode & 61440) === 16384; + },isLink:function(mode) { + return (mode & 61440) === 40960; + },isChrdev:function(mode) { + return (mode & 61440) === 8192; + },isBlkdev:function(mode) { + return (mode & 61440) === 24576; + },isFIFO:function(mode) { + return (mode & 61440) === 4096; + },isSocket:function(mode) { + return (mode & 49152) === 49152; + },flagModes:{"r":0,"rs":1052672,"r+":2,"w":577,"wx":705,"xw":705,"w+":578,"wx+":706,"xw+":706,"a":1089,"ax":1217,"xa":1217,"a+":1090,"ax+":1218,"xa+":1218},modeStringToFlags:function(str) { + var flags = FS.flagModes[str]; + if (typeof flags === 'undefined') { + throw new Error('Unknown file open mode: ' + str); + } + return flags; + },flagsToPermissionString:function(flag) { + var perms = ['r', 'w', 'rw'][flag & 3]; + if ((flag & 512)) { + perms += 'w'; + } + return perms; + },nodePermissions:function(node, perms) { + if (FS.ignorePermissions) { + return 0; + } + // return 0 if any user, group or owner bits are set. + if (perms.indexOf('r') !== -1 && !(node.mode & 292)) { + return 2; + } else if (perms.indexOf('w') !== -1 && !(node.mode & 146)) { + return 2; + } else if (perms.indexOf('x') !== -1 && !(node.mode & 73)) { + return 2; + } + return 0; + },mayLookup:function(dir) { + var errCode = FS.nodePermissions(dir, 'x'); + if (errCode) return errCode; + if (!dir.node_ops.lookup) return 2; + return 0; + },mayCreate:function(dir, name) { + try { + var node = FS.lookupNode(dir, name); + return 20; + } catch (e) { + } + return FS.nodePermissions(dir, 'wx'); + },mayDelete:function(dir, name, isdir) { + var node; + try { + node = FS.lookupNode(dir, name); + } catch (e) { + return e.errno; + } + var errCode = FS.nodePermissions(dir, 'wx'); + if (errCode) { + return errCode; + } + if (isdir) { + if (!FS.isDir(node.mode)) { + return 54; + } + if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) { + return 10; + } + } else { + if (FS.isDir(node.mode)) { + return 31; + } + } + return 0; + },mayOpen:function(node, flags) { + if (!node) { + return 44; + } + if (FS.isLink(node.mode)) { + return 32; + } else if (FS.isDir(node.mode)) { + if (FS.flagsToPermissionString(flags) !== 'r' || // opening for write + (flags & 512)) { // TODO: check for O_SEARCH? (== search for dir only) + return 31; + } + } + return FS.nodePermissions(node, FS.flagsToPermissionString(flags)); + },MAX_OPEN_FDS:4096,nextfd:function(fd_start, fd_end) { + fd_start = fd_start || 0; + fd_end = fd_end || FS.MAX_OPEN_FDS; + for (var fd = fd_start; fd <= fd_end; fd++) { + if (!FS.streams[fd]) { + return fd; + } + } + throw new FS.ErrnoError(33); + },getStream:function(fd) { + return FS.streams[fd]; + },createStream:function(stream, fd_start, fd_end) { + if (!FS.FSStream) { + FS.FSStream = /** @constructor */ function(){}; + FS.FSStream.prototype = { + object: { + get: function() { return this.node; }, + set: function(val) { this.node = val; } + }, + isRead: { + get: function() { return (this.flags & 2097155) !== 1; } + }, + isWrite: { + get: function() { return (this.flags & 2097155) !== 0; } + }, + isAppend: { + get: function() { return (this.flags & 1024); } + } + }; + } + // clone it, so we can return an instance of FSStream + var newStream = new FS.FSStream(); + for (var p in stream) { + newStream[p] = stream[p]; + } + stream = newStream; + var fd = FS.nextfd(fd_start, fd_end); + stream.fd = fd; + FS.streams[fd] = stream; + return stream; + },closeStream:function(fd) { + FS.streams[fd] = null; + },chrdev_stream_ops:{open:function(stream) { + var device = FS.getDevice(stream.node.rdev); + // override node's stream ops with the device's + stream.stream_ops = device.stream_ops; + // forward the open call + if (stream.stream_ops.open) { + stream.stream_ops.open(stream); + } + },llseek:function() { + throw new FS.ErrnoError(70); + }},major:function(dev) { + return ((dev) >> 8); + },minor:function(dev) { + return ((dev) & 0xff); + },makedev:function(ma, mi) { + return ((ma) << 8 | (mi)); + },registerDevice:function(dev, ops) { + FS.devices[dev] = { stream_ops: ops }; + },getDevice:function(dev) { + return FS.devices[dev]; + },getMounts:function(mount) { + var mounts = []; + var check = [mount]; + + while (check.length) { + var m = check.pop(); + + mounts.push(m); + + check.push.apply(check, m.mounts); + } + + return mounts; + },syncfs:function(populate, callback) { + if (typeof(populate) === 'function') { + callback = populate; + populate = false; + } + + FS.syncFSRequests++; + + if (FS.syncFSRequests > 1) { + err('warning: ' + FS.syncFSRequests + ' FS.syncfs operations in flight at once, probably just doing extra work'); + } + + var mounts = FS.getMounts(FS.root.mount); + var completed = 0; + + function doCallback(errCode) { + assert(FS.syncFSRequests > 0); + FS.syncFSRequests--; + return callback(errCode); + } + + function done(errCode) { + if (errCode) { + if (!done.errored) { + done.errored = true; + return doCallback(errCode); + } + return; + } + if (++completed >= mounts.length) { + doCallback(null); + } + }; + + // sync all mounts + mounts.forEach(function (mount) { + if (!mount.type.syncfs) { + return done(null); + } + mount.type.syncfs(mount, populate, done); + }); + },mount:function(type, opts, mountpoint) { + if (typeof type === 'string') { + // The filesystem was not included, and instead we have an error + // message stored in the variable. + throw type; + } + var root = mountpoint === '/'; + var pseudo = !mountpoint; + var node; + + if (root && FS.root) { + throw new FS.ErrnoError(10); + } else if (!root && !pseudo) { + var lookup = FS.lookupPath(mountpoint, { follow_mount: false }); + + mountpoint = lookup.path; // use the absolute path + node = lookup.node; + + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(10); + } + + if (!FS.isDir(node.mode)) { + throw new FS.ErrnoError(54); + } + } + + var mount = { + type: type, + opts: opts, + mountpoint: mountpoint, + mounts: [] + }; + + // create a root node for the fs + var mountRoot = type.mount(mount); + mountRoot.mount = mount; + mount.root = mountRoot; + + if (root) { + FS.root = mountRoot; + } else if (node) { + // set as a mountpoint + node.mounted = mount; + + // add the new mount to the current mount's children + if (node.mount) { + node.mount.mounts.push(mount); + } + } + + return mountRoot; + },unmount:function (mountpoint) { + var lookup = FS.lookupPath(mountpoint, { follow_mount: false }); + + if (!FS.isMountpoint(lookup.node)) { + throw new FS.ErrnoError(28); + } + + // destroy the nodes for this mount, and all its child mounts + var node = lookup.node; + var mount = node.mounted; + var mounts = FS.getMounts(mount); + + Object.keys(FS.nameTable).forEach(function (hash) { + var current = FS.nameTable[hash]; + + while (current) { + var next = current.name_next; + + if (mounts.indexOf(current.mount) !== -1) { + FS.destroyNode(current); + } + + current = next; + } + }); + + // no longer a mountpoint + node.mounted = null; + + // remove this mount from the child mounts + var idx = node.mount.mounts.indexOf(mount); + assert(idx !== -1); + node.mount.mounts.splice(idx, 1); + },lookup:function(parent, name) { + return parent.node_ops.lookup(parent, name); + },mknod:function(path, mode, dev) { + var lookup = FS.lookupPath(path, { parent: true }); + var parent = lookup.node; + var name = PATH.basename(path); + if (!name || name === '.' || name === '..') { + throw new FS.ErrnoError(28); + } + var errCode = FS.mayCreate(parent, name); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + if (!parent.node_ops.mknod) { + throw new FS.ErrnoError(63); + } + return parent.node_ops.mknod(parent, name, mode, dev); + },create:function(path, mode) { + mode = mode !== undefined ? mode : 438 /* 0666 */; + mode &= 4095; + mode |= 32768; + return FS.mknod(path, mode, 0); + },mkdir:function(path, mode) { + mode = mode !== undefined ? mode : 511 /* 0777 */; + mode &= 511 | 512; + mode |= 16384; + return FS.mknod(path, mode, 0); + },mkdirTree:function(path, mode) { + var dirs = path.split('/'); + var d = ''; + for (var i = 0; i < dirs.length; ++i) { + if (!dirs[i]) continue; + d += '/' + dirs[i]; + try { + FS.mkdir(d, mode); + } catch(e) { + if (e.errno != 20) throw e; + } + } + },mkdev:function(path, mode, dev) { + if (typeof(dev) === 'undefined') { + dev = mode; + mode = 438 /* 0666 */; + } + mode |= 8192; + return FS.mknod(path, mode, dev); + },symlink:function(oldpath, newpath) { + if (!PATH_FS.resolve(oldpath)) { + throw new FS.ErrnoError(44); + } + var lookup = FS.lookupPath(newpath, { parent: true }); + var parent = lookup.node; + if (!parent) { + throw new FS.ErrnoError(44); + } + var newname = PATH.basename(newpath); + var errCode = FS.mayCreate(parent, newname); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + if (!parent.node_ops.symlink) { + throw new FS.ErrnoError(63); + } + return parent.node_ops.symlink(parent, newname, oldpath); + },rename:function(old_path, new_path) { + var old_dirname = PATH.dirname(old_path); + var new_dirname = PATH.dirname(new_path); + var old_name = PATH.basename(old_path); + var new_name = PATH.basename(new_path); + // parents must exist + var lookup, old_dir, new_dir; + try { + lookup = FS.lookupPath(old_path, { parent: true }); + old_dir = lookup.node; + lookup = FS.lookupPath(new_path, { parent: true }); + new_dir = lookup.node; + } catch (e) { + throw new FS.ErrnoError(10); + } + if (!old_dir || !new_dir) throw new FS.ErrnoError(44); + // need to be part of the same mount + if (old_dir.mount !== new_dir.mount) { + throw new FS.ErrnoError(75); + } + // source must exist + var old_node = FS.lookupNode(old_dir, old_name); + // old path should not be an ancestor of the new path + var relative = PATH_FS.relative(old_path, new_dirname); + if (relative.charAt(0) !== '.') { + throw new FS.ErrnoError(28); + } + // new path should not be an ancestor of the old path + relative = PATH_FS.relative(new_path, old_dirname); + if (relative.charAt(0) !== '.') { + throw new FS.ErrnoError(55); + } + // see if the new path already exists + var new_node; + try { + new_node = FS.lookupNode(new_dir, new_name); + } catch (e) { + // not fatal + } + // early out if nothing needs to change + if (old_node === new_node) { + return; + } + // we'll need to delete the old entry + var isdir = FS.isDir(old_node.mode); + var errCode = FS.mayDelete(old_dir, old_name, isdir); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + // need delete permissions if we'll be overwriting. + // need create permissions if new doesn't already exist. + errCode = new_node ? + FS.mayDelete(new_dir, new_name, isdir) : + FS.mayCreate(new_dir, new_name); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + if (!old_dir.node_ops.rename) { + throw new FS.ErrnoError(63); + } + if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) { + throw new FS.ErrnoError(10); + } + // if we are going to change the parent, check write permissions + if (new_dir !== old_dir) { + errCode = FS.nodePermissions(old_dir, 'w'); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + } + try { + if (FS.trackingDelegate['willMovePath']) { + FS.trackingDelegate['willMovePath'](old_path, new_path); + } + } catch(e) { + err("FS.trackingDelegate['willMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message); + } + // remove the node from the lookup hash + FS.hashRemoveNode(old_node); + // do the underlying fs rename + try { + old_dir.node_ops.rename(old_node, new_dir, new_name); + } catch (e) { + throw e; + } finally { + // add the node back to the hash (in case node_ops.rename + // changed its name) + FS.hashAddNode(old_node); + } + try { + if (FS.trackingDelegate['onMovePath']) FS.trackingDelegate['onMovePath'](old_path, new_path); + } catch(e) { + err("FS.trackingDelegate['onMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message); + } + },rmdir:function(path) { + var lookup = FS.lookupPath(path, { parent: true }); + var parent = lookup.node; + var name = PATH.basename(path); + var node = FS.lookupNode(parent, name); + var errCode = FS.mayDelete(parent, name, true); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + if (!parent.node_ops.rmdir) { + throw new FS.ErrnoError(63); + } + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(10); + } + try { + if (FS.trackingDelegate['willDeletePath']) { + FS.trackingDelegate['willDeletePath'](path); + } + } catch(e) { + err("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message); + } + parent.node_ops.rmdir(parent, name); + FS.destroyNode(node); + try { + if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path); + } catch(e) { + err("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message); + } + },readdir:function(path) { + var lookup = FS.lookupPath(path, { follow: true }); + var node = lookup.node; + if (!node.node_ops.readdir) { + throw new FS.ErrnoError(54); + } + return node.node_ops.readdir(node); + },unlink:function(path) { + var lookup = FS.lookupPath(path, { parent: true }); + var parent = lookup.node; + var name = PATH.basename(path); + var node = FS.lookupNode(parent, name); + var errCode = FS.mayDelete(parent, name, false); + if (errCode) { + // According to POSIX, we should map EISDIR to EPERM, but + // we instead do what Linux does (and we must, as we use + // the musl linux libc). + throw new FS.ErrnoError(errCode); + } + if (!parent.node_ops.unlink) { + throw new FS.ErrnoError(63); + } + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(10); + } + try { + if (FS.trackingDelegate['willDeletePath']) { + FS.trackingDelegate['willDeletePath'](path); + } + } catch(e) { + err("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message); + } + parent.node_ops.unlink(parent, name); + FS.destroyNode(node); + try { + if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path); + } catch(e) { + err("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message); + } + },readlink:function(path) { + var lookup = FS.lookupPath(path); + var link = lookup.node; + if (!link) { + throw new FS.ErrnoError(44); + } + if (!link.node_ops.readlink) { + throw new FS.ErrnoError(28); + } + return PATH_FS.resolve(FS.getPath(link.parent), link.node_ops.readlink(link)); + },stat:function(path, dontFollow) { + var lookup = FS.lookupPath(path, { follow: !dontFollow }); + var node = lookup.node; + if (!node) { + throw new FS.ErrnoError(44); + } + if (!node.node_ops.getattr) { + throw new FS.ErrnoError(63); + } + return node.node_ops.getattr(node); + },lstat:function(path) { + return FS.stat(path, true); + },chmod:function(path, mode, dontFollow) { + var node; + if (typeof path === 'string') { + var lookup = FS.lookupPath(path, { follow: !dontFollow }); + node = lookup.node; + } else { + node = path; + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(63); + } + node.node_ops.setattr(node, { + mode: (mode & 4095) | (node.mode & ~4095), + timestamp: Date.now() + }); + },lchmod:function(path, mode) { + FS.chmod(path, mode, true); + },fchmod:function(fd, mode) { + var stream = FS.getStream(fd); + if (!stream) { + throw new FS.ErrnoError(8); + } + FS.chmod(stream.node, mode); + },chown:function(path, uid, gid, dontFollow) { + var node; + if (typeof path === 'string') { + var lookup = FS.lookupPath(path, { follow: !dontFollow }); + node = lookup.node; + } else { + node = path; + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(63); + } + node.node_ops.setattr(node, { + timestamp: Date.now() + // we ignore the uid / gid for now + }); + },lchown:function(path, uid, gid) { + FS.chown(path, uid, gid, true); + },fchown:function(fd, uid, gid) { + var stream = FS.getStream(fd); + if (!stream) { + throw new FS.ErrnoError(8); + } + FS.chown(stream.node, uid, gid); + },truncate:function(path, len) { + if (len < 0) { + throw new FS.ErrnoError(28); + } + var node; + if (typeof path === 'string') { + var lookup = FS.lookupPath(path, { follow: true }); + node = lookup.node; + } else { + node = path; + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(63); + } + if (FS.isDir(node.mode)) { + throw new FS.ErrnoError(31); + } + if (!FS.isFile(node.mode)) { + throw new FS.ErrnoError(28); + } + var errCode = FS.nodePermissions(node, 'w'); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + node.node_ops.setattr(node, { + size: len, + timestamp: Date.now() + }); + },ftruncate:function(fd, len) { + var stream = FS.getStream(fd); + if (!stream) { + throw new FS.ErrnoError(8); + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(28); + } + FS.truncate(stream.node, len); + },utime:function(path, atime, mtime) { + var lookup = FS.lookupPath(path, { follow: true }); + var node = lookup.node; + node.node_ops.setattr(node, { + timestamp: Math.max(atime, mtime) + }); + },open:function(path, flags, mode, fd_start, fd_end) { + if (path === "") { + throw new FS.ErrnoError(44); + } + flags = typeof flags === 'string' ? FS.modeStringToFlags(flags) : flags; + mode = typeof mode === 'undefined' ? 438 /* 0666 */ : mode; + if ((flags & 64)) { + mode = (mode & 4095) | 32768; + } else { + mode = 0; + } + var node; + if (typeof path === 'object') { + node = path; + } else { + path = PATH.normalize(path); + try { + var lookup = FS.lookupPath(path, { + follow: !(flags & 131072) + }); + node = lookup.node; + } catch (e) { + // ignore + } + } + // perhaps we need to create the node + var created = false; + if ((flags & 64)) { + if (node) { + // if O_CREAT and O_EXCL are set, error out if the node already exists + if ((flags & 128)) { + throw new FS.ErrnoError(20); + } + } else { + // node doesn't exist, try to create it + node = FS.mknod(path, mode, 0); + created = true; + } + } + if (!node) { + throw new FS.ErrnoError(44); + } + // can't truncate a device + if (FS.isChrdev(node.mode)) { + flags &= ~512; + } + // if asked only for a directory, then this must be one + if ((flags & 65536) && !FS.isDir(node.mode)) { + throw new FS.ErrnoError(54); + } + // check permissions, if this is not a file we just created now (it is ok to + // create and write to a file with read-only permissions; it is read-only + // for later use) + if (!created) { + var errCode = FS.mayOpen(node, flags); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + } + // do truncation if necessary + if ((flags & 512)) { + FS.truncate(node, 0); + } + // we've already handled these, don't pass down to the underlying vfs + flags &= ~(128 | 512 | 131072); + + // register the stream with the filesystem + var stream = FS.createStream({ + node: node, + path: FS.getPath(node), // we want the absolute path to the node + flags: flags, + seekable: true, + position: 0, + stream_ops: node.stream_ops, + // used by the file family libc calls (fopen, fwrite, ferror, etc.) + ungotten: [], + error: false + }, fd_start, fd_end); + // call the new stream's open function + if (stream.stream_ops.open) { + stream.stream_ops.open(stream); + } + if (Module['logReadFiles'] && !(flags & 1)) { + if (!FS.readFiles) FS.readFiles = {}; + if (!(path in FS.readFiles)) { + FS.readFiles[path] = 1; + err("FS.trackingDelegate error on read file: " + path); + } + } + try { + if (FS.trackingDelegate['onOpenFile']) { + var trackingFlags = 0; + if ((flags & 2097155) !== 1) { + trackingFlags |= FS.tracking.openFlags.READ; + } + if ((flags & 2097155) !== 0) { + trackingFlags |= FS.tracking.openFlags.WRITE; + } + FS.trackingDelegate['onOpenFile'](path, trackingFlags); + } + } catch(e) { + err("FS.trackingDelegate['onOpenFile']('"+path+"', flags) threw an exception: " + e.message); + } + return stream; + },close:function(stream) { + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if (stream.getdents) stream.getdents = null; // free readdir state + try { + if (stream.stream_ops.close) { + stream.stream_ops.close(stream); + } + } catch (e) { + throw e; + } finally { + FS.closeStream(stream.fd); + } + stream.fd = null; + },isClosed:function(stream) { + return stream.fd === null; + },llseek:function(stream, offset, whence) { + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if (!stream.seekable || !stream.stream_ops.llseek) { + throw new FS.ErrnoError(70); + } + if (whence != 0 && whence != 1 && whence != 2) { + throw new FS.ErrnoError(28); + } + stream.position = stream.stream_ops.llseek(stream, offset, whence); + stream.ungotten = []; + return stream.position; + },read:function(stream, buffer, offset, length, position) { + if (length < 0 || position < 0) { + throw new FS.ErrnoError(28); + } + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if ((stream.flags & 2097155) === 1) { + throw new FS.ErrnoError(8); + } + if (FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(31); + } + if (!stream.stream_ops.read) { + throw new FS.ErrnoError(28); + } + var seeking = typeof position !== 'undefined'; + if (!seeking) { + position = stream.position; + } else if (!stream.seekable) { + throw new FS.ErrnoError(70); + } + var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position); + if (!seeking) stream.position += bytesRead; + return bytesRead; + },write:function(stream, buffer, offset, length, position, canOwn) { + if (length < 0 || position < 0) { + throw new FS.ErrnoError(28); + } + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(8); + } + if (FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(31); + } + if (!stream.stream_ops.write) { + throw new FS.ErrnoError(28); + } + if (stream.seekable && stream.flags & 1024) { + // seek to the end before writing in append mode + FS.llseek(stream, 0, 2); + } + var seeking = typeof position !== 'undefined'; + if (!seeking) { + position = stream.position; + } else if (!stream.seekable) { + throw new FS.ErrnoError(70); + } + var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn); + if (!seeking) stream.position += bytesWritten; + try { + if (stream.path && FS.trackingDelegate['onWriteToFile']) FS.trackingDelegate['onWriteToFile'](stream.path); + } catch(e) { + err("FS.trackingDelegate['onWriteToFile']('"+stream.path+"') threw an exception: " + e.message); + } + return bytesWritten; + },allocate:function(stream, offset, length) { + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if (offset < 0 || length <= 0) { + throw new FS.ErrnoError(28); + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(8); + } + if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(43); + } + if (!stream.stream_ops.allocate) { + throw new FS.ErrnoError(138); + } + stream.stream_ops.allocate(stream, offset, length); + },mmap:function(stream, address, length, position, prot, flags) { + // User requests writing to file (prot & PROT_WRITE != 0). + // Checking if we have permissions to write to the file unless + // MAP_PRIVATE flag is set. According to POSIX spec it is possible + // to write to file opened in read-only mode with MAP_PRIVATE flag, + // as all modifications will be visible only in the memory of + // the current process. + if ((prot & 2) !== 0 + && (flags & 2) === 0 + && (stream.flags & 2097155) !== 2) { + throw new FS.ErrnoError(2); + } + if ((stream.flags & 2097155) === 1) { + throw new FS.ErrnoError(2); + } + if (!stream.stream_ops.mmap) { + throw new FS.ErrnoError(43); + } + return stream.stream_ops.mmap(stream, address, length, position, prot, flags); + },msync:function(stream, buffer, offset, length, mmapFlags) { + if (!stream || !stream.stream_ops.msync) { + return 0; + } + return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags); + },munmap:function(stream) { + return 0; + },ioctl:function(stream, cmd, arg) { + if (!stream.stream_ops.ioctl) { + throw new FS.ErrnoError(59); + } + return stream.stream_ops.ioctl(stream, cmd, arg); + },readFile:function(path, opts) { + opts = opts || {}; + opts.flags = opts.flags || 'r'; + opts.encoding = opts.encoding || 'binary'; + if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') { + throw new Error('Invalid encoding type "' + opts.encoding + '"'); + } + var ret; + var stream = FS.open(path, opts.flags); + var stat = FS.stat(path); + var length = stat.size; + var buf = new Uint8Array(length); + FS.read(stream, buf, 0, length, 0); + if (opts.encoding === 'utf8') { + ret = UTF8ArrayToString(buf, 0); + } else if (opts.encoding === 'binary') { + ret = buf; + } + FS.close(stream); + return ret; + },writeFile:function(path, data, opts) { + opts = opts || {}; + opts.flags = opts.flags || 'w'; + var stream = FS.open(path, opts.flags, opts.mode); + if (typeof data === 'string') { + var buf = new Uint8Array(lengthBytesUTF8(data)+1); + var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length); + FS.write(stream, buf, 0, actualNumBytes, undefined, opts.canOwn); + } else if (ArrayBuffer.isView(data)) { + FS.write(stream, data, 0, data.byteLength, undefined, opts.canOwn); + } else { + throw new Error('Unsupported data type'); + } + FS.close(stream); + },cwd:function() { + return FS.currentPath; + },chdir:function(path) { + var lookup = FS.lookupPath(path, { follow: true }); + if (lookup.node === null) { + throw new FS.ErrnoError(44); + } + if (!FS.isDir(lookup.node.mode)) { + throw new FS.ErrnoError(54); + } + var errCode = FS.nodePermissions(lookup.node, 'x'); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + FS.currentPath = lookup.path; + },createDefaultDirectories:function() { + FS.mkdir('/tmp'); + FS.mkdir('/home'); + FS.mkdir('/home/web_user'); + },createDefaultDevices:function() { + // create /dev + FS.mkdir('/dev'); + // setup /dev/null + FS.registerDevice(FS.makedev(1, 3), { + read: function() { return 0; }, + write: function(stream, buffer, offset, length, pos) { return length; } + }); + FS.mkdev('/dev/null', FS.makedev(1, 3)); + // setup /dev/tty and /dev/tty1 + // stderr needs to print output using Module['printErr'] + // so we register a second tty just for it. + TTY.register(FS.makedev(5, 0), TTY.default_tty_ops); + TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops); + FS.mkdev('/dev/tty', FS.makedev(5, 0)); + FS.mkdev('/dev/tty1', FS.makedev(6, 0)); + // setup /dev/[u]random + var random_device; + if (typeof crypto === 'object' && typeof crypto['getRandomValues'] === 'function') { + // for modern web browsers + var randomBuffer = new Uint8Array(1); + random_device = function() { crypto.getRandomValues(randomBuffer); return randomBuffer[0]; }; + } else + if (ENVIRONMENT_IS_NODE) { + // for nodejs with or without crypto support included + try { + var crypto_module = require('crypto'); + // nodejs has crypto support + random_device = function() { return crypto_module['randomBytes'](1)[0]; }; + } catch (e) { + // nodejs doesn't have crypto support + } + } else + {} + if (!random_device) { + // we couldn't find a proper implementation, as Math.random() is not suitable for /dev/random, see emscripten-core/emscripten/pull/7096 + random_device = function() { abort("no cryptographic support found for random_device. consider polyfilling it if you want to use something insecure like Math.random(), e.g. put this in a --pre-js: var crypto = { getRandomValues: function(array) { for (var i = 0; i < array.length; i++) array[i] = (Math.random()*256)|0 } };"); }; + } + FS.createDevice('/dev', 'random', random_device); + FS.createDevice('/dev', 'urandom', random_device); + // we're not going to emulate the actual shm device, + // just create the tmp dirs that reside in it commonly + FS.mkdir('/dev/shm'); + FS.mkdir('/dev/shm/tmp'); + },createSpecialDirectories:function() { + // create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the name of the stream for fd 6 (see test_unistd_ttyname) + FS.mkdir('/proc'); + FS.mkdir('/proc/self'); + FS.mkdir('/proc/self/fd'); + FS.mount({ + mount: function() { + var node = FS.createNode('/proc/self', 'fd', 16384 | 511 /* 0777 */, 73); + node.node_ops = { + lookup: function(parent, name) { + var fd = +name; + var stream = FS.getStream(fd); + if (!stream) throw new FS.ErrnoError(8); + var ret = { + parent: null, + mount: { mountpoint: 'fake' }, + node_ops: { readlink: function() { return stream.path } } + }; + ret.parent = ret; // make it look like a simple root node + return ret; + } + }; + return node; + } + }, {}, '/proc/self/fd'); + },createStandardStreams:function() { + // TODO deprecate the old functionality of a single + // input / output callback and that utilizes FS.createDevice + // and instead require a unique set of stream ops + + // by default, we symlink the standard streams to the + // default tty devices. however, if the standard streams + // have been overwritten we create a unique device for + // them instead. + if (Module['stdin']) { + FS.createDevice('/dev', 'stdin', Module['stdin']); + } else { + FS.symlink('/dev/tty', '/dev/stdin'); + } + if (Module['stdout']) { + FS.createDevice('/dev', 'stdout', null, Module['stdout']); + } else { + FS.symlink('/dev/tty', '/dev/stdout'); + } + if (Module['stderr']) { + FS.createDevice('/dev', 'stderr', null, Module['stderr']); + } else { + FS.symlink('/dev/tty1', '/dev/stderr'); + } + + // open default streams for the stdin, stdout and stderr devices + var stdin = FS.open('/dev/stdin', 'r'); + var stdout = FS.open('/dev/stdout', 'w'); + var stderr = FS.open('/dev/stderr', 'w'); + assert(stdin.fd === 0, 'invalid handle for stdin (' + stdin.fd + ')'); + assert(stdout.fd === 1, 'invalid handle for stdout (' + stdout.fd + ')'); + assert(stderr.fd === 2, 'invalid handle for stderr (' + stderr.fd + ')'); + },ensureErrnoError:function() { + if (FS.ErrnoError) return; + FS.ErrnoError = /** @this{Object} */ function ErrnoError(errno, node) { + this.node = node; + this.setErrno = /** @this{Object} */ function(errno) { + this.errno = errno; + for (var key in ERRNO_CODES) { + if (ERRNO_CODES[key] === errno) { + this.code = key; + break; + } + } + }; + this.setErrno(errno); + this.message = ERRNO_MESSAGES[errno]; + + // Try to get a maximally helpful stack trace. On Node.js, getting Error.stack + // now ensures it shows what we want. + if (this.stack) { + // Define the stack property for Node.js 4, which otherwise errors on the next line. + Object.defineProperty(this, "stack", { value: (new Error).stack, writable: true }); + this.stack = demangleAll(this.stack); + } + }; + FS.ErrnoError.prototype = new Error(); + FS.ErrnoError.prototype.constructor = FS.ErrnoError; + // Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info) + [44].forEach(function(code) { + FS.genericErrors[code] = new FS.ErrnoError(code); + FS.genericErrors[code].stack = '<generic error, no stack>'; + }); + },staticInit:function() { + FS.ensureErrnoError(); + + FS.nameTable = new Array(4096); + + FS.mount(MEMFS, {}, '/'); + + FS.createDefaultDirectories(); + FS.createDefaultDevices(); + FS.createSpecialDirectories(); + + FS.filesystems = { + 'MEMFS': MEMFS, + }; + },init:function(input, output, error) { + assert(!FS.init.initialized, 'FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)'); + FS.init.initialized = true; + + FS.ensureErrnoError(); + + // Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here + Module['stdin'] = input || Module['stdin']; + Module['stdout'] = output || Module['stdout']; + Module['stderr'] = error || Module['stderr']; + + FS.createStandardStreams(); + },quit:function() { + FS.init.initialized = false; + // force-flush all streams, so we get musl std streams printed out + var fflush = Module['_fflush']; + if (fflush) fflush(0); + // close all of our streams + for (var i = 0; i < FS.streams.length; i++) { + var stream = FS.streams[i]; + if (!stream) { + continue; + } + FS.close(stream); + } + },getMode:function(canRead, canWrite) { + var mode = 0; + if (canRead) mode |= 292 | 73; + if (canWrite) mode |= 146; + return mode; + },joinPath:function(parts, forceRelative) { + var path = PATH.join.apply(null, parts); + if (forceRelative && path[0] == '/') path = path.substr(1); + return path; + },absolutePath:function(relative, base) { + return PATH_FS.resolve(base, relative); + },standardizePath:function(path) { + return PATH.normalize(path); + },findObject:function(path, dontResolveLastLink) { + var ret = FS.analyzePath(path, dontResolveLastLink); + if (ret.exists) { + return ret.object; + } else { + setErrNo(ret.error); + return null; + } + },analyzePath:function(path, dontResolveLastLink) { + // operate from within the context of the symlink's target + try { + var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink }); + path = lookup.path; + } catch (e) { + } + var ret = { + isRoot: false, exists: false, error: 0, name: null, path: null, object: null, + parentExists: false, parentPath: null, parentObject: null + }; + try { + var lookup = FS.lookupPath(path, { parent: true }); + ret.parentExists = true; + ret.parentPath = lookup.path; + ret.parentObject = lookup.node; + ret.name = PATH.basename(path); + lookup = FS.lookupPath(path, { follow: !dontResolveLastLink }); + ret.exists = true; + ret.path = lookup.path; + ret.object = lookup.node; + ret.name = lookup.node.name; + ret.isRoot = lookup.path === '/'; + } catch (e) { + ret.error = e.errno; + }; + return ret; + },createFolder:function(parent, name, canRead, canWrite) { + var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); + var mode = FS.getMode(canRead, canWrite); + return FS.mkdir(path, mode); + },createPath:function(parent, path, canRead, canWrite) { + parent = typeof parent === 'string' ? parent : FS.getPath(parent); + var parts = path.split('/').reverse(); + while (parts.length) { + var part = parts.pop(); + if (!part) continue; + var current = PATH.join2(parent, part); + try { + FS.mkdir(current); + } catch (e) { + // ignore EEXIST + } + parent = current; + } + return current; + },createFile:function(parent, name, properties, canRead, canWrite) { + var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); + var mode = FS.getMode(canRead, canWrite); + return FS.create(path, mode); + },createDataFile:function(parent, name, data, canRead, canWrite, canOwn) { + var path = name ? PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name) : parent; + var mode = FS.getMode(canRead, canWrite); + var node = FS.create(path, mode); + if (data) { + if (typeof data === 'string') { + var arr = new Array(data.length); + for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i); + data = arr; + } + // make sure we can write to the file + FS.chmod(node, mode | 146); + var stream = FS.open(node, 'w'); + FS.write(stream, data, 0, data.length, 0, canOwn); + FS.close(stream); + FS.chmod(node, mode); + } + return node; + },createDevice:function(parent, name, input, output) { + var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); + var mode = FS.getMode(!!input, !!output); + if (!FS.createDevice.major) FS.createDevice.major = 64; + var dev = FS.makedev(FS.createDevice.major++, 0); + // Create a fake device that a set of stream ops to emulate + // the old behavior. + FS.registerDevice(dev, { + open: function(stream) { + stream.seekable = false; + }, + close: function(stream) { + // flush any pending line data + if (output && output.buffer && output.buffer.length) { + output(10); + } + }, + read: function(stream, buffer, offset, length, pos /* ignored */) { + var bytesRead = 0; + for (var i = 0; i < length; i++) { + var result; + try { + result = input(); + } catch (e) { + throw new FS.ErrnoError(29); + } + if (result === undefined && bytesRead === 0) { + throw new FS.ErrnoError(6); + } + if (result === null || result === undefined) break; + bytesRead++; + buffer[offset+i] = result; + } + if (bytesRead) { + stream.node.timestamp = Date.now(); + } + return bytesRead; + }, + write: function(stream, buffer, offset, length, pos) { + for (var i = 0; i < length; i++) { + try { + output(buffer[offset+i]); + } catch (e) { + throw new FS.ErrnoError(29); + } + } + if (length) { + stream.node.timestamp = Date.now(); + } + return i; + } + }); + return FS.mkdev(path, mode, dev); + },createLink:function(parent, name, target, canRead, canWrite) { + var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); + return FS.symlink(target, path); + },forceLoadFile:function(obj) { + if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true; + var success = true; + if (typeof XMLHttpRequest !== 'undefined') { + throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread."); + } else if (read_) { + // Command-line. + try { + // WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as + // read() will try to parse UTF8. + obj.contents = intArrayFromString(read_(obj.url), true); + obj.usedBytes = obj.contents.length; + } catch (e) { + success = false; + } + } else { + throw new Error('Cannot load without read() or XMLHttpRequest.'); + } + if (!success) setErrNo(29); + return success; + },createLazyFile:function(parent, name, url, canRead, canWrite) { + // Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse. + /** @constructor */ + function LazyUint8Array() { + this.lengthKnown = false; + this.chunks = []; // Loaded chunks. Index is the chunk number + } + LazyUint8Array.prototype.get = /** @this{Object} */ function LazyUint8Array_get(idx) { + if (idx > this.length-1 || idx < 0) { + return undefined; + } + var chunkOffset = idx % this.chunkSize; + var chunkNum = (idx / this.chunkSize)|0; + return this.getter(chunkNum)[chunkOffset]; + }; + LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) { + this.getter = getter; + }; + LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() { + // Find length + var xhr = new XMLHttpRequest(); + xhr.open('HEAD', url, false); + xhr.send(null); + if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); + var datalength = Number(xhr.getResponseHeader("Content-length")); + var header; + var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes"; + var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip"; + + var chunkSize = 1024*1024; // Chunk size in bytes + + if (!hasByteServing) chunkSize = datalength; + + // Function to get a range from the remote URL. + var doXHR = (function(from, to) { + if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!"); + if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!"); + + // TODO: Use mozResponseArrayBuffer, responseStream, etc. if available. + var xhr = new XMLHttpRequest(); + xhr.open('GET', url, false); + if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to); + + // Some hints to the browser that we want binary data. + if (typeof Uint8Array != 'undefined') xhr.responseType = 'arraybuffer'; + if (xhr.overrideMimeType) { + xhr.overrideMimeType('text/plain; charset=x-user-defined'); + } + + xhr.send(null); + if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); + if (xhr.response !== undefined) { + return new Uint8Array(/** @type{Array<number>} */(xhr.response || [])); + } else { + return intArrayFromString(xhr.responseText || '', true); + } + }); + var lazyArray = this; + lazyArray.setDataGetter(function(chunkNum) { + var start = chunkNum * chunkSize; + var end = (chunkNum+1) * chunkSize - 1; // including this byte + end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block + if (typeof(lazyArray.chunks[chunkNum]) === "undefined") { + lazyArray.chunks[chunkNum] = doXHR(start, end); + } + if (typeof(lazyArray.chunks[chunkNum]) === "undefined") throw new Error("doXHR failed!"); + return lazyArray.chunks[chunkNum]; + }); + + if (usesGzip || !datalength) { + // if the server uses gzip or doesn't supply the length, we have to download the whole file to get the (uncompressed) length + chunkSize = datalength = 1; // this will force getter(0)/doXHR do download the whole file + datalength = this.getter(0).length; + chunkSize = datalength; + out("LazyFiles on gzip forces download of the whole file when length is accessed"); + } + + this._length = datalength; + this._chunkSize = chunkSize; + this.lengthKnown = true; + }; + if (typeof XMLHttpRequest !== 'undefined') { + if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc'; + var lazyArray = new LazyUint8Array(); + Object.defineProperties(lazyArray, { + length: { + get: /** @this{Object} */ function() { + if(!this.lengthKnown) { + this.cacheLength(); + } + return this._length; + } + }, + chunkSize: { + get: /** @this{Object} */ function() { + if(!this.lengthKnown) { + this.cacheLength(); + } + return this._chunkSize; + } + } + }); + + var properties = { isDevice: false, contents: lazyArray }; + } else { + var properties = { isDevice: false, url: url }; + } + + var node = FS.createFile(parent, name, properties, canRead, canWrite); + // This is a total hack, but I want to get this lazy file code out of the + // core of MEMFS. If we want to keep this lazy file concept I feel it should + // be its own thin LAZYFS proxying calls to MEMFS. + if (properties.contents) { + node.contents = properties.contents; + } else if (properties.url) { + node.contents = null; + node.url = properties.url; + } + // Add a function that defers querying the file size until it is asked the first time. + Object.defineProperties(node, { + usedBytes: { + get: /** @this {FSNode} */ function() { return this.contents.length; } + } + }); + // override each stream op with one that tries to force load the lazy file first + var stream_ops = {}; + var keys = Object.keys(node.stream_ops); + keys.forEach(function(key) { + var fn = node.stream_ops[key]; + stream_ops[key] = function forceLoadLazyFile() { + if (!FS.forceLoadFile(node)) { + throw new FS.ErrnoError(29); + } + return fn.apply(null, arguments); + }; + }); + // use a custom read function + stream_ops.read = function stream_ops_read(stream, buffer, offset, length, position) { + if (!FS.forceLoadFile(node)) { + throw new FS.ErrnoError(29); + } + var contents = stream.node.contents; + if (position >= contents.length) + return 0; + var size = Math.min(contents.length - position, length); + assert(size >= 0); + if (contents.slice) { // normal array + for (var i = 0; i < size; i++) { + buffer[offset + i] = contents[position + i]; + } + } else { + for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR + buffer[offset + i] = contents.get(position + i); + } + } + return size; + }; + node.stream_ops = stream_ops; + return node; + },createPreloadedFile:function(parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) { + Browser.init(); // XXX perhaps this method should move onto Browser? + // TODO we should allow people to just pass in a complete filename instead + // of parent and name being that we just join them anyways + var fullname = name ? PATH_FS.resolve(PATH.join2(parent, name)) : parent; + var dep = getUniqueRunDependency('cp ' + fullname); // might have several active requests for the same fullname + function processData(byteArray) { + function finish(byteArray) { + if (preFinish) preFinish(); + if (!dontCreateFile) { + FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn); + } + if (onload) onload(); + removeRunDependency(dep); + } + var handled = false; + Module['preloadPlugins'].forEach(function(plugin) { + if (handled) return; + if (plugin['canHandle'](fullname)) { + plugin['handle'](byteArray, fullname, finish, function() { + if (onerror) onerror(); + removeRunDependency(dep); + }); + handled = true; + } + }); + if (!handled) finish(byteArray); + } + addRunDependency(dep); + if (typeof url == 'string') { + Browser.asyncLoad(url, function(byteArray) { + processData(byteArray); + }, onerror); + } else { + processData(url); + } + },indexedDB:function() { + return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB; + },DB_NAME:function() { + return 'EM_FS_' + window.location.pathname; + },DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:function(paths, onload, onerror) { + onload = onload || function(){}; + onerror = onerror || function(){}; + var indexedDB = FS.indexedDB(); + try { + var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION); + } catch (e) { + return onerror(e); + } + openRequest.onupgradeneeded = function openRequest_onupgradeneeded() { + out('creating db'); + var db = openRequest.result; + db.createObjectStore(FS.DB_STORE_NAME); + }; + openRequest.onsuccess = function openRequest_onsuccess() { + var db = openRequest.result; + var transaction = db.transaction([FS.DB_STORE_NAME], 'readwrite'); + var files = transaction.objectStore(FS.DB_STORE_NAME); + var ok = 0, fail = 0, total = paths.length; + function finish() { + if (fail == 0) onload(); else onerror(); + } + paths.forEach(function(path) { + var putRequest = files.put(FS.analyzePath(path).object.contents, path); + putRequest.onsuccess = function putRequest_onsuccess() { ok++; if (ok + fail == total) finish() }; + putRequest.onerror = function putRequest_onerror() { fail++; if (ok + fail == total) finish() }; + }); + transaction.onerror = onerror; + }; + openRequest.onerror = onerror; + },loadFilesFromDB:function(paths, onload, onerror) { + onload = onload || function(){}; + onerror = onerror || function(){}; + var indexedDB = FS.indexedDB(); + try { + var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION); + } catch (e) { + return onerror(e); + } + openRequest.onupgradeneeded = onerror; // no database to load from + openRequest.onsuccess = function openRequest_onsuccess() { + var db = openRequest.result; + try { + var transaction = db.transaction([FS.DB_STORE_NAME], 'readonly'); + } catch(e) { + onerror(e); + return; + } + var files = transaction.objectStore(FS.DB_STORE_NAME); + var ok = 0, fail = 0, total = paths.length; + function finish() { + if (fail == 0) onload(); else onerror(); + } + paths.forEach(function(path) { + var getRequest = files.get(path); + getRequest.onsuccess = function getRequest_onsuccess() { + if (FS.analyzePath(path).exists) { + FS.unlink(path); + } + FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true); + ok++; + if (ok + fail == total) finish(); + }; + getRequest.onerror = function getRequest_onerror() { fail++; if (ok + fail == total) finish() }; + }); + transaction.onerror = onerror; + }; + openRequest.onerror = onerror; + },mmapAlloc:function(size) { + var alignedSize = alignMemory(size, 16384); + var ptr = _malloc(alignedSize); + while (size < alignedSize) HEAP8[ptr + size++] = 0; + return ptr; + }};var SYSCALLS={mappings:{},DEFAULT_POLLMASK:5,umask:511,calculateAt:function(dirfd, path) { + if (path[0] !== '/') { + // relative path + var dir; + if (dirfd === -100) { + dir = FS.cwd(); + } else { + var dirstream = FS.getStream(dirfd); + if (!dirstream) throw new FS.ErrnoError(8); + dir = dirstream.path; + } + path = PATH.join2(dir, path); + } + return path; + },doStat:function(func, path, buf) { + try { + var stat = func(path); + } catch (e) { + if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) { + // an error occurred while trying to look up the path; we should just report ENOTDIR + return -54; + } + throw e; + } + HEAP32[((buf)>>2)]=stat.dev; + HEAP32[(((buf)+(4))>>2)]=0; + HEAP32[(((buf)+(8))>>2)]=stat.ino; + HEAP32[(((buf)+(12))>>2)]=stat.mode; + HEAP32[(((buf)+(16))>>2)]=stat.nlink; + HEAP32[(((buf)+(20))>>2)]=stat.uid; + HEAP32[(((buf)+(24))>>2)]=stat.gid; + HEAP32[(((buf)+(28))>>2)]=stat.rdev; + HEAP32[(((buf)+(32))>>2)]=0; + (tempI64 = [stat.size>>>0,(tempDouble=stat.size,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[(((buf)+(40))>>2)]=tempI64[0],HEAP32[(((buf)+(44))>>2)]=tempI64[1]); + HEAP32[(((buf)+(48))>>2)]=4096; + HEAP32[(((buf)+(52))>>2)]=stat.blocks; + HEAP32[(((buf)+(56))>>2)]=(stat.atime.getTime() / 1000)|0; + HEAP32[(((buf)+(60))>>2)]=0; + HEAP32[(((buf)+(64))>>2)]=(stat.mtime.getTime() / 1000)|0; + HEAP32[(((buf)+(68))>>2)]=0; + HEAP32[(((buf)+(72))>>2)]=(stat.ctime.getTime() / 1000)|0; + HEAP32[(((buf)+(76))>>2)]=0; + (tempI64 = [stat.ino>>>0,(tempDouble=stat.ino,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[(((buf)+(80))>>2)]=tempI64[0],HEAP32[(((buf)+(84))>>2)]=tempI64[1]); + return 0; + },doMsync:function(addr, stream, len, flags, offset) { + var buffer = HEAPU8.slice(addr, addr + len); + FS.msync(stream, buffer, offset, len, flags); + },doMkdir:function(path, mode) { + // remove a trailing slash, if one - /a/b/ has basename of '', but + // we want to create b in the context of this function + path = PATH.normalize(path); + if (path[path.length-1] === '/') path = path.substr(0, path.length-1); + FS.mkdir(path, mode, 0); + return 0; + },doMknod:function(path, mode, dev) { + // we don't want this in the JS API as it uses mknod to create all nodes. + switch (mode & 61440) { + case 32768: + case 8192: + case 24576: + case 4096: + case 49152: + break; + default: return -28; + } + FS.mknod(path, mode, dev); + return 0; + },doReadlink:function(path, buf, bufsize) { + if (bufsize <= 0) return -28; + var ret = FS.readlink(path); + + var len = Math.min(bufsize, lengthBytesUTF8(ret)); + var endChar = HEAP8[buf+len]; + stringToUTF8(ret, buf, bufsize+1); + // readlink is one of the rare functions that write out a C string, but does never append a null to the output buffer(!) + // stringToUTF8() always appends a null byte, so restore the character under the null byte after the write. + HEAP8[buf+len] = endChar; + + return len; + },doAccess:function(path, amode) { + if (amode & ~7) { + // need a valid mode + return -28; + } + var node; + var lookup = FS.lookupPath(path, { follow: true }); + node = lookup.node; + if (!node) { + return -44; + } + var perms = ''; + if (amode & 4) perms += 'r'; + if (amode & 2) perms += 'w'; + if (amode & 1) perms += 'x'; + if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) { + return -2; + } + return 0; + },doDup:function(path, flags, suggestFD) { + var suggest = FS.getStream(suggestFD); + if (suggest) FS.close(suggest); + return FS.open(path, flags, 0, suggestFD, suggestFD).fd; + },doReadv:function(stream, iov, iovcnt, offset) { + var ret = 0; + for (var i = 0; i < iovcnt; i++) { + var ptr = HEAP32[(((iov)+(i*8))>>2)]; + var len = HEAP32[(((iov)+(i*8 + 4))>>2)]; + var curr = FS.read(stream, HEAP8,ptr, len, offset); + if (curr < 0) return -1; + ret += curr; + if (curr < len) break; // nothing more to read + } + return ret; + },doWritev:function(stream, iov, iovcnt, offset) { + var ret = 0; + for (var i = 0; i < iovcnt; i++) { + var ptr = HEAP32[(((iov)+(i*8))>>2)]; + var len = HEAP32[(((iov)+(i*8 + 4))>>2)]; + var curr = FS.write(stream, HEAP8,ptr, len, offset); + if (curr < 0) return -1; + ret += curr; + } + return ret; + },varargs:undefined,get:function() { + assert(SYSCALLS.varargs != undefined); + SYSCALLS.varargs += 4; + var ret = HEAP32[(((SYSCALLS.varargs)-(4))>>2)]; + return ret; + },getStr:function(ptr) { + var ret = UTF8ToString(ptr); + return ret; + },getStreamFromFD:function(fd) { + var stream = FS.getStream(fd); + if (!stream) throw new FS.ErrnoError(8); + return stream; + },get64:function(low, high) { + if (low >= 0) assert(high === 0); + else assert(high === -1); + return low; + }};function ___sys_fcntl64(fd, cmd, varargs) {SYSCALLS.varargs = varargs; + try { + + var stream = SYSCALLS.getStreamFromFD(fd); + switch (cmd) { + case 0: { + var arg = SYSCALLS.get(); + if (arg < 0) { + return -28; + } + var newStream; + newStream = FS.open(stream.path, stream.flags, 0, arg); + return newStream.fd; + } + case 1: + case 2: + return 0; // FD_CLOEXEC makes no sense for a single process. + case 3: + return stream.flags; + case 4: { + var arg = SYSCALLS.get(); + stream.flags |= arg; + return 0; + } + case 12: + /* case 12: Currently in musl F_GETLK64 has same value as F_GETLK, so omitted to avoid duplicate case blocks. If that changes, uncomment this */ { + + var arg = SYSCALLS.get(); + var offset = 0; + // We're always unlocked. + HEAP16[(((arg)+(offset))>>1)]=2; + return 0; + } + case 13: + case 14: + /* case 13: Currently in musl F_SETLK64 has same value as F_SETLK, so omitted to avoid duplicate case blocks. If that changes, uncomment this */ + /* case 14: Currently in musl F_SETLKW64 has same value as F_SETLKW, so omitted to avoid duplicate case blocks. If that changes, uncomment this */ + + + return 0; // Pretend that the locking is successful. + case 16: + case 8: + return -28; // These are for sockets. We don't have them fully implemented yet. + case 9: + // musl trusts getown return values, due to a bug where they must be, as they overlap with errors. just return -1 here, so fnctl() returns that, and we set errno ourselves. + setErrNo(28); + return -1; + default: { + return -28; + } + } + } catch (e) { + if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); + return -e.errno; + } + } + + function ___sys_ioctl(fd, op, varargs) {SYSCALLS.varargs = varargs; + try { + + var stream = SYSCALLS.getStreamFromFD(fd); + switch (op) { + case 21509: + case 21505: { + if (!stream.tty) return -59; + return 0; + } + case 21510: + case 21511: + case 21512: + case 21506: + case 21507: + case 21508: { + if (!stream.tty) return -59; + return 0; // no-op, not actually adjusting terminal settings + } + case 21519: { + if (!stream.tty) return -59; + var argp = SYSCALLS.get(); + HEAP32[((argp)>>2)]=0; + return 0; + } + case 21520: { + if (!stream.tty) return -59; + return -28; // not supported + } + case 21531: { + var argp = SYSCALLS.get(); + return FS.ioctl(stream, op, argp); + } + case 21523: { + // TODO: in theory we should write to the winsize struct that gets + // passed in, but for now musl doesn't read anything on it + if (!stream.tty) return -59; + return 0; + } + case 21524: { + // TODO: technically, this ioctl call should change the window size. + // but, since emscripten doesn't have any concept of a terminal window + // yet, we'll just silently throw it away as we do TIOCGWINSZ + if (!stream.tty) return -59; + return 0; + } + default: abort('bad ioctl syscall ' + op); + } + } catch (e) { + if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); + return -e.errno; + } + } + + + function syscallMunmap(addr, len) { + if ((addr | 0) === -1 || len === 0) { + return -28; + } + // TODO: support unmmap'ing parts of allocations + var info = SYSCALLS.mappings[addr]; + if (!info) return 0; + if (len === info.len) { + var stream = FS.getStream(info.fd); + if (info.prot & 2) { + SYSCALLS.doMsync(addr, stream, len, info.flags, info.offset); + } + FS.munmap(stream); + SYSCALLS.mappings[addr] = null; + if (info.allocated) { + _free(info.malloc); + } + } + return 0; + }function ___sys_munmap(addr, len) {try { + + return syscallMunmap(addr, len); + } catch (e) { + if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); + return -e.errno; + } + } + + function ___sys_open(path, flags, varargs) {SYSCALLS.varargs = varargs; + try { + + var pathname = SYSCALLS.getStr(path); + var mode = SYSCALLS.get(); + var stream = FS.open(pathname, flags, mode); + return stream.fd; + } catch (e) { + if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); + return -e.errno; + } + } + + function ___sys_read(fd, buf, count) {try { + + var stream = SYSCALLS.getStreamFromFD(fd); + return FS.read(stream, HEAP8,buf, count); + } catch (e) { + if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); + return -e.errno; + } + } + + + var SOCKFS={mount:function(mount) { + // If Module['websocket'] has already been defined (e.g. for configuring + // the subprotocol/url) use that, if not initialise it to a new object. + Module['websocket'] = (Module['websocket'] && + ('object' === typeof Module['websocket'])) ? Module['websocket'] : {}; + + // Add the Event registration mechanism to the exported websocket configuration + // object so we can register network callbacks from native JavaScript too. + // For more documentation see system/include/emscripten/emscripten.h + Module['websocket']._callbacks = {}; + Module['websocket']['on'] = /** @this{Object} */ function(event, callback) { + if ('function' === typeof callback) { + this._callbacks[event] = callback; + } + return this; + }; + + Module['websocket'].emit = /** @this{Object} */ function(event, param) { + if ('function' === typeof this._callbacks[event]) { + this._callbacks[event].call(this, param); + } + }; + + // If debug is enabled register simple default logging callbacks for each Event. + + return FS.createNode(null, '/', 16384 | 511 /* 0777 */, 0); + },createSocket:function(family, type, protocol) { + type &= ~526336; // Some applications may pass it; it makes no sense for a single process. + var streaming = type == 1; + if (protocol) { + assert(streaming == (protocol == 6)); // if SOCK_STREAM, must be tcp + } + + // create our internal socket structure + var sock = { + family: family, + type: type, + protocol: protocol, + server: null, + error: null, // Used in getsockopt for SOL_SOCKET/SO_ERROR test + peers: {}, + pending: [], + recv_queue: [], + sock_ops: SOCKFS.websocket_sock_ops + }; + + // create the filesystem node to store the socket structure + var name = SOCKFS.nextname(); + var node = FS.createNode(SOCKFS.root, name, 49152, 0); + node.sock = sock; + + // and the wrapping stream that enables library functions such + // as read and write to indirectly interact with the socket + var stream = FS.createStream({ + path: name, + node: node, + flags: FS.modeStringToFlags('r+'), + seekable: false, + stream_ops: SOCKFS.stream_ops + }); + + // map the new stream to the socket structure (sockets have a 1:1 + // relationship with a stream) + sock.stream = stream; + + return sock; + },getSocket:function(fd) { + var stream = FS.getStream(fd); + if (!stream || !FS.isSocket(stream.node.mode)) { + return null; + } + return stream.node.sock; + },stream_ops:{poll:function(stream) { + var sock = stream.node.sock; + return sock.sock_ops.poll(sock); + },ioctl:function(stream, request, varargs) { + var sock = stream.node.sock; + return sock.sock_ops.ioctl(sock, request, varargs); + },read:function(stream, buffer, offset, length, position /* ignored */) { + var sock = stream.node.sock; + var msg = sock.sock_ops.recvmsg(sock, length); + if (!msg) { + // socket is closed + return 0; + } + buffer.set(msg.buffer, offset); + return msg.buffer.length; + },write:function(stream, buffer, offset, length, position /* ignored */) { + var sock = stream.node.sock; + return sock.sock_ops.sendmsg(sock, buffer, offset, length); + },close:function(stream) { + var sock = stream.node.sock; + sock.sock_ops.close(sock); + }},nextname:function() { + if (!SOCKFS.nextname.current) { + SOCKFS.nextname.current = 0; + } + return 'socket[' + (SOCKFS.nextname.current++) + ']'; + },websocket_sock_ops:{createPeer:function(sock, addr, port) { + var ws; + + if (typeof addr === 'object') { + ws = addr; + addr = null; + port = null; + } + + if (ws) { + // for sockets that've already connected (e.g. we're the server) + // we can inspect the _socket property for the address + if (ws._socket) { + addr = ws._socket.remoteAddress; + port = ws._socket.remotePort; + } + // if we're just now initializing a connection to the remote, + // inspect the url property + else { + var result = /ws[s]?:\/\/([^:]+):(\d+)/.exec(ws.url); + if (!result) { + throw new Error('WebSocket URL must be in the format ws(s)://address:port'); + } + addr = result[1]; + port = parseInt(result[2], 10); + } + } else { + // create the actual websocket object and connect + try { + // runtimeConfig gets set to true if WebSocket runtime configuration is available. + var runtimeConfig = (Module['websocket'] && ('object' === typeof Module['websocket'])); + + // The default value is 'ws://' the replace is needed because the compiler replaces '//' comments with '#' + // comments without checking context, so we'd end up with ws:#, the replace swaps the '#' for '//' again. + var url = 'ws:#'.replace('#', '//'); + + if (runtimeConfig) { + if ('string' === typeof Module['websocket']['url']) { + url = Module['websocket']['url']; // Fetch runtime WebSocket URL config. + } + } + + if (url === 'ws://' || url === 'wss://') { // Is the supplied URL config just a prefix, if so complete it. + var parts = addr.split('/'); + url = url + parts[0] + ":" + port + "/" + parts.slice(1).join('/'); + } + + // Make the WebSocket subprotocol (Sec-WebSocket-Protocol) default to binary if no configuration is set. + var subProtocols = 'binary'; // The default value is 'binary' + + if (runtimeConfig) { + if ('string' === typeof Module['websocket']['subprotocol']) { + subProtocols = Module['websocket']['subprotocol']; // Fetch runtime WebSocket subprotocol config. + } + } + + // The default WebSocket options + var opts = undefined; + + if (subProtocols !== 'null') { + // The regex trims the string (removes spaces at the beginning and end, then splits the string by + // <any space>,<any space> into an Array. Whitespace removal is important for Websockify and ws. + subProtocols = subProtocols.replace(/^ +| +$/g,"").split(/ *, */); + + // The node ws library API for specifying optional subprotocol is slightly different than the browser's. + opts = ENVIRONMENT_IS_NODE ? {'protocol': subProtocols.toString()} : subProtocols; + } + + // some webservers (azure) does not support subprotocol header + if (runtimeConfig && null === Module['websocket']['subprotocol']) { + subProtocols = 'null'; + opts = undefined; + } + + // If node we use the ws library. + var WebSocketConstructor; + if (ENVIRONMENT_IS_NODE) { + WebSocketConstructor = /** @type{(typeof WebSocket)} */(require('ws')); + } else + { + WebSocketConstructor = WebSocket; + } + ws = new WebSocketConstructor(url, opts); + ws.binaryType = 'arraybuffer'; + } catch (e) { + throw new FS.ErrnoError(ERRNO_CODES.EHOSTUNREACH); + } + } + + + var peer = { + addr: addr, + port: port, + socket: ws, + dgram_send_queue: [] + }; + + SOCKFS.websocket_sock_ops.addPeer(sock, peer); + SOCKFS.websocket_sock_ops.handlePeerEvents(sock, peer); + + // if this is a bound dgram socket, send the port number first to allow + // us to override the ephemeral port reported to us by remotePort on the + // remote end. + if (sock.type === 2 && typeof sock.sport !== 'undefined') { + peer.dgram_send_queue.push(new Uint8Array([ + 255, 255, 255, 255, + 'p'.charCodeAt(0), 'o'.charCodeAt(0), 'r'.charCodeAt(0), 't'.charCodeAt(0), + ((sock.sport & 0xff00) >> 8) , (sock.sport & 0xff) + ])); + } + + return peer; + },getPeer:function(sock, addr, port) { + return sock.peers[addr + ':' + port]; + },addPeer:function(sock, peer) { + sock.peers[peer.addr + ':' + peer.port] = peer; + },removePeer:function(sock, peer) { + delete sock.peers[peer.addr + ':' + peer.port]; + },handlePeerEvents:function(sock, peer) { + var first = true; + + var handleOpen = function () { + + Module['websocket'].emit('open', sock.stream.fd); + + try { + var queued = peer.dgram_send_queue.shift(); + while (queued) { + peer.socket.send(queued); + queued = peer.dgram_send_queue.shift(); + } + } catch (e) { + // not much we can do here in the way of proper error handling as we've already + // lied and said this data was sent. shut it down. + peer.socket.close(); + } + }; + + function handleMessage(data) { + if (typeof data === 'string') { + var encoder = new TextEncoder(); // should be utf-8 + data = encoder.encode(data); // make a typed array from the string + } else { + assert(data.byteLength !== undefined); // must receive an ArrayBuffer + if (data.byteLength == 0) { + // An empty ArrayBuffer will emit a pseudo disconnect event + // as recv/recvmsg will return zero which indicates that a socket + // has performed a shutdown although the connection has not been disconnected yet. + return; + } else { + data = new Uint8Array(data); // make a typed array view on the array buffer + } + } + + + // if this is the port message, override the peer's port with it + var wasfirst = first; + first = false; + if (wasfirst && + data.length === 10 && + data[0] === 255 && data[1] === 255 && data[2] === 255 && data[3] === 255 && + data[4] === 'p'.charCodeAt(0) && data[5] === 'o'.charCodeAt(0) && data[6] === 'r'.charCodeAt(0) && data[7] === 't'.charCodeAt(0)) { + // update the peer's port and it's key in the peer map + var newport = ((data[8] << 8) | data[9]); + SOCKFS.websocket_sock_ops.removePeer(sock, peer); + peer.port = newport; + SOCKFS.websocket_sock_ops.addPeer(sock, peer); + return; + } + + sock.recv_queue.push({ addr: peer.addr, port: peer.port, data: data }); + Module['websocket'].emit('message', sock.stream.fd); + }; + + if (ENVIRONMENT_IS_NODE) { + peer.socket.on('open', handleOpen); + peer.socket.on('message', function(data, flags) { + if (!flags.binary) { + return; + } + handleMessage((new Uint8Array(data)).buffer); // copy from node Buffer -> ArrayBuffer + }); + peer.socket.on('close', function() { + Module['websocket'].emit('close', sock.stream.fd); + }); + peer.socket.on('error', function(error) { + // Although the ws library may pass errors that may be more descriptive than + // ECONNREFUSED they are not necessarily the expected error code e.g. + // ENOTFOUND on getaddrinfo seems to be node.js specific, so using ECONNREFUSED + // is still probably the most useful thing to do. + sock.error = ERRNO_CODES.ECONNREFUSED; // Used in getsockopt for SOL_SOCKET/SO_ERROR test. + Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'ECONNREFUSED: Connection refused']); + // don't throw + }); + } else { + peer.socket.onopen = handleOpen; + peer.socket.onclose = function() { + Module['websocket'].emit('close', sock.stream.fd); + }; + peer.socket.onmessage = function peer_socket_onmessage(event) { + handleMessage(event.data); + }; + peer.socket.onerror = function(error) { + // The WebSocket spec only allows a 'simple event' to be thrown on error, + // so we only really know as much as ECONNREFUSED. + sock.error = ERRNO_CODES.ECONNREFUSED; // Used in getsockopt for SOL_SOCKET/SO_ERROR test. + Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'ECONNREFUSED: Connection refused']); + }; + } + },poll:function(sock) { + if (sock.type === 1 && sock.server) { + // listen sockets should only say they're available for reading + // if there are pending clients. + return sock.pending.length ? (64 | 1) : 0; + } + + var mask = 0; + var dest = sock.type === 1 ? // we only care about the socket state for connection-based sockets + SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport) : + null; + + if (sock.recv_queue.length || + !dest || // connection-less sockets are always ready to read + (dest && dest.socket.readyState === dest.socket.CLOSING) || + (dest && dest.socket.readyState === dest.socket.CLOSED)) { // let recv return 0 once closed + mask |= (64 | 1); + } + + if (!dest || // connection-less sockets are always ready to write + (dest && dest.socket.readyState === dest.socket.OPEN)) { + mask |= 4; + } + + if ((dest && dest.socket.readyState === dest.socket.CLOSING) || + (dest && dest.socket.readyState === dest.socket.CLOSED)) { + mask |= 16; + } + + return mask; + },ioctl:function(sock, request, arg) { + switch (request) { + case 21531: + var bytes = 0; + if (sock.recv_queue.length) { + bytes = sock.recv_queue[0].data.length; + } + HEAP32[((arg)>>2)]=bytes; + return 0; + default: + return ERRNO_CODES.EINVAL; + } + },close:function(sock) { + // if we've spawned a listen server, close it + if (sock.server) { + try { + sock.server.close(); + } catch (e) { + } + sock.server = null; + } + // close any peer connections + var peers = Object.keys(sock.peers); + for (var i = 0; i < peers.length; i++) { + var peer = sock.peers[peers[i]]; + try { + peer.socket.close(); + } catch (e) { + } + SOCKFS.websocket_sock_ops.removePeer(sock, peer); + } + return 0; + },bind:function(sock, addr, port) { + if (typeof sock.saddr !== 'undefined' || typeof sock.sport !== 'undefined') { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); // already bound + } + sock.saddr = addr; + sock.sport = port; + // in order to emulate dgram sockets, we need to launch a listen server when + // binding on a connection-less socket + // note: this is only required on the server side + if (sock.type === 2) { + // close the existing server if it exists + if (sock.server) { + sock.server.close(); + sock.server = null; + } + // swallow error operation not supported error that occurs when binding in the + // browser where this isn't supported + try { + sock.sock_ops.listen(sock, 0); + } catch (e) { + if (!(e instanceof FS.ErrnoError)) throw e; + if (e.errno !== ERRNO_CODES.EOPNOTSUPP) throw e; + } + } + },connect:function(sock, addr, port) { + if (sock.server) { + throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP); + } + + // TODO autobind + // if (!sock.addr && sock.type == 2) { + // } + + // early out if we're already connected / in the middle of connecting + if (typeof sock.daddr !== 'undefined' && typeof sock.dport !== 'undefined') { + var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport); + if (dest) { + if (dest.socket.readyState === dest.socket.CONNECTING) { + throw new FS.ErrnoError(ERRNO_CODES.EALREADY); + } else { + throw new FS.ErrnoError(ERRNO_CODES.EISCONN); + } + } + } + + // add the socket to our peer list and set our + // destination address / port to match + var peer = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port); + sock.daddr = peer.addr; + sock.dport = peer.port; + + // always "fail" in non-blocking mode + throw new FS.ErrnoError(ERRNO_CODES.EINPROGRESS); + },listen:function(sock, backlog) { + if (!ENVIRONMENT_IS_NODE) { + throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP); + } + if (sock.server) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); // already listening + } + var WebSocketServer = require('ws').Server; + var host = sock.saddr; + sock.server = new WebSocketServer({ + host: host, + port: sock.sport + // TODO support backlog + }); + Module['websocket'].emit('listen', sock.stream.fd); // Send Event with listen fd. + + sock.server.on('connection', function(ws) { + if (sock.type === 1) { + var newsock = SOCKFS.createSocket(sock.family, sock.type, sock.protocol); + + // create a peer on the new socket + var peer = SOCKFS.websocket_sock_ops.createPeer(newsock, ws); + newsock.daddr = peer.addr; + newsock.dport = peer.port; + + // push to queue for accept to pick up + sock.pending.push(newsock); + Module['websocket'].emit('connection', newsock.stream.fd); + } else { + // create a peer on the listen socket so calling sendto + // with the listen socket and an address will resolve + // to the correct client + SOCKFS.websocket_sock_ops.createPeer(sock, ws); + Module['websocket'].emit('connection', sock.stream.fd); + } + }); + sock.server.on('closed', function() { + Module['websocket'].emit('close', sock.stream.fd); + sock.server = null; + }); + sock.server.on('error', function(error) { + // Although the ws library may pass errors that may be more descriptive than + // ECONNREFUSED they are not necessarily the expected error code e.g. + // ENOTFOUND on getaddrinfo seems to be node.js specific, so using EHOSTUNREACH + // is still probably the most useful thing to do. This error shouldn't + // occur in a well written app as errors should get trapped in the compiled + // app's own getaddrinfo call. + sock.error = ERRNO_CODES.EHOSTUNREACH; // Used in getsockopt for SOL_SOCKET/SO_ERROR test. + Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'EHOSTUNREACH: Host is unreachable']); + // don't throw + }); + },accept:function(listensock) { + if (!listensock.server) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + var newsock = listensock.pending.shift(); + newsock.stream.flags = listensock.stream.flags; + return newsock; + },getname:function(sock, peer) { + var addr, port; + if (peer) { + if (sock.daddr === undefined || sock.dport === undefined) { + throw new FS.ErrnoError(ERRNO_CODES.ENOTCONN); + } + addr = sock.daddr; + port = sock.dport; + } else { + // TODO saddr and sport will be set for bind()'d UDP sockets, but what + // should we be returning for TCP sockets that've been connect()'d? + addr = sock.saddr || 0; + port = sock.sport || 0; + } + return { addr: addr, port: port }; + },sendmsg:function(sock, buffer, offset, length, addr, port) { + if (sock.type === 2) { + // connection-less sockets will honor the message address, + // and otherwise fall back to the bound destination address + if (addr === undefined || port === undefined) { + addr = sock.daddr; + port = sock.dport; + } + // if there was no address to fall back to, error out + if (addr === undefined || port === undefined) { + throw new FS.ErrnoError(ERRNO_CODES.EDESTADDRREQ); + } + } else { + // connection-based sockets will only use the bound + addr = sock.daddr; + port = sock.dport; + } + + // find the peer for the destination address + var dest = SOCKFS.websocket_sock_ops.getPeer(sock, addr, port); + + // early out if not connected with a connection-based socket + if (sock.type === 1) { + if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) { + throw new FS.ErrnoError(ERRNO_CODES.ENOTCONN); + } else if (dest.socket.readyState === dest.socket.CONNECTING) { + throw new FS.ErrnoError(ERRNO_CODES.EAGAIN); + } + } + + // create a copy of the incoming data to send, as the WebSocket API + // doesn't work entirely with an ArrayBufferView, it'll just send + // the entire underlying buffer + if (ArrayBuffer.isView(buffer)) { + offset += buffer.byteOffset; + buffer = buffer.buffer; + } + + var data; + data = buffer.slice(offset, offset + length); + + // if we're emulating a connection-less dgram socket and don't have + // a cached connection, queue the buffer to send upon connect and + // lie, saying the data was sent now. + if (sock.type === 2) { + if (!dest || dest.socket.readyState !== dest.socket.OPEN) { + // if we're not connected, open a new connection + if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) { + dest = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port); + } + dest.dgram_send_queue.push(data); + return length; + } + } + + try { + // send the actual data + dest.socket.send(data); + return length; + } catch (e) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + },recvmsg:function(sock, length) { + // http://pubs.opengroup.org/onlinepubs/7908799/xns/recvmsg.html + if (sock.type === 1 && sock.server) { + // tcp servers should not be recv()'ing on the listen socket + throw new FS.ErrnoError(ERRNO_CODES.ENOTCONN); + } + + var queued = sock.recv_queue.shift(); + if (!queued) { + if (sock.type === 1) { + var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport); + + if (!dest) { + // if we have a destination address but are not connected, error out + throw new FS.ErrnoError(ERRNO_CODES.ENOTCONN); + } + else if (dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) { + // return null if the socket has closed + return null; + } + else { + // else, our socket is in a valid state but truly has nothing available + throw new FS.ErrnoError(ERRNO_CODES.EAGAIN); + } + } else { + throw new FS.ErrnoError(ERRNO_CODES.EAGAIN); + } + } + + // queued.data will be an ArrayBuffer if it's unadulterated, but if it's + // requeued TCP data it'll be an ArrayBufferView + var queuedLength = queued.data.byteLength || queued.data.length; + var queuedOffset = queued.data.byteOffset || 0; + var queuedBuffer = queued.data.buffer || queued.data; + var bytesRead = Math.min(length, queuedLength); + var res = { + buffer: new Uint8Array(queuedBuffer, queuedOffset, bytesRead), + addr: queued.addr, + port: queued.port + }; + + + // push back any unread data for TCP connections + if (sock.type === 1 && bytesRead < queuedLength) { + var bytesRemaining = queuedLength - bytesRead; + queued.data = new Uint8Array(queuedBuffer, queuedOffset + bytesRead, bytesRemaining); + sock.recv_queue.unshift(queued); + } + + return res; + }}}; + + + function __inet_pton4_raw(str) { + var b = str.split('.'); + for (var i = 0; i < 4; i++) { + var tmp = Number(b[i]); + if (isNaN(tmp)) return null; + b[i] = tmp; + } + return (b[0] | (b[1] << 8) | (b[2] << 16) | (b[3] << 24)) >>> 0; + } + + + /** @suppress {checkTypes} */ + function jstoi_q(str) { + return parseInt(str); + }function __inet_pton6_raw(str) { + var words; + var w, offset, z, i; + /* http://home.deds.nl/~aeron/regex/ */ + var valid6regx = /^((?=.*::)(?!.*::.+::)(::)?([\dA-F]{1,4}:(:|\b)|){5}|([\dA-F]{1,4}:){6})((([\dA-F]{1,4}((?!\3)::|:\b|$))|(?!\2\3)){2}|(((2[0-4]|1\d|[1-9])?\d|25[0-5])\.?\b){4})$/i + var parts = []; + if (!valid6regx.test(str)) { + return null; + } + if (str === "::") { + return [0, 0, 0, 0, 0, 0, 0, 0]; + } + // Z placeholder to keep track of zeros when splitting the string on ":" + if (str.indexOf("::") === 0) { + str = str.replace("::", "Z:"); // leading zeros case + } else { + str = str.replace("::", ":Z:"); + } + + if (str.indexOf(".") > 0) { + // parse IPv4 embedded stress + str = str.replace(new RegExp('[.]', 'g'), ":"); + words = str.split(":"); + words[words.length-4] = jstoi_q(words[words.length-4]) + jstoi_q(words[words.length-3])*256; + words[words.length-3] = jstoi_q(words[words.length-2]) + jstoi_q(words[words.length-1])*256; + words = words.slice(0, words.length-2); + } else { + words = str.split(":"); + } + + offset = 0; z = 0; + for (w=0; w < words.length; w++) { + if (typeof words[w] === 'string') { + if (words[w] === 'Z') { + // compressed zeros - write appropriate number of zero words + for (z = 0; z < (8 - words.length+1); z++) { + parts[w+z] = 0; + } + offset = z-1; + } else { + // parse hex to field to 16-bit value and write it in network byte-order + parts[w+offset] = _htons(parseInt(words[w],16)); + } + } else { + // parsed IPv4 words + parts[w+offset] = words[w]; + } + } + return [ + (parts[1] << 16) | parts[0], + (parts[3] << 16) | parts[2], + (parts[5] << 16) | parts[4], + (parts[7] << 16) | parts[6] + ]; + }var DNS={address_map:{id:1,addrs:{},names:{}},lookup_name:function (name) { + // If the name is already a valid ipv4 / ipv6 address, don't generate a fake one. + var res = __inet_pton4_raw(name); + if (res !== null) { + return name; + } + res = __inet_pton6_raw(name); + if (res !== null) { + return name; + } + + // See if this name is already mapped. + var addr; + + if (DNS.address_map.addrs[name]) { + addr = DNS.address_map.addrs[name]; + } else { + var id = DNS.address_map.id++; + assert(id < 65535, 'exceeded max address mappings of 65535'); + + addr = '172.29.' + (id & 0xff) + '.' + (id & 0xff00); + + DNS.address_map.names[addr] = name; + DNS.address_map.addrs[name] = addr; + } + + return addr; + },lookup_addr:function (addr) { + if (DNS.address_map.names[addr]) { + return DNS.address_map.names[addr]; + } + + return null; + }}; + + + var Sockets={BUFFER_SIZE:10240,MAX_BUFFER_SIZE:10485760,nextFd:1,fds:{},nextport:1,maxport:65535,peer:null,connections:{},portmap:{},localAddr:4261412874,addrPool:[33554442,50331658,67108874,83886090,100663306,117440522,134217738,150994954,167772170,184549386,201326602,218103818,234881034]}; + + function __inet_ntop4_raw(addr) { + return (addr & 0xff) + '.' + ((addr >> 8) & 0xff) + '.' + ((addr >> 16) & 0xff) + '.' + ((addr >> 24) & 0xff) + } + + function __inet_ntop6_raw(ints) { + // ref: http://www.ietf.org/rfc/rfc2373.txt - section 2.5.4 + // Format for IPv4 compatible and mapped 128-bit IPv6 Addresses + // 128-bits are split into eight 16-bit words + // stored in network byte order (big-endian) + // | 80 bits | 16 | 32 bits | + // +-----------------------------------------------------------------+ + // | 10 bytes | 2 | 4 bytes | + // +--------------------------------------+--------------------------+ + // + 5 words | 1 | 2 words | + // +--------------------------------------+--------------------------+ + // |0000..............................0000|0000| IPv4 ADDRESS | (compatible) + // +--------------------------------------+----+---------------------+ + // |0000..............................0000|FFFF| IPv4 ADDRESS | (mapped) + // +--------------------------------------+----+---------------------+ + var str = ""; + var word = 0; + var longest = 0; + var lastzero = 0; + var zstart = 0; + var len = 0; + var i = 0; + var parts = [ + ints[0] & 0xffff, + (ints[0] >> 16), + ints[1] & 0xffff, + (ints[1] >> 16), + ints[2] & 0xffff, + (ints[2] >> 16), + ints[3] & 0xffff, + (ints[3] >> 16) + ]; + + // Handle IPv4-compatible, IPv4-mapped, loopback and any/unspecified addresses + + var hasipv4 = true; + var v4part = ""; + // check if the 10 high-order bytes are all zeros (first 5 words) + for (i = 0; i < 5; i++) { + if (parts[i] !== 0) { hasipv4 = false; break; } + } + + if (hasipv4) { + // low-order 32-bits store an IPv4 address (bytes 13 to 16) (last 2 words) + v4part = __inet_ntop4_raw(parts[6] | (parts[7] << 16)); + // IPv4-mapped IPv6 address if 16-bit value (bytes 11 and 12) == 0xFFFF (6th word) + if (parts[5] === -1) { + str = "::ffff:"; + str += v4part; + return str; + } + // IPv4-compatible IPv6 address if 16-bit value (bytes 11 and 12) == 0x0000 (6th word) + if (parts[5] === 0) { + str = "::"; + //special case IPv6 addresses + if(v4part === "0.0.0.0") v4part = ""; // any/unspecified address + if(v4part === "0.0.0.1") v4part = "1";// loopback address + str += v4part; + return str; + } + } + + // Handle all other IPv6 addresses + + // first run to find the longest contiguous zero words + for (word = 0; word < 8; word++) { + if (parts[word] === 0) { + if (word - lastzero > 1) { + len = 0; + } + lastzero = word; + len++; + } + if (len > longest) { + longest = len; + zstart = word - longest + 1; + } + } + + for (word = 0; word < 8; word++) { + if (longest > 1) { + // compress contiguous zeros - to produce "::" + if (parts[word] === 0 && word >= zstart && word < (zstart + longest) ) { + if (word === zstart) { + str += ":"; + if (zstart === 0) str += ":"; //leading zeros case + } + continue; + } + } + // converts 16-bit words from big-endian to little-endian before converting to hex string + str += Number(_ntohs(parts[word] & 0xffff)).toString(16); + str += word < 7 ? ":" : ""; + } + return str; + }function __read_sockaddr(sa, salen) { + // family / port offsets are common to both sockaddr_in and sockaddr_in6 + var family = HEAP16[((sa)>>1)]; + var port = _ntohs(HEAPU16[(((sa)+(2))>>1)]); + var addr; + + switch (family) { + case 2: + if (salen !== 16) { + return { errno: 28 }; + } + addr = HEAP32[(((sa)+(4))>>2)]; + addr = __inet_ntop4_raw(addr); + break; + case 10: + if (salen !== 28) { + return { errno: 28 }; + } + addr = [ + HEAP32[(((sa)+(8))>>2)], + HEAP32[(((sa)+(12))>>2)], + HEAP32[(((sa)+(16))>>2)], + HEAP32[(((sa)+(20))>>2)] + ]; + addr = __inet_ntop6_raw(addr); + break; + default: + return { errno: 5 }; + } + + return { family: family, addr: addr, port: port }; + } + + function __write_sockaddr(sa, family, addr, port) { + switch (family) { + case 2: + addr = __inet_pton4_raw(addr); + HEAP16[((sa)>>1)]=family; + HEAP32[(((sa)+(4))>>2)]=addr; + HEAP16[(((sa)+(2))>>1)]=_htons(port); + break; + case 10: + addr = __inet_pton6_raw(addr); + HEAP32[((sa)>>2)]=family; + HEAP32[(((sa)+(8))>>2)]=addr[0]; + HEAP32[(((sa)+(12))>>2)]=addr[1]; + HEAP32[(((sa)+(16))>>2)]=addr[2]; + HEAP32[(((sa)+(20))>>2)]=addr[3]; + HEAP16[(((sa)+(2))>>1)]=_htons(port); + HEAP32[(((sa)+(4))>>2)]=0; + HEAP32[(((sa)+(24))>>2)]=0; + break; + default: + return { errno: 5 }; + } + // kind of lame, but let's match _read_sockaddr's interface + return {}; + }function ___sys_socketcall(call, socketvararg) {try { + + // socketcalls pass the rest of the arguments in a struct + SYSCALLS.varargs = socketvararg; + + var getSocketFromFD = function() { + var socket = SOCKFS.getSocket(SYSCALLS.get()); + if (!socket) throw new FS.ErrnoError(8); + return socket; + }; + /** @param {boolean=} allowNull */ + var getSocketAddress = function(allowNull) { + var addrp = SYSCALLS.get(), addrlen = SYSCALLS.get(); + if (allowNull && addrp === 0) return null; + var info = __read_sockaddr(addrp, addrlen); + if (info.errno) throw new FS.ErrnoError(info.errno); + info.addr = DNS.lookup_addr(info.addr) || info.addr; + return info; + }; + + switch (call) { + case 1: { // socket + var domain = SYSCALLS.get(), type = SYSCALLS.get(), protocol = SYSCALLS.get(); + var sock = SOCKFS.createSocket(domain, type, protocol); + assert(sock.stream.fd < 64); // XXX ? select() assumes socket fd values are in 0..63 + return sock.stream.fd; + } + case 2: { // bind + var sock = getSocketFromFD(), info = getSocketAddress(); + sock.sock_ops.bind(sock, info.addr, info.port); + return 0; + } + case 3: { // connect + var sock = getSocketFromFD(), info = getSocketAddress(); + sock.sock_ops.connect(sock, info.addr, info.port); + return 0; + } + case 4: { // listen + var sock = getSocketFromFD(), backlog = SYSCALLS.get(); + sock.sock_ops.listen(sock, backlog); + return 0; + } + case 5: { // accept + var sock = getSocketFromFD(), addr = SYSCALLS.get(), addrlen = SYSCALLS.get(); + var newsock = sock.sock_ops.accept(sock); + if (addr) { + var res = __write_sockaddr(addr, newsock.family, DNS.lookup_name(newsock.daddr), newsock.dport); + assert(!res.errno); + } + return newsock.stream.fd; + } + case 6: { // getsockname + var sock = getSocketFromFD(), addr = SYSCALLS.get(), addrlen = SYSCALLS.get(); + // TODO: sock.saddr should never be undefined, see TODO in websocket_sock_ops.getname + var res = __write_sockaddr(addr, sock.family, DNS.lookup_name(sock.saddr || '0.0.0.0'), sock.sport); + assert(!res.errno); + return 0; + } + case 7: { // getpeername + var sock = getSocketFromFD(), addr = SYSCALLS.get(), addrlen = SYSCALLS.get(); + if (!sock.daddr) { + return -53; // The socket is not connected. + } + var res = __write_sockaddr(addr, sock.family, DNS.lookup_name(sock.daddr), sock.dport); + assert(!res.errno); + return 0; + } + case 11: { // sendto + var sock = getSocketFromFD(), message = SYSCALLS.get(), length = SYSCALLS.get(), flags = SYSCALLS.get(), dest = getSocketAddress(true); + if (!dest) { + // send, no address provided + return FS.write(sock.stream, HEAP8,message, length); + } else { + // sendto an address + return sock.sock_ops.sendmsg(sock, HEAP8,message, length, dest.addr, dest.port); + } + } + case 12: { // recvfrom + var sock = getSocketFromFD(), buf = SYSCALLS.get(), len = SYSCALLS.get(), flags = SYSCALLS.get(), addr = SYSCALLS.get(), addrlen = SYSCALLS.get(); + var msg = sock.sock_ops.recvmsg(sock, len); + if (!msg) return 0; // socket is closed + if (addr) { + var res = __write_sockaddr(addr, sock.family, DNS.lookup_name(msg.addr), msg.port); + assert(!res.errno); + } + HEAPU8.set(msg.buffer, buf); + return msg.buffer.byteLength; + } + case 14: { // setsockopt + return -50; // The option is unknown at the level indicated. + } + case 15: { // getsockopt + var sock = getSocketFromFD(), level = SYSCALLS.get(), optname = SYSCALLS.get(), optval = SYSCALLS.get(), optlen = SYSCALLS.get(); + // Minimal getsockopt aimed at resolving https://github.com/emscripten-core/emscripten/issues/2211 + // so only supports SOL_SOCKET with SO_ERROR. + if (level === 1) { + if (optname === 4) { + HEAP32[((optval)>>2)]=sock.error; + HEAP32[((optlen)>>2)]=4; + sock.error = null; // Clear the error (The SO_ERROR option obtains and then clears this field). + return 0; + } + } + return -50; // The option is unknown at the level indicated. + } + case 16: { // sendmsg + var sock = getSocketFromFD(), message = SYSCALLS.get(), flags = SYSCALLS.get(); + var iov = HEAP32[(((message)+(8))>>2)]; + var num = HEAP32[(((message)+(12))>>2)]; + // read the address and port to send to + var addr, port; + var name = HEAP32[((message)>>2)]; + var namelen = HEAP32[(((message)+(4))>>2)]; + if (name) { + var info = __read_sockaddr(name, namelen); + if (info.errno) return -info.errno; + port = info.port; + addr = DNS.lookup_addr(info.addr) || info.addr; + } + // concatenate scatter-gather arrays into one message buffer + var total = 0; + for (var i = 0; i < num; i++) { + total += HEAP32[(((iov)+((8 * i) + 4))>>2)]; + } + var view = new Uint8Array(total); + var offset = 0; + for (var i = 0; i < num; i++) { + var iovbase = HEAP32[(((iov)+((8 * i) + 0))>>2)]; + var iovlen = HEAP32[(((iov)+((8 * i) + 4))>>2)]; + for (var j = 0; j < iovlen; j++) { + view[offset++] = HEAP8[(((iovbase)+(j))>>0)]; + } + } + // write the buffer + return sock.sock_ops.sendmsg(sock, view, 0, total, addr, port); + } + case 17: { // recvmsg + var sock = getSocketFromFD(), message = SYSCALLS.get(), flags = SYSCALLS.get(); + var iov = HEAP32[(((message)+(8))>>2)]; + var num = HEAP32[(((message)+(12))>>2)]; + // get the total amount of data we can read across all arrays + var total = 0; + for (var i = 0; i < num; i++) { + total += HEAP32[(((iov)+((8 * i) + 4))>>2)]; + } + // try to read total data + var msg = sock.sock_ops.recvmsg(sock, total); + if (!msg) return 0; // socket is closed + + // TODO honor flags: + // MSG_OOB + // Requests out-of-band data. The significance and semantics of out-of-band data are protocol-specific. + // MSG_PEEK + // Peeks at the incoming message. + // MSG_WAITALL + // Requests that the function block until the full amount of data requested can be returned. The function may return a smaller amount of data if a signal is caught, if the connection is terminated, if MSG_PEEK was specified, or if an error is pending for the socket. + + // write the source address out + var name = HEAP32[((message)>>2)]; + if (name) { + var res = __write_sockaddr(name, sock.family, DNS.lookup_name(msg.addr), msg.port); + assert(!res.errno); + } + // write the buffer out to the scatter-gather arrays + var bytesRead = 0; + var bytesRemaining = msg.buffer.byteLength; + for (var i = 0; bytesRemaining > 0 && i < num; i++) { + var iovbase = HEAP32[(((iov)+((8 * i) + 0))>>2)]; + var iovlen = HEAP32[(((iov)+((8 * i) + 4))>>2)]; + if (!iovlen) { + continue; + } + var length = Math.min(iovlen, bytesRemaining); + var buf = msg.buffer.subarray(bytesRead, bytesRead + length); + HEAPU8.set(buf, iovbase + bytesRead); + bytesRead += length; + bytesRemaining -= length; + } + + // TODO set msghdr.msg_flags + // MSG_EOR + // End of record was received (if supported by the protocol). + // MSG_OOB + // Out-of-band data was received. + // MSG_TRUNC + // Normal data was truncated. + // MSG_CTRUNC + + return bytesRead; + } + default: { + return -52; // unsupported feature + } + } + } catch (e) { + if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); + return -e.errno; + } + } + + + function getShiftFromSize(size) { + switch (size) { + case 1: return 0; + case 2: return 1; + case 4: return 2; + case 8: return 3; + default: + throw new TypeError('Unknown type size: ' + size); + } + } + + + + function embind_init_charCodes() { + var codes = new Array(256); + for (var i = 0; i < 256; ++i) { + codes[i] = String.fromCharCode(i); + } + embind_charCodes = codes; + }var embind_charCodes=undefined;function readLatin1String(ptr) { + var ret = ""; + var c = ptr; + while (HEAPU8[c]) { + ret += embind_charCodes[HEAPU8[c++]]; + } + return ret; + } + + + var awaitingDependencies={}; + + var registeredTypes={}; + + var typeDependencies={}; + + + + + + + var char_0=48; + + var char_9=57;function makeLegalFunctionName(name) { + if (undefined === name) { + return '_unknown'; + } + name = name.replace(/[^a-zA-Z0-9_]/g, '$'); + var f = name.charCodeAt(0); + if (f >= char_0 && f <= char_9) { + return '_' + name; + } else { + return name; + } + }function createNamedFunction(name, body) { + name = makeLegalFunctionName(name); + /*jshint evil:true*/ + return new Function( + "body", + "return function " + name + "() {\n" + + " \"use strict\";" + + " return body.apply(this, arguments);\n" + + "};\n" + )(body); + }function extendError(baseErrorType, errorName) { + var errorClass = createNamedFunction(errorName, function(message) { + this.name = errorName; + this.message = message; + + var stack = (new Error(message)).stack; + if (stack !== undefined) { + this.stack = this.toString() + '\n' + + stack.replace(/^Error(:[^\n]*)?\n/, ''); + } + }); + errorClass.prototype = Object.create(baseErrorType.prototype); + errorClass.prototype.constructor = errorClass; + errorClass.prototype.toString = function() { + if (this.message === undefined) { + return this.name; + } else { + return this.name + ': ' + this.message; + } + }; + + return errorClass; + }var BindingError=undefined;function throwBindingError(message) { + throw new BindingError(message); + } + + + + var InternalError=undefined;function throwInternalError(message) { + throw new InternalError(message); + }function whenDependentTypesAreResolved(myTypes, dependentTypes, getTypeConverters) { + myTypes.forEach(function(type) { + typeDependencies[type] = dependentTypes; + }); + + function onComplete(typeConverters) { + var myTypeConverters = getTypeConverters(typeConverters); + if (myTypeConverters.length !== myTypes.length) { + throwInternalError('Mismatched type converter count'); + } + for (var i = 0; i < myTypes.length; ++i) { + registerType(myTypes[i], myTypeConverters[i]); + } + } + + var typeConverters = new Array(dependentTypes.length); + var unregisteredTypes = []; + var registered = 0; + dependentTypes.forEach(function(dt, i) { + if (registeredTypes.hasOwnProperty(dt)) { + typeConverters[i] = registeredTypes[dt]; + } else { + unregisteredTypes.push(dt); + if (!awaitingDependencies.hasOwnProperty(dt)) { + awaitingDependencies[dt] = []; + } + awaitingDependencies[dt].push(function() { + typeConverters[i] = registeredTypes[dt]; + ++registered; + if (registered === unregisteredTypes.length) { + onComplete(typeConverters); + } + }); + } + }); + if (0 === unregisteredTypes.length) { + onComplete(typeConverters); + } + }/** @param {Object=} options */ + function registerType(rawType, registeredInstance, options) { + options = options || {}; + + if (!('argPackAdvance' in registeredInstance)) { + throw new TypeError('registerType registeredInstance requires argPackAdvance'); + } + + var name = registeredInstance.name; + if (!rawType) { + throwBindingError('type "' + name + '" must have a positive integer typeid pointer'); + } + if (registeredTypes.hasOwnProperty(rawType)) { + if (options.ignoreDuplicateRegistrations) { + return; + } else { + throwBindingError("Cannot register type '" + name + "' twice"); + } + } + + registeredTypes[rawType] = registeredInstance; + delete typeDependencies[rawType]; + + if (awaitingDependencies.hasOwnProperty(rawType)) { + var callbacks = awaitingDependencies[rawType]; + delete awaitingDependencies[rawType]; + callbacks.forEach(function(cb) { + cb(); + }); + } + }function __embind_register_bool(rawType, name, size, trueValue, falseValue) { + var shift = getShiftFromSize(size); + + name = readLatin1String(name); + registerType(rawType, { + name: name, + 'fromWireType': function(wt) { + // ambiguous emscripten ABI: sometimes return values are + // true or false, and sometimes integers (0 or 1) + return !!wt; + }, + 'toWireType': function(destructors, o) { + return o ? trueValue : falseValue; + }, + 'argPackAdvance': 8, + 'readValueFromPointer': function(pointer) { + // TODO: if heap is fixed (like in asm.js) this could be executed outside + var heap; + if (size === 1) { + heap = HEAP8; + } else if (size === 2) { + heap = HEAP16; + } else if (size === 4) { + heap = HEAP32; + } else { + throw new TypeError("Unknown boolean type size: " + name); + } + return this['fromWireType'](heap[pointer >> shift]); + }, + destructorFunction: null, // This type does not need a destructor + }); + } + + + + var emval_free_list=[]; + + var emval_handle_array=[{},{value:undefined},{value:null},{value:true},{value:false}];function __emval_decref(handle) { + if (handle > 4 && 0 === --emval_handle_array[handle].refcount) { + emval_handle_array[handle] = undefined; + emval_free_list.push(handle); + } + } + + + + function count_emval_handles() { + var count = 0; + for (var i = 5; i < emval_handle_array.length; ++i) { + if (emval_handle_array[i] !== undefined) { + ++count; + } + } + return count; + } + + function get_first_emval() { + for (var i = 5; i < emval_handle_array.length; ++i) { + if (emval_handle_array[i] !== undefined) { + return emval_handle_array[i]; + } + } + return null; + }function init_emval() { + Module['count_emval_handles'] = count_emval_handles; + Module['get_first_emval'] = get_first_emval; + }function __emval_register(value) { + + switch(value){ + case undefined :{ return 1; } + case null :{ return 2; } + case true :{ return 3; } + case false :{ return 4; } + default:{ + var handle = emval_free_list.length ? + emval_free_list.pop() : + emval_handle_array.length; + + emval_handle_array[handle] = {refcount: 1, value: value}; + return handle; + } + } + } + + function simpleReadValueFromPointer(pointer) { + return this['fromWireType'](HEAPU32[pointer >> 2]); + }function __embind_register_emval(rawType, name) { + name = readLatin1String(name); + registerType(rawType, { + name: name, + 'fromWireType': function(handle) { + var rv = emval_handle_array[handle].value; + __emval_decref(handle); + return rv; + }, + 'toWireType': function(destructors, value) { + return __emval_register(value); + }, + 'argPackAdvance': 8, + 'readValueFromPointer': simpleReadValueFromPointer, + destructorFunction: null, // This type does not need a destructor + + // TODO: do we need a deleteObject here? write a test where + // emval is passed into JS via an interface + }); + } + + + function _embind_repr(v) { + if (v === null) { + return 'null'; + } + var t = typeof v; + if (t === 'object' || t === 'array' || t === 'function') { + return v.toString(); + } else { + return '' + v; + } + } + + function floatReadValueFromPointer(name, shift) { + switch (shift) { + case 2: return function(pointer) { + return this['fromWireType'](HEAPF32[pointer >> 2]); + }; + case 3: return function(pointer) { + return this['fromWireType'](HEAPF64[pointer >> 3]); + }; + default: + throw new TypeError("Unknown float type: " + name); + } + }function __embind_register_float(rawType, name, size) { + var shift = getShiftFromSize(size); + name = readLatin1String(name); + registerType(rawType, { + name: name, + 'fromWireType': function(value) { + return value; + }, + 'toWireType': function(destructors, value) { + // todo: Here we have an opportunity for -O3 level "unsafe" optimizations: we could + // avoid the following if() and assume value is of proper type. + if (typeof value !== "number" && typeof value !== "boolean") { + throw new TypeError('Cannot convert "' + _embind_repr(value) + '" to ' + this.name); + } + return value; + }, + 'argPackAdvance': 8, + 'readValueFromPointer': floatReadValueFromPointer(name, shift), + destructorFunction: null, // This type does not need a destructor + }); + } + + + + function new_(constructor, argumentList) { + if (!(constructor instanceof Function)) { + throw new TypeError('new_ called with constructor type ' + typeof(constructor) + " which is not a function"); + } + + /* + * Previously, the following line was just: + + function dummy() {}; + + * Unfortunately, Chrome was preserving 'dummy' as the object's name, even though at creation, the 'dummy' has the + * correct constructor name. Thus, objects created with IMVU.new would show up in the debugger as 'dummy', which + * isn't very helpful. Using IMVU.createNamedFunction addresses the issue. Doublely-unfortunately, there's no way + * to write a test for this behavior. -NRD 2013.02.22 + */ + var dummy = createNamedFunction(constructor.name || 'unknownFunctionName', function(){}); + dummy.prototype = constructor.prototype; + var obj = new dummy; + + var r = constructor.apply(obj, argumentList); + return (r instanceof Object) ? r : obj; + } + + function runDestructors(destructors) { + while (destructors.length) { + var ptr = destructors.pop(); + var del = destructors.pop(); + del(ptr); + } + }function craftInvokerFunction(humanName, argTypes, classType, cppInvokerFunc, cppTargetFunc) { + // humanName: a human-readable string name for the function to be generated. + // argTypes: An array that contains the embind type objects for all types in the function signature. + // argTypes[0] is the type object for the function return value. + // argTypes[1] is the type object for function this object/class type, or null if not crafting an invoker for a class method. + // argTypes[2...] are the actual function parameters. + // classType: The embind type object for the class to be bound, or null if this is not a method of a class. + // cppInvokerFunc: JS Function object to the C++-side function that interops into C++ code. + // cppTargetFunc: Function pointer (an integer to FUNCTION_TABLE) to the target C++ function the cppInvokerFunc will end up calling. + var argCount = argTypes.length; + + if (argCount < 2) { + throwBindingError("argTypes array size mismatch! Must at least get return value and 'this' types!"); + } + + var isClassMethodFunc = (argTypes[1] !== null && classType !== null); + + // Free functions with signature "void function()" do not need an invoker that marshalls between wire types. + // TODO: This omits argument count check - enable only at -O3 or similar. + // if (ENABLE_UNSAFE_OPTS && argCount == 2 && argTypes[0].name == "void" && !isClassMethodFunc) { + // return FUNCTION_TABLE[fn]; + // } + + + // Determine if we need to use a dynamic stack to store the destructors for the function parameters. + // TODO: Remove this completely once all function invokers are being dynamically generated. + var needsDestructorStack = false; + + for(var i = 1; i < argTypes.length; ++i) { // Skip return value at index 0 - it's not deleted here. + if (argTypes[i] !== null && argTypes[i].destructorFunction === undefined) { // The type does not define a destructor function - must use dynamic stack + needsDestructorStack = true; + break; + } + } + + var returns = (argTypes[0].name !== "void"); + + var argsList = ""; + var argsListWired = ""; + for(var i = 0; i < argCount - 2; ++i) { + argsList += (i!==0?", ":"")+"arg"+i; + argsListWired += (i!==0?", ":"")+"arg"+i+"Wired"; + } + + var invokerFnBody = + "return function "+makeLegalFunctionName(humanName)+"("+argsList+") {\n" + + "if (arguments.length !== "+(argCount - 2)+") {\n" + + "throwBindingError('function "+humanName+" called with ' + arguments.length + ' arguments, expected "+(argCount - 2)+" args!');\n" + + "}\n"; + + + if (needsDestructorStack) { + invokerFnBody += + "var destructors = [];\n"; + } + + var dtorStack = needsDestructorStack ? "destructors" : "null"; + var args1 = ["throwBindingError", "invoker", "fn", "runDestructors", "retType", "classParam"]; + var args2 = [throwBindingError, cppInvokerFunc, cppTargetFunc, runDestructors, argTypes[0], argTypes[1]]; + + + if (isClassMethodFunc) { + invokerFnBody += "var thisWired = classParam.toWireType("+dtorStack+", this);\n"; + } + + for(var i = 0; i < argCount - 2; ++i) { + invokerFnBody += "var arg"+i+"Wired = argType"+i+".toWireType("+dtorStack+", arg"+i+"); // "+argTypes[i+2].name+"\n"; + args1.push("argType"+i); + args2.push(argTypes[i+2]); + } + + if (isClassMethodFunc) { + argsListWired = "thisWired" + (argsListWired.length > 0 ? ", " : "") + argsListWired; + } + + invokerFnBody += + (returns?"var rv = ":"") + "invoker(fn"+(argsListWired.length>0?", ":"")+argsListWired+");\n"; + + if (needsDestructorStack) { + invokerFnBody += "runDestructors(destructors);\n"; + } else { + for(var i = isClassMethodFunc?1:2; i < argTypes.length; ++i) { // Skip return value at index 0 - it's not deleted here. Also skip class type if not a method. + var paramName = (i === 1 ? "thisWired" : ("arg"+(i - 2)+"Wired")); + if (argTypes[i].destructorFunction !== null) { + invokerFnBody += paramName+"_dtor("+paramName+"); // "+argTypes[i].name+"\n"; + args1.push(paramName+"_dtor"); + args2.push(argTypes[i].destructorFunction); + } + } + } + + if (returns) { + invokerFnBody += "var ret = retType.fromWireType(rv);\n" + + "return ret;\n"; + } else { + } + invokerFnBody += "}\n"; + + args1.push(invokerFnBody); + + var invokerFunction = new_(Function, args1).apply(null, args2); + return invokerFunction; + } + + + function ensureOverloadTable(proto, methodName, humanName) { + if (undefined === proto[methodName].overloadTable) { + var prevFunc = proto[methodName]; + // Inject an overload resolver function that routes to the appropriate overload based on the number of arguments. + proto[methodName] = function() { + // TODO This check can be removed in -O3 level "unsafe" optimizations. + if (!proto[methodName].overloadTable.hasOwnProperty(arguments.length)) { + throwBindingError("Function '" + humanName + "' called with an invalid number of arguments (" + arguments.length + ") - expects one of (" + proto[methodName].overloadTable + ")!"); + } + return proto[methodName].overloadTable[arguments.length].apply(this, arguments); + }; + // Move the previous function into the overload table. + proto[methodName].overloadTable = []; + proto[methodName].overloadTable[prevFunc.argCount] = prevFunc; + } + }/** @param {number=} numArguments */ + function exposePublicSymbol(name, value, numArguments) { + if (Module.hasOwnProperty(name)) { + if (undefined === numArguments || (undefined !== Module[name].overloadTable && undefined !== Module[name].overloadTable[numArguments])) { + throwBindingError("Cannot register public name '" + name + "' twice"); + } + + // We are exposing a function with the same name as an existing function. Create an overload table and a function selector + // that routes between the two. + ensureOverloadTable(Module, name, name); + if (Module.hasOwnProperty(numArguments)) { + throwBindingError("Cannot register multiple overloads of a function with the same number of arguments (" + numArguments + ")!"); + } + // Add the new function into the overload table. + Module[name].overloadTable[numArguments] = value; + } + else { + Module[name] = value; + if (undefined !== numArguments) { + Module[name].numArguments = numArguments; + } + } + } + + function heap32VectorToArray(count, firstElement) { + var array = []; + for (var i = 0; i < count; i++) { + array.push(HEAP32[(firstElement >> 2) + i]); + } + return array; + } + + /** @param {number=} numArguments */ + function replacePublicSymbol(name, value, numArguments) { + if (!Module.hasOwnProperty(name)) { + throwInternalError('Replacing nonexistant public symbol'); + } + // If there's an overload table for this symbol, replace the symbol in the overload table instead. + if (undefined !== Module[name].overloadTable && undefined !== numArguments) { + Module[name].overloadTable[numArguments] = value; + } + else { + Module[name] = value; + Module[name].argCount = numArguments; + } + } + + function embind__requireFunction(signature, rawFunction) { + signature = readLatin1String(signature); + + function makeDynCaller(dynCall) { + var args = []; + for (var i = 1; i < signature.length; ++i) { + args.push('a' + i); + } + + var name = 'dynCall_' + signature + '_' + rawFunction; + var body = 'return function ' + name + '(' + args.join(', ') + ') {\n'; + body += ' return dynCall(rawFunction' + (args.length ? ', ' : '') + args.join(', ') + ');\n'; + body += '};\n'; + + return (new Function('dynCall', 'rawFunction', body))(dynCall, rawFunction); + } + + var dc = Module['dynCall_' + signature]; + var fp = makeDynCaller(dc); + + if (typeof fp !== "function") { + throwBindingError("unknown function pointer with signature " + signature + ": " + rawFunction); + } + return fp; + } + + + var UnboundTypeError=undefined; + + function getTypeName(type) { + var ptr = ___getTypeName(type); + var rv = readLatin1String(ptr); + _free(ptr); + return rv; + }function throwUnboundTypeError(message, types) { + var unboundTypes = []; + var seen = {}; + function visit(type) { + if (seen[type]) { + return; + } + if (registeredTypes[type]) { + return; + } + if (typeDependencies[type]) { + typeDependencies[type].forEach(visit); + return; + } + unboundTypes.push(type); + seen[type] = true; + } + types.forEach(visit); + + throw new UnboundTypeError(message + ': ' + unboundTypes.map(getTypeName).join([', '])); + }function __embind_register_function(name, argCount, rawArgTypesAddr, signature, rawInvoker, fn) { + var argTypes = heap32VectorToArray(argCount, rawArgTypesAddr); + name = readLatin1String(name); + + rawInvoker = embind__requireFunction(signature, rawInvoker); + + exposePublicSymbol(name, function() { + throwUnboundTypeError('Cannot call ' + name + ' due to unbound types', argTypes); + }, argCount - 1); + + whenDependentTypesAreResolved([], argTypes, function(argTypes) { + var invokerArgsArray = [argTypes[0] /* return value */, null /* no class 'this'*/].concat(argTypes.slice(1) /* actual params */); + replacePublicSymbol(name, craftInvokerFunction(name, invokerArgsArray, null /* no class 'this'*/, rawInvoker, fn), argCount - 1); + return []; + }); + } + + + function integerReadValueFromPointer(name, shift, signed) { + // integers are quite common, so generate very specialized functions + switch (shift) { + case 0: return signed ? + function readS8FromPointer(pointer) { return HEAP8[pointer]; } : + function readU8FromPointer(pointer) { return HEAPU8[pointer]; }; + case 1: return signed ? + function readS16FromPointer(pointer) { return HEAP16[pointer >> 1]; } : + function readU16FromPointer(pointer) { return HEAPU16[pointer >> 1]; }; + case 2: return signed ? + function readS32FromPointer(pointer) { return HEAP32[pointer >> 2]; } : + function readU32FromPointer(pointer) { return HEAPU32[pointer >> 2]; }; + default: + throw new TypeError("Unknown integer type: " + name); + } + }function __embind_register_integer(primitiveType, name, size, minRange, maxRange) { + name = readLatin1String(name); + if (maxRange === -1) { // LLVM doesn't have signed and unsigned 32-bit types, so u32 literals come out as 'i32 -1'. Always treat those as max u32. + maxRange = 4294967295; + } + + var shift = getShiftFromSize(size); + + var fromWireType = function(value) { + return value; + }; + + if (minRange === 0) { + var bitshift = 32 - 8*size; + fromWireType = function(value) { + return (value << bitshift) >>> bitshift; + }; + } + + var isUnsignedType = (name.indexOf('unsigned') != -1); + + registerType(primitiveType, { + name: name, + 'fromWireType': fromWireType, + 'toWireType': function(destructors, value) { + // todo: Here we have an opportunity for -O3 level "unsafe" optimizations: we could + // avoid the following two if()s and assume value is of proper type. + if (typeof value !== "number" && typeof value !== "boolean") { + throw new TypeError('Cannot convert "' + _embind_repr(value) + '" to ' + this.name); + } + if (value < minRange || value > maxRange) { + throw new TypeError('Passing a number "' + _embind_repr(value) + '" from JS side to C/C++ side to an argument of type "' + name + '", which is outside the valid range [' + minRange + ', ' + maxRange + ']!'); + } + return isUnsignedType ? (value >>> 0) : (value | 0); + }, + 'argPackAdvance': 8, + 'readValueFromPointer': integerReadValueFromPointer(name, shift, minRange !== 0), + destructorFunction: null, // This type does not need a destructor + }); + } + + function __embind_register_memory_view(rawType, dataTypeIndex, name) { + var typeMapping = [ + Int8Array, + Uint8Array, + Int16Array, + Uint16Array, + Int32Array, + Uint32Array, + Float32Array, + Float64Array, + ]; + + var TA = typeMapping[dataTypeIndex]; + + function decodeMemoryView(handle) { + handle = handle >> 2; + var heap = HEAPU32; + var size = heap[handle]; // in elements + var data = heap[handle + 1]; // byte offset into emscripten heap + return new TA(buffer, data, size); + } + + name = readLatin1String(name); + registerType(rawType, { + name: name, + 'fromWireType': decodeMemoryView, + 'argPackAdvance': 8, + 'readValueFromPointer': decodeMemoryView, + }, { + ignoreDuplicateRegistrations: true, + }); + } + + function __embind_register_std_string(rawType, name) { + name = readLatin1String(name); + var stdStringIsUTF8 + //process only std::string bindings with UTF8 support, in contrast to e.g. std::basic_string<unsigned char> + = (name === "std::string"); + + registerType(rawType, { + name: name, + 'fromWireType': function(value) { + var length = HEAPU32[value >> 2]; + + var str; + if (stdStringIsUTF8) { + var decodeStartPtr = value + 4; + // Looping here to support possible embedded '0' bytes + for (var i = 0; i <= length; ++i) { + var currentBytePtr = value + 4 + i; + if (i == length || HEAPU8[currentBytePtr] == 0) { + var maxRead = currentBytePtr - decodeStartPtr; + var stringSegment = UTF8ToString(decodeStartPtr, maxRead); + if (str === undefined) { + str = stringSegment; + } else { + str += String.fromCharCode(0); + str += stringSegment; + } + decodeStartPtr = currentBytePtr + 1; + } + } + } else { + var a = new Array(length); + for (var i = 0; i < length; ++i) { + a[i] = String.fromCharCode(HEAPU8[value + 4 + i]); + } + str = a.join(''); + } + + _free(value); + + return str; + }, + 'toWireType': function(destructors, value) { + if (value instanceof ArrayBuffer) { + value = new Uint8Array(value); + } + + var getLength; + var valueIsOfTypeString = (typeof value === 'string'); + + if (!(valueIsOfTypeString || value instanceof Uint8Array || value instanceof Uint8ClampedArray || value instanceof Int8Array)) { + throwBindingError('Cannot pass non-string to std::string'); + } + if (stdStringIsUTF8 && valueIsOfTypeString) { + getLength = function() {return lengthBytesUTF8(value);}; + } else { + getLength = function() {return value.length;}; + } + + // assumes 4-byte alignment + var length = getLength(); + var ptr = _malloc(4 + length + 1); + HEAPU32[ptr >> 2] = length; + if (stdStringIsUTF8 && valueIsOfTypeString) { + stringToUTF8(value, ptr + 4, length + 1); + } else { + if (valueIsOfTypeString) { + for (var i = 0; i < length; ++i) { + var charCode = value.charCodeAt(i); + if (charCode > 255) { + _free(ptr); + throwBindingError('String has UTF-16 code units that do not fit in 8 bits'); + } + HEAPU8[ptr + 4 + i] = charCode; + } + } else { + for (var i = 0; i < length; ++i) { + HEAPU8[ptr + 4 + i] = value[i]; + } + } + } + + if (destructors !== null) { + destructors.push(_free, ptr); + } + return ptr; + }, + 'argPackAdvance': 8, + 'readValueFromPointer': simpleReadValueFromPointer, + destructorFunction: function(ptr) { _free(ptr); }, + }); + } + + function __embind_register_std_wstring(rawType, charSize, name) { + name = readLatin1String(name); + var decodeString, encodeString, getHeap, lengthBytesUTF, shift; + if (charSize === 2) { + decodeString = UTF16ToString; + encodeString = stringToUTF16; + lengthBytesUTF = lengthBytesUTF16; + getHeap = function() { return HEAPU16; }; + shift = 1; + } else if (charSize === 4) { + decodeString = UTF32ToString; + encodeString = stringToUTF32; + lengthBytesUTF = lengthBytesUTF32; + getHeap = function() { return HEAPU32; }; + shift = 2; + } + registerType(rawType, { + name: name, + 'fromWireType': function(value) { + // Code mostly taken from _embind_register_std_string fromWireType + var length = HEAPU32[value >> 2]; + var HEAP = getHeap(); + var str; + + var decodeStartPtr = value + 4; + // Looping here to support possible embedded '0' bytes + for (var i = 0; i <= length; ++i) { + var currentBytePtr = value + 4 + i * charSize; + if (i == length || HEAP[currentBytePtr >> shift] == 0) { + var maxReadBytes = currentBytePtr - decodeStartPtr; + var stringSegment = decodeString(decodeStartPtr, maxReadBytes); + if (str === undefined) { + str = stringSegment; + } else { + str += String.fromCharCode(0); + str += stringSegment; + } + decodeStartPtr = currentBytePtr + charSize; + } + } + + _free(value); + + return str; + }, + 'toWireType': function(destructors, value) { + if (!(typeof value === 'string')) { + throwBindingError('Cannot pass non-string to C++ string type ' + name); + } + + // assumes 4-byte alignment + var length = lengthBytesUTF(value); + var ptr = _malloc(4 + length + charSize); + HEAPU32[ptr >> 2] = length >> shift; + + encodeString(value, ptr + 4, length + charSize); + + if (destructors !== null) { + destructors.push(_free, ptr); + } + return ptr; + }, + 'argPackAdvance': 8, + 'readValueFromPointer': simpleReadValueFromPointer, + destructorFunction: function(ptr) { _free(ptr); }, + }); + } + + function __embind_register_void(rawType, name) { + name = readLatin1String(name); + registerType(rawType, { + isVoid: true, // void return values can be optimized out sometimes + name: name, + 'argPackAdvance': 0, + 'fromWireType': function() { + return undefined; + }, + 'toWireType': function(destructors, o) { + // TODO: assert if anything else is given? + return undefined; + }, + }); + } + + + function requireHandle(handle) { + if (!handle) { + throwBindingError('Cannot use deleted val. handle = ' + handle); + } + return emval_handle_array[handle].value; + } + + function requireRegisteredType(rawType, humanName) { + var impl = registeredTypes[rawType]; + if (undefined === impl) { + throwBindingError(humanName + " has unknown type " + getTypeName(rawType)); + } + return impl; + }function __emval_as(handle, returnType, destructorsRef) { + handle = requireHandle(handle); + returnType = requireRegisteredType(returnType, 'emval::as'); + var destructors = []; + var rd = __emval_register(destructors); + HEAP32[destructorsRef >> 2] = rd; + return returnType['toWireType'](destructors, handle); + } + + + function __emval_allocateDestructors(destructorsRef) { + var destructors = []; + HEAP32[destructorsRef >> 2] = __emval_register(destructors); + return destructors; + } + + + var emval_symbols={};function getStringOrSymbol(address) { + var symbol = emval_symbols[address]; + if (symbol === undefined) { + return readLatin1String(address); + } else { + return symbol; + } + } + + var emval_methodCallers=[];function __emval_call_method(caller, handle, methodName, destructorsRef, args) { + caller = emval_methodCallers[caller]; + handle = requireHandle(handle); + methodName = getStringOrSymbol(methodName); + return caller(handle, methodName, __emval_allocateDestructors(destructorsRef), args); + } + + function __emval_call_void_method(caller, handle, methodName, args) { + caller = emval_methodCallers[caller]; + handle = requireHandle(handle); + methodName = getStringOrSymbol(methodName); + caller(handle, methodName, null, args); + } + + + + function emval_get_global() { + if (typeof globalThis === 'object') { + return globalThis; + } + return (function(){ + return Function; + })()('return this')(); + }function __emval_get_global(name) { + if(name===0){ + return __emval_register(emval_get_global()); + } else { + name = getStringOrSymbol(name); + return __emval_register(emval_get_global()[name]); + } + } + + + function __emval_addMethodCaller(caller) { + var id = emval_methodCallers.length; + emval_methodCallers.push(caller); + return id; + } + + function __emval_lookupTypes(argCount, argTypes) { + var a = new Array(argCount); + for (var i = 0; i < argCount; ++i) { + a[i] = requireRegisteredType( + HEAP32[(argTypes >> 2) + i], + "parameter " + i); + } + return a; + }function __emval_get_method_caller(argCount, argTypes) { + var types = __emval_lookupTypes(argCount, argTypes); + + var retType = types[0]; + var signatureName = retType.name + "_$" + types.slice(1).map(function (t) { return t.name; }).join("_") + "$"; + + var params = ["retType"]; + var args = [retType]; + + var argsList = ""; // 'arg0, arg1, arg2, ... , argN' + for (var i = 0; i < argCount - 1; ++i) { + argsList += (i !== 0 ? ", " : "") + "arg" + i; + params.push("argType" + i); + args.push(types[1 + i]); + } + + var functionName = makeLegalFunctionName("methodCaller_" + signatureName); + var functionBody = + "return function " + functionName + "(handle, name, destructors, args) {\n"; + + var offset = 0; + for (var i = 0; i < argCount - 1; ++i) { + functionBody += + " var arg" + i + " = argType" + i + ".readValueFromPointer(args" + (offset ? ("+"+offset) : "") + ");\n"; + offset += types[i + 1]['argPackAdvance']; + } + functionBody += + " var rv = handle[name](" + argsList + ");\n"; + for (var i = 0; i < argCount - 1; ++i) { + if (types[i + 1]['deleteObject']) { + functionBody += + " argType" + i + ".deleteObject(arg" + i + ");\n"; + } + } + if (!retType.isVoid) { + functionBody += + " return retType.toWireType(destructors, rv);\n"; + } + functionBody += + "};\n"; + + params.push(functionBody); + var invokerFunction = new_(Function, params).apply(null, args); + return __emval_addMethodCaller(invokerFunction); + } + + function __emval_get_property(handle, key) { + handle = requireHandle(handle); + key = requireHandle(key); + return __emval_register(handle[key]); + } + + function __emval_new_cstring(v) { + return __emval_register(getStringOrSymbol(v)); + } + + function __emval_run_destructors(handle) { + var destructors = emval_handle_array[handle].value; + runDestructors(destructors); + __emval_decref(handle); + } + + function _abort() { + abort(); + } + + + var _emscripten_get_now;if (ENVIRONMENT_IS_NODE) { + _emscripten_get_now = function() { + var t = process['hrtime'](); + return t[0] * 1e3 + t[1] / 1e6; + }; + } else if (typeof dateNow !== 'undefined') { + _emscripten_get_now = dateNow; + } else _emscripten_get_now = function() { return performance.now(); } + ; + + var _emscripten_get_now_is_monotonic=true;;function _clock_gettime(clk_id, tp) { + // int clock_gettime(clockid_t clk_id, struct timespec *tp); + var now; + if (clk_id === 0) { + now = Date.now(); + } else if ((clk_id === 1 || clk_id === 4) && _emscripten_get_now_is_monotonic) { + now = _emscripten_get_now(); + } else { + setErrNo(28); + return -1; + } + HEAP32[((tp)>>2)]=(now/1000)|0; // seconds + HEAP32[(((tp)+(4))>>2)]=((now % 1000)*1000*1000)|0; // nanoseconds + return 0; + } + + function _dlclose(handle) { + abort("To use dlopen, you need to use Emscripten's linking support, see https://github.com/emscripten-core/emscripten/wiki/Linking"); + } + + + + + + function _emscripten_set_main_loop_timing(mode, value) { + Browser.mainLoop.timingMode = mode; + Browser.mainLoop.timingValue = value; + + if (!Browser.mainLoop.func) { + console.error('emscripten_set_main_loop_timing: Cannot set timing mode for main loop since a main loop does not exist! Call emscripten_set_main_loop first to set one up.'); + return 1; // Return non-zero on failure, can't set timing mode when there is no main loop. + } + + if (mode == 0 /*EM_TIMING_SETTIMEOUT*/) { + Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setTimeout() { + var timeUntilNextTick = Math.max(0, Browser.mainLoop.tickStartTime + value - _emscripten_get_now())|0; + setTimeout(Browser.mainLoop.runner, timeUntilNextTick); // doing this each time means that on exception, we stop + }; + Browser.mainLoop.method = 'timeout'; + } else if (mode == 1 /*EM_TIMING_RAF*/) { + Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_rAF() { + Browser.requestAnimationFrame(Browser.mainLoop.runner); + }; + Browser.mainLoop.method = 'rAF'; + } else if (mode == 2 /*EM_TIMING_SETIMMEDIATE*/) { + if (typeof setImmediate === 'undefined') { + // Emulate setImmediate. (note: not a complete polyfill, we don't emulate clearImmediate() to keep code size to minimum, since not needed) + var setImmediates = []; + var emscriptenMainLoopMessageId = 'setimmediate'; + var Browser_setImmediate_messageHandler = function(event) { + // When called in current thread or Worker, the main loop ID is structured slightly different to accommodate for --proxy-to-worker runtime listening to Worker events, + // so check for both cases. + if (event.data === emscriptenMainLoopMessageId || event.data.target === emscriptenMainLoopMessageId) { + event.stopPropagation(); + setImmediates.shift()(); + } + } + addEventListener("message", Browser_setImmediate_messageHandler, true); + setImmediate = /** @type{function(function(): ?, ...?): number} */(function Browser_emulated_setImmediate(func) { + setImmediates.push(func); + if (ENVIRONMENT_IS_WORKER) { + if (Module['setImmediates'] === undefined) Module['setImmediates'] = []; + Module['setImmediates'].push(func); + postMessage({target: emscriptenMainLoopMessageId}); // In --proxy-to-worker, route the message via proxyClient.js + } else postMessage(emscriptenMainLoopMessageId, "*"); // On the main thread, can just send the message to itself. + }) + } + Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setImmediate() { + setImmediate(Browser.mainLoop.runner); + }; + Browser.mainLoop.method = 'immediate'; + } + return 0; + }/** @param {number|boolean=} noSetTiming */ + function _emscripten_set_main_loop(func, fps, simulateInfiniteLoop, arg, noSetTiming) { + noExitRuntime = true; + + assert(!Browser.mainLoop.func, 'emscripten_set_main_loop: there can only be one main loop function at once: call emscripten_cancel_main_loop to cancel the previous one before setting a new one with different parameters.'); + + Browser.mainLoop.func = func; + Browser.mainLoop.arg = arg; + + var browserIterationFunc; + if (typeof arg !== 'undefined') { + browserIterationFunc = function() { + Module['dynCall_vi'](func, arg); + }; + } else { + browserIterationFunc = function() { + Module['dynCall_v'](func); + }; + } + + var thisMainLoopId = Browser.mainLoop.currentlyRunningMainloop; + + Browser.mainLoop.runner = function Browser_mainLoop_runner() { + if (ABORT) return; + if (Browser.mainLoop.queue.length > 0) { + var start = Date.now(); + var blocker = Browser.mainLoop.queue.shift(); + blocker.func(blocker.arg); + if (Browser.mainLoop.remainingBlockers) { + var remaining = Browser.mainLoop.remainingBlockers; + var next = remaining%1 == 0 ? remaining-1 : Math.floor(remaining); + if (blocker.counted) { + Browser.mainLoop.remainingBlockers = next; + } else { + // not counted, but move the progress along a tiny bit + next = next + 0.5; // do not steal all the next one's progress + Browser.mainLoop.remainingBlockers = (8*remaining + next)/9; + } + } + console.log('main loop blocker "' + blocker.name + '" took ' + (Date.now() - start) + ' ms'); //, left: ' + Browser.mainLoop.remainingBlockers); + Browser.mainLoop.updateStatus(); + + // catches pause/resume main loop from blocker execution + if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return; + + setTimeout(Browser.mainLoop.runner, 0); + return; + } + + // catch pauses from non-main loop sources + if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return; + + // Implement very basic swap interval control + Browser.mainLoop.currentFrameNumber = Browser.mainLoop.currentFrameNumber + 1 | 0; + if (Browser.mainLoop.timingMode == 1/*EM_TIMING_RAF*/ && Browser.mainLoop.timingValue > 1 && Browser.mainLoop.currentFrameNumber % Browser.mainLoop.timingValue != 0) { + // Not the scheduled time to render this frame - skip. + Browser.mainLoop.scheduler(); + return; + } else if (Browser.mainLoop.timingMode == 0/*EM_TIMING_SETTIMEOUT*/) { + Browser.mainLoop.tickStartTime = _emscripten_get_now(); + } + + // Signal GL rendering layer that processing of a new frame is about to start. This helps it optimize + // VBO double-buffering and reduce GPU stalls. + + + + if (Browser.mainLoop.method === 'timeout' && Module.ctx) { + warnOnce('Looks like you are rendering without using requestAnimationFrame for the main loop. You should use 0 for the frame rate in emscripten_set_main_loop in order to use requestAnimationFrame, as that can greatly improve your frame rates!'); + Browser.mainLoop.method = ''; // just warn once per call to set main loop + } + + Browser.mainLoop.runIter(browserIterationFunc); + + checkStackCookie(); + + // catch pauses from the main loop itself + if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return; + + // Queue new audio data. This is important to be right after the main loop invocation, so that we will immediately be able + // to queue the newest produced audio samples. + // TODO: Consider adding pre- and post- rAF callbacks so that GL.newRenderingFrameStarted() and SDL.audio.queueNewAudioData() + // do not need to be hardcoded into this function, but can be more generic. + if (typeof SDL === 'object' && SDL.audio && SDL.audio.queueNewAudioData) SDL.audio.queueNewAudioData(); + + Browser.mainLoop.scheduler(); + } + + if (!noSetTiming) { + if (fps && fps > 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 1000.0 / fps); + else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, 1); // Do rAF by rendering each frame (no decimating) + + Browser.mainLoop.scheduler(); + } + + if (simulateInfiniteLoop) { + throw 'unwind'; + } + }var Browser={mainLoop:{scheduler:null,method:"",currentlyRunningMainloop:0,func:null,arg:0,timingMode:0,timingValue:0,currentFrameNumber:0,queue:[],pause:function() { + Browser.mainLoop.scheduler = null; + Browser.mainLoop.currentlyRunningMainloop++; // Incrementing this signals the previous main loop that it's now become old, and it must return. + },resume:function() { + Browser.mainLoop.currentlyRunningMainloop++; + var timingMode = Browser.mainLoop.timingMode; + var timingValue = Browser.mainLoop.timingValue; + var func = Browser.mainLoop.func; + Browser.mainLoop.func = null; + _emscripten_set_main_loop(func, 0, false, Browser.mainLoop.arg, true /* do not set timing and call scheduler, we will do it on the next lines */); + _emscripten_set_main_loop_timing(timingMode, timingValue); + Browser.mainLoop.scheduler(); + },updateStatus:function() { + if (Module['setStatus']) { + var message = Module['statusMessage'] || 'Please wait...'; + var remaining = Browser.mainLoop.remainingBlockers; + var expected = Browser.mainLoop.expectedBlockers; + if (remaining) { + if (remaining < expected) { + Module['setStatus'](message + ' (' + (expected - remaining) + '/' + expected + ')'); + } else { + Module['setStatus'](message); + } + } else { + Module['setStatus'](''); + } + } + },runIter:function(func) { + if (ABORT) return; + if (Module['preMainLoop']) { + var preRet = Module['preMainLoop'](); + if (preRet === false) { + return; // |return false| skips a frame + } + } + try { + func(); + } catch (e) { + if (e instanceof ExitStatus) { + return; + } else { + if (e && typeof e === 'object' && e.stack) err('exception thrown: ' + [e, e.stack]); + throw e; + } + } + if (Module['postMainLoop']) Module['postMainLoop'](); + }},isFullscreen:false,pointerLock:false,moduleContextCreatedCallbacks:[],workers:[],init:function() { + if (!Module["preloadPlugins"]) Module["preloadPlugins"] = []; // needs to exist even in workers + + if (Browser.initted) return; + Browser.initted = true; + + try { + new Blob(); + Browser.hasBlobConstructor = true; + } catch(e) { + Browser.hasBlobConstructor = false; + console.log("warning: no blob constructor, cannot create blobs with mimetypes"); + } + Browser.BlobBuilder = typeof MozBlobBuilder != "undefined" ? MozBlobBuilder : (typeof WebKitBlobBuilder != "undefined" ? WebKitBlobBuilder : (!Browser.hasBlobConstructor ? console.log("warning: no BlobBuilder") : null)); + Browser.URLObject = typeof window != "undefined" ? (window.URL ? window.URL : window.webkitURL) : undefined; + if (!Module.noImageDecoding && typeof Browser.URLObject === 'undefined') { + console.log("warning: Browser does not support creating object URLs. Built-in browser image decoding will not be available."); + Module.noImageDecoding = true; + } + + // Support for plugins that can process preloaded files. You can add more of these to + // your app by creating and appending to Module.preloadPlugins. + // + // Each plugin is asked if it can handle a file based on the file's name. If it can, + // it is given the file's raw data. When it is done, it calls a callback with the file's + // (possibly modified) data. For example, a plugin might decompress a file, or it + // might create some side data structure for use later (like an Image element, etc.). + + var imagePlugin = {}; + imagePlugin['canHandle'] = function imagePlugin_canHandle(name) { + return !Module.noImageDecoding && /\.(jpg|jpeg|png|bmp)$/i.test(name); + }; + imagePlugin['handle'] = function imagePlugin_handle(byteArray, name, onload, onerror) { + var b = null; + if (Browser.hasBlobConstructor) { + try { + b = new Blob([byteArray], { type: Browser.getMimetype(name) }); + if (b.size !== byteArray.length) { // Safari bug #118630 + // Safari's Blob can only take an ArrayBuffer + b = new Blob([(new Uint8Array(byteArray)).buffer], { type: Browser.getMimetype(name) }); + } + } catch(e) { + warnOnce('Blob constructor present but fails: ' + e + '; falling back to blob builder'); + } + } + if (!b) { + var bb = new Browser.BlobBuilder(); + bb.append((new Uint8Array(byteArray)).buffer); // we need to pass a buffer, and must copy the array to get the right data range + b = bb.getBlob(); + } + var url = Browser.URLObject.createObjectURL(b); + assert(typeof url == 'string', 'createObjectURL must return a url as a string'); + var img = new Image(); + img.onload = function img_onload() { + assert(img.complete, 'Image ' + name + ' could not be decoded'); + var canvas = document.createElement('canvas'); + canvas.width = img.width; + canvas.height = img.height; + var ctx = canvas.getContext('2d'); + ctx.drawImage(img, 0, 0); + Module["preloadedImages"][name] = canvas; + Browser.URLObject.revokeObjectURL(url); + if (onload) onload(byteArray); + }; + img.onerror = function img_onerror(event) { + console.log('Image ' + url + ' could not be decoded'); + if (onerror) onerror(); + }; + img.src = url; + }; + Module['preloadPlugins'].push(imagePlugin); + + var audioPlugin = {}; + audioPlugin['canHandle'] = function audioPlugin_canHandle(name) { + return !Module.noAudioDecoding && name.substr(-4) in { '.ogg': 1, '.wav': 1, '.mp3': 1 }; + }; + audioPlugin['handle'] = function audioPlugin_handle(byteArray, name, onload, onerror) { + var done = false; + function finish(audio) { + if (done) return; + done = true; + Module["preloadedAudios"][name] = audio; + if (onload) onload(byteArray); + } + function fail() { + if (done) return; + done = true; + Module["preloadedAudios"][name] = new Audio(); // empty shim + if (onerror) onerror(); + } + if (Browser.hasBlobConstructor) { + try { + var b = new Blob([byteArray], { type: Browser.getMimetype(name) }); + } catch(e) { + return fail(); + } + var url = Browser.URLObject.createObjectURL(b); // XXX we never revoke this! + assert(typeof url == 'string', 'createObjectURL must return a url as a string'); + var audio = new Audio(); + audio.addEventListener('canplaythrough', function() { finish(audio) }, false); // use addEventListener due to chromium bug 124926 + audio.onerror = function audio_onerror(event) { + if (done) return; + console.log('warning: browser could not fully decode audio ' + name + ', trying slower base64 approach'); + function encode64(data) { + var BASE = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'; + var PAD = '='; + var ret = ''; + var leftchar = 0; + var leftbits = 0; + for (var i = 0; i < data.length; i++) { + leftchar = (leftchar << 8) | data[i]; + leftbits += 8; + while (leftbits >= 6) { + var curr = (leftchar >> (leftbits-6)) & 0x3f; + leftbits -= 6; + ret += BASE[curr]; + } + } + if (leftbits == 2) { + ret += BASE[(leftchar&3) << 4]; + ret += PAD + PAD; + } else if (leftbits == 4) { + ret += BASE[(leftchar&0xf) << 2]; + ret += PAD; + } + return ret; + } + audio.src = 'data:audio/x-' + name.substr(-3) + ';base64,' + encode64(byteArray); + finish(audio); // we don't wait for confirmation this worked - but it's worth trying + }; + audio.src = url; + // workaround for chrome bug 124926 - we do not always get oncanplaythrough or onerror + Browser.safeSetTimeout(function() { + finish(audio); // try to use it even though it is not necessarily ready to play + }, 10000); + } else { + return fail(); + } + }; + Module['preloadPlugins'].push(audioPlugin); + + + // Canvas event setup + + function pointerLockChange() { + Browser.pointerLock = document['pointerLockElement'] === Module['canvas'] || + document['mozPointerLockElement'] === Module['canvas'] || + document['webkitPointerLockElement'] === Module['canvas'] || + document['msPointerLockElement'] === Module['canvas']; + } + var canvas = Module['canvas']; + if (canvas) { + // forced aspect ratio can be enabled by defining 'forcedAspectRatio' on Module + // Module['forcedAspectRatio'] = 4 / 3; + + canvas.requestPointerLock = canvas['requestPointerLock'] || + canvas['mozRequestPointerLock'] || + canvas['webkitRequestPointerLock'] || + canvas['msRequestPointerLock'] || + function(){}; + canvas.exitPointerLock = document['exitPointerLock'] || + document['mozExitPointerLock'] || + document['webkitExitPointerLock'] || + document['msExitPointerLock'] || + function(){}; // no-op if function does not exist + canvas.exitPointerLock = canvas.exitPointerLock.bind(document); + + document.addEventListener('pointerlockchange', pointerLockChange, false); + document.addEventListener('mozpointerlockchange', pointerLockChange, false); + document.addEventListener('webkitpointerlockchange', pointerLockChange, false); + document.addEventListener('mspointerlockchange', pointerLockChange, false); + + if (Module['elementPointerLock']) { + canvas.addEventListener("click", function(ev) { + if (!Browser.pointerLock && Module['canvas'].requestPointerLock) { + Module['canvas'].requestPointerLock(); + ev.preventDefault(); + } + }, false); + } + } + },createContext:function(canvas, useWebGL, setInModule, webGLContextAttributes) { + if (useWebGL && Module.ctx && canvas == Module.canvas) return Module.ctx; // no need to recreate GL context if it's already been created for this canvas. + + var ctx; + var contextHandle; + if (useWebGL) { + // For GLES2/desktop GL compatibility, adjust a few defaults to be different to WebGL defaults, so that they align better with the desktop defaults. + var contextAttributes = { + antialias: false, + alpha: false, + majorVersion: 1, + }; + + if (webGLContextAttributes) { + for (var attribute in webGLContextAttributes) { + contextAttributes[attribute] = webGLContextAttributes[attribute]; + } + } + + // This check of existence of GL is here to satisfy Closure compiler, which yells if variable GL is referenced below but GL object is not + // actually compiled in because application is not doing any GL operations. TODO: Ideally if GL is not being used, this function + // Browser.createContext() should not even be emitted. + if (typeof GL !== 'undefined') { + contextHandle = GL.createContext(canvas, contextAttributes); + if (contextHandle) { + ctx = GL.getContext(contextHandle).GLctx; + } + } + } else { + ctx = canvas.getContext('2d'); + } + + if (!ctx) return null; + + if (setInModule) { + if (!useWebGL) assert(typeof GLctx === 'undefined', 'cannot set in module if GLctx is used, but we are a non-GL context that would replace it'); + + Module.ctx = ctx; + if (useWebGL) GL.makeContextCurrent(contextHandle); + Module.useWebGL = useWebGL; + Browser.moduleContextCreatedCallbacks.forEach(function(callback) { callback() }); + Browser.init(); + } + return ctx; + },destroyContext:function(canvas, useWebGL, setInModule) {},fullscreenHandlersInstalled:false,lockPointer:undefined,resizeCanvas:undefined,requestFullscreen:function(lockPointer, resizeCanvas) { + Browser.lockPointer = lockPointer; + Browser.resizeCanvas = resizeCanvas; + if (typeof Browser.lockPointer === 'undefined') Browser.lockPointer = true; + if (typeof Browser.resizeCanvas === 'undefined') Browser.resizeCanvas = false; + + var canvas = Module['canvas']; + function fullscreenChange() { + Browser.isFullscreen = false; + var canvasContainer = canvas.parentNode; + if ((document['fullscreenElement'] || document['mozFullScreenElement'] || + document['msFullscreenElement'] || document['webkitFullscreenElement'] || + document['webkitCurrentFullScreenElement']) === canvasContainer) { + canvas.exitFullscreen = Browser.exitFullscreen; + if (Browser.lockPointer) canvas.requestPointerLock(); + Browser.isFullscreen = true; + if (Browser.resizeCanvas) { + Browser.setFullscreenCanvasSize(); + } else { + Browser.updateCanvasDimensions(canvas); + } + } else { + // remove the full screen specific parent of the canvas again to restore the HTML structure from before going full screen + canvasContainer.parentNode.insertBefore(canvas, canvasContainer); + canvasContainer.parentNode.removeChild(canvasContainer); + + if (Browser.resizeCanvas) { + Browser.setWindowedCanvasSize(); + } else { + Browser.updateCanvasDimensions(canvas); + } + } + if (Module['onFullScreen']) Module['onFullScreen'](Browser.isFullscreen); + if (Module['onFullscreen']) Module['onFullscreen'](Browser.isFullscreen); + } + + if (!Browser.fullscreenHandlersInstalled) { + Browser.fullscreenHandlersInstalled = true; + document.addEventListener('fullscreenchange', fullscreenChange, false); + document.addEventListener('mozfullscreenchange', fullscreenChange, false); + document.addEventListener('webkitfullscreenchange', fullscreenChange, false); + document.addEventListener('MSFullscreenChange', fullscreenChange, false); + } + + // create a new parent to ensure the canvas has no siblings. this allows browsers to optimize full screen performance when its parent is the full screen root + var canvasContainer = document.createElement("div"); + canvas.parentNode.insertBefore(canvasContainer, canvas); + canvasContainer.appendChild(canvas); + + // use parent of canvas as full screen root to allow aspect ratio correction (Firefox stretches the root to screen size) + canvasContainer.requestFullscreen = canvasContainer['requestFullscreen'] || + canvasContainer['mozRequestFullScreen'] || + canvasContainer['msRequestFullscreen'] || + (canvasContainer['webkitRequestFullscreen'] ? function() { canvasContainer['webkitRequestFullscreen'](Element['ALLOW_KEYBOARD_INPUT']) } : null) || + (canvasContainer['webkitRequestFullScreen'] ? function() { canvasContainer['webkitRequestFullScreen'](Element['ALLOW_KEYBOARD_INPUT']) } : null); + + canvasContainer.requestFullscreen(); + },requestFullScreen:function() { + abort('Module.requestFullScreen has been replaced by Module.requestFullscreen (without a capital S)'); + },exitFullscreen:function() { + // This is workaround for chrome. Trying to exit from fullscreen + // not in fullscreen state will cause "TypeError: Document not active" + // in chrome. See https://github.com/emscripten-core/emscripten/pull/8236 + if (!Browser.isFullscreen) { + return false; + } + + var CFS = document['exitFullscreen'] || + document['cancelFullScreen'] || + document['mozCancelFullScreen'] || + document['msExitFullscreen'] || + document['webkitCancelFullScreen'] || + (function() {}); + CFS.apply(document, []); + return true; + },nextRAF:0,fakeRequestAnimationFrame:function(func) { + // try to keep 60fps between calls to here + var now = Date.now(); + if (Browser.nextRAF === 0) { + Browser.nextRAF = now + 1000/60; + } else { + while (now + 2 >= Browser.nextRAF) { // fudge a little, to avoid timer jitter causing us to do lots of delay:0 + Browser.nextRAF += 1000/60; + } + } + var delay = Math.max(Browser.nextRAF - now, 0); + setTimeout(func, delay); + },requestAnimationFrame:function(func) { + if (typeof requestAnimationFrame === 'function') { + requestAnimationFrame(func); + return; + } + var RAF = Browser.fakeRequestAnimationFrame; + RAF(func); + },safeCallback:function(func) { + return function() { + if (!ABORT) return func.apply(null, arguments); + }; + },allowAsyncCallbacks:true,queuedAsyncCallbacks:[],pauseAsyncCallbacks:function() { + Browser.allowAsyncCallbacks = false; + },resumeAsyncCallbacks:function() { // marks future callbacks as ok to execute, and synchronously runs any remaining ones right now + Browser.allowAsyncCallbacks = true; + if (Browser.queuedAsyncCallbacks.length > 0) { + var callbacks = Browser.queuedAsyncCallbacks; + Browser.queuedAsyncCallbacks = []; + callbacks.forEach(function(func) { + func(); + }); + } + },safeRequestAnimationFrame:function(func) { + return Browser.requestAnimationFrame(function() { + if (ABORT) return; + if (Browser.allowAsyncCallbacks) { + func(); + } else { + Browser.queuedAsyncCallbacks.push(func); + } + }); + },safeSetTimeout:function(func, timeout) { + noExitRuntime = true; + return setTimeout(function() { + if (ABORT) return; + if (Browser.allowAsyncCallbacks) { + func(); + } else { + Browser.queuedAsyncCallbacks.push(func); + } + }, timeout); + },safeSetInterval:function(func, timeout) { + noExitRuntime = true; + return setInterval(function() { + if (ABORT) return; + if (Browser.allowAsyncCallbacks) { + func(); + } // drop it on the floor otherwise, next interval will kick in + }, timeout); + },getMimetype:function(name) { + return { + 'jpg': 'image/jpeg', + 'jpeg': 'image/jpeg', + 'png': 'image/png', + 'bmp': 'image/bmp', + 'ogg': 'audio/ogg', + 'wav': 'audio/wav', + 'mp3': 'audio/mpeg' + }[name.substr(name.lastIndexOf('.')+1)]; + },getUserMedia:function(func) { + if(!window.getUserMedia) { + window.getUserMedia = navigator['getUserMedia'] || + navigator['mozGetUserMedia']; + } + window.getUserMedia(func); + },getMovementX:function(event) { + return event['movementX'] || + event['mozMovementX'] || + event['webkitMovementX'] || + 0; + },getMovementY:function(event) { + return event['movementY'] || + event['mozMovementY'] || + event['webkitMovementY'] || + 0; + },getMouseWheelDelta:function(event) { + var delta = 0; + switch (event.type) { + case 'DOMMouseScroll': + // 3 lines make up a step + delta = event.detail / 3; + break; + case 'mousewheel': + // 120 units make up a step + delta = event.wheelDelta / 120; + break; + case 'wheel': + delta = event.deltaY + switch(event.deltaMode) { + case 0: + // DOM_DELTA_PIXEL: 100 pixels make up a step + delta /= 100; + break; + case 1: + // DOM_DELTA_LINE: 3 lines make up a step + delta /= 3; + break; + case 2: + // DOM_DELTA_PAGE: A page makes up 80 steps + delta *= 80; + break; + default: + throw 'unrecognized mouse wheel delta mode: ' + event.deltaMode; + } + break; + default: + throw 'unrecognized mouse wheel event: ' + event.type; + } + return delta; + },mouseX:0,mouseY:0,mouseMovementX:0,mouseMovementY:0,touches:{},lastTouches:{},calculateMouseEvent:function(event) { // event should be mousemove, mousedown or mouseup + if (Browser.pointerLock) { + // When the pointer is locked, calculate the coordinates + // based on the movement of the mouse. + // Workaround for Firefox bug 764498 + if (event.type != 'mousemove' && + ('mozMovementX' in event)) { + Browser.mouseMovementX = Browser.mouseMovementY = 0; + } else { + Browser.mouseMovementX = Browser.getMovementX(event); + Browser.mouseMovementY = Browser.getMovementY(event); + } + + // check if SDL is available + if (typeof SDL != "undefined") { + Browser.mouseX = SDL.mouseX + Browser.mouseMovementX; + Browser.mouseY = SDL.mouseY + Browser.mouseMovementY; + } else { + // just add the mouse delta to the current absolut mouse position + // FIXME: ideally this should be clamped against the canvas size and zero + Browser.mouseX += Browser.mouseMovementX; + Browser.mouseY += Browser.mouseMovementY; + } + } else { + // Otherwise, calculate the movement based on the changes + // in the coordinates. + var rect = Module["canvas"].getBoundingClientRect(); + var cw = Module["canvas"].width; + var ch = Module["canvas"].height; + + // Neither .scrollX or .pageXOffset are defined in a spec, but + // we prefer .scrollX because it is currently in a spec draft. + // (see: http://www.w3.org/TR/2013/WD-cssom-view-20131217/) + var scrollX = ((typeof window.scrollX !== 'undefined') ? window.scrollX : window.pageXOffset); + var scrollY = ((typeof window.scrollY !== 'undefined') ? window.scrollY : window.pageYOffset); + // If this assert lands, it's likely because the browser doesn't support scrollX or pageXOffset + // and we have no viable fallback. + assert((typeof scrollX !== 'undefined') && (typeof scrollY !== 'undefined'), 'Unable to retrieve scroll position, mouse positions likely broken.'); + + if (event.type === 'touchstart' || event.type === 'touchend' || event.type === 'touchmove') { + var touch = event.touch; + if (touch === undefined) { + return; // the "touch" property is only defined in SDL + + } + var adjustedX = touch.pageX - (scrollX + rect.left); + var adjustedY = touch.pageY - (scrollY + rect.top); + + adjustedX = adjustedX * (cw / rect.width); + adjustedY = adjustedY * (ch / rect.height); + + var coords = { x: adjustedX, y: adjustedY }; + + if (event.type === 'touchstart') { + Browser.lastTouches[touch.identifier] = coords; + Browser.touches[touch.identifier] = coords; + } else if (event.type === 'touchend' || event.type === 'touchmove') { + var last = Browser.touches[touch.identifier]; + if (!last) last = coords; + Browser.lastTouches[touch.identifier] = last; + Browser.touches[touch.identifier] = coords; + } + return; + } + + var x = event.pageX - (scrollX + rect.left); + var y = event.pageY - (scrollY + rect.top); + + // the canvas might be CSS-scaled compared to its backbuffer; + // SDL-using content will want mouse coordinates in terms + // of backbuffer units. + x = x * (cw / rect.width); + y = y * (ch / rect.height); + + Browser.mouseMovementX = x - Browser.mouseX; + Browser.mouseMovementY = y - Browser.mouseY; + Browser.mouseX = x; + Browser.mouseY = y; + } + },asyncLoad:function(url, onload, onerror, noRunDep) { + var dep = !noRunDep ? getUniqueRunDependency('al ' + url) : ''; + readAsync(url, function(arrayBuffer) { + assert(arrayBuffer, 'Loading data file "' + url + '" failed (no arrayBuffer).'); + onload(new Uint8Array(arrayBuffer)); + if (dep) removeRunDependency(dep); + }, function(event) { + if (onerror) { + onerror(); + } else { + throw 'Loading data file "' + url + '" failed.'; + } + }); + if (dep) addRunDependency(dep); + },resizeListeners:[],updateResizeListeners:function() { + var canvas = Module['canvas']; + Browser.resizeListeners.forEach(function(listener) { + listener(canvas.width, canvas.height); + }); + },setCanvasSize:function(width, height, noUpdates) { + var canvas = Module['canvas']; + Browser.updateCanvasDimensions(canvas, width, height); + if (!noUpdates) Browser.updateResizeListeners(); + },windowedWidth:0,windowedHeight:0,setFullscreenCanvasSize:function() { + // check if SDL is available + if (typeof SDL != "undefined") { + var flags = HEAPU32[((SDL.screen)>>2)]; + flags = flags | 0x00800000; // set SDL_FULLSCREEN flag + HEAP32[((SDL.screen)>>2)]=flags + } + Browser.updateCanvasDimensions(Module['canvas']); + Browser.updateResizeListeners(); + },setWindowedCanvasSize:function() { + // check if SDL is available + if (typeof SDL != "undefined") { + var flags = HEAPU32[((SDL.screen)>>2)]; + flags = flags & ~0x00800000; // clear SDL_FULLSCREEN flag + HEAP32[((SDL.screen)>>2)]=flags + } + Browser.updateCanvasDimensions(Module['canvas']); + Browser.updateResizeListeners(); + },updateCanvasDimensions:function(canvas, wNative, hNative) { + if (wNative && hNative) { + canvas.widthNative = wNative; + canvas.heightNative = hNative; + } else { + wNative = canvas.widthNative; + hNative = canvas.heightNative; + } + var w = wNative; + var h = hNative; + if (Module['forcedAspectRatio'] && Module['forcedAspectRatio'] > 0) { + if (w/h < Module['forcedAspectRatio']) { + w = Math.round(h * Module['forcedAspectRatio']); + } else { + h = Math.round(w / Module['forcedAspectRatio']); + } + } + if (((document['fullscreenElement'] || document['mozFullScreenElement'] || + document['msFullscreenElement'] || document['webkitFullscreenElement'] || + document['webkitCurrentFullScreenElement']) === canvas.parentNode) && (typeof screen != 'undefined')) { + var factor = Math.min(screen.width / w, screen.height / h); + w = Math.round(w * factor); + h = Math.round(h * factor); + } + if (Browser.resizeCanvas) { + if (canvas.width != w) canvas.width = w; + if (canvas.height != h) canvas.height = h; + if (typeof canvas.style != 'undefined') { + canvas.style.removeProperty( "width"); + canvas.style.removeProperty("height"); + } + } else { + if (canvas.width != wNative) canvas.width = wNative; + if (canvas.height != hNative) canvas.height = hNative; + if (typeof canvas.style != 'undefined') { + if (w != wNative || h != hNative) { + canvas.style.setProperty( "width", w + "px", "important"); + canvas.style.setProperty("height", h + "px", "important"); + } else { + canvas.style.removeProperty( "width"); + canvas.style.removeProperty("height"); + } + } + } + },wgetRequests:{},nextWgetRequestHandle:0,getNextWgetRequestHandle:function() { + var handle = Browser.nextWgetRequestHandle; + Browser.nextWgetRequestHandle++; + return handle; + }};var EGL={errorCode:12288,defaultDisplayInitialized:false,currentContext:0,currentReadSurface:0,currentDrawSurface:0,contextAttributes:{alpha:false,depth:false,stencil:false,antialias:false},stringCache:{},setErrorCode:function(code) { + EGL.errorCode = code; + },chooseConfig:function(display, attribList, config, config_size, numConfigs) { + if (display != 62000 /* Magic ID for Emscripten 'default display' */) { + EGL.setErrorCode(0x3008 /* EGL_BAD_DISPLAY */); + return 0; + } + + if (attribList) { + // read attribList if it is non-null + for(;;) { + var param = HEAP32[((attribList)>>2)]; + if (param == 0x3021 /*EGL_ALPHA_SIZE*/) { + var alphaSize = HEAP32[(((attribList)+(4))>>2)]; + EGL.contextAttributes.alpha = (alphaSize > 0); + } else if (param == 0x3025 /*EGL_DEPTH_SIZE*/) { + var depthSize = HEAP32[(((attribList)+(4))>>2)]; + EGL.contextAttributes.depth = (depthSize > 0); + } else if (param == 0x3026 /*EGL_STENCIL_SIZE*/) { + var stencilSize = HEAP32[(((attribList)+(4))>>2)]; + EGL.contextAttributes.stencil = (stencilSize > 0); + } else if (param == 0x3031 /*EGL_SAMPLES*/) { + var samples = HEAP32[(((attribList)+(4))>>2)]; + EGL.contextAttributes.antialias = (samples > 0); + } else if (param == 0x3032 /*EGL_SAMPLE_BUFFERS*/) { + var samples = HEAP32[(((attribList)+(4))>>2)]; + EGL.contextAttributes.antialias = (samples == 1); + } else if (param == 0x3100 /*EGL_CONTEXT_PRIORITY_LEVEL_IMG*/) { + var requestedPriority = HEAP32[(((attribList)+(4))>>2)]; + EGL.contextAttributes.lowLatency = (requestedPriority != 0x3103 /*EGL_CONTEXT_PRIORITY_LOW_IMG*/); + } else if (param == 0x3038 /*EGL_NONE*/) { + break; + } + attribList += 8; + } + } + + if ((!config || !config_size) && !numConfigs) { + EGL.setErrorCode(0x300C /* EGL_BAD_PARAMETER */); + return 0; + } + if (numConfigs) { + HEAP32[((numConfigs)>>2)]=1; // Total number of supported configs: 1. + } + if (config && config_size > 0) { + HEAP32[((config)>>2)]=62002; + } + + EGL.setErrorCode(0x3000 /* EGL_SUCCESS */); + return 1; + }};function _eglBindAPI(api) { + if (api == 0x30A0 /* EGL_OPENGL_ES_API */) { + EGL.setErrorCode(0x3000 /* EGL_SUCCESS */); + return 1; + } else { // if (api == 0x30A1 /* EGL_OPENVG_API */ || api == 0x30A2 /* EGL_OPENGL_API */) { + EGL.setErrorCode(0x300C /* EGL_BAD_PARAMETER */); + return 0; + } + } + + function _eglChooseConfig(display, attrib_list, configs, config_size, numConfigs) { + return EGL.chooseConfig(display, attrib_list, configs, config_size, numConfigs); + } + + + + function __webgl_enable_ANGLE_instanced_arrays(ctx) { + // Extension available in WebGL 1 from Firefox 26 and Google Chrome 30 onwards. Core feature in WebGL 2. + var ext = ctx.getExtension('ANGLE_instanced_arrays'); + if (ext) { + ctx['vertexAttribDivisor'] = function(index, divisor) { ext['vertexAttribDivisorANGLE'](index, divisor); }; + ctx['drawArraysInstanced'] = function(mode, first, count, primcount) { ext['drawArraysInstancedANGLE'](mode, first, count, primcount); }; + ctx['drawElementsInstanced'] = function(mode, count, type, indices, primcount) { ext['drawElementsInstancedANGLE'](mode, count, type, indices, primcount); }; + return 1; + } + } + + function __webgl_enable_OES_vertex_array_object(ctx) { + // Extension available in WebGL 1 from Firefox 25 and WebKit 536.28/desktop Safari 6.0.3 onwards. Core feature in WebGL 2. + var ext = ctx.getExtension('OES_vertex_array_object'); + if (ext) { + ctx['createVertexArray'] = function() { return ext['createVertexArrayOES'](); }; + ctx['deleteVertexArray'] = function(vao) { ext['deleteVertexArrayOES'](vao); }; + ctx['bindVertexArray'] = function(vao) { ext['bindVertexArrayOES'](vao); }; + ctx['isVertexArray'] = function(vao) { return ext['isVertexArrayOES'](vao); }; + return 1; + } + } + + function __webgl_enable_WEBGL_draw_buffers(ctx) { + // Extension available in WebGL 1 from Firefox 28 onwards. Core feature in WebGL 2. + var ext = ctx.getExtension('WEBGL_draw_buffers'); + if (ext) { + ctx['drawBuffers'] = function(n, bufs) { ext['drawBuffersWEBGL'](n, bufs); }; + return 1; + } + }var GL={counter:1,buffers:[],programs:[],framebuffers:[],renderbuffers:[],textures:[],uniforms:[],shaders:[],vaos:[],contexts:[],offscreenCanvases:{},timerQueriesEXT:[],programInfos:{},stringCache:{},unpackAlignment:4,recordError:function recordError(errorCode) { + if (!GL.lastError) { + GL.lastError = errorCode; + } + },getNewId:function(table) { + var ret = GL.counter++; + for (var i = table.length; i < ret; i++) { + table[i] = null; + } + return ret; + },getSource:function(shader, count, string, length) { + var source = ''; + for (var i = 0; i < count; ++i) { + var len = length ? HEAP32[(((length)+(i*4))>>2)] : -1; + source += UTF8ToString(HEAP32[(((string)+(i*4))>>2)], len < 0 ? undefined : len); + } + return source; + },createContext:function(canvas, webGLContextAttributes) { + + + + + + var ctx = + (canvas.getContext("webgl", webGLContextAttributes) + // https://caniuse.com/#feat=webgl + ); + + + if (!ctx) return 0; + + var handle = GL.registerContext(ctx, webGLContextAttributes); + + + + return handle; + },registerContext:function(ctx, webGLContextAttributes) { + // without pthreads a context is just an integer ID + var handle = GL.getNewId(GL.contexts); + + var context = { + handle: handle, + attributes: webGLContextAttributes, + version: webGLContextAttributes.majorVersion, + GLctx: ctx + }; + + + // Store the created context object so that we can access the context given a canvas without having to pass the parameters again. + if (ctx.canvas) ctx.canvas.GLctxObject = context; + GL.contexts[handle] = context; + if (typeof webGLContextAttributes.enableExtensionsByDefault === 'undefined' || webGLContextAttributes.enableExtensionsByDefault) { + GL.initExtensions(context); + } + + + + + return handle; + },makeContextCurrent:function(contextHandle) { + + GL.currentContext = GL.contexts[contextHandle]; // Active Emscripten GL layer context object. + Module.ctx = GLctx = GL.currentContext && GL.currentContext.GLctx; // Active WebGL context object. + return !(contextHandle && !GLctx); + },getContext:function(contextHandle) { + return GL.contexts[contextHandle]; + },deleteContext:function(contextHandle) { + if (GL.currentContext === GL.contexts[contextHandle]) GL.currentContext = null; + if (typeof JSEvents === 'object') JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas); // Release all JS event handlers on the DOM element that the GL context is associated with since the context is now deleted. + if (GL.contexts[contextHandle] && GL.contexts[contextHandle].GLctx.canvas) GL.contexts[contextHandle].GLctx.canvas.GLctxObject = undefined; // Make sure the canvas object no longer refers to the context object so there are no GC surprises. + GL.contexts[contextHandle] = null; + },initExtensions:function(context) { + // If this function is called without a specific context object, init the extensions of the currently active context. + if (!context) context = GL.currentContext; + + if (context.initExtensionsDone) return; + context.initExtensionsDone = true; + + var GLctx = context.GLctx; + + // Detect the presence of a few extensions manually, this GL interop layer itself will need to know if they exist. + + // Extensions that are only available in WebGL 1 (the calls will be no-ops if called on a WebGL 2 context active) + __webgl_enable_ANGLE_instanced_arrays(GLctx); + __webgl_enable_OES_vertex_array_object(GLctx); + __webgl_enable_WEBGL_draw_buffers(GLctx); + + GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query"); + + // These are the 'safe' feature-enabling extensions that don't add any performance impact related to e.g. debugging, and + // should be enabled by default so that client GLES2/GL code will not need to go through extra hoops to get its stuff working. + // As new extensions are ratified at http://www.khronos.org/registry/webgl/extensions/ , feel free to add your new extensions + // here, as long as they don't produce a performance impact for users that might not be using those extensions. + // E.g. debugging-related extensions should probably be off by default. + var automaticallyEnabledExtensions = [ // Khronos ratified WebGL extensions ordered by number (no debug extensions): + "OES_texture_float", "OES_texture_half_float", "OES_standard_derivatives", + "OES_vertex_array_object", "WEBGL_compressed_texture_s3tc", "WEBGL_depth_texture", + "OES_element_index_uint", "EXT_texture_filter_anisotropic", "EXT_frag_depth", + "WEBGL_draw_buffers", "ANGLE_instanced_arrays", "OES_texture_float_linear", + "OES_texture_half_float_linear", "EXT_blend_minmax", "EXT_shader_texture_lod", + "EXT_texture_norm16", + // Community approved WebGL extensions ordered by number: + "WEBGL_compressed_texture_pvrtc", "EXT_color_buffer_half_float", "WEBGL_color_buffer_float", + "EXT_sRGB", "WEBGL_compressed_texture_etc1", "EXT_disjoint_timer_query", + "WEBGL_compressed_texture_etc", "WEBGL_compressed_texture_astc", "EXT_color_buffer_float", + "WEBGL_compressed_texture_s3tc_srgb", "EXT_disjoint_timer_query_webgl2", + // Old style prefixed forms of extensions (but still currently used on e.g. iPhone Xs as + // tested on iOS 12.4.1): + "WEBKIT_WEBGL_compressed_texture_pvrtc"]; + + function shouldEnableAutomatically(extension) { + var ret = false; + automaticallyEnabledExtensions.forEach(function(include) { + if (extension.indexOf(include) != -1) { + ret = true; + } + }); + return ret; + } + + var exts = GLctx.getSupportedExtensions() || []; // .getSupportedExtensions() can return null if context is lost, so coerce to empty array. + exts.forEach(function(ext) { + if (automaticallyEnabledExtensions.indexOf(ext) != -1) { + GLctx.getExtension(ext); // Calling .getExtension enables that extension permanently, no need to store the return value to be enabled. + } + }); + },populateUniformTable:function(program) { + var p = GL.programs[program]; + var ptable = GL.programInfos[program] = { + uniforms: {}, + maxUniformLength: 0, // This is eagerly computed below, since we already enumerate all uniforms anyway. + maxAttributeLength: -1, // This is lazily computed and cached, computed when/if first asked, "-1" meaning not computed yet. + maxUniformBlockNameLength: -1 // Lazily computed as well + }; + + var utable = ptable.uniforms; + // A program's uniform table maps the string name of an uniform to an integer location of that uniform. + // The global GL.uniforms map maps integer locations to WebGLUniformLocations. + var numUniforms = GLctx.getProgramParameter(p, 0x8B86/*GL_ACTIVE_UNIFORMS*/); + for (var i = 0; i < numUniforms; ++i) { + var u = GLctx.getActiveUniform(p, i); + + var name = u.name; + ptable.maxUniformLength = Math.max(ptable.maxUniformLength, name.length+1); + + // If we are dealing with an array, e.g. vec4 foo[3], strip off the array index part to canonicalize that "foo", "foo[]", + // and "foo[0]" will mean the same. Loop below will populate foo[1] and foo[2]. + if (name.slice(-1) == ']') { + name = name.slice(0, name.lastIndexOf('[')); + } + + // Optimize memory usage slightly: If we have an array of uniforms, e.g. 'vec3 colors[3];', then + // only store the string 'colors' in utable, and 'colors[0]', 'colors[1]' and 'colors[2]' will be parsed as 'colors'+i. + // Note that for the GL.uniforms table, we still need to fetch the all WebGLUniformLocations for all the indices. + var loc = GLctx.getUniformLocation(p, name); + if (loc) { + var id = GL.getNewId(GL.uniforms); + utable[name] = [u.size, id]; + GL.uniforms[id] = loc; + + for (var j = 1; j < u.size; ++j) { + var n = name + '['+j+']'; + loc = GLctx.getUniformLocation(p, n); + id = GL.getNewId(GL.uniforms); + + GL.uniforms[id] = loc; + } + } + } + }};function _eglCreateContext(display, config, hmm, contextAttribs) { + if (display != 62000 /* Magic ID for Emscripten 'default display' */) { + EGL.setErrorCode(0x3008 /* EGL_BAD_DISPLAY */); + return 0; + } + + // EGL 1.4 spec says default EGL_CONTEXT_CLIENT_VERSION is GLES1, but this is not supported by Emscripten. + // So user must pass EGL_CONTEXT_CLIENT_VERSION == 2 to initialize EGL. + var glesContextVersion = 1; + for(;;) { + var param = HEAP32[((contextAttribs)>>2)]; + if (param == 0x3098 /*EGL_CONTEXT_CLIENT_VERSION*/) { + glesContextVersion = HEAP32[(((contextAttribs)+(4))>>2)]; + } else if (param == 0x3038 /*EGL_NONE*/) { + break; + } else { + /* EGL1.4 specifies only EGL_CONTEXT_CLIENT_VERSION as supported attribute */ + EGL.setErrorCode(0x3004 /*EGL_BAD_ATTRIBUTE*/); + return 0; + } + contextAttribs += 8; + } + if (glesContextVersion != 2) { + EGL.setErrorCode(0x3005 /* EGL_BAD_CONFIG */); + return 0; /* EGL_NO_CONTEXT */ + } + + EGL.contextAttributes.majorVersion = glesContextVersion - 1; // WebGL 1 is GLES 2, WebGL2 is GLES3 + EGL.contextAttributes.minorVersion = 0; + + EGL.context = GL.createContext(Module['canvas'], EGL.contextAttributes); + + if (EGL.context != 0) { + EGL.setErrorCode(0x3000 /* EGL_SUCCESS */); + + // Run callbacks so that GL emulation works + GL.makeContextCurrent(EGL.context); + Module.useWebGL = true; + Browser.moduleContextCreatedCallbacks.forEach(function(callback) { callback() }); + + // Note: This function only creates a context, but it shall not make it active. + GL.makeContextCurrent(null); + return 62004; // Magic ID for Emscripten EGLContext + } else { + EGL.setErrorCode(0x3009 /* EGL_BAD_MATCH */); // By the EGL 1.4 spec, an implementation that does not support GLES2 (WebGL in this case), this error code is set. + return 0; /* EGL_NO_CONTEXT */ + } + } + + function _eglCreateWindowSurface(display, config, win, attrib_list) { + if (display != 62000 /* Magic ID for Emscripten 'default display' */) { + EGL.setErrorCode(0x3008 /* EGL_BAD_DISPLAY */); + return 0; + } + if (config != 62002 /* Magic ID for the only EGLConfig supported by Emscripten */) { + EGL.setErrorCode(0x3005 /* EGL_BAD_CONFIG */); + return 0; + } + // TODO: Examine attrib_list! Parameters that can be present there are: + // - EGL_RENDER_BUFFER (must be EGL_BACK_BUFFER) + // - EGL_VG_COLORSPACE (can't be set) + // - EGL_VG_ALPHA_FORMAT (can't be set) + EGL.setErrorCode(0x3000 /* EGL_SUCCESS */); + return 62006; /* Magic ID for Emscripten 'default surface' */ + } + + function _eglDestroyContext(display, context) { + if (display != 62000 /* Magic ID for Emscripten 'default display' */) { + EGL.setErrorCode(0x3008 /* EGL_BAD_DISPLAY */); + return 0; + } + if (context != 62004 /* Magic ID for Emscripten EGLContext */) { + EGL.setErrorCode(0x3006 /* EGL_BAD_CONTEXT */); + return 0; + } + + GL.deleteContext(EGL.context); + EGL.setErrorCode(0x3000 /* EGL_SUCCESS */); + if (EGL.currentContext == context) { + EGL.currentContext = 0; + } + return 1 /* EGL_TRUE */; + } + + function _eglDestroySurface(display, surface) { + if (display != 62000 /* Magic ID for Emscripten 'default display' */) { + EGL.setErrorCode(0x3008 /* EGL_BAD_DISPLAY */); + return 0; + } + if (surface != 62006 /* Magic ID for the only EGLSurface supported by Emscripten */) { + EGL.setErrorCode(0x300D /* EGL_BAD_SURFACE */); + return 1; + } + if (EGL.currentReadSurface == surface) { + EGL.currentReadSurface = 0; + } + if (EGL.currentDrawSurface == surface) { + EGL.currentDrawSurface = 0; + } + EGL.setErrorCode(0x3000 /* EGL_SUCCESS */); + return 1; /* Magic ID for Emscripten 'default surface' */ + } + + function _eglGetConfigAttrib(display, config, attribute, value) { + if (display != 62000 /* Magic ID for Emscripten 'default display' */) { + EGL.setErrorCode(0x3008 /* EGL_BAD_DISPLAY */); + return 0; + } + if (config != 62002 /* Magic ID for the only EGLConfig supported by Emscripten */) { + EGL.setErrorCode(0x3005 /* EGL_BAD_CONFIG */); + return 0; + } + if (!value) { + EGL.setErrorCode(0x300C /* EGL_BAD_PARAMETER */); + return 0; + } + EGL.setErrorCode(0x3000 /* EGL_SUCCESS */); + switch(attribute) { + case 0x3020: // EGL_BUFFER_SIZE + HEAP32[((value)>>2)]=EGL.contextAttributes.alpha ? 32 : 24; + return 1; + case 0x3021: // EGL_ALPHA_SIZE + HEAP32[((value)>>2)]=EGL.contextAttributes.alpha ? 8 : 0; + return 1; + case 0x3022: // EGL_BLUE_SIZE + HEAP32[((value)>>2)]=8; + return 1; + case 0x3023: // EGL_GREEN_SIZE + HEAP32[((value)>>2)]=8; + return 1; + case 0x3024: // EGL_RED_SIZE + HEAP32[((value)>>2)]=8; + return 1; + case 0x3025: // EGL_DEPTH_SIZE + HEAP32[((value)>>2)]=EGL.contextAttributes.depth ? 24 : 0; + return 1; + case 0x3026: // EGL_STENCIL_SIZE + HEAP32[((value)>>2)]=EGL.contextAttributes.stencil ? 8 : 0; + return 1; + case 0x3027: // EGL_CONFIG_CAVEAT + // We can return here one of EGL_NONE (0x3038), EGL_SLOW_CONFIG (0x3050) or EGL_NON_CONFORMANT_CONFIG (0x3051). + HEAP32[((value)>>2)]=0x3038; + return 1; + case 0x3028: // EGL_CONFIG_ID + HEAP32[((value)>>2)]=62002; + return 1; + case 0x3029: // EGL_LEVEL + HEAP32[((value)>>2)]=0; + return 1; + case 0x302A: // EGL_MAX_PBUFFER_HEIGHT + HEAP32[((value)>>2)]=4096; + return 1; + case 0x302B: // EGL_MAX_PBUFFER_PIXELS + HEAP32[((value)>>2)]=16777216; + return 1; + case 0x302C: // EGL_MAX_PBUFFER_WIDTH + HEAP32[((value)>>2)]=4096; + return 1; + case 0x302D: // EGL_NATIVE_RENDERABLE + HEAP32[((value)>>2)]=0; + return 1; + case 0x302E: // EGL_NATIVE_VISUAL_ID + HEAP32[((value)>>2)]=0; + return 1; + case 0x302F: // EGL_NATIVE_VISUAL_TYPE + HEAP32[((value)>>2)]=0x3038; + return 1; + case 0x3031: // EGL_SAMPLES + HEAP32[((value)>>2)]=EGL.contextAttributes.antialias ? 4 : 0; + return 1; + case 0x3032: // EGL_SAMPLE_BUFFERS + HEAP32[((value)>>2)]=EGL.contextAttributes.antialias ? 1 : 0; + return 1; + case 0x3033: // EGL_SURFACE_TYPE + HEAP32[((value)>>2)]=0x4; + return 1; + case 0x3034: // EGL_TRANSPARENT_TYPE + // If this returns EGL_TRANSPARENT_RGB (0x3052), transparency is used through color-keying. No such thing applies to Emscripten canvas. + HEAP32[((value)>>2)]=0x3038; + return 1; + case 0x3035: // EGL_TRANSPARENT_BLUE_VALUE + case 0x3036: // EGL_TRANSPARENT_GREEN_VALUE + case 0x3037: // EGL_TRANSPARENT_RED_VALUE + // "If EGL_TRANSPARENT_TYPE is EGL_NONE, then the values for EGL_TRANSPARENT_RED_VALUE, EGL_TRANSPARENT_GREEN_VALUE, and EGL_TRANSPARENT_BLUE_VALUE are undefined." + HEAP32[((value)>>2)]=-1; + return 1; + case 0x3039: // EGL_BIND_TO_TEXTURE_RGB + case 0x303A: // EGL_BIND_TO_TEXTURE_RGBA + HEAP32[((value)>>2)]=0; + return 1; + case 0x303B: // EGL_MIN_SWAP_INTERVAL + HEAP32[((value)>>2)]=0; + return 1; + case 0x303C: // EGL_MAX_SWAP_INTERVAL + HEAP32[((value)>>2)]=1; + return 1; + case 0x303D: // EGL_LUMINANCE_SIZE + case 0x303E: // EGL_ALPHA_MASK_SIZE + HEAP32[((value)>>2)]=0; + return 1; + case 0x303F: // EGL_COLOR_BUFFER_TYPE + // EGL has two types of buffers: EGL_RGB_BUFFER and EGL_LUMINANCE_BUFFER. + HEAP32[((value)>>2)]=0x308E; + return 1; + case 0x3040: // EGL_RENDERABLE_TYPE + // A bit combination of EGL_OPENGL_ES_BIT,EGL_OPENVG_BIT,EGL_OPENGL_ES2_BIT and EGL_OPENGL_BIT. + HEAP32[((value)>>2)]=0x4; + return 1; + case 0x3042: // EGL_CONFORMANT + // "EGL_CONFORMANT is a mask indicating if a client API context created with respect to the corresponding EGLConfig will pass the required conformance tests for that API." + HEAP32[((value)>>2)]=0; + return 1; + default: + EGL.setErrorCode(0x3004 /* EGL_BAD_ATTRIBUTE */); + return 0; + } + } + + function _eglGetDisplay(nativeDisplayType) { + EGL.setErrorCode(0x3000 /* EGL_SUCCESS */); + // Note: As a 'conformant' implementation of EGL, we would prefer to init here only if the user + // calls this function with EGL_DEFAULT_DISPLAY. Other display IDs would be preferred to be unsupported + // and EGL_NO_DISPLAY returned. Uncomment the following code lines to do this. + // Instead, an alternative route has been preferred, namely that the Emscripten EGL implementation + // "emulates" X11, and eglGetDisplay is expected to accept/receive a pointer to an X11 Display object. + // Therefore, be lax and allow anything to be passed in, and return the magic handle to our default EGLDisplay object. + + // if (nativeDisplayType == 0 /* EGL_DEFAULT_DISPLAY */) { + return 62000; // Magic ID for Emscripten 'default display' + // } + // else + // return 0; // EGL_NO_DISPLAY + } + + function _eglGetError() { + return EGL.errorCode; + } + + function _eglGetProcAddress(name_) { + return _emscripten_GetProcAddress(name_); + } + + function _eglInitialize(display, majorVersion, minorVersion) { + if (display == 62000 /* Magic ID for Emscripten 'default display' */) { + if (majorVersion) { + HEAP32[((majorVersion)>>2)]=1; // Advertise EGL Major version: '1' + } + if (minorVersion) { + HEAP32[((minorVersion)>>2)]=4; // Advertise EGL Minor version: '4' + } + EGL.defaultDisplayInitialized = true; + EGL.setErrorCode(0x3000 /* EGL_SUCCESS */); + return 1; + } + else { + EGL.setErrorCode(0x3008 /* EGL_BAD_DISPLAY */); + return 0; + } + } + + function _eglMakeCurrent(display, draw, read, context) { + if (display != 62000 /* Magic ID for Emscripten 'default display' */) { + EGL.setErrorCode(0x3008 /* EGL_BAD_DISPLAY */); + return 0 /* EGL_FALSE */; + } + //\todo An EGL_NOT_INITIALIZED error is generated if EGL is not initialized for dpy. + if (context != 0 && context != 62004 /* Magic ID for Emscripten EGLContext */) { + EGL.setErrorCode(0x3006 /* EGL_BAD_CONTEXT */); + return 0; + } + if ((read != 0 && read != 62006) || (draw != 0 && draw != 62006 /* Magic ID for Emscripten 'default surface' */)) { + EGL.setErrorCode(0x300D /* EGL_BAD_SURFACE */); + return 0; + } + + GL.makeContextCurrent(context ? EGL.context : null); + + EGL.currentContext = context; + EGL.currentDrawSurface = draw; + EGL.currentReadSurface = read; + EGL.setErrorCode(0x3000 /* EGL_SUCCESS */); + return 1 /* EGL_TRUE */; + } + + function _eglQueryString(display, name) { + if (display != 62000 /* Magic ID for Emscripten 'default display' */) { + EGL.setErrorCode(0x3008 /* EGL_BAD_DISPLAY */); + return 0; + } + //\todo An EGL_NOT_INITIALIZED error is generated if EGL is not initialized for dpy. + EGL.setErrorCode(0x3000 /* EGL_SUCCESS */); + if (EGL.stringCache[name]) return EGL.stringCache[name]; + var ret; + switch(name) { + case 0x3053 /* EGL_VENDOR */: ret = allocateUTF8("Emscripten"); break; + case 0x3054 /* EGL_VERSION */: ret = allocateUTF8("1.4 Emscripten EGL"); break; + case 0x3055 /* EGL_EXTENSIONS */: ret = allocateUTF8(""); break; // Currently not supporting any EGL extensions. + case 0x308D /* EGL_CLIENT_APIS */: ret = allocateUTF8("OpenGL_ES"); break; + default: + EGL.setErrorCode(0x300C /* EGL_BAD_PARAMETER */); + return 0; + } + EGL.stringCache[name] = ret; + return ret; + } + + function _eglSwapBuffers() { + + if (!EGL.defaultDisplayInitialized) { + EGL.setErrorCode(0x3001 /* EGL_NOT_INITIALIZED */); + } else if (!Module.ctx) { + EGL.setErrorCode(0x3002 /* EGL_BAD_ACCESS */); + } else if (Module.ctx.isContextLost()) { + EGL.setErrorCode(0x300E /* EGL_CONTEXT_LOST */); + } else { + // According to documentation this does an implicit flush. + // Due to discussion at https://github.com/emscripten-core/emscripten/pull/1871 + // the flush was removed since this _may_ result in slowing code down. + //_glFlush(); + EGL.setErrorCode(0x3000 /* EGL_SUCCESS */); + return 1 /* EGL_TRUE */; + } + return 0 /* EGL_FALSE */; + } + + function _eglSwapInterval(display, interval) { + if (display != 62000 /* Magic ID for Emscripten 'default display' */) { + EGL.setErrorCode(0x3008 /* EGL_BAD_DISPLAY */); + return 0; + } + if (interval == 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 0); + else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, interval); + + EGL.setErrorCode(0x3000 /* EGL_SUCCESS */); + return 1; + } + + function _eglTerminate(display) { + if (display != 62000 /* Magic ID for Emscripten 'default display' */) { + EGL.setErrorCode(0x3008 /* EGL_BAD_DISPLAY */); + return 0; + } + EGL.currentContext = 0; + EGL.currentReadSurface = 0; + EGL.currentDrawSurface = 0; + EGL.defaultDisplayInitialized = false; + EGL.setErrorCode(0x3000 /* EGL_SUCCESS */); + return 1; + } + + + function _eglWaitClient() { + EGL.setErrorCode(0x3000 /* EGL_SUCCESS */); + return 1; + }function _eglWaitGL( + ) { + return _eglWaitClient(); + } + + function _eglWaitNative(nativeEngineId) { + EGL.setErrorCode(0x3000 /* EGL_SUCCESS */); + return 1; + } + + + var JSEvents={inEventHandler:0,removeAllEventListeners:function() { + for(var i = JSEvents.eventHandlers.length-1; i >= 0; --i) { + JSEvents._removeHandler(i); + } + JSEvents.eventHandlers = []; + JSEvents.deferredCalls = []; + },registerRemoveEventListeners:function() { + if (!JSEvents.removeEventListenersRegistered) { + __ATEXIT__.push(JSEvents.removeAllEventListeners); + JSEvents.removeEventListenersRegistered = true; + } + },deferredCalls:[],deferCall:function(targetFunction, precedence, argsList) { + function arraysHaveEqualContent(arrA, arrB) { + if (arrA.length != arrB.length) return false; + + for(var i in arrA) { + if (arrA[i] != arrB[i]) return false; + } + return true; + } + // Test if the given call was already queued, and if so, don't add it again. + for(var i in JSEvents.deferredCalls) { + var call = JSEvents.deferredCalls[i]; + if (call.targetFunction == targetFunction && arraysHaveEqualContent(call.argsList, argsList)) { + return; + } + } + JSEvents.deferredCalls.push({ + targetFunction: targetFunction, + precedence: precedence, + argsList: argsList + }); + + JSEvents.deferredCalls.sort(function(x,y) { return x.precedence < y.precedence; }); + },removeDeferredCalls:function(targetFunction) { + for(var i = 0; i < JSEvents.deferredCalls.length; ++i) { + if (JSEvents.deferredCalls[i].targetFunction == targetFunction) { + JSEvents.deferredCalls.splice(i, 1); + --i; + } + } + },canPerformEventHandlerRequests:function() { + return JSEvents.inEventHandler && JSEvents.currentEventHandler.allowsDeferredCalls; + },runDeferredCalls:function() { + if (!JSEvents.canPerformEventHandlerRequests()) { + return; + } + for(var i = 0; i < JSEvents.deferredCalls.length; ++i) { + var call = JSEvents.deferredCalls[i]; + JSEvents.deferredCalls.splice(i, 1); + --i; + call.targetFunction.apply(null, call.argsList); + } + },eventHandlers:[],removeAllHandlersOnTarget:function(target, eventTypeString) { + for(var i = 0; i < JSEvents.eventHandlers.length; ++i) { + if (JSEvents.eventHandlers[i].target == target && + (!eventTypeString || eventTypeString == JSEvents.eventHandlers[i].eventTypeString)) { + JSEvents._removeHandler(i--); + } + } + },_removeHandler:function(i) { + var h = JSEvents.eventHandlers[i]; + h.target.removeEventListener(h.eventTypeString, h.eventListenerFunc, h.useCapture); + JSEvents.eventHandlers.splice(i, 1); + },registerOrRemoveHandler:function(eventHandler) { + var jsEventHandler = function jsEventHandler(event) { + // Increment nesting count for the event handler. + ++JSEvents.inEventHandler; + JSEvents.currentEventHandler = eventHandler; + // Process any old deferred calls the user has placed. + JSEvents.runDeferredCalls(); + // Process the actual event, calls back to user C code handler. + eventHandler.handlerFunc(event); + // Process any new deferred calls that were placed right now from this event handler. + JSEvents.runDeferredCalls(); + // Out of event handler - restore nesting count. + --JSEvents.inEventHandler; + }; + + if (eventHandler.callbackfunc) { + eventHandler.eventListenerFunc = jsEventHandler; + eventHandler.target.addEventListener(eventHandler.eventTypeString, jsEventHandler, eventHandler.useCapture); + JSEvents.eventHandlers.push(eventHandler); + JSEvents.registerRemoveEventListeners(); + } else { + for(var i = 0; i < JSEvents.eventHandlers.length; ++i) { + if (JSEvents.eventHandlers[i].target == eventHandler.target + && JSEvents.eventHandlers[i].eventTypeString == eventHandler.eventTypeString) { + JSEvents._removeHandler(i--); + } + } + } + },getNodeNameForTarget:function(target) { + if (!target) return ''; + if (target == window) return '#window'; + if (target == screen) return '#screen'; + return (target && target.nodeName) ? target.nodeName : ''; + },fullscreenEnabled:function() { + return document.fullscreenEnabled + // Safari 13.0.3 on macOS Catalina 10.15.1 still ships with prefixed webkitFullscreenEnabled. + // TODO: If Safari at some point ships with unprefixed version, update the version check above. + || document.webkitFullscreenEnabled + ; + }}; + + var __currentFullscreenStrategy={}; + + + + + + + + + function maybeCStringToJsString(cString) { + // "cString > 2" checks if the input is a number, and isn't of the special + // values we accept here, EMSCRIPTEN_EVENT_TARGET_* (which map to 0, 1, 2). + // In other words, if cString > 2 then it's a pointer to a valid place in + // memory, and points to a C string. + return cString > 2 ? UTF8ToString(cString) : cString; + } + + var specialHTMLTargets=[0, typeof document !== 'undefined' ? document : 0, typeof window !== 'undefined' ? window : 0];function findEventTarget(target) { + target = maybeCStringToJsString(target); + var domElement = specialHTMLTargets[target] || (typeof document !== 'undefined' ? document.querySelector(target) : undefined); + return domElement; + }function findCanvasEventTarget(target) { return findEventTarget(target); }function _emscripten_get_canvas_element_size(target, width, height) { + var canvas = findCanvasEventTarget(target); + if (!canvas) return -4; + HEAP32[((width)>>2)]=canvas.width; + HEAP32[((height)>>2)]=canvas.height; + }function __get_canvas_element_size(target) { + var stackTop = stackSave(); + var w = stackAlloc(8); + var h = w + 4; + + var targetInt = stackAlloc(target.id.length+1); + stringToUTF8(target.id, targetInt, target.id.length+1); + var ret = _emscripten_get_canvas_element_size(targetInt, w, h); + var size = [HEAP32[((w)>>2)], HEAP32[((h)>>2)]]; + stackRestore(stackTop); + return size; + } + + + function _emscripten_set_canvas_element_size(target, width, height) { + var canvas = findCanvasEventTarget(target); + if (!canvas) return -4; + canvas.width = width; + canvas.height = height; + return 0; + }function __set_canvas_element_size(target, width, height) { + if (!target.controlTransferredOffscreen) { + target.width = width; + target.height = height; + } else { + // This function is being called from high-level JavaScript code instead of asm.js/Wasm, + // and it needs to synchronously proxy over to another thread, so marshal the string onto the heap to do the call. + var stackTop = stackSave(); + var targetInt = stackAlloc(target.id.length+1); + stringToUTF8(target.id, targetInt, target.id.length+1); + _emscripten_set_canvas_element_size(targetInt, width, height); + stackRestore(stackTop); + } + }function __registerRestoreOldStyle(canvas) { + var canvasSize = __get_canvas_element_size(canvas); + var oldWidth = canvasSize[0]; + var oldHeight = canvasSize[1]; + var oldCssWidth = canvas.style.width; + var oldCssHeight = canvas.style.height; + var oldBackgroundColor = canvas.style.backgroundColor; // Chrome reads color from here. + var oldDocumentBackgroundColor = document.body.style.backgroundColor; // IE11 reads color from here. + // Firefox always has black background color. + var oldPaddingLeft = canvas.style.paddingLeft; // Chrome, FF, Safari + var oldPaddingRight = canvas.style.paddingRight; + var oldPaddingTop = canvas.style.paddingTop; + var oldPaddingBottom = canvas.style.paddingBottom; + var oldMarginLeft = canvas.style.marginLeft; // IE11 + var oldMarginRight = canvas.style.marginRight; + var oldMarginTop = canvas.style.marginTop; + var oldMarginBottom = canvas.style.marginBottom; + var oldDocumentBodyMargin = document.body.style.margin; + var oldDocumentOverflow = document.documentElement.style.overflow; // Chrome, Firefox + var oldDocumentScroll = document.body.scroll; // IE + var oldImageRendering = canvas.style.imageRendering; + + function restoreOldStyle() { + var fullscreenElement = document.fullscreenElement + || document.webkitFullscreenElement + || document.msFullscreenElement + ; + if (!fullscreenElement) { + document.removeEventListener('fullscreenchange', restoreOldStyle); + + + // Unprefixed Fullscreen API shipped in Chromium 71 (https://bugs.chromium.org/p/chromium/issues/detail?id=383813) + // As of Safari 13.0.3 on macOS Catalina 10.15.1 still ships with prefixed webkitfullscreenchange. TODO: revisit this check once Safari ships unprefixed version. + document.removeEventListener('webkitfullscreenchange', restoreOldStyle); + + + __set_canvas_element_size(canvas, oldWidth, oldHeight); + + canvas.style.width = oldCssWidth; + canvas.style.height = oldCssHeight; + canvas.style.backgroundColor = oldBackgroundColor; // Chrome + // IE11 hack: assigning 'undefined' or an empty string to document.body.style.backgroundColor has no effect, so first assign back the default color + // before setting the undefined value. Setting undefined value is also important, or otherwise we would later treat that as something that the user + // had explicitly set so subsequent fullscreen transitions would not set background color properly. + if (!oldDocumentBackgroundColor) document.body.style.backgroundColor = 'white'; + document.body.style.backgroundColor = oldDocumentBackgroundColor; // IE11 + canvas.style.paddingLeft = oldPaddingLeft; // Chrome, FF, Safari + canvas.style.paddingRight = oldPaddingRight; + canvas.style.paddingTop = oldPaddingTop; + canvas.style.paddingBottom = oldPaddingBottom; + canvas.style.marginLeft = oldMarginLeft; // IE11 + canvas.style.marginRight = oldMarginRight; + canvas.style.marginTop = oldMarginTop; + canvas.style.marginBottom = oldMarginBottom; + document.body.style.margin = oldDocumentBodyMargin; + document.documentElement.style.overflow = oldDocumentOverflow; // Chrome, Firefox + document.body.scroll = oldDocumentScroll; // IE + canvas.style.imageRendering = oldImageRendering; + if (canvas.GLctxObject) canvas.GLctxObject.GLctx.viewport(0, 0, oldWidth, oldHeight); + + if (__currentFullscreenStrategy.canvasResizedCallback) { + dynCall_iiii(__currentFullscreenStrategy.canvasResizedCallback, 37, 0, __currentFullscreenStrategy.canvasResizedCallbackUserData); + } + } + } + document.addEventListener('fullscreenchange', restoreOldStyle); + // Unprefixed Fullscreen API shipped in Chromium 71 (https://bugs.chromium.org/p/chromium/issues/detail?id=383813) + // As of Safari 13.0.3 on macOS Catalina 10.15.1 still ships with prefixed webkitfullscreenchange. TODO: revisit this check once Safari ships unprefixed version. + document.addEventListener('webkitfullscreenchange', restoreOldStyle); + return restoreOldStyle; + } + + function __setLetterbox(element, topBottom, leftRight) { + // Cannot use margin to specify letterboxes in FF or Chrome, since those ignore margins in fullscreen mode. + element.style.paddingLeft = element.style.paddingRight = leftRight + 'px'; + element.style.paddingTop = element.style.paddingBottom = topBottom + 'px'; + } + + function __getBoundingClientRect(e) { + return specialHTMLTargets.indexOf(e) < 0 ? e.getBoundingClientRect() : {'left':0,'top':0}; + }function _JSEvents_resizeCanvasForFullscreen(target, strategy) { + var restoreOldStyle = __registerRestoreOldStyle(target); + var cssWidth = strategy.softFullscreen ? innerWidth : screen.width; + var cssHeight = strategy.softFullscreen ? innerHeight : screen.height; + var rect = __getBoundingClientRect(target); + var windowedCssWidth = rect.width; + var windowedCssHeight = rect.height; + var canvasSize = __get_canvas_element_size(target); + var windowedRttWidth = canvasSize[0]; + var windowedRttHeight = canvasSize[1]; + + if (strategy.scaleMode == 3) { + __setLetterbox(target, (cssHeight - windowedCssHeight) / 2, (cssWidth - windowedCssWidth) / 2); + cssWidth = windowedCssWidth; + cssHeight = windowedCssHeight; + } else if (strategy.scaleMode == 2) { + if (cssWidth*windowedRttHeight < windowedRttWidth*cssHeight) { + var desiredCssHeight = windowedRttHeight * cssWidth / windowedRttWidth; + __setLetterbox(target, (cssHeight - desiredCssHeight) / 2, 0); + cssHeight = desiredCssHeight; + } else { + var desiredCssWidth = windowedRttWidth * cssHeight / windowedRttHeight; + __setLetterbox(target, 0, (cssWidth - desiredCssWidth) / 2); + cssWidth = desiredCssWidth; + } + } + + // If we are adding padding, must choose a background color or otherwise Chrome will give the + // padding a default white color. Do it only if user has not customized their own background color. + if (!target.style.backgroundColor) target.style.backgroundColor = 'black'; + // IE11 does the same, but requires the color to be set in the document body. + if (!document.body.style.backgroundColor) document.body.style.backgroundColor = 'black'; // IE11 + // Firefox always shows black letterboxes independent of style color. + + target.style.width = cssWidth + 'px'; + target.style.height = cssHeight + 'px'; + + if (strategy.filteringMode == 1) { + target.style.imageRendering = 'optimizeSpeed'; + target.style.imageRendering = '-moz-crisp-edges'; + target.style.imageRendering = '-o-crisp-edges'; + target.style.imageRendering = '-webkit-optimize-contrast'; + target.style.imageRendering = 'optimize-contrast'; + target.style.imageRendering = 'crisp-edges'; + target.style.imageRendering = 'pixelated'; + } + + var dpiScale = (strategy.canvasResolutionScaleMode == 2) ? devicePixelRatio : 1; + if (strategy.canvasResolutionScaleMode != 0) { + var newWidth = (cssWidth * dpiScale)|0; + var newHeight = (cssHeight * dpiScale)|0; + __set_canvas_element_size(target, newWidth, newHeight); + if (target.GLctxObject) target.GLctxObject.GLctx.viewport(0, 0, newWidth, newHeight); + } + return restoreOldStyle; + }function _JSEvents_requestFullscreen(target, strategy) { + // EMSCRIPTEN_FULLSCREEN_SCALE_DEFAULT + EMSCRIPTEN_FULLSCREEN_CANVAS_SCALE_NONE is a mode where no extra logic is performed to the DOM elements. + if (strategy.scaleMode != 0 || strategy.canvasResolutionScaleMode != 0) { + _JSEvents_resizeCanvasForFullscreen(target, strategy); + } + + if (target.requestFullscreen) { + target.requestFullscreen(); + } else if (target.webkitRequestFullscreen) { + target.webkitRequestFullscreen(Element.ALLOW_KEYBOARD_INPUT); + } else { + return JSEvents.fullscreenEnabled() ? -3 : -1; + } + + __currentFullscreenStrategy = strategy; + + if (strategy.canvasResizedCallback) { + dynCall_iiii(strategy.canvasResizedCallback, 37, 0, strategy.canvasResizedCallbackUserData); + } + + return 0; + }function _emscripten_exit_fullscreen() { + if (!JSEvents.fullscreenEnabled()) return -1; + // Make sure no queued up calls will fire after this. + JSEvents.removeDeferredCalls(_JSEvents_requestFullscreen); + + var d = specialHTMLTargets[1]; + if (d.exitFullscreen) { + d.fullscreenElement && d.exitFullscreen(); + } else if (d.webkitExitFullscreen) { + d.webkitFullscreenElement && d.webkitExitFullscreen(); + } else { + return -1; + } + + return 0; + } + + + function __requestPointerLock(target) { + if (target.requestPointerLock) { + target.requestPointerLock(); + } else if (target.msRequestPointerLock) { + target.msRequestPointerLock(); + } else { + // document.body is known to accept pointer lock, so use that to differentiate if the user passed a bad element, + // or if the whole browser just doesn't support the feature. + if (document.body.requestPointerLock + || document.body.msRequestPointerLock + ) { + return -3; + } else { + return -1; + } + } + return 0; + }function _emscripten_exit_pointerlock() { + // Make sure no queued up calls will fire after this. + JSEvents.removeDeferredCalls(__requestPointerLock); + + if (document.exitPointerLock) { + document.exitPointerLock(); + } else if (document.msExitPointerLock) { + document.msExitPointerLock(); + } else { + return -1; + } + return 0; + } + + function _emscripten_get_device_pixel_ratio() { + return (typeof devicePixelRatio === 'number' && devicePixelRatio) || 1.0; + } + + function _emscripten_get_element_css_size(target, width, height) { + target = findEventTarget(target); + if (!target) return -4; + + var rect = __getBoundingClientRect(target); + HEAPF64[((width)>>3)]=rect.width; + HEAPF64[((height)>>3)]=rect.height; + + return 0; + } + + + function __fillGamepadEventData(eventStruct, e) { + HEAPF64[((eventStruct)>>3)]=e.timestamp; + for(var i = 0; i < e.axes.length; ++i) { + HEAPF64[(((eventStruct+i*8)+(16))>>3)]=e.axes[i]; + } + for(var i = 0; i < e.buttons.length; ++i) { + if (typeof(e.buttons[i]) === 'object') { + HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i].value; + } else { + HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i]; + } + } + for(var i = 0; i < e.buttons.length; ++i) { + if (typeof(e.buttons[i]) === 'object') { + HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i].pressed; + } else { + // Assigning a boolean to HEAP32, that's ok, but Closure would like to warn about it: + /** @suppress {checkTypes} */ + HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i] == 1; + } + } + HEAP32[(((eventStruct)+(1296))>>2)]=e.connected; + HEAP32[(((eventStruct)+(1300))>>2)]=e.index; + HEAP32[(((eventStruct)+(8))>>2)]=e.axes.length; + HEAP32[(((eventStruct)+(12))>>2)]=e.buttons.length; + stringToUTF8(e.id, eventStruct + 1304, 64); + stringToUTF8(e.mapping, eventStruct + 1368, 64); + }function _emscripten_get_gamepad_status(index, gamepadState) { + if (!JSEvents.lastGamepadState) throw 'emscripten_get_gamepad_status() can only be called after having first called emscripten_sample_gamepad_data() and that function has returned EMSCRIPTEN_RESULT_SUCCESS!'; + + // INVALID_PARAM is returned on a Gamepad index that never was there. + if (index < 0 || index >= JSEvents.lastGamepadState.length) return -5; + + // NO_DATA is returned on a Gamepad index that was removed. + // For previously disconnected gamepads there should be an empty slot (null/undefined/false) at the index. + // This is because gamepads must keep their original position in the array. + // For example, removing the first of two gamepads produces [null/undefined/false, gamepad]. + if (!JSEvents.lastGamepadState[index]) return -7; + + __fillGamepadEventData(gamepadState, JSEvents.lastGamepadState[index]); + return 0; + } + + function _emscripten_get_num_gamepads() { + if (!JSEvents.lastGamepadState) throw 'emscripten_get_num_gamepads() can only be called after having first called emscripten_sample_gamepad_data() and that function has returned EMSCRIPTEN_RESULT_SUCCESS!'; + // N.B. Do not call emscripten_get_num_gamepads() unless having first called emscripten_sample_gamepad_data(), and that has returned EMSCRIPTEN_RESULT_SUCCESS. + // Otherwise the following line will throw an exception. + return JSEvents.lastGamepadState.length; + } + + function _emscripten_get_sbrk_ptr() { + return 702336; + } + + function _emscripten_glActiveTexture(x0) { GLctx['activeTexture'](x0) } + + function _emscripten_glAttachShader(program, shader) { + GLctx.attachShader(GL.programs[program], + GL.shaders[shader]); + } + + function _emscripten_glBeginQueryEXT(target, id) { + GLctx.disjointTimerQueryExt['beginQueryEXT'](target, GL.timerQueriesEXT[id]); + } + + function _emscripten_glBindAttribLocation(program, index, name) { + GLctx.bindAttribLocation(GL.programs[program], index, UTF8ToString(name)); + } + + function _emscripten_glBindBuffer(target, buffer) { + + GLctx.bindBuffer(target, GL.buffers[buffer]); + } + + function _emscripten_glBindFramebuffer(target, framebuffer) { + + GLctx.bindFramebuffer(target, GL.framebuffers[framebuffer]); + + } + + function _emscripten_glBindRenderbuffer(target, renderbuffer) { + GLctx.bindRenderbuffer(target, GL.renderbuffers[renderbuffer]); + } + + function _emscripten_glBindTexture(target, texture) { + GLctx.bindTexture(target, GL.textures[texture]); + } + + function _emscripten_glBindVertexArrayOES(vao) { + GLctx['bindVertexArray'](GL.vaos[vao]); + } + + function _emscripten_glBlendColor(x0, x1, x2, x3) { GLctx['blendColor'](x0, x1, x2, x3) } + + function _emscripten_glBlendEquation(x0) { GLctx['blendEquation'](x0) } + + function _emscripten_glBlendEquationSeparate(x0, x1) { GLctx['blendEquationSeparate'](x0, x1) } + + function _emscripten_glBlendFunc(x0, x1) { GLctx['blendFunc'](x0, x1) } + + function _emscripten_glBlendFuncSeparate(x0, x1, x2, x3) { GLctx['blendFuncSeparate'](x0, x1, x2, x3) } + + function _emscripten_glBufferData(target, size, data, usage) { + + // N.b. here first form specifies a heap subarray, second form an integer size, so the ?: code here is polymorphic. It is advised to avoid + // randomly mixing both uses in calling code, to avoid any potential JS engine JIT issues. + GLctx.bufferData(target, data ? HEAPU8.subarray(data, data+size) : size, usage); + } + + function _emscripten_glBufferSubData(target, offset, size, data) { + GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size)); + } + + function _emscripten_glCheckFramebufferStatus(x0) { return GLctx['checkFramebufferStatus'](x0) } + + function _emscripten_glClear(x0) { GLctx['clear'](x0) } + + function _emscripten_glClearColor(x0, x1, x2, x3) { GLctx['clearColor'](x0, x1, x2, x3) } + + function _emscripten_glClearDepthf(x0) { GLctx['clearDepth'](x0) } + + function _emscripten_glClearStencil(x0) { GLctx['clearStencil'](x0) } + + function _emscripten_glColorMask(red, green, blue, alpha) { + GLctx.colorMask(!!red, !!green, !!blue, !!alpha); + } + + function _emscripten_glCompileShader(shader) { + GLctx.compileShader(GL.shaders[shader]); + } + + function _emscripten_glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) { + GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, data ? HEAPU8.subarray((data),(data+imageSize)) : null); + } + + function _emscripten_glCompressedTexSubImage2D(target, level, xoffset, yoffset, width, height, format, imageSize, data) { + GLctx['compressedTexSubImage2D'](target, level, xoffset, yoffset, width, height, format, data ? HEAPU8.subarray((data),(data+imageSize)) : null); + } + + function _emscripten_glCopyTexImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx['copyTexImage2D'](x0, x1, x2, x3, x4, x5, x6, x7) } + + function _emscripten_glCopyTexSubImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx['copyTexSubImage2D'](x0, x1, x2, x3, x4, x5, x6, x7) } + + function _emscripten_glCreateProgram() { + var id = GL.getNewId(GL.programs); + var program = GLctx.createProgram(); + program.name = id; + GL.programs[id] = program; + return id; + } + + function _emscripten_glCreateShader(shaderType) { + var id = GL.getNewId(GL.shaders); + GL.shaders[id] = GLctx.createShader(shaderType); + return id; + } + + function _emscripten_glCullFace(x0) { GLctx['cullFace'](x0) } + + function _emscripten_glDeleteBuffers(n, buffers) { + for (var i = 0; i < n; i++) { + var id = HEAP32[(((buffers)+(i*4))>>2)]; + var buffer = GL.buffers[id]; + + // From spec: "glDeleteBuffers silently ignores 0's and names that do not + // correspond to existing buffer objects." + if (!buffer) continue; + + GLctx.deleteBuffer(buffer); + buffer.name = 0; + GL.buffers[id] = null; + + } + } + + function _emscripten_glDeleteFramebuffers(n, framebuffers) { + for (var i = 0; i < n; ++i) { + var id = HEAP32[(((framebuffers)+(i*4))>>2)]; + var framebuffer = GL.framebuffers[id]; + if (!framebuffer) continue; // GL spec: "glDeleteFramebuffers silently ignores 0s and names that do not correspond to existing framebuffer objects". + GLctx.deleteFramebuffer(framebuffer); + framebuffer.name = 0; + GL.framebuffers[id] = null; + } + } + + function _emscripten_glDeleteProgram(id) { + if (!id) return; + var program = GL.programs[id]; + if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + GLctx.deleteProgram(program); + program.name = 0; + GL.programs[id] = null; + GL.programInfos[id] = null; + } + + function _emscripten_glDeleteQueriesEXT(n, ids) { + for (var i = 0; i < n; i++) { + var id = HEAP32[(((ids)+(i*4))>>2)]; + var query = GL.timerQueriesEXT[id]; + if (!query) continue; // GL spec: "unused names in ids are ignored, as is the name zero." + GLctx.disjointTimerQueryExt['deleteQueryEXT'](query); + GL.timerQueriesEXT[id] = null; + } + } + + function _emscripten_glDeleteRenderbuffers(n, renderbuffers) { + for (var i = 0; i < n; i++) { + var id = HEAP32[(((renderbuffers)+(i*4))>>2)]; + var renderbuffer = GL.renderbuffers[id]; + if (!renderbuffer) continue; // GL spec: "glDeleteRenderbuffers silently ignores 0s and names that do not correspond to existing renderbuffer objects". + GLctx.deleteRenderbuffer(renderbuffer); + renderbuffer.name = 0; + GL.renderbuffers[id] = null; + } + } + + function _emscripten_glDeleteShader(id) { + if (!id) return; + var shader = GL.shaders[id]; + if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + GLctx.deleteShader(shader); + GL.shaders[id] = null; + } + + function _emscripten_glDeleteTextures(n, textures) { + for (var i = 0; i < n; i++) { + var id = HEAP32[(((textures)+(i*4))>>2)]; + var texture = GL.textures[id]; + if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures". + GLctx.deleteTexture(texture); + texture.name = 0; + GL.textures[id] = null; + } + } + + function _emscripten_glDeleteVertexArraysOES(n, vaos) { + for (var i = 0; i < n; i++) { + var id = HEAP32[(((vaos)+(i*4))>>2)]; + GLctx['deleteVertexArray'](GL.vaos[id]); + GL.vaos[id] = null; + } + } + + function _emscripten_glDepthFunc(x0) { GLctx['depthFunc'](x0) } + + function _emscripten_glDepthMask(flag) { + GLctx.depthMask(!!flag); + } + + function _emscripten_glDepthRangef(x0, x1) { GLctx['depthRange'](x0, x1) } + + function _emscripten_glDetachShader(program, shader) { + GLctx.detachShader(GL.programs[program], + GL.shaders[shader]); + } + + function _emscripten_glDisable(x0) { GLctx['disable'](x0) } + + function _emscripten_glDisableVertexAttribArray(index) { + GLctx.disableVertexAttribArray(index); + } + + function _emscripten_glDrawArrays(mode, first, count) { + + GLctx.drawArrays(mode, first, count); + + } + + function _emscripten_glDrawArraysInstancedANGLE(mode, first, count, primcount) { + GLctx['drawArraysInstanced'](mode, first, count, primcount); + } + + + var tempFixedLengthArray=[];function _emscripten_glDrawBuffersWEBGL(n, bufs) { + + var bufArray = tempFixedLengthArray[n]; + for (var i = 0; i < n; i++) { + bufArray[i] = HEAP32[(((bufs)+(i*4))>>2)]; + } + + GLctx['drawBuffers'](bufArray); + } + + function _emscripten_glDrawElements(mode, count, type, indices) { + + GLctx.drawElements(mode, count, type, indices); + + } + + function _emscripten_glDrawElementsInstancedANGLE(mode, count, type, indices, primcount) { + GLctx['drawElementsInstanced'](mode, count, type, indices, primcount); + } + + function _emscripten_glEnable(x0) { GLctx['enable'](x0) } + + function _emscripten_glEnableVertexAttribArray(index) { + GLctx.enableVertexAttribArray(index); + } + + function _emscripten_glEndQueryEXT(target) { + GLctx.disjointTimerQueryExt['endQueryEXT'](target); + } + + function _emscripten_glFinish() { GLctx['finish']() } + + function _emscripten_glFlush() { GLctx['flush']() } + + function _emscripten_glFramebufferRenderbuffer(target, attachment, renderbuffertarget, renderbuffer) { + GLctx.framebufferRenderbuffer(target, attachment, renderbuffertarget, + GL.renderbuffers[renderbuffer]); + } + + function _emscripten_glFramebufferTexture2D(target, attachment, textarget, texture, level) { + GLctx.framebufferTexture2D(target, attachment, textarget, + GL.textures[texture], level); + } + + function _emscripten_glFrontFace(x0) { GLctx['frontFace'](x0) } + + + function __glGenObject(n, buffers, createFunction, objectTable + ) { + for (var i = 0; i < n; i++) { + var buffer = GLctx[createFunction](); + var id = buffer && GL.getNewId(objectTable); + if (buffer) { + buffer.name = id; + objectTable[id] = buffer; + } else { + GL.recordError(0x502 /* GL_INVALID_OPERATION */); + } + HEAP32[(((buffers)+(i*4))>>2)]=id; + } + }function _emscripten_glGenBuffers(n, buffers) { + __glGenObject(n, buffers, 'createBuffer', GL.buffers + ); + } + + function _emscripten_glGenFramebuffers(n, ids) { + __glGenObject(n, ids, 'createFramebuffer', GL.framebuffers + ); + } + + function _emscripten_glGenQueriesEXT(n, ids) { + for (var i = 0; i < n; i++) { + var query = GLctx.disjointTimerQueryExt['createQueryEXT'](); + if (!query) { + GL.recordError(0x502 /* GL_INVALID_OPERATION */); + while(i < n) HEAP32[(((ids)+(i++*4))>>2)]=0; + return; + } + var id = GL.getNewId(GL.timerQueriesEXT); + query.name = id; + GL.timerQueriesEXT[id] = query; + HEAP32[(((ids)+(i*4))>>2)]=id; + } + } + + function _emscripten_glGenRenderbuffers(n, renderbuffers) { + __glGenObject(n, renderbuffers, 'createRenderbuffer', GL.renderbuffers + ); + } + + function _emscripten_glGenTextures(n, textures) { + __glGenObject(n, textures, 'createTexture', GL.textures + ); + } + + function _emscripten_glGenVertexArraysOES(n, arrays) { + __glGenObject(n, arrays, 'createVertexArray', GL.vaos + ); + } + + function _emscripten_glGenerateMipmap(x0) { GLctx['generateMipmap'](x0) } + + + function __glGetActiveAttribOrUniform(funcName, program, index, bufSize, length, size, type, name) { + program = GL.programs[program]; + var info = GLctx[funcName](program, index); + if (info) { // If an error occurs, nothing will be written to length, size and type and name. + var numBytesWrittenExclNull = name && stringToUTF8(info.name, name, bufSize); + if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull; + if (size) HEAP32[((size)>>2)]=info.size; + if (type) HEAP32[((type)>>2)]=info.type; + } + }function _emscripten_glGetActiveAttrib(program, index, bufSize, length, size, type, name) { + __glGetActiveAttribOrUniform('getActiveAttrib', program, index, bufSize, length, size, type, name); + } + + function _emscripten_glGetActiveUniform(program, index, bufSize, length, size, type, name) { + __glGetActiveAttribOrUniform('getActiveUniform', program, index, bufSize, length, size, type, name); + } + + function _emscripten_glGetAttachedShaders(program, maxCount, count, shaders) { + var result = GLctx.getAttachedShaders(GL.programs[program]); + var len = result.length; + if (len > maxCount) { + len = maxCount; + } + HEAP32[((count)>>2)]=len; + for (var i = 0; i < len; ++i) { + var id = GL.shaders.indexOf(result[i]); + HEAP32[(((shaders)+(i*4))>>2)]=id; + } + } + + function _emscripten_glGetAttribLocation(program, name) { + return GLctx.getAttribLocation(GL.programs[program], UTF8ToString(name)); + } + + + + + function readI53FromI64(ptr) { + return HEAPU32[ptr>>2] + HEAP32[ptr+4>>2] * 4294967296; + } + + function readI53FromU64(ptr) { + return HEAPU32[ptr>>2] + HEAPU32[ptr+4>>2] * 4294967296; + }function writeI53ToI64(ptr, num) { + HEAPU32[ptr>>2] = num; + HEAPU32[ptr+4>>2] = (num - HEAPU32[ptr>>2])/4294967296; + var deserialized = (num >= 0) ? readI53FromU64(ptr) : readI53FromI64(ptr); + if (deserialized != num) warnOnce('writeI53ToI64() out of range: serialized JS Number ' + num + ' to Wasm heap as bytes lo=0x' + HEAPU32[ptr>>2].toString(16) + ', hi=0x' + HEAPU32[ptr+4>>2].toString(16) + ', which deserializes back to ' + deserialized + ' instead!'); + }function emscriptenWebGLGet(name_, p, type) { + // Guard against user passing a null pointer. + // Note that GLES2 spec does not say anything about how passing a null pointer should be treated. + // Testing on desktop core GL 3, the application crashes on glGetIntegerv to a null pointer, but + // better to report an error instead of doing anything random. + if (!p) { + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + var ret = undefined; + switch(name_) { // Handle a few trivial GLES values + case 0x8DFA: // GL_SHADER_COMPILER + ret = 1; + break; + case 0x8DF8: // GL_SHADER_BINARY_FORMATS + if (type != 0 && type != 1) { + GL.recordError(0x500); // GL_INVALID_ENUM + } + return; // Do not write anything to the out pointer, since no binary formats are supported. + case 0x8DF9: // GL_NUM_SHADER_BINARY_FORMATS + ret = 0; + break; + case 0x86A2: // GL_NUM_COMPRESSED_TEXTURE_FORMATS + // WebGL doesn't have GL_NUM_COMPRESSED_TEXTURE_FORMATS (it's obsolete since GL_COMPRESSED_TEXTURE_FORMATS returns a JS array that can be queried for length), + // so implement it ourselves to allow C++ GLES2 code get the length. + var formats = GLctx.getParameter(0x86A3 /*GL_COMPRESSED_TEXTURE_FORMATS*/); + ret = formats ? formats.length : 0; + break; + } + + if (ret === undefined) { + var result = GLctx.getParameter(name_); + switch (typeof(result)) { + case "number": + ret = result; + break; + case "boolean": + ret = result ? 1 : 0; + break; + case "string": + GL.recordError(0x500); // GL_INVALID_ENUM + return; + case "object": + if (result === null) { + // null is a valid result for some (e.g., which buffer is bound - perhaps nothing is bound), but otherwise + // can mean an invalid name_, which we need to report as an error + switch(name_) { + case 0x8894: // ARRAY_BUFFER_BINDING + case 0x8B8D: // CURRENT_PROGRAM + case 0x8895: // ELEMENT_ARRAY_BUFFER_BINDING + case 0x8CA6: // FRAMEBUFFER_BINDING or DRAW_FRAMEBUFFER_BINDING + case 0x8CA7: // RENDERBUFFER_BINDING + case 0x8069: // TEXTURE_BINDING_2D + case 0x85B5: // WebGL 2 GL_VERTEX_ARRAY_BINDING, or WebGL 1 extension OES_vertex_array_object GL_VERTEX_ARRAY_BINDING_OES + case 0x8514: { // TEXTURE_BINDING_CUBE_MAP + ret = 0; + break; + } + default: { + GL.recordError(0x500); // GL_INVALID_ENUM + return; + } + } + } else if (result instanceof Float32Array || + result instanceof Uint32Array || + result instanceof Int32Array || + result instanceof Array) { + for (var i = 0; i < result.length; ++i) { + switch (type) { + case 0: HEAP32[(((p)+(i*4))>>2)]=result[i]; break; + case 2: HEAPF32[(((p)+(i*4))>>2)]=result[i]; break; + case 4: HEAP8[(((p)+(i))>>0)]=result[i] ? 1 : 0; break; + } + } + return; + } else { + try { + ret = result.name | 0; + } catch(e) { + GL.recordError(0x500); // GL_INVALID_ENUM + err('GL_INVALID_ENUM in glGet' + type + 'v: Unknown object returned from WebGL getParameter(' + name_ + ')! (error: ' + e + ')'); + return; + } + } + break; + default: + GL.recordError(0x500); // GL_INVALID_ENUM + err('GL_INVALID_ENUM in glGet' + type + 'v: Native code calling glGet' + type + 'v(' + name_ + ') and it returns ' + result + ' of type ' + typeof(result) + '!'); + return; + } + } + + switch (type) { + case 1: writeI53ToI64(p, ret); break; + case 0: HEAP32[((p)>>2)]=ret; break; + case 2: HEAPF32[((p)>>2)]=ret; break; + case 4: HEAP8[((p)>>0)]=ret ? 1 : 0; break; + } + }function _emscripten_glGetBooleanv(name_, p) { + emscriptenWebGLGet(name_, p, 4); + } + + function _emscripten_glGetBufferParameteriv(target, value, data) { + if (!data) { + // GLES2 specification does not specify how to behave if data is a null pointer. Since calling this function does not make sense + // if data == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + HEAP32[((data)>>2)]=GLctx.getBufferParameter(target, value); + } + + function _emscripten_glGetError() { + var error = GLctx.getError() || GL.lastError; + GL.lastError = 0/*GL_NO_ERROR*/; + return error; + } + + function _emscripten_glGetFloatv(name_, p) { + emscriptenWebGLGet(name_, p, 2); + } + + function _emscripten_glGetFramebufferAttachmentParameteriv(target, attachment, pname, params) { + var result = GLctx.getFramebufferAttachmentParameter(target, attachment, pname); + if (result instanceof WebGLRenderbuffer || + result instanceof WebGLTexture) { + result = result.name | 0; + } + HEAP32[((params)>>2)]=result; + } + + function _emscripten_glGetIntegerv(name_, p) { + emscriptenWebGLGet(name_, p, 0); + } + + function _emscripten_glGetProgramInfoLog(program, maxLength, length, infoLog) { + var log = GLctx.getProgramInfoLog(GL.programs[program]); + if (log === null) log = '(unknown error)'; + var numBytesWrittenExclNull = (maxLength > 0 && infoLog) ? stringToUTF8(log, infoLog, maxLength) : 0; + if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull; + } + + function _emscripten_glGetProgramiv(program, pname, p) { + if (!p) { + // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + + if (program >= GL.counter) { + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + + var ptable = GL.programInfos[program]; + if (!ptable) { + GL.recordError(0x502 /* GL_INVALID_OPERATION */); + return; + } + + if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH + var log = GLctx.getProgramInfoLog(GL.programs[program]); + if (log === null) log = '(unknown error)'; + HEAP32[((p)>>2)]=log.length + 1; + } else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) { + HEAP32[((p)>>2)]=ptable.maxUniformLength; + } else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) { + if (ptable.maxAttributeLength == -1) { + program = GL.programs[program]; + var numAttribs = GLctx.getProgramParameter(program, 0x8B89/*GL_ACTIVE_ATTRIBUTES*/); + ptable.maxAttributeLength = 0; // Spec says if there are no active attribs, 0 must be returned. + for (var i = 0; i < numAttribs; ++i) { + var activeAttrib = GLctx.getActiveAttrib(program, i); + ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length+1); + } + } + HEAP32[((p)>>2)]=ptable.maxAttributeLength; + } else if (pname == 0x8A35 /* GL_ACTIVE_UNIFORM_BLOCK_MAX_NAME_LENGTH */) { + if (ptable.maxUniformBlockNameLength == -1) { + program = GL.programs[program]; + var numBlocks = GLctx.getProgramParameter(program, 0x8A36/*GL_ACTIVE_UNIFORM_BLOCKS*/); + ptable.maxUniformBlockNameLength = 0; + for (var i = 0; i < numBlocks; ++i) { + var activeBlockName = GLctx.getActiveUniformBlockName(program, i); + ptable.maxUniformBlockNameLength = Math.max(ptable.maxUniformBlockNameLength, activeBlockName.length+1); + } + } + HEAP32[((p)>>2)]=ptable.maxUniformBlockNameLength; + } else { + HEAP32[((p)>>2)]=GLctx.getProgramParameter(GL.programs[program], pname); + } + } + + function _emscripten_glGetQueryObjecti64vEXT(id, pname, params) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + var query = GL.timerQueriesEXT[id]; + var param = GLctx.disjointTimerQueryExt['getQueryObjectEXT'](query, pname); + var ret; + if (typeof param == 'boolean') { + ret = param ? 1 : 0; + } else { + ret = param; + } + writeI53ToI64(params, ret); + } + + function _emscripten_glGetQueryObjectivEXT(id, pname, params) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + var query = GL.timerQueriesEXT[id]; + var param = GLctx.disjointTimerQueryExt['getQueryObjectEXT'](query, pname); + var ret; + if (typeof param == 'boolean') { + ret = param ? 1 : 0; + } else { + ret = param; + } + HEAP32[((params)>>2)]=ret; + } + + function _emscripten_glGetQueryObjectui64vEXT(id, pname, params) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + var query = GL.timerQueriesEXT[id]; + var param = GLctx.disjointTimerQueryExt['getQueryObjectEXT'](query, pname); + var ret; + if (typeof param == 'boolean') { + ret = param ? 1 : 0; + } else { + ret = param; + } + writeI53ToI64(params, ret); + } + + function _emscripten_glGetQueryObjectuivEXT(id, pname, params) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + var query = GL.timerQueriesEXT[id]; + var param = GLctx.disjointTimerQueryExt['getQueryObjectEXT'](query, pname); + var ret; + if (typeof param == 'boolean') { + ret = param ? 1 : 0; + } else { + ret = param; + } + HEAP32[((params)>>2)]=ret; + } + + function _emscripten_glGetQueryivEXT(target, pname, params) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + HEAP32[((params)>>2)]=GLctx.disjointTimerQueryExt['getQueryEXT'](target, pname); + } + + function _emscripten_glGetRenderbufferParameteriv(target, pname, params) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if params == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + HEAP32[((params)>>2)]=GLctx.getRenderbufferParameter(target, pname); + } + + function _emscripten_glGetShaderInfoLog(shader, maxLength, length, infoLog) { + var log = GLctx.getShaderInfoLog(GL.shaders[shader]); + if (log === null) log = '(unknown error)'; + var numBytesWrittenExclNull = (maxLength > 0 && infoLog) ? stringToUTF8(log, infoLog, maxLength) : 0; + if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull; + } + + function _emscripten_glGetShaderPrecisionFormat(shaderType, precisionType, range, precision) { + var result = GLctx.getShaderPrecisionFormat(shaderType, precisionType); + HEAP32[((range)>>2)]=result.rangeMin; + HEAP32[(((range)+(4))>>2)]=result.rangeMax; + HEAP32[((precision)>>2)]=result.precision; + } + + function _emscripten_glGetShaderSource(shader, bufSize, length, source) { + var result = GLctx.getShaderSource(GL.shaders[shader]); + if (!result) return; // If an error occurs, nothing will be written to length or source. + var numBytesWrittenExclNull = (bufSize > 0 && source) ? stringToUTF8(result, source, bufSize) : 0; + if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull; + } + + function _emscripten_glGetShaderiv(shader, pname, p) { + if (!p) { + // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH + var log = GLctx.getShaderInfoLog(GL.shaders[shader]); + if (log === null) log = '(unknown error)'; + // The GLES2 specification says that if the shader has an empty info log, + // a value of 0 is returned. Otherwise the log has a null char appended. + // (An empty string is falsey, so we can just check that instead of + // looking at log.length.) + var logLength = log ? log.length + 1 : 0; + HEAP32[((p)>>2)]=logLength; + } else if (pname == 0x8B88) { // GL_SHADER_SOURCE_LENGTH + var source = GLctx.getShaderSource(GL.shaders[shader]); + // source may be a null, or the empty string, both of which are falsey + // values that we report a 0 length for. + var sourceLength = source ? source.length + 1 : 0; + HEAP32[((p)>>2)]=sourceLength; + } else { + HEAP32[((p)>>2)]=GLctx.getShaderParameter(GL.shaders[shader], pname); + } + } + + + function stringToNewUTF8(jsString) { + var length = lengthBytesUTF8(jsString)+1; + var cString = _malloc(length); + stringToUTF8(jsString, cString, length); + return cString; + }function _emscripten_glGetString(name_) { + if (GL.stringCache[name_]) return GL.stringCache[name_]; + var ret; + switch(name_) { + case 0x1F03 /* GL_EXTENSIONS */: + var exts = GLctx.getSupportedExtensions() || []; // .getSupportedExtensions() can return null if context is lost, so coerce to empty array. + exts = exts.concat(exts.map(function(e) { return "GL_" + e; })); + ret = stringToNewUTF8(exts.join(' ')); + break; + case 0x1F00 /* GL_VENDOR */: + case 0x1F01 /* GL_RENDERER */: + case 0x9245 /* UNMASKED_VENDOR_WEBGL */: + case 0x9246 /* UNMASKED_RENDERER_WEBGL */: + var s = GLctx.getParameter(name_); + if (!s) { + GL.recordError(0x500/*GL_INVALID_ENUM*/); + } + ret = stringToNewUTF8(s); + break; + + case 0x1F02 /* GL_VERSION */: + var glVersion = GLctx.getParameter(0x1F02 /*GL_VERSION*/); + // return GLES version string corresponding to the version of the WebGL context + { + glVersion = 'OpenGL ES 2.0 (' + glVersion + ')'; + } + ret = stringToNewUTF8(glVersion); + break; + case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */: + var glslVersion = GLctx.getParameter(0x8B8C /*GL_SHADING_LANGUAGE_VERSION*/); + // extract the version number 'N.M' from the string 'WebGL GLSL ES N.M ...' + var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/; + var ver_num = glslVersion.match(ver_re); + if (ver_num !== null) { + if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + '0'; // ensure minor version has 2 digits + glslVersion = 'OpenGL ES GLSL ES ' + ver_num[1] + ' (' + glslVersion + ')'; + } + ret = stringToNewUTF8(glslVersion); + break; + default: + GL.recordError(0x500/*GL_INVALID_ENUM*/); + return 0; + } + GL.stringCache[name_] = ret; + return ret; + } + + function _emscripten_glGetTexParameterfv(target, pname, params) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + HEAPF32[((params)>>2)]=GLctx.getTexParameter(target, pname); + } + + function _emscripten_glGetTexParameteriv(target, pname, params) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + HEAP32[((params)>>2)]=GLctx.getTexParameter(target, pname); + } + + function _emscripten_glGetUniformLocation(program, name) { + name = UTF8ToString(name); + + var arrayIndex = 0; + // If user passed an array accessor "[index]", parse the array index off the accessor. + if (name[name.length - 1] == ']') { + var leftBrace = name.lastIndexOf('['); + arrayIndex = name[leftBrace+1] != ']' ? jstoi_q(name.slice(leftBrace + 1)) : 0; // "index]", parseInt will ignore the ']' at the end; but treat "foo[]" as "foo[0]" + name = name.slice(0, leftBrace); + } + + var uniformInfo = GL.programInfos[program] && GL.programInfos[program].uniforms[name]; // returns pair [ dimension_of_uniform_array, uniform_location ] + if (uniformInfo && arrayIndex >= 0 && arrayIndex < uniformInfo[0]) { // Check if user asked for an out-of-bounds element, i.e. for 'vec4 colors[3];' user could ask for 'colors[10]' which should return -1. + return uniformInfo[1] + arrayIndex; + } else { + return -1; + } + } + + + /** @suppress{checkTypes} */ + function emscriptenWebGLGetUniform(program, location, params, type) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if params == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + var data = GLctx.getUniform(GL.programs[program], GL.uniforms[location]); + if (typeof data == 'number' || typeof data == 'boolean') { + switch (type) { + case 0: HEAP32[((params)>>2)]=data; break; + case 2: HEAPF32[((params)>>2)]=data; break; + } + } else { + for (var i = 0; i < data.length; i++) { + switch (type) { + case 0: HEAP32[(((params)+(i*4))>>2)]=data[i]; break; + case 2: HEAPF32[(((params)+(i*4))>>2)]=data[i]; break; + } + } + } + }function _emscripten_glGetUniformfv(program, location, params) { + emscriptenWebGLGetUniform(program, location, params, 2); + } + + function _emscripten_glGetUniformiv(program, location, params) { + emscriptenWebGLGetUniform(program, location, params, 0); + } + + function _emscripten_glGetVertexAttribPointerv(index, pname, pointer) { + if (!pointer) { + // GLES2 specification does not specify how to behave if pointer is a null pointer. Since calling this function does not make sense + // if pointer == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + HEAP32[((pointer)>>2)]=GLctx.getVertexAttribOffset(index, pname); + } + + + /** @suppress{checkTypes} */ + function emscriptenWebGLGetVertexAttrib(index, pname, params, type) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if params == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + var data = GLctx.getVertexAttrib(index, pname); + if (pname == 0x889F/*VERTEX_ATTRIB_ARRAY_BUFFER_BINDING*/) { + HEAP32[((params)>>2)]=data && data["name"]; + } else if (typeof data == 'number' || typeof data == 'boolean') { + switch (type) { + case 0: HEAP32[((params)>>2)]=data; break; + case 2: HEAPF32[((params)>>2)]=data; break; + case 5: HEAP32[((params)>>2)]=Math.fround(data); break; + } + } else { + for (var i = 0; i < data.length; i++) { + switch (type) { + case 0: HEAP32[(((params)+(i*4))>>2)]=data[i]; break; + case 2: HEAPF32[(((params)+(i*4))>>2)]=data[i]; break; + case 5: HEAP32[(((params)+(i*4))>>2)]=Math.fround(data[i]); break; + } + } + } + }function _emscripten_glGetVertexAttribfv(index, pname, params) { + // N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(), + // otherwise the results are undefined. (GLES3 spec 6.1.12) + emscriptenWebGLGetVertexAttrib(index, pname, params, 2); + } + + function _emscripten_glGetVertexAttribiv(index, pname, params) { + // N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(), + // otherwise the results are undefined. (GLES3 spec 6.1.12) + emscriptenWebGLGetVertexAttrib(index, pname, params, 5); + } + + function _emscripten_glHint(x0, x1) { GLctx['hint'](x0, x1) } + + function _emscripten_glIsBuffer(buffer) { + var b = GL.buffers[buffer]; + if (!b) return 0; + return GLctx.isBuffer(b); + } + + function _emscripten_glIsEnabled(x0) { return GLctx['isEnabled'](x0) } + + function _emscripten_glIsFramebuffer(framebuffer) { + var fb = GL.framebuffers[framebuffer]; + if (!fb) return 0; + return GLctx.isFramebuffer(fb); + } + + function _emscripten_glIsProgram(program) { + program = GL.programs[program]; + if (!program) return 0; + return GLctx.isProgram(program); + } + + function _emscripten_glIsQueryEXT(id) { + var query = GL.timerQueriesEXT[id]; + if (!query) return 0; + return GLctx.disjointTimerQueryExt['isQueryEXT'](query); + } + + function _emscripten_glIsRenderbuffer(renderbuffer) { + var rb = GL.renderbuffers[renderbuffer]; + if (!rb) return 0; + return GLctx.isRenderbuffer(rb); + } + + function _emscripten_glIsShader(shader) { + var s = GL.shaders[shader]; + if (!s) return 0; + return GLctx.isShader(s); + } + + function _emscripten_glIsTexture(id) { + var texture = GL.textures[id]; + if (!texture) return 0; + return GLctx.isTexture(texture); + } + + function _emscripten_glIsVertexArrayOES(array) { + + var vao = GL.vaos[array]; + if (!vao) return 0; + return GLctx['isVertexArray'](vao); + } + + function _emscripten_glLineWidth(x0) { GLctx['lineWidth'](x0) } + + function _emscripten_glLinkProgram(program) { + GLctx.linkProgram(GL.programs[program]); + GL.populateUniformTable(program); + } + + function _emscripten_glPixelStorei(pname, param) { + if (pname == 0xCF5 /* GL_UNPACK_ALIGNMENT */) { + GL.unpackAlignment = param; + } + GLctx.pixelStorei(pname, param); + } + + function _emscripten_glPolygonOffset(x0, x1) { GLctx['polygonOffset'](x0, x1) } + + function _emscripten_glQueryCounterEXT(id, target) { + GLctx.disjointTimerQueryExt['queryCounterEXT'](GL.timerQueriesEXT[id], target); + } + + + + function computeUnpackAlignedImageSize(width, height, sizePerPixel, alignment) { + function roundedToNextMultipleOf(x, y) { + return (x + y - 1) & -y; + } + var plainRowSize = width * sizePerPixel; + var alignedRowSize = roundedToNextMultipleOf(plainRowSize, alignment); + return height * alignedRowSize; + } + + function __colorChannelsInGlTextureFormat(format) { + // Micro-optimizations for size: map format to size by subtracting smallest enum value (0x1902) from all values first. + // Also omit the most common size value (1) from the list, which is assumed by formats not on the list. + var colorChannels = { + // 0x1902 /* GL_DEPTH_COMPONENT */ - 0x1902: 1, + // 0x1906 /* GL_ALPHA */ - 0x1902: 1, + 5: 3, + 6: 4, + // 0x1909 /* GL_LUMINANCE */ - 0x1902: 1, + 8: 2, + 29502: 3, + 29504: 4, + }; + return colorChannels[format - 0x1902]||1; + } + + function heapObjectForWebGLType(type) { + // Micro-optimization for size: Subtract lowest GL enum number (0x1400/* GL_BYTE */) from type to compare + // smaller values for the heap, for shorter generated code size. + // Also the type HEAPU16 is not tested for explicitly, but any unrecognized type will return out HEAPU16. + // (since most types are HEAPU16) + type -= 0x1400; + + if (type == 1) return HEAPU8; + + + if (type == 4) return HEAP32; + + if (type == 6) return HEAPF32; + + if (type == 5 + || type == 28922 + ) + return HEAPU32; + + return HEAPU16; + } + + function heapAccessShiftForWebGLHeap(heap) { + return 31 - Math.clz32(heap.BYTES_PER_ELEMENT); + }function emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) { + var heap = heapObjectForWebGLType(type); + var shift = heapAccessShiftForWebGLHeap(heap); + var byteSize = 1<<shift; + var sizePerPixel = __colorChannelsInGlTextureFormat(format) * byteSize; + var bytes = computeUnpackAlignedImageSize(width, height, sizePerPixel, GL.unpackAlignment); + return heap.subarray(pixels >> shift, pixels + bytes >> shift); + }function _emscripten_glReadPixels(x, y, width, height, format, type, pixels) { + var pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, format); + if (!pixelData) { + GL.recordError(0x500/*GL_INVALID_ENUM*/); + return; + } + GLctx.readPixels(x, y, width, height, format, type, pixelData); + } + + function _emscripten_glReleaseShaderCompiler() { + // NOP (as allowed by GLES 2.0 spec) + } + + function _emscripten_glRenderbufferStorage(x0, x1, x2, x3) { GLctx['renderbufferStorage'](x0, x1, x2, x3) } + + function _emscripten_glSampleCoverage(value, invert) { + GLctx.sampleCoverage(value, !!invert); + } + + function _emscripten_glScissor(x0, x1, x2, x3) { GLctx['scissor'](x0, x1, x2, x3) } + + function _emscripten_glShaderBinary() { + GL.recordError(0x500/*GL_INVALID_ENUM*/); + } + + function _emscripten_glShaderSource(shader, count, string, length) { + var source = GL.getSource(shader, count, string, length); + + + GLctx.shaderSource(GL.shaders[shader], source); + } + + function _emscripten_glStencilFunc(x0, x1, x2) { GLctx['stencilFunc'](x0, x1, x2) } + + function _emscripten_glStencilFuncSeparate(x0, x1, x2, x3) { GLctx['stencilFuncSeparate'](x0, x1, x2, x3) } + + function _emscripten_glStencilMask(x0) { GLctx['stencilMask'](x0) } + + function _emscripten_glStencilMaskSeparate(x0, x1) { GLctx['stencilMaskSeparate'](x0, x1) } + + function _emscripten_glStencilOp(x0, x1, x2) { GLctx['stencilOp'](x0, x1, x2) } + + function _emscripten_glStencilOpSeparate(x0, x1, x2, x3) { GLctx['stencilOpSeparate'](x0, x1, x2, x3) } + + function _emscripten_glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) { + GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixels ? emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) : null); + } + + function _emscripten_glTexParameterf(x0, x1, x2) { GLctx['texParameterf'](x0, x1, x2) } + + function _emscripten_glTexParameterfv(target, pname, params) { + var param = HEAPF32[((params)>>2)]; + GLctx.texParameterf(target, pname, param); + } + + function _emscripten_glTexParameteri(x0, x1, x2) { GLctx['texParameteri'](x0, x1, x2) } + + function _emscripten_glTexParameteriv(target, pname, params) { + var param = HEAP32[((params)>>2)]; + GLctx.texParameteri(target, pname, param); + } + + function _emscripten_glTexSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels) { + var pixelData = null; + if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, 0); + GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixelData); + } + + function _emscripten_glUniform1f(location, v0) { + GLctx.uniform1f(GL.uniforms[location], v0); + } + + + var miniTempWebGLFloatBuffers=[];function _emscripten_glUniform1fv(location, count, value) { + + + + if (count <= 288) { + // avoid allocation when uploading few enough uniforms + var view = miniTempWebGLFloatBuffers[count-1]; + for (var i = 0; i < count; ++i) { + view[i] = HEAPF32[(((value)+(4*i))>>2)]; + } + } else + { + var view = HEAPF32.subarray((value)>>2,(value+count*4)>>2); + } + GLctx.uniform1fv(GL.uniforms[location], view); + } + + function _emscripten_glUniform1i(location, v0) { + GLctx.uniform1i(GL.uniforms[location], v0); + } + + + var __miniTempWebGLIntBuffers=[];function _emscripten_glUniform1iv(location, count, value) { + + + + if (count <= 288) { + // avoid allocation when uploading few enough uniforms + var view = __miniTempWebGLIntBuffers[count-1]; + for (var i = 0; i < count; ++i) { + view[i] = HEAP32[(((value)+(4*i))>>2)]; + } + } else + { + var view = HEAP32.subarray((value)>>2,(value+count*4)>>2); + } + GLctx.uniform1iv(GL.uniforms[location], view); + } + + function _emscripten_glUniform2f(location, v0, v1) { + GLctx.uniform2f(GL.uniforms[location], v0, v1); + } + + function _emscripten_glUniform2fv(location, count, value) { + + + + if (count <= 144) { + // avoid allocation when uploading few enough uniforms + var view = miniTempWebGLFloatBuffers[2*count-1]; + for (var i = 0; i < 2*count; i += 2) { + view[i] = HEAPF32[(((value)+(4*i))>>2)]; + view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)]; + } + } else + { + var view = HEAPF32.subarray((value)>>2,(value+count*8)>>2); + } + GLctx.uniform2fv(GL.uniforms[location], view); + } + + function _emscripten_glUniform2i(location, v0, v1) { + GLctx.uniform2i(GL.uniforms[location], v0, v1); + } + + function _emscripten_glUniform2iv(location, count, value) { + + + + if (count <= 144) { + // avoid allocation when uploading few enough uniforms + var view = __miniTempWebGLIntBuffers[2*count-1]; + for (var i = 0; i < 2*count; i += 2) { + view[i] = HEAP32[(((value)+(4*i))>>2)]; + view[i+1] = HEAP32[(((value)+(4*i+4))>>2)]; + } + } else + { + var view = HEAP32.subarray((value)>>2,(value+count*8)>>2); + } + GLctx.uniform2iv(GL.uniforms[location], view); + } + + function _emscripten_glUniform3f(location, v0, v1, v2) { + GLctx.uniform3f(GL.uniforms[location], v0, v1, v2); + } + + function _emscripten_glUniform3fv(location, count, value) { + + + + if (count <= 96) { + // avoid allocation when uploading few enough uniforms + var view = miniTempWebGLFloatBuffers[3*count-1]; + for (var i = 0; i < 3*count; i += 3) { + view[i] = HEAPF32[(((value)+(4*i))>>2)]; + view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)]; + view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)]; + } + } else + { + var view = HEAPF32.subarray((value)>>2,(value+count*12)>>2); + } + GLctx.uniform3fv(GL.uniforms[location], view); + } + + function _emscripten_glUniform3i(location, v0, v1, v2) { + GLctx.uniform3i(GL.uniforms[location], v0, v1, v2); + } + + function _emscripten_glUniform3iv(location, count, value) { + + + + if (count <= 96) { + // avoid allocation when uploading few enough uniforms + var view = __miniTempWebGLIntBuffers[3*count-1]; + for (var i = 0; i < 3*count; i += 3) { + view[i] = HEAP32[(((value)+(4*i))>>2)]; + view[i+1] = HEAP32[(((value)+(4*i+4))>>2)]; + view[i+2] = HEAP32[(((value)+(4*i+8))>>2)]; + } + } else + { + var view = HEAP32.subarray((value)>>2,(value+count*12)>>2); + } + GLctx.uniform3iv(GL.uniforms[location], view); + } + + function _emscripten_glUniform4f(location, v0, v1, v2, v3) { + GLctx.uniform4f(GL.uniforms[location], v0, v1, v2, v3); + } + + function _emscripten_glUniform4fv(location, count, value) { + + + + if (count <= 72) { + // avoid allocation when uploading few enough uniforms + var view = miniTempWebGLFloatBuffers[4*count-1]; + // hoist the heap out of the loop for size and for pthreads+growth. + var heap = HEAPF32; + value >>= 2; + for (var i = 0; i < 4 * count; i += 4) { + var dst = value + i; + view[i] = heap[dst]; + view[i + 1] = heap[dst + 1]; + view[i + 2] = heap[dst + 2]; + view[i + 3] = heap[dst + 3]; + } + } else + { + var view = HEAPF32.subarray((value)>>2,(value+count*16)>>2); + } + GLctx.uniform4fv(GL.uniforms[location], view); + } + + function _emscripten_glUniform4i(location, v0, v1, v2, v3) { + GLctx.uniform4i(GL.uniforms[location], v0, v1, v2, v3); + } + + function _emscripten_glUniform4iv(location, count, value) { + + + + if (count <= 72) { + // avoid allocation when uploading few enough uniforms + var view = __miniTempWebGLIntBuffers[4*count-1]; + for (var i = 0; i < 4*count; i += 4) { + view[i] = HEAP32[(((value)+(4*i))>>2)]; + view[i+1] = HEAP32[(((value)+(4*i+4))>>2)]; + view[i+2] = HEAP32[(((value)+(4*i+8))>>2)]; + view[i+3] = HEAP32[(((value)+(4*i+12))>>2)]; + } + } else + { + var view = HEAP32.subarray((value)>>2,(value+count*16)>>2); + } + GLctx.uniform4iv(GL.uniforms[location], view); + } + + function _emscripten_glUniformMatrix2fv(location, count, transpose, value) { + + + + if (count <= 72) { + // avoid allocation when uploading few enough uniforms + var view = miniTempWebGLFloatBuffers[4*count-1]; + for (var i = 0; i < 4*count; i += 4) { + view[i] = HEAPF32[(((value)+(4*i))>>2)]; + view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)]; + view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)]; + view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)]; + } + } else + { + var view = HEAPF32.subarray((value)>>2,(value+count*16)>>2); + } + GLctx.uniformMatrix2fv(GL.uniforms[location], !!transpose, view); + } + + function _emscripten_glUniformMatrix3fv(location, count, transpose, value) { + + + + if (count <= 32) { + // avoid allocation when uploading few enough uniforms + var view = miniTempWebGLFloatBuffers[9*count-1]; + for (var i = 0; i < 9*count; i += 9) { + view[i] = HEAPF32[(((value)+(4*i))>>2)]; + view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)]; + view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)]; + view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)]; + view[i+4] = HEAPF32[(((value)+(4*i+16))>>2)]; + view[i+5] = HEAPF32[(((value)+(4*i+20))>>2)]; + view[i+6] = HEAPF32[(((value)+(4*i+24))>>2)]; + view[i+7] = HEAPF32[(((value)+(4*i+28))>>2)]; + view[i+8] = HEAPF32[(((value)+(4*i+32))>>2)]; + } + } else + { + var view = HEAPF32.subarray((value)>>2,(value+count*36)>>2); + } + GLctx.uniformMatrix3fv(GL.uniforms[location], !!transpose, view); + } + + function _emscripten_glUniformMatrix4fv(location, count, transpose, value) { + + + + if (count <= 18) { + // avoid allocation when uploading few enough uniforms + var view = miniTempWebGLFloatBuffers[16*count-1]; + // hoist the heap out of the loop for size and for pthreads+growth. + var heap = HEAPF32; + value >>= 2; + for (var i = 0; i < 16 * count; i += 16) { + var dst = value + i; + view[i] = heap[dst]; + view[i + 1] = heap[dst + 1]; + view[i + 2] = heap[dst + 2]; + view[i + 3] = heap[dst + 3]; + view[i + 4] = heap[dst + 4]; + view[i + 5] = heap[dst + 5]; + view[i + 6] = heap[dst + 6]; + view[i + 7] = heap[dst + 7]; + view[i + 8] = heap[dst + 8]; + view[i + 9] = heap[dst + 9]; + view[i + 10] = heap[dst + 10]; + view[i + 11] = heap[dst + 11]; + view[i + 12] = heap[dst + 12]; + view[i + 13] = heap[dst + 13]; + view[i + 14] = heap[dst + 14]; + view[i + 15] = heap[dst + 15]; + } + } else + { + var view = HEAPF32.subarray((value)>>2,(value+count*64)>>2); + } + GLctx.uniformMatrix4fv(GL.uniforms[location], !!transpose, view); + } + + function _emscripten_glUseProgram(program) { + GLctx.useProgram(GL.programs[program]); + } + + function _emscripten_glValidateProgram(program) { + GLctx.validateProgram(GL.programs[program]); + } + + function _emscripten_glVertexAttrib1f(x0, x1) { GLctx['vertexAttrib1f'](x0, x1) } + + function _emscripten_glVertexAttrib1fv(index, v) { + + GLctx.vertexAttrib1f(index, HEAPF32[v>>2]); + } + + function _emscripten_glVertexAttrib2f(x0, x1, x2) { GLctx['vertexAttrib2f'](x0, x1, x2) } + + function _emscripten_glVertexAttrib2fv(index, v) { + + GLctx.vertexAttrib2f(index, HEAPF32[v>>2], HEAPF32[v+4>>2]); + } + + function _emscripten_glVertexAttrib3f(x0, x1, x2, x3) { GLctx['vertexAttrib3f'](x0, x1, x2, x3) } + + function _emscripten_glVertexAttrib3fv(index, v) { + + GLctx.vertexAttrib3f(index, HEAPF32[v>>2], HEAPF32[v+4>>2], HEAPF32[v+8>>2]); + } + + function _emscripten_glVertexAttrib4f(x0, x1, x2, x3, x4) { GLctx['vertexAttrib4f'](x0, x1, x2, x3, x4) } + + function _emscripten_glVertexAttrib4fv(index, v) { + + GLctx.vertexAttrib4f(index, HEAPF32[v>>2], HEAPF32[v+4>>2], HEAPF32[v+8>>2], HEAPF32[v+12>>2]); + } + + function _emscripten_glVertexAttribDivisorANGLE(index, divisor) { + GLctx['vertexAttribDivisor'](index, divisor); + } + + function _emscripten_glVertexAttribPointer(index, size, type, normalized, stride, ptr) { + GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr); + } + + function _emscripten_glViewport(x0, x1, x2, x3) { GLctx['viewport'](x0, x1, x2, x3) } + + function _emscripten_has_asyncify() { + return 0; + } + + + function _longjmp(env, value) { + _setThrew(env, value || 1); + throw 'longjmp'; + }function _emscripten_longjmp(env, value) { + _longjmp(env, value); + } + + function _emscripten_memcpy_big(dest, src, num) { + HEAPU8.copyWithin(dest, src, src + num); + } + + + function __emscripten_do_request_fullscreen(target, strategy) { + if (!JSEvents.fullscreenEnabled()) return -1; + target = findEventTarget(target); + if (!target) return -4; + + if (!target.requestFullscreen + && !target.webkitRequestFullscreen + ) { + return -3; + } + + var canPerformRequests = JSEvents.canPerformEventHandlerRequests(); + + // Queue this function call if we're not currently in an event handler and the user saw it appropriate to do so. + if (!canPerformRequests) { + if (strategy.deferUntilInEventHandler) { + JSEvents.deferCall(_JSEvents_requestFullscreen, 1 /* priority over pointer lock */, [target, strategy]); + return 1; + } else { + return -2; + } + } + + return _JSEvents_requestFullscreen(target, strategy); + }function _emscripten_request_fullscreen_strategy(target, deferUntilInEventHandler, fullscreenStrategy) { + var strategy = { + scaleMode: HEAP32[((fullscreenStrategy)>>2)], + canvasResolutionScaleMode: HEAP32[(((fullscreenStrategy)+(4))>>2)], + filteringMode: HEAP32[(((fullscreenStrategy)+(8))>>2)], + deferUntilInEventHandler: deferUntilInEventHandler, + canvasResizedCallback: HEAP32[(((fullscreenStrategy)+(12))>>2)], + canvasResizedCallbackUserData: HEAP32[(((fullscreenStrategy)+(16))>>2)] + }; + + return __emscripten_do_request_fullscreen(target, strategy); + } + + function _emscripten_request_pointerlock(target, deferUntilInEventHandler) { + target = findEventTarget(target); + if (!target) return -4; + if (!target.requestPointerLock + && !target.msRequestPointerLock + ) { + return -1; + } + + var canPerformRequests = JSEvents.canPerformEventHandlerRequests(); + + // Queue this function call if we're not currently in an event handler and the user saw it appropriate to do so. + if (!canPerformRequests) { + if (deferUntilInEventHandler) { + JSEvents.deferCall(__requestPointerLock, 2 /* priority below fullscreen */, [target]); + return 1; + } else { + return -2; + } + } + + return __requestPointerLock(target); + } + + + function _emscripten_get_heap_size() { + return HEAPU8.length; + } + + function abortOnCannotGrowMemory(requestedSize) { + abort('Cannot enlarge memory arrays to size ' + requestedSize + ' bytes (OOM). Either (1) compile with -s INITIAL_MEMORY=X with X higher than the current value ' + HEAP8.length + ', (2) compile with -s ALLOW_MEMORY_GROWTH=1 which allows increasing the size at runtime, or (3) if you want malloc to return NULL (0) instead of this abort, compile with -s ABORTING_MALLOC=0 '); + }function _emscripten_resize_heap(requestedSize) { + requestedSize = requestedSize >>> 0; + abortOnCannotGrowMemory(requestedSize); + } + + function _emscripten_sample_gamepad_data() { + return (JSEvents.lastGamepadState = (navigator.getGamepads ? navigator.getGamepads() : (navigator.webkitGetGamepads ? navigator.webkitGetGamepads() : null))) + ? 0 : -1; + } + + + function __registerBeforeUnloadEventCallback(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + var beforeUnloadEventHandlerFunc = function(ev) { + var e = ev || event; + + // Note: This is always called on the main browser thread, since it needs synchronously return a value! + var confirmationMessage = dynCall_iiii(callbackfunc, eventTypeId, 0, userData); + + if (confirmationMessage) { + confirmationMessage = UTF8ToString(confirmationMessage); + } + if (confirmationMessage) { + e.preventDefault(); + e.returnValue = confirmationMessage; + return confirmationMessage; + } + }; + + var eventHandler = { + target: findEventTarget(target), + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: beforeUnloadEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + }function _emscripten_set_beforeunload_callback_on_thread(userData, callbackfunc, targetThread) { + if (typeof onbeforeunload === 'undefined') return -1; + // beforeunload callback can only be registered on the main browser thread, because the page will go away immediately after returning from the handler, + // and there is no time to start proxying it anywhere. + if (targetThread !== 1) return -5; + __registerBeforeUnloadEventCallback(2, userData, true, callbackfunc, 28, "beforeunload"); + return 0; + } + + + function __registerFocusEventCallback(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.focusEvent) JSEvents.focusEvent = _malloc( 256 ); + + var focusEventHandlerFunc = function(ev) { + var e = ev || event; + + var nodeName = JSEvents.getNodeNameForTarget(e.target); + var id = e.target.id ? e.target.id : ''; + + var focusEvent = JSEvents.focusEvent; + stringToUTF8(nodeName, focusEvent + 0, 128); + stringToUTF8(id, focusEvent + 128, 128); + + if (dynCall_iiii(callbackfunc, eventTypeId, focusEvent, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: findEventTarget(target), + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: focusEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + }function _emscripten_set_blur_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + __registerFocusEventCallback(target, userData, useCapture, callbackfunc, 12, "blur", targetThread); + return 0; + } + + + function _emscripten_set_element_css_size(target, width, height) { + target = findEventTarget(target); + if (!target) return -4; + + target.style.width = width + "px"; + target.style.height = height + "px"; + + return 0; + } + + function _emscripten_set_focus_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + __registerFocusEventCallback(target, userData, useCapture, callbackfunc, 13, "focus", targetThread); + return 0; + } + + + + function __fillFullscreenChangeEventData(eventStruct) { + var fullscreenElement = document.fullscreenElement || document.mozFullScreenElement || document.webkitFullscreenElement || document.msFullscreenElement; + var isFullscreen = !!fullscreenElement; + /** @suppress{checkTypes} */ + HEAP32[((eventStruct)>>2)]=isFullscreen; + HEAP32[(((eventStruct)+(4))>>2)]=JSEvents.fullscreenEnabled(); + // If transitioning to fullscreen, report info about the element that is now fullscreen. + // If transitioning to windowed mode, report info about the element that just was fullscreen. + var reportedElement = isFullscreen ? fullscreenElement : JSEvents.previousFullscreenElement; + var nodeName = JSEvents.getNodeNameForTarget(reportedElement); + var id = (reportedElement && reportedElement.id) ? reportedElement.id : ''; + stringToUTF8(nodeName, eventStruct + 8, 128); + stringToUTF8(id, eventStruct + 136, 128); + HEAP32[(((eventStruct)+(264))>>2)]=reportedElement ? reportedElement.clientWidth : 0; + HEAP32[(((eventStruct)+(268))>>2)]=reportedElement ? reportedElement.clientHeight : 0; + HEAP32[(((eventStruct)+(272))>>2)]=screen.width; + HEAP32[(((eventStruct)+(276))>>2)]=screen.height; + if (isFullscreen) { + JSEvents.previousFullscreenElement = fullscreenElement; + } + }function __registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.fullscreenChangeEvent) JSEvents.fullscreenChangeEvent = _malloc( 280 ); + + var fullscreenChangeEventhandlerFunc = function(ev) { + var e = ev || event; + + var fullscreenChangeEvent = JSEvents.fullscreenChangeEvent; + + __fillFullscreenChangeEventData(fullscreenChangeEvent); + + if (dynCall_iiii(callbackfunc, eventTypeId, fullscreenChangeEvent, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: target, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: fullscreenChangeEventhandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + }function _emscripten_set_fullscreenchange_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + if (!JSEvents.fullscreenEnabled()) return -1; + target = findEventTarget(target); + if (!target) return -4; + __registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "fullscreenchange", targetThread); + + + // Unprefixed Fullscreen API shipped in Chromium 71 (https://bugs.chromium.org/p/chromium/issues/detail?id=383813) + // As of Safari 13.0.3 on macOS Catalina 10.15.1 still ships with prefixed webkitfullscreenchange. TODO: revisit this check once Safari ships unprefixed version. + __registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "webkitfullscreenchange", targetThread); + + return 0; + } + + + function __registerGamepadEventCallback(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.gamepadEvent) JSEvents.gamepadEvent = _malloc( 1432 ); + + var gamepadEventHandlerFunc = function(ev) { + var e = ev || event; + + var gamepadEvent = JSEvents.gamepadEvent; + __fillGamepadEventData(gamepadEvent, e["gamepad"]); + + if (dynCall_iiii(callbackfunc, eventTypeId, gamepadEvent, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: findEventTarget(target), + allowsDeferredCalls: true, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: gamepadEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + }function _emscripten_set_gamepadconnected_callback_on_thread(userData, useCapture, callbackfunc, targetThread) { + if (!navigator.getGamepads && !navigator.webkitGetGamepads) return -1; + __registerGamepadEventCallback(2, userData, useCapture, callbackfunc, 26, "gamepadconnected", targetThread); + return 0; + } + + function _emscripten_set_gamepaddisconnected_callback_on_thread(userData, useCapture, callbackfunc, targetThread) { + if (!navigator.getGamepads && !navigator.webkitGetGamepads) return -1; + __registerGamepadEventCallback(2, userData, useCapture, callbackfunc, 27, "gamepaddisconnected", targetThread); + return 0; + } + + + function __registerKeyEventCallback(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.keyEvent) JSEvents.keyEvent = _malloc( 164 ); + + var keyEventHandlerFunc = function(e) { + assert(e); + + var keyEventData = JSEvents.keyEvent; + var idx = keyEventData >> 2; + + HEAP32[idx + 0] = e.location; + HEAP32[idx + 1] = e.ctrlKey; + HEAP32[idx + 2] = e.shiftKey; + HEAP32[idx + 3] = e.altKey; + HEAP32[idx + 4] = e.metaKey; + HEAP32[idx + 5] = e.repeat; + HEAP32[idx + 6] = e.charCode; + HEAP32[idx + 7] = e.keyCode; + HEAP32[idx + 8] = e.which; + stringToUTF8(e.key || '', keyEventData + 36, 32); + stringToUTF8(e.code || '', keyEventData + 68, 32); + stringToUTF8(e.char || '', keyEventData + 100, 32); + stringToUTF8(e.locale || '', keyEventData + 132, 32); + + if (dynCall_iiii(callbackfunc, eventTypeId, keyEventData, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: findEventTarget(target), + allowsDeferredCalls: true, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: keyEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + }function _emscripten_set_keydown_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + __registerKeyEventCallback(target, userData, useCapture, callbackfunc, 2, "keydown", targetThread); + return 0; + } + + function _emscripten_set_keypress_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + __registerKeyEventCallback(target, userData, useCapture, callbackfunc, 1, "keypress", targetThread); + return 0; + } + + function _emscripten_set_keyup_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + __registerKeyEventCallback(target, userData, useCapture, callbackfunc, 3, "keyup", targetThread); + return 0; + } + + + + + function __fillMouseEventData(eventStruct, e, target) { + assert(eventStruct % 4 == 0); + var idx = eventStruct >> 2; + HEAP32[idx + 0] = e.screenX; + HEAP32[idx + 1] = e.screenY; + HEAP32[idx + 2] = e.clientX; + HEAP32[idx + 3] = e.clientY; + HEAP32[idx + 4] = e.ctrlKey; + HEAP32[idx + 5] = e.shiftKey; + HEAP32[idx + 6] = e.altKey; + HEAP32[idx + 7] = e.metaKey; + HEAP16[idx*2 + 16] = e.button; + HEAP16[idx*2 + 17] = e.buttons; + + HEAP32[idx + 9] = e["movementX"] + ; + + HEAP32[idx + 10] = e["movementY"] + ; + + var rect = __getBoundingClientRect(target); + HEAP32[idx + 11] = e.clientX - rect.left; + HEAP32[idx + 12] = e.clientY - rect.top; + + }function __registerMouseEventCallback(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.mouseEvent) JSEvents.mouseEvent = _malloc( 64 ); + target = findEventTarget(target); + + var mouseEventHandlerFunc = function(ev) { + var e = ev || event; + + // TODO: Make this access thread safe, or this could update live while app is reading it. + __fillMouseEventData(JSEvents.mouseEvent, e, target); + + if (dynCall_iiii(callbackfunc, eventTypeId, JSEvents.mouseEvent, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: eventTypeString != 'mousemove' && eventTypeString != 'mouseenter' && eventTypeString != 'mouseleave', // Mouse move events do not allow fullscreen/pointer lock requests to be handled in them! + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: mouseEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + }function _emscripten_set_mousedown_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + __registerMouseEventCallback(target, userData, useCapture, callbackfunc, 5, "mousedown", targetThread); + return 0; + } + + function _emscripten_set_mouseenter_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + __registerMouseEventCallback(target, userData, useCapture, callbackfunc, 33, "mouseenter", targetThread); + return 0; + } + + function _emscripten_set_mouseleave_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + __registerMouseEventCallback(target, userData, useCapture, callbackfunc, 34, "mouseleave", targetThread); + return 0; + } + + function _emscripten_set_mousemove_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + __registerMouseEventCallback(target, userData, useCapture, callbackfunc, 8, "mousemove", targetThread); + return 0; + } + + function _emscripten_set_mouseup_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + __registerMouseEventCallback(target, userData, useCapture, callbackfunc, 6, "mouseup", targetThread); + return 0; + } + + + + function __fillPointerlockChangeEventData(eventStruct) { + var pointerLockElement = document.pointerLockElement || document.mozPointerLockElement || document.webkitPointerLockElement || document.msPointerLockElement; + var isPointerlocked = !!pointerLockElement; + /** @suppress {checkTypes} */ + HEAP32[((eventStruct)>>2)]=isPointerlocked; + var nodeName = JSEvents.getNodeNameForTarget(pointerLockElement); + var id = (pointerLockElement && pointerLockElement.id) ? pointerLockElement.id : ''; + stringToUTF8(nodeName, eventStruct + 4, 128); + stringToUTF8(id, eventStruct + 132, 128); + }function __registerPointerlockChangeEventCallback(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.pointerlockChangeEvent) JSEvents.pointerlockChangeEvent = _malloc( 260 ); + + var pointerlockChangeEventHandlerFunc = function(ev) { + var e = ev || event; + + var pointerlockChangeEvent = JSEvents.pointerlockChangeEvent; + __fillPointerlockChangeEventData(pointerlockChangeEvent); + + if (dynCall_iiii(callbackfunc, eventTypeId, pointerlockChangeEvent, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: target, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: pointerlockChangeEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + }/** @suppress {missingProperties} */ + function _emscripten_set_pointerlockchange_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + // TODO: Currently not supported in pthreads or in --proxy-to-worker mode. (In pthreads mode, document object is not defined) + if (!document || !document.body || (!document.body.requestPointerLock && !document.body.mozRequestPointerLock && !document.body.webkitRequestPointerLock && !document.body.msRequestPointerLock)) { + return -1; + } + + target = findEventTarget(target); + if (!target) return -4; + __registerPointerlockChangeEventCallback(target, userData, useCapture, callbackfunc, 20, "pointerlockchange", targetThread); + __registerPointerlockChangeEventCallback(target, userData, useCapture, callbackfunc, 20, "mozpointerlockchange", targetThread); + __registerPointerlockChangeEventCallback(target, userData, useCapture, callbackfunc, 20, "webkitpointerlockchange", targetThread); + __registerPointerlockChangeEventCallback(target, userData, useCapture, callbackfunc, 20, "mspointerlockchange", targetThread); + return 0; + } + + + function __registerUiEventCallback(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.uiEvent) JSEvents.uiEvent = _malloc( 36 ); + + target = findEventTarget(target); + + var uiEventHandlerFunc = function(ev) { + var e = ev || event; + if (e.target != target) { + // Never take ui events such as scroll via a 'bubbled' route, but always from the direct element that + // was targeted. Otherwise e.g. if app logs a message in response to a page scroll, the Emscripten log + // message box could cause to scroll, generating a new (bubbled) scroll message, causing a new log print, + // causing a new scroll, etc.. + return; + } + var uiEvent = JSEvents.uiEvent; + var b = document.body; // Take document.body to a variable, Closure compiler does not outline access to it on its own. + HEAP32[((uiEvent)>>2)]=e.detail; + HEAP32[(((uiEvent)+(4))>>2)]=b.clientWidth; + HEAP32[(((uiEvent)+(8))>>2)]=b.clientHeight; + HEAP32[(((uiEvent)+(12))>>2)]=innerWidth; + HEAP32[(((uiEvent)+(16))>>2)]=innerHeight; + HEAP32[(((uiEvent)+(20))>>2)]=outerWidth; + HEAP32[(((uiEvent)+(24))>>2)]=outerHeight; + HEAP32[(((uiEvent)+(28))>>2)]=pageXOffset; + HEAP32[(((uiEvent)+(32))>>2)]=pageYOffset; + if (dynCall_iiii(callbackfunc, eventTypeId, uiEvent, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: target, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: uiEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + }function _emscripten_set_resize_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + __registerUiEventCallback(target, userData, useCapture, callbackfunc, 10, "resize", targetThread); + return 0; + } + + + function __registerTouchEventCallback(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.touchEvent) JSEvents.touchEvent = _malloc( 1684 ); + + target = findEventTarget(target); + + var touchEventHandlerFunc = function(e) { + assert(e); + var touches = {}; + var et = e.touches; + for(var i = 0; i < et.length; ++i) { + var touch = et[i]; + // Verify that browser does not recycle touch objects with old stale data, but reports new ones each time. + assert(!touch.isChanged); + assert(!touch.onTarget); + touches[touch.identifier] = touch; + } + et = e.changedTouches; + for(var i = 0; i < et.length; ++i) { + var touch = et[i]; + // Verify that browser does not recycle touch objects with old stale data, but reports new ones each time. + assert(!touch.onTarget); + touch.isChanged = 1; + touches[touch.identifier] = touch; + } + et = e.targetTouches; + for(var i = 0; i < et.length; ++i) { + touches[et[i].identifier].onTarget = 1; + } + + var touchEvent = JSEvents.touchEvent; + var idx = touchEvent>>2; // Pre-shift the ptr to index to HEAP32 to save code size + HEAP32[idx + 1] = e.ctrlKey; + HEAP32[idx + 2] = e.shiftKey; + HEAP32[idx + 3] = e.altKey; + HEAP32[idx + 4] = e.metaKey; + idx += 5; // Advance to the start of the touch array. + var targetRect = __getBoundingClientRect(target); + var numTouches = 0; + for(var i in touches) { + var t = touches[i]; + HEAP32[idx + 0] = t.identifier; + HEAP32[idx + 1] = t.screenX; + HEAP32[idx + 2] = t.screenY; + HEAP32[idx + 3] = t.clientX; + HEAP32[idx + 4] = t.clientY; + HEAP32[idx + 5] = t.pageX; + HEAP32[idx + 6] = t.pageY; + HEAP32[idx + 7] = t.isChanged; + HEAP32[idx + 8] = t.onTarget; + HEAP32[idx + 9] = t.clientX - targetRect.left; + HEAP32[idx + 10] = t.clientY - targetRect.top; + + idx += 13; + + if (++numTouches > 31) { + break; + } + } + HEAP32[((touchEvent)>>2)]=numTouches; + + if (dynCall_iiii(callbackfunc, eventTypeId, touchEvent, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: eventTypeString == 'touchstart' || eventTypeString == 'touchend', + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: touchEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + }function _emscripten_set_touchcancel_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + __registerTouchEventCallback(target, userData, useCapture, callbackfunc, 25, "touchcancel", targetThread); + return 0; + } + + function _emscripten_set_touchend_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + __registerTouchEventCallback(target, userData, useCapture, callbackfunc, 23, "touchend", targetThread); + return 0; + } + + function _emscripten_set_touchmove_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + __registerTouchEventCallback(target, userData, useCapture, callbackfunc, 24, "touchmove", targetThread); + return 0; + } + + function _emscripten_set_touchstart_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + __registerTouchEventCallback(target, userData, useCapture, callbackfunc, 22, "touchstart", targetThread); + return 0; + } + + + + function __fillVisibilityChangeEventData(eventStruct) { + var visibilityStates = [ "hidden", "visible", "prerender", "unloaded" ]; + var visibilityState = visibilityStates.indexOf(document.visibilityState); + + // Assigning a boolean to HEAP32 with expected type coercion. + /** @suppress {checkTypes} */ + HEAP32[((eventStruct)>>2)]=document.hidden; + HEAP32[(((eventStruct)+(4))>>2)]=visibilityState; + }function __registerVisibilityChangeEventCallback(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.visibilityChangeEvent) JSEvents.visibilityChangeEvent = _malloc( 8 ); + + var visibilityChangeEventHandlerFunc = function(ev) { + var e = ev || event; + + var visibilityChangeEvent = JSEvents.visibilityChangeEvent; + + __fillVisibilityChangeEventData(visibilityChangeEvent); + + if (dynCall_iiii(callbackfunc, eventTypeId, visibilityChangeEvent, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: target, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: visibilityChangeEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + }function _emscripten_set_visibilitychange_callback_on_thread(userData, useCapture, callbackfunc, targetThread) { + if (!specialHTMLTargets[1]) { + return -4; + } + __registerVisibilityChangeEventCallback(specialHTMLTargets[1], userData, useCapture, callbackfunc, 21, "visibilitychange", targetThread); + return 0; + } + + + function __registerWheelEventCallback(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.wheelEvent) JSEvents.wheelEvent = _malloc( 96 ); + + // The DOM Level 3 events spec event 'wheel' + var wheelHandlerFunc = function(ev) { + var e = ev || event; + var wheelEvent = JSEvents.wheelEvent; + __fillMouseEventData(wheelEvent, e, target); + HEAPF64[(((wheelEvent)+(64))>>3)]=e["deltaX"]; + HEAPF64[(((wheelEvent)+(72))>>3)]=e["deltaY"]; + HEAPF64[(((wheelEvent)+(80))>>3)]=e["deltaZ"]; + HEAP32[(((wheelEvent)+(88))>>2)]=e["deltaMode"]; + if (dynCall_iiii(callbackfunc, eventTypeId, wheelEvent, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: true, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: wheelHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + }function _emscripten_set_wheel_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + target = findEventTarget(target); + if (typeof target.onwheel !== 'undefined') { + __registerWheelEventCallback(target, userData, useCapture, callbackfunc, 9, "wheel", targetThread); + return 0; + } else { + return -1; + } + } + + function _emscripten_sleep() { + throw 'Please compile your program with async support in order to use asynchronous operations like emscripten_sleep'; + } + + + + var ENV={}; + + function getExecutableName() { + return thisProgram || './this.program'; + }function getEnvStrings() { + if (!getEnvStrings.strings) { + // Default values. + // Browser language detection #8751 + var lang = ((typeof navigator === 'object' && navigator.languages && navigator.languages[0]) || 'C').replace('-', '_') + '.UTF-8'; + var env = { + 'USER': 'web_user', + 'LOGNAME': 'web_user', + 'PATH': '/', + 'PWD': '/', + 'HOME': '/home/web_user', + 'LANG': lang, + '_': getExecutableName() + }; + // Apply the user-provided values, if any. + for (var x in ENV) { + env[x] = ENV[x]; + } + var strings = []; + for (var x in env) { + strings.push(x + '=' + env[x]); + } + getEnvStrings.strings = strings; + } + return getEnvStrings.strings; + }function _environ_get(__environ, environ_buf) { + var bufSize = 0; + getEnvStrings().forEach(function(string, i) { + var ptr = environ_buf + bufSize; + HEAP32[(((__environ)+(i * 4))>>2)]=ptr; + writeAsciiToMemory(string, ptr); + bufSize += string.length + 1; + }); + return 0; + } + + function _environ_sizes_get(penviron_count, penviron_buf_size) { + var strings = getEnvStrings(); + HEAP32[((penviron_count)>>2)]=strings.length; + var bufSize = 0; + strings.forEach(function(string) { + bufSize += string.length + 1; + }); + HEAP32[((penviron_buf_size)>>2)]=bufSize; + return 0; + } + + function _exit(status) { + // void _exit(int status); + // http://pubs.opengroup.org/onlinepubs/000095399/functions/exit.html + exit(status); + } + + function _fd_close(fd) {try { + + var stream = SYSCALLS.getStreamFromFD(fd); + FS.close(stream); + return 0; + } catch (e) { + if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); + return e.errno; + } + } + + function _fd_read(fd, iov, iovcnt, pnum) {try { + + var stream = SYSCALLS.getStreamFromFD(fd); + var num = SYSCALLS.doReadv(stream, iov, iovcnt); + HEAP32[((pnum)>>2)]=num + return 0; + } catch (e) { + if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); + return e.errno; + } + } + + function _fd_seek(fd, offset_low, offset_high, whence, newOffset) {try { + + + var stream = SYSCALLS.getStreamFromFD(fd); + var HIGH_OFFSET = 0x100000000; // 2^32 + // use an unsigned operator on low and shift high by 32-bits + var offset = offset_high * HIGH_OFFSET + (offset_low >>> 0); + + var DOUBLE_LIMIT = 0x20000000000000; // 2^53 + // we also check for equality since DOUBLE_LIMIT + 1 == DOUBLE_LIMIT + if (offset <= -DOUBLE_LIMIT || offset >= DOUBLE_LIMIT) { + return -61; + } + + FS.llseek(stream, offset, whence); + (tempI64 = [stream.position>>>0,(tempDouble=stream.position,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((newOffset)>>2)]=tempI64[0],HEAP32[(((newOffset)+(4))>>2)]=tempI64[1]); + if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state + return 0; + } catch (e) { + if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); + return e.errno; + } + } + + function _fd_write(fd, iov, iovcnt, pnum) {try { + + var stream = SYSCALLS.getStreamFromFD(fd); + var num = SYSCALLS.doWritev(stream, iov, iovcnt); + HEAP32[((pnum)>>2)]=num + return 0; + } catch (e) { + if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); + return e.errno; + } + } + + function _getTempRet0() { + return (getTempRet0() | 0); + } + + function _gettimeofday(ptr) { + var now = Date.now(); + HEAP32[((ptr)>>2)]=(now/1000)|0; // seconds + HEAP32[(((ptr)+(4))>>2)]=((now % 1000)*1000)|0; // microseconds + return 0; + } + + function _glActiveTexture(x0) { GLctx['activeTexture'](x0) } + + function _glAttachShader(program, shader) { + GLctx.attachShader(GL.programs[program], + GL.shaders[shader]); + } + + function _glBindAttribLocation(program, index, name) { + GLctx.bindAttribLocation(GL.programs[program], index, UTF8ToString(name)); + } + + function _glBindBuffer(target, buffer) { + + GLctx.bindBuffer(target, GL.buffers[buffer]); + } + + function _glBindFramebuffer(target, framebuffer) { + + GLctx.bindFramebuffer(target, GL.framebuffers[framebuffer]); + + } + + function _glBindTexture(target, texture) { + GLctx.bindTexture(target, GL.textures[texture]); + } + + function _glBlendFunc(x0, x1) { GLctx['blendFunc'](x0, x1) } + + function _glBufferData(target, size, data, usage) { + + // N.b. here first form specifies a heap subarray, second form an integer size, so the ?: code here is polymorphic. It is advised to avoid + // randomly mixing both uses in calling code, to avoid any potential JS engine JIT issues. + GLctx.bufferData(target, data ? HEAPU8.subarray(data, data+size) : size, usage); + } + + function _glCheckFramebufferStatus(x0) { return GLctx['checkFramebufferStatus'](x0) } + + function _glClear(x0) { GLctx['clear'](x0) } + + function _glClearColor(x0, x1, x2, x3) { GLctx['clearColor'](x0, x1, x2, x3) } + + function _glCompileShader(shader) { + GLctx.compileShader(GL.shaders[shader]); + } + + function _glCreateProgram() { + var id = GL.getNewId(GL.programs); + var program = GLctx.createProgram(); + program.name = id; + GL.programs[id] = program; + return id; + } + + function _glCreateShader(shaderType) { + var id = GL.getNewId(GL.shaders); + GL.shaders[id] = GLctx.createShader(shaderType); + return id; + } + + function _glDeleteBuffers(n, buffers) { + for (var i = 0; i < n; i++) { + var id = HEAP32[(((buffers)+(i*4))>>2)]; + var buffer = GL.buffers[id]; + + // From spec: "glDeleteBuffers silently ignores 0's and names that do not + // correspond to existing buffer objects." + if (!buffer) continue; + + GLctx.deleteBuffer(buffer); + buffer.name = 0; + GL.buffers[id] = null; + + } + } + + function _glDeleteFramebuffers(n, framebuffers) { + for (var i = 0; i < n; ++i) { + var id = HEAP32[(((framebuffers)+(i*4))>>2)]; + var framebuffer = GL.framebuffers[id]; + if (!framebuffer) continue; // GL spec: "glDeleteFramebuffers silently ignores 0s and names that do not correspond to existing framebuffer objects". + GLctx.deleteFramebuffer(framebuffer); + framebuffer.name = 0; + GL.framebuffers[id] = null; + } + } + + function _glDeleteProgram(id) { + if (!id) return; + var program = GL.programs[id]; + if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + GLctx.deleteProgram(program); + program.name = 0; + GL.programs[id] = null; + GL.programInfos[id] = null; + } + + function _glDeleteShader(id) { + if (!id) return; + var shader = GL.shaders[id]; + if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + GLctx.deleteShader(shader); + GL.shaders[id] = null; + } + + function _glDeleteTextures(n, textures) { + for (var i = 0; i < n; i++) { + var id = HEAP32[(((textures)+(i*4))>>2)]; + var texture = GL.textures[id]; + if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures". + GLctx.deleteTexture(texture); + texture.name = 0; + GL.textures[id] = null; + } + } + + function _glDetachShader(program, shader) { + GLctx.detachShader(GL.programs[program], + GL.shaders[shader]); + } + + function _glDisable(x0) { GLctx['disable'](x0) } + + function _glDisableVertexAttribArray(index) { + GLctx.disableVertexAttribArray(index); + } + + function _glDrawElements(mode, count, type, indices) { + + GLctx.drawElements(mode, count, type, indices); + + } + + function _glEnable(x0) { GLctx['enable'](x0) } + + function _glEnableVertexAttribArray(index) { + GLctx.enableVertexAttribArray(index); + } + + function _glFramebufferTexture2D(target, attachment, textarget, texture, level) { + GLctx.framebufferTexture2D(target, attachment, textarget, + GL.textures[texture], level); + } + + function _glGenBuffers(n, buffers) { + __glGenObject(n, buffers, 'createBuffer', GL.buffers + ); + } + + function _glGenFramebuffers(n, ids) { + __glGenObject(n, ids, 'createFramebuffer', GL.framebuffers + ); + } + + function _glGenTextures(n, textures) { + __glGenObject(n, textures, 'createTexture', GL.textures + ); + } + + function _glGetIntegerv(name_, p) { + emscriptenWebGLGet(name_, p, 0); + } + + function _glGetProgramInfoLog(program, maxLength, length, infoLog) { + var log = GLctx.getProgramInfoLog(GL.programs[program]); + if (log === null) log = '(unknown error)'; + var numBytesWrittenExclNull = (maxLength > 0 && infoLog) ? stringToUTF8(log, infoLog, maxLength) : 0; + if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull; + } + + function _glGetProgramiv(program, pname, p) { + if (!p) { + // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + + if (program >= GL.counter) { + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + + var ptable = GL.programInfos[program]; + if (!ptable) { + GL.recordError(0x502 /* GL_INVALID_OPERATION */); + return; + } + + if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH + var log = GLctx.getProgramInfoLog(GL.programs[program]); + if (log === null) log = '(unknown error)'; + HEAP32[((p)>>2)]=log.length + 1; + } else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) { + HEAP32[((p)>>2)]=ptable.maxUniformLength; + } else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) { + if (ptable.maxAttributeLength == -1) { + program = GL.programs[program]; + var numAttribs = GLctx.getProgramParameter(program, 0x8B89/*GL_ACTIVE_ATTRIBUTES*/); + ptable.maxAttributeLength = 0; // Spec says if there are no active attribs, 0 must be returned. + for (var i = 0; i < numAttribs; ++i) { + var activeAttrib = GLctx.getActiveAttrib(program, i); + ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length+1); + } + } + HEAP32[((p)>>2)]=ptable.maxAttributeLength; + } else if (pname == 0x8A35 /* GL_ACTIVE_UNIFORM_BLOCK_MAX_NAME_LENGTH */) { + if (ptable.maxUniformBlockNameLength == -1) { + program = GL.programs[program]; + var numBlocks = GLctx.getProgramParameter(program, 0x8A36/*GL_ACTIVE_UNIFORM_BLOCKS*/); + ptable.maxUniformBlockNameLength = 0; + for (var i = 0; i < numBlocks; ++i) { + var activeBlockName = GLctx.getActiveUniformBlockName(program, i); + ptable.maxUniformBlockNameLength = Math.max(ptable.maxUniformBlockNameLength, activeBlockName.length+1); + } + } + HEAP32[((p)>>2)]=ptable.maxUniformBlockNameLength; + } else { + HEAP32[((p)>>2)]=GLctx.getProgramParameter(GL.programs[program], pname); + } + } + + function _glGetShaderInfoLog(shader, maxLength, length, infoLog) { + var log = GLctx.getShaderInfoLog(GL.shaders[shader]); + if (log === null) log = '(unknown error)'; + var numBytesWrittenExclNull = (maxLength > 0 && infoLog) ? stringToUTF8(log, infoLog, maxLength) : 0; + if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull; + } + + function _glGetShaderiv(shader, pname, p) { + if (!p) { + // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH + var log = GLctx.getShaderInfoLog(GL.shaders[shader]); + if (log === null) log = '(unknown error)'; + // The GLES2 specification says that if the shader has an empty info log, + // a value of 0 is returned. Otherwise the log has a null char appended. + // (An empty string is falsey, so we can just check that instead of + // looking at log.length.) + var logLength = log ? log.length + 1 : 0; + HEAP32[((p)>>2)]=logLength; + } else if (pname == 0x8B88) { // GL_SHADER_SOURCE_LENGTH + var source = GLctx.getShaderSource(GL.shaders[shader]); + // source may be a null, or the empty string, both of which are falsey + // values that we report a 0 length for. + var sourceLength = source ? source.length + 1 : 0; + HEAP32[((p)>>2)]=sourceLength; + } else { + HEAP32[((p)>>2)]=GLctx.getShaderParameter(GL.shaders[shader], pname); + } + } + + function _glGetUniformLocation(program, name) { + name = UTF8ToString(name); + + var arrayIndex = 0; + // If user passed an array accessor "[index]", parse the array index off the accessor. + if (name[name.length - 1] == ']') { + var leftBrace = name.lastIndexOf('['); + arrayIndex = name[leftBrace+1] != ']' ? jstoi_q(name.slice(leftBrace + 1)) : 0; // "index]", parseInt will ignore the ']' at the end; but treat "foo[]" as "foo[0]" + name = name.slice(0, leftBrace); + } + + var uniformInfo = GL.programInfos[program] && GL.programInfos[program].uniforms[name]; // returns pair [ dimension_of_uniform_array, uniform_location ] + if (uniformInfo && arrayIndex >= 0 && arrayIndex < uniformInfo[0]) { // Check if user asked for an out-of-bounds element, i.e. for 'vec4 colors[3];' user could ask for 'colors[10]' which should return -1. + return uniformInfo[1] + arrayIndex; + } else { + return -1; + } + } + + function _glLinkProgram(program) { + GLctx.linkProgram(GL.programs[program]); + GL.populateUniformTable(program); + } + + function _glScissor(x0, x1, x2, x3) { GLctx['scissor'](x0, x1, x2, x3) } + + function _glShaderSource(shader, count, string, length) { + var source = GL.getSource(shader, count, string, length); + + + GLctx.shaderSource(GL.shaders[shader], source); + } + + function _glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) { + GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixels ? emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) : null); + } + + function _glTexParameteri(x0, x1, x2) { GLctx['texParameteri'](x0, x1, x2) } + + function _glUniform1f(location, v0) { + GLctx.uniform1f(GL.uniforms[location], v0); + } + + function _glUniform1i(location, v0) { + GLctx.uniform1i(GL.uniforms[location], v0); + } + + function _glUniform2f(location, v0, v1) { + GLctx.uniform2f(GL.uniforms[location], v0, v1); + } + + function _glUniform4f(location, v0, v1, v2, v3) { + GLctx.uniform4f(GL.uniforms[location], v0, v1, v2, v3); + } + + function _glUniformMatrix4fv(location, count, transpose, value) { + + + + if (count <= 18) { + // avoid allocation when uploading few enough uniforms + var view = miniTempWebGLFloatBuffers[16*count-1]; + // hoist the heap out of the loop for size and for pthreads+growth. + var heap = HEAPF32; + value >>= 2; + for (var i = 0; i < 16 * count; i += 16) { + var dst = value + i; + view[i] = heap[dst]; + view[i + 1] = heap[dst + 1]; + view[i + 2] = heap[dst + 2]; + view[i + 3] = heap[dst + 3]; + view[i + 4] = heap[dst + 4]; + view[i + 5] = heap[dst + 5]; + view[i + 6] = heap[dst + 6]; + view[i + 7] = heap[dst + 7]; + view[i + 8] = heap[dst + 8]; + view[i + 9] = heap[dst + 9]; + view[i + 10] = heap[dst + 10]; + view[i + 11] = heap[dst + 11]; + view[i + 12] = heap[dst + 12]; + view[i + 13] = heap[dst + 13]; + view[i + 14] = heap[dst + 14]; + view[i + 15] = heap[dst + 15]; + } + } else + { + var view = HEAPF32.subarray((value)>>2,(value+count*64)>>2); + } + GLctx.uniformMatrix4fv(GL.uniforms[location], !!transpose, view); + } + + function _glUseProgram(program) { + GLctx.useProgram(GL.programs[program]); + } + + function _glVertexAttribPointer(index, size, type, normalized, stride, ptr) { + GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr); + } + + function _glViewport(x0, x1, x2, x3) { GLctx['viewport'](x0, x1, x2, x3) } + + + function _usleep(useconds) { + // int usleep(useconds_t useconds); + // http://pubs.opengroup.org/onlinepubs/000095399/functions/usleep.html + // We're single-threaded, so use a busy loop. Super-ugly. + var start = _emscripten_get_now(); + while (_emscripten_get_now() - start < useconds / 1000) { + // Do nothing. + } + }function _nanosleep(rqtp, rmtp) { + // int nanosleep(const struct timespec *rqtp, struct timespec *rmtp); + if (rqtp === 0) { + setErrNo(28); + return -1; + } + var seconds = HEAP32[((rqtp)>>2)]; + var nanoseconds = HEAP32[(((rqtp)+(4))>>2)]; + if (nanoseconds < 0 || nanoseconds > 999999999 || seconds < 0) { + setErrNo(28); + return -1; + } + if (rmtp !== 0) { + HEAP32[((rmtp)>>2)]=0; + HEAP32[(((rmtp)+(4))>>2)]=0; + } + return _usleep((seconds * 1e6) + (nanoseconds / 1000)); + } + + function _pthread_create() { + return 6; + } + + function _pthread_join() {} + + function _setTempRet0($i) { + setTempRet0(($i) | 0); + } + + function _sigaction(signum, act, oldact) { + //int sigaction(int signum, const struct sigaction *act, struct sigaction *oldact); + err('Calling stub instead of sigaction()'); + return 0; + } + + + var __sigalrm_handler=0;function _signal(sig, func) { + if (sig == 14 /*SIGALRM*/) { + __sigalrm_handler = func; + } else { + err('Calling stub instead of signal()'); + } + return 0; + } + + + + function __isLeapYear(year) { + return year%4 === 0 && (year%100 !== 0 || year%400 === 0); + } + + function __arraySum(array, index) { + var sum = 0; + for (var i = 0; i <= index; sum += array[i++]) { + // no-op + } + return sum; + } + + + var __MONTH_DAYS_LEAP=[31,29,31,30,31,30,31,31,30,31,30,31]; + + var __MONTH_DAYS_REGULAR=[31,28,31,30,31,30,31,31,30,31,30,31];function __addDays(date, days) { + var newDate = new Date(date.getTime()); + while(days > 0) { + var leap = __isLeapYear(newDate.getFullYear()); + var currentMonth = newDate.getMonth(); + var daysInCurrentMonth = (leap ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR)[currentMonth]; + + if (days > daysInCurrentMonth-newDate.getDate()) { + // we spill over to next month + days -= (daysInCurrentMonth-newDate.getDate()+1); + newDate.setDate(1); + if (currentMonth < 11) { + newDate.setMonth(currentMonth+1) + } else { + newDate.setMonth(0); + newDate.setFullYear(newDate.getFullYear()+1); + } + } else { + // we stay in current month + newDate.setDate(newDate.getDate()+days); + return newDate; + } + } + + return newDate; + }function _strftime(s, maxsize, format, tm) { + // size_t strftime(char *restrict s, size_t maxsize, const char *restrict format, const struct tm *restrict timeptr); + // http://pubs.opengroup.org/onlinepubs/009695399/functions/strftime.html + + var tm_zone = HEAP32[(((tm)+(40))>>2)]; + + var date = { + tm_sec: HEAP32[((tm)>>2)], + tm_min: HEAP32[(((tm)+(4))>>2)], + tm_hour: HEAP32[(((tm)+(8))>>2)], + tm_mday: HEAP32[(((tm)+(12))>>2)], + tm_mon: HEAP32[(((tm)+(16))>>2)], + tm_year: HEAP32[(((tm)+(20))>>2)], + tm_wday: HEAP32[(((tm)+(24))>>2)], + tm_yday: HEAP32[(((tm)+(28))>>2)], + tm_isdst: HEAP32[(((tm)+(32))>>2)], + tm_gmtoff: HEAP32[(((tm)+(36))>>2)], + tm_zone: tm_zone ? UTF8ToString(tm_zone) : '' + }; + + var pattern = UTF8ToString(format); + + // expand format + var EXPANSION_RULES_1 = { + '%c': '%a %b %d %H:%M:%S %Y', // Replaced by the locale's appropriate date and time representation - e.g., Mon Aug 3 14:02:01 2013 + '%D': '%m/%d/%y', // Equivalent to %m / %d / %y + '%F': '%Y-%m-%d', // Equivalent to %Y - %m - %d + '%h': '%b', // Equivalent to %b + '%r': '%I:%M:%S %p', // Replaced by the time in a.m. and p.m. notation + '%R': '%H:%M', // Replaced by the time in 24-hour notation + '%T': '%H:%M:%S', // Replaced by the time + '%x': '%m/%d/%y', // Replaced by the locale's appropriate date representation + '%X': '%H:%M:%S', // Replaced by the locale's appropriate time representation + // Modified Conversion Specifiers + '%Ec': '%c', // Replaced by the locale's alternative appropriate date and time representation. + '%EC': '%C', // Replaced by the name of the base year (period) in the locale's alternative representation. + '%Ex': '%m/%d/%y', // Replaced by the locale's alternative date representation. + '%EX': '%H:%M:%S', // Replaced by the locale's alternative time representation. + '%Ey': '%y', // Replaced by the offset from %EC (year only) in the locale's alternative representation. + '%EY': '%Y', // Replaced by the full alternative year representation. + '%Od': '%d', // Replaced by the day of the month, using the locale's alternative numeric symbols, filled as needed with leading zeros if there is any alternative symbol for zero; otherwise, with leading <space> characters. + '%Oe': '%e', // Replaced by the day of the month, using the locale's alternative numeric symbols, filled as needed with leading <space> characters. + '%OH': '%H', // Replaced by the hour (24-hour clock) using the locale's alternative numeric symbols. + '%OI': '%I', // Replaced by the hour (12-hour clock) using the locale's alternative numeric symbols. + '%Om': '%m', // Replaced by the month using the locale's alternative numeric symbols. + '%OM': '%M', // Replaced by the minutes using the locale's alternative numeric symbols. + '%OS': '%S', // Replaced by the seconds using the locale's alternative numeric symbols. + '%Ou': '%u', // Replaced by the weekday as a number in the locale's alternative representation (Monday=1). + '%OU': '%U', // Replaced by the week number of the year (Sunday as the first day of the week, rules corresponding to %U ) using the locale's alternative numeric symbols. + '%OV': '%V', // Replaced by the week number of the year (Monday as the first day of the week, rules corresponding to %V ) using the locale's alternative numeric symbols. + '%Ow': '%w', // Replaced by the number of the weekday (Sunday=0) using the locale's alternative numeric symbols. + '%OW': '%W', // Replaced by the week number of the year (Monday as the first day of the week) using the locale's alternative numeric symbols. + '%Oy': '%y', // Replaced by the year (offset from %C ) using the locale's alternative numeric symbols. + }; + for (var rule in EXPANSION_RULES_1) { + pattern = pattern.replace(new RegExp(rule, 'g'), EXPANSION_RULES_1[rule]); + } + + var WEEKDAYS = ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday']; + var MONTHS = ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December']; + + function leadingSomething(value, digits, character) { + var str = typeof value === 'number' ? value.toString() : (value || ''); + while (str.length < digits) { + str = character[0]+str; + } + return str; + } + + function leadingNulls(value, digits) { + return leadingSomething(value, digits, '0'); + } + + function compareByDay(date1, date2) { + function sgn(value) { + return value < 0 ? -1 : (value > 0 ? 1 : 0); + } + + var compare; + if ((compare = sgn(date1.getFullYear()-date2.getFullYear())) === 0) { + if ((compare = sgn(date1.getMonth()-date2.getMonth())) === 0) { + compare = sgn(date1.getDate()-date2.getDate()); + } + } + return compare; + } + + function getFirstWeekStartDate(janFourth) { + switch (janFourth.getDay()) { + case 0: // Sunday + return new Date(janFourth.getFullYear()-1, 11, 29); + case 1: // Monday + return janFourth; + case 2: // Tuesday + return new Date(janFourth.getFullYear(), 0, 3); + case 3: // Wednesday + return new Date(janFourth.getFullYear(), 0, 2); + case 4: // Thursday + return new Date(janFourth.getFullYear(), 0, 1); + case 5: // Friday + return new Date(janFourth.getFullYear()-1, 11, 31); + case 6: // Saturday + return new Date(janFourth.getFullYear()-1, 11, 30); + } + } + + function getWeekBasedYear(date) { + var thisDate = __addDays(new Date(date.tm_year+1900, 0, 1), date.tm_yday); + + var janFourthThisYear = new Date(thisDate.getFullYear(), 0, 4); + var janFourthNextYear = new Date(thisDate.getFullYear()+1, 0, 4); + + var firstWeekStartThisYear = getFirstWeekStartDate(janFourthThisYear); + var firstWeekStartNextYear = getFirstWeekStartDate(janFourthNextYear); + + if (compareByDay(firstWeekStartThisYear, thisDate) <= 0) { + // this date is after the start of the first week of this year + if (compareByDay(firstWeekStartNextYear, thisDate) <= 0) { + return thisDate.getFullYear()+1; + } else { + return thisDate.getFullYear(); + } + } else { + return thisDate.getFullYear()-1; + } + } + + var EXPANSION_RULES_2 = { + '%a': function(date) { + return WEEKDAYS[date.tm_wday].substring(0,3); + }, + '%A': function(date) { + return WEEKDAYS[date.tm_wday]; + }, + '%b': function(date) { + return MONTHS[date.tm_mon].substring(0,3); + }, + '%B': function(date) { + return MONTHS[date.tm_mon]; + }, + '%C': function(date) { + var year = date.tm_year+1900; + return leadingNulls((year/100)|0,2); + }, + '%d': function(date) { + return leadingNulls(date.tm_mday, 2); + }, + '%e': function(date) { + return leadingSomething(date.tm_mday, 2, ' '); + }, + '%g': function(date) { + // %g, %G, and %V give values according to the ISO 8601:2000 standard week-based year. + // In this system, weeks begin on a Monday and week 1 of the year is the week that includes + // January 4th, which is also the week that includes the first Thursday of the year, and + // is also the first week that contains at least four days in the year. + // If the first Monday of January is the 2nd, 3rd, or 4th, the preceding days are part of + // the last week of the preceding year; thus, for Saturday 2nd January 1999, + // %G is replaced by 1998 and %V is replaced by 53. If December 29th, 30th, + // or 31st is a Monday, it and any following days are part of week 1 of the following year. + // Thus, for Tuesday 30th December 1997, %G is replaced by 1998 and %V is replaced by 01. + + return getWeekBasedYear(date).toString().substring(2); + }, + '%G': function(date) { + return getWeekBasedYear(date); + }, + '%H': function(date) { + return leadingNulls(date.tm_hour, 2); + }, + '%I': function(date) { + var twelveHour = date.tm_hour; + if (twelveHour == 0) twelveHour = 12; + else if (twelveHour > 12) twelveHour -= 12; + return leadingNulls(twelveHour, 2); + }, + '%j': function(date) { + // Day of the year (001-366) + return leadingNulls(date.tm_mday+__arraySum(__isLeapYear(date.tm_year+1900) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, date.tm_mon-1), 3); + }, + '%m': function(date) { + return leadingNulls(date.tm_mon+1, 2); + }, + '%M': function(date) { + return leadingNulls(date.tm_min, 2); + }, + '%n': function() { + return '\n'; + }, + '%p': function(date) { + if (date.tm_hour >= 0 && date.tm_hour < 12) { + return 'AM'; + } else { + return 'PM'; + } + }, + '%S': function(date) { + return leadingNulls(date.tm_sec, 2); + }, + '%t': function() { + return '\t'; + }, + '%u': function(date) { + return date.tm_wday || 7; + }, + '%U': function(date) { + // Replaced by the week number of the year as a decimal number [00,53]. + // The first Sunday of January is the first day of week 1; + // days in the new year before this are in week 0. [ tm_year, tm_wday, tm_yday] + var janFirst = new Date(date.tm_year+1900, 0, 1); + var firstSunday = janFirst.getDay() === 0 ? janFirst : __addDays(janFirst, 7-janFirst.getDay()); + var endDate = new Date(date.tm_year+1900, date.tm_mon, date.tm_mday); + + // is target date after the first Sunday? + if (compareByDay(firstSunday, endDate) < 0) { + // calculate difference in days between first Sunday and endDate + var februaryFirstUntilEndMonth = __arraySum(__isLeapYear(endDate.getFullYear()) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, endDate.getMonth()-1)-31; + var firstSundayUntilEndJanuary = 31-firstSunday.getDate(); + var days = firstSundayUntilEndJanuary+februaryFirstUntilEndMonth+endDate.getDate(); + return leadingNulls(Math.ceil(days/7), 2); + } + + return compareByDay(firstSunday, janFirst) === 0 ? '01': '00'; + }, + '%V': function(date) { + // Replaced by the week number of the year (Monday as the first day of the week) + // as a decimal number [01,53]. If the week containing 1 January has four + // or more days in the new year, then it is considered week 1. + // Otherwise, it is the last week of the previous year, and the next week is week 1. + // Both January 4th and the first Thursday of January are always in week 1. [ tm_year, tm_wday, tm_yday] + var janFourthThisYear = new Date(date.tm_year+1900, 0, 4); + var janFourthNextYear = new Date(date.tm_year+1901, 0, 4); + + var firstWeekStartThisYear = getFirstWeekStartDate(janFourthThisYear); + var firstWeekStartNextYear = getFirstWeekStartDate(janFourthNextYear); + + var endDate = __addDays(new Date(date.tm_year+1900, 0, 1), date.tm_yday); + + if (compareByDay(endDate, firstWeekStartThisYear) < 0) { + // if given date is before this years first week, then it belongs to the 53rd week of last year + return '53'; + } + + if (compareByDay(firstWeekStartNextYear, endDate) <= 0) { + // if given date is after next years first week, then it belongs to the 01th week of next year + return '01'; + } + + // given date is in between CW 01..53 of this calendar year + var daysDifference; + if (firstWeekStartThisYear.getFullYear() < date.tm_year+1900) { + // first CW of this year starts last year + daysDifference = date.tm_yday+32-firstWeekStartThisYear.getDate() + } else { + // first CW of this year starts this year + daysDifference = date.tm_yday+1-firstWeekStartThisYear.getDate(); + } + return leadingNulls(Math.ceil(daysDifference/7), 2); + }, + '%w': function(date) { + return date.tm_wday; + }, + '%W': function(date) { + // Replaced by the week number of the year as a decimal number [00,53]. + // The first Monday of January is the first day of week 1; + // days in the new year before this are in week 0. [ tm_year, tm_wday, tm_yday] + var janFirst = new Date(date.tm_year, 0, 1); + var firstMonday = janFirst.getDay() === 1 ? janFirst : __addDays(janFirst, janFirst.getDay() === 0 ? 1 : 7-janFirst.getDay()+1); + var endDate = new Date(date.tm_year+1900, date.tm_mon, date.tm_mday); + + // is target date after the first Monday? + if (compareByDay(firstMonday, endDate) < 0) { + var februaryFirstUntilEndMonth = __arraySum(__isLeapYear(endDate.getFullYear()) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, endDate.getMonth()-1)-31; + var firstMondayUntilEndJanuary = 31-firstMonday.getDate(); + var days = firstMondayUntilEndJanuary+februaryFirstUntilEndMonth+endDate.getDate(); + return leadingNulls(Math.ceil(days/7), 2); + } + return compareByDay(firstMonday, janFirst) === 0 ? '01': '00'; + }, + '%y': function(date) { + // Replaced by the last two digits of the year as a decimal number [00,99]. [ tm_year] + return (date.tm_year+1900).toString().substring(2); + }, + '%Y': function(date) { + // Replaced by the year as a decimal number (for example, 1997). [ tm_year] + return date.tm_year+1900; + }, + '%z': function(date) { + // Replaced by the offset from UTC in the ISO 8601:2000 standard format ( +hhmm or -hhmm ). + // For example, "-0430" means 4 hours 30 minutes behind UTC (west of Greenwich). + var off = date.tm_gmtoff; + var ahead = off >= 0; + off = Math.abs(off) / 60; + // convert from minutes into hhmm format (which means 60 minutes = 100 units) + off = (off / 60)*100 + (off % 60); + return (ahead ? '+' : '-') + String("0000" + off).slice(-4); + }, + '%Z': function(date) { + return date.tm_zone; + }, + '%%': function() { + return '%'; + } + }; + for (var rule in EXPANSION_RULES_2) { + if (pattern.indexOf(rule) >= 0) { + pattern = pattern.replace(new RegExp(rule, 'g'), EXPANSION_RULES_2[rule](date)); + } + } + + var bytes = intArrayFromString(pattern, false); + if (bytes.length > maxsize) { + return 0; + } + + writeArrayToMemory(bytes, s); + return bytes.length-1; + }function _strftime_l(s, maxsize, format, tm) { + return _strftime(s, maxsize, format, tm); // no locale support yet + } + + function _time(ptr) { + var ret = (Date.now()/1000)|0; + if (ptr) { + HEAP32[((ptr)>>2)]=ret; + } + return ret; + } + + + var readAsmConstArgsArray=[];function readAsmConstArgs(sigPtr, buf) { + // Nobody should have mutated _readAsmConstArgsArray underneath us to be something else than an array. + assert(Array.isArray(readAsmConstArgsArray)); + // The input buffer is allocated on the stack, so it must be stack-aligned. + assert(buf % 16 == 0); + readAsmConstArgsArray.length = 0; + var ch; + // Most arguments are i32s, so shift the buffer pointer so it is a plain + // index into HEAP32. + buf >>= 2; + while (ch = HEAPU8[sigPtr++]) { + assert(ch === 100/*'d'*/ || ch === 102/*'f'*/ || ch === 105 /*'i'*/); + // A double takes two 32-bit slots, and must also be aligned - the backend + // will emit padding to avoid that. + var double = ch < 105; + if (double && (buf & 1)) buf++; + readAsmConstArgsArray.push(double ? HEAPF64[buf++ >> 1] : HEAP32[buf]); + ++buf; + } + return readAsmConstArgsArray; + } +var FSNode = /** @constructor */ function(parent, name, mode, rdev) { + if (!parent) { + parent = this; // root node sets parent to itself + } + this.parent = parent; + this.mount = parent.mount; + this.mounted = null; + this.id = FS.nextInode++; + this.name = name; + this.mode = mode; + this.node_ops = {}; + this.stream_ops = {}; + this.rdev = rdev; + }; + var readMode = 292/*292*/ | 73/*73*/; + var writeMode = 146/*146*/; + Object.defineProperties(FSNode.prototype, { + read: { + get: /** @this{FSNode} */function() { + return (this.mode & readMode) === readMode; + }, + set: /** @this{FSNode} */function(val) { + val ? this.mode |= readMode : this.mode &= ~readMode; + } + }, + write: { + get: /** @this{FSNode} */function() { + return (this.mode & writeMode) === writeMode; + }, + set: /** @this{FSNode} */function(val) { + val ? this.mode |= writeMode : this.mode &= ~writeMode; + } + }, + isFolder: { + get: /** @this{FSNode} */function() { + return FS.isDir(this.mode); + } + }, + isDevice: { + get: /** @this{FSNode} */function() { + return FS.isChrdev(this.mode); + } + } + }); + FS.FSNode = FSNode; + FS.staticInit();; +embind_init_charCodes(); +BindingError = Module['BindingError'] = extendError(Error, 'BindingError');; +InternalError = Module['InternalError'] = extendError(Error, 'InternalError');; +init_emval();; +UnboundTypeError = Module['UnboundTypeError'] = extendError(Error, 'UnboundTypeError');; +Module["requestFullscreen"] = function Module_requestFullscreen(lockPointer, resizeCanvas) { Browser.requestFullscreen(lockPointer, resizeCanvas) }; + Module["requestFullScreen"] = function Module_requestFullScreen() { Browser.requestFullScreen() }; + Module["requestAnimationFrame"] = function Module_requestAnimationFrame(func) { Browser.requestAnimationFrame(func) }; + Module["setCanvasSize"] = function Module_setCanvasSize(width, height, noUpdates) { Browser.setCanvasSize(width, height, noUpdates) }; + Module["pauseMainLoop"] = function Module_pauseMainLoop() { Browser.mainLoop.pause() }; + Module["resumeMainLoop"] = function Module_resumeMainLoop() { Browser.mainLoop.resume() }; + Module["getUserMedia"] = function Module_getUserMedia() { Browser.getUserMedia() } + Module["createContext"] = function Module_createContext(canvas, useWebGL, setInModule, webGLContextAttributes) { return Browser.createContext(canvas, useWebGL, setInModule, webGLContextAttributes) }; +var GLctx;; +for (var i = 0; i < 32; ++i) tempFixedLengthArray.push(new Array(i));; +var miniTempWebGLFloatBuffersStorage = new Float32Array(288); + for (/**@suppress{duplicate}*/var i = 0; i < 288; ++i) { + miniTempWebGLFloatBuffers[i] = miniTempWebGLFloatBuffersStorage.subarray(0, i+1); + } + ; +var __miniTempWebGLIntBuffersStorage = new Int32Array(288); + for (/**@suppress{duplicate}*/var i = 0; i < 288; ++i) { + __miniTempWebGLIntBuffers[i] = __miniTempWebGLIntBuffersStorage.subarray(0, i+1); + } + ; +var ASSERTIONS = true; + + + +/** @type {function(string, boolean=, number=)} */ +function intArrayFromString(stringy, dontAddNull, length) { + var len = length > 0 ? length : lengthBytesUTF8(stringy)+1; + var u8array = new Array(len); + var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length); + if (dontAddNull) u8array.length = numBytesWritten; + return u8array; +} + +function intArrayToString(array) { + var ret = []; + for (var i = 0; i < array.length; i++) { + var chr = array[i]; + if (chr > 0xFF) { + if (ASSERTIONS) { + assert(false, 'Character code ' + chr + ' (' + String.fromCharCode(chr) + ') at offset ' + i + ' not in 0x00-0xFF.'); + } + chr &= 0xFF; + } + ret.push(String.fromCharCode(chr)); + } + return ret.join(''); +} + + +var asmGlobalArg = {}; +var asmLibraryArg = { "__assert_fail": ___assert_fail, "__cxa_atexit": ___cxa_atexit, "__cxa_thread_atexit": ___cxa_thread_atexit, "__handle_stack_overflow": ___handle_stack_overflow, "__map_file": ___map_file, "__sys_fcntl64": ___sys_fcntl64, "__sys_ioctl": ___sys_ioctl, "__sys_munmap": ___sys_munmap, "__sys_open": ___sys_open, "__sys_read": ___sys_read, "__sys_socketcall": ___sys_socketcall, "_embind_register_bool": __embind_register_bool, "_embind_register_emval": __embind_register_emval, "_embind_register_float": __embind_register_float, "_embind_register_function": __embind_register_function, "_embind_register_integer": __embind_register_integer, "_embind_register_memory_view": __embind_register_memory_view, "_embind_register_std_string": __embind_register_std_string, "_embind_register_std_wstring": __embind_register_std_wstring, "_embind_register_void": __embind_register_void, "_emval_as": __emval_as, "_emval_call_method": __emval_call_method, "_emval_call_void_method": __emval_call_void_method, "_emval_decref": __emval_decref, "_emval_get_global": __emval_get_global, "_emval_get_method_caller": __emval_get_method_caller, "_emval_get_property": __emval_get_property, "_emval_new_cstring": __emval_new_cstring, "_emval_run_destructors": __emval_run_destructors, "abort": _abort, "clock_gettime": _clock_gettime, "dlclose": _dlclose, "eglBindAPI": _eglBindAPI, "eglChooseConfig": _eglChooseConfig, "eglCreateContext": _eglCreateContext, "eglCreateWindowSurface": _eglCreateWindowSurface, "eglDestroyContext": _eglDestroyContext, "eglDestroySurface": _eglDestroySurface, "eglGetConfigAttrib": _eglGetConfigAttrib, "eglGetDisplay": _eglGetDisplay, "eglGetError": _eglGetError, "eglGetProcAddress": _eglGetProcAddress, "eglInitialize": _eglInitialize, "eglMakeCurrent": _eglMakeCurrent, "eglQueryString": _eglQueryString, "eglSwapBuffers": _eglSwapBuffers, "eglSwapInterval": _eglSwapInterval, "eglTerminate": _eglTerminate, "eglWaitGL": _eglWaitGL, "eglWaitNative": _eglWaitNative, "emscripten_asm_const_iii": _emscripten_asm_const_iii, "emscripten_exit_fullscreen": _emscripten_exit_fullscreen, "emscripten_exit_pointerlock": _emscripten_exit_pointerlock, "emscripten_get_device_pixel_ratio": _emscripten_get_device_pixel_ratio, "emscripten_get_element_css_size": _emscripten_get_element_css_size, "emscripten_get_gamepad_status": _emscripten_get_gamepad_status, "emscripten_get_num_gamepads": _emscripten_get_num_gamepads, "emscripten_get_sbrk_ptr": _emscripten_get_sbrk_ptr, "emscripten_glActiveTexture": _emscripten_glActiveTexture, "emscripten_glAttachShader": _emscripten_glAttachShader, "emscripten_glBeginQueryEXT": _emscripten_glBeginQueryEXT, "emscripten_glBindAttribLocation": _emscripten_glBindAttribLocation, "emscripten_glBindBuffer": _emscripten_glBindBuffer, "emscripten_glBindFramebuffer": _emscripten_glBindFramebuffer, "emscripten_glBindRenderbuffer": _emscripten_glBindRenderbuffer, "emscripten_glBindTexture": _emscripten_glBindTexture, "emscripten_glBindVertexArrayOES": _emscripten_glBindVertexArrayOES, "emscripten_glBlendColor": _emscripten_glBlendColor, "emscripten_glBlendEquation": _emscripten_glBlendEquation, "emscripten_glBlendEquationSeparate": _emscripten_glBlendEquationSeparate, "emscripten_glBlendFunc": _emscripten_glBlendFunc, "emscripten_glBlendFuncSeparate": _emscripten_glBlendFuncSeparate, "emscripten_glBufferData": _emscripten_glBufferData, "emscripten_glBufferSubData": _emscripten_glBufferSubData, "emscripten_glCheckFramebufferStatus": _emscripten_glCheckFramebufferStatus, "emscripten_glClear": _emscripten_glClear, "emscripten_glClearColor": _emscripten_glClearColor, "emscripten_glClearDepthf": _emscripten_glClearDepthf, "emscripten_glClearStencil": _emscripten_glClearStencil, "emscripten_glColorMask": _emscripten_glColorMask, "emscripten_glCompileShader": _emscripten_glCompileShader, "emscripten_glCompressedTexImage2D": _emscripten_glCompressedTexImage2D, "emscripten_glCompressedTexSubImage2D": _emscripten_glCompressedTexSubImage2D, "emscripten_glCopyTexImage2D": _emscripten_glCopyTexImage2D, "emscripten_glCopyTexSubImage2D": _emscripten_glCopyTexSubImage2D, "emscripten_glCreateProgram": _emscripten_glCreateProgram, "emscripten_glCreateShader": _emscripten_glCreateShader, "emscripten_glCullFace": _emscripten_glCullFace, "emscripten_glDeleteBuffers": _emscripten_glDeleteBuffers, "emscripten_glDeleteFramebuffers": _emscripten_glDeleteFramebuffers, "emscripten_glDeleteProgram": _emscripten_glDeleteProgram, "emscripten_glDeleteQueriesEXT": _emscripten_glDeleteQueriesEXT, "emscripten_glDeleteRenderbuffers": _emscripten_glDeleteRenderbuffers, "emscripten_glDeleteShader": _emscripten_glDeleteShader, "emscripten_glDeleteTextures": _emscripten_glDeleteTextures, "emscripten_glDeleteVertexArraysOES": _emscripten_glDeleteVertexArraysOES, "emscripten_glDepthFunc": _emscripten_glDepthFunc, "emscripten_glDepthMask": _emscripten_glDepthMask, "emscripten_glDepthRangef": _emscripten_glDepthRangef, "emscripten_glDetachShader": _emscripten_glDetachShader, "emscripten_glDisable": _emscripten_glDisable, "emscripten_glDisableVertexAttribArray": _emscripten_glDisableVertexAttribArray, "emscripten_glDrawArrays": _emscripten_glDrawArrays, "emscripten_glDrawArraysInstancedANGLE": _emscripten_glDrawArraysInstancedANGLE, "emscripten_glDrawBuffersWEBGL": _emscripten_glDrawBuffersWEBGL, "emscripten_glDrawElements": _emscripten_glDrawElements, "emscripten_glDrawElementsInstancedANGLE": _emscripten_glDrawElementsInstancedANGLE, "emscripten_glEnable": _emscripten_glEnable, "emscripten_glEnableVertexAttribArray": _emscripten_glEnableVertexAttribArray, "emscripten_glEndQueryEXT": _emscripten_glEndQueryEXT, "emscripten_glFinish": _emscripten_glFinish, "emscripten_glFlush": _emscripten_glFlush, "emscripten_glFramebufferRenderbuffer": _emscripten_glFramebufferRenderbuffer, "emscripten_glFramebufferTexture2D": _emscripten_glFramebufferTexture2D, "emscripten_glFrontFace": _emscripten_glFrontFace, "emscripten_glGenBuffers": _emscripten_glGenBuffers, "emscripten_glGenFramebuffers": _emscripten_glGenFramebuffers, "emscripten_glGenQueriesEXT": _emscripten_glGenQueriesEXT, "emscripten_glGenRenderbuffers": _emscripten_glGenRenderbuffers, "emscripten_glGenTextures": _emscripten_glGenTextures, "emscripten_glGenVertexArraysOES": _emscripten_glGenVertexArraysOES, "emscripten_glGenerateMipmap": _emscripten_glGenerateMipmap, "emscripten_glGetActiveAttrib": _emscripten_glGetActiveAttrib, "emscripten_glGetActiveUniform": _emscripten_glGetActiveUniform, "emscripten_glGetAttachedShaders": _emscripten_glGetAttachedShaders, "emscripten_glGetAttribLocation": _emscripten_glGetAttribLocation, "emscripten_glGetBooleanv": _emscripten_glGetBooleanv, "emscripten_glGetBufferParameteriv": _emscripten_glGetBufferParameteriv, "emscripten_glGetError": _emscripten_glGetError, "emscripten_glGetFloatv": _emscripten_glGetFloatv, "emscripten_glGetFramebufferAttachmentParameteriv": _emscripten_glGetFramebufferAttachmentParameteriv, "emscripten_glGetIntegerv": _emscripten_glGetIntegerv, "emscripten_glGetProgramInfoLog": _emscripten_glGetProgramInfoLog, "emscripten_glGetProgramiv": _emscripten_glGetProgramiv, "emscripten_glGetQueryObjecti64vEXT": _emscripten_glGetQueryObjecti64vEXT, "emscripten_glGetQueryObjectivEXT": _emscripten_glGetQueryObjectivEXT, "emscripten_glGetQueryObjectui64vEXT": _emscripten_glGetQueryObjectui64vEXT, "emscripten_glGetQueryObjectuivEXT": _emscripten_glGetQueryObjectuivEXT, "emscripten_glGetQueryivEXT": _emscripten_glGetQueryivEXT, "emscripten_glGetRenderbufferParameteriv": _emscripten_glGetRenderbufferParameteriv, "emscripten_glGetShaderInfoLog": _emscripten_glGetShaderInfoLog, "emscripten_glGetShaderPrecisionFormat": _emscripten_glGetShaderPrecisionFormat, "emscripten_glGetShaderSource": _emscripten_glGetShaderSource, "emscripten_glGetShaderiv": _emscripten_glGetShaderiv, "emscripten_glGetString": _emscripten_glGetString, "emscripten_glGetTexParameterfv": _emscripten_glGetTexParameterfv, "emscripten_glGetTexParameteriv": _emscripten_glGetTexParameteriv, "emscripten_glGetUniformLocation": _emscripten_glGetUniformLocation, "emscripten_glGetUniformfv": _emscripten_glGetUniformfv, "emscripten_glGetUniformiv": _emscripten_glGetUniformiv, "emscripten_glGetVertexAttribPointerv": _emscripten_glGetVertexAttribPointerv, "emscripten_glGetVertexAttribfv": _emscripten_glGetVertexAttribfv, "emscripten_glGetVertexAttribiv": _emscripten_glGetVertexAttribiv, "emscripten_glHint": _emscripten_glHint, "emscripten_glIsBuffer": _emscripten_glIsBuffer, "emscripten_glIsEnabled": _emscripten_glIsEnabled, "emscripten_glIsFramebuffer": _emscripten_glIsFramebuffer, "emscripten_glIsProgram": _emscripten_glIsProgram, "emscripten_glIsQueryEXT": _emscripten_glIsQueryEXT, "emscripten_glIsRenderbuffer": _emscripten_glIsRenderbuffer, "emscripten_glIsShader": _emscripten_glIsShader, "emscripten_glIsTexture": _emscripten_glIsTexture, "emscripten_glIsVertexArrayOES": _emscripten_glIsVertexArrayOES, "emscripten_glLineWidth": _emscripten_glLineWidth, "emscripten_glLinkProgram": _emscripten_glLinkProgram, "emscripten_glPixelStorei": _emscripten_glPixelStorei, "emscripten_glPolygonOffset": _emscripten_glPolygonOffset, "emscripten_glQueryCounterEXT": _emscripten_glQueryCounterEXT, "emscripten_glReadPixels": _emscripten_glReadPixels, "emscripten_glReleaseShaderCompiler": _emscripten_glReleaseShaderCompiler, "emscripten_glRenderbufferStorage": _emscripten_glRenderbufferStorage, "emscripten_glSampleCoverage": _emscripten_glSampleCoverage, "emscripten_glScissor": _emscripten_glScissor, "emscripten_glShaderBinary": _emscripten_glShaderBinary, "emscripten_glShaderSource": _emscripten_glShaderSource, "emscripten_glStencilFunc": _emscripten_glStencilFunc, "emscripten_glStencilFuncSeparate": _emscripten_glStencilFuncSeparate, "emscripten_glStencilMask": _emscripten_glStencilMask, "emscripten_glStencilMaskSeparate": _emscripten_glStencilMaskSeparate, "emscripten_glStencilOp": _emscripten_glStencilOp, "emscripten_glStencilOpSeparate": _emscripten_glStencilOpSeparate, "emscripten_glTexImage2D": _emscripten_glTexImage2D, "emscripten_glTexParameterf": _emscripten_glTexParameterf, "emscripten_glTexParameterfv": _emscripten_glTexParameterfv, "emscripten_glTexParameteri": _emscripten_glTexParameteri, "emscripten_glTexParameteriv": _emscripten_glTexParameteriv, "emscripten_glTexSubImage2D": _emscripten_glTexSubImage2D, "emscripten_glUniform1f": _emscripten_glUniform1f, "emscripten_glUniform1fv": _emscripten_glUniform1fv, "emscripten_glUniform1i": _emscripten_glUniform1i, "emscripten_glUniform1iv": _emscripten_glUniform1iv, "emscripten_glUniform2f": _emscripten_glUniform2f, "emscripten_glUniform2fv": _emscripten_glUniform2fv, "emscripten_glUniform2i": _emscripten_glUniform2i, "emscripten_glUniform2iv": _emscripten_glUniform2iv, "emscripten_glUniform3f": _emscripten_glUniform3f, "emscripten_glUniform3fv": _emscripten_glUniform3fv, "emscripten_glUniform3i": _emscripten_glUniform3i, "emscripten_glUniform3iv": _emscripten_glUniform3iv, "emscripten_glUniform4f": _emscripten_glUniform4f, "emscripten_glUniform4fv": _emscripten_glUniform4fv, "emscripten_glUniform4i": _emscripten_glUniform4i, "emscripten_glUniform4iv": _emscripten_glUniform4iv, "emscripten_glUniformMatrix2fv": _emscripten_glUniformMatrix2fv, "emscripten_glUniformMatrix3fv": _emscripten_glUniformMatrix3fv, "emscripten_glUniformMatrix4fv": _emscripten_glUniformMatrix4fv, "emscripten_glUseProgram": _emscripten_glUseProgram, "emscripten_glValidateProgram": _emscripten_glValidateProgram, "emscripten_glVertexAttrib1f": _emscripten_glVertexAttrib1f, "emscripten_glVertexAttrib1fv": _emscripten_glVertexAttrib1fv, "emscripten_glVertexAttrib2f": _emscripten_glVertexAttrib2f, "emscripten_glVertexAttrib2fv": _emscripten_glVertexAttrib2fv, "emscripten_glVertexAttrib3f": _emscripten_glVertexAttrib3f, "emscripten_glVertexAttrib3fv": _emscripten_glVertexAttrib3fv, "emscripten_glVertexAttrib4f": _emscripten_glVertexAttrib4f, "emscripten_glVertexAttrib4fv": _emscripten_glVertexAttrib4fv, "emscripten_glVertexAttribDivisorANGLE": _emscripten_glVertexAttribDivisorANGLE, "emscripten_glVertexAttribPointer": _emscripten_glVertexAttribPointer, "emscripten_glViewport": _emscripten_glViewport, "emscripten_has_asyncify": _emscripten_has_asyncify, "emscripten_longjmp": _emscripten_longjmp, "emscripten_memcpy_big": _emscripten_memcpy_big, "emscripten_request_fullscreen_strategy": _emscripten_request_fullscreen_strategy, "emscripten_request_pointerlock": _emscripten_request_pointerlock, "emscripten_resize_heap": _emscripten_resize_heap, "emscripten_sample_gamepad_data": _emscripten_sample_gamepad_data, "emscripten_set_beforeunload_callback_on_thread": _emscripten_set_beforeunload_callback_on_thread, "emscripten_set_blur_callback_on_thread": _emscripten_set_blur_callback_on_thread, "emscripten_set_canvas_element_size": _emscripten_set_canvas_element_size, "emscripten_set_element_css_size": _emscripten_set_element_css_size, "emscripten_set_focus_callback_on_thread": _emscripten_set_focus_callback_on_thread, "emscripten_set_fullscreenchange_callback_on_thread": _emscripten_set_fullscreenchange_callback_on_thread, "emscripten_set_gamepadconnected_callback_on_thread": _emscripten_set_gamepadconnected_callback_on_thread, "emscripten_set_gamepaddisconnected_callback_on_thread": _emscripten_set_gamepaddisconnected_callback_on_thread, "emscripten_set_keydown_callback_on_thread": _emscripten_set_keydown_callback_on_thread, "emscripten_set_keypress_callback_on_thread": _emscripten_set_keypress_callback_on_thread, "emscripten_set_keyup_callback_on_thread": _emscripten_set_keyup_callback_on_thread, "emscripten_set_main_loop": _emscripten_set_main_loop, "emscripten_set_mousedown_callback_on_thread": _emscripten_set_mousedown_callback_on_thread, "emscripten_set_mouseenter_callback_on_thread": _emscripten_set_mouseenter_callback_on_thread, "emscripten_set_mouseleave_callback_on_thread": _emscripten_set_mouseleave_callback_on_thread, "emscripten_set_mousemove_callback_on_thread": _emscripten_set_mousemove_callback_on_thread, "emscripten_set_mouseup_callback_on_thread": _emscripten_set_mouseup_callback_on_thread, "emscripten_set_pointerlockchange_callback_on_thread": _emscripten_set_pointerlockchange_callback_on_thread, "emscripten_set_resize_callback_on_thread": _emscripten_set_resize_callback_on_thread, "emscripten_set_touchcancel_callback_on_thread": _emscripten_set_touchcancel_callback_on_thread, "emscripten_set_touchend_callback_on_thread": _emscripten_set_touchend_callback_on_thread, "emscripten_set_touchmove_callback_on_thread": _emscripten_set_touchmove_callback_on_thread, "emscripten_set_touchstart_callback_on_thread": _emscripten_set_touchstart_callback_on_thread, "emscripten_set_visibilitychange_callback_on_thread": _emscripten_set_visibilitychange_callback_on_thread, "emscripten_set_wheel_callback_on_thread": _emscripten_set_wheel_callback_on_thread, "emscripten_sleep": _emscripten_sleep, "environ_get": _environ_get, "environ_sizes_get": _environ_sizes_get, "exit": _exit, "fd_close": _fd_close, "fd_read": _fd_read, "fd_seek": _fd_seek, "fd_write": _fd_write, "getTempRet0": _getTempRet0, "gettimeofday": _gettimeofday, "glActiveTexture": _glActiveTexture, "glAttachShader": _glAttachShader, "glBindAttribLocation": _glBindAttribLocation, "glBindBuffer": _glBindBuffer, "glBindFramebuffer": _glBindFramebuffer, "glBindTexture": _glBindTexture, "glBlendFunc": _glBlendFunc, "glBufferData": _glBufferData, "glCheckFramebufferStatus": _glCheckFramebufferStatus, "glClear": _glClear, "glClearColor": _glClearColor, "glCompileShader": _glCompileShader, "glCreateProgram": _glCreateProgram, "glCreateShader": _glCreateShader, "glDeleteBuffers": _glDeleteBuffers, "glDeleteFramebuffers": _glDeleteFramebuffers, "glDeleteProgram": _glDeleteProgram, "glDeleteShader": _glDeleteShader, "glDeleteTextures": _glDeleteTextures, "glDetachShader": _glDetachShader, "glDisable": _glDisable, "glDisableVertexAttribArray": _glDisableVertexAttribArray, "glDrawElements": _glDrawElements, "glEnable": _glEnable, "glEnableVertexAttribArray": _glEnableVertexAttribArray, "glFramebufferTexture2D": _glFramebufferTexture2D, "glGenBuffers": _glGenBuffers, "glGenFramebuffers": _glGenFramebuffers, "glGenTextures": _glGenTextures, "glGetIntegerv": _glGetIntegerv, "glGetProgramInfoLog": _glGetProgramInfoLog, "glGetProgramiv": _glGetProgramiv, "glGetShaderInfoLog": _glGetShaderInfoLog, "glGetShaderiv": _glGetShaderiv, "glGetUniformLocation": _glGetUniformLocation, "glLinkProgram": _glLinkProgram, "glScissor": _glScissor, "glShaderSource": _glShaderSource, "glTexImage2D": _glTexImage2D, "glTexParameteri": _glTexParameteri, "glUniform1f": _glUniform1f, "glUniform1i": _glUniform1i, "glUniform2f": _glUniform2f, "glUniform4f": _glUniform4f, "glUniformMatrix4fv": _glUniformMatrix4fv, "glUseProgram": _glUseProgram, "glVertexAttribPointer": _glVertexAttribPointer, "glViewport": _glViewport, "invoke_vii": invoke_vii, "memory": wasmMemory, "nanosleep": _nanosleep, "pthread_create": _pthread_create, "pthread_join": _pthread_join, "setTempRet0": _setTempRet0, "sigaction": _sigaction, "signal": _signal, "strftime_l": _strftime_l, "table": wasmTable, "time": _time }; +var asm = createWasm(); +/** @type {function(...*):?} */ +var ___wasm_call_ctors = Module["___wasm_call_ctors"] = createExportWrapper("__wasm_call_ctors"); + +/** @type {function(...*):?} */ +var _memcpy = Module["_memcpy"] = createExportWrapper("memcpy"); + +/** @type {function(...*):?} */ +var _memset = Module["_memset"] = createExportWrapper("memset"); + +/** @type {function(...*):?} */ +var _realloc = Module["_realloc"] = createExportWrapper("realloc"); + +/** @type {function(...*):?} */ +var _malloc = Module["_malloc"] = createExportWrapper("malloc"); + +/** @type {function(...*):?} */ +var _free = Module["_free"] = createExportWrapper("free"); + +/** @type {function(...*):?} */ +var _htons = Module["_htons"] = createExportWrapper("htons"); + +/** @type {function(...*):?} */ +var _htonl = Module["_htonl"] = createExportWrapper("htonl"); + +/** @type {function(...*):?} */ +var ___errno_location = Module["___errno_location"] = createExportWrapper("__errno_location"); + +/** @type {function(...*):?} */ +var _fflush = Module["_fflush"] = createExportWrapper("fflush"); + +/** @type {function(...*):?} */ +var _strstr = Module["_strstr"] = createExportWrapper("strstr"); + +/** @type {function(...*):?} */ +var _saveSetjmp = Module["_saveSetjmp"] = createExportWrapper("saveSetjmp"); + +/** @type {function(...*):?} */ +var _testSetjmp = Module["_testSetjmp"] = createExportWrapper("testSetjmp"); + +/** @type {function(...*):?} */ +var _main = Module["_main"] = createExportWrapper("main"); + +/** @type {function(...*):?} */ +var ___getTypeName = Module["___getTypeName"] = createExportWrapper("__getTypeName"); + +/** @type {function(...*):?} */ +var ___embind_register_native_and_builtin_types = Module["___embind_register_native_and_builtin_types"] = createExportWrapper("__embind_register_native_and_builtin_types"); + +/** @type {function(...*):?} */ +var _emscripten_GetProcAddress = Module["_emscripten_GetProcAddress"] = createExportWrapper("emscripten_GetProcAddress"); + +/** @type {function(...*):?} */ +var _ntohs = Module["_ntohs"] = createExportWrapper("ntohs"); + +/** @type {function(...*):?} */ +var _setThrew = Module["_setThrew"] = createExportWrapper("setThrew"); + +/** @type {function(...*):?} */ +var stackSave = Module["stackSave"] = createExportWrapper("stackSave"); + +/** @type {function(...*):?} */ +var stackRestore = Module["stackRestore"] = createExportWrapper("stackRestore"); + +/** @type {function(...*):?} */ +var stackAlloc = Module["stackAlloc"] = createExportWrapper("stackAlloc"); + +/** @type {function(...*):?} */ +var ___cxa_demangle = Module["___cxa_demangle"] = createExportWrapper("__cxa_demangle"); + +/** @type {function(...*):?} */ +var _emscripten_main_thread_process_queued_calls = Module["_emscripten_main_thread_process_queued_calls"] = createExportWrapper("emscripten_main_thread_process_queued_calls"); + +/** @type {function(...*):?} */ +var dynCall_vii = Module["dynCall_vii"] = createExportWrapper("dynCall_vii"); + +/** @type {function(...*):?} */ +var ___set_stack_limit = Module["___set_stack_limit"] = createExportWrapper("__set_stack_limit"); + +/** @type {function(...*):?} */ +var __growWasmMemory = Module["__growWasmMemory"] = createExportWrapper("__growWasmMemory"); + +/** @type {function(...*):?} */ +var dynCall_ii = Module["dynCall_ii"] = createExportWrapper("dynCall_ii"); + +/** @type {function(...*):?} */ +var dynCall_vi = Module["dynCall_vi"] = createExportWrapper("dynCall_vi"); + +/** @type {function(...*):?} */ +var dynCall_v = Module["dynCall_v"] = createExportWrapper("dynCall_v"); + +/** @type {function(...*):?} */ +var dynCall_ji = Module["dynCall_ji"] = createExportWrapper("dynCall_ji"); + +/** @type {function(...*):?} */ +var dynCall_iii = Module["dynCall_iii"] = createExportWrapper("dynCall_iii"); + +/** @type {function(...*):?} */ +var dynCall_viif = Module["dynCall_viif"] = createExportWrapper("dynCall_viif"); + +/** @type {function(...*):?} */ +var dynCall_iiii = Module["dynCall_iiii"] = createExportWrapper("dynCall_iiii"); + +/** @type {function(...*):?} */ +var dynCall_viijii = Module["dynCall_viijii"] = createExportWrapper("dynCall_viijii"); + +/** @type {function(...*):?} */ +var dynCall_viiii = Module["dynCall_viiii"] = createExportWrapper("dynCall_viiii"); + +/** @type {function(...*):?} */ +var dynCall_viii = Module["dynCall_viii"] = createExportWrapper("dynCall_viii"); + +/** @type {function(...*):?} */ +var dynCall_fiff = Module["dynCall_fiff"] = createExportWrapper("dynCall_fiff"); + +/** @type {function(...*):?} */ +var dynCall_iiiii = Module["dynCall_iiiii"] = createExportWrapper("dynCall_iiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiij = Module["dynCall_iiij"] = createExportWrapper("dynCall_iiij"); + +/** @type {function(...*):?} */ +var dynCall_viij = Module["dynCall_viij"] = createExportWrapper("dynCall_viij"); + +/** @type {function(...*):?} */ +var dynCall_viiiii = Module["dynCall_viiiii"] = createExportWrapper("dynCall_viiiii"); + +/** @type {function(...*):?} */ +var dynCall_jiji = Module["dynCall_jiji"] = createExportWrapper("dynCall_jiji"); + +/** @type {function(...*):?} */ +var dynCall_iiiiii = Module["dynCall_iiiiii"] = createExportWrapper("dynCall_iiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiiiii = Module["dynCall_iiiiiiiiii"] = createExportWrapper("dynCall_iiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiidii = Module["dynCall_iiiiiidii"] = createExportWrapper("dynCall_iiiiiidii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiiii = Module["dynCall_iiiiiiiii"] = createExportWrapper("dynCall_iiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiii = Module["dynCall_viiiiiii"] = createExportWrapper("dynCall_viiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiiiiii = Module["dynCall_viiiiiiiiiii"] = createExportWrapper("dynCall_viiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiii = Module["dynCall_iiiiiiii"] = createExportWrapper("dynCall_iiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_i = Module["dynCall_i"] = createExportWrapper("dynCall_i"); + +/** @type {function(...*):?} */ +var dynCall_iidiiii = Module["dynCall_iidiiii"] = createExportWrapper("dynCall_iidiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiii = Module["dynCall_iiiiiii"] = createExportWrapper("dynCall_iiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiij = Module["dynCall_iiiiij"] = createExportWrapper("dynCall_iiiiij"); + +/** @type {function(...*):?} */ +var dynCall_iiiiid = Module["dynCall_iiiiid"] = createExportWrapper("dynCall_iiiiid"); + +/** @type {function(...*):?} */ +var dynCall_iiiiijj = Module["dynCall_iiiiijj"] = createExportWrapper("dynCall_iiiiijj"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiijj = Module["dynCall_iiiiiijj"] = createExportWrapper("dynCall_iiiiiijj"); + +/** @type {function(...*):?} */ +var dynCall_viiiiii = Module["dynCall_viiiiii"] = createExportWrapper("dynCall_viiiiii"); + +/** @type {function(...*):?} */ +var dynCall_vffff = Module["dynCall_vffff"] = createExportWrapper("dynCall_vffff"); + +/** @type {function(...*):?} */ +var dynCall_vf = Module["dynCall_vf"] = createExportWrapper("dynCall_vf"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiii = Module["dynCall_viiiiiiii"] = createExportWrapper("dynCall_viiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiiii = Module["dynCall_viiiiiiiii"] = createExportWrapper("dynCall_viiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_vff = Module["dynCall_vff"] = createExportWrapper("dynCall_vff"); + +/** @type {function(...*):?} */ +var dynCall_vfi = Module["dynCall_vfi"] = createExportWrapper("dynCall_vfi"); + +/** @type {function(...*):?} */ +var dynCall_vif = Module["dynCall_vif"] = createExportWrapper("dynCall_vif"); + +/** @type {function(...*):?} */ +var dynCall_viff = Module["dynCall_viff"] = createExportWrapper("dynCall_viff"); + +/** @type {function(...*):?} */ +var dynCall_vifff = Module["dynCall_vifff"] = createExportWrapper("dynCall_vifff"); + +/** @type {function(...*):?} */ +var dynCall_viffff = Module["dynCall_viffff"] = createExportWrapper("dynCall_viffff"); + + +function invoke_vii(index,a1,a2) { + var sp = stackSave(); + try { + dynCall_vii(index,a1,a2); + } catch(e) { + stackRestore(sp); + if (e !== e+0 && e !== 'longjmp') throw e; + _setThrew(1, 0); + } +} + + + + +// === Auto-generated postamble setup entry stuff === + + +if (!Object.getOwnPropertyDescriptor(Module, "intArrayFromString")) Module["intArrayFromString"] = function() { abort("'intArrayFromString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "intArrayToString")) Module["intArrayToString"] = function() { abort("'intArrayToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "ccall")) Module["ccall"] = function() { abort("'ccall' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "cwrap")) Module["cwrap"] = function() { abort("'cwrap' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "setValue")) Module["setValue"] = function() { abort("'setValue' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "getValue")) Module["getValue"] = function() { abort("'getValue' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "allocate")) Module["allocate"] = function() { abort("'allocate' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "getMemory")) Module["getMemory"] = function() { abort("'getMemory' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you") }; +if (!Object.getOwnPropertyDescriptor(Module, "UTF8ArrayToString")) Module["UTF8ArrayToString"] = function() { abort("'UTF8ArrayToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "UTF8ToString")) Module["UTF8ToString"] = function() { abort("'UTF8ToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "stringToUTF8Array")) Module["stringToUTF8Array"] = function() { abort("'stringToUTF8Array' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "stringToUTF8")) Module["stringToUTF8"] = function() { abort("'stringToUTF8' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "lengthBytesUTF8")) Module["lengthBytesUTF8"] = function() { abort("'lengthBytesUTF8' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "stackTrace")) Module["stackTrace"] = function() { abort("'stackTrace' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "addOnPreRun")) Module["addOnPreRun"] = function() { abort("'addOnPreRun' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "addOnInit")) Module["addOnInit"] = function() { abort("'addOnInit' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "addOnPreMain")) Module["addOnPreMain"] = function() { abort("'addOnPreMain' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "addOnExit")) Module["addOnExit"] = function() { abort("'addOnExit' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "addOnPostRun")) Module["addOnPostRun"] = function() { abort("'addOnPostRun' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "writeStringToMemory")) Module["writeStringToMemory"] = function() { abort("'writeStringToMemory' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "writeArrayToMemory")) Module["writeArrayToMemory"] = function() { abort("'writeArrayToMemory' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "writeAsciiToMemory")) Module["writeAsciiToMemory"] = function() { abort("'writeAsciiToMemory' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "addRunDependency")) Module["addRunDependency"] = function() { abort("'addRunDependency' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you") }; +if (!Object.getOwnPropertyDescriptor(Module, "removeRunDependency")) Module["removeRunDependency"] = function() { abort("'removeRunDependency' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you") }; +if (!Object.getOwnPropertyDescriptor(Module, "FS_createFolder")) Module["FS_createFolder"] = function() { abort("'FS_createFolder' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you") }; +if (!Object.getOwnPropertyDescriptor(Module, "FS_createPath")) Module["FS_createPath"] = function() { abort("'FS_createPath' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you") }; +if (!Object.getOwnPropertyDescriptor(Module, "FS_createDataFile")) Module["FS_createDataFile"] = function() { abort("'FS_createDataFile' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you") }; +if (!Object.getOwnPropertyDescriptor(Module, "FS_createPreloadedFile")) Module["FS_createPreloadedFile"] = function() { abort("'FS_createPreloadedFile' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you") }; +if (!Object.getOwnPropertyDescriptor(Module, "FS_createLazyFile")) Module["FS_createLazyFile"] = function() { abort("'FS_createLazyFile' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you") }; +if (!Object.getOwnPropertyDescriptor(Module, "FS_createLink")) Module["FS_createLink"] = function() { abort("'FS_createLink' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you") }; +if (!Object.getOwnPropertyDescriptor(Module, "FS_createDevice")) Module["FS_createDevice"] = function() { abort("'FS_createDevice' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you") }; +if (!Object.getOwnPropertyDescriptor(Module, "FS_unlink")) Module["FS_unlink"] = function() { abort("'FS_unlink' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you") }; +if (!Object.getOwnPropertyDescriptor(Module, "dynamicAlloc")) Module["dynamicAlloc"] = function() { abort("'dynamicAlloc' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "loadDynamicLibrary")) Module["loadDynamicLibrary"] = function() { abort("'loadDynamicLibrary' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "loadWebAssemblyModule")) Module["loadWebAssemblyModule"] = function() { abort("'loadWebAssemblyModule' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "getLEB")) Module["getLEB"] = function() { abort("'getLEB' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "getFunctionTables")) Module["getFunctionTables"] = function() { abort("'getFunctionTables' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "alignFunctionTables")) Module["alignFunctionTables"] = function() { abort("'alignFunctionTables' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "registerFunctions")) Module["registerFunctions"] = function() { abort("'registerFunctions' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "addFunction")) Module["addFunction"] = function() { abort("'addFunction' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "removeFunction")) Module["removeFunction"] = function() { abort("'removeFunction' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "getFuncWrapper")) Module["getFuncWrapper"] = function() { abort("'getFuncWrapper' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "prettyPrint")) Module["prettyPrint"] = function() { abort("'prettyPrint' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "makeBigInt")) Module["makeBigInt"] = function() { abort("'makeBigInt' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "dynCall")) Module["dynCall"] = function() { abort("'dynCall' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "getCompilerSetting")) Module["getCompilerSetting"] = function() { abort("'getCompilerSetting' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "print")) Module["print"] = function() { abort("'print' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "printErr")) Module["printErr"] = function() { abort("'printErr' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "getTempRet0")) Module["getTempRet0"] = function() { abort("'getTempRet0' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "setTempRet0")) Module["setTempRet0"] = function() { abort("'setTempRet0' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "callMain")) Module["callMain"] = function() { abort("'callMain' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "abort")) Module["abort"] = function() { abort("'abort' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "stringToNewUTF8")) Module["stringToNewUTF8"] = function() { abort("'stringToNewUTF8' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "abortOnCannotGrowMemory")) Module["abortOnCannotGrowMemory"] = function() { abort("'abortOnCannotGrowMemory' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "emscripten_realloc_buffer")) Module["emscripten_realloc_buffer"] = function() { abort("'emscripten_realloc_buffer' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "ENV")) Module["ENV"] = function() { abort("'ENV' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "ERRNO_CODES")) Module["ERRNO_CODES"] = function() { abort("'ERRNO_CODES' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "ERRNO_MESSAGES")) Module["ERRNO_MESSAGES"] = function() { abort("'ERRNO_MESSAGES' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "setErrNo")) Module["setErrNo"] = function() { abort("'setErrNo' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "DNS")) Module["DNS"] = function() { abort("'DNS' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "GAI_ERRNO_MESSAGES")) Module["GAI_ERRNO_MESSAGES"] = function() { abort("'GAI_ERRNO_MESSAGES' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "Protocols")) Module["Protocols"] = function() { abort("'Protocols' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "Sockets")) Module["Sockets"] = function() { abort("'Sockets' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "traverseStack")) Module["traverseStack"] = function() { abort("'traverseStack' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "UNWIND_CACHE")) Module["UNWIND_CACHE"] = function() { abort("'UNWIND_CACHE' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "withBuiltinMalloc")) Module["withBuiltinMalloc"] = function() { abort("'withBuiltinMalloc' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "readAsmConstArgsArray")) Module["readAsmConstArgsArray"] = function() { abort("'readAsmConstArgsArray' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "readAsmConstArgs")) Module["readAsmConstArgs"] = function() { abort("'readAsmConstArgs' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "jstoi_q")) Module["jstoi_q"] = function() { abort("'jstoi_q' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "jstoi_s")) Module["jstoi_s"] = function() { abort("'jstoi_s' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "getExecutableName")) Module["getExecutableName"] = function() { abort("'getExecutableName' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "listenOnce")) Module["listenOnce"] = function() { abort("'listenOnce' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "autoResumeAudioContext")) Module["autoResumeAudioContext"] = function() { abort("'autoResumeAudioContext' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "abortStackOverflow")) Module["abortStackOverflow"] = function() { abort("'abortStackOverflow' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "reallyNegative")) Module["reallyNegative"] = function() { abort("'reallyNegative' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "formatString")) Module["formatString"] = function() { abort("'formatString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "PATH")) Module["PATH"] = function() { abort("'PATH' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "PATH_FS")) Module["PATH_FS"] = function() { abort("'PATH_FS' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "SYSCALLS")) Module["SYSCALLS"] = function() { abort("'SYSCALLS' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "syscallMmap2")) Module["syscallMmap2"] = function() { abort("'syscallMmap2' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "syscallMunmap")) Module["syscallMunmap"] = function() { abort("'syscallMunmap' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "JSEvents")) Module["JSEvents"] = function() { abort("'JSEvents' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "specialHTMLTargets")) Module["specialHTMLTargets"] = function() { abort("'specialHTMLTargets' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "maybeCStringToJsString")) Module["maybeCStringToJsString"] = function() { abort("'maybeCStringToJsString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "findEventTarget")) Module["findEventTarget"] = function() { abort("'findEventTarget' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "findCanvasEventTarget")) Module["findCanvasEventTarget"] = function() { abort("'findCanvasEventTarget' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "polyfillSetImmediate")) Module["polyfillSetImmediate"] = function() { abort("'polyfillSetImmediate' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "demangle")) Module["demangle"] = function() { abort("'demangle' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "demangleAll")) Module["demangleAll"] = function() { abort("'demangleAll' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "jsStackTrace")) Module["jsStackTrace"] = function() { abort("'jsStackTrace' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "stackTrace")) Module["stackTrace"] = function() { abort("'stackTrace' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "getEnvStrings")) Module["getEnvStrings"] = function() { abort("'getEnvStrings' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "checkWasiClock")) Module["checkWasiClock"] = function() { abort("'checkWasiClock' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "writeI53ToI64")) Module["writeI53ToI64"] = function() { abort("'writeI53ToI64' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "writeI53ToI64Clamped")) Module["writeI53ToI64Clamped"] = function() { abort("'writeI53ToI64Clamped' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "writeI53ToI64Signaling")) Module["writeI53ToI64Signaling"] = function() { abort("'writeI53ToI64Signaling' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "writeI53ToU64Clamped")) Module["writeI53ToU64Clamped"] = function() { abort("'writeI53ToU64Clamped' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "writeI53ToU64Signaling")) Module["writeI53ToU64Signaling"] = function() { abort("'writeI53ToU64Signaling' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "readI53FromI64")) Module["readI53FromI64"] = function() { abort("'readI53FromI64' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "readI53FromU64")) Module["readI53FromU64"] = function() { abort("'readI53FromU64' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "convertI32PairToI53")) Module["convertI32PairToI53"] = function() { abort("'convertI32PairToI53' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "convertU32PairToI53")) Module["convertU32PairToI53"] = function() { abort("'convertU32PairToI53' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "exceptionLast")) Module["exceptionLast"] = function() { abort("'exceptionLast' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "exceptionCaught")) Module["exceptionCaught"] = function() { abort("'exceptionCaught' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "exceptionInfos")) Module["exceptionInfos"] = function() { abort("'exceptionInfos' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "exception_deAdjust")) Module["exception_deAdjust"] = function() { abort("'exception_deAdjust' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "exception_addRef")) Module["exception_addRef"] = function() { abort("'exception_addRef' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "exception_decRef")) Module["exception_decRef"] = function() { abort("'exception_decRef' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "Browser")) Module["Browser"] = function() { abort("'Browser' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "FS")) Module["FS"] = function() { abort("'FS' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "MEMFS")) Module["MEMFS"] = function() { abort("'MEMFS' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "TTY")) Module["TTY"] = function() { abort("'TTY' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "PIPEFS")) Module["PIPEFS"] = function() { abort("'PIPEFS' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "SOCKFS")) Module["SOCKFS"] = function() { abort("'SOCKFS' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "tempFixedLengthArray")) Module["tempFixedLengthArray"] = function() { abort("'tempFixedLengthArray' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "miniTempWebGLFloatBuffers")) Module["miniTempWebGLFloatBuffers"] = function() { abort("'miniTempWebGLFloatBuffers' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "heapObjectForWebGLType")) Module["heapObjectForWebGLType"] = function() { abort("'heapObjectForWebGLType' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "heapAccessShiftForWebGLHeap")) Module["heapAccessShiftForWebGLHeap"] = function() { abort("'heapAccessShiftForWebGLHeap' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "GL")) Module["GL"] = function() { abort("'GL' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "emscriptenWebGLGet")) Module["emscriptenWebGLGet"] = function() { abort("'emscriptenWebGLGet' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "computeUnpackAlignedImageSize")) Module["computeUnpackAlignedImageSize"] = function() { abort("'computeUnpackAlignedImageSize' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "emscriptenWebGLGetTexPixelData")) Module["emscriptenWebGLGetTexPixelData"] = function() { abort("'emscriptenWebGLGetTexPixelData' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "emscriptenWebGLGetUniform")) Module["emscriptenWebGLGetUniform"] = function() { abort("'emscriptenWebGLGetUniform' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "emscriptenWebGLGetVertexAttrib")) Module["emscriptenWebGLGetVertexAttrib"] = function() { abort("'emscriptenWebGLGetVertexAttrib' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "writeGLArray")) Module["writeGLArray"] = function() { abort("'writeGLArray' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "AL")) Module["AL"] = function() { abort("'AL' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "SDL_unicode")) Module["SDL_unicode"] = function() { abort("'SDL_unicode' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "SDL_ttfContext")) Module["SDL_ttfContext"] = function() { abort("'SDL_ttfContext' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "SDL_audio")) Module["SDL_audio"] = function() { abort("'SDL_audio' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "SDL")) Module["SDL"] = function() { abort("'SDL' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "SDL_gfx")) Module["SDL_gfx"] = function() { abort("'SDL_gfx' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "GLUT")) Module["GLUT"] = function() { abort("'GLUT' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "EGL")) Module["EGL"] = function() { abort("'EGL' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "GLFW_Window")) Module["GLFW_Window"] = function() { abort("'GLFW_Window' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "GLFW")) Module["GLFW"] = function() { abort("'GLFW' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "GLEW")) Module["GLEW"] = function() { abort("'GLEW' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "IDBStore")) Module["IDBStore"] = function() { abort("'IDBStore' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "runAndAbortIfError")) Module["runAndAbortIfError"] = function() { abort("'runAndAbortIfError' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "emval_handle_array")) Module["emval_handle_array"] = function() { abort("'emval_handle_array' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "emval_free_list")) Module["emval_free_list"] = function() { abort("'emval_free_list' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "emval_symbols")) Module["emval_symbols"] = function() { abort("'emval_symbols' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "init_emval")) Module["init_emval"] = function() { abort("'init_emval' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "count_emval_handles")) Module["count_emval_handles"] = function() { abort("'count_emval_handles' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "get_first_emval")) Module["get_first_emval"] = function() { abort("'get_first_emval' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "getStringOrSymbol")) Module["getStringOrSymbol"] = function() { abort("'getStringOrSymbol' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "requireHandle")) Module["requireHandle"] = function() { abort("'requireHandle' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "emval_newers")) Module["emval_newers"] = function() { abort("'emval_newers' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "craftEmvalAllocator")) Module["craftEmvalAllocator"] = function() { abort("'craftEmvalAllocator' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "emval_get_global")) Module["emval_get_global"] = function() { abort("'emval_get_global' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "emval_methodCallers")) Module["emval_methodCallers"] = function() { abort("'emval_methodCallers' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "InternalError")) Module["InternalError"] = function() { abort("'InternalError' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "BindingError")) Module["BindingError"] = function() { abort("'BindingError' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "UnboundTypeError")) Module["UnboundTypeError"] = function() { abort("'UnboundTypeError' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "PureVirtualError")) Module["PureVirtualError"] = function() { abort("'PureVirtualError' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "init_embind")) Module["init_embind"] = function() { abort("'init_embind' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "throwInternalError")) Module["throwInternalError"] = function() { abort("'throwInternalError' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "throwBindingError")) Module["throwBindingError"] = function() { abort("'throwBindingError' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "throwUnboundTypeError")) Module["throwUnboundTypeError"] = function() { abort("'throwUnboundTypeError' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "ensureOverloadTable")) Module["ensureOverloadTable"] = function() { abort("'ensureOverloadTable' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "exposePublicSymbol")) Module["exposePublicSymbol"] = function() { abort("'exposePublicSymbol' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "replacePublicSymbol")) Module["replacePublicSymbol"] = function() { abort("'replacePublicSymbol' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "extendError")) Module["extendError"] = function() { abort("'extendError' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "createNamedFunction")) Module["createNamedFunction"] = function() { abort("'createNamedFunction' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "registeredInstances")) Module["registeredInstances"] = function() { abort("'registeredInstances' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "getBasestPointer")) Module["getBasestPointer"] = function() { abort("'getBasestPointer' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "registerInheritedInstance")) Module["registerInheritedInstance"] = function() { abort("'registerInheritedInstance' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "unregisterInheritedInstance")) Module["unregisterInheritedInstance"] = function() { abort("'unregisterInheritedInstance' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "getInheritedInstance")) Module["getInheritedInstance"] = function() { abort("'getInheritedInstance' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "getInheritedInstanceCount")) Module["getInheritedInstanceCount"] = function() { abort("'getInheritedInstanceCount' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "getLiveInheritedInstances")) Module["getLiveInheritedInstances"] = function() { abort("'getLiveInheritedInstances' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "registeredTypes")) Module["registeredTypes"] = function() { abort("'registeredTypes' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "awaitingDependencies")) Module["awaitingDependencies"] = function() { abort("'awaitingDependencies' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "typeDependencies")) Module["typeDependencies"] = function() { abort("'typeDependencies' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "registeredPointers")) Module["registeredPointers"] = function() { abort("'registeredPointers' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "registerType")) Module["registerType"] = function() { abort("'registerType' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "whenDependentTypesAreResolved")) Module["whenDependentTypesAreResolved"] = function() { abort("'whenDependentTypesAreResolved' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "embind_charCodes")) Module["embind_charCodes"] = function() { abort("'embind_charCodes' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "embind_init_charCodes")) Module["embind_init_charCodes"] = function() { abort("'embind_init_charCodes' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "readLatin1String")) Module["readLatin1String"] = function() { abort("'readLatin1String' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "getTypeName")) Module["getTypeName"] = function() { abort("'getTypeName' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "heap32VectorToArray")) Module["heap32VectorToArray"] = function() { abort("'heap32VectorToArray' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "requireRegisteredType")) Module["requireRegisteredType"] = function() { abort("'requireRegisteredType' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "getShiftFromSize")) Module["getShiftFromSize"] = function() { abort("'getShiftFromSize' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "integerReadValueFromPointer")) Module["integerReadValueFromPointer"] = function() { abort("'integerReadValueFromPointer' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "enumReadValueFromPointer")) Module["enumReadValueFromPointer"] = function() { abort("'enumReadValueFromPointer' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "floatReadValueFromPointer")) Module["floatReadValueFromPointer"] = function() { abort("'floatReadValueFromPointer' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "simpleReadValueFromPointer")) Module["simpleReadValueFromPointer"] = function() { abort("'simpleReadValueFromPointer' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "runDestructors")) Module["runDestructors"] = function() { abort("'runDestructors' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "new_")) Module["new_"] = function() { abort("'new_' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "craftInvokerFunction")) Module["craftInvokerFunction"] = function() { abort("'craftInvokerFunction' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "embind__requireFunction")) Module["embind__requireFunction"] = function() { abort("'embind__requireFunction' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "tupleRegistrations")) Module["tupleRegistrations"] = function() { abort("'tupleRegistrations' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "structRegistrations")) Module["structRegistrations"] = function() { abort("'structRegistrations' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "genericPointerToWireType")) Module["genericPointerToWireType"] = function() { abort("'genericPointerToWireType' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "constNoSmartPtrRawPointerToWireType")) Module["constNoSmartPtrRawPointerToWireType"] = function() { abort("'constNoSmartPtrRawPointerToWireType' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "nonConstNoSmartPtrRawPointerToWireType")) Module["nonConstNoSmartPtrRawPointerToWireType"] = function() { abort("'nonConstNoSmartPtrRawPointerToWireType' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "init_RegisteredPointer")) Module["init_RegisteredPointer"] = function() { abort("'init_RegisteredPointer' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "RegisteredPointer")) Module["RegisteredPointer"] = function() { abort("'RegisteredPointer' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "RegisteredPointer_getPointee")) Module["RegisteredPointer_getPointee"] = function() { abort("'RegisteredPointer_getPointee' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "RegisteredPointer_destructor")) Module["RegisteredPointer_destructor"] = function() { abort("'RegisteredPointer_destructor' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "RegisteredPointer_deleteObject")) Module["RegisteredPointer_deleteObject"] = function() { abort("'RegisteredPointer_deleteObject' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "RegisteredPointer_fromWireType")) Module["RegisteredPointer_fromWireType"] = function() { abort("'RegisteredPointer_fromWireType' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "runDestructor")) Module["runDestructor"] = function() { abort("'runDestructor' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "releaseClassHandle")) Module["releaseClassHandle"] = function() { abort("'releaseClassHandle' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "finalizationGroup")) Module["finalizationGroup"] = function() { abort("'finalizationGroup' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "detachFinalizer_deps")) Module["detachFinalizer_deps"] = function() { abort("'detachFinalizer_deps' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "detachFinalizer")) Module["detachFinalizer"] = function() { abort("'detachFinalizer' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "attachFinalizer")) Module["attachFinalizer"] = function() { abort("'attachFinalizer' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "makeClassHandle")) Module["makeClassHandle"] = function() { abort("'makeClassHandle' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "init_ClassHandle")) Module["init_ClassHandle"] = function() { abort("'init_ClassHandle' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "ClassHandle")) Module["ClassHandle"] = function() { abort("'ClassHandle' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "ClassHandle_isAliasOf")) Module["ClassHandle_isAliasOf"] = function() { abort("'ClassHandle_isAliasOf' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "throwInstanceAlreadyDeleted")) Module["throwInstanceAlreadyDeleted"] = function() { abort("'throwInstanceAlreadyDeleted' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "ClassHandle_clone")) Module["ClassHandle_clone"] = function() { abort("'ClassHandle_clone' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "ClassHandle_delete")) Module["ClassHandle_delete"] = function() { abort("'ClassHandle_delete' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "deletionQueue")) Module["deletionQueue"] = function() { abort("'deletionQueue' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "ClassHandle_isDeleted")) Module["ClassHandle_isDeleted"] = function() { abort("'ClassHandle_isDeleted' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "ClassHandle_deleteLater")) Module["ClassHandle_deleteLater"] = function() { abort("'ClassHandle_deleteLater' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "flushPendingDeletes")) Module["flushPendingDeletes"] = function() { abort("'flushPendingDeletes' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "delayFunction")) Module["delayFunction"] = function() { abort("'delayFunction' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "setDelayFunction")) Module["setDelayFunction"] = function() { abort("'setDelayFunction' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "RegisteredClass")) Module["RegisteredClass"] = function() { abort("'RegisteredClass' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "shallowCopyInternalPointer")) Module["shallowCopyInternalPointer"] = function() { abort("'shallowCopyInternalPointer' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "downcastPointer")) Module["downcastPointer"] = function() { abort("'downcastPointer' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "upcastPointer")) Module["upcastPointer"] = function() { abort("'upcastPointer' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "validateThis")) Module["validateThis"] = function() { abort("'validateThis' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "char_0")) Module["char_0"] = function() { abort("'char_0' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "char_9")) Module["char_9"] = function() { abort("'char_9' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "makeLegalFunctionName")) Module["makeLegalFunctionName"] = function() { abort("'makeLegalFunctionName' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "warnOnce")) Module["warnOnce"] = function() { abort("'warnOnce' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "stackSave")) Module["stackSave"] = function() { abort("'stackSave' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "stackRestore")) Module["stackRestore"] = function() { abort("'stackRestore' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "stackAlloc")) Module["stackAlloc"] = function() { abort("'stackAlloc' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "AsciiToString")) Module["AsciiToString"] = function() { abort("'AsciiToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "stringToAscii")) Module["stringToAscii"] = function() { abort("'stringToAscii' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "UTF16ToString")) Module["UTF16ToString"] = function() { abort("'UTF16ToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "stringToUTF16")) Module["stringToUTF16"] = function() { abort("'stringToUTF16' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "lengthBytesUTF16")) Module["lengthBytesUTF16"] = function() { abort("'lengthBytesUTF16' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "UTF32ToString")) Module["UTF32ToString"] = function() { abort("'UTF32ToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "stringToUTF32")) Module["stringToUTF32"] = function() { abort("'stringToUTF32' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "lengthBytesUTF32")) Module["lengthBytesUTF32"] = function() { abort("'lengthBytesUTF32' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "allocateUTF8")) Module["allocateUTF8"] = function() { abort("'allocateUTF8' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +if (!Object.getOwnPropertyDescriptor(Module, "allocateUTF8OnStack")) Module["allocateUTF8OnStack"] = function() { abort("'allocateUTF8OnStack' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") }; +Module["writeStackCookie"] = writeStackCookie; +Module["checkStackCookie"] = checkStackCookie;if (!Object.getOwnPropertyDescriptor(Module, "ALLOC_NORMAL")) Object.defineProperty(Module, "ALLOC_NORMAL", { configurable: true, get: function() { abort("'ALLOC_NORMAL' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") } }); +if (!Object.getOwnPropertyDescriptor(Module, "ALLOC_STACK")) Object.defineProperty(Module, "ALLOC_STACK", { configurable: true, get: function() { abort("'ALLOC_STACK' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") } }); +if (!Object.getOwnPropertyDescriptor(Module, "ALLOC_DYNAMIC")) Object.defineProperty(Module, "ALLOC_DYNAMIC", { configurable: true, get: function() { abort("'ALLOC_DYNAMIC' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") } }); +if (!Object.getOwnPropertyDescriptor(Module, "ALLOC_NONE")) Object.defineProperty(Module, "ALLOC_NONE", { configurable: true, get: function() { abort("'ALLOC_NONE' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") } }); + + + +var calledRun; + +/** + * @constructor + * @this {ExitStatus} + */ +function ExitStatus(status) { + this.name = "ExitStatus"; + this.message = "Program terminated with exit(" + status + ")"; + this.status = status; +} + +var calledMain = false; + + +dependenciesFulfilled = function runCaller() { + // If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false) + if (!calledRun) run(); + if (!calledRun) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled +}; + +function callMain(args) { + assert(runDependencies == 0, 'cannot call main when async dependencies remain! (listen on Module["onRuntimeInitialized"])'); + assert(__ATPRERUN__.length == 0, 'cannot call main when preRun functions remain to be called'); + + var entryFunction = Module['_main']; + + + args = args || []; + + var argc = args.length+1; + var argv = stackAlloc((argc + 1) * 4); + HEAP32[argv >> 2] = allocateUTF8OnStack(thisProgram); + for (var i = 1; i < argc; i++) { + HEAP32[(argv >> 2) + i] = allocateUTF8OnStack(args[i - 1]); + } + HEAP32[(argv >> 2) + argc] = 0; + + try { + + Module['___set_stack_limit'](STACK_MAX); + + var ret = entryFunction(argc, argv); + + + // In PROXY_TO_PTHREAD builds, we should never exit the runtime below, as execution is asynchronously handed + // off to a pthread. + // if we're not running an evented main loop, it's time to exit + exit(ret, /* implicit = */ true); + } + catch(e) { + if (e instanceof ExitStatus) { + // exit() throws this once it's done to make sure execution + // has been stopped completely + return; + } else if (e == 'unwind') { + // running an evented main loop, don't immediately exit + noExitRuntime = true; + return; + } else { + var toLog = e; + if (e && typeof e === 'object' && e.stack) { + toLog = [e, e.stack]; + } + err('exception thrown: ' + toLog); + quit_(1, e); + } + } finally { + calledMain = true; + } +} + + + + +/** @type {function(Array=)} */ +function run(args) { + args = args || arguments_; + + if (runDependencies > 0) { + return; + } + + writeStackCookie(); + + preRun(); + + if (runDependencies > 0) return; // a preRun added a dependency, run will be called later + + function doRun() { + // run may have just been called through dependencies being fulfilled just in this very frame, + // or while the async setStatus time below was happening + if (calledRun) return; + calledRun = true; + Module['calledRun'] = true; + + if (ABORT) return; + + initRuntime(); + + preMain(); + + if (Module['onRuntimeInitialized']) Module['onRuntimeInitialized'](); + + if (shouldRunNow) callMain(args); + + postRun(); + } + + if (Module['setStatus']) { + Module['setStatus']('Running...'); + setTimeout(function() { + setTimeout(function() { + Module['setStatus'](''); + }, 1); + doRun(); + }, 1); + } else + { + doRun(); + } + checkStackCookie(); +} +Module['run'] = run; + + +/** @param {boolean|number=} implicit */ +function exit(status, implicit) { + + // if this is just main exit-ing implicitly, and the status is 0, then we + // don't need to do anything here and can just leave. if the status is + // non-zero, though, then we need to report it. + // (we may have warned about this earlier, if a situation justifies doing so) + if (implicit && noExitRuntime && status === 0) { + return; + } + + if (noExitRuntime) { + // if exit() was called, we may warn the user if the runtime isn't actually being shut down + if (!implicit) { + var msg = 'program exited (with status: ' + status + '), but noExitRuntime is set due to an async operation, so halting execution but not exiting the runtime or preventing further async execution (you can use emscripten_force_exit, if you want to force a true shutdown)'; + err(msg); + } + } else { + + ABORT = true; + EXITSTATUS = status; + + exitRuntime(); + + if (Module['onExit']) Module['onExit'](status); + } + + quit_(status, new ExitStatus(status)); +} + +if (Module['preInit']) { + if (typeof Module['preInit'] == 'function') Module['preInit'] = [Module['preInit']]; + while (Module['preInit'].length > 0) { + Module['preInit'].pop()(); + } +} + +// shouldRunNow refers to calling main(), not run(). +var shouldRunNow = true; + +if (Module['noInitialRun']) shouldRunNow = false; + + + +run(); + + + + + + +// {{MODULE_ADDITIONS}} + + + diff --git a/content/pewpewlive-wasm.wasm b/content/pewpewlive-wasm.wasm new file mode 100644 index 0000000..9bfdee0 Binary files /dev/null and b/content/pewpewlive-wasm.wasm differ